Compare commits

..

893 Commits

Author SHA1 Message Date
Mikayla
07406ca5fc Merge pull request #542 from MikaylaFischler/devel
2024.08.25 Release
2024-08-25 22:50:18 -04:00
Mikayla Fischler
6b20445446 added INF tab to supervisor to provide helpful info and removed some redundant alignment specifiers 2024-08-25 22:45:41 -04:00
Mikayla Fischler
f93db02793 incremented common version 2024-08-25 21:29:20 -04:00
Mikayla
fe1b916b1f Merge pull request #541 from MikaylaFischler/pocket-alpha-dev
display pocket connecting failure reasons
2024-08-25 20:41:12 -04:00
Mikayla Fischler
ebeeecc5ab luacheck fix 2024-08-25 20:40:30 -04:00
Mikayla Fischler
dbabcd13b0 luacheck fix 2024-08-25 20:39:21 -04:00
Mikayla Fischler
acc8e1c058 incremented graphics version and disabled listbox debug messages for now 2024-08-25 20:38:01 -04:00
Mikayla Fischler
5a38acf2a7 #540 display pocket connecting failure reasons 2024-08-25 20:29:52 -04:00
Mikayla Fischler
b3be2d4bfc #537 close sessions on receiving an ESTABLISH packet to allow for retries 2024-08-24 14:46:58 -04:00
Mikayla
0ab2d57b66 Merge pull request #538 from MikaylaFischler/367-list-duplicate-and-missing-device-ids
Supervisor Listing of Missing and Bad Device IDs
2024-08-24 14:11:46 -04:00
Mikayla
183af8a5ca #539 logging for investigations 2024-08-22 18:18:13 +00:00
Mikayla
6f63092d4b #367 check facility dynamic tank linking 2024-08-22 16:45:36 +00:00
Mikayla
a087eda0ee #367 RTU fail enum and logging messages 2024-08-22 16:42:57 +00:00
Mikayla Fischler
a1b6ff4bcc luacheck fixes 2024-08-21 19:18:55 -04:00
Mikayla Fischler
8c6b264f6b #367 simplified chk_entry 2024-08-21 19:15:12 -04:00
Mikayla Fischler
8a5c468606 #367 fixes and removed computer ID display 2024-08-21 18:53:52 -04:00
Mikayla
12f187f596 #367 logic for missing device detection and user-friendly messages 2024-08-21 21:23:16 +00:00
Mikayla
01a1c374ab Merge branch 'devel' into 367-list-duplicate-and-missing-device-ids 2024-08-21 13:56:50 +00:00
Mikayla Fischler
465875b287 coordinator receives tank list from supervisor 2024-08-20 22:28:41 -04:00
Mikayla Fischler
45d4b4e653 fixed PLC status retry packet type 2024-08-20 21:35:05 -04:00
Mikayla Fischler
fc7441b2f6 #367 reworked ownership of tank data and facility instance to make more sense 2024-08-20 21:32:54 -04:00
Mikayla Fischler
6917697290 #536 proper clearing of cleared config values 2024-08-20 20:56:41 -04:00
Mikayla
c323967b6a #536 fix for clearing settings 2024-08-20 20:52:38 +00:00
Mikayla Fischler
4775639245 #367 WIP listing ID check failures and missing devices 2024-08-18 23:04:44 -04:00
Mikayla Fischler
072613959c facility tank list generation on supervisor 2024-08-18 23:04:07 -04:00
Mikayla Fischler
f259f85a99 fixed wrong function name 2024-08-18 19:12:13 -04:00
Mikayla Fischler
e076e327d8 split up facility logic into two files 2024-08-18 19:10:43 -04:00
Mikayla
f34747372f #367 work on device ID check failure list 2024-08-16 21:19:25 +00:00
Mikayla
affe2d6c6d listbox debugging 2024-08-16 21:17:36 +00:00
Mikayla
5597ea2097 comment updates for clarity around RTU gateway vs RTU 2024-08-16 19:53:43 +00:00
Mikayla
0f4a8b6dfc refactoring and RTU gateway terminology cleanup 2024-08-16 18:17:03 +00:00
Mikayla
ab97f8935d #367 reject and record bad or duplicate RTU IDs 2024-08-16 18:08:53 +00:00
Mikayla
b0342654e7 added off-line installation to installation options 2024-08-12 09:55:19 -04:00
Mikayla Fischler
bee96ed12e #517 ccmsi print wrapping and other adjustments for pocket environment 2024-08-11 22:11:57 -04:00
Mikayla Fischler
50bd59781e #534 fixed PLC self-check UI problem 2024-08-11 20:21:26 -04:00
Mikayla Fischler
196e0b1daf #519 fixed issue with turbine stability evaluation 2024-08-11 19:58:29 -04:00
Mikayla
f725eb0eef Merge pull request #533 from MikaylaFischler/devel
2024.07.28 Release
2024-07-28 17:21:26 -04:00
Mikayla Fischler
bcc55628cf don't disable self-check even if there is no config 2024-07-28 16:41:39 -04:00
Mikayla Fischler
9bffd6feee incremented coordinator version 2024-07-27 21:28:37 -04:00
Mikayla
1500004481 Merge pull request #532 from MikaylaFischler/configurator-updates
Configurator Updates
2024-07-27 20:55:25 -04:00
Mikayla Fischler
2904621e81 fixed wrong disable format on self-check button 2024-07-27 20:55:00 -04:00
Mikayla Fischler
08eee198c8 cleanup and rewording notices 2024-07-27 20:35:09 -04:00
Mikayla Fischler
e750ffe69d updated element asserts for power indicator and incremented graphics version 2024-07-27 16:23:37 -04:00
Mikayla Fischler
de6d8a89ca avoid redundant calls to report_link_state 2024-07-27 16:23:19 -04:00
Mikayla Fischler
f00751edeb still display supervisor/coordinator address info if not linked to both 2024-07-27 13:17:56 -04:00
Mikayla Fischler
d58a6a3369 #531 pocket energy scale options 2024-07-27 12:51:46 -04:00
Mikayla Fischler
340c6689a9 #523 coordinator configurator updates 2024-07-27 12:35:26 -04:00
Mikayla Fischler
7cc088ca95 #523 coordinator energy scale options 2024-07-27 12:34:01 -04:00
Mikayla Fischler
01f6b1e190 #363 added tip about self-check 2024-07-27 11:15:23 -04:00
Mikayla Fischler
3ffc79b181 #530 fix RTU reconnection issue 2024-07-27 11:15:05 -04:00
Mikayla Fischler
8e4bb583a8 #528 reactor PLC configurator fixes 2024-07-26 23:06:42 -04:00
Mikayla
ec107929bc #528 reactor PLC configurator cleanup 2024-07-27 00:27:38 +00:00
Mikayla Fischler
3406d12681 #363 check config 2024-07-24 22:42:14 -04:00
Mikayla Fischler
03bbf8a891 updated coordinator configurator connection sequence number logic to match new system 2024-07-22 23:45:25 -04:00
Mikayla Fischler
b61867be3c updated RTU configurator change log 2024-07-22 23:44:56 -04:00
Mikayla Fischler
1358d95269 cc strings infinite loop mitigation 2024-07-22 23:44:34 -04:00
Mikayla Fischler
fd06730e46 #363 PLC configurator self check WIP 2024-07-22 23:44:12 -04:00
Mikayla
fb5f3b9474 #363 work on PLC self-check 2024-07-20 18:17:36 +00:00
Mikayla
3afc1e6cfa #512 rtu help text updates 2024-07-20 18:14:59 +00:00
Mikayla Fischler
715765d442 #512 increased clarity of peripheral assignments 2024-07-16 18:07:37 -04:00
Mikayla
3762e9dced #524 fix tank layout render reset 2024-07-16 21:03:52 +00:00
Mikayla Fischler
022d1f9f49 updated main's manifest workflow 2024-07-06 00:55:03 -04:00
Mikayla
b1da76c2f6 Merge pull request #516 from MikaylaFischler/devel
2024.07.05 Release
2024-07-06 00:51:28 -04:00
Mikayla Fischler
0364b4df7b fixed pocket crash due to guide section height too small 2024-07-06 00:07:21 -04:00
Mikayla Fischler
e04bd032fe incremented common version 2024-07-06 00:07:00 -04:00
Mikayla
34fe5dc382 Merge pull request #518 from MikaylaFischler/pocket-alpha-dev
Pocket alpha dev
2024-07-05 23:29:06 -04:00
Mikayla
1f8ea56095 Merge pull request #515 from MikaylaFischler/514-retry-file-downloads-on-failure
514 retry file downloads on failure
2024-07-05 13:39:20 -04:00
Mikayla Fischler
f2cd98c57a #194 fixes to log file handling, improved failure behavior, skip extra dialogs if nothing can be updated 2024-07-03 21:14:39 -04:00
Mikayla
1e341af8a5 #514 optimizations and fixes 2024-07-03 15:01:43 +00:00
Mikayla Fischler
2fb3d9b515 #514 cleaned up download logic and added retries 2024-07-02 22:07:12 -04:00
Mikayla
220f9d152f Merge branch 'devel' into pocket-alpha-dev 2024-07-01 16:36:36 +00:00
Mikayla
604b4a1927 Merge pull request #511 from MikaylaFischler/500-remove-height=1-from-textbox-elements
#500 removed now redundant height=1 from TextBox elements
2024-06-30 14:14:20 -04:00
Mikayla Fischler
0ecaa42a7f restored incorrectly modified height 2024-06-30 14:05:34 -04:00
Mikayla Fischler
9614407c37 #500 removed now redundant height=1 from TextBox elements 2024-06-30 13:55:13 -04:00
Mikayla Fischler
f1c4f8c00a keep main on old file path for now 2024-06-30 12:40:23 -04:00
Mikayla Fischler
8a409f0313 manifest build fix 2024-06-30 12:36:22 -04:00
Mikayla
da68398fa4 Merge pull request #510 from MikaylaFischler/506-single-file-off-line-installer
506 single file off line installer
2024-06-30 12:34:27 -04:00
Mikayla Fischler
375e969161 cleanup 2024-06-30 12:33:52 -04:00
Mikayla Fischler
c93cd4d0bd remove UTF-8 copyright symbol 2024-06-30 00:01:00 -04:00
Mikayla Fischler
e69cbc8633 luacheck fix 3 who could see this coming 2024-06-29 23:53:37 -04:00
Mikayla Fischler
ea1bcbf81c luacheck fix 2 2024-06-29 23:52:34 -04:00
Mikayla Fischler
f13f03fddc luacheck fix 2024-06-29 23:51:32 -04:00
Mikayla Fischler
72a480e475 luacheck the offline script but with an ignore 2024-06-29 23:49:33 -04:00
Mikayla Fischler
ec1b56b853 disable luacheck on offline script 2024-06-29 23:42:22 -04:00
Mikayla Fischler
c5fb299f55 message rewording, fixed colors on deletions 2024-06-29 23:38:51 -04:00
Mikayla Fischler
63c990a3cf #506 two-file bundled offline installer generation 2024-06-29 22:44:12 -04:00
Mikayla Fischler
89e84f9711 #194 ccmsi updates around log handling 2024-06-29 22:39:58 -04:00
Mikayla Fischler
270aeb13ca removed config.lua from luacheck 2024-06-29 22:38:11 -04:00
Mikayla Fischler
df8c71f12e #506 use minified files for off-line installer 2024-06-29 16:02:25 -04:00
Mikayla Fischler
347f67c8ee Merge branch '465-safe-lua-minifier' into 506-single-file-off-line-installer 2024-06-29 15:57:07 -04:00
Mikayla
8de2d7071e Merge pull request #509 from MikaylaFischler/465-safe-lua-minifier
465 safe lua minifier
2024-06-29 15:55:11 -04:00
Mikayla Fischler
d424cf74d3 Merge branch 'devel' into 506-single-file-off-line-installer 2024-06-29 15:53:27 -04:00
Mikayla Fischler
a1b571d7c0 copy over LICENSE to minified output directory 2024-06-29 15:52:47 -04:00
Mikayla Fischler
8e0e4df3eb rename package zip script 2024-06-29 15:52:34 -04:00
Mikayla Fischler
b025958173 comments in minifier 2024-06-29 15:41:04 -04:00
Mikayla Fischler
f83eecf2e2 script to package zips for installation without internet but with filesystem upload access 2024-06-29 15:28:16 -04:00
Mikayla Fischler
0b2f7b13a1 moved build scripts to new build directory 2024-06-29 15:14:43 -04:00
Mikayla Fischler
3ad3cbb4eb Merge branch 'devel' into 465-safe-lua-minifier 2024-06-29 15:11:55 -04:00
Mikayla Fischler
e868fd3397 cleanup of bootloader 2024-06-29 15:11:16 -04:00
Mikayla Fischler
a4add9370c RTU modem init consistency and cleanup 2024-06-29 15:08:11 -04:00
Mikayla
4f48ba8abc #403 work on guide docs 2024-06-29 18:59:39 +00:00
Mikayla
3cc6781844 Merge pull request #507 from MikaylaFischler/488-accelerate-hmac-computation
488 accelerate hmac computation
2024-06-29 14:52:15 -04:00
Mikayla Fischler
c05a45c29a more cleanup 2024-06-29 14:51:15 -04:00
Mikayla Fischler
f2937b47e9 cleanup 2024-06-29 14:49:26 -04:00
Mikayla
8e14fa1591 disable a diagnostic message in ccmsi 2024-06-29 18:30:32 +00:00
Mikayla
aebb9f42be #506 work on off-line installer generation script 2024-06-29 18:29:49 +00:00
Mikayla Fischler
2de30ef064 #488 fixes to sequence number changes and auth packet data 2024-06-29 14:10:58 -04:00
Mikayla Fischler
8dedb092e7 Merge branch 'devel' into 488-accelerate-hmac-computation 2024-06-29 12:51:52 -04:00
Mikayla
807e575580 Merge pull request #505 from MikaylaFischler/502-supervisor-crash-arithmetic-operation-on-nil-value
502 supervisor crash arithmetic operation on nil value
2024-06-29 12:48:28 -04:00
Mikayla Fischler
55dc203cdd increment reactor plc version to 1.8.0 2024-06-29 12:47:56 -04:00
Mikayla Fischler
a15cbadd32 #497 initial loading screen 2024-06-29 12:29:28 -04:00
Mikayla Fischler
bc76c01aa5 #504 fixed reactor idle status on pocket display 2024-06-29 12:18:55 -04:00
Mikayla
d2bc4f6bc0 #488 HMAC acceleration and seq_num changes 2024-06-29 02:27:55 +00:00
Mikayla Fischler
4cdbe3b07f some more cleanup 2024-06-27 21:05:53 -04:00
Mikayla Fischler
897a3ed22d #502 much needed refresh and cleanup of PLC struct and status packet handling 2024-06-27 21:03:53 -04:00
Mikayla Fischler
2bc20ec312 cleanup 2024-06-27 20:01:53 -04:00
Mikayla Fischler
fc42049aa0 removed deprecated high temp constant 2024-06-27 19:57:55 -04:00
Mikayla Fischler
4a7028f401 #497 instantly launch pocket program, block network dependent apps until connected 2024-06-27 19:57:43 -04:00
Mikayla
006c5e6adf Merge pull request #501 from MikaylaFischler/devel
2024.06.15 Release
2024-06-15 18:27:17 -04:00
Mikayla Fischler
f64db66448 comms version updates 2024-06-14 17:58:39 -04:00
Mikayla
a8e6bc0e35 Merge pull request #499 from MikaylaFischler/pocket-alpha-dev
Pocket June Update
2024-06-14 17:50:47 -04:00
Mikayla Fischler
4a39ed9d38 removed stray newline 2024-06-14 17:50:16 -04:00
Mikayla Fischler
9fe0669fda updated guide section heights and added a debug message to track height usage 2024-06-14 17:49:43 -04:00
Mikayla Fischler
219f02b188 print render crash cause to user 2024-06-14 17:42:03 -04:00
Mikayla Fischler
ea8f62dea6 #497 exit app if it is unloaded 2024-06-14 17:38:45 -04:00
Mikayla
1c719ad67b cleanup for pull request 2024-06-14 21:10:42 +00:00
Mikayla
87a91e309d #403 guide updates 2024-06-14 21:09:14 +00:00
Mikayla
c66ad44adb pocket cleanup 2024-06-14 16:32:25 +00:00
Mikayla
14736e414f luacheck ignore 2024-06-14 16:20:53 +00:00
Mikayla
fb1f85a626 possible luacheck suppression 2024-06-14 16:16:41 +00:00
Mikayla
697a3d6f6b luacheck fixes 2024-06-14 16:14:24 +00:00
Mikayla
00cacd6d0a #497 unload apps when required connections are lost 2024-06-14 16:10:04 +00:00
Mikayla Fischler
0b97d4d4b0 updated header message 2024-06-13 21:52:13 -04:00
Mikayla Fischler
def5b49327 #496 threaded app loading 2024-06-13 21:43:56 -04:00
Mikayla Fischler
38457cfbbc enforce pocket computer requirement 2024-06-13 20:34:39 -04:00
Mikayla
e851a5275f #496 pocket threading 2024-06-13 16:45:44 +00:00
Mikayla Fischler
5848c2ac1a test code for debugging 2024-06-12 20:22:41 -04:00
Mikayla Fischler
f8a5dd9c32 #200 additional fields for info display 2024-06-12 20:20:30 -04:00
Mikayla Fischler
ff8ae5e609 #200 updated status info display fields 2024-06-12 20:17:31 -04:00
Mikayla Fischler
95b93eb795 #403 nav up button sends back to prior app if open_help was used 2024-06-12 20:10:16 -04:00
Mikayla Fischler
356caf7b4d #403 guide searching 2024-06-12 20:01:31 -04:00
Mikayla Fischler
09c44a6969 multi-line push button and keep focus on keyboard select 2024-06-12 19:59:19 -04:00
Mikayla Fischler
83ba6e3961 #403 updated search navigation 2024-06-06 23:10:19 -04:00
Mikayla Fischler
e88e1afcc4 #403 started work on guide searching 2024-06-06 23:05:22 -04:00
Mikayla Fischler
b457edbc71 #403 variable sizing on listbox heights for sections 2024-06-06 22:54:26 -04:00
Mikayla
5e70e4131e #403 more work on guide and help linking 2024-06-07 02:30:55 +00:00
Mikayla Fischler
375b7f680e fixes to graphics constraint logic 2024-06-05 19:38:22 -04:00
Mikayla Fischler
e37b8758cd #403 guide fixes and focusing improvements 2024-06-05 19:38:02 -04:00
Mikayla
9404b50a8c #403 additional work on guide app 2024-06-05 22:07:38 +00:00
Mikayla
58fb35e85b keyboard and paste support for pocket 2024-06-05 00:31:47 +00:00
Mikayla
b9030d6bed #403 work on guide app 2024-06-05 00:31:29 +00:00
Mikayla
25ebf2c8c7 graphics automatic constraints 2024-06-05 00:31:06 +00:00
Mikayla Fischler
4d87887709 #403 pocket guide fixes 2024-06-03 20:52:59 -04:00
Mikayla
b63a17bda0 Merge branch 'pocket-alpha-dev' of https://github.com/MikaylaFischler/cc-mek-scada into pocket-alpha-dev 2024-06-04 00:24:41 +00:00
Mikayla
39233dae8a Merge branch 'pocket-alpha-dev' of https://github.com/MikaylaFischler/cc-mek-scada into pocket-alpha-dev 2024-06-04 00:22:06 +00:00
Mikayla
a2af0d3829 #403 work on pocket guide app 2024-06-04 00:21:54 +00:00
Mikayla Fischler
db901129f9 #200 status display updates 2024-06-02 22:00:42 -04:00
Mikayla Fischler
c1c49ea3fb #200 unit app updates 2024-06-02 16:06:32 -04:00
Mikayla Fischler
be6c3755a4 #207 pocket turbine view 2024-06-01 00:50:19 -04:00
Mikayla Fischler
ac2d189c1a reactor and boiler view fixes 2024-05-31 19:25:36 -04:00
Mikayla Fischler
0fa0324940 #206 pocket boiler view 2024-05-31 18:16:04 -04:00
Mikayla Fischler
3181ab96f1 #206 work on boiler view and reorganized app code 2024-05-29 22:08:36 -04:00
Mikayla Fischler
30c9215658 #202 pocket reactor view 2024-05-27 23:53:35 -04:00
Mikayla Fischler
946c28c929 record additional reactor unit data 2024-05-27 23:49:53 -04:00
Mikayla Fischler
e6d6353d05 added temperature units to pocket and to common types 2024-05-27 19:31:24 -04:00
Mikayla Fischler
0e81391144 #200 fixes to alarm/info display 2024-05-22 21:45:52 -04:00
Mikayla Fischler
b18cadb53e Merge branch 'devel' into pocket-alpha-dev 2024-05-22 18:46:23 -04:00
Mikayla Fischler
9a500d8f96 Merge branch 'pocket-alpha-dev' of github.com:MikaylaFischler/cc-mek-scada into pocket-alpha-dev 2024-05-22 18:15:18 -04:00
Mikayla
a268a770f2 #200 pocket alarm/status informational display, ECAM style 2024-05-22 21:55:59 +00:00
Mikayla
b96eb7d89d Merge pull request #492 from MikaylaFischler/devel
2024.05.16 Beta Hotfix
2024-05-16 22:13:01 -04:00
Mikayla Fischler
9b8947fba2 #491 fixed ps table indexing for boiler/turbine online 2024-05-16 22:06:53 -04:00
Mikayla
afc38e7e7a Merge pull request #490 from MikaylaFischler/devel
2024.05.15 Release
2024-05-15 17:22:18 -04:00
Mikayla Fischler
41b7a68f3e #487 stop retrying failed disable when needing to enable 2024-05-14 20:10:21 -04:00
Mikayla Fischler
8968ebede3 #486 fixed pcall messages for newer CC versions 2024-05-14 20:00:34 -04:00
Mikayla
50a9168b06 Merge pull request #489 from MikaylaFischler/pocket-alpha-dev
Pocket Update
2024-05-12 18:27:03 -04:00
Mikayla Fischler
76e85da9d5 version increments and small fix 2024-05-12 18:19:21 -04:00
Mikayla Fischler
be560cd532 luacheck fixes 2024-05-12 15:19:01 -04:00
Mikayla Fischler
2b0a536292 #200 pocket RCS overview 2024-05-12 15:14:58 -04:00
Mikayla Fischler
afed6f514d removed stray space in annunciator Coolant Level Low 2024-05-12 15:05:36 -04:00
Mikayla Fischler
3e6a0a8869 #200 updated RPS indicator text 2024-05-12 14:20:48 -04:00
Mikayla Fischler
b99cf19be0 #200 placeholder for alarm page, start of RCS page 2024-05-12 13:36:46 -04:00
Mikayla Fischler
7f009f9c86 #200 RPS view on pocket 2024-05-12 13:28:34 -04:00
Mikayla Fischler
6a8ed311f3 #200 functioning pocket unit overview 2024-05-11 19:19:52 -04:00
Mikayla Fischler
c181142f75 added network details to about app 2024-05-11 15:03:14 -04:00
Mikayla Fischler
0cb964a177 diagnostic disables 2024-05-10 19:18:21 -04:00
Mikayla Fischler
3cd832ca20 sidebar updates 2024-05-10 19:17:52 -04:00
Mikayla Fischler
0c6c7bf9a5 #200 work in progress unit views and sidebar/app updates 2024-05-09 23:05:55 -04:00
Mikayla Fischler
3bfcb1d83c #485 fixed assertion with height auto incrementing y when inheriting height 2024-05-04 13:50:53 -04:00
Mikayla
4fe6792804 Merge pull request #483 from MikaylaFischler/devel
2024.04.30 Release
2024-04-30 20:35:24 -04:00
Mikayla Fischler
25dc47d520 fixed recording bad stats on induction matrix faults 2024-04-30 20:28:07 -04:00
Mikayla Fischler
f958b0e3b7 fixed at max i/o indicator 2024-04-30 20:27:04 -04:00
Mikayla Fischler
f621ff2482 added some value inits and unit labels 2024-04-30 18:54:01 -04:00
Mikayla Fischler
eb45ff899b #455 calculate reactor temp high limit 2024-04-29 22:03:54 -04:00
Mikayla
e91fd2fcaa Merge pull request #482 from MikaylaFischler/412-additional-matrix-integrations
412 additional matrix integrations
2024-04-28 13:08:51 -04:00
Mikayla Fischler
d35b824458 luacheck fix and cleanup 2024-04-28 13:08:16 -04:00
Mikayla Fischler
165d1497f8 reverted test change that got committed 2024-04-28 02:01:40 -04:00
Mikayla Fischler
50bf057ca6 #412 optionally disable SPS at low power 2024-04-28 02:01:21 -04:00
Mikayla Fischler
6f768ef6b3 #469 made ETA tolerant to induction matrix capacity changes 2024-04-28 01:26:44 -04:00
Mikayla Fischler
826086951e return zero on mov_avg compute if no samples 2024-04-27 19:50:35 -04:00
Mikayla Fischler
35bf56663f #469 induction matrix charge ETAs and misc cleanup/updates 2024-04-27 16:27:01 -04:00
Mikayla
43b44cc425 #465 first pass at minifier 2024-04-24 21:11:41 +00:00
Mikayla Fischler
7b8cea4a5c Merge branch 'devel' into 412-additional-matrix-integrations 2024-04-21 13:57:47 -04:00
Mikayla Fischler
51d4a22532 #478 simplified reactor PLC reactor formed handling 2024-04-21 13:55:39 -04:00
Mikayla Fischler
fb85c2f05b RTU configurator updates for redstone I/O clarity 2024-04-21 13:54:14 -04:00
Mikayla Fischler
712d018806 Merge branch 'devel' into 412-additional-matrix-integrations 2024-04-21 12:09:53 -04:00
Mikayla Fischler
00a8d64a88 fixed coordinator not showing FAIL on unit count mismatch when connecting 2024-04-20 20:38:55 -04:00
Mikayla Fischler
d9efd5b8d2 #412 updates to RSIO for induction matrix low, high, and analog charge level 2024-04-20 16:32:18 -04:00
Mikayla Fischler
a786404092 #476 fixed PPM not initing fault counter in __index handler when a function is found 2024-04-16 15:55:40 -04:00
Mikayla
1bd03c0b1a Merge pull request #473 from MikaylaFischler/devel
2024.04.14 Release
2024-04-15 11:59:40 -04:00
Mikayla Fischler
0d8d7aeb15 readme updates 2024-04-15 10:20:48 -04:00
Mikayla Fischler
0b60dc9fa4 #474 run main reactor-plc loop clock when not networked 2024-04-14 19:24:12 -04:00
Mikayla Fischler
48b91ac808 fixed reactor-plc configurator auth key displaying *** when not networked 2024-04-14 19:08:19 -04:00
Mikayla Fischler
4c9efc78b1 bumped up scada-common version 2024-04-14 16:30:50 -04:00
Mikayla
3c5857cd68 Merge pull request #472 from MikaylaFischler/pocket-alpha-dev
Work on Pocket Alpha App
2024-04-14 16:17:14 -04:00
Mikayla Fischler
473b0dd10d fixes and comments 2024-04-14 16:16:18 -04:00
Mikayla Fischler
d2df7db18b luacheck fixes 2024-04-14 15:30:13 -04:00
Mikayla Fischler
0ca002316f work on pocket, bumped comms version for PR 2024-04-14 15:28:38 -04:00
Mikayla Fischler
9fe34648c2 added system information/about app 2024-04-13 16:18:27 -04:00
Mikayla Fischler
57dc20692b need to use a compact signal bar due to how edge extensions work 2024-04-13 16:15:20 -04:00
Mikayla Fischler
f22d699baf flipped app pane scroll direction 2024-04-13 16:14:38 -04:00
Mikayla Fischler
23b31e0049 #410 pocket nav overhaul 2024-04-13 14:47:20 -04:00
Mikayla Fischler
2b4309afa7 pocket coordinator linking fixes 2024-04-13 11:02:41 -04:00
Mikayla
89cd5a07f2 Merge branch 'pocket-alpha-dev' of https://github.com/MikaylaFischler/cc-mek-scada into pocket-alpha-dev 2024-04-13 00:42:01 +00:00
Mikayla
99213da760 #200 work on pocket comms for unit data 2024-04-13 00:41:47 +00:00
Mikayla Fischler
f23f69d441 Merge branch 'devel' into pocket-alpha-dev 2024-04-12 20:27:21 -04:00
Mikayla
a99b7912f8 Merge pull request #471 from MikaylaFischler/366-charge-control-mode-idling
366 charge control mode idling
2024-04-12 20:07:21 -04:00
Mikayla Fischler
23ca5fb69e clear flow monitor on coordinator ui close 2024-04-12 20:06:39 -04:00
Mikayla Fischler
c243d064ef fixed incorrect render behavior on quick supervisor reconnects 2024-04-12 00:18:35 -04:00
Mikayla Fischler
878c3b92e1 #366 added idling to config and adjusted/fixed some behaviors 2024-04-12 00:13:05 -04:00
Mikayla Fischler
2aa52d2e2c simplified a config validation assert 2024-04-11 20:30:54 -04:00
Mikayla Fischler
dfc1ee6497 cleanup and constants 2024-04-10 22:16:41 -04:00
Mikayla Fischler
a6a1a61954 #470 reworked flow stability logic 2024-04-10 21:30:51 -04:00
Mikayla Fischler
d0b50c834c fixed coordinator not exiting on failed connection 2024-04-10 20:49:14 -04:00
Mikayla Fischler
612a06ba98 use os.clock rather than unix time for control 2024-04-09 22:24:03 -04:00
Mikayla Fischler
65d43d55c7 #366 idling and charge level PD gain changes 2024-04-09 22:23:43 -04:00
Mikayla Fischler
4fcd375ee2 show average charge rather than current charge below charge target 2024-04-09 22:20:46 -04:00
Mikayla Fischler
a22f5562cf only ramp up on reactor plc 2024-04-09 22:19:53 -04:00
Mikayla
0365ea5e8a Merge branch 'pocket-alpha-dev' of https://github.com/MikaylaFischler/cc-mek-scada into pocket-alpha-dev 2024-04-09 14:27:50 +00:00
Mikayla
da300607f1 Merge pull request #468 from MikaylaFischler/460-create-coordinator-ui-thread
460 create coordinator UI thread
2024-04-09 00:10:44 -04:00
Mikayla Fischler
cc3174ee76 comments and whitespace 2024-04-09 00:08:47 -04:00
Mikayla Fischler
98c37caecd #460 cleanup 2024-04-08 23:59:16 -04:00
Mikayla Fischler
cc50e4a020 #460 removed coordinator connecting grace period 2024-04-07 22:33:48 -04:00
Mikayla Fischler
f734c4307b #460 exit on UI crash 2024-04-07 20:55:07 -04:00
Mikayla Fischler
45573be8c7 #460 renderer logging 2024-04-07 20:47:31 -04:00
Mikayla Fischler
eab1ffbe03 #460 cleanup and moved date and time update to be behind UI ready rather than linked 2024-04-07 20:24:27 -04:00
Mikayla Fischler
1504247b33 #460 added yields throughout main UI rendering 2024-04-07 20:21:57 -04:00
Mikayla Fischler
92a4277f73 #460 moved connect/disconnect/resize to render thread 2024-04-07 19:54:22 -04:00
Mikayla Fischler
31a663e86b #460 threaded coordinator and moved UI start to render thread 2024-04-07 19:37:06 -04:00
Mikayla Fischler
5c0e2c32ee #461 prevent log spam in standalone mode when RPS trips continuously 2024-04-07 18:04:11 -04:00
Mikayla
3537c59365 Merge pull request #466 from MikaylaFischler/devel
2024.03.31 Release
2024-03-31 18:53:18 -04:00
Mikayla Fischler
1d7104ae74 Merge branch 'devel' into pocket-alpha-dev 2024-03-31 13:35:23 -04:00
Mikayla Fischler
4629e1ba2a #464 fixed color options button not appearing disabled when disabled 2024-03-31 00:03:28 -04:00
Mikayla Fischler
659644865a #449 include disconnected configured monitors in monitor list 2024-03-30 12:46:01 -04:00
Mikayla Fischler
03d2b3f087 #452 enable emergency coolant on boiler water level low when reactor can't cool 2024-03-29 18:31:17 -04:00
Mikayla
bea7b91ff1 Merge pull request #459 from MikaylaFischler/457-colorblind-independent-color-accessibility-modifiers
457 colorblind independent color accessibility modifiers
2024-03-25 10:13:15 -04:00
Mikayla Fischler
b94c89f4ec #457 cleanup 2024-03-25 10:11:35 -04:00
Mikayla Fischler
55e4e5a68b #457 fix for indicator background 2024-03-24 23:05:52 -04:00
Mikayla Fischler
e1ad76a00d #457 fixes and adjusted text 2024-03-24 13:56:19 -04:00
Mikayla Fischler
93e4590947 #457 added standard with black off 2024-03-24 13:39:24 -04:00
Mikayla Fischler
2442e7f972 #457 added ind_bkg for front panels 2024-03-24 13:03:48 -04:00
Mikayla Fischler
bb2c07963b #457 work on blue indicator modes 2024-03-24 12:56:51 -04:00
Mikayla Fischler
44c6352a8c #458 changed induction matrix title text to be white in dark mode 2024-03-23 01:15:42 -04:00
Mikayla Fischler
968b0a9122 log environment versions when debug logs are enabled 2024-03-23 00:49:19 -04:00
Mikayla Fischler
19869416af #434 #454 PPM improvements and undefined function overhaul 2024-03-23 00:26:58 -04:00
Mikayla
598f6f08af Merge branch 'devel' into pocket-alpha-dev 2024-03-13 13:55:51 +00:00
Mikayla
ca2d8ab7da Merge pull request #450 from MikaylaFischler/devel
2024.03.12 Release
2024-03-12 21:15:24 -04:00
Mikayla Fischler
1c0f61b3e0 changed config defaults to use theme enums 2024-03-12 21:09:37 -04:00
Mikayla Fischler
ecd3575643 Merge branch 'color-update' into devel 2024-03-12 13:35:39 -04:00
Mikayla Fischler
9dc3a09f4d bumped up pocket version for configurator change 2024-03-12 13:35:15 -04:00
Mikayla
7a5d14d67f Merge pull request #448 from MikaylaFischler/color-update
Colorblind Modes
2024-03-12 13:25:36 -04:00
Mikayla Fischler
d6175e5cec switched to using LEDPair elements for colorblind mode network lights 2024-03-12 13:23:39 -04:00
Mikayla Fischler
a00a824a7f cleanup and fixes 2024-03-12 13:15:28 -04:00
Mikayla Fischler
9393632428 removed unused value specifiers 2024-03-12 12:54:31 -04:00
Mikayla Fischler
886bd0d5d5 luacheck fixes 2024-03-12 12:49:33 -04:00
Mikayla Fischler
9c1d83fdfc Merge branch 'devel' into color-update 2024-03-12 12:46:17 -04:00
Mikayla Fischler
bd88244681 #439 remind user to configure peripherals and redstone, and provide buttons to do so 2024-03-12 12:45:47 -04:00
Mikayla
8dae632b25 simplified checks for colorblind mode 2024-03-12 16:24:32 +00:00
Mikayla Fischler
89d56d3101 moved main UI palettes to themes.lua and set configurators to use it 2024-03-11 23:54:03 -04:00
Mikayla Fischler
1f451ff92a #340 coordinator colorblind support 2024-03-11 23:31:31 -04:00
Mikayla Fischler
9d08b51f84 #340 restored softer blue for deuteranopia/protanopia basalt theme 2024-03-11 21:43:11 -04:00
Mikayla Fischler
047ff5c203 Merge branch 'devel' into color-update 2024-03-11 21:26:23 -04:00
Mikayla Fischler
895f768e58 Merge branch 'color-update' of github.com:MikaylaFischler/cc-mek-scada into color-update 2024-03-11 21:25:55 -04:00
Mikayla Fischler
b3f29566ea #340 colorblind modes for rtu, reactor-plc, and supervisor 2024-03-11 21:25:34 -04:00
Mikayla
c0a5c8d504 Merge pull request #447 from MikaylaFischler/color-update
Dark Mode Themes
2024-03-11 12:38:22 -04:00
Mikayla
bbe7b52662 bugfixes and cleanup 2024-03-11 16:35:06 +00:00
Mikayla Fischler
d5b166dcc6 Merge branch 'devel' into color-update 2024-03-09 18:51:21 -05:00
Mikayla
b0aa6d54ac Merge pull request #446 from MikaylaFischler/devel
2024.03.09 Beta Hotfix
2024-03-09 18:14:02 -05:00
Mikayla Fischler
ad240ae44c #445 increment common version 2024-03-09 17:54:04 -05:00
Mikayla Fischler
79c93f1562 #445 fixed PPM undefined field logic and improved RTU unit fault handling 2024-03-09 13:24:06 -05:00
Mikayla Fischler
5d760a0524 #405 helper functions, enums, and name tables added to themes.lua 2024-03-09 12:41:45 -05:00
Mikayla Fischler
6c89b3134c #405 make pu fallback selector visible 2024-03-09 12:39:37 -05:00
Mikayla
3c7fff28c9 Merge pull request #443 from MikaylaFischler/devel
2024.03.08 Release
2024-03-08 22:40:28 -05:00
Mikayla Fischler
814043bf04 #405 basalt theme color adjustments 2024-03-07 20:46:10 -05:00
Mikayla Fischler
fc7896ebd3 #405 #340 rtu and supervisor configurator control of theme and color mode 2024-03-07 19:23:46 -05:00
Mikayla Fischler
48a8eadc55 #405 #340 reactor plc configurator control of theme and color mode 2024-03-07 18:00:33 -05:00
Mikayla
f0f2aadf53 #200 work on pocket comms 2024-03-07 17:27:25 +00:00
Mikayla
ce37a672a3 Merge branch 'devel' into pocket-alpha-dev 2024-03-07 16:21:37 +00:00
Mikayla Fischler
510995b04f #405 #340 coordinator configurator control of theme and color mode 2024-03-06 23:35:30 -05:00
Mikayla Fischler
560061d4ad removed latest shield and added missing common version shield 2024-03-06 20:51:23 -05:00
Mikayla Fischler
d87e3893f0 #405 plc and rtu front panel themes 2024-03-06 12:18:50 -05:00
Mikayla Fischler
fc198cd9d2 #405 supervisor and coordinator front panel themes 2024-03-06 11:43:31 -05:00
Mikayla Fischler
c714e49ad8 Merge branch 'devel' into color-update 2024-03-05 22:03:24 -05:00
Mikayla Fischler
d1e4ea586e supervisor comment cleanup 2024-03-05 21:47:14 -05:00
Mikayla Fischler
4e789ab92d cleanup and refactors 2024-03-05 21:24:17 -05:00
Mikayla Fischler
0892a57d35 #442 return rather than assert on configuration error 2024-03-05 20:17:52 -05:00
Mikayla Fischler
1bc4828010 #438 use reported polonium rate rather than an estimate 2024-03-05 19:35:54 -05:00
Mikayla Fischler
fb5a9d5d9e #432 fixes and enhancements to coordinator waiting on chunk loads 2024-03-05 17:16:35 -05:00
Mikayla Fischler
adbf1f2f78 #441 #431 bugfixes to the bugfixes 2024-03-05 17:12:12 -05:00
Mikayla Fischler
2f99aaeedb #431 handle ppm mount of unformed reactor race condition 2024-03-05 10:56:27 -05:00
Mikayla Fischler
a318ffb283 #405 styling improvements to PLC front panel 2024-03-05 10:51:18 -05:00
Mikayla Fischler
a677e994d6 Merge branch 'devel' into color-update 2024-02-26 14:44:47 -05:00
Mikayla Fischler
f9917b786c #432 wait 20s on computer power on before assuming monitor configuration problem 2024-02-25 18:02:13 -05:00
Mikayla Fischler
dbc1f41c5d #406 bounds check all controls 2024-02-25 15:53:14 -05:00
Mikayla Fischler
d6185e0183 #433 use os.clock instead of util.time_s for coordinator connection timeout to supervisor 2024-02-25 13:13:36 -05:00
Mikayla Fischler
6ef049baa1 #405 reverted yellow, desaturated orange 2024-02-25 13:09:30 -05:00
Mikayla Fischler
a4214e8a4f #405 fixed waste line still always being black and removed colormap test 2024-02-24 19:34:43 -05:00
Mikayla Fischler
45881067df fixed extra space in RCS indicator list 2024-02-24 18:01:30 -05:00
Mikayla Fischler
c40aa229bf #405 flow monitor theme implementation 2024-02-24 17:35:10 -05:00
Mikayla Fischler
51f2bba4d1 #405 theme implementation for unit displays 2024-02-24 15:37:39 -05:00
Mikayla Fischler
628a50e1bd #405 WIP themes and completed main display theme implementation 2024-02-24 14:35:04 -05:00
Mikayla Fischler
cdd31508d9 #430 fixed unit boiler, turbine, and tank status indicators flashing OFF-LINE when online 2024-02-22 21:35:08 -05:00
Mikayla
83d62991f8 Merge pull request #429 from MikaylaFischler/328-coordinator-temperature-unit-options
328 coordinator temperature unit options
2024-02-22 20:50:01 -05:00
Mikayla Fischler
f207a950e4 fixed bug with hmac still being used for connecting in coordinator configurator after clearing key 2024-02-22 19:25:55 -05:00
Mikayla Fischler
0b0051dc2f #328 K, C, F, and R temperature unit options 2024-02-22 19:25:16 -05:00
Mikayla Fischler
f152c37ea9 #387 handle resizing, improved reconnect handling, fixed disconnect detection bug 2024-02-21 20:33:07 -05:00
Mikayla Fischler
372fd426d8 test code for psil allocations 2024-02-21 18:48:55 -05:00
Mikayla
8347afb6d0 Merge pull request #420 from MikaylaFischler/devel
2024.02.19 Release
2024-02-21 13:12:51 -05:00
Mikayla Fischler
10d0a9763a disabled a verbose log message 2024-02-21 12:59:48 -05:00
Mikayla Fischler
96691d773a supervisor debug log messages and #427 fix 2024-02-21 12:58:49 -05:00
Mikayla Fischler
910509d764 coordinator configurator bugfixes 2024-02-20 19:33:14 -05:00
Mikayla Fischler
158cc39b80 #421 remove 'latest' branch 2024-02-19 20:40:05 -05:00
Mikayla
940f71aa35 Merge pull request #422 from MikaylaFischler/145-graphical-configure-utilities
Pocket Configurator and Other Fixes
2024-02-19 20:34:41 -05:00
Mikayla Fischler
788cef8f86 comment cleanup and absolute paths while saving 2024-02-19 20:32:33 -05:00
Mikayla Fischler
baaef862ab #145 coordinator configurator enhancements 2024-02-19 20:26:05 -05:00
Mikayla Fischler
96db709ced ccmsi print fix 2024-02-19 20:24:30 -05:00
Mikayla Fischler
c47fa5433f #408 improvements to pocket configurator 2024-02-19 19:36:27 -05:00
Mikayla Fischler
440b724798 #424 tick comms version up 2024-02-19 19:33:08 -05:00
Mikayla Fischler
126d6eb163 #424 fixed key derivation init 2024-02-19 19:28:12 -05:00
Mikayla Fischler
8ac46faf36 set text scales before checking monitor dimensions 2024-02-19 18:56:24 -05:00
Mikayla Fischler
f112746e12 #408 increment bootloader version for pocket configurator, minification 2024-02-19 14:27:02 -05:00
Mikayla Fischler
76f21e925b #145 removed unneeded references to config.lua files + some minification 2024-02-19 14:18:23 -05:00
Mikayla Fischler
a330249c7e #408 integrate new settings with pocket 2024-02-19 14:07:26 -05:00
Mikayla Fischler
bbc64c8dc2 #145 fixed oversized listboxes 2024-02-19 13:54:23 -05:00
Mikayla Fischler
bb062cf397 #408 added pocket configure to configure launcher 2024-02-19 13:50:38 -05:00
Mikayla Fischler
53bb36ce8d #145 fixed change log page on coordinator 2024-02-19 13:50:03 -05:00
Mikayla Fischler
8237113577 #408 pocket configurator 2024-02-19 13:49:50 -05:00
Mikayla Fischler
02906ae707 add FUNDING.yml 2024-02-19 12:49:26 -05:00
Mikayla Fischler
6d0e777e68 updated copyright and removed coordinator from list mentioning config.lua 2024-02-18 21:40:25 -05:00
Mikayla
36468c4043 Merge pull request #419 from MikaylaFischler/145-graphical-configure-utilities
Coordinator Configurator
2024-02-18 21:36:50 -05:00
Mikayla Fischler
1cf7375311 #309 cleanup 2024-02-18 21:34:25 -05:00
Mikayla Fischler
ca55948286 #309 remove legacy config.lua 2024-02-18 21:25:21 -05:00
Mikayla Fischler
195f59178f #309 bugfix to apisessions still using old config 2024-02-18 21:24:30 -05:00
Mikayla Fischler
e416faf313 #309 integrated process control with new settings file 2024-02-18 20:47:37 -05:00
Mikayla Fischler
20bff48cfd #309 cleanup, fixes, optimizations 2024-02-18 20:21:07 -05:00
Mikayla Fischler
1a9892b291 cleanup and optimizations 2024-02-18 16:49:39 -05:00
Mikayla Fischler
827953c0a1 more luacheck fixes 2024-02-18 15:31:45 -05:00
Mikayla Fischler
56e69e3a29 luacheck fixes 2024-02-18 15:30:18 -05:00
Mikayla Fischler
1984b63837 additional config validations 2024-02-18 15:25:30 -05:00
Mikayla Fischler
36b12d5dea #309 integrated new configuration into coordinator 2024-02-18 15:21:00 -05:00
Mikayla Fischler
3e83c8e2c6 #309 moved monitor block size to ppm and fixed size estimation for monitor requirements 2024-02-18 13:00:18 -05:00
Mikayla Fischler
1fa8c03dff #309 import legacy configs 2024-02-18 00:56:36 -05:00
Mikayla Fischler
d6de9c266b #309 viewing and saving coordinator config 2024-02-17 22:39:50 -05:00
Mikayla Fischler
2142c1b4f7 updated license year 2024-02-17 18:39:02 -05:00
Mikayla Fischler
cafba6c67a #309 legacy options and general improvements 2024-02-17 18:38:36 -05:00
Mikayla Fischler
6eccebbe39 #409 fixed positioning 2024-02-17 18:16:21 -05:00
Mikayla Fischler
5e9f03c900 #418 fixed graphics bug with redraw 2024-02-17 18:12:28 -05:00
Mikayla Fischler
7374bb02d1 #309 speaker and time format configuration 2024-02-14 14:41:34 -05:00
Mikayla Fischler
d19794ae4f #309 unassign unused monitors on unit count reduction and support autofilling fields when editing existing monitor configs 2024-02-14 10:24:27 -05:00
Mikayla Fischler
108cf75cad #309 coordinator monitor configuration 2024-02-14 09:43:30 -05:00
Mikayla Fischler
34cbb6be39 bugfixes 2024-02-03 01:48:56 -05:00
Mikayla
907f27baf8 #309 show data received from supervisor 2024-02-02 23:01:51 +00:00
Mikayla Fischler
4710fa7cee #309 WIP coordinator configurator 2024-01-31 14:10:03 -05:00
Mikayla Fischler
526a54903e #410 moved diagnostic apps to main app list and added app page nav 2024-01-15 17:40:43 -05:00
Mikayla Fischler
e1a632dcc7 Merge branch 'devel' into pocket-alpha-dev 2024-01-14 14:21:09 -05:00
Mikayla Fischler
d5d818e625 pocket signal bars 2024-01-14 14:20:59 -05:00
Mikayla
bfa1f4d0c6 Merge pull request #404 from MikaylaFischler/devel
2023.12.31 Release
2023-12-31 21:34:40 -05:00
Mikayla Fischler
737e0d72b0 changed supervisor facility config color theme as green is for the summary already 2023-12-31 15:41:28 -05:00
Mikayla Fischler
6edeb3e3b8 add default value to sounder volume for very old RTU config imports 2023-12-31 15:00:38 -05:00
Mikayla Fischler
fb00e98a5b more supervisor configurator bugfixes 2023-12-31 15:00:08 -05:00
Mikayla Fischler
4f952eff83 fixed supervisor incorrectly trying to validate tank defs when tank mode is zero 2023-12-31 14:14:35 -05:00
Mikayla Fischler
1eede97c08 fixed supervisor not using proper config on front panel 2023-12-31 14:04:22 -05:00
Mikayla Fischler
95419562ee no longer mention config.lua for supervisor update 2023-12-31 13:17:49 -05:00
Mikayla Fischler
03de90c3d8 fixes to page navigation nav_up 2023-12-31 12:58:24 -05:00
Mikayla Fischler
99096e0fc9 Merge branch 'devel' into pocket-alpha-dev 2023-12-30 22:58:53 -05:00
Mikayla Fischler
7b85d947c4 fixed supervisor always using MAC 2023-12-30 22:57:30 -05:00
Mikayla Fischler
08e670091a #396 fixed fractional connection timeouts being treated as invalid 2023-12-30 20:25:57 -05:00
Mikayla
1348b632a8 Merge pull request #397 from MikaylaFischler/145-graphical-configure-utilities
Supervisor Configurator
2023-12-30 20:19:34 -05:00
Mikayla Fischler
8cd5162362 fixed PLCs not connecting, fixed facility tank mode checkbox not changing after import, and reordered info on tank mode vis about page 2023-12-30 20:18:58 -05:00
Mikayla Fischler
1c410a89d8 incremented comms version due to data change 2023-12-30 19:40:53 -05:00
Mikayla Fischler
6a931fced4 cleanup and fixes 2023-12-30 19:21:44 -05:00
Mikayla Fischler
622e2eeb90 more useful messages, incremented bootloader version 2023-12-30 14:51:25 -05:00
Mikayla Fischler
42cd9fff0c improved number field precision handling and limited decimal precision of timeouts #396 2023-12-30 14:41:03 -05:00
Mikayla Fischler
2a85a438ba #396 connection timeouts can now have a fractional part 2023-12-29 14:33:22 -05:00
Mikayla Fischler
338b3b1615 addressed luacheck warning 2023-12-29 14:29:46 -05:00
Mikayla Fischler
363f164f47 #308 deleted old config.lua 2023-12-29 14:12:54 -05:00
Mikayla Fischler
739f04ece9 #308 integrated new settings file with supervisor 2023-12-29 13:58:28 -05:00
Mikayla Fischler
c6ade68ce2 #308 importing legacy config 2023-12-29 12:40:48 -05:00
Mikayla Fischler
7d60e259e2 #308 supervisor configurator bugfixes and saving of settings 2023-12-29 01:07:50 -05:00
Mikayla Fischler
cd71c6a9c1 #308 summary display of supervisor config 2023-12-29 00:19:17 -05:00
Mikayla Fischler
26fe130609 #308 supervisor configurator completed facility tank mode and network config pages 2023-12-28 15:06:30 -05:00
Mikayla Fischler
95f87b1b05 #308 significantly improved facility dynamic tank configuration visualization 2023-12-26 13:13:05 -05:00
Mikayla Fischler
aebdf3e8df fixed include ordering 2023-12-26 13:11:46 -05:00
Mikayla Fischler
0395aa95b6 indicate pocket app is a work in progress 2023-12-22 22:30:22 -05:00
Mikayla Fischler
c624baed2c #395 fixes to new pocket navigation 2023-12-22 12:46:36 -05:00
Mikayla
1a40321c0f #395 pocket navigation system 2023-12-22 16:12:47 +00:00
Mikayla Fischler
5d4fc36256 #308 WIP supervisor configurator 2023-12-18 15:23:51 -05:00
Mikayla
b799d785b9 Merge pull request #394 from MikaylaFischler/devel
2023.12.17 Release
2023-12-17 21:02:32 -05:00
Mikayla
d55442fa53 Merge pull request #393 from MikaylaFischler/145-graphical-configure-utilities
Bring in changes from 145 branch to devel for release
2023-12-17 20:51:05 -05:00
Mikayla Fischler
c870b749a4 cleanup 2023-12-17 20:48:02 -05:00
Mikayla Fischler
4421cbc0c5 fixed input/output side text being sometimes wrong on rtu configurator redstone editing 2023-12-17 20:47:17 -05:00
Mikayla Fischler
b6a3305f23 minor minification 2023-12-17 20:43:40 -05:00
Mikayla Fischler
5680260136 use existing is_valid_port rather than repeating the code 2023-12-17 20:43:08 -05:00
Mikayla Fischler
bc66ea6ecb #381 fixed plc main thread crash on modem connect after boot with no modem 2023-12-17 20:28:26 -05:00
Mikayla Fischler
1b20218445 #194 #382 ccmsi no longer deletes drive mounts and now prompts to delete unknown files/folders in root 2023-12-17 20:10:11 -05:00
Mikayla Fischler
466e442353 #389 added width to RTU front panel entry name box 2023-12-17 19:39:00 -05:00
Mikayla Fischler
9e6751f47f #391 fixed editing of redstone entries 2023-12-17 19:32:01 -05:00
Mikayla Fischler
f868923905 #392 fixed typo preventing water level low indicator from working 2023-12-17 18:04:09 -05:00
Mikayla Fischler
5d3fd6d939 #390 fixed not being able to edit entries after using ALL_WASTE shortcut 2023-12-17 17:46:18 -05:00
Mikayla Fischler
37659d687e #388 fixed peripherals list not updating on add/delete of config entry 2023-12-17 17:22:29 -05:00
Mikayla Fischler
f23b7e2c2f fixed out of bounds coordinates crashing GUI for form fields 2023-12-17 12:56:08 -05:00
Mikayla Fischler
55ccdd63d4 don't mention config.lua on update for apps that don't have it 2023-12-17 12:55:00 -05:00
Mikayla Fischler
5c88890ed4 removed redundant min_width values 2023-12-14 20:51:54 -05:00
Mikayla Fischler
fa0185c9a4 fixed checkbox width 2023-12-13 12:20:12 -05:00
Mikayla Fischler
e1ed9a8e5e fixed error messages not fitting and say input side when configuring inputs on RTU configurator 2023-11-29 22:25:34 -05:00
Mikayla
9f7e3bc282 Merge pull request #383 from MikaylaFischler/devel
2023.11.28 Beta Hotfix
2023-11-28 20:35:56 -05:00
Mikayla Fischler
4ec060ba24 #378 fixed unit input not being re-shown on RTU configurator 2023-11-28 18:05:07 -05:00
Mikayla
b1f1753a8d Merge pull request #379 from MikaylaFischler/377-compatibility-fixes-for-lua-5.2
#377 switched to using ... for vararg
2023-11-28 17:54:36 -05:00
Mikayla Fischler
94a62f8c31 #377 switched to using ... for vararg 2023-11-27 19:32:52 -05:00
Mikayla
e6f49f256c Merge pull request #372 from MikaylaFischler/devel
2023.11.15 Hotfix
2023-11-15 19:41:29 -05:00
Mikayla Fischler
a048b0aa4a #371 fixed RTU configurator bug with empty peripherals or redstone, re-ordered settings load, added type checks 2023-11-15 19:30:49 -05:00
Mikayla
b6617c140c Merge pull request #369 from MikaylaFischler/devel
2023.11.14 Release
2023-11-14 22:10:12 -05:00
Mikayla Fischler
1fdf012f65 properly clear peripherals and redstone when importing 2023-11-14 22:00:01 -05:00
Mikayla Fischler
8fe0321ac0 fixed RTU authkey check 2023-11-14 19:40:55 -05:00
Mikayla Fischler
4a2199fa13 readme update 2023-11-14 19:40:29 -05:00
Mikayla
69680a53a0 Merge pull request #368 from MikaylaFischler/145-graphical-configure-utilities
RTU configurator and other updates
2023-11-12 18:37:23 -05:00
Mikayla Fischler
785dea6545 #306 fixed incorrect screenflow and changed peripheral import validation symbols 2023-11-12 18:36:16 -05:00
Mikayla Fischler
885932afe1 don't try to log if log.init wasn't called 2023-11-12 18:35:46 -05:00
Mikayla Fischler
a38ccf3dcc #145 #306 improvements and fixes, better peripheral import 2023-11-12 18:27:24 -05:00
Mikayla Fischler
d7b1f9cc7e #306 #362 bugfixes 2023-11-12 16:55:24 -05:00
Mikayla Fischler
6e92097544 fixed util.concat handling of nil parameters 2023-11-12 16:06:16 -05:00
Mikayla Fischler
76403b4ddc cleanup and grammar 2023-11-12 15:38:25 -05:00
Mikayla Fischler
41ad8d8edb #306 prevent duplicate redstone inputs 2023-11-12 14:35:53 -05:00
Mikayla Fischler
68754977b0 cleanup and fixes 2023-11-12 14:21:48 -05:00
Mikayla Fischler
78ad6d5457 luacheck fix 2023-11-12 12:00:42 -05:00
Mikayla Fischler
cb049ebf41 #194 changed 'newer' to 'different' in ccmsi 2023-11-12 11:57:05 -05:00
Mikayla Fischler
f2f5c3201f #362 taking max of connected radiation monitors 2023-11-12 11:54:47 -05:00
Mikayla Fischler
1ba178eae8 #306 delete legacy RTU config 2023-11-06 10:22:52 -05:00
Mikayla Fischler
838f80c30c #306 #362 supervisor updates for RTU config changes 2023-11-06 10:21:42 -05:00
Mikayla Fischler
dc0408881e #145 use rsio.color_name on PLC configurator 2023-11-06 10:11:57 -05:00
Mikayla Fischler
1b5e8cb69c #306 RTU integration with new settings 2023-11-06 09:25:44 -05:00
Mikayla Fischler
9e13a3a467 added ability to view reactor PLC config after importing if cancelled before deleting 2023-11-05 13:23:45 -05:00
Mikayla Fischler
32653c3b8a param type change and added validator.assert 2023-11-05 13:23:22 -05:00
Mikayla Fischler
16258a2631 rtu configurator config import 2023-11-04 15:06:29 -04:00
Mikayla Fischler
4c646249ad plc configurator cleanup 2023-11-04 14:57:17 -04:00
Mikayla Fischler
45c8a8d8a9 added peripheral connections to rtu configurator 2023-11-04 13:29:38 -04:00
Mikayla Fischler
eff3444834 added type def to ppm and return a copy of the peripherals list rather than the table itself 2023-11-04 12:56:49 -04:00
Mikayla Fischler
25f68f338c bootloader cleanup and added license to installer downloads 2023-11-04 12:51:24 -04:00
Mikayla Fischler
7ef363a3c2 fixed installer typo 2023-11-04 12:49:54 -04:00
Mikayla Fischler
3065e2bece plc configurator clear settings when loading settings and show actual current settings on view 2023-11-04 12:49:14 -04:00
Mikayla Fischler
1075d66122 graphics bugfix with disabled input fields 2023-11-04 12:48:06 -04:00
Mikayla Fischler
d477b33774 fixed reposition not repositioning frame for mouse events 2023-10-21 13:58:42 -04:00
Mikayla Fischler
7b374f8618 rtu redstone configuration 2023-10-19 23:35:18 -04:00
Mikayla Fischler
4869c00c0e added side type alias and added some validation to RSIO 2023-10-19 23:22:04 -04:00
Mikayla Fischler
ff4a5a68d9 reactor PLC configurator emercoolcolor correction 2023-10-19 23:20:41 -04:00
Mikayla Fischler
d77a527b15 added text alignment to push buttons and added keyboard events to listbox 2023-10-19 23:20:04 -04:00
Mikayla Fischler
01caca48dc listbox improvements, tabbing while staying in frame (autoscroll) 2023-10-15 17:02:48 -04:00
Mikayla Fischler
43e545b6ae fixed unfocus all 2023-10-15 16:49:03 -04:00
Mikayla Fischler
8b65956dcc #306 base RTU configurator 2023-10-15 13:26:49 -04:00
Mikayla
7b522ae120 Merge pull request #360 from MikaylaFischler/devel
2023.10.14 Release
2023-10-14 19:46:33 -04:00
Mikayla Fischler
43d134d9ad comment clarity 2023-10-14 18:49:51 -04:00
Mikayla Fischler
24c787f47d #353 fixed auto lock not restoring on reconnect 2023-10-14 17:57:50 -04:00
Mikayla Fischler
f95ac8be8c #359 drop packets with nil distances if using trusted range feature 2023-10-14 12:17:25 -04:00
Mikayla Fischler
41442012c2 #357 min length of auth key and some cleanup, added config change log 2023-10-14 12:02:25 -04:00
Mikayla Fischler
6f1195dded fixed element assertion scope on frame validations 2023-10-14 11:40:36 -04:00
Mikayla Fischler
86e8feaabc #358 fixed non-networked PLC operation 2023-10-14 10:07:56 -04:00
Mikayla Fischler
670ca78a5b #356 fixed extract assert msg 2023-10-14 00:38:13 -04:00
Mikayla Fischler
73ceed0f60 #354 another reversion 2023-10-13 23:53:15 -04:00
Mikayla Fischler
8412270772 #354 some reversions 2023-10-13 23:48:30 -04:00
Mikayla Fischler
686b47898c #354 optimizations/minification 2023-10-08 12:47:51 -04:00
Mikayla
e03eaf2982 #354 type check functions 2023-10-07 20:57:24 +00:00
Mikayla
8b1775b0af Merge pull request #352 from MikaylaFischler/devel
2023.10.04 Hotfix
2023-10-04 20:03:06 -04:00
Mikayla
8bbd04d133 Update feature_request.md 2023-10-04 17:32:43 -04:00
Mikayla
26dc6ff6d1 #350 handle RPS_DISABLE ack packet on supervisor 2023-10-04 21:28:14 +00:00
Mikayla
24d190921d #349 F_ALARM_ANY rsio output added 2023-10-04 21:26:07 +00:00
Mikayla
4fec116e93 Merge pull request #348 from MikaylaFischler/devel
2023.10.03 Release
2023-10-04 00:11:47 -04:00
Mikayla Fischler
ef6fdaa3ac don't report settings files as not used 2023-10-03 23:39:14 -04:00
Mikayla
0160d4c53a Merge pull request #347 from MikaylaFischler/145-graphical-configure-utilities
#307 Reactor PLC Configurator
2023-10-03 23:18:02 -04:00
Mikayla Fischler
d2a1951b66 refactored TEXT_ALIGN to ALIGN 2023-10-03 23:16:46 -04:00
Mikayla Fischler
5d7a0b266a handle new settings file and not deleting legacy config 2023-10-03 23:11:52 -04:00
Mikayla Fischler
ebabd99f2b #307 fixes and cleanup 2023-10-03 22:52:13 -04:00
Mikayla Fischler
b5e0183e54 luacheck fix and added keys to luacheck globals 2023-10-01 19:16:44 -04:00
Mikayla Fischler
d450c9ca3e Merge branch 'devel' into 145-graphical-configure-utilities 2023-10-01 18:43:28 -04:00
Mikayla Fischler
894229831d #307 configure bugfixes and settings file rename 2023-10-01 17:12:59 -04:00
Mikayla Fischler
bfa24b3665 #307 PLC integration with new config storage 2023-10-01 17:10:16 -04:00
Mikayla Fischler
b1446637ad checkbox default val and radio type checks for set_value 2023-10-01 17:06:24 -04:00
Mikayla Fischler
02e9c09daf #307 configurator error reporting 2023-10-01 15:30:49 -04:00
Mikayla Fischler
21d5cb3858 #307 reactor PLC configurator 2023-10-01 00:21:46 -04:00
Mikayla Fischler
c0a602385d recycle log at <512B free 2023-10-01 00:20:19 -04:00
Mikayla Fischler
4d4dd4ed39 fix to redraw and improvements to hide() 2023-10-01 00:19:16 -04:00
Mikayla Fischler
3a5d69d96f improvements to number field 2023-10-01 00:18:57 -04:00
Mikayla Fischler
d38a2dea7c #344 renderer integration with new assertion handling 2023-09-30 13:31:41 -04:00
Mikayla Fischler
560d48084a #344 coordinator renderer assert handling 2023-09-30 12:19:04 -04:00
Mikayla Fischler
625feb3fd1 #344 graphics assertion overhaul 2023-09-30 11:46:47 -04:00
Mikayla Fischler
ed4180a072 #344 element redraws and shorter assert messages 2023-09-29 19:34:10 -04:00
Mikayla Fischler
70831b49d2 #344 2D radio button array 2023-09-24 22:27:39 -04:00
Mikayla Fischler
881a120d34 #145 more work on plc configurator 2023-09-23 20:22:02 -04:00
Mikayla Fischler
8ab1307b2b #344 include holding down keys for number fields 2023-09-23 16:50:54 -04:00
Mikayla Fischler
689d474796 #344 support hiding characters in text fields 2023-09-23 16:45:33 -04:00
Mikayla Fischler
18bcfb4014 #344 nav to start/end of fields 2023-09-23 15:30:53 -04:00
Mikayla Fischler
645a5f5137 #344 added focus navigation to checkboxes and radio buttons, refactor of enable handlers 2023-09-23 14:31:37 -04:00
Mikayla Fischler
1f9743efd0 #344 don't hide cursor at end of input length 2023-09-23 13:45:00 -04:00
Mikayla Fischler
9cef6e6175 #344 added double click events to event handlers 2023-09-23 12:58:09 -04:00
Mikayla Fischler
70b03896d5 added double click to custom events 2023-09-23 12:53:05 -04:00
Mikayla Fischler
f9d0ef60b4 #344 select all and improved input fields 2023-09-23 12:49:31 -04:00
Mikayla Fischler
09ab60f79d #344 double click support 2023-09-23 00:11:45 -04:00
Mikayla Fischler
d21604ea09 #344 improvements to text fields 2023-09-23 00:09:37 -04:00
Mikayla Fischler
611b048cb4 #307 work in progress PLC configurator 2023-09-20 00:02:30 -04:00
Mikayla Fischler
a2182d9566 #344 work in progress on text field & paste events, re-show number field on val/min/max changes 2023-09-20 00:02:21 -04:00
Mikayla Fischler
7a87499aa4 #344 radio button appearance changes 2023-09-20 00:02:05 -04:00
Mikayla Fischler
b173b72f21 #344 numeric field cleanup 2023-09-20 00:01:49 -04:00
Mikayla
29cc107ea5 #329 updated comment 2023-09-19 20:40:11 +00:00
Mikayla
c24766a4db #329 disable reactor rather than trip on auto control stop 2023-09-19 20:37:15 +00:00
Mikayla Fischler
29e910ba3c #342 added element focusing feature to graphics library 2023-09-16 21:08:28 -04:00
Mikayla Fischler
1cb240b1b0 improved ignoring mouse events for hidden elements 2023-09-05 15:32:45 -04:00
Mikayla Fischler
1525ed9d60 Merge branch 'devel' into 145-graphical-configure-utilities 2023-09-03 19:38:17 -04:00
Mikayla Fischler
b1c2c4d291 #339 added sum of raw waste stat to flow monitor 2023-09-03 18:07:34 -04:00
Mikayla Fischler
5585088e3a #338 resolved diagnostic warnings 2023-09-03 17:54:39 -04:00
Mikayla
b9073153b3 Merge pull request #341 from MikaylaFischler/300-code-footprint-cleanup-tasks
300 code footprint cleanup tasks
2023-09-01 22:52:47 -04:00
Mikayla Fischler
cb554e5d16 luacheck fixes 2023-09-01 22:51:02 -04:00
Mikayla Fischler
71d8b5ba0a #300 utilizing style file for common color pairs 2023-09-01 22:24:31 -04:00
Mikayla
e4f49e9949 #145 configure bootstrap command and size reduction of startup/initenv 2023-09-01 14:23:39 +00:00
Mikayla Fischler
3afc765f72 #300 graphics alias functions 2023-08-30 21:11:57 -04:00
Mikayla Fischler
048714817e #300 replaced util.strrep with string.rep 2023-08-30 19:30:46 -04:00
Mikayla
f267a4e569 #300 comms device type cleanup 2023-08-30 21:15:42 +00:00
Mikayla
cfc6479dd5 #300 comms cleanup 2023-08-30 20:45:48 +00:00
Mikayla
70f24edb53 Merge pull request #337 from MikaylaFischler/305-detailed-info-on-multi-condition-alarms
305 detailed info on multi condition alarms
2023-08-30 09:00:16 -04:00
Mikayla Fischler
31df4a7f7e removed unnecessary parentheses 2023-08-29 22:41:56 -04:00
Mikayla Fischler
ca49cf90b4 #305 improved log message clarity 2023-08-29 22:34:30 -04:00
Mikayla
785dbe9533 #305 print out cause of multi-condition alarms 2023-08-29 13:19:50 +00:00
Mikayla Fischler
a9d1bc2b50 #336 consolidated remove and purge into uninstall, added clarification on low space handling 2023-08-28 23:19:30 -04:00
Mikayla
f7766d8cba Merge pull request #334 from MikaylaFischler/devel
2023.08.27 Release
2023-08-27 14:02:43 -04:00
Mikayla Fischler
37f8b85924 #333 always set emergency coolant state 2023-08-27 13:42:25 -04:00
Mikayla Fischler
2ed28cf74d #324 fixed alarm sounder lag 2023-08-26 19:01:22 -04:00
Mikayla Fischler
17698b7fb4 #332 fixed turbine production rate on coordinator UI 2023-08-26 12:22:47 -04:00
Mikayla Fischler
386a33ffd8 #298 consistent log tags 2023-08-26 11:54:58 -04:00
Mikayla Fischler
b7d4468cea #327 close connections on timeout 2023-08-25 21:42:35 -04:00
Mikayla Fischler
8b0a5d529e #330 close coordinator comms on error exit 2023-08-25 21:02:24 -04:00
Mikayla Fischler
d18a93f7d2 #326 added commas to dynamic tank fill 2023-08-25 20:53:28 -04:00
Mikayla Fischler
89d1087b1c updated flow monitor to say boiler when 1, boilers when 2 2023-08-25 20:49:38 -04:00
Mikayla Fischler
d9e48f5cac #325 fixed coordinator unit overview height calcs 2023-08-25 20:02:59 -04:00
Mikayla
56377ef595 Merge pull request #322 from MikaylaFischler/devel
2023.08.22 Hotfix 2
2023-08-22 21:49:32 -04:00
Mikayla Fischler
95c300e450 #321 fixed boiler flow indicators on flow monitor 2023-08-22 21:46:34 -04:00
Mikayla
2985898b7e Merge pull request #320 from MikaylaFischler/devel
2023.08.22 Hotfix
2023-08-22 20:05:53 -04:00
Mikayla Fischler
57d50e6745 #319 updated installer version 2023-08-22 19:56:47 -04:00
Mikayla Fischler
3dc1a06969 #319 fixed installer bug on fresh install 2023-08-22 19:55:34 -04:00
Mikayla Fischler
fcba935240 updated readme with new installer 2023-08-22 19:13:34 -04:00
Mikayla Fischler
9b32bb4675 deleted legacy install manifest for v1.0 installer 2023-08-22 19:06:36 -04:00
Mikayla
f59f484e7b Merge pull request #317 from MikaylaFischler/devel
2023.08.22 Release
2023-08-22 18:42:21 -04:00
Mikayla Fischler
0fe9b391d8 #313 installer self-update fix, added update command for it 2023-08-21 22:47:00 -04:00
Mikayla
97f0191875 #313 installer self update 2023-08-22 02:18:25 +00:00
Mikayla Fischler
70db8d782c fixed unit dynamic tank state indicator 2023-08-21 22:05:02 -04:00
Mikayla
2acd166c3e Merge pull request #316 from MikaylaFischler/232-waste-valve-and-flow-monitoring-display
232 Waste Valve and Flow Monitoring Display
2023-08-21 21:54:22 -04:00
Mikayla Fischler
c78f7e173a #232 cleanup, changed antimatter rate to be integer on main display 2023-08-21 21:53:31 -04:00
Mikayla Fischler
99a0b0a55a #232 documentation and refactor 2023-08-21 21:44:15 -04:00
Mikayla Fischler
6e51e70b62 #232 cleanup and fixes 2023-08-21 21:37:56 -04:00
Mikayla Fischler
fd2abad5cf changed some green/red indicators to be green/gray for contrast 2023-08-21 21:35:32 -04:00
Mikayla Fischler
b93c6b7c6e fixes per luacheck 2023-08-20 23:53:49 -04:00
Mikayla Fischler
8b3f558f68 Merge branch 'devel' into 232-waste-valve-and-flow-monitoring-display 2023-08-20 23:43:07 -04:00
Mikayla Fischler
8c5289867c #232 updated coordinator monitor disconnect/reconnect handling for changes 2023-08-20 23:28:48 -04:00
Mikayla Fischler
d179920565 #232 option to disable flow view screen for legacy setups 2023-08-20 23:23:23 -04:00
Mikayla Fischler
504ee0594f #315 switch off dynamic tank fill mode if emergency coolant is required 2023-08-20 22:56:51 -04:00
Mikayla Fischler
a92f182156 #232 fixed incorrect arrows on turbine flow view 2023-08-20 22:53:14 -04:00
Mikayla Fischler
c5d38a5584 #232 added container mode indicators for tanks 2023-08-20 17:30:34 -04:00
Mikayla Fischler
9bf07e6c3e completed work on updated pipenet 2023-08-20 17:04:14 -04:00
Mikayla Fischler
7656936982 #232 cleanup, added general stats 2023-08-20 16:52:12 -04:00
Mikayla Fischler
f477ad9426 #232 re-indexed valve IDs 2023-08-19 23:28:03 -04:00
Mikayla Fischler
59950e9d15 #232 connected valve indicators 2023-08-19 23:24:20 -04:00
Mikayla Fischler
11d86d92eb #232 bugfixes and linked up indicators to data 2023-08-19 20:06:37 -04:00
Mikayla Fischler
1275f61113 #232 refactor and fixed sv config verify 2023-08-19 13:42:07 -04:00
Mikayla Fischler
d17e2b8321 #232 completed display of flow/dynamic tank/sps, dynamically sized 2023-08-19 13:38:05 -04:00
Mikayla Fischler
ce780c3d72 added common color pairs to coordinator style 2023-08-13 00:51:37 -04:00
Mikayla Fischler
76ab4e17bf #232 WIP full flow view drawn out 2023-08-13 00:11:58 -04:00
Mikayla Fischler
ac1733c46e #314 20s grace period for coordinator render to finish to prevent timeouts 2023-08-12 15:16:37 -04:00
Mikayla
17731de61b #312 improved reactor peripheral handling 2023-08-11 14:20:13 +00:00
Mikayla Fischler
d85385c1fe #232 continued work on flow monitor, added SPS display 2023-08-10 23:31:38 -04:00
Mikayla Fischler
e0809f52a6 #232 WIP coordinator flow view 2023-08-09 23:26:06 -04:00
Mikayla Fischler
b2c55f9d4b #303 check modem message distance for nil 2023-08-02 10:13:54 -04:00
Mikayla
ba896ea163 Merge pull request #302 from MikaylaFischler/common-cleanup
Common Cleanup
2023-07-30 21:38:18 -04:00
Mikayla Fischler
1a64591256 #282 version the common directory 2023-07-30 20:46:04 -04:00
Mikayla Fischler
9ce75eb4bd #283 common cleanup, added lockbox version to crash dump, changed crash handler to pcall requires for graphics/lockbox 2023-07-30 12:24:54 -04:00
Mikayla
451f804f87 Merge pull request #301 from MikaylaFischler/rtu-speaker-system
RTU Speaker System and Pocket Diagnostics
2023-07-30 00:14:49 -04:00
Mikayla Fischler
724d13510d optimizations and cleanup for pull request 2023-07-30 00:13:26 -04:00
Mikayla Fischler
3f01ce7ec5 lowered SVS queue process time limit warning to debug level 2023-07-29 18:44:17 -04:00
Mikayla Fischler
df67795239 #290 pocket page management and alarm test tool, supervisor pocket diagnostics system 2023-07-29 18:16:59 -04:00
Mikayla Fischler
775d4dc95b #264 improvements to RTU speaker sounder 2023-07-29 17:57:51 -04:00
Mikayla Fischler
b3c7263bc4 #299 fixed mouse events passing to hidden elements 2023-07-29 00:25:20 -04:00
Mikayla Fischler
9f8732830c #264, #280 fixed sounder issues 2023-07-26 22:37:25 -04:00
Mikayla Fischler
1c87ef18a1 #297 added tone packet to valid MGMT packet types 2023-07-26 21:33:43 -04:00
Mikayla Fischler
f111b711c5 #264, #280 send tones to RTUs 2023-07-26 21:02:34 -04:00
Mikayla Fischler
92d1945bea #264 WIP RTU alarm sounders 2023-07-26 20:48:44 -04:00
Mikayla Fischler
4192ea426c #280 moved alarm sounder logic to supervisor and tone control to common 2023-07-26 20:48:11 -04:00
Mikayla
7bd8f34773 update README.md 2023-07-19 20:06:13 -04:00
Mikayla
bdbb3071b3 Merge pull request #294 from MikaylaFischler/devel
2023.07.19 Hotfix
2023-07-19 19:18:48 -04:00
Mikayla Fischler
def02a94d2 #293 fixed race condition with graphics element IDs 2023-07-19 11:27:33 -04:00
Mikayla Fischler
681bb0963e #291 RTU comms thread no longer yields every packet 2023-07-18 22:28:43 -04:00
Mikayla
8f7d7c3ead Merge pull request #288 from MikaylaFischler/devel
2023.07.17 Hotfix
2023-07-17 22:48:03 -04:00
Mikayla Fischler
c0f45cfb8b updated comments 2023-07-17 22:47:19 -04:00
Mikayla Fischler
455653074a #287 fixed coordinator not notifying supervisor of auto waste config 2023-07-17 22:09:21 -04:00
Mikayla Fischler
1202289fab #285 #286 mitigated false trips 2023-07-17 20:59:45 -04:00
Mikayla
acb7b5b4cb update README.md with new installer pastebin 2023-07-16 21:29:41 -04:00
Mikayla
9bd79dacad Merge pull request #281 from MikaylaFischler/devel
2023.07.16 Release
2023-07-16 21:25:00 -04:00
Mikayla Fischler
c544d140bf installer key handling improvements 2023-07-16 21:21:33 -04:00
Mikayla Fischler
353cb3622b improved installer any key detection 2023-07-16 21:11:27 -04:00
Mikayla Fischler
b54f15bad6 #274 bugfixes and optimizations 2023-07-16 21:07:37 -04:00
Mikayla Fischler
4d9783beca fixed installer clean bug 2023-07-16 20:58:34 -04:00
Mikayla Fischler
5529774b0e changed installer press enter to continue to any key, fixed some text colors 2023-07-16 20:53:39 -04:00
Mikayla Fischler
2a541ef3fe #274 cleanup functionality added to installer 2023-07-16 19:42:20 -04:00
Mikayla Fischler
e1b4d72ef8 updated legacy install manifest 2023-07-15 13:33:51 -04:00
Mikayla Fischler
6a0992c7a4 removed unused variable 2023-07-15 13:33:18 -04:00
Mikayla Fischler
cff7c724be #272 fixed bug with transmitting unit dynamic tank table 2023-07-15 13:31:48 -04:00
Mikayla Fischler
47bda73afe #272 basic dynamic tank data in supervisor and coordinator 2023-07-15 13:16:36 -04:00
Mikayla
8daedc109c added discord info to readme 2023-07-13 13:50:17 -04:00
Mikayla Fischler
a164c18a50 removed unused fields from dynamic tank rtu 2023-07-13 12:19:25 -04:00
Mikayla Fischler
4d663ada8d added high contrast yellow to rtu/plc/coord front panels 2023-07-12 13:38:37 -04:00
Mikayla Fischler
084a153a79 #268 fixed incorrect info print on extra wireless modem connection 2023-07-11 21:06:47 -04:00
Mikayla Fischler
4ed6ec1c63 correctly print new messages without overwrites in dmesg even if a prior message is a progress one 2023-07-11 21:01:24 -04:00
Mikayla Fischler
d3c2ba7bee update install manifest 2023-07-11 20:32:37 -04:00
Mikayla Fischler
55ff9dad4b #249 coordinator handle monitor disconnects/reconnects 2023-07-11 20:32:10 -04:00
Mikayla Fischler
0d6022f5e3 fixed always reporting failure to connect to supervisor even when inaccurate 2023-07-11 18:31:53 -04:00
Mikayla Fischler
8b136d78a8 #268 better handling of wireless modem peripherals 2023-07-11 18:22:09 -04:00
Mikayla Fischler
a5214730ef #260 added dynamic tank RTU 2023-07-11 17:27:03 -04:00
Mikayla Fischler
9f3ad3caf0 removed PLC establish packet handling when already linked 2023-07-11 16:17:24 -04:00
Mikayla
9bb2a99be5 Merge pull request #279 from MikaylaFischler/265-coordinator-front-panel
265 coordinator front panel
2023-07-11 15:37:17 -04:00
Mikayla Fischler
65ace26258 corrected comments 2023-07-11 15:36:41 -04:00
Mikayla Fischler
61d975d13f updated error messages for consistency 2023-07-11 15:15:44 -04:00
Mikayla Fischler
1d7d6e9817 update legacy install manifest 2023-07-11 13:38:21 -04:00
Mikayla Fischler
a2e0999cea combine coordinator supervisor connection event loop with main loop 2023-07-11 13:32:26 -04:00
Mikayla Fischler
1edee7f64b updated graphics comments 2023-07-09 23:42:44 -04:00
Mikayla Fischler
df61ec2c62 #265 coordinator front panel 2023-07-09 23:31:56 -04:00
Mikayla Fischler
bf7a316b04 don't start flasher if already started 2023-07-09 23:24:41 -04:00
Mikayla Fischler
96c4444184 corrected some comments 2023-07-09 23:22:24 -04:00
Mikayla Fischler
59eac62c33 #270 validate reactor PLC status packet types 2023-07-08 18:07:40 -04:00
Mikayla
ab193db153 Merge pull request #277 from MikaylaFischler/25-process-waste-control
25 process waste control
2023-07-08 17:12:23 -04:00
Mikayla Fischler
7d65bba589 fixes/cleanups for pull request 2023-07-08 17:11:51 -04:00
Mikayla Fischler
dcef5a96f0 removed unused function 2023-07-08 16:57:41 -04:00
Mikayla Fischler
ba0900ac65 #25 sna/sps integration, plutonium fallback, waste rate reporting 2023-07-08 16:57:13 -04:00
Mikayla Fischler
8f54e95519 #25 continued WIP waste control, main view updated and unit fields modified 2023-07-06 01:36:06 -04:00
Mikayla Fischler
7b9824b6f9 added checkbox graphics element 2023-07-01 19:40:33 -04:00
Mikayla Fischler
b6835fc7d1 #276 updated readme 2023-06-29 16:54:46 -04:00
Mikayla
bc5a94cd3b Update README.md 2023-06-29 12:57:25 -04:00
Mikayla
2a3d868402 Merge pull request #273 from MikaylaFischler/devel
2023.06.29 Release
2023-06-29 12:33:12 -04:00
Mikayla Fischler
b998634da1 installer fixes 2023-06-29 12:29:30 -04:00
Mikayla
5225380523 Merge pull request #271 from MikaylaFischler/51-hmac-message-authentication
HMAC Message Authentication
2023-06-27 19:09:38 -04:00
Mikayla Fischler
0e7ea7102c removed extra verbose comment in configs 2023-06-27 19:08:33 -04:00
Mikayla Fischler
8924ba4e99 cleanup and luacheck fixes 2023-06-27 19:05:51 -04:00
Mikayla Fischler
a8071db08e #51 send serialized data to properly MAC 2023-06-27 18:36:16 -04:00
Mikayla Fischler
fb3c7ded06 updated lockbox benchmark 2023-06-26 20:44:55 -04:00
Mikayla Fischler
f6b0a49904 added graphics version to crash dump 2023-06-26 14:03:36 -04:00
Mikayla Fischler
bfbbfb164b #51 include versioned lockbox in installer, reduced installer file size 2023-06-25 17:53:02 -04:00
Mikayla Fischler
57763702ff #51 init mac component from config key 2023-06-25 14:00:18 -04:00
Mikayla Fischler
f469754bb7 #51 network file cleanup 2023-06-25 13:06:03 -04:00
Mikayla Fischler
336662de62 #51 nic integration with rtu and supervisor 2023-06-25 12:59:38 -04:00
Mikayla Fischler
9073009eb0 #51 usage of nic.receive and some cleanup 2023-06-23 14:12:41 -04:00
Mikayla Fischler
ffac6996ed #51 PLC changes for new networking 2023-06-23 13:52:24 -04:00
Mikayla Fischler
da3c92b3bf Merge branch 'devel' into 51-hmac-message-authentication 2023-06-22 16:05:46 -04:00
Mikayla
712c7a8f3b #266 added health check to ppm and strengthened reliability of RTU hw state reporting 2023-06-22 19:46:17 +00:00
Mikayla
737afe586d renamed lockbox benchmark 2023-06-22 14:22:32 +00:00
Mikayla
d69796b607 lockbox benchmark cleanup 2023-06-22 14:21:00 +00:00
Mikayla
1cdf66a8c3 #51 WIP network interface controller 2023-06-21 23:04:39 +00:00
Mikayla
282c7db3eb Merge branch 'devel' into 51-hmac-message-authentication 2023-06-18 19:23:56 +00:00
Mikayla Fischler
a02529b9f7 #263 fixed bug with supervisor group map length not matching number of reactors 2023-06-18 15:19:01 -04:00
Mikayla Fischler
af38025f50 #262 don't ever abort RTU unit parsing on error, just skip 2023-06-18 14:26:38 -04:00
Mikayla Fischler
b28e4d1e95 #258 installer bugfix 2023-06-18 14:04:49 -04:00
Mikayla Fischler
75dfa3ae73 #258 luacheck fix 2023-06-18 13:16:28 -04:00
Mikayla Fischler
4a3455fa60 #258 luacheck fix 2023-06-18 13:13:34 -04:00
Mikayla Fischler
a2fa6570dc #258 installer improvement 2023-06-18 13:12:34 -04:00
Mikayla Fischler
aef8281ad6 #258 more installer fixes 2023-06-18 01:19:00 -04:00
Mikayla Fischler
d42327a20d #258 bugfixes 2023-06-18 01:09:46 -04:00
Mikayla Fischler
49db75f34d #258 installer bugfix 2023-06-18 01:04:40 -04:00
Mikayla Fischler
bc87030491 #258 installer improvements and test change to graphics version 2023-06-18 00:48:06 -04:00
Mikayla Fischler
9266d7d8e1 #258 versioned graphics component 2023-06-18 00:40:01 -04:00
Mikayla
ef5567ad46 #51 hmac verification 2023-06-11 18:26:55 +00:00
Mikayla Fischler
302f3d913f unlikely to use ldoc due to incompatibilities with vscode lua extension luadocs 2023-06-08 11:39:07 -04:00
Mikayla Fischler
650b9c1811 #244 luadoc actions fixes 2023-06-08 10:58:06 -04:00
Mikayla Fischler
543ac8c9fe updated ldoc version 2023-06-08 10:50:39 -04:00
Mikayla Fischler
7f19f76c0b update comment to force re-run 2023-06-08 10:46:35 -04:00
Mikayla
8d76c86309 fixed pages.yml format error 2023-06-08 10:42:49 -04:00
Mikayla Fischler
a4be6a6dde #244 luadoc in github actions 2023-06-08 10:41:44 -04:00
Mikayla Fischler
8b926a0978 #257 tick supervisor version to force installers to re-pull graphics 2023-06-07 21:42:21 -04:00
Mikayla Fischler
775ffc8094 added graphics to supervisor depends 2023-06-07 21:25:42 -04:00
Mikayla
13a8435f6c Merge pull request #256 from MikaylaFischler/devel
2023.06.07 Hotfix
2023-06-07 18:42:29 -04:00
Mikayla Fischler
5d6dda5619 #255 fixed rectangle element not offsetting mouse events 2023-06-07 18:38:00 -04:00
Mikayla
f8221ad0f1 update README.md with new pastebin link 2023-06-07 18:16:36 -04:00
Mikayla
193aeed6df Merge pull request #254 from MikaylaFischler/devel
2023.06.07 Release
2023-06-07 17:46:50 -04:00
Mikayla Fischler
8c87cb3e26 actions fixed maybe 2023-06-07 16:07:12 -04:00
Mikayla Fischler
1548cd706d actions test 6 2023-06-07 16:04:39 -04:00
Mikayla Fischler
996272e108 actions test 5 2023-06-07 16:01:04 -04:00
Mikayla Fischler
ef673bdf1b actions test 4 2023-06-07 15:57:07 -04:00
Mikayla Fischler
7aa236e987 actions test 3 2023-06-07 15:55:46 -04:00
Mikayla Fischler
35d857a5f4 actions testing 2 2023-06-07 15:51:54 -04:00
Mikayla Fischler
c2c87ec6c6 github actions testing 2023-06-07 15:45:37 -04:00
Mikayla Fischler
5ce54d78e1 github actions 2023-06-07 15:44:07 -04:00
Mikayla Fischler
c05a312f6c actions testing 2023-06-07 15:43:03 -04:00
Mikayla Fischler
86325d9527 more possible actions fixes 2023-06-07 15:37:48 -04:00
Mikayla Fischler
5074ca89f0 possible actions fix? 2023-06-07 15:35:25 -04:00
Mikayla Fischler
c22b048608 actions fix maybe 2023-06-07 15:28:49 -04:00
Mikayla Fischler
7ae3014e06 updated step conditions 2023-06-07 15:24:44 -04:00
Mikayla Fischler
8fa37cc9be manifest update: don't clean on checkout 2023-06-07 15:17:05 -04:00
Mikayla Fischler
2c730fbdc2 update to manifest generation to skip failed branches 2023-06-07 15:11:42 -04:00
Mikayla Fischler
5c21140025 updated manifest generation to include all data in each go 2023-06-07 15:05:36 -04:00
Mikayla Fischler
7859e5ea4c updated old install manifest 2023-06-07 14:55:56 -04:00
Mikayla
0b5ee8eabc Merge pull request #252 from MikaylaFischler/225-consolidate-network-channels
225 Consolidate Network Channels
2023-06-07 14:27:10 -04:00
Mikayla Fischler
1decd88415 last few cleanups 2023-06-07 14:22:35 -04:00
Mikayla Fischler
f1b1f0b75a updated supervisor front panel default computer ID place holders and fixed PDG establish using channel in messages 2023-06-07 14:18:13 -04:00
Mikayla Fischler
f37f2f009f comms only set nil max distance if requested max is exactly 0 2023-06-07 14:17:10 -04:00
Mikayla Fischler
15b071378c #225 removed redundant checks on remote address, added clarity to log messages 2023-06-07 12:48:43 -04:00
Mikayla Fischler
5ba06dcdaf #225 log message fixes and sv addr checks for RTU 2023-06-07 12:35:17 -04:00
Mikayla Fischler
f4e7137eb3 #225 pocket verify packets are from linked computer 2023-06-07 12:27:13 -04:00
Mikayla Fischler
cf881548d7 config file comments 2023-06-07 12:25:50 -04:00
Mikayla Fischler
0a6fd35f93 supervisor front panel computer IDs cleanup 2023-06-06 21:56:17 -04:00
Mikayla Fischler
671f8b55bc updated supervisor front panel RTT coloring limits 2023-06-06 19:49:28 -04:00
Mikayla Fischler
e16b0d237e #225 fixed svsessions __tostring for sessions, refactored s_addr to src_addr 2023-06-06 19:45:04 -04:00
Mikayla Fischler
55dab6d675 don't print brackets in util.strval if metatable __tostring is present 2023-06-06 19:41:55 -04:00
Mikayla Fischler
0f5ae9a756 #225 coordinator changes for new comms 2023-06-06 19:41:09 -04:00
Mikayla Fischler
cdff7af431 #225 pocket properly handle disconnects and address validation 2023-06-05 20:59:28 -04:00
Mikayla Fischler
c536b823e7 #225 PLC/RTUs drop incoming packets from devices other than the configured supervisor while linked 2023-06-05 19:12:43 -04:00
Mikayla Fischler
b20d42ff38 #225 added computer IDs to PLC/RTU front panels, updated supervisor front panel to use computer ID terminology 2023-06-05 18:10:53 -04:00
Mikayla Fischler
63147bfab5 #248 fixed network light not going out on PLC/RTU when disconnected 2023-06-05 17:47:43 -04:00
Mikayla Fischler
360609df1f #225 network changes for supervisor sessions 2023-06-05 17:24:00 -04:00
Mikayla Fischler
9a5fc92c86 Merge branch 'devel' into 225-consolidate-network-channels 2023-06-05 01:18:13 -04:00
Mikayla
337fca7e7c #225 work in progress comms changes 2023-06-05 05:13:22 +00:00
Mikayla Fischler
38fc7189ba #245 fixed coordinator missing pocket packets and connection timeouts 2023-06-03 18:51:59 -04:00
Mikayla Fischler
0b939be412 #231 renamed unit a_ functions to auto_ 2023-06-03 17:59:20 -04:00
Mikayla Fischler
351842c9a1 updated RTU to say STATUS instead of POWER on first LED 2023-06-03 17:44:32 -04:00
Mikayla Fischler
8d248408d4 #247 renamed tcallbackdsp to tcd and added handler to RTU 2023-06-03 17:40:57 -04:00
Mikayla
2427561dc5 Merge pull request #246 from MikaylaFischler/front-panels
Supervisor Front Panel
2023-06-03 17:32:37 -04:00
Mikayla Fischler
b4932b33b6 code cleanup 2023-06-03 17:31:06 -04:00
Mikayla Fischler
24a7275543 fixed trailing whitespace 2023-06-03 15:50:44 -04:00
Mikayla Fischler
529371a0fd #184 support supervisor running without front panel, halved heartbeat blink rate 2023-06-03 15:45:48 -04:00
Mikayla Fischler
69df5edbeb #184 RTU and pocket lists on supervisor front panel, element delete() bugfix 2023-06-03 14:33:08 -04:00
Mikayla Fischler
153a83e569 listbox improvements 2023-06-01 13:00:45 -04:00
Mikayla Fischler
ef1ec220a4 #184 initial draft of listbox element and associated supervisor front panel test example 2023-05-31 11:44:41 -04:00
Mikayla Fischler
8f2e9fe319 more manifest.yml fixes 2023-05-31 11:19:32 -04:00
Mikayla Fischler
86ad2a1069 fixed a typo in manifest.yml 2023-05-31 11:17:44 -04:00
Mikayla Fischler
494dc437a5 fixed error in manifest.yml 2023-05-31 11:16:56 -04:00
Mikayla Fischler
deec1ff1df fix shields deploy 2023-05-31 11:15:55 -04:00
Mikayla Fischler
4c35233289 #243 changed rectangle to use content window, significant simplification of offset logic, improved delete rendering 2023-05-30 20:43:33 -04:00
Mikayla Fischler
de9cb3bd3a #243 graphics core updates for content windows, redrawing, and handling of addition/removal of children 2023-05-30 19:51:10 -04:00
Mikayla Fischler
270726e276 Merge branch 'devel' into front-panels 2023-05-30 00:30:08 -04:00
Mikayla Fischler
dbd74afbe6 #242 update per luacheck 2023-05-27 23:53:20 -04:00
Mikayla Fischler
37a91986e5 #242 updated installer for github pages manifest 2023-05-27 23:50:00 -04:00
Mikayla Fischler
a892c0cf41 #242 create manifest.yml 2023-05-27 23:36:32 -04:00
Mikayla Fischler
b7d90872d5 Merge branch 'devel' into front-panels 2023-05-25 17:48:20 -04:00
Mikayla Fischler
82ab85daa5 updated install manifest hotfix 2023.05.23 2023-05-25 17:41:44 -04:00
Mikayla Fischler
f9aa75a105 graphics element hidden on creation option, changed hide/show logic to only hide/show current element 2023-05-25 17:40:16 -04:00
Mikayla Fischler
e313b77abc Merge branch 'devel' into front-panels 2023-05-23 20:25:19 -04:00
Mikayla
a14ffea6f0 Merge pull request #239 from MikaylaFischler/devel
2023.05.23 Hotfix
2023-05-23 19:54:35 -04:00
Mikayla Fischler
43a0ff86d7 #238 bugfix for push button and sidebar in bounds checks 2023-05-23 19:51:48 -04:00
Mikayla Fischler
ece7c0fe9a #184 supervisor graphics updates for new system, added PLC and CRD pages on supervisor front panel 2023-05-23 19:22:22 -04:00
Mikayla
97cee58e5a Merge pull request #236 from MikaylaFischler/devel
2023.05.22 Release
2023-05-22 10:06:18 -04:00
Mikayla Fischler
4aba79f232 Merge branch 'devel' into front-panels 2023-05-20 09:44:26 -04:00
Mikayla Fischler
b8c81e2e70 Merge branch 'graphics-rearchitect' into devel 2023-05-20 08:38:29 -04:00
Mikayla Fischler
142f2c363a #234 made debug config setting optional, defaults to false 2023-05-19 19:12:27 -04:00
Mikayla
de99169db8 Merge pull request #235 from MikaylaFischler/graphics-rearchitect
Graphics Rearchitect: Part 2
2023-05-19 18:15:11 -04:00
Mikayla Fischler
d5446f970b updated install manifest and removed early ref to listbox 2023-05-19 17:38:55 -04:00
Mikayla Fischler
792cb46ce6 resolved register simplification 2023-05-19 17:38:08 -04:00
Mikayla Fischler
86615b03ff fixed unused variable 2023-05-18 20:42:15 -04:00
Mikayla Fischler
d5fe790c86 #227 move graphics windows 2023-05-18 20:21:23 -04:00
Mikayla Fischler
beda7624f4 #233 fixed mouse enter/exit behavior via simplification 2023-05-18 10:58:42 -04:00
Mikayla Fischler
82e3fa494c #229 pocket changes for UI element register change 2023-05-14 19:13:44 -04:00
Mikayla Fischler
466902371a #229 coordinator changes for UI element register change 2023-05-14 19:13:12 -04:00
Mikayla Fischler
e763af9981 #229 PLC changes for UI element register change 2023-05-13 09:43:42 -04:00
Mikayla Fischler
b2115fd077 #229 element PSIL register/deletion, changes for RTU to use new PSIL register 2023-05-13 08:50:13 -04:00
Mikayla Fischler
36bd2c5e08 enabled debug logs on turbine modbustest 2023-05-12 13:52:42 -04:00
Mikayla Fischler
f6610489c2 #224 fix for RTU unit indexing on supervisor when virtual units were present 2023-05-11 20:54:43 -04:00
Mikayla Fischler
e159dbb850 #184 updated supervisor for new mouse events 2023-05-11 20:06:41 -04:00
Mikayla Fischler
513c72ea79 Merge branch 'devel' into front-panels 2023-05-11 20:02:42 -04:00
Mikayla Fischler
a81fd49604 updated manifest 2023-05-11 20:01:04 -04:00
Mikayla
b430a22f08 Merge pull request #230 from MikaylaFischler/graphics-rearchitect
Graphics Rearchitect Part 1: Mouse Events
2023-05-11 19:59:52 -04:00
Mikayla
a220713385 Merge branch 'devel' into graphics-rearchitect 2023-05-11 19:57:57 -04:00
Mikayla Fischler
fac9a8d104 updated install manifest 2023-05-11 19:56:45 -04:00
Mikayla Fischler
0783c4c01f #226 bugfixes and pocket mouse events 2023-05-11 19:55:02 -04:00
Mikayla Fischler
676dfc8c22 #226 mouse events in coordinator 2023-05-10 20:01:06 -04:00
Mikayla
50c0a4a3eb #222 added debug log enable to configs 2023-05-10 20:57:23 +00:00
Mikayla
032284e90d #224 skip virtual RTU units when parsing advertisements instead of aborting 2023-05-10 20:40:52 +00:00
Mikayla
3a0d677c16 #226 updated PLC/RTU front panels to use new mouse events 2023-05-10 19:21:54 +00:00
Mikayla Fischler
2c2f936232 #226 updated the other controls for new mouse events, added tabbar control 2023-05-10 11:46:06 -04:00
Mikayla Fischler
4ef1915137 #226 multi button updated for new graphics mouse events 2023-05-10 11:08:24 -04:00
Mikayla Fischler
40fa0de7a3 #226 hazard and push buttons updated for new graphics mouse events 2023-05-10 10:56:56 -04:00
Mikayla Fischler
b8a8da1ac4 #226 graphics core changes for mouse events 2023-05-09 20:29:07 -04:00
Mikayla
e26dc905f8 #226 updated mouse events WIP 2023-05-07 01:27:36 +00:00
Mikayla Fischler
c7edd8c487 updated install manifest after luacheck changes 2023-05-05 14:12:35 -04:00
Mikayla Fischler
d3249da102 removed check.yml comment about -a 2023-05-05 14:11:15 -04:00
Mikayla Fischler
0e1f23efe8 fixed luacheck comments 2023-05-05 14:09:50 -04:00
Mikayla Fischler
5a139c2dd6 possible luacheck fixes 2023-05-05 14:07:15 -04:00
Mikayla Fischler
30ba8bdccf luacheck fixes continued 2023-05-05 14:04:28 -04:00
Mikayla Fischler
b2e21cb6d9 luacheck fixes 2023-05-05 14:02:25 -04:00
Mikayla Fischler
8064b33a36 some luacheck fixes 2023-05-05 13:55:14 -04:00
Mikayla Fischler
7e33f22577 luacheck suppression attempt 2023-05-05 13:15:17 -04:00
Mikayla Fischler
464451c378 unused vararg suppression, re-enable unused args luacheck 2023-05-05 13:09:53 -04:00
Mikayla Fischler
0778a442b1 diagnostic suppression 2023-05-05 13:07:48 -04:00
Mikayla Fischler
2c7b98ba42 #184 WIP supervisor front panel 2023-05-05 13:04:13 -04:00
Mikayla Fischler
ff9a18a019 rtu log message cleanup 2023-04-29 23:49:04 -04:00
Mikayla Fischler
81005d3e2c pocket cleanup 2023-04-29 23:48:50 -04:00
Mikayla
d7e2884634 Merge pull request #221 from MikaylaFischler/devel
2023.04.22 Release
2023-04-22 11:03:47 -04:00
Mikayla Fischler
43e708aa0d #219 bugfixes with renderer exit handling 2023-04-21 23:43:28 -04:00
Mikayla
783c4936cc #213 strict sequence verification 2023-04-21 21:10:15 +00:00
Mikayla
c75f08a9f7 added python to devcontainer and recommendations 2023-04-21 18:56:32 +00:00
Mikayla
e1da8b59d3 #219 properly close out GUI on error on pocket and coordinator 2023-04-21 18:53:28 +00:00
Mikayla
706fb5ea74 updated devcontainer and workspace extension recommendations 2023-04-21 13:34:46 +00:00
Mikayla Fischler
419ca2e6ef #220 close ui on crash 2023-04-20 21:19:16 -04:00
Mikayla Fischler
4c8723eb32 #217 close log file on pocket too 2023-04-20 21:01:41 -04:00
Mikayla Fischler
5db517cedc #217 close log files on exit (including crash) 2023-04-20 21:00:10 -04:00
Mikayla Fischler
e9788abde7 #219 fixed PLC renderer crash handling 2023-04-20 20:47:14 -04:00
Mikayla
be077aa1fb Merge pull request #218 from MikaylaFischler/front-panels
#183 RTU front panel
2023-04-20 20:42:28 -04:00
Mikayla Fischler
d143015cc7 #183 RTU front panel 2023-04-20 20:40:28 -04:00
Mikayla
df45f6c984 Merge pull request #215 from MikaylaFischler/193-pocket-main-application
193 pocket main application
2023-04-19 23:01:39 -04:00
Mikayla
f6fe99a5fd Merge branch 'devel' into 193-pocket-main-application 2023-04-19 23:01:10 -04:00
Mikayla Fischler
a843c8eb79 fixes and cleanup 2023-04-19 23:00:27 -04:00
Mikayla Fischler
a614b97d02 cleanup to pass checks 2023-04-19 21:26:54 -04:00
Mikayla Fischler
eca303e289 #208 ui cleanup for indicating emergency coolant status 2023-04-19 21:21:19 -04:00
Mikayla Fischler
ccdc31ed87 fixed typo in check workflow 2023-04-19 20:40:09 -04:00
Mikayla Fischler
c49ad63d6a Merge branch 'devel' into 193-pocket-main-application 2023-04-19 20:37:19 -04:00
Mikayla Fischler
7929318096 #201 functional pocket comms with supervisor and coordinator, adjusted some UI element positioning, bugfixes with apisessions and svsessions 2023-04-19 20:35:42 -04:00
Mikayla
2371a75130 #214 log level cleanup 2023-04-19 13:30:17 +00:00
Mikayla
fee54db43e #203 removed log message on failed structure send, lowered some other log levels to debug 2023-04-18 22:01:35 +00:00
Mikayla Fischler
b48c956354 #201 coordinator apisessions for pocket access 2023-04-18 13:55:18 -04:00
Mikayla Fischler
449e393b73 #201 supervisor pocket diagnostics session 2023-04-18 13:49:59 -04:00
Mikayla Fischler
d295c2b3c3 #201 added pocket connecting screens 2023-04-18 13:47:06 -04:00
Mikayla Fischler
438ab55f4f updated lua diagnostics config 2023-04-18 13:46:00 -04:00
Mikayla
46607dd690 #208 indicate emergency coolant control on PLC front panel 2023-04-18 15:28:46 +00:00
Mikayla Fischler
33c570075c supervisor code cleanup 2023-04-17 19:48:03 -04:00
Mikayla Fischler
93776a0421 update luacheck args and copied lua extension configs to workspace 2023-04-17 15:40:30 -04:00
Mikayla
14dc814925 #201 removed redundant close handling 2023-04-17 00:22:47 +00:00
Mikayla
a7ba0e43e8 #201 pocket comms establishes 2023-04-16 23:50:16 +00:00
Mikayla Fischler
e9290540f5 #193 pocket main application core 2023-04-16 15:05:28 -04:00
Mikayla
b35bf98dec update devcontainer with extensions 2023-04-13 14:45:02 +00:00
Mikayla
59512bb0cf Create devcontainer.json 2023-04-13 10:43:03 -04:00
Mikayla
64449c6674 restore shields action to just main branch 2023-04-13 09:41:56 -04:00
Mikayla
5bcd885f53 shortened shields URLs after adjustment to action 2023-04-13 09:33:44 -04:00
Mikayla
ba70aa31dc test update of shields.yml 2023-04-13 09:29:16 -04:00
Mikayla Fischler
d9ec3d7825 Merge branch 'devel' into 193-pocket-main-application 2023-04-12 18:06:24 -04:00
Mikayla Fischler
9b9ce7eae1 finally got shields component versions working with github actions 2023-04-12 18:03:48 -04:00
Mikayla Fischler
e2a3252d8a possible fix for actions 10 2023-04-12 17:55:18 -04:00
Mikayla Fischler
c0547fe463 possible fix for actions 9 2023-04-12 17:54:18 -04:00
Mikayla Fischler
36b86a4825 possible fix for actions 8 2023-04-12 17:52:45 -04:00
Mikayla Fischler
37dd52b12b possible fix for actions 7 2023-04-12 17:50:43 -04:00
Mikayla Fischler
6b8b38b8cb possible fix for actions 6 2023-04-12 17:49:08 -04:00
Mikayla Fischler
2b23dac1fe possible fix for actions 4 2023-04-12 17:44:51 -04:00
Mikayla Fischler
76f6cca42d possible fix for actions 3 2023-04-12 17:44:00 -04:00
Mikayla Fischler
ab9e487a2d possible fix for actions 2 2023-04-12 17:41:06 -04:00
Mikayla Fischler
982fded31d possible fix for actions 2023-04-12 17:39:38 -04:00
Mikayla Fischler
a8e0538804 debugging actions 2023-04-12 17:37:16 -04:00
Mikayla Fischler
8c42a05bbd test for sheilds 2023-04-12 17:34:46 -04:00
Mikayla Fischler
60a3fc8c37 Merge branch 'main' into devel 2023-04-12 17:33:16 -04:00
Mikayla
83cc4d3067 pages fix 2023-04-12 17:25:16 -04:00
Mikayla
fb31afc89c Merge pull request #211 from MikaylaFischler/sheilds-pages
create shields.yml
2023-04-12 17:23:36 -04:00
Mikayla
36c8a9ccfa Create shields.yml 2023-04-12 17:22:44 -04:00
Mikayla Fischler
f108db9cfc alternate plan for shields 2023-04-12 17:21:39 -04:00
Mikayla Fischler
f48266e27c added subversions to readme 2023-04-12 17:09:53 -04:00
Mikayla Fischler
5c333c2a07 test for adding subversions to shields.io 2023-04-12 17:04:28 -04:00
Mikayla Fischler
df0ee7c4f7 updated shields readme elements 2023-04-12 16:07:15 -04:00
Mikayla
c987d14d8d added Luacheck GitHub action (#210)
* added shields.io elements
* #209 luacheck action
* #209 cleanup to pass luacheck
* added check statuses to readme
2023-04-12 16:02:29 -04:00
Mikayla Fischler
075a0280ac #193 WIP pocket initial app, sidebar added 2023-04-12 12:40:13 -04:00
Mikayla Fischler
4b1c982292 #209 luacheck action 2023-04-12 12:13:11 -04:00
Mikayla
e276a99cb3 added shields.io elements 2023-04-12 09:51:40 -04:00
Mikayla Fischler
3ae39b2455 #204 replaced util.strwrap implementation with cc.strings.wrap 2023-04-11 23:53:42 -04:00
Mikayla Fischler
fc9d86f23e Merge branch 'latest' 2023-04-09 18:11:20 -04:00
Mikayla Fischler
b325992a0d disabled emergency coolant example config 2023-04-09 18:10:20 -04:00
Mikayla
04d73cdcd3 Merge pull request #199 from MikaylaFischler/latest
2023.04.09 Release
2023-04-09 18:04:01 -04:00
Mikayla Fischler
0c0055d5ae disabled debug logs for release 2023-04-09 18:03:28 -04:00
Mikayla Fischler
4ef73a8580 #147 fixed bug with the fix for startup race condition with RTUs 2023-04-09 14:25:22 -04:00
Mikayla Fischler
fa88392438 someday i'll remember to gen the install manifest with the actual commit 2023-04-09 12:57:42 -04:00
Mikayla Fischler
6e95755db4 rectangle fix and RCS annunciator cleanup 2023-04-09 12:56:18 -04:00
Mikayla Fischler
5b1f304467 updated install manifest 2023-04-09 12:30:05 -04:00
Mikayla Fischler
a2ea6438b5 #190 updated high startup rate warning per wiki 2023-04-09 12:29:29 -04:00
Mikayla
c9b67f68dd Merge pull request #196 from MikaylaFischler/front-panels
PLC Front Panel
2023-04-08 22:01:09 -04:00
Mikayla Fischler
d624690b6b comment/indentation fixes 2023-04-08 22:00:51 -04:00
Mikayla Fischler
527f3446a1 Merge branch 'devel' of github.com:MikaylaFischler/cc-mek-scada into front-panels 2023-04-08 21:51:34 -04:00
Mikayla Fischler
27a697c27e #182 added scram/reset buttons to PLC front panel 2023-04-08 21:35:44 -04:00
Mikayla Fischler
6bd7dd0271 improved rectangle graphics element feature set 2023-04-08 21:35:16 -04:00
Mikayla Fischler
67872a1053 updated graphics touch events to be mouse events 2023-04-08 21:33:54 -04:00
Mikayla Fischler
4aad591d3a #182 linked up PLC front panel indicators, cleaned up panel display and added flashing to RPS trip 2023-04-08 16:49:54 -04:00
Mikayla Fischler
9bc4f0f7a6 #182 WIP work on PLC PSIL 2023-04-08 00:38:46 -04:00
Mikayla Fischler
d642f28fa9 updated manifest 2023-04-07 08:07:58 -04:00
Mikayla Fischler
ccc0aa18ff #181 independent emergency coolant valve control 2023-04-07 08:05:14 -04:00
Mikayla Fischler
6ea530635f #182 WIP PLC front panel 2023-04-06 22:10:33 -04:00
Mikayla Fischler
c2132ea7eb #147 possible fix for MODBUS failures on server startup 2023-04-06 12:52:25 -04:00
Mikayla Fischler
40b11dbfd3 change generation to use same paths on unix vs windows 2023-04-06 12:49:23 -04:00
Mikayla Fischler
6e1edce8e7 remove unicode
make python on windows happy
2023-04-06 12:48:54 -04:00
Mikayla Fischler
efef4a845f Merge branch 'main' into devel 2023-04-04 15:48:06 -04:00
Mikayla Fischler
91f72ace24 #176 generator trip display on coordinator 2023-04-03 17:18:30 -04:00
Mikayla Fischler
0f735d049e #176 generator trip detection on supervisor 2023-04-02 09:57:57 -04:00
216 changed files with 30532 additions and 10085 deletions

View File

@@ -0,0 +1,16 @@
{
"image": "mcr.microsoft.com/devcontainers/universal:2",
"features": {
},
"customizations": {
"vscode": {
"extensions": [
"sumneko.lua",
"jackmacwindows.vscode-computercraft",
"ms-python.python",
"Catppuccin.catppuccin-vsc-icons",
"melishev.feather-vscode"
]
}
}
}

1
.github/FUNDING.yml vendored Normal file
View File

@@ -0,0 +1 @@
ko_fi: mikayla_f

View File

@@ -2,7 +2,7 @@
name: Feature request name: Feature request
about: Suggest an idea for this project about: Suggest an idea for this project
title: '' title: ''
labels: enhancement labels: "enhancement,feature request"
assignees: '' assignees: ''
--- ---

29
.github/workflows/check.yml vendored Normal file
View File

@@ -0,0 +1,29 @@
name: Lua Checks
on:
workflow_dispatch:
push:
branches:
- main
- devel
pull_request:
branches:
- main
- devel
jobs:
check:
runs-on: ubuntu-latest
steps:
- name: checkout
uses: actions/checkout@v3.5.1
- name: Luacheck
uses: lunarmodules/luacheck@v1.1.0
with:
# Argument Explanations
# -i 121 = Setting a read-only global variable
# 512 = Loop can be executed at most once
# 542 = An empty if branch
# --no-max-line-length = Disable warnings for long line lengths
# --exclude-files ... = Exclude lockbox library (external) and config files
# --globals ... = Override all globals overridden in .vscode/settings.json AND 'os' since CraftOS 'os' differs from Lua's 'os'
args: . --no-max-line-length -i 121 512 542 --exclude-files ./lockbox/* --globals os _HOST bit colors fs http keys parallel periphemu peripheral read rs settings shell term textutils window

79
.github/workflows/manifest.yml vendored Normal file
View File

@@ -0,0 +1,79 @@
# Deploy installation manifests and shields versions
name: Deploy Installation Data
on:
workflow_dispatch:
push:
branches:
- main
- devel
# Sets permissions of the GITHUB_TOKEN to allow deployment to GitHub Pages
permissions:
contents: read
pages: write
id-token: write
# Allow only one concurrent deployment, skipping runs queued between the run in-progress and latest queued.
# However, do NOT cancel in-progress runs as we want to allow these production deployments to complete.
concurrency:
group: "pages"
cancel-in-progress: false
jobs:
# Single deploy job since we're just deploying
deploy:
environment:
name: github-pages
url: ${{ steps.deployment.outputs.page_url }}
runs-on: ubuntu-latest
steps:
- name: Setup Pages
uses: actions/configure-pages@v3
- name: Setup Python
uses: actions/setup-python@v3.1.3
# Generate manifest + shields files for main branch
- name: Checkout main
id: checkout-main
uses: actions/checkout@v3
with:
ref: 'main'
clean: false
- name: Create outputs folders
if: success() || failure()
shell: bash
run: mkdir deploy; mkdir deploy/manifests; mkdir deploy/manifests/main deploy/manifests/devel
- name: Generate manifest and shields for main branch
id: manifest-main
if: ${{ (success() || failure()) && steps.checkout-main.outcome == 'success' }}
run: python build/imgen.py shields
- name: Save main's manifest
if: ${{ (success() || failure()) && steps.manifest-main.outcome == 'success' }}
run: mv install_manifest.json deploy/manifests/main
# Generate manifest for devel branch
- name: Checkout devel
id: checkout-devel
if: success() || failure()
uses: actions/checkout@v3
with:
ref: 'devel'
clean: false
- name: Generate manifest for devel
id: manifest-devel
if: ${{ (success() || failure()) && steps.checkout-devel.outcome == 'success' }}
run: python build/imgen.py
- name: Save devel's manifest
if: ${{ (success() || failure()) && steps.manifest-devel.outcome == 'success' }}
run: mv install_manifest.json deploy/manifests/devel
# All artifacts ready now, upload deploy directory
- name: Upload artifacts
id: upload-artifacts
if: ${{ (success() || failure()) && (steps.manifest-main.outcome == 'success' || steps.manifest-latest.outcome == 'success' || steps.manifest-devel.outcome == 'success') }}
uses: actions/upload-pages-artifact@v1
with:
# Upload manifest JSON
path: 'deploy/'
- name: Deploy to GitHub Pages
if: ${{ (success() || failure()) && steps.upload-artifacts.outcome == 'success' }}
id: deployment
uses: actions/deploy-pages@v2

4
.gitignore vendored
View File

@@ -1,2 +1,2 @@
_notes/ _*/
program.sh /*program.sh

7
.vscode/extensions.json vendored Normal file
View File

@@ -0,0 +1,7 @@
{
"recommendations": [
"sumneko.lua",
"jackmacwindows.vscode-computercraft",
"ms-python.python"
]
}

40
.vscode/settings.json vendored
View File

@@ -1,23 +1,31 @@
{ {
"Lua.diagnostics.globals": [ "Lua.diagnostics.globals": [
"term",
"fs",
"peripheral",
"rs",
"bit",
"parallel",
"colors",
"textutils",
"shell",
"settings",
"window",
"read",
"periphemu",
"mekanismEnergyHelper",
"_HOST", "_HOST",
"http" "bit",
"colors",
"fs",
"http",
"keys",
"parallel",
"periphemu",
"peripheral",
"read",
"rs",
"settings",
"shell",
"term",
"textutils",
"window"
], ],
"Lua.diagnostics.severity": {
"unused-local": "Information",
"unused-vararg": "Information",
"unused-function": "Warning",
"unused-label": "Information"
},
"Lua.hint.setType": true,
"Lua.diagnostics.disable": [ "Lua.diagnostics.disable": [
"duplicate-set-field" "duplicate-set-field",
"inject-field"
] ]
} }

View File

@@ -1,6 +1,6 @@
MIT License MIT License
Copyright © 2022 - 2023 Mikayla Fischler Copyright 2022 - 2024 Mikayla Fischler
Permission is hereby granted, free of charge, to any person obtaining a copy Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal of this software and associated documentation files (the "Software"), to deal

View File

@@ -1,22 +1,57 @@
# cc-mek-scada # cc-mek-scada
Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fission reactors with a GUI, automatic safety features, waste processing control, and more! Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fission reactors with a GUI, automatic safety features, waste processing control, and more!
![GitHub](https://img.shields.io/github/license/MikaylaFischler/cc-mek-scada)
![GitHub release (latest by date including pre-releases)](https://img.shields.io/github/v/release/MikaylaFischler/cc-mek-scada?include_prereleases)
![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=main&label=main)
![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=devel&label=devel)
### Join [the Discord](https://discord.gg/R9NSCkhcwt)!
![Discord](https://img.shields.io/discord/1129075839288496259?logo=Discord&logoColor=white&label=discord)
## Released Component Versions
![Installer](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Finstaller.json)
![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcommon.json)
![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
![Graphics](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fgraphics.json)
![Lockbox](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Flockbox.json)
![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
![RTU](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Frtu.json)
![Supervisor](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fsupervisor.json)
![Coordinator](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcoordinator.json)
![Pocket](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fpocket.json)
## Requirements
Mod Requirements: Mod Requirements:
- CC: Tweaked - CC: Tweaked
- Mekanism v10.1+ - Mekanism v10.1+
Mod Recommendations: Mod Recommendations:
- Advanced Peripherals (adds the capability to detect environmental radiation levels) - Advanced Peripherals (adds the capability to detect environmental radiation levels)
- Immersive Engineering (provides bundled redstone, though any mod containing bundled redstone will do)
v10.1+ is required due the complete support of CC:Tweaked added in Mekanism v10.1 v10.1+ is required due to the complete support of CC:Tweaked added in Mekanism v10.1
There was also an apparent bug with boilers disconnecting and reconnecting when active in my test world on 10.0.24, so it may not even have been an option to fully implement this with support for 10.0.
## Installation ## Installation
You can install this on a ComputerCraft computer using either: You can install this on a ComputerCraft computer using either:
* `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua` * `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua`
* `pastebin get iUMjgW0C ccmsi.lua` * `pastebin get sqUN6VUb ccmsi.lua`
* Off-line (when HTTP is disabled) installation via [release bundles](https://github.com/MikaylaFischler/cc-mek-scada/wiki/Alternative-Installation-Strategies#release-bundles)
## Contributing
Please reach out to me via Discord or email (or GitHub in some way) if you are thinking of making any contributions at this time. I started this project as a challenge for myself and have been enjoying having something I can work on in my own way.
Once this is out of beta I will be more open to contributions, but for now I am hoping to keep them to a minimum as the remaining challenges are ones I am looking forward to solving.
## [SCADA](https://en.wikipedia.org/wiki/SCADA) ## [SCADA](https://en.wikipedia.org/wiki/SCADA)
> Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery. > Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery.
@@ -61,14 +96,8 @@ A vaguely-modbus [modbus](https://en.wikipedia.org/wiki/Modbus) communication pr
- Input Registers: Multi-Byte Read-Only (analog inputs) - Input Registers: Multi-Byte Read-Only (analog inputs)
- Holding Registers: Multi-Byte Read/Write (analog I/O) - Holding Registers: Multi-Byte Read/Write (analog I/O)
### Security and Encryption ### Security
TBD, I am planning on AES symmetric encryption for security + HMAC to prevent replay attacks. This will be done utilizing this codebase: https://github.com/somesocks/lua-lockbox. HMAC message authentication is available as a configuration option to prevent replay attacks and generally prevent control or false data reporting within a system's network. This is done utilizing the [lua-lockbox](https://github.com/somesocks/lua-lockbox) project.
This is somewhat important here as otherwise anyone can just control your setup, which is undeseriable. Unlike normal Minecraft PVP chaos, it would be very difficult to identify who is messing with your system, as with an Ender Modem they can do it from effectively anywhere and the server operators would have to check every computer's filesystem to find suspicious code. The other, simpler security feature is to enforce a maximum authorized transmission range, which is also a configurable feature on each device.
The other security mitigation for commanding (no effect on monitoring) is to enforce a maximum authorized transmission range, which has been added as a configurable feature.
## Known Issues
None yet since the switch to requiring 10.1+!

118
build/_offline.lua Normal file
View File

@@ -0,0 +1,118 @@
---@diagnostic disable: undefined-global
-- luacheck: push ignore install_manifest ccmsi_offline app_files dep_files lgray green white
local b64_lookup = {
['A'] = 0, ['B'] = 1, ['C'] = 2, ['D'] = 3, ['E'] = 4, ['F'] = 5, ['G'] = 6, ['H'] = 7, ['I'] = 8, ['J'] = 9, ['K'] = 10, ['L'] = 11, ['M'] = 12, ['N'] = 13, ['O'] = 14, ['P'] = 15, ['Q'] = 16, ['R'] = 17, ['S'] = 18, ['T'] = 19, ['U'] = 20, ['V'] = 21, ['W'] = 22, ['X'] = 23, ['Y'] = 24, ['Z'] = 25,
['a'] = 26, ['b'] = 27, ['c'] = 28, ['d'] = 29, ['e'] = 30, ['f'] = 31, ['g'] = 32, ['h'] = 33, ['i'] = 34, ['j'] = 35, ['k'] = 36, ['l'] = 37, ['m'] = 38, ['n'] = 39, ['o'] = 40, ['p'] = 41, ['q'] = 42, ['r'] = 43, ['s'] = 44, ['t'] = 45, ['u'] = 46, ['v'] = 47, ['w'] = 48, ['x'] = 49, ['y'] = 50, ['z'] = 51,
['0'] = 52, ['1'] = 53, ['2'] = 54, ['3'] = 55, ['4'] = 56, ['5'] = 57, ['6'] = 58, ['7'] = 59, ['8'] = 60, ['9'] = 61, ['+'] = 62, ['/'] = 63
}
local BYTE = 0xFF
local CHAR = string.char
local BOR = bit.bor ---@type function
local BAND = bit.band ---@type function
local LSHFT = bit.blshift ---@type function
local RSHFT = bit.blogic_rshift ---@type function
-- decode a base64 string
---@param input string
local function b64_decode(input)
---@diagnostic disable-next-line: undefined-field
local t_start = os.epoch("local")
local decoded = {}
local c_idx, idx = 1, 1
for _ = 1, input:len() / 4 do
local block = input:sub(idx, idx + 4)
local word = 0x0
-- build the 24-bit sequence from the 4 characters
for i = 1, 4 do
local num = b64_lookup[block:sub(i, i)]
if num then
word = BOR(word, LSHFT(b64_lookup[block:sub(i, i)], (4 - i) * 6))
end
end
-- decode the 24-bit sequence as 8 bytes
for i = 1, 3 do
local char = BAND(BYTE, RSHFT(word, (3 - i) * 8))
if char ~= 0 then
decoded[c_idx] = CHAR(char)
c_idx = c_idx + 1
end
end
idx = idx + 4
end
---@diagnostic disable-next-line: undefined-field
local elapsed = (os.epoch("local") - t_start)
local decoded_str = table.concat(decoded)
return decoded_str, elapsed
end
-- write files recursively from base64 encodings in a table
---@param files table
---@param path string
local function write_files(files, path)
fs.makeDir(path)
for k, v in pairs(files) do
if type(v) == "table" then
if k == "system" then
-- write system files to root
write_files(v, "/")
else
-- descend into directories
write_files(v, path .. "/" .. k .. "/")
end
---@diagnostic disable-next-line: undefined-field
os.sleep(0.05)
else
local handle = fs.open(path .. k, "w")
local text, time = b64_decode(v)
print("decoded '" .. k .. "' in " .. time .. "ms")
handle.write(text)
handle.close()
end
end
end
-- write installation manifiest and offline install manager
local function write_install()
local handle = fs.open("install_manifest.json", "w")
handle.write(b64_decode(install_manifest))
handle.close()
handle = fs.open("ccmsim.lua", "w")
handle.write(b64_decode(ccmsi_offline))
handle.close()
end
lgray()
-- write both app and dependency files
write_files(app_files, "/")
write_files(dep_files, "/")
-- write an install manifest and the offline installer
write_install()
green()
print("Done!")
white()
print("All files have been installed. The app can be started with 'startup' and configured with 'configure'.")
lgray()
print("Hint: You can use 'ccmsim' to manage your off-line installation.")
white()
--luacheck: pop

214
build/bundle.py Normal file
View File

@@ -0,0 +1,214 @@
import base64
import json
import os
import subprocess
import sys
path_prefix = "./_minified/"
# get git build info
build = subprocess.check_output(["git", "describe", "--tags"]).strip().decode('UTF-8')
# list files in a directory
def list_files(path):
list = []
for (root, dirs, files) in os.walk(path):
for f in files:
list.append((root[2:] + "/" + f).replace('\\','/'))
return list
# recursively encode files with base64
def encode_recursive(path):
list = {}
for item in os.listdir(path):
item_path = path + '/' + item
if os.path.isfile(item_path):
handle = open(item_path, 'r')
list[item] = base64.b64encode(bytes(handle.read(), 'UTF-8')).decode('ASCII')
handle.close()
else:
list[item] = encode_recursive(item_path)
return list
# encode listed files with base64
def encode_files(files):
list = {}
for item in files:
item_path = path_prefix + './' + item
handle = open(item_path, 'r')
list[item] = base64.b64encode(bytes(handle.read(), 'UTF-8')).decode('ASCII')
handle.close()
return list
# get the version of an application at the provided path
def get_version(path, is_lib = False):
ver = ""
string = ".version = \""
if not is_lib:
string = "_VERSION = \""
f = open(path, "r")
for line in f:
pos = line.find(string)
if pos >= 0:
ver = line[(pos + len(string)):(len(line) - 2)]
break
f.close()
return ver
# file manifest (reflects imgen.py)
manifest = {
"common_versions" : {
"bootloader" : get_version("./startup.lua"),
"common" : get_version("./scada-common/util.lua", True),
"comms" : get_version("./scada-common/comms.lua", True),
"graphics" : get_version("./graphics/core.lua", True),
"lockbox" : get_version("./lockbox/init.lua", True),
},
"app_versions" : {
"reactor-plc" : get_version("./reactor-plc/startup.lua"),
"rtu" : get_version("./rtu/startup.lua"),
"supervisor" : get_version("./supervisor/startup.lua"),
"coordinator" : get_version("./coordinator/startup.lua"),
"pocket" : get_version("./pocket/startup.lua")
},
"files" : {
# common files
"system" : encode_files([ "initenv.lua", "startup.lua", "configure.lua", "LICENSE" ]),
"scada-common" : encode_recursive(path_prefix + "./scada-common"),
"graphics" : encode_recursive(path_prefix + "./graphics"),
"lockbox" : encode_recursive(path_prefix + "./lockbox"),
# platform files
"reactor-plc" : encode_recursive(path_prefix + "./reactor-plc"),
"rtu" : encode_recursive(path_prefix + "./rtu"),
"supervisor" : encode_recursive(path_prefix + "./supervisor"),
"coordinator" : encode_recursive(path_prefix + "./coordinator"),
"pocket" : encode_recursive(path_prefix + "./pocket"),
},
"install_files" : {
# common files
"system" : [ "initenv.lua", "startup.lua", "configure.lua", "LICENSE" ],
"scada-common" : list_files("./scada-common"),
"graphics" : list_files("./graphics"),
"lockbox" : list_files("./lockbox"),
# platform files
"reactor-plc" : list_files("./reactor-plc"),
"rtu" : list_files("./rtu"),
"supervisor" : list_files("./supervisor"),
"coordinator" : list_files("./coordinator"),
"pocket" : list_files("./pocket"),
},
"depends" : [ "system", "scada-common", "graphics", "lockbox" ]
}
# write the application installation items as Lua tables
def write_items(body, items, indent):
indent_str = " " * indent
for key, value in items.items():
if isinstance(value, str):
body = body + f"{indent_str}['{key}'] = \"{value}\",\n"
else:
body = body + f"{indent_str}['{key}'] = {{\n"
body = write_items(body, value, indent + 4)
body = body + f"{indent_str}}},\n"
return body
# create output directory
if not os.path.exists("./BUNDLE"):
os.makedirs("./BUNDLE")
# get offline installer
ccmsim_file = open("./build/ccmsim.lua", "r")
ccmsim_script = ccmsim_file.read()
ccmsim_file.close()
# create dependency bundled file
dep_file = "common_" + build + ".lua"
f_d = open("./BUNDLE/" + dep_file, "w")
body_b = "local dep_files = {\n"
for depend in manifest["depends"]:
body_b = body_b + write_items("", { f"{depend}": manifest["files"][depend] }, 4)
body_b = body_b + "}\n"
body_b = body_b + f"""
if select("#", ...) == 0 then
term.setTextColor(colors.red)
print("You must run the other file you should have uploaded (it has the app in its name).")
term.setTextColor(colors.white)
end
return dep_files
"""
f_d.write(body_b)
f_d.close()
# application bundled files
for app in [ "reactor-plc", "rtu", "supervisor", "coordinator", "pocket" ]:
app_file = app + "_" + build + ".lua"
f_script = open("./build/_offline.lua", "r")
script = f_script.read()
f_script.close()
f_a = open("./BUNDLE/" + app_file, "w")
body_a = "local app_files = {\n"
body_a = body_a + write_items("", { f"{app}": manifest["files"][app] }, 4) + "}\n"
versions = manifest["common_versions"].copy()
versions[app] = manifest["app_versions"][app]
depends = manifest["depends"].copy()
depends.append(app)
install_manifest = json.dumps({ "versions" : versions, "files" : manifest["install_files"], "depends" : depends })
body_a = body_a + f"""
-- install manifest JSON and offline installer
local install_manifest = "{base64.b64encode(bytes(install_manifest, 'UTF-8')).decode('ASCII')}"
local ccmsi_offline = "{base64.b64encode(bytes(ccmsim_script, 'UTF-8')).decode('ASCII')}"
local function red() term.setTextColor(colors.red) end
local function green() term.setTextColor(colors.green) end
local function white() term.setTextColor(colors.white) end
local function lgray() term.setTextColor(colors.lightGray) end
if not fs.exists("{dep_file}") then
red()
print("Missing '{dep_file}'! Please upload it, then run this file again.")
white()
return
end
-- rename the dependency file
fs.move("{dep_file}", "install_depends.lua")
-- load the other file
local dep_files = require("install_depends")
-- delete the uploaded files to free up space to actually install
fs.delete("{app_file}")
fs.delete("install_depends.lua")
-- get started installing
{script}"""
f_a.write(body_a)
f_a.close()

237
build/ccmsim.lua Normal file
View File

@@ -0,0 +1,237 @@
local function println(message) print(tostring(message)) end
local function print(message) term.write(tostring(message)) end
local opts = { ... }
local mode, app
local function red() term.setTextColor(colors.red) end
local function orange() term.setTextColor(colors.orange) end
local function yellow() term.setTextColor(colors.yellow) end
local function green() term.setTextColor(colors.green) end
local function blue() term.setTextColor(colors.blue) end
local function white() term.setTextColor(colors.white) end
local function lgray() term.setTextColor(colors.lightGray) end
-- get command line option in list
local function get_opt(opt, options)
for _, v in pairs(options) do if opt == v then return v end end
return nil
end
-- wait for any key to be pressed
---@diagnostic disable-next-line: undefined-field
local function any_key() os.pullEvent("key_up") end
-- ask the user yes or no
local function ask_y_n(question, default)
print(question)
if default == true then print(" (Y/n)? ") else print(" (y/N)? ") end
local response = read();any_key()
if response == "" then return default
elseif response == "Y" or response == "y" then return true
elseif response == "N" or response == "n" then return false
else return nil end
end
-- read the local manifest file
local function read_local_manifest()
local local_ok = false
local local_manifest = {}
local imfile = fs.open("install_manifest.json", "r")
if imfile ~= nil then
local_ok, local_manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
imfile.close()
end
return local_ok, local_manifest
end
-- recursively build a tree out of the file manifest
local function gen_tree(manifest, log)
local function _tree_add(tree, split)
if #split > 1 then
local name = table.remove(split, 1)
if tree[name] == nil then tree[name] = {} end
table.insert(tree[name], _tree_add(tree[name], split))
else return split[1] end
return nil
end
local list, tree = { log }, {}
-- make a list of each and every file
for _, files in pairs(manifest.files) do for i = 1, #files do table.insert(list, files[i]) end end
for i = 1, #list do
local split = {}
---@diagnostic disable-next-line: discard-returns
string.gsub(list[i], "([^/]+)", function(c) split[#split + 1] = c end)
if #split == 1 then table.insert(tree, list[i])
else table.insert(tree, _tree_add(tree, split)) end
end
return tree
end
local function _in_array(val, array)
for _, v in pairs(array) do if v == val then return true end end
return false
end
local function _clean_dir(dir, tree)
if tree == nil then tree = {} end
local ls = fs.list(dir)
for _, val in pairs(ls) do
local path = dir.."/"..val
if fs.isDir(path) then
_clean_dir(path, tree[val])
if #fs.list(path) == 0 then fs.delete(path);println("deleted "..path) end
elseif (not _in_array(val, tree)) and (val ~= "config.lua" ) then
fs.delete(path)
println("deleted "..path)
end
end
end
-- go through app/common directories to delete unused files
local function clean(manifest)
local log = nil
if fs.exists(app..".settings") and settings.load(app..".settings") then
log = settings.get("LogPath")
if log:sub(1, 1) == "/" then log = log:sub(2) end
end
local tree = gen_tree(manifest, log)
table.insert(tree, "install_manifest.json")
table.insert(tree, "ccmsim.lua")
local ls = fs.list("/")
for _, val in pairs(ls) do
if fs.isDriveRoot(val) then
yellow();println("skipped mount '"..val.."'")
elseif fs.isDir(val) then
if tree[val] ~= nil then lgray();_clean_dir("/"..val, tree[val])
else white(); if ask_y_n("delete the unused directory '"..val.."'") then lgray();_clean_dir("/"..val) end end
if #fs.list(val) == 0 then fs.delete(val);lgray();println("deleted empty directory '"..val.."'") end
elseif not _in_array(val, tree) and (string.find(val, ".settings") == nil) then
white();if ask_y_n("delete the unused file '"..val.."'") then fs.delete(val);lgray();println("deleted "..val) end
end
end
white()
end
-- get and validate command line options
println("-- CC Mekanism SCADA Install Manager (Off-Line) --")
if #opts == 0 or opts[1] == "help" then
println("usage: ccmsim <mode>")
println("<mode>")
lgray()
println(" check - check your installed versions")
println(" update-rm - delete everything except the config,")
println(" so that you can upload files for a")
println(" new two-file off-line update")
println(" uninstall - delete all app files and config")
return
else
mode = get_opt(opts[1], { "check", "update-rm", "uninstall" })
if mode == nil then
red();println("Unrecognized mode.");white()
return
end
end
-- run selected mode
if mode == "check" then
local local_ok, manifest = read_local_manifest()
if not local_ok then
yellow();println("failed to load local installation information");white()
end
-- list all versions
for key, value in pairs(manifest.versions) do
term.setTextColor(colors.purple)
print(string.format("%-14s", "["..key.."]"))
blue();println(value);white()
end
elseif mode == "update-rm" or mode == "uninstall" then
local ok, manifest = read_local_manifest()
if not ok then
red();println("Error parsing local installation manifest.");white()
return
end
app = manifest.depends[#manifest.depends]
if mode == "uninstall" then
orange();println("Uninstalling all app files...")
else
orange();println("Deleting all app files except for configuration...")
end
-- ask for confirmation
if not ask_y_n("Continue", false) then return end
-- delete unused files first
clean(manifest)
local file_list = manifest.files
local dependencies = manifest.depends
-- delete all installed files
lgray()
for _, dependency in pairs(dependencies) do
local files = file_list[dependency]
for _, file in pairs(files) do
if fs.exists(file) then fs.delete(file);println("deleted "..file) end
end
local folder = files[1]
while true do
local dir = fs.getDir(folder)
if dir == "" or dir == ".." then break else folder = dir end
end
if fs.isDir(folder) then
fs.delete(folder)
println("deleted directory "..folder)
end
end
-- delete log file
local log_deleted = false
local settings_file = app..".settings"
if fs.exists(settings_file) and settings.load(settings_file) then
local log = settings.get("LogPath")
if log ~= nil then
log_deleted = true
if fs.exists(log) then
fs.delete(log)
println("deleted log file "..log)
end
end
end
if not log_deleted then
red();println("Failed to delete log file (it may not exist).");lgray()
end
if mode == "uninstall" then
if fs.exists(settings_file) then
fs.delete(settings_file);println("deleted "..settings_file)
end
fs.delete("install_manifest.json")
println("deleted install_manifest.json")
fs.delete("ccmsim.lua")
println("deleted ccmsim.lua")
end
green();println("Done!")
end
white()

View File

@@ -1,5 +1,6 @@
import json import json
import os import os
import sys
# list files in a directory # list files in a directory
def list_files(path): def list_files(path):
@@ -7,7 +8,7 @@ def list_files(path):
for (root, dirs, files) in os.walk(path): for (root, dirs, files) in os.walk(path):
for f in files: for f in files:
list.append(root[2:] + "/" + f) list.append((root[2:] + "/" + f).replace('\\','/'))
return list return list
@@ -22,11 +23,11 @@ def dir_size(path):
return total return total
# get the version of an application at the provided path # get the version of an application at the provided path
def get_version(path, is_comms = False): def get_version(path, is_lib = False):
ver = "" ver = ""
string = "comms.version = \"" string = ".version = \""
if not is_comms: if not is_lib:
string = "_VERSION = \"" string = "_VERSION = \""
f = open(path, "r") f = open(path, "r")
@@ -47,7 +48,10 @@ def make_manifest(size):
"versions" : { "versions" : {
"installer" : get_version("./ccmsi.lua"), "installer" : get_version("./ccmsi.lua"),
"bootloader" : get_version("./startup.lua"), "bootloader" : get_version("./startup.lua"),
"common" : get_version("./scada-common/util.lua", True),
"comms" : get_version("./scada-common/comms.lua", True), "comms" : get_version("./scada-common/comms.lua", True),
"graphics" : get_version("./graphics/core.lua", True),
"lockbox" : get_version("./lockbox/init.lua", True),
"reactor-plc" : get_version("./reactor-plc/startup.lua"), "reactor-plc" : get_version("./reactor-plc/startup.lua"),
"rtu" : get_version("./rtu/startup.lua"), "rtu" : get_version("./rtu/startup.lua"),
"supervisor" : get_version("./supervisor/startup.lua"), "supervisor" : get_version("./supervisor/startup.lua"),
@@ -56,7 +60,7 @@ def make_manifest(size):
}, },
"files" : { "files" : {
# common files # common files
"system" : [ "initenv.lua", "startup.lua" ], "system" : [ "initenv.lua", "startup.lua", "configure.lua", "LICENSE" ],
"common" : list_files("./scada-common"), "common" : list_files("./scada-common"),
"graphics" : list_files("./graphics"), "graphics" : list_files("./graphics"),
"lockbox" : list_files("./lockbox"), "lockbox" : list_files("./lockbox"),
@@ -68,17 +72,17 @@ def make_manifest(size):
"pocket" : list_files("./pocket"), "pocket" : list_files("./pocket"),
}, },
"depends" : { "depends" : {
"reactor-plc" : [ "system", "common" ], "reactor-plc" : [ "system", "common", "graphics", "lockbox" ],
"rtu" : [ "system", "common" ], "rtu" : [ "system", "common", "graphics", "lockbox" ],
"supervisor" : [ "system", "common" ], "supervisor" : [ "system", "common", "graphics", "lockbox" ],
"coordinator" : [ "system", "common", "graphics" ], "coordinator" : [ "system", "common", "graphics", "lockbox" ],
"pocket" : [ "system", "common", "graphics" ] "pocket" : [ "system", "common", "graphics", "lockbox" ]
}, },
"sizes" : { "sizes" : {
# manifest file estimate # manifest file estimate
"manifest" : size, "manifest" : size,
# common files # common files
"system" : os.path.getsize("initenv.lua") + os.path.getsize("startup.lua"), "system" : os.path.getsize("initenv.lua") + os.path.getsize("startup.lua") + os.path.getsize("configure.lua"),
"common" : dir_size("./scada-common"), "common" : dir_size("./scada-common"),
"graphics" : dir_size("./graphics"), "graphics" : dir_size("./graphics"),
"lockbox" : dir_size("./lockbox"), "lockbox" : dir_size("./lockbox"),
@@ -100,7 +104,30 @@ f.close()
manifest_size = os.path.getsize("install_manifest.json") manifest_size = os.path.getsize("install_manifest.json")
final_manifest = make_manifest(manifest_size)
# calculate file size then regenerate with embedded size # calculate file size then regenerate with embedded size
f = open("install_manifest.json", "w") f = open("install_manifest.json", "w")
json.dump(make_manifest(manifest_size), f) json.dump(final_manifest, f)
f.close() f.close()
if len(sys.argv) > 1 and sys.argv[1] == "shields":
# write all the JSON files for shields.io
for key, version in final_manifest["versions"].items():
f = open("./deploy/" + key + ".json", "w")
if version.find("alpha") >= 0:
color = "yellow"
elif version.find("beta") >= 0:
color = "orange"
else:
color = "blue"
json.dump({
"schemaVersion": 1,
"label": key,
"message": "" + version,
"color": color
}, f)
f.close()

14
build/package.sh Executable file
View File

@@ -0,0 +1,14 @@
#!/bin/bash
# Create zips to attach to GitHub releases.
# These can be extracted onto a computer and will include all files CCMSI would otherwise install.
tag=$(git describe --tags)
apps=(coordinator pocket reactor-plc rtu supervisor)
for app in "${apps[@]}" do
mkdir ${tag}_${app}
cp -R $app scada-common graphics lockbox configure.lua initenv.lua startup.lua LICENSE ${tag}_${app}
zip -r ${tag}_${app}.zip ${tag}_${app}
rm -R ${tag}_${app}
done

80
build/safemin.py Normal file
View File

@@ -0,0 +1,80 @@
import os
import re
# minify files in a directory
def min_files(path):
start_sum, end_sum = 0, 0
for (root, _, files) in os.walk(path):
os.makedirs('_minified/' + root, exist_ok=True)
for f in files:
start, end = minify(root + "/" + f)
start_sum = start_sum + start
end_sum = end_sum + end
delta = start_sum - end_sum
print(f"> done with '{path}': shrunk from {start_sum} bytes to {end_sum} bytes (saved {delta} bytes, or {(100*delta/start_sum):.2f}%)")
return list
# minify a file
def minify(path: str):
size_start = os.stat(path).st_size
f = open(path, "r")
contents = f.read()
f.close()
if re.search(r'--+\[+', contents) != None:
# absolutely not dealing with lua multiline comments
# - there are more important things to do
# - this minification is intended to be 100% safe, so working with multiline comments is asking for trouble
# - the project doesn't use them as of writing this (except in test/), and it might as well stay that way
raise Exception(f"no multiline comments allowed! (offending file: {path})")
if re.search(r'\\$', contents, flags=re.MULTILINE) != None:
# '\' allows for multiline strings, which would require reverting to processing syntax line by line to support them
raise Exception(f"no escaping newlines! (offending file: {path})")
# drop the comments, unless the line has quotes, because quotes are scary
# (quotes are scary since we could actually be inside a string: "-- ..." shouldn't get deleted)
# -> whitespace before '--' and anything after that, which includes '---' comments
minified = re.sub(r'\s*--+(?!.*[\'"]).*', '', contents)
# drop leading whitespace on each line
minified = re.sub(r'^ +', '', minified, flags=re.MULTILINE)
# drop blank lines
while minified != re.sub(r'\n\n', '\n', minified):
minified = re.sub(r'\n\n', '\n', minified)
# write the minified file
f_min = open(f"_minified/{path}", "w")
f_min.write(minified)
f_min.close()
size_end = os.stat(f"_minified/{path}").st_size
print(f">> shrunk '{path}' from {size_start} bytes to {size_end} bytes (saved {size_start-size_end} bytes)")
return size_start, size_end
# minify applications and libraries
dirs = [ 'scada-common', 'graphics', 'lockbox', 'reactor-plc', 'rtu', 'supervisor', 'coordinator', 'pocket' ]
for _, d in enumerate(dirs):
min_files(d)
# minify root files
minify("startup.lua")
minify("initenv.lua")
minify("configure.lua")
# copy in license for build usage
lic1 = open("LICENSE", "r")
lic2 = open("_minified/LICENSE", "w")
lic2.write(lic1.read())
lic1.close()
lic2.close()

966
ccmsi.lua

File diff suppressed because it is too large Load Diff

11
configure.lua Normal file
View File

@@ -0,0 +1,11 @@
print("CONFIGURE> SCANNING FOR CONFIGURATOR...")
if fs.exists("reactor-plc/configure.lua") then require("reactor-plc.configure").configure()
elseif fs.exists("rtu/configure.lua") then require("rtu.configure").configure()
elseif fs.exists("supervisor/configure.lua") then require("supervisor.configure").configure()
elseif fs.exists("coordinator/configure.lua") then require("coordinator.configure").configure()
elseif fs.exists("pocket/configure.lua") then require("pocket.configure").configure()
else
print("CONFIGURE> NO CONFIGURATOR FOUND")
print("CONFIGURE> EXIT")
end

View File

@@ -1,20 +0,0 @@
local apisessions = {}
---@param packet capi_frame
function apisessions.handle_packet(packet)
end
-- attempt to identify which session's watchdog timer fired
---@param timer_event number
function apisessions.check_all_watchdogs(timer_event)
end
-- delete all closed sessions
function apisessions.free_all_closed()
end
-- close all open connections
function apisessions.close_all()
end
return apisessions

View File

@@ -1,31 +0,0 @@
local config = {}
-- port of the SCADA supervisor
config.SCADA_SV_PORT = 16100
-- port to listen to incoming packets from supervisor
config.SCADA_SV_LISTEN = 16101
-- listen port for SCADA coordinator API access
config.SCADA_API_LISTEN = 16200
-- max trusted modem message distance (0 to disable check)
config.TRUSTED_RANGE = 0
-- time in seconds (>= 2) before assuming a remote device is no longer active
config.COMMS_TIMEOUT = 5
-- expected number of reactor units, used only to require that number of unit monitors
config.NUM_UNITS = 4
-- alarm sounder volume (0.0 to 3.0, 1.0 being standard max volume, this is the option given to to speaker.play())
-- note: alarm sine waves are at half saturation, so that multiple will be required to reach full scale
config.SOUNDER_VOLUME = 1.0
-- true for 24 hour time on main view screen
config.TIME_24_HOUR = true
-- log path
config.LOG_PATH = "/log.txt"
-- log mode
-- 0 = APPEND (adds to existing file on start)
-- 1 = NEW (replaces existing file on start)
config.LOG_MODE = 0
return config

1505
coordinator/configure.lua Normal file

File diff suppressed because it is too large Load Diff

View File

@@ -2,175 +2,190 @@ local comms = require("scada-common.comms")
local log = require("scada-common.log") local log = require("scada-common.log")
local ppm = require("scada-common.ppm") local ppm = require("scada-common.ppm")
local util = require("scada-common.util") local util = require("scada-common.util")
local types = require("scada-common.types")
local themes = require("graphics.themes")
local apisessions = require("coordinator.apisessions")
local iocontrol = require("coordinator.iocontrol") local iocontrol = require("coordinator.iocontrol")
local process = require("coordinator.process") local process = require("coordinator.process")
local dialog = require("coordinator.ui.dialog") local apisessions = require("coordinator.session.apisessions")
local print = util.print
local println = util.println
local print_ts = util.print_ts
local println_ts = util.println_ts
local PROTOCOL = comms.PROTOCOL local PROTOCOL = comms.PROTOCOL
local DEVICE_TYPE = comms.DEVICE_TYPE local DEVICE_TYPE = comms.DEVICE_TYPE
local ESTABLISH_ACK = comms.ESTABLISH_ACK local ESTABLISH_ACK = comms.ESTABLISH_ACK
local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE local MGMT_TYPE = comms.MGMT_TYPE
local SCADA_CRDN_TYPE = comms.SCADA_CRDN_TYPE local CRDN_TYPE = comms.CRDN_TYPE
local UNIT_COMMAND = comms.UNIT_COMMAND local UNIT_COMMAND = comms.UNIT_COMMAND
local FAC_COMMAND = comms.FAC_COMMAND local FAC_COMMAND = comms.FAC_COMMAND
local LINK_TIMEOUT = 60.0
local coordinator = {} local coordinator = {}
-- request the user to select a monitor ---@type crd_config
---@nodiscard local config = {}
---@param names table available monitors
---@return boolean|string|nil
local function ask_monitor(names)
println("available monitors:")
for i = 1, #names do
print(" " .. names[i])
end
println("")
println("select a monitor or type c to cancel")
local iface = dialog.ask_options(names, "c") coordinator.config = config
if iface ~= false and iface ~= nil then -- load the coordinator configuration<br>
util.filter_table(names, function (x) return x ~= iface end) -- status of 0 is OK, 1 is bad config, 2 is bad monitor config
---@return 0|1|2 status, nil|monitors_struct|string monitors (or error message)
function coordinator.load_config()
if not settings.load("/coordinator.settings") then return 1 end
config.UnitCount = settings.get("UnitCount")
config.SpeakerVolume = settings.get("SpeakerVolume")
config.Time24Hour = settings.get("Time24Hour")
config.TempScale = settings.get("TempScale")
config.EnergyScale = settings.get("EnergyScale")
config.DisableFlowView = settings.get("DisableFlowView")
config.MainDisplay = settings.get("MainDisplay")
config.FlowDisplay = settings.get("FlowDisplay")
config.UnitDisplays = settings.get("UnitDisplays")
config.SVR_Channel = settings.get("SVR_Channel")
config.CRD_Channel = settings.get("CRD_Channel")
config.PKT_Channel = settings.get("PKT_Channel")
config.SVR_Timeout = settings.get("SVR_Timeout")
config.API_Timeout = settings.get("API_Timeout")
config.TrustedRange = settings.get("TrustedRange")
config.AuthKey = settings.get("AuthKey")
config.LogMode = settings.get("LogMode")
config.LogPath = settings.get("LogPath")
config.LogDebug = settings.get("LogDebug")
config.MainTheme = settings.get("MainTheme")
config.FrontPanelTheme = settings.get("FrontPanelTheme")
config.ColorMode = settings.get("ColorMode")
local cfv = util.new_validator()
cfv.assert_type_int(config.UnitCount)
cfv.assert_range(config.UnitCount, 1, 4)
cfv.assert_type_bool(config.Time24Hour)
cfv.assert_type_int(config.TempScale)
cfv.assert_range(config.TempScale, 1, 4)
cfv.assert_type_int(config.EnergyScale)
cfv.assert_range(config.EnergyScale, 1, 3)
cfv.assert_type_bool(config.DisableFlowView)
cfv.assert_type_table(config.UnitDisplays)
cfv.assert_type_num(config.SpeakerVolume)
cfv.assert_range(config.SpeakerVolume, 0, 3)
cfv.assert_channel(config.SVR_Channel)
cfv.assert_channel(config.CRD_Channel)
cfv.assert_channel(config.PKT_Channel)
cfv.assert_type_num(config.SVR_Timeout)
cfv.assert_min(config.SVR_Timeout, 2)
cfv.assert_type_num(config.API_Timeout)
cfv.assert_min(config.API_Timeout, 2)
cfv.assert_type_num(config.TrustedRange)
cfv.assert_min(config.TrustedRange, 0)
cfv.assert_type_str(config.AuthKey)
if type(config.AuthKey) == "string" then
local len = string.len(config.AuthKey)
cfv.assert(len == 0 or len >= 8)
end end
return iface cfv.assert_type_int(config.LogMode)
end cfv.assert_range(config.LogMode, 0, 1)
cfv.assert_type_str(config.LogPath)
cfv.assert_type_bool(config.LogDebug)
cfv.assert_type_int(config.MainTheme)
cfv.assert_range(config.MainTheme, 1, 2)
cfv.assert_type_int(config.FrontPanelTheme)
cfv.assert_range(config.FrontPanelTheme, 1, 2)
cfv.assert_type_int(config.ColorMode)
cfv.assert_range(config.ColorMode, 1, themes.COLOR_MODE.NUM_MODES)
-- Monitor Setup
-- configure monitor layout
---@param num_units integer number of units expected
---@return boolean success, monitors_struct? monitors
function coordinator.configure_monitors(num_units)
---@class monitors_struct ---@class monitors_struct
local monitors = { local monitors = {
primary = nil, main = nil, ---@type table|nil
primary_name = "", main_name = "",
flow = nil, ---@type table|nil
flow_name = "",
unit_displays = {}, unit_displays = {},
unit_name_map = {} unit_name_map = {}
} }
local monitors_avail = ppm.get_monitor_list() local mon_cfv = util.new_validator()
local names = {}
local available = {}
-- get all interface names -- get all interface names
for iface, _ in pairs(monitors_avail) do local names = {}
table.insert(names, iface) for iface, _ in pairs(ppm.get_monitor_list()) do table.insert(names, iface) end
table.insert(available, iface)
end
-- we need a certain number of monitors (1 per unit + 1 primary display) local function setup_monitors()
local num_displays_needed = num_units + 1 mon_cfv.assert_type_str(config.MainDisplay)
if #names < num_displays_needed then if not config.DisableFlowView then mon_cfv.assert_type_str(config.FlowDisplay) end
local message = "not enough monitors connected (need " .. num_displays_needed .. ")" mon_cfv.assert_eq(#config.UnitDisplays, config.UnitCount)
println(message)
log.warning(message)
return false
end
-- attempt to load settings if mon_cfv.valid() then
if not settings.load("/coord.settings") then local w, h, _
log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)")
else
local _primary = settings.get("PRIMARY_DISPLAY")
local _unitd = settings.get("UNIT_DISPLAYS")
-- filter out already assigned monitors if not util.table_contains(names, config.MainDisplay) then
util.filter_table(available, function (x) return x ~= _primary end) return 2, "Main monitor is not connected."
if type(_unitd) == "table" then
util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end)
end
end
---------------------
-- PRIMARY DISPLAY --
---------------------
local iface_primary_display = settings.get("PRIMARY_DISPLAY") ---@type boolean|string|nil
if not util.table_contains(names, iface_primary_display) then
println("primary display is not connected")
local response = dialog.ask_y_n("would you like to change it", true)
if response == false then return false end
iface_primary_display = nil
end
while iface_primary_display == nil and #available > 0 do
-- lets get a monitor
iface_primary_display = ask_monitor(available)
end
if type(iface_primary_display) ~= "string" then return false end
settings.set("PRIMARY_DISPLAY", iface_primary_display)
util.filter_table(available, function (x) return x ~= iface_primary_display end)
monitors.primary = ppm.get_periph(iface_primary_display)
monitors.primary_name = iface_primary_display
-------------------
-- UNIT DISPLAYS --
-------------------
local unit_displays = settings.get("UNIT_DISPLAYS")
if unit_displays == nil then
unit_displays = {}
for i = 1, num_units do
local display = nil
while display == nil and #available > 0 do
-- lets get a monitor
println("please select monitor for unit #" .. i)
display = ask_monitor(available)
end end
if display == false then return false end monitors.main = ppm.get_periph(config.MainDisplay)
monitors.main_name = config.MainDisplay
unit_displays[i] = display monitors.main.setTextScale(0.5)
end w, _ = ppm.monitor_block_size(monitors.main.getSize())
else if w ~= 8 then
-- make sure all displays are connected return 2, util.c("Main monitor width is incorrect (was ", w, ", must be 8).")
for i = 1, num_units do
local display = unit_displays[i]
if not util.table_contains(names, display) then
println("unit #" .. i .. " display is not connected")
local response = dialog.ask_y_n("would you like to change it", true)
if response == false then return false end
display = nil
end end
while display == nil and #available > 0 do if not config.DisableFlowView then
-- lets get a monitor if not util.table_contains(names, config.FlowDisplay) then
display = ask_monitor(available) return 2, "Flow monitor is not connected."
end
monitors.flow = ppm.get_periph(config.FlowDisplay)
monitors.flow_name = config.FlowDisplay
monitors.flow.setTextScale(0.5)
w, _ = ppm.monitor_block_size(monitors.flow.getSize())
if w ~= 8 then
return 2, util.c("Flow monitor width is incorrect (was ", w, ", must be 8).")
end
end end
if display == false then return false end for i = 1, config.UnitCount do
local display = config.UnitDisplays[i]
if type(display) ~= "string" or not util.table_contains(names, display) then
return 2, "Unit " .. i .. " monitor is not connected."
end
unit_displays[i] = display monitors.unit_displays[i] = ppm.get_periph(display)
end monitors.unit_name_map[i] = display
monitors.unit_displays[i].setTextScale(0.5)
w, h = ppm.monitor_block_size(monitors.unit_displays[i].getSize())
if w ~= 4 or h ~= 4 then
return 2, util.c("Unit ", i, " monitor size is incorrect (was ", w, " by ", h,", must be 4 by 4).")
end
end
else return 2, "Monitor configuration invalid." end
end end
settings.set("UNIT_DISPLAYS", unit_displays) if cfv.valid() then
if not settings.save("/coord.settings") then local ok, result, message = pcall(setup_monitors)
log.warning("configure_monitors(): failed to save coordinator settings file") assert(ok, util.c("fatal error while trying to verify monitors: ", result))
end if result == 2 then return 2, message end
else return 1 end
for i = 1, #unit_displays do return 0, monitors
monitors.unit_displays[i] = ppm.get_periph(unit_displays[i])
monitors.unit_name_map[i] = unit_displays[i]
end
return true, monitors
end end
-- dmesg print wrapper -- dmesg print wrapper
@@ -180,10 +195,11 @@ end
---@return function? update, function? done ---@return function? update, function? done
local function log_dmesg(message, dmesg_tag, working) local function log_dmesg(message, dmesg_tag, working)
local colors = { local colors = {
GRAPHICS = colors.green, RENDER = colors.green,
SYSTEM = colors.cyan, SYSTEM = colors.cyan,
BOOT = colors.blue, BOOT = colors.blue,
COMMS = colors.purple COMMS = colors.purple,
CRYPTO = colors.yellow
} }
if working then if working then
@@ -193,10 +209,11 @@ local function log_dmesg(message, dmesg_tag, working)
end end
end end
function coordinator.log_graphics(message) log_dmesg(message, "GRAPHICS") end function coordinator.log_render(message) log_dmesg(message, "RENDER") end
function coordinator.log_sys(message) log_dmesg(message, "SYSTEM") end function coordinator.log_sys(message) log_dmesg(message, "SYSTEM") end
function coordinator.log_boot(message) log_dmesg(message, "BOOT") end function coordinator.log_boot(message) log_dmesg(message, "BOOT") end
function coordinator.log_comms(message) log_dmesg(message, "COMMS") end function coordinator.log_comms(message) log_dmesg(message, "COMMS") end
function coordinator.log_crypto(message) log_dmesg(message, "CRYPTO") end
-- log a message for communications connecting, providing access to progress indication control functions -- log a message for communications connecting, providing access to progress indication control functions
---@nodiscard ---@nodiscard
@@ -212,41 +229,40 @@ end
-- coordinator communications -- coordinator communications
---@nodiscard ---@nodiscard
---@param version string coordinator version ---@param version string coordinator version
---@param modem table modem device ---@param nic nic network interface device
---@param sv_port integer port of configured supervisor
---@param sv_listen integer listening port for supervisor replys
---@param api_listen integer listening port for pocket API
---@param range integer trusted device connection range
---@param sv_watchdog watchdog ---@param sv_watchdog watchdog
function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range, sv_watchdog) function coordinator.comms(version, nic, sv_watchdog)
local self = { local self = {
sv_linked = false, sv_linked = false,
sv_seq_num = 0, sv_addr = comms.BROADCAST,
sv_r_seq_num = nil, sv_seq_num = util.time_ms() * 10, -- unique per peer, restarting will not re-use seq nums due to message rate
sv_r_seq_num = nil, ---@type nil|integer
sv_config_err = false, sv_config_err = false,
connected = false, last_est_ack = ESTABLISH_ACK.ALLOW,
last_est_ack = ESTABLISH_ACK.ALLOW last_api_est_acks = {},
est_start = 0,
est_last = 0,
est_tick_waiting = nil,
est_task_done = nil
} }
comms.set_trusted_range(range) comms.set_trusted_range(config.TrustedRange)
-- configure network channels
nic.closeAll()
nic.open(config.CRD_Channel)
-- pass config to apisessions
apisessions.init(nic, config)
-- PRIVATE FUNCTIONS -- -- PRIVATE FUNCTIONS --
-- configure modem channels
local function _conf_channels()
modem.closeAll()
modem.open(sv_listen)
modem.open(api_listen)
end
_conf_channels()
-- send a packet to the supervisor -- send a packet to the supervisor
---@param msg_type SCADA_MGMT_TYPE|SCADA_CRDN_TYPE ---@param msg_type MGMT_TYPE|CRDN_TYPE
---@param msg table ---@param msg table
local function _send_sv(protocol, msg_type, msg) local function _send_sv(protocol, msg_type, msg)
local s_pkt = comms.scada_packet() local s_pkt = comms.scada_packet()
local pkt = nil ---@type mgmt_packet|crdn_packet local pkt ---@type mgmt_packet|crdn_packet
if protocol == PROTOCOL.SCADA_MGMT then if protocol == PROTOCOL.SCADA_MGMT then
pkt = comms.mgmt_packet() pkt = comms.mgmt_packet()
@@ -257,21 +273,36 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
end end
pkt.make(msg_type, msg) pkt.make(msg_type, msg)
s_pkt.make(self.sv_seq_num, protocol, pkt.raw_sendable()) s_pkt.make(self.sv_addr, self.sv_seq_num, protocol, pkt.raw_sendable())
modem.transmit(sv_port, sv_listen, s_pkt.raw_sendable()) nic.transmit(config.SVR_Channel, config.CRD_Channel, s_pkt)
self.sv_seq_num = self.sv_seq_num + 1 self.sv_seq_num = self.sv_seq_num + 1
end end
-- send an API establish request response
---@param packet scada_packet
---@param ack ESTABLISH_ACK
---@param data any?
local function _send_api_establish_ack(packet, ack, data)
local s_pkt = comms.scada_packet()
local m_pkt = comms.mgmt_packet()
m_pkt.make(MGMT_TYPE.ESTABLISH, { ack, data })
s_pkt.make(packet.src_addr(), packet.seq_num() + 1, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
nic.transmit(config.PKT_Channel, config.CRD_Channel, s_pkt)
self.last_api_est_acks[packet.src_addr()] = ack
end
-- attempt connection establishment -- attempt connection establishment
local function _send_establish() local function _send_establish()
_send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.CRDN }) _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.CRD })
end end
-- keep alive ack -- keep alive ack
---@param srv_time integer ---@param srv_time integer
local function _send_keep_alive_ack(srv_time) local function _send_keep_alive_ack(srv_time)
_send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() }) _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
end end
-- PUBLIC FUNCTIONS -- -- PUBLIC FUNCTIONS --
@@ -279,97 +310,95 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
---@class coord_comms ---@class coord_comms
local public = {} local public = {}
-- reconnect a newly connected modem -- try to connect to the supervisor if not already linked
---@param new_modem table ---@param abort boolean? true to print out cancel info if not linked (use on program terminate)
function public.reconnect_modem(new_modem) ---@return boolean ok, boolean start_ui
modem = new_modem function public.try_connect(abort)
_conf_channels() local ok = true
local start_ui = false
if not self.sv_linked then
if self.est_tick_waiting == nil then
self.est_start = os.clock()
self.est_last = self.est_start
self.est_tick_waiting, self.est_task_done =
coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. config.SVR_Channel)
_send_establish()
else
self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (os.clock() - self.est_start)))
end
if abort or (os.clock() - self.est_start) >= LINK_TIMEOUT then
self.est_task_done(false)
if abort then
coordinator.log_comms("supervisor connection attempt cancelled by user")
elseif self.sv_config_err then
coordinator.log_comms("supervisor unit count does not match coordinator unit count, check configs")
elseif not self.sv_linked then
if self.last_est_ack == ESTABLISH_ACK.DENY then
coordinator.log_comms("supervisor connection attempt denied")
elseif self.last_est_ack == ESTABLISH_ACK.COLLISION then
coordinator.log_comms("supervisor connection failed due to collision")
elseif self.last_est_ack == ESTABLISH_ACK.BAD_VERSION then
coordinator.log_comms("supervisor connection failed due to version mismatch")
else
coordinator.log_comms("supervisor connection failed with no valid response")
end
end
ok = false
elseif self.sv_config_err then
self.est_task_done(false)
coordinator.log_comms("supervisor unit count does not match coordinator unit count, check configs")
ok = false
elseif (os.clock() - self.est_last) > 1.0 then
_send_establish()
self.est_last = os.clock()
end
elseif self.est_tick_waiting ~= nil then
self.est_task_done(true)
self.est_tick_waiting = nil
self.est_task_done = nil
start_ui = true
end
return ok, start_ui
end end
-- close the connection to the server -- close the connection to the server
function public.close() function public.close()
sv_watchdog.cancel() sv_watchdog.cancel()
self.sv_addr = comms.BROADCAST
self.sv_linked = false self.sv_linked = false
_send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.CLOSE, {}) self.sv_r_seq_num = nil
end iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
_send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.CLOSE, {})
-- attempt to connect to the subervisor
---@nodiscard
---@param timeout_s number timeout in seconds
---@param tick_dmesg_waiting function callback to tick dmesg waiting
---@param task_done function callback to show done on dmesg
---@return boolean sv_linked true if connected, false otherwise
--- EVENT_CONSUMER: this function consumes events
function public.sv_connect(timeout_s, tick_dmesg_waiting, task_done)
local clock = util.new_clock(1)
local start = util.time_s()
local terminated = false
_send_establish()
clock.start()
while (util.time_s() - start) < timeout_s and (not self.sv_linked) and (not self.sv_config_err) do
local event, p1, p2, p3, p4, p5 = util.pull_event()
if event == "timer" and clock.is_clock(p1) then
-- timed out attempt, try again
tick_dmesg_waiting(math.max(0, timeout_s - (util.time_s() - start)))
_send_establish()
clock.start()
elseif event == "modem_message" then
-- handle message
local packet = public.parse_packet(p1, p2, p3, p4, p5)
if packet ~= nil and packet.type == SCADA_MGMT_TYPE.ESTABLISH then
public.handle_packet(packet)
end
elseif event == "terminate" then
terminated = true
break
end
end
task_done(self.sv_linked)
if terminated then
coordinator.log_comms("supervisor connection attempt cancelled by user")
elseif self.sv_config_err then
coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
elseif not self.sv_linked then
if self.last_est_ack == ESTABLISH_ACK.DENY then
coordinator.log_comms("supervisor connection attempt denied")
elseif self.last_est_ack == ESTABLISH_ACK.COLLISION then
coordinator.log_comms("supervisor connection failed due to collision")
elseif self.last_est_ack == ESTABLISH_ACK.BAD_VERSION then
coordinator.log_comms("supervisor connection failed due to version mismatch")
else
coordinator.log_comms("supervisor connection failed with no valid response")
end
end
return self.sv_linked
end end
-- send a facility command -- send a facility command
---@param cmd FAC_COMMAND command ---@param cmd FAC_COMMAND command
function public.send_fac_command(cmd) ---@param option any? optional option options for the optional options (like waste mode)
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd }) function public.send_fac_command(cmd, option)
_send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_CMD, { cmd, option })
end end
-- send the auto process control configuration with a start command -- send the auto process control configuration with a start command
---@param config coord_auto_config configuration ---@param auto_cfg coord_auto_config configuration
function public.send_auto_start(config) function public.send_auto_start(auto_cfg)
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_CMD, {
FAC_COMMAND.START, config.mode, config.burn_target, config.charge_target, config.gen_target, config.limits FAC_COMMAND.START, auto_cfg.mode, auto_cfg.burn_target, auto_cfg.charge_target, auto_cfg.gen_target, auto_cfg.limits
}) })
end end
-- send a unit command -- send a unit command
---@param cmd UNIT_COMMAND command ---@param cmd UNIT_COMMAND command
---@param unit integer unit ID ---@param unit integer unit ID
---@param option any? optional option options for the optional options (like burn rate) (does option still look like a word?) ---@param option any? optional option options for the optional options (like burn rate)
function public.send_unit_command(cmd, unit, option) function public.send_unit_command(cmd, unit, option)
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_CMD, { cmd, unit, option }) _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
end end
-- parse a packet -- parse a packet
@@ -378,15 +407,12 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
---@param reply_to integer ---@param reply_to integer
---@param message any ---@param message any
---@param distance integer ---@param distance integer
---@return mgmt_frame|crdn_frame|capi_frame|nil packet ---@return mgmt_frame|crdn_frame|nil packet
function public.parse_packet(side, sender, reply_to, message, distance) function public.parse_packet(side, sender, reply_to, message, distance)
local s_pkt = nic.receive(side, sender, reply_to, message, distance)
local pkt = nil local pkt = nil
local s_pkt = comms.scada_packet()
-- parse packet as generic SCADA packet if s_pkt then
s_pkt.receive(side, sender, reply_to, message, distance)
if s_pkt.is_valid() then
-- get as SCADA management packet -- get as SCADA management packet
if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then
local mgmt_pkt = comms.mgmt_packet() local mgmt_pkt = comms.mgmt_packet()
@@ -399,12 +425,6 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
if crdn_pkt.decode(s_pkt) then if crdn_pkt.decode(s_pkt) then
pkt = crdn_pkt.get() pkt = crdn_pkt.get()
end end
-- get as coordinator API packet
elseif s_pkt.protocol() == PROTOCOL.COORD_API then
local capi_pkt = comms.capi_packet()
if capi_pkt.decode(s_pkt) then
pkt = capi_pkt.get()
end
else else
log.debug("attempted parse of illegal packet type " .. s_pkt.protocol(), true) log.debug("attempted parse of illegal packet type " .. s_pkt.protocol(), true)
end end
@@ -414,28 +434,99 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
end end
-- handle a packet -- handle a packet
---@param packet mgmt_frame|crdn_frame|capi_frame|nil ---@param packet mgmt_frame|crdn_frame|nil
---@return boolean close_ui
function public.handle_packet(packet) function public.handle_packet(packet)
if packet ~= nil then local was_linked = self.sv_linked
local protocol = packet.scada_frame.protocol()
local l_port = packet.scada_frame.local_port()
if l_port == api_listen then if packet ~= nil then
if protocol == PROTOCOL.COORD_API then local l_chan = packet.scada_frame.local_channel()
---@cast packet capi_frame local r_chan = packet.scada_frame.remote_channel()
apisessions.handle_packet(packet) local src_addr = packet.scada_frame.src_addr()
local protocol = packet.scada_frame.protocol()
if l_chan ~= config.CRD_Channel then
log.debug("received packet on unconfigured channel " .. l_chan, true)
elseif r_chan == config.PKT_Channel then
if not self.sv_linked then
log.debug("discarding pocket API packet before linked to supervisor")
elseif protocol == PROTOCOL.SCADA_CRDN then
---@cast packet crdn_frame
-- look for an associated session
local session = apisessions.find_session(src_addr)
-- coordinator packet
if session ~= nil then
-- pass the packet onto the session handler
session.in_queue.push_packet(packet)
else
-- any other packet should be session related, discard it
log.debug("discarding SCADA_CRDN packet without a known session")
end
elseif protocol == PROTOCOL.SCADA_MGMT then
---@cast packet mgmt_frame
-- look for an associated session
local session = apisessions.find_session(src_addr)
-- SCADA management packet
if session ~= nil then
-- pass the packet onto the session handler
session.in_queue.push_packet(packet)
elseif packet.type == MGMT_TYPE.ESTABLISH then
-- establish a new session
-- validate packet and continue
if packet.length == 4 then
local comms_v = util.strval(packet.data[1])
local firmware_v = util.strval(packet.data[2])
local dev_type = packet.data[3]
local api_v = util.strval(packet.data[4])
if comms_v ~= comms.version then
if self.last_api_est_acks[src_addr] ~= ESTABLISH_ACK.BAD_VERSION then
log.info(util.c("dropping API establish packet with incorrect comms version v", comms_v, " (expected v", comms.version, ")"))
end
_send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.BAD_VERSION)
elseif api_v ~= comms.api_version then
if self.last_api_est_acks[src_addr] ~= ESTABLISH_ACK.BAD_API_VERSION then
log.info(util.c("dropping API establish packet with incorrect api version v", api_v, " (expected v", comms.api_version, ")"))
end
_send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.BAD_API_VERSION)
elseif dev_type == DEVICE_TYPE.PKT then
-- pocket linking request
local id = apisessions.establish_session(src_addr, packet.scada_frame.seq_num(), firmware_v)
coordinator.log_comms(util.c("API_ESTABLISH: pocket (", firmware_v, ") [@", src_addr, "] connected with session ID ", id))
local conf = iocontrol.get_db().facility.conf
_send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW, { conf.num_units, conf.cooling })
else
log.debug(util.c("API_ESTABLISH: illegal establish packet for device ", dev_type, " on pocket channel"))
_send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.DENY)
end
else
log.debug("invalid establish packet (on API listening channel)")
_send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.DENY)
end
else
-- any other packet should be session related, discard it
log.debug(util.c("discarding pocket SCADA_MGMT packet without a known session from computer ", src_addr))
end
else else
log.debug("illegal packet type " .. protocol .. " on api listening channel", true) log.debug("illegal packet type " .. protocol .. " on pocket channel", true)
end end
elseif l_port == sv_listen then elseif r_chan == config.SVR_Channel then
-- check sequence number -- check sequence number
if self.sv_r_seq_num == nil then if self.sv_r_seq_num == nil then
self.sv_r_seq_num = packet.scada_frame.seq_num() self.sv_r_seq_num = packet.scada_frame.seq_num() + 1
elseif self.connected and self.sv_r_seq_num >= packet.scada_frame.seq_num() then elseif self.sv_r_seq_num ~= packet.scada_frame.seq_num() then
log.warning("sequence out-of-order: last = " .. self.sv_r_seq_num .. ", new = " .. packet.scada_frame.seq_num()) log.warning("sequence out-of-order: next = " .. self.sv_r_seq_num .. ", new = " .. packet.scada_frame.seq_num())
return return false
elseif self.sv_linked and src_addr ~= self.sv_addr then
log.debug("received packet from unknown computer " .. src_addr .. " while linked; channel in use by another system?")
return false
else else
self.sv_r_seq_num = packet.scada_frame.seq_num() self.sv_r_seq_num = packet.scada_frame.seq_num() + 1
end end
-- feed watchdog on valid sequence number -- feed watchdog on valid sequence number
@@ -445,7 +536,7 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
if protocol == PROTOCOL.SCADA_CRDN then if protocol == PROTOCOL.SCADA_CRDN then
---@cast packet crdn_frame ---@cast packet crdn_frame
if self.sv_linked then if self.sv_linked then
if packet.type == SCADA_CRDN_TYPE.INITIAL_BUILDS then if packet.type == CRDN_TYPE.INITIAL_BUILDS then
if packet.length == 2 then if packet.length == 2 then
-- record builds -- record builds
local fac_builds = iocontrol.record_facility_builds(packet.data[1]) local fac_builds = iocontrol.record_facility_builds(packet.data[1])
@@ -453,31 +544,31 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
if fac_builds and unit_builds then if fac_builds and unit_builds then
-- acknowledge receipt of builds -- acknowledge receipt of builds
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.INITIAL_BUILDS, {}) _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.INITIAL_BUILDS, {})
else else
log.debug("received invalid INITIAL_BUILDS packet") log.debug("received invalid INITIAL_BUILDS packet")
end end
else else
log.debug("INITIAL_BUILDS packet length mismatch") log.debug("INITIAL_BUILDS packet length mismatch")
end end
elseif packet.type == SCADA_CRDN_TYPE.FAC_BUILDS then elseif packet.type == CRDN_TYPE.FAC_BUILDS then
if packet.length == 1 then if packet.length == 1 then
-- record facility builds -- record facility builds
if iocontrol.record_facility_builds(packet.data[1]) then if iocontrol.record_facility_builds(packet.data[1]) then
-- acknowledge receipt of builds -- acknowledge receipt of builds
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_BUILDS, {}) _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_BUILDS, {})
else else
log.debug("received invalid FAC_BUILDS packet") log.debug("received invalid FAC_BUILDS packet")
end end
else else
log.debug("FAC_BUILDS packet length mismatch") log.debug("FAC_BUILDS packet length mismatch")
end end
elseif packet.type == SCADA_CRDN_TYPE.FAC_STATUS then elseif packet.type == CRDN_TYPE.FAC_STATUS then
-- update facility status -- update facility status
if not iocontrol.update_facility_status(packet.data) then if not iocontrol.update_facility_status(packet.data) then
log.debug("received invalid FAC_STATUS packet") log.debug("received invalid FAC_STATUS packet")
end end
elseif packet.type == SCADA_CRDN_TYPE.FAC_CMD then elseif packet.type == CRDN_TYPE.FAC_CMD then
-- facility command acknowledgement -- facility command acknowledgement
if packet.length >= 2 then if packet.length >= 2 then
local cmd = packet.data[1] local cmd = packet.data[1]
@@ -495,30 +586,34 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
end end
elseif cmd == FAC_COMMAND.ACK_ALL_ALARMS then elseif cmd == FAC_COMMAND.ACK_ALL_ALARMS then
iocontrol.get_db().facility.ack_alarms_ack(ack) iocontrol.get_db().facility.ack_alarms_ack(ack)
elseif cmd == FAC_COMMAND.SET_WASTE_MODE then
process.waste_ack_handle(packet.data[2])
elseif cmd == FAC_COMMAND.SET_PU_FB then
process.pu_fb_ack_handle(packet.data[2])
else else
log.debug(util.c("received facility command ack with unknown command ", cmd)) log.debug(util.c("received facility command ack with unknown command ", cmd))
end end
else else
log.debug("SCADA_CRDN facility command ack packet length mismatch") log.debug("SCADA_CRDN facility command ack packet length mismatch")
end end
elseif packet.type == SCADA_CRDN_TYPE.UNIT_BUILDS then elseif packet.type == CRDN_TYPE.UNIT_BUILDS then
-- record builds -- record builds
if packet.length == 1 then if packet.length == 1 then
if iocontrol.record_unit_builds(packet.data[1]) then if iocontrol.record_unit_builds(packet.data[1]) then
-- acknowledge receipt of builds -- acknowledge receipt of builds
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_BUILDS, {}) _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.UNIT_BUILDS, {})
else else
log.debug("received invalid UNIT_BUILDS packet") log.debug("received invalid UNIT_BUILDS packet")
end end
else else
log.debug("UNIT_BUILDS packet length mismatch") log.debug("UNIT_BUILDS packet length mismatch")
end end
elseif packet.type == SCADA_CRDN_TYPE.UNIT_STATUSES then elseif packet.type == CRDN_TYPE.UNIT_STATUSES then
-- update statuses -- update statuses
if not iocontrol.update_unit_statuses(packet.data) then if not iocontrol.update_unit_statuses(packet.data) then
log.error("received invalid UNIT_STATUSES packet") log.debug("received invalid UNIT_STATUSES packet")
end end
elseif packet.type == SCADA_CRDN_TYPE.UNIT_CMD then elseif packet.type == CRDN_TYPE.UNIT_CMD then
-- unit command acknowledgement -- unit command acknowledgement
if packet.length == 3 then if packet.length == 3 then
local cmd = packet.data[1] local cmd = packet.data[1]
@@ -552,43 +647,74 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
log.debug("SCADA_CRDN unit command ack packet length mismatch") log.debug("SCADA_CRDN unit command ack packet length mismatch")
end end
else else
log.warning("received unknown SCADA_CRDN packet type " .. packet.type) log.debug("received unknown SCADA_CRDN packet type " .. packet.type)
end end
else else
log.debug("discarding SCADA_CRDN packet before linked") log.debug("discarding SCADA_CRDN packet before linked")
end end
elseif protocol == PROTOCOL.SCADA_MGMT then elseif protocol == PROTOCOL.SCADA_MGMT then
---@cast packet mgmt_frame ---@cast packet mgmt_frame
if packet.type == SCADA_MGMT_TYPE.ESTABLISH then if self.sv_linked then
if packet.type == MGMT_TYPE.KEEP_ALIVE then
-- keep alive request received, echo back
if packet.length == 1 then
local timestamp = packet.data[1]
local trip_time = util.time() - timestamp
if trip_time > 750 then
log.warning("coordinator KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
end
-- log.debug("coordinator RTT = " .. trip_time .. "ms")
iocontrol.get_db().facility.ps.publish("sv_ping", trip_time)
_send_keep_alive_ack(timestamp)
else
log.debug("SCADA keep alive packet length mismatch")
end
elseif packet.type == MGMT_TYPE.CLOSE then
-- handle session close
sv_watchdog.cancel()
self.sv_addr = comms.BROADCAST
self.sv_linked = false
self.sv_r_seq_num = nil
iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
log.info("server connection closed by remote host")
else
log.debug("received unknown SCADA_MGMT packet type " .. packet.type)
end
elseif packet.type == MGMT_TYPE.ESTABLISH then
-- connection with supervisor established -- connection with supervisor established
if packet.length == 2 then if packet.length == 2 then
local est_ack = packet.data[1] local est_ack = packet.data[1]
local config = packet.data[2] local sv_config = packet.data[2]
if est_ack == ESTABLISH_ACK.ALLOW then if est_ack == ESTABLISH_ACK.ALLOW then
if type(config) == "table" and #config > 1 then -- reset to disconnected before validating
iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
if type(sv_config) == "table" and #sv_config == 2 then
-- get configuration -- get configuration
---@class facility_conf ---@class facility_conf
local conf = { local conf = {
num_units = config[1], ---@type integer num_units = sv_config[1], ---@type integer
defs = {} -- boilers and turbines cooling = sv_config[2] ---@type sv_cooling_conf
} }
if (#config - 1) == (conf.num_units * 2) then if conf.num_units == config.UnitCount then
-- record sequence of pairs of [#boilers, #turbines] per unit
for i = 2, #config do
table.insert(conf.defs, config[i])
end
-- init io controller -- init io controller
iocontrol.init(conf, public) iocontrol.init(conf, public, config.TempScale, config.EnergyScale)
self.sv_addr = src_addr
self.sv_linked = true self.sv_linked = true
self.sv_config_err = false self.sv_config_err = false
iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED)
else else
self.sv_config_err = true self.sv_config_err = true
log.warning("invalid supervisor configuration definitions received, establish failed") log.warning("supervisor config's number of units don't match coordinator's config, establish failed")
end end
else else
log.debug("invalid supervisor configuration table received, establish failed") log.debug("invalid supervisor configuration table received, establish failed")
@@ -603,15 +729,18 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
if est_ack == ESTABLISH_ACK.DENY then if est_ack == ESTABLISH_ACK.DENY then
if self.last_est_ack ~= est_ack then if self.last_est_ack ~= est_ack then
iocontrol.fp_link_state(types.PANEL_LINK_STATE.DENIED)
log.info("supervisor connection denied") log.info("supervisor connection denied")
end end
elseif est_ack == ESTABLISH_ACK.COLLISION then elseif est_ack == ESTABLISH_ACK.COLLISION then
if self.last_est_ack ~= est_ack then if self.last_est_ack ~= est_ack then
log.info("supervisor connection denied due to collision") iocontrol.fp_link_state(types.PANEL_LINK_STATE.COLLISION)
log.warning("supervisor connection denied due to collision")
end end
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
if self.last_est_ack ~= est_ack then if self.last_est_ack ~= est_ack then
log.info("supervisor comms version mismatch") iocontrol.fp_link_state(types.PANEL_LINK_STATE.BAD_VERSION)
log.warning("supervisor comms version mismatch")
end end
else else
log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported") log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported")
@@ -621,34 +750,6 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
else else
log.debug("SCADA_MGMT establish packet length mismatch") log.debug("SCADA_MGMT establish packet length mismatch")
end end
elseif self.sv_linked then
if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-- keep alive request received, echo back
if packet.length == 1 then
local timestamp = packet.data[1]
local trip_time = util.time() - timestamp
if trip_time > 750 then
log.warning("coord KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
end
-- log.debug("coord RTT = " .. trip_time .. "ms")
iocontrol.get_db().facility.ps.publish("sv_ping", trip_time)
_send_keep_alive_ack(timestamp)
else
log.debug("SCADA keep alive packet length mismatch")
end
elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
-- handle session close
sv_watchdog.cancel()
self.sv_linked = false
println_ts("server connection closed by remote host")
log.info("server connection closed by remote host")
else
log.debug("received unknown SCADA_MGMT packet type " .. packet.type)
end
else else
log.debug("discarding non-link SCADA_MGMT packet before linked") log.debug("discarding non-link SCADA_MGMT packet before linked")
end end
@@ -656,9 +757,11 @@ function coordinator.comms(version, modem, sv_port, sv_listen, api_listen, range
log.debug("illegal packet type " .. protocol .. " on supervisor listening channel", true) log.debug("illegal packet type " .. protocol .. " on supervisor listening channel", true)
end end
else else
log.debug("received packet on unconfigured channel " .. l_port, true) log.debug("received packet for unknown channel " .. r_chan, true)
end end
end end
return was_linked and not self.sv_linked
end end
-- check if the coordinator is still linked to the supervisor -- check if the coordinator is still linked to the supervisor

File diff suppressed because it is too large Load Diff

View File

@@ -11,6 +11,7 @@ local FAC_COMMAND = comms.FAC_COMMAND
local UNIT_COMMAND = comms.UNIT_COMMAND local UNIT_COMMAND = comms.UNIT_COMMAND
local PROCESS = types.PROCESS local PROCESS = types.PROCESS
local PRODUCT = types.WASTE_PRODUCT
---@class process_controller ---@class process_controller
local process = {} local process = {}
@@ -18,13 +19,21 @@ local process = {}
local self = { local self = {
io = nil, ---@type ioctl io = nil, ---@type ioctl
comms = nil, ---@type coord_comms comms = nil, ---@type coord_comms
---@class coord_auto_config ---@class coord_control_states
config = { control_states = {
mode = PROCESS.INACTIVE, ---@class coord_auto_config
burn_target = 0.0, process = {
charge_target = 0.0, mode = PROCESS.INACTIVE,
gen_target = 0.0, burn_target = 0.0,
limits = {} charge_target = 0.0,
gen_target = 0.0,
limits = {},
waste_product = PRODUCT.PLUTONIUM,
pu_fallback = false,
sps_low_power = false
},
waste_modes = {},
priority_groups = {}
} }
} }
@@ -39,55 +48,67 @@ function process.init(iocontrol, coord_comms)
self.io = iocontrol self.io = iocontrol
self.comms = coord_comms self.comms = coord_comms
local ctl_proc = self.control_states.process
for i = 1, self.io.facility.num_units do for i = 1, self.io.facility.num_units do
self.config.limits[i] = 0.1 ctl_proc.limits[i] = 0.1
end end
-- load settings local ctrl_states = settings.get("ControlStates", {})
if not settings.load("/coord.settings") then local config = ctrl_states.process ---@type coord_auto_config
log.error("process.init(): failed to load coordinator settings file")
end
local config = settings.get("PROCESS") ---@type coord_auto_config|nil
-- facility auto control configuration
if type(config) == "table" then if type(config) == "table" then
self.config.mode = config.mode ctl_proc.mode = config.mode
self.config.burn_target = config.burn_target ctl_proc.burn_target = config.burn_target
self.config.charge_target = config.charge_target ctl_proc.charge_target = config.charge_target
self.config.gen_target = config.gen_target ctl_proc.gen_target = config.gen_target
self.config.limits = config.limits ctl_proc.limits = config.limits
ctl_proc.waste_product = config.waste_product
ctl_proc.pu_fallback = config.pu_fallback
ctl_proc.sps_low_power = config.sps_low_power
self.io.facility.ps.publish("process_mode", self.config.mode) self.io.facility.ps.publish("process_mode", ctl_proc.mode)
self.io.facility.ps.publish("process_burn_target", self.config.burn_target) self.io.facility.ps.publish("process_burn_target", ctl_proc.burn_target)
self.io.facility.ps.publish("process_charge_target", self.config.charge_target) self.io.facility.ps.publish("process_charge_target", self.io.energy_convert_from_fe(ctl_proc.charge_target))
self.io.facility.ps.publish("process_gen_target", self.config.gen_target) self.io.facility.ps.publish("process_gen_target", self.io.energy_convert_from_fe(ctl_proc.gen_target))
self.io.facility.ps.publish("process_waste_product", ctl_proc.waste_product)
self.io.facility.ps.publish("process_pu_fallback", ctl_proc.pu_fallback)
self.io.facility.ps.publish("process_sps_low_power", ctl_proc.sps_low_power)
for id = 1, math.min(#self.config.limits, self.io.facility.num_units) do for id = 1, math.min(#ctl_proc.limits, self.io.facility.num_units) do
local unit = self.io.units[id] ---@type ioctl_unit local unit = self.io.units[id] ---@type ioctl_unit
unit.unit_ps.publish("burn_limit", self.config.limits[id]) unit.unit_ps.publish("burn_limit", ctl_proc.limits[id])
end end
log.info("PROCESS: loaded auto control settings from coord.settings") log.info("PROCESS: loaded auto control settings")
-- notify supervisor of auto waste config
self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, ctl_proc.waste_product)
self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, ctl_proc.pu_fallback)
self.comms.send_fac_command(FAC_COMMAND.SET_SPS_LP, ctl_proc.sps_low_power)
end end
local waste_mode = settings.get("WASTE_MODES") ---@type table|nil -- unit waste states
local waste_modes = ctrl_states.waste_modes ---@type table|nil
if type(waste_mode) == "table" then if type(waste_modes) == "table" then
for id, mode in pairs(waste_mode) do for id, mode in pairs(waste_modes) do
self.control_states.waste_modes[id] = mode
self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode) self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
end end
log.info("PROCESS: loaded waste mode settings from coord.settings") log.info("PROCESS: loaded unit waste mode settings")
end end
local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil -- unit priority groups
local prio_groups = ctrl_states.priority_groups ---@type table|nil
if type(prio_groups) == "table" then if type(prio_groups) == "table" then
for id, group in pairs(prio_groups) do for id, group in pairs(prio_groups) do
self.control_states.priority_groups[id] = group
self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group) self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group)
end end
log.info("PROCESS: loaded priority groups settings from coord.settings") log.info("PROCESS: loaded priority groups settings")
end end
end end
@@ -137,23 +158,18 @@ end
-- set waste mode -- set waste mode
---@param id integer unit ID ---@param id integer unit ID
---@param mode integer waste mode ---@param mode integer waste mode
function process.set_waste(id, mode) function process.set_unit_waste(id, mode)
-- publish so that if it fails then it gets reset -- publish so that if it fails then it gets reset
self.io.units[id].unit_ps.publish("U_WasteMode", mode) self.io.units[id].unit_ps.publish("U_WasteMode", mode)
self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode) self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
log.debug(util.c("PROCESS: UNIT[", id, "] SET WASTE ", mode)) log.debug(util.c("PROCESS: UNIT[", id, "] SET WASTE ", mode))
local waste_mode = settings.get("WASTE_MODES") ---@type table|nil self.control_states.waste_modes[id] = mode
settings.set("ControlStates", self.control_states)
if type(waste_mode) ~= "table" then waste_mode = {} end if not settings.save("/coordinator.settings") then
log.error("process.set_unit_waste(): failed to save coordinator settings file")
waste_mode[id] = mode
settings.set("WASTE_MODES", waste_mode)
if not settings.save("/coord.settings") then
log.error("process.set_waste(): failed to save coordinator settings file")
end end
end end
@@ -187,15 +203,10 @@ function process.set_group(unit_id, group_id)
self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, unit_id, group_id) self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, unit_id, group_id)
log.debug(util.c("PROCESS: UNIT[", unit_id, "] SET GROUP ", group_id)) log.debug(util.c("PROCESS: UNIT[", unit_id, "] SET GROUP ", group_id))
local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil self.control_states.priority_groups[unit_id] = group_id
settings.set("ControlStates", self.control_states)
if type(prio_groups) ~= "table" then prio_groups = {} end if not settings.save("/coordinator.settings") then
prio_groups[unit_id] = group_id
settings.set("PRIORITY_GROUPS", prio_groups)
if not settings.save("/coord.settings") then
log.error("process.set_group(): failed to save coordinator settings file") log.error("process.set_group(): failed to save coordinator settings file")
end end
end end
@@ -204,6 +215,18 @@ end
-- AUTO PROCESS CONTROL -- -- AUTO PROCESS CONTROL --
-------------------------- --------------------------
-- write auto process control to config file
local function _write_auto_config()
-- save config
settings.set("ControlStates", self.control_states)
local saved = settings.save("/coordinator.settings")
if not saved then
log.warning("process._write_auto_config(): failed to save coordinator settings file")
end
return saved
end
-- stop automatic process control -- stop automatic process control
function process.stop_auto() function process.stop_auto()
self.comms.send_fac_command(FAC_COMMAND.STOP) self.comms.send_fac_command(FAC_COMMAND.STOP)
@@ -212,10 +235,46 @@ end
-- start automatic process control -- start automatic process control
function process.start_auto() function process.start_auto()
self.comms.send_auto_start(self.config) self.comms.send_auto_start(self.control_states.process)
log.debug("PROCESS: START AUTO CTL") log.debug("PROCESS: START AUTO CTL")
end end
-- set automatic process control waste mode
---@param product WASTE_PRODUCT waste product for auto control
function process.set_process_waste(product)
self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, product)
log.debug(util.c("PROCESS: SET WASTE ", product))
-- update config table and save
self.control_states.process.waste_product = product
_write_auto_config()
end
-- set automatic process control plutonium fallback
---@param enabled boolean whether to enable plutonium fallback
function process.set_pu_fallback(enabled)
self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, enabled)
log.debug(util.c("PROCESS: SET PU FALLBACK ", enabled))
-- update config table and save
self.control_states.process.pu_fallback = enabled
_write_auto_config()
end
-- set automatic process control SPS usage at low power
---@param enabled boolean whether to enable SPS usage at low power
function process.set_sps_low_power(enabled)
self.comms.send_fac_command(FAC_COMMAND.SET_SPS_LP, enabled)
log.debug(util.c("PROCESS: SET SPS LOW POWER ", enabled))
-- update config table and save
self.control_states.process.sps_low_power = enabled
_write_auto_config()
end
-- save process control settings -- save process control settings
---@param mode PROCESS control mode ---@param mode PROCESS control mode
---@param burn_target number burn rate target ---@param burn_target number burn rate target
@@ -223,29 +282,18 @@ end
---@param gen_target number generation rate target ---@param gen_target number generation rate target
---@param limits table unit burn rate limits ---@param limits table unit burn rate limits
function process.save(mode, burn_target, charge_target, gen_target, limits) function process.save(mode, burn_target, charge_target, gen_target, limits)
-- attempt to load settings log.debug("PROCESS: SAVE")
if not settings.load("/coord.settings") then
log.warning("process.save(): failed to load coordinator settings file")
end
-- config table -- update config table
self.config = { local ctl_proc = self.control_states.process
mode = mode, ctl_proc.mode = mode
burn_target = burn_target, ctl_proc.burn_target = burn_target
charge_target = charge_target, ctl_proc.charge_target = charge_target
gen_target = gen_target, ctl_proc.gen_target = gen_target
limits = limits ctl_proc.limits = limits
}
-- save config -- save config
settings.set("PROCESS", self.config) self.io.facility.save_cfg_ack(_write_auto_config())
local saved = settings.save("/coord.settings")
if not saved then
log.warning("process.save(): failed to save coordinator settings file")
end
self.io.facility.save_cfg_ack(saved)
end end
-- handle a start command acknowledgement -- handle a start command acknowledgement
@@ -253,21 +301,39 @@ end
function process.start_ack_handle(response) function process.start_ack_handle(response)
local ack = response[1] local ack = response[1]
self.config.mode = response[2] local ctl_proc = self.control_states.process
self.config.burn_target = response[3] ctl_proc.mode = response[2]
self.config.charge_target = response[4] ctl_proc.burn_target = response[3]
self.config.gen_target = response[5] ctl_proc.charge_target = response[4]
ctl_proc.gen_target = response[5]
for i = 1, #response[6] do for i = 1, math.min(#response[6], self.io.facility.num_units) do
self.config.limits[i] = response[6][i] ctl_proc.limits[i] = response[6][i]
local unit = self.io.units[i] ---@type ioctl_unit
unit.unit_ps.publish("burn_limit", ctl_proc.limits[i])
end end
self.io.facility.ps.publish("auto_mode", self.config.mode) self.io.facility.ps.publish("process_mode", ctl_proc.mode)
self.io.facility.ps.publish("burn_target", self.config.burn_target) self.io.facility.ps.publish("process_burn_target", ctl_proc.burn_target)
self.io.facility.ps.publish("charge_target", self.config.charge_target) self.io.facility.ps.publish("process_charge_target", self.io.energy_convert_from_fe(ctl_proc.charge_target))
self.io.facility.ps.publish("gen_target", self.config.gen_target) self.io.facility.ps.publish("process_gen_target", self.io.energy_convert_from_fe(ctl_proc.gen_target))
self.io.facility.start_ack(ack) self.io.facility.start_ack(ack)
end end
-- record waste product state after attempting to change it
---@param response WASTE_PRODUCT supervisor waste product state
function process.waste_ack_handle(response)
self.control_states.process.waste_product = response
self.io.facility.ps.publish("process_waste_product", response)
end
-- record plutonium fallback state after attempting to change it
---@param response boolean supervisor plutonium fallback state
function process.pu_fb_ack_handle(response)
self.control_states.process.pu_fallback = response
self.io.facility.ps.publish("process_pu_fallback", response)
end
return process return process

View File

@@ -2,29 +2,44 @@
-- Graphics Rendering Control -- Graphics Rendering Control
-- --
local log = require("scada-common.log") local log = require("scada-common.log")
local util = require("scada-common.util") local util = require("scada-common.util")
local style = require("coordinator.ui.style") local coordinator = require("coordinator.coordinator")
local iocontrol = require("coordinator.iocontrol")
local main_view = require("coordinator.ui.layout.main_view") local style = require("coordinator.ui.style")
local unit_view = require("coordinator.ui.layout.unit_view") local pgi = require("coordinator.ui.pgi")
local flasher = require("graphics.flasher") local flow_view = require("coordinator.ui.layout.flow_view")
local panel_view = require("coordinator.ui.layout.front_panel")
local main_view = require("coordinator.ui.layout.main_view")
local unit_view = require("coordinator.ui.layout.unit_view")
local core = require("graphics.core")
local flasher = require("graphics.flasher")
local DisplayBox = require("graphics.elements.displaybox")
local log_render = coordinator.log_render
---@class coord_renderer
local renderer = {} local renderer = {}
-- render engine -- render engine
local engine = { local engine = {
monitors = nil, color_mode = 1, ---@type COLOR_MODE
dmesg_window = nil, monitors = nil, ---@type monitors_struct|nil
ui_ready = false dmesg_window = nil, ---@type table|nil
} ui_ready = false,
fp_ready = false,
-- UI layouts ui = {
local ui = { front_panel = nil, ---@type graphics_element|nil
main_layout = nil, main_display = nil, ---@type graphics_element|nil
unit_layouts = {} flow_display = nil, ---@type graphics_element|nil
unit_displays = {}
},
disable_flow_view = false
} }
-- init a display to the "default", but set text scale to 0.5 -- init a display to the "default", but set text scale to 0.5
@@ -37,149 +52,470 @@ local function _init_display(monitor)
monitor.setCursorPos(1, 1) monitor.setCursorPos(1, 1)
-- set overridden colors -- set overridden colors
for i = 1, #style.colors do for i = 1, #style.theme.colors do
monitor.setPaletteColor(style.colors[i].c, style.colors[i].hex) monitor.setPaletteColor(style.theme.colors[i].c, style.theme.colors[i].hex)
end end
-- apply color mode
local c_mode_overrides = style.theme.color_modes[engine.color_mode]
for i = 1, #c_mode_overrides do
monitor.setPaletteColor(c_mode_overrides[i].c, c_mode_overrides[i].hex)
end
end
-- print out that the monitor is too small
---@param monitor table monitor
local function _print_too_small(monitor)
monitor.setCursorPos(1, 1)
monitor.setBackgroundColor(colors.black)
monitor.setTextColor(colors.red)
monitor.clear()
monitor.write("monitor too small")
end
-- apply renderer configurations
---@param config crd_config
function renderer.configure(config)
style.set_themes(config.MainTheme, config.FrontPanelTheme, config.ColorMode)
engine.color_mode = config.ColorMode
engine.disable_flow_view = config.DisableFlowView
end end
-- link to the monitor peripherals -- link to the monitor peripherals
---@param monitors monitors_struct ---@param monitors monitors_struct
function renderer.set_displays(monitors) function renderer.set_displays(monitors)
engine.monitors = monitors engine.monitors = monitors
end
-- check if the renderer is configured to use a given monitor peripheral -- report to front panel as connected
---@nodiscard iocontrol.fp_monitor_state("main", engine.monitors.main ~= nil)
---@param periph table peripheral iocontrol.fp_monitor_state("flow", engine.monitors.flow ~= nil)
---@return boolean is_used for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end
function renderer.is_monitor_used(periph)
if engine.monitors ~= nil then
if engine.monitors.primary == periph then
return true
else
for i = 1, #engine.monitors.unit_displays do
if engine.monitors.unit_displays[i] == periph then
return true
end
end
end
end
return false
end end
-- init all displays in use by the renderer -- init all displays in use by the renderer
function renderer.init_displays() function renderer.init_displays()
-- init primary monitor -- init main and flow monitors
_init_display(engine.monitors.primary) _init_display(engine.monitors.main)
if not engine.disable_flow_view then _init_display(engine.monitors.flow) end
-- init unit displays -- init unit displays
for _, monitor in pairs(engine.monitors.unit_displays) do for _, monitor in ipairs(engine.monitors.unit_displays) do
_init_display(monitor) _init_display(monitor)
end end
end
-- check main display width -- init terminal
---@nodiscard term.setTextColor(colors.white)
---@return boolean width_okay term.setBackgroundColor(colors.black)
function renderer.validate_main_display_width() term.clear()
local w, _ = engine.monitors.primary.getSize() term.setCursorPos(1, 1)
return w == 164
end
-- check display sizes -- set overridden colors
---@nodiscard for i = 1, #style.fp_theme.colors do
---@return boolean valid all unit display dimensions OK term.setPaletteColor(style.fp_theme.colors[i].c, style.fp_theme.colors[i].hex)
function renderer.validate_unit_display_sizes()
local valid = true
for id, monitor in pairs(engine.monitors.unit_displays) do
local w, h = monitor.getSize()
if w ~= 79 or h ~= 52 then
log.warning(util.c("RENDERER: unit ", id, " display resolution not 79 wide by 52 tall: ", w, ", ", h))
valid = false
end
end end
return valid -- apply color mode
local c_mode_overrides = style.fp_theme.color_modes[engine.color_mode]
for i = 1, #c_mode_overrides do
term.setPaletteColor(c_mode_overrides[i].c, c_mode_overrides[i].hex)
end
end end
-- initialize the dmesg output window -- initialize the dmesg output window
function renderer.init_dmesg() function renderer.init_dmesg()
local disp_x, disp_y = engine.monitors.primary.getSize() local disp_w, disp_h = engine.monitors.main.getSize()
engine.dmesg_window = window.create(engine.monitors.primary, 1, 1, disp_x, disp_y) engine.dmesg_window = window.create(engine.monitors.main, 1, 1, disp_w, disp_h)
log.direct_dmesg(engine.dmesg_window) log.direct_dmesg(engine.dmesg_window)
end end
-- start the coordinator GUI -- try to start the front panel
function renderer.start_ui() ---@return boolean success, any error_msg
function renderer.try_start_fp()
local status, msg = true, nil
if not engine.fp_ready then
-- show front panel view on terminal
status, msg = pcall(function ()
engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
end)
if status then
-- start flasher callback task and report ready
flasher.run()
engine.fp_ready = true
else
-- report fail and close front panel
msg = core.extract_assert_msg(msg)
renderer.close_fp()
end
end
return status, msg
end
-- close out the front panel
function renderer.close_fp()
if engine.fp_ready then
if not engine.ui_ready then
-- stop blinking indicators
flasher.clear()
end
-- disable PGI
pgi.unlink()
-- hide to stop animation callbacks and clear root UI elements
engine.ui.front_panel.hide()
engine.ui.front_panel = nil
engine.fp_ready = false
-- restore colors
for i = 1, #style.fp_theme.colors do
local r, g, b = term.nativePaletteColor(style.fp_theme.colors[i].c)
term.setPaletteColor(style.fp_theme.colors[i].c, r, g, b)
end
-- reset terminal
term.setTextColor(colors.white)
term.setBackgroundColor(colors.black)
term.clear()
term.setCursorPos(1, 1)
end
end
-- try to start the main GUI
---@return boolean success, any error_msg
function renderer.try_start_ui()
local status, msg = true, nil
if not engine.ui_ready then if not engine.ui_ready then
-- hide dmesg -- hide dmesg
engine.dmesg_window.setVisible(false) engine.dmesg_window.setVisible(false)
-- show main view on main monitor status, msg = pcall(function ()
ui.main_layout = main_view(engine.monitors.primary) -- show main view on main monitor
if engine.monitors.main ~= nil then
engine.ui.main_display = DisplayBox{window=engine.monitors.main,fg_bg=style.root}
main_view(engine.ui.main_display)
util.nop()
end
-- show unit views on unit displays -- show flow view on flow monitor
for id, monitor in pairs(engine.monitors.unit_displays) do if engine.monitors.flow ~= nil then
table.insert(ui.unit_layouts, unit_view(monitor, id)) engine.ui.flow_display = DisplayBox{window=engine.monitors.flow,fg_bg=style.root}
flow_view(engine.ui.flow_display)
util.nop()
end
-- show unit views on unit displays
for idx, display in pairs(engine.monitors.unit_displays) do
engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
unit_view(engine.ui.unit_displays[idx], idx)
util.nop()
end
end)
if status then
-- start flasher callback task and report ready
flasher.run()
engine.ui_ready = true
else
-- report fail and close ui
msg = core.extract_assert_msg(msg)
renderer.close_ui()
end end
-- start flasher callback task
flasher.run()
-- report ui as ready
engine.ui_ready = true
end end
return status, msg
end end
-- close out the UI -- close out the UI
function renderer.close_ui() function renderer.close_ui()
if not engine.fp_ready then
-- stop blinking indicators
flasher.clear()
end
-- delete element trees
if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end
if engine.ui.flow_display ~= nil then engine.ui.flow_display.delete() end
for _, display in pairs(engine.ui.unit_displays) do display.delete() end
-- report ui as not ready -- report ui as not ready
engine.ui_ready = false engine.ui_ready = false
-- stop blinking indicators
flasher.clear()
if engine.ui_ready then
-- hide to stop animation callbacks
ui.main_layout.hide()
for i = 1, #ui.unit_layouts do
ui.unit_layouts[i].hide()
engine.monitors.unit_displays[i].clear()
end
else
-- clear unit displays
for i = 1, #ui.unit_layouts do
engine.monitors.unit_displays[i].clear()
end
end
-- clear root UI elements -- clear root UI elements
ui.main_layout = nil engine.ui.main_display = nil
ui.unit_layouts = {} engine.ui.flow_display = nil
engine.ui.unit_displays = {}
-- clear unit monitors
for _, monitor in ipairs(engine.monitors.unit_displays) do monitor.clear() end
if not engine.disable_flow_view then
-- clear flow monitor
engine.monitors.flow.clear()
end
-- re-draw dmesg -- re-draw dmesg
engine.dmesg_window.setVisible(true) engine.dmesg_window.setVisible(true)
engine.dmesg_window.redraw() engine.dmesg_window.redraw()
end end
-- is the front panel ready?
---@nodiscard
---@return boolean ready
function renderer.fp_ready() return engine.fp_ready end
-- is the UI ready? -- is the UI ready?
---@nodiscard ---@nodiscard
---@return boolean ready ---@return boolean ready
function renderer.ui_ready() return engine.ui_ready end function renderer.ui_ready() return engine.ui_ready end
-- handle a touch event -- handle a monitor peripheral being disconnected
---@param event monitor_touch ---@param device table monitor
function renderer.handle_touch(event) ---@return boolean is_used if the monitor is one of the configured monitors
if event.monitor == engine.monitors.primary_name then function renderer.handle_disconnect(device)
ui.main_layout.handle_touch(event) local is_used = false
if not engine.monitors then return false end
if engine.monitors.main == device then
if engine.ui.main_display ~= nil then
-- delete element tree and clear root UI elements
engine.ui.main_display.delete()
end
is_used = true
engine.monitors.main = nil
engine.ui.main_display = nil
iocontrol.fp_monitor_state("main", false)
elseif engine.monitors.flow == device then
if engine.ui.flow_display ~= nil then
-- delete element tree and clear root UI elements
engine.ui.flow_display.delete()
end
is_used = true
engine.monitors.flow = nil
engine.ui.flow_display = nil
iocontrol.fp_monitor_state("flow", false)
else else
for id, monitor in pairs(engine.monitors.unit_name_map) do for idx, monitor in pairs(engine.monitors.unit_displays) do
if event.monitor == monitor then if monitor == device then
local layout = ui.unit_layouts[id] ---@type graphics_element if engine.ui.unit_displays[idx] ~= nil then
layout.handle_touch(event) engine.ui.unit_displays[idx].delete()
end
is_used = true
engine.monitors.unit_displays[idx] = nil
engine.ui.unit_displays[idx] = nil
iocontrol.fp_monitor_state(idx, false)
break
end
end
end
return is_used
end
-- handle a monitor peripheral being reconnected
---@param name string monitor name
---@param device table monitor
---@return boolean is_used if the monitor is one of the configured monitors
function renderer.handle_reconnect(name, device)
local is_used = false
if not engine.monitors then return false end
-- note: handle_resize is a more adaptive way of re-initializing a connected monitor
-- since it can handle a monitor being reconnected that isn't the right size
if engine.monitors.main_name == name then
is_used = true
engine.monitors.main = device
renderer.handle_resize(name)
elseif engine.monitors.flow_name == name then
is_used = true
engine.monitors.flow = device
renderer.handle_resize(name)
else
for idx, monitor in ipairs(engine.monitors.unit_name_map) do
if monitor == name then
is_used = true
engine.monitors.unit_displays[idx] = device
renderer.handle_resize(name)
break
end
end
end
return is_used
end
-- handle a monitor being resized<br>
-- returns if this monitor is assigned + if the assigned screen still fits
---@param name string monitor name
---@return boolean is_used, boolean is_ok
function renderer.handle_resize(name)
local is_used = false
local is_ok = true
local ui = engine.ui
if not engine.monitors then return false, false end
if engine.monitors.main_name == name and engine.monitors.main then
local device = engine.monitors.main ---@type table
-- this is necessary if the bottom left block was broken and on reconnect
_init_display(device)
is_used = true
-- resize dmesg window if needed, but don't make it thinner
local disp_w, disp_h = engine.monitors.main.getSize()
local dmsg_w, _ = engine.dmesg_window.getSize()
engine.dmesg_window.reposition(1, 1, math.max(disp_w, dmsg_w), disp_h, engine.monitors.main)
if ui.main_display then
ui.main_display.delete()
ui.main_display = nil
end
iocontrol.fp_monitor_state("main", true)
engine.dmesg_window.setVisible(not engine.ui_ready)
if engine.ui_ready then
local draw_start = util.time_ms()
local ok = pcall(function ()
ui.main_display = DisplayBox{window=device,fg_bg=style.root}
main_view(ui.main_display)
end)
if ok then
log_render("main view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
else
if ui.main_display then
ui.main_display.delete()
ui.main_display = nil
end
_print_too_small(device)
iocontrol.fp_monitor_state("main", false)
is_ok = false
end
else engine.dmesg_window.redraw() end
elseif engine.monitors.flow_name == name and engine.monitors.flow then
local device = engine.monitors.flow ---@type table
-- this is necessary if the bottom left block was broken and on reconnect
_init_display(device)
is_used = true
if ui.flow_display then
ui.flow_display.delete()
ui.flow_display = nil
end
iocontrol.fp_monitor_state("flow", true)
if engine.ui_ready then
local draw_start = util.time_ms()
local ok = pcall(function ()
ui.flow_display = DisplayBox{window=device,fg_bg=style.root}
flow_view(ui.flow_display)
end)
if ok then
log_render("flow view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
else
if ui.flow_display then
ui.flow_display.delete()
ui.flow_display = nil
end
_print_too_small(device)
iocontrol.fp_monitor_state("flow", false)
is_ok = false
end
end
else
for idx, monitor in ipairs(engine.monitors.unit_name_map) do
local device = engine.monitors.unit_displays[idx]
if monitor == name and device then
-- this is necessary if the bottom left block was broken and on reconnect
_init_display(device)
is_used = true
if ui.unit_displays[idx] then
ui.unit_displays[idx].delete()
ui.unit_displays[idx] = nil
end
iocontrol.fp_monitor_state(idx, true)
if engine.ui_ready then
local draw_start = util.time_ms()
local ok = pcall(function ()
ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
unit_view(ui.unit_displays[idx], idx)
end)
if ok then
log_render("unit " .. idx .. " view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
else
if ui.unit_displays[idx] then
ui.unit_displays[idx].delete()
ui.unit_displays[idx] = nil
end
_print_too_small(device)
iocontrol.fp_monitor_state(idx, false)
is_ok = false
end
end
break
end
end
end
return is_used, is_ok
end
-- handle a touch event
---@param event mouse_interaction|nil
function renderer.handle_mouse(event)
if event ~= nil then
if engine.fp_ready and event.monitor == "terminal" then
engine.ui.front_panel.handle_mouse(event)
elseif engine.ui_ready then
if event.monitor == engine.monitors.main_name then
if engine.ui.main_display then engine.ui.main_display.handle_mouse(event) end
elseif event.monitor == engine.monitors.flow_name then
if engine.ui.flow_display then engine.ui.flow_display.handle_mouse(event) end
else
for id, monitor in ipairs(engine.monitors.unit_name_map) do
local display = engine.ui.unit_displays[id]
if event.monitor == monitor and display then
if display then display.handle_mouse(event) end
end
end
end end
end end
end end

View File

@@ -0,0 +1,178 @@
local log = require("scada-common.log")
local mqueue = require("scada-common.mqueue")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local pocket = require("coordinator.session.pocket")
local apisessions = {}
local self = {
nic = nil, ---@type nic
config = nil, ---@type crd_config
next_id = 0,
sessions = {}
}
-- PRIVATE FUNCTIONS --
-- handle a session output queue
---@param session pkt_session_struct
local function _api_handle_outq(session)
-- record handler start time
local handle_start = util.time()
-- process output queue
while session.out_queue.ready() do
-- get a new message to process
local msg = session.out_queue.pop()
if msg ~= nil then
if msg.qtype == mqueue.TYPE.PACKET then
-- handle a packet to be sent
self.nic.transmit(self.config.PKT_Channel, self.config.CRD_Channel, msg.message)
elseif msg.qtype == mqueue.TYPE.COMMAND then
-- handle instruction/notification
elseif msg.qtype == mqueue.TYPE.DATA then
-- instruction/notification with body
end
end
-- max 100ms spent processing queue
if util.time() - handle_start > 100 then
log.warning("API: out queue handler exceeded 100ms queue process limit")
log.warning(util.c("API: offending session: ", session))
break
end
end
end
-- cleanly close a session
---@param session pkt_session_struct
local function _shutdown(session)
session.open = false
session.instance.close()
-- send packets in out queue (namely the close packet)
while session.out_queue.ready() do
local msg = session.out_queue.pop()
if msg ~= nil and msg.qtype == mqueue.TYPE.PACKET then
self.nic.transmit(self.config.PKT_Channel, self.config.CRD_Channel, msg.message)
end
end
log.debug(util.c("API: closed session ", session))
end
-- PUBLIC FUNCTIONS --
-- initialize apisessions
---@param nic nic network interface
---@param config crd_config coordinator config
function apisessions.init(nic, config)
self.nic = nic
self.config = config
end
-- find a session by remote port
---@nodiscard
---@param source_addr integer
---@return pkt_session_struct|nil
function apisessions.find_session(source_addr)
for i = 1, #self.sessions do
if self.sessions[i].s_addr == source_addr then return self.sessions[i] end
end
return nil
end
-- establish a new API session
---@nodiscard
---@param source_addr integer pocket computer ID
---@param i_seq_num integer initial (most recent) sequence number
---@param version string pocket version
---@return integer session_id
function apisessions.establish_session(source_addr, i_seq_num, version)
---@class pkt_session_struct
local pkt_s = {
open = true,
version = version,
s_addr = source_addr,
in_queue = mqueue.new(),
out_queue = mqueue.new(),
instance = nil ---@type pkt_session
}
local id = self.next_id
pkt_s.instance = pocket.new_session(id, source_addr, i_seq_num, pkt_s.in_queue, pkt_s.out_queue, self.config.API_Timeout)
table.insert(self.sessions, pkt_s)
local mt = {
---@param s pkt_session_struct
__tostring = function (s) return util.c("PKT [", id, "] (@", s.s_addr, ")") end
}
setmetatable(pkt_s, mt)
iocontrol.fp_pkt_connected(id, version, source_addr)
log.debug(util.c("API: established new session: ", pkt_s))
self.next_id = id + 1
-- success
return pkt_s.instance.get_id()
end
-- attempt to identify which session's watchdog timer fired
---@param timer_event number
function apisessions.check_all_watchdogs(timer_event)
for i = 1, #self.sessions do
local session = self.sessions[i] ---@type pkt_session_struct
if session.open then
local triggered = session.instance.check_wd(timer_event)
if triggered then
log.debug(util.c("API: watchdog closing session ", session, "..."))
_shutdown(session)
end
end
end
end
-- iterate all the API sessions
function apisessions.iterate_all()
for i = 1, #self.sessions do
local session = self.sessions[i] ---@type pkt_session_struct
if session.open and session.instance.iterate() then
_api_handle_outq(session)
else
session.open = false
end
end
end
-- delete all closed sessions
function apisessions.free_all_closed()
local f = function (session) return session.open end
---@param session pkt_session_struct
local on_delete = function (session)
log.debug(util.c("API: free'ing closed session ", session))
end
util.filter_table(self.sessions, f, on_delete)
end
-- close all open connections
function apisessions.close_all()
for i = 1, #self.sessions do
local session = self.sessions[i] ---@type pkt_session_struct
if session.open then _shutdown(session) end
end
apisessions.free_all_closed()
end
return apisessions

View File

@@ -0,0 +1,292 @@
local comms = require("scada-common.comms")
local log = require("scada-common.log")
local mqueue = require("scada-common.mqueue")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local pocket = {}
local PROTOCOL = comms.PROTOCOL
local CRDN_TYPE = comms.CRDN_TYPE
local MGMT_TYPE = comms.MGMT_TYPE
-- retry time constants in ms
-- local INITIAL_WAIT = 1500
-- local RETRY_PERIOD = 1000
local API_S_CMDS = {
}
local API_S_DATA = {
}
pocket.API_S_CMDS = API_S_CMDS
pocket.API_S_DATA = API_S_DATA
local PERIODICS = {
KEEP_ALIVE = 2000
}
-- pocket API session
---@nodiscard
---@param id integer session ID
---@param s_addr integer device source address
---@param i_seq_num integer initial sequence number
---@param in_queue mqueue in message queue
---@param out_queue mqueue out message queue
---@param timeout number communications timeout
function pocket.new_session(id, s_addr, i_seq_num, in_queue, out_queue, timeout)
local log_header = "pkt_session(" .. id .. "): "
local self = {
-- connection properties
seq_num = i_seq_num + 2, -- next after the establish approval was sent
r_seq_num = i_seq_num + 1,
connected = true,
conn_watchdog = util.new_watchdog(timeout),
last_rtt = 0,
-- periodic messages
periodics = {
last_update = 0,
keep_alive = 0
},
-- when to next retry one of these requests
retry_times = {
},
-- command acknowledgements
acks = {
},
-- session database
---@class api_db
sDB = {
}
}
---@class pkt_session
local public = {}
-- mark this pocket session as closed, stop watchdog
local function _close()
self.conn_watchdog.cancel()
self.connected = false
iocontrol.fp_pkt_disconnected(id)
end
-- send a CRDN packet
---@param msg_type CRDN_TYPE
---@param msg table
local function _send(msg_type, msg)
local s_pkt = comms.scada_packet()
local c_pkt = comms.crdn_packet()
c_pkt.make(msg_type, msg)
s_pkt.make(s_addr, self.seq_num, PROTOCOL.SCADA_CRDN, c_pkt.raw_sendable())
out_queue.push_packet(s_pkt)
self.seq_num = self.seq_num + 1
end
-- send a SCADA management packet
---@param msg_type MGMT_TYPE
---@param msg table
local function _send_mgmt(msg_type, msg)
local s_pkt = comms.scada_packet()
local m_pkt = comms.mgmt_packet()
m_pkt.make(msg_type, msg)
s_pkt.make(s_addr, self.seq_num, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
out_queue.push_packet(s_pkt)
self.seq_num = self.seq_num + 1
end
-- handle a packet
---@param pkt mgmt_frame|crdn_frame
local function _handle_packet(pkt)
-- check sequence number
if self.r_seq_num ~= pkt.scada_frame.seq_num() then
log.warning(log_header .. "sequence out-of-order: next = " .. self.r_seq_num .. ", new = " .. pkt.scada_frame.seq_num())
return
else
self.r_seq_num = pkt.scada_frame.seq_num() + 1
end
-- feed watchdog
self.conn_watchdog.feed()
-- process packet
if pkt.scada_frame.protocol() == PROTOCOL.SCADA_CRDN then
---@cast pkt crdn_frame
local db = iocontrol.get_db()
-- handle packet by type
if pkt.type == CRDN_TYPE.API_GET_FAC then
local fac = db.facility
local data = {
fac.all_sys_ok,
fac.rtu_count,
fac.radiation,
{ fac.auto_ready, fac.auto_active, fac.auto_ramping, fac.auto_saturated },
{ fac.auto_current_waste_product, fac.auto_pu_fallback_active },
util.table_len(fac.tank_data_tbl),
fac.induction_data_tbl[1] ~= nil,
fac.sps_data_tbl[1] ~= nil,
}
_send(CRDN_TYPE.API_GET_FAC, data)
elseif pkt.type == CRDN_TYPE.API_GET_UNIT then
if pkt.length == 1 and type(pkt.data[1]) == "number" then
local u = db.units[pkt.data[1]] ---@type ioctl_unit
if u then
local data = {
u.unit_id,
u.connected,
u.rtu_hw,
u.alarms,
u.annunciator,
u.reactor_data,
u.boiler_data_tbl,
u.turbine_data_tbl,
u.tank_data_tbl,
u.last_rate_change_ms,
u.turbine_flow_stable
}
_send(CRDN_TYPE.API_GET_UNIT, data)
end
end
else
log.debug(log_header .. "handler received unsupported CRDN packet type " .. pkt.type)
end
elseif pkt.scada_frame.protocol() == PROTOCOL.SCADA_MGMT then
---@cast pkt mgmt_frame
if pkt.type == MGMT_TYPE.KEEP_ALIVE then
-- keep alive reply
if pkt.length == 2 then
local srv_start = pkt.data[1]
-- local api_send = pkt.data[2]
local srv_now = util.time()
self.last_rtt = srv_now - srv_start
if self.last_rtt > 750 then
log.warning(log_header .. "PKT KEEP_ALIVE round trip time > 750ms (" .. self.last_rtt .. "ms)")
end
-- log.debug(log_header .. "PKT RTT = " .. self.last_rtt .. "ms")
-- log.debug(log_header .. "PKT TT = " .. (srv_now - api_send) .. "ms")
iocontrol.fp_pkt_rtt(id, self.last_rtt)
else
log.debug(log_header .. "SCADA keep alive packet length mismatch")
end
elseif pkt.type == MGMT_TYPE.CLOSE then
-- close the session
_close()
elseif pkt.type == MGMT_TYPE.ESTABLISH then
-- something is wrong, kill the session
_close()
log.warning(log_header .. "terminated session due to an unexpected ESTABLISH packet")
else
log.debug(log_header .. "handler received unsupported SCADA_MGMT packet type " .. pkt.type)
end
end
end
-- PUBLIC FUNCTIONS --
-- get the session ID
---@nodiscard
function public.get_id() return id end
-- get the session database
---@nodiscard
function public.get_db() return self.sDB end
-- check if a timer matches this session's watchdog
---@nodiscard
function public.check_wd(timer)
return self.conn_watchdog.is_timer(timer) and self.connected
end
-- close the connection
function public.close()
_close()
_send_mgmt(MGMT_TYPE.CLOSE, {})
log.info(log_header .. "session closed by server")
end
-- iterate the session
---@nodiscard
---@return boolean connected
function public.iterate()
if self.connected then
------------------
-- handle queue --
------------------
local handle_start = util.time()
while in_queue.ready() and self.connected do
-- get a new message to process
local message = in_queue.pop()
if message ~= nil then
if message.qtype == mqueue.TYPE.PACKET then
-- handle a packet
_handle_packet(message.message)
elseif message.qtype == mqueue.TYPE.COMMAND then
-- handle instruction
elseif message.qtype == mqueue.TYPE.DATA then
-- instruction with body
end
end
-- max 100ms spent processing queue
if util.time() - handle_start > 100 then
log.warning(log_header .. "exceeded 100ms queue process limit")
break
end
end
-- exit if connection was closed
if not self.connected then
log.info(log_header .. "session closed by remote host")
return self.connected
end
----------------------
-- update periodics --
----------------------
local elapsed = util.time() - self.periodics.last_update
local periodics = self.periodics
-- keep alive
periodics.keep_alive = periodics.keep_alive + elapsed
if periodics.keep_alive >= PERIODICS.KEEP_ALIVE then
_send_mgmt(MGMT_TYPE.KEEP_ALIVE, { util.time() })
periodics.keep_alive = 0
end
self.periodics.last_update = util.time()
---------------------
-- attempt retries --
---------------------
-- local rtimes = self.retry_times
end
return self.connected
end
return public
end
return pocket

View File

@@ -2,268 +2,25 @@
-- Alarm Sounder -- Alarm Sounder
-- --
local audio = require("scada-common.audio")
local log = require("scada-common.log") local log = require("scada-common.log")
local types = require("scada-common.types")
local util = require("scada-common.util")
local ALARM = types.ALARM
local ALARM_STATE = types.ALARM_STATE
---@class sounder ---@class sounder
local sounder = {} local sounder = {}
local _2_PI = 2 * math.pi -- 2 whole pies, hope you're hungry
local _DRATE = 48000 -- 48kHz audio
local _MAX_VAL = 127 / 2 -- max signed integer in this 8-bit audio
local _MAX_SAMPLES = 0x20000 -- 128 * 1024 samples
local _05s_SAMPLES = 24000 -- half a second worth of samples
local test_alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
local alarm_ctl = { local alarm_ctl = {
speaker = nil, speaker = nil,
volume = 0.5, volume = 0.5,
playing = false, stream = audio.new_stream()
num_active = 0,
next_block = 1,
-- split audio up into 0.5s samples so specific components can be ended quicker
quad_buffer = { {}, {}, {}, {} }
} }
-- sounds modeled after https://www.e2s.com/references-and-guidelines/listen-and-download-alarm-tones
local T_340Hz_Int_2Hz = 1
local T_544Hz_440Hz_Alt = 2
local T_660Hz_Int_125ms = 3
local T_745Hz_Int_1Hz = 4
local T_800Hz_Int = 5
local T_800Hz_1000Hz_Alt = 6
local T_1000Hz_Int = 7
local T_1800Hz_Int_4Hz = 8
local TONES = {
{ active = false, component = { {}, {}, {}, {} } }, -- 340Hz @ 2Hz Intermittent
{ active = false, component = { {}, {}, {}, {} } }, -- 544Hz 100mS / 440Hz 400mS Alternating
{ active = false, component = { {}, {}, {}, {} } }, -- 660Hz @ 125ms On 125ms Off
{ active = false, component = { {}, {}, {}, {} } }, -- 745Hz @ 1Hz Intermittent
{ active = false, component = { {}, {}, {}, {} } }, -- 800Hz @ 0.25s On 1.75s Off
{ active = false, component = { {}, {}, {}, {} } }, -- 800/1000Hz @ 0.25s Alternating
{ active = false, component = { {}, {}, {}, {} } }, -- 1KHz 1s on, 1s off Intermittent
{ active = false, component = { {}, {}, {}, {} } } -- 1.8KHz @ 4Hz Intermittent
}
-- calculate how many samples are in the given number of milliseconds
---@nodiscard
---@param ms integer milliseconds
---@return integer samples
local function ms_to_samples(ms) return math.floor(ms * 48) end
--#region Tone Generation (the Maths)
-- 340Hz @ 2Hz Intermittent
local function gen_tone_1()
local t, dt = 0, _2_PI * 340 / _DRATE
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[1].component[1][i] = val
TONES[1].component[3][i] = val
TONES[1].component[2][i] = 0
TONES[1].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 544Hz 100mS / 440Hz 400mS Alternating
local function gen_tone_2()
local t1, dt1 = 0, _2_PI * 544 / _DRATE
local t2, dt2 = 0, _2_PI * 440 / _DRATE
local alternate_at = ms_to_samples(100)
for i = 1, _05s_SAMPLES do
local value
if i <= alternate_at then
value = math.floor(math.sin(t1) * _MAX_VAL)
t1 = (t1 + dt1) % _2_PI
else
value = math.floor(math.sin(t2) * _MAX_VAL)
t2 = (t2 + dt2) % _2_PI
end
TONES[2].component[1][i] = value
TONES[2].component[2][i] = value
TONES[2].component[3][i] = value
TONES[2].component[4][i] = value
end
end
-- 660Hz @ 125ms On 125ms Off
local function gen_tone_3()
local elapsed_samples = 0
local alternate_after = ms_to_samples(125)
local alternate_at = alternate_after
local mode = true
local t, dt = 0, _2_PI * 660 / _DRATE
for set = 1, 4 do
for i = 1, _05s_SAMPLES do
if mode then
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[3].component[set][i] = val
t = (t + dt) % _2_PI
else
t = 0
TONES[3].component[set][i] = 0
end
if elapsed_samples == alternate_at then
mode = not mode
alternate_at = elapsed_samples + alternate_after
end
elapsed_samples = elapsed_samples + 1
end
end
end
-- 745Hz @ 1Hz Intermittent
local function gen_tone_4()
local t, dt = 0, _2_PI * 745 / _DRATE
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[4].component[1][i] = val
TONES[4].component[3][i] = val
TONES[4].component[2][i] = 0
TONES[4].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 800Hz @ 0.25s On 1.75s Off
local function gen_tone_5()
local t, dt = 0, _2_PI * 800 / _DRATE
local stop_at = ms_to_samples(250)
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
if i > stop_at then
TONES[5].component[1][i] = val
else
TONES[5].component[1][i] = 0
end
TONES[5].component[2][i] = 0
TONES[5].component[3][i] = 0
TONES[5].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 1000/800Hz @ 0.25s Alternating
local function gen_tone_6()
local t1, dt1 = 0, _2_PI * 1000 / _DRATE
local t2, dt2 = 0, _2_PI * 800 / _DRATE
local alternate_at = ms_to_samples(250)
for i = 1, _05s_SAMPLES do
local val
if i <= alternate_at then
val = math.floor(math.sin(t1) * _MAX_VAL)
t1 = (t1 + dt1) % _2_PI
else
val = math.floor(math.sin(t2) * _MAX_VAL)
t2 = (t2 + dt2) % _2_PI
end
TONES[6].component[1][i] = val
TONES[6].component[2][i] = val
TONES[6].component[3][i] = val
TONES[6].component[4][i] = val
end
end
-- 1KHz 1s on, 1s off Intermittent
local function gen_tone_7()
local t, dt = 0, _2_PI * 1000 / _DRATE
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[7].component[1][i] = val
TONES[7].component[2][i] = val
TONES[7].component[3][i] = 0
TONES[7].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 1800Hz @ 4Hz Intermittent
local function gen_tone_8()
local t, dt = 0, _2_PI * 1800 / _DRATE
local off_at = ms_to_samples(250)
for i = 1, _05s_SAMPLES do
local val = 0
if i <= off_at then
val = math.floor(math.sin(t) * _MAX_VAL)
t = (t + dt) % _2_PI
end
TONES[8].component[1][i] = val
TONES[8].component[2][i] = val
TONES[8].component[3][i] = val
TONES[8].component[4][i] = val
end
end
--#endregion
-- hard audio limiter
---@nodiscard
---@param output number output level
---@return number limited -128.0 to 127.0
local function limit(output)
return math.max(-128, math.min(127, output))
end
-- zero the alarm audio buffer
local function zero()
for i = 1, 4 do
for s = 1, _05s_SAMPLES do alarm_ctl.quad_buffer[i][s] = 0 end
end
end
-- add an alarm to the output buffer
---@param alarm_idx integer tone ID
local function add(alarm_idx)
alarm_ctl.num_active = alarm_ctl.num_active + 1
TONES[alarm_idx].active = true
for i = 1, 4 do
for s = 1, _05s_SAMPLES do
alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] + TONES[alarm_idx].component[i][s])
end
end
end
-- start audio or continue audio on buffer empty -- start audio or continue audio on buffer empty
---@return boolean success successfully added buffer to audio output ---@return boolean success successfully added buffer to audio output
local function play() local function play()
if not alarm_ctl.playing then if not alarm_ctl.playing then
alarm_ctl.playing = true alarm_ctl.playing = true
alarm_ctl.next_block = 1
return sounder.continue() return sounder.continue()
else else return true end
return true
end
end end
-- initialize the annunciator alarm system -- initialize the annunciator alarm system
@@ -272,23 +29,10 @@ end
function sounder.init(speaker, volume) function sounder.init(speaker, volume)
alarm_ctl.speaker = speaker alarm_ctl.speaker = speaker
alarm_ctl.speaker.stop() alarm_ctl.speaker.stop()
alarm_ctl.volume = volume alarm_ctl.volume = volume
alarm_ctl.playing = false alarm_ctl.stream.stop()
alarm_ctl.num_active = 0
alarm_ctl.next_block = 1
zero() audio.generate_tones()
-- generate tones
gen_tone_1()
gen_tone_2()
gen_tone_3()
gen_tone_4()
gen_tone_5()
gen_tone_6()
gen_tone_7()
gen_tone_8()
end end
-- reconnect the speaker peripheral -- reconnect the speaker peripheral
@@ -296,173 +40,40 @@ end
function sounder.reconnect(speaker) function sounder.reconnect(speaker)
alarm_ctl.speaker = speaker alarm_ctl.speaker = speaker
alarm_ctl.playing = false alarm_ctl.playing = false
alarm_ctl.next_block = 1 alarm_ctl.stream.stop()
alarm_ctl.num_active = 0
for id = 1, #TONES do TONES[id].active = false end
end end
-- check alarm state to enable/disable alarms -- set alarm tones
---@param units table|nil unit list or nil to use test mode ---@param states table alarm tone commands from supervisor
function sounder.eval(units) function sounder.set(states)
local changed = false -- set tone states
local any_active = false for id = 1, #states do alarm_ctl.stream.set_active(id, states[id]) end
local new_states = { false, false, false, false, false, false, false, false }
local alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
if units ~= nil then -- re-compute output if needed, then play audio if available
-- check all alarms for all units if alarm_ctl.stream.is_recompute_needed() then alarm_ctl.stream.compute_buffer() end
for i = 1, #units do if alarm_ctl.stream.any_active() then play() else sounder.stop() end
local unit = units[i] ---@type ioctl_unit
for id = 1, #unit.alarms do
alarms[id] = alarms[id] or (unit.alarms[id] == ALARM_STATE.TRIPPED)
end
end
else
alarms = test_alarms
end
-- containment breach is worst case CRITICAL alarm, this takes priority
if alarms[ALARM.ContainmentBreach] then
new_states[T_1800Hz_Int_4Hz] = true
else
-- critical damage is highest priority CRITICAL level alarm
if alarms[ALARM.CriticalDamage] then
new_states[T_660Hz_Int_125ms] = true
else
-- EMERGENCY level alarms + URGENT over temp
if alarms[ALARM.ReactorDamage] or alarms[ALARM.ReactorOverTemp] or alarms[ALARM.ReactorWasteLeak] then
new_states[T_544Hz_440Hz_Alt] = true
-- URGENT level turbine trip
elseif alarms[ALARM.TurbineTrip] then
new_states[T_745Hz_Int_1Hz] = true
-- URGENT level reactor lost
elseif alarms[ALARM.ReactorLost] then
new_states[T_340Hz_Int_2Hz] = true
-- TIMELY level alarms
elseif alarms[ALARM.ReactorHighTemp] or alarms[ALARM.ReactorHighWaste] or alarms[ALARM.RCSTransient] then
new_states[T_800Hz_Int] = true
end
end
-- check RPS transient URGENT level alarm
if alarms[ALARM.RPSTransient] then
new_states[T_1000Hz_Int] = true
-- disable really painful audio combination
new_states[T_340Hz_Int_2Hz] = false
end
end
-- radiation is a big concern, always play this CRITICAL level alarm if active
if alarms[ALARM.ContainmentRadiation] then
new_states[T_800Hz_1000Hz_Alt] = true
-- we are going to disable the RPS trip alarm audio due to conflict, and if it was enabled
-- then we can re-enable the reactor lost alarm audio since it doesn't painfully combine with this one
if new_states[T_1000Hz_Int] and alarms[ALARM.ReactorLost] then new_states[T_340Hz_Int_2Hz] = true end
-- it sounds *really* bad if this is in conjunction with these other tones, so disable them
new_states[T_745Hz_Int_1Hz] = false
new_states[T_800Hz_Int] = false
new_states[T_1000Hz_Int] = false
end
-- check if any changed, check if any active, update active flags
for id = 1, #TONES do
if new_states[id] ~= TONES[id].active then
TONES[id].active = new_states[id]
changed = true
end
if TONES[id].active then any_active = true end
end
-- zero and re-add tones if changed
if changed then
zero()
for id = 1, #TONES do
if TONES[id].active then add(id) end
end
end
if any_active then play() else sounder.stop() end
end end
-- stop all audio and clear output buffer -- stop all audio and clear output buffer
function sounder.stop() function sounder.stop()
alarm_ctl.playing = false alarm_ctl.playing = false
alarm_ctl.speaker.stop() alarm_ctl.speaker.stop()
alarm_ctl.next_block = 1 alarm_ctl.stream.stop()
alarm_ctl.num_active = 0
for id = 1, #TONES do TONES[id].active = false end
zero()
end end
-- continue audio on buffer empty -- continue audio on buffer empty
---@return boolean success successfully added buffer to audio output ---@return boolean success successfully added buffer to audio output
function sounder.continue() function sounder.continue()
local success = false
if alarm_ctl.playing then if alarm_ctl.playing then
if alarm_ctl.speaker ~= nil and #alarm_ctl.quad_buffer[alarm_ctl.next_block] > 0 then if alarm_ctl.speaker ~= nil and alarm_ctl.stream.has_next_block() then
local success = alarm_ctl.speaker.playAudio(alarm_ctl.quad_buffer[alarm_ctl.next_block], alarm_ctl.volume) success = alarm_ctl.speaker.playAudio(alarm_ctl.stream.get_next_block(), alarm_ctl.volume)
if not success then log.error("SOUNDER: error playing audio") end
alarm_ctl.next_block = alarm_ctl.next_block + 1
if alarm_ctl.next_block > 4 then alarm_ctl.next_block = 1 end
if not success then
log.debug("SOUNDER: error playing audio")
end
return success
else
return false
end
else
return false
end
end
--#region Test Functions
function sounder.test_1() add(1) play() end -- play tone T_340Hz_Int_2Hz
function sounder.test_2() add(2) play() end -- play tone T_544Hz_440Hz_Alt
function sounder.test_3() add(3) play() end -- play tone T_660Hz_Int_125ms
function sounder.test_4() add(4) play() end -- play tone T_745Hz_Int_1Hz
function sounder.test_5() add(5) play() end -- play tone T_800Hz_Int
function sounder.test_6() add(6) play() end -- play tone T_800Hz_1000Hz_Alt
function sounder.test_7() add(7) play() end -- play tone T_1000Hz_Int
function sounder.test_8() add(8) play() end -- play tone T_1800Hz_Int_4Hz
function sounder.test_breach(active) test_alarms[ALARM.ContainmentBreach] = active end ---@param active boolean
function sounder.test_rad(active) test_alarms[ALARM.ContainmentRadiation] = active end ---@param active boolean
function sounder.test_lost(active) test_alarms[ALARM.ReactorLost] = active end ---@param active boolean
function sounder.test_crit(active) test_alarms[ALARM.CriticalDamage] = active end ---@param active boolean
function sounder.test_dmg(active) test_alarms[ALARM.ReactorDamage] = active end ---@param active boolean
function sounder.test_overtemp(active) test_alarms[ALARM.ReactorOverTemp] = active end ---@param active boolean
function sounder.test_hightemp(active) test_alarms[ALARM.ReactorHighTemp] = active end ---@param active boolean
function sounder.test_wasteleak(active) test_alarms[ALARM.ReactorWasteLeak] = active end ---@param active boolean
function sounder.test_highwaste(active) test_alarms[ALARM.ReactorHighWaste] = active end ---@param active boolean
function sounder.test_rps(active) test_alarms[ALARM.RPSTransient] = active end ---@param active boolean
function sounder.test_rcs(active) test_alarms[ALARM.RCSTransient] = active end ---@param active boolean
function sounder.test_turbinet(active) test_alarms[ALARM.TurbineTrip] = active end ---@param active boolean
-- power rescaling limiter test
function sounder.test_power_scale()
local start = util.time_ms()
zero()
for id = 1, #TONES do
if TONES[id].active then
for i = 1, 4 do
for s = 1, _05s_SAMPLES do
alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] +
(TONES[id].component[i][s] / math.sqrt(alarm_ctl.num_active)))
end
end
end end
end end
log.debug("SOUNDER: power rescale test took " .. (util.time_ms() - start) .. "ms") return success
end end
--#endregion
return sounder return sounder

View File

@@ -4,59 +4,95 @@
require("/initenv").init_env() require("/initenv").init_env()
local crash = require("scada-common.crash") local comms = require("scada-common.comms")
local log = require("scada-common.log") local crash = require("scada-common.crash")
local ppm = require("scada-common.ppm") local log = require("scada-common.log")
local tcallbackdsp = require("scada-common.tcallbackdsp") local mqueue = require("scada-common.mqueue")
local util = require("scada-common.util") local network = require("scada-common.network")
local ppm = require("scada-common.ppm")
local util = require("scada-common.util")
local core = require("graphics.core") local configure = require("coordinator.configure")
local coordinator = require("coordinator.coordinator")
local iocontrol = require("coordinator.iocontrol")
local renderer = require("coordinator.renderer")
local sounder = require("coordinator.sounder")
local threads = require("coordinator.threads")
local apisessions = require("coordinator.apisessions") local COORDINATOR_VERSION = "v1.5.6"
local config = require("coordinator.config")
local coordinator = require("coordinator.coordinator")
local iocontrol = require("coordinator.iocontrol")
local renderer = require("coordinator.renderer")
local sounder = require("coordinator.sounder")
local COORDINATOR_VERSION = "v0.12.2" local CHUNK_LOAD_DELAY_S = 30.0
local print = util.print local println = util.println
local println = util.println
local print_ts = util.print_ts
local println_ts = util.println_ts local println_ts = util.println_ts
local log_graphics = coordinator.log_graphics local log_render = coordinator.log_render
local log_sys = coordinator.log_sys local log_sys = coordinator.log_sys
local log_boot = coordinator.log_boot local log_boot = coordinator.log_boot
local log_comms = coordinator.log_comms local log_comms = coordinator.log_comms
local log_comms_connecting = coordinator.log_comms_connecting local log_crypto = coordinator.log_crypto
---------------------------------------- ----------------------------------------
-- config validation -- get configuration
---------------------------------------- ----------------------------------------
local cfv = util.new_validator() -- mount connected devices (required for monitor setup)
ppm.mount_all()
cfv.assert_port(config.SCADA_SV_PORT) local wait_on_load = true
cfv.assert_port(config.SCADA_SV_LISTEN) local loaded, monitors = coordinator.load_config()
cfv.assert_port(config.SCADA_API_LISTEN)
cfv.assert_type_int(config.TRUSTED_RANGE)
cfv.assert_type_num(config.COMMS_TIMEOUT)
cfv.assert_min(config.COMMS_TIMEOUT, 2)
cfv.assert_type_int(config.NUM_UNITS)
cfv.assert_type_num(config.SOUNDER_VOLUME)
cfv.assert_type_bool(config.TIME_24_HOUR)
cfv.assert_type_str(config.LOG_PATH)
cfv.assert_type_int(config.LOG_MODE)
assert(cfv.valid(), "bad config file: missing/invalid fields") -- if the computer just started, its chunk may have just loaded (...or the user rebooted)
-- if monitor config failed, maybe an adjacent chunk containing all or part of a monitor has not loaded yet, so keep trying
while wait_on_load and loaded == 2 and os.clock() < CHUNK_LOAD_DELAY_S do
term.clear()
term.setCursorPos(1, 1)
println("There was a monitor configuration problem at boot.\n")
println("Startup will keep trying every 2s in case of chunk load delays.\n")
println(util.sprintf("The configurator will be started in %ds if all attempts fail.\n", math.max(0, CHUNK_LOAD_DELAY_S - os.clock())))
println("(click to skip to the configurator)")
local timer_id = util.start_timer(2)
while true do
local event, param1 = util.pull_event()
if event == "timer" and param1 == timer_id then
-- remount and re-attempt
ppm.mount_all()
loaded, monitors = coordinator.load_config()
break
elseif event == "mouse_click" or event == "terminate" then
wait_on_load = false
break
end
end
end
if loaded ~= 0 then
-- try to reconfigure (user action)
local success, error = configure.configure(loaded, monitors)
if success then
loaded, monitors = coordinator.load_config()
if loaded ~= 0 then
println(util.trinary(loaded == 2, "monitor configuration invalid", "failed to load a valid configuration") .. ", please reconfigure")
return
end
else
println("configuration error: " .. error)
return
end
end
-- passed checks, good now
---@cast monitors monitors_struct
local config = coordinator.config
---------------------------------------- ----------------------------------------
-- log init -- log init
---------------------------------------- ----------------------------------------
log.init(config.LOG_PATH, config.LOG_MODE) log.init(config.LogPath, config.LogMode, config.LogDebug)
log.info("========================================") log.info("========================================")
log.info("BOOTING coordinator.startup " .. COORDINATOR_VERSION) log.info("BOOTING coordinator.startup " .. COORDINATOR_VERSION)
@@ -64,6 +100,7 @@ log.info("========================================")
println(">> SCADA Coordinator " .. COORDINATOR_VERSION .. " <<") println(">> SCADA Coordinator " .. COORDINATOR_VERSION .. " <<")
crash.set_env("coordinator", COORDINATOR_VERSION) crash.set_env("coordinator", COORDINATOR_VERSION)
crash.dbg_log_env()
---------------------------------------- ----------------------------------------
-- main application -- main application
@@ -74,46 +111,73 @@ local function main()
-- system startup -- system startup
---------------------------------------- ----------------------------------------
-- mount connected devices -- log mounts now since mounting was done before logging was ready
ppm.mount_all() ppm.log_mounts()
-- setup monitors -- report versions/init fp PSIL
local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS) iocontrol.init_fp(COORDINATOR_VERSION, comms.version)
if not configured or monitors == nil then
println("startup> monitor setup failed")
log.fatal("monitor configuration failed")
return
end
-- init renderer -- init renderer
renderer.configure(config)
renderer.set_displays(monitors) renderer.set_displays(monitors)
renderer.init_displays() renderer.init_displays()
if not renderer.validate_main_display_width() then
println("startup> main display must be 8 blocks wide")
log.fatal("main display not wide enough")
return
elseif not renderer.validate_unit_display_sizes() then
println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks")
log.fatal("unit display dimensions incorrect")
return
end
renderer.init_dmesg() renderer.init_dmesg()
-- lets get started! -- lets get started!
log.info("monitors ready, dmesg output incoming...") log.info("monitors ready, dmesg output incoming...")
log_graphics("displays connected and reset") log_render("displays connected and reset")
log_sys("system start on " .. os.date("%c")) log_sys("system start on " .. os.date("%c"))
log_boot("starting " .. COORDINATOR_VERSION) log_boot("starting " .. COORDINATOR_VERSION)
----------------------------------------
-- memory allocation
----------------------------------------
-- shared memory across threads
---@class crd_shared_memory
local __shared_memory = {
-- time and date format for display
date_format = util.trinary(config.Time24Hour, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y"),
-- coordinator system state flags
---@class crd_state
crd_state = {
fp_ok = false,
ui_ok = true, -- default true, used to abort on fail
link_fail = false,
shutdown = false
},
-- core coordinator devices
crd_dev = {
modem = ppm.get_wireless_modem(),
speaker = ppm.get_device("speaker")
},
-- system objects
crd_sys = {
nic = nil, ---@type nic
coord_comms = nil, ---@type coord_comms
conn_watchdog = nil ---@type watchdog
},
-- message queues
q = {
mq_render = mqueue.new()
}
}
local smem_dev = __shared_memory.crd_dev
local smem_sys = __shared_memory.crd_sys
local crd_state = __shared_memory.crd_state
---------------------------------------- ----------------------------------------
-- setup alarm sounder subsystem -- setup alarm sounder subsystem
---------------------------------------- ----------------------------------------
local speaker = ppm.get_device("speaker") if smem_dev.speaker == nil then
if speaker == nil then
log_boot("annunciator alarm speaker not found") log_boot("annunciator alarm speaker not found")
println("startup> speaker not found") println("startup> speaker not found")
log.fatal("no annunciator alarm speaker found") log.fatal("no annunciator alarm speaker found")
@@ -121,268 +185,92 @@ local function main()
else else
local sounder_start = util.time_ms() local sounder_start = util.time_ms()
log_boot("annunciator alarm speaker connected") log_boot("annunciator alarm speaker connected")
sounder.init(speaker, config.SOUNDER_VOLUME) sounder.init(smem_dev.speaker, config.SpeakerVolume)
log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms") log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms")
log_sys("annunciator alarm configured") log_sys("annunciator alarm configured")
iocontrol.fp_has_speaker(true)
end end
---------------------------------------- ----------------------------------------
-- setup communications -- setup communications
---------------------------------------- ----------------------------------------
-- message authentication init
if type(config.AuthKey) == "string" and string.len(config.AuthKey) > 0 then
local init_time = network.init_mac(config.AuthKey)
log_crypto("HMAC init took " .. init_time .. "ms")
end
-- get the communications modem -- get the communications modem
local modem = ppm.get_wireless_modem() if smem_dev.modem == nil then
if modem == nil then
log_comms("wireless modem not found") log_comms("wireless modem not found")
println("startup> wireless modem not found") println("startup> wireless modem not found")
log.fatal("no wireless modem on startup") log.fatal("no wireless modem on startup")
return return
else else
log_comms("wireless modem connected") log_comms("wireless modem connected")
iocontrol.fp_has_modem(true)
end end
-- create connection watchdog -- create connection watchdog
local conn_watchdog = util.new_watchdog(config.COMMS_TIMEOUT) smem_sys.conn_watchdog = util.new_watchdog(config.SVR_Timeout)
conn_watchdog.cancel() smem_sys.conn_watchdog.cancel()
log.debug("startup> conn watchdog created") log.debug("startup> conn watchdog created")
-- start comms, open all channels -- create network interface then setup comms
local coord_comms = coordinator.comms(COORDINATOR_VERSION, modem, config.SCADA_SV_PORT, config.SCADA_SV_LISTEN, smem_sys.nic = network.nic(smem_dev.modem)
config.SCADA_API_LISTEN, config.TRUSTED_RANGE, conn_watchdog) smem_sys.coord_comms = coordinator.comms(COORDINATOR_VERSION, smem_sys.nic, smem_sys.conn_watchdog)
log.debug("startup> comms init") log.debug("startup> comms init")
log_comms("comms initialized") log_comms("comms initialized")
-- base loop clock (2Hz, 10 ticks)
local MAIN_CLOCK = 0.5
local loop_clock = util.new_clock(MAIN_CLOCK)
---------------------------------------- ----------------------------------------
-- connect to the supervisor -- start front panel
---------------------------------------- ----------------------------------------
-- attempt to connect to the supervisor or exit log_render("starting front panel UI...")
local function init_connect_sv()
local tick_waiting, task_done = log_comms_connecting("attempting to connect to configured supervisor on channel " .. config.SCADA_SV_PORT)
-- attempt to establish a connection with the supervisory computer local fp_message
if not coord_comms.sv_connect(60, tick_waiting, task_done) then crd_state.fp_ok, fp_message = renderer.try_start_fp()
log_sys("supervisor connection failed, shutting down...") if not crd_state.fp_ok then
log.fatal("failed to connect to supervisor") log_render(util.c("front panel UI error: ", fp_message))
return false println_ts("front panel UI creation failed")
end log.fatal(util.c("front panel GUI render failed with error ", fp_message))
return true
end
if not init_connect_sv() then
println("startup> failed to connect to supervisor")
log_sys("system shutdown")
return return
else else log_render("front panel ready") end
log_sys("supervisor connected, proceeding to UI start")
end
---------------------------------------- ----------------------------------------
-- start the UI -- start system
---------------------------------------- ----------------------------------------
-- start up the UI -- init threads
---@return boolean ui_ok started ok local main_thread = threads.thread__main(__shared_memory)
local function init_start_ui() local render_thread = threads.thread__render(__shared_memory)
log_graphics("starting UI...")
local draw_start = util.time_ms() log.info("startup> completed")
local ui_ok, message = pcall(renderer.start_ui) -- run threads
if not ui_ok then parallel.waitForAll(main_thread.p_exec, render_thread.p_exec)
renderer.close_ui()
log_graphics(util.c("UI crashed: ", message))
println_ts("UI crashed")
log.fatal(util.c("GUI crashed with error ", message))
else
log_graphics("first UI draw took " .. (util.time_ms() - draw_start) .. "ms")
-- start clock
loop_clock.start()
end
return ui_ok
end
local ui_ok = init_start_ui()
----------------------------------------
-- main event loop
----------------------------------------
local date_format = util.trinary(config.TIME_24_HOUR, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y")
local no_modem = false
if ui_ok then
-- start connection watchdog
conn_watchdog.feed()
log.debug("startup> conn watchdog started")
log_sys("system started successfully")
end
-- main event loop
while ui_ok do
local event, param1, param2, param3, param4, param5 = util.pull_event()
-- handle event
if event == "peripheral_detach" then
local type, device = ppm.handle_unmount(param1)
if type ~= nil and device ~= nil then
if type == "modem" then
-- we only really care if this is our wireless modem
if device == modem then
no_modem = true
log_sys("comms modem disconnected")
println_ts("wireless modem disconnected!")
-- close out UI
renderer.close_ui()
-- alert user to status
log_sys("awaiting comms modem reconnect...")
else
log_sys("non-comms modem disconnected")
end
elseif type == "monitor" then
if renderer.is_monitor_used(device) then
-- "halt and catch fire" style handling
local msg = "lost a configured monitor, system will now exit"
println_ts(msg)
log_sys(msg)
break
else
log_sys("lost unused monitor, ignoring")
end
elseif type == "speaker" then
local msg = "lost alarm sounder speaker"
println_ts(msg)
log_sys(msg)
end
end
elseif event == "peripheral" then
local type, device = ppm.mount(param1)
if type ~= nil and device ~= nil then
if type == "modem" then
if device.isWireless() then
-- reconnected modem
no_modem = false
modem = device
coord_comms.reconnect_modem(modem)
log_sys("comms modem reconnected")
println_ts("wireless modem reconnected.")
-- re-init system
if not init_connect_sv() then break end
ui_ok = init_start_ui()
else
log_sys("wired modem reconnected")
end
elseif type == "monitor" then
-- not supported, system will exit on loss of in-use monitors
elseif type == "speaker" then
local msg = "alarm sounder speaker reconnected"
println_ts(msg)
log_sys(msg)
sounder.reconnect(device)
end
end
elseif event == "timer" then
if loop_clock.is_clock(param1) then
-- main loop tick
-- free any closed sessions
apisessions.free_all_closed()
-- update date and time string for main display
iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
loop_clock.start()
elseif conn_watchdog.is_timer(param1) then
-- supervisor watchdog timeout
local msg = "supervisor server timeout"
log_comms(msg)
println_ts(msg)
-- close connection, UI, and stop sounder
coord_comms.close()
renderer.close_ui()
sounder.stop()
if not no_modem then
-- try to re-connect to the supervisor
if not init_connect_sv() then break end
ui_ok = init_start_ui()
end
else
-- a non-clock/main watchdog timer event
--check API watchdogs
apisessions.check_all_watchdogs(param1)
-- notify timer callback dispatcher
tcallbackdsp.handle(param1)
end
elseif event == "modem_message" then
-- got a packet
local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
coord_comms.handle_packet(packet)
-- check if it was a disconnect
if not coord_comms.is_linked() then
log_comms("supervisor closed connection")
-- close connection, UI, and stop sounder
coord_comms.close()
renderer.close_ui()
sounder.stop()
if not no_modem then
-- try to re-connect to the supervisor
if not init_connect_sv() then break end
ui_ok = init_start_ui()
end
end
elseif event == "monitor_touch" then
-- handle a monitor touch event
renderer.handle_touch(core.events.touch(param1, param2, param3))
elseif event == "speaker_audio_empty" then
-- handle speaker buffer emptied
sounder.continue()
end
-- check for termination request
if event == "terminate" or ppm.should_terminate() then
println_ts("terminate requested, closing connections...")
log_comms("terminate requested, closing supervisor connection...")
coord_comms.close()
log_comms("supervisor connection closed")
log_comms("closing api sessions...")
apisessions.close_all()
log_comms("api sessions closed")
break
end
end
renderer.close_ui() renderer.close_ui()
renderer.close_fp()
sounder.stop() sounder.stop()
log_sys("system shutdown") log_sys("system shutdown")
if crd_state.link_fail then println_ts("failed to connect to supervisor") end
if not crd_state.ui_ok then println_ts("main UI creation failed") end
-- close on error exit (such as UI error)
if smem_sys.coord_comms.is_linked() then smem_sys.coord_comms.close() end
println_ts("exited") println_ts("exited")
log.info("exited") log.info("exited")
end end
if not xpcall(main, crash.handler) then if not xpcall(main, crash.handler) then
pcall(renderer.close_ui) pcall(renderer.close_ui)
pcall(renderer.close_fp)
pcall(sounder.stop) pcall(sounder.stop)
crash.exit() crash.exit()
else
log.close()
end end

363
coordinator/threads.lua Normal file
View File

@@ -0,0 +1,363 @@
local log = require("scada-common.log")
local mqueue = require("scada-common.mqueue")
local ppm = require("scada-common.ppm")
local tcd = require("scada-common.tcd")
local util = require("scada-common.util")
local coordinator = require("coordinator.coordinator")
local iocontrol = require("coordinator.iocontrol")
local renderer = require("coordinator.renderer")
local sounder = require("coordinator.sounder")
local apisessions = require("coordinator.session.apisessions")
local core = require("graphics.core")
local log_render = coordinator.log_render
local log_sys = coordinator.log_sys
local log_comms = coordinator.log_comms
local threads = {}
local MAIN_CLOCK = 0.5 -- (2Hz, 10 ticks)
local RENDER_SLEEP = 100 -- (100ms, 2 ticks)
local MQ__RENDER_CMD = {
START_MAIN_UI = 1
}
local MQ__RENDER_DATA = {
MON_CONNECT = 1,
MON_DISCONNECT = 2,
MON_RESIZE = 3
}
-- main thread
---@nodiscard
---@param smem crd_shared_memory
function threads.thread__main(smem)
---@class parallel_thread
local public = {}
-- execute thread
function public.exec()
iocontrol.fp_rt_status("main", true)
log.debug("main thread start")
local loop_clock = util.new_clock(MAIN_CLOCK)
-- start clock
loop_clock.start()
log_sys("system started successfully")
-- load in from shared memory
local crd_state = smem.crd_state
local nic = smem.crd_sys.nic
local coord_comms = smem.crd_sys.coord_comms
local conn_watchdog = smem.crd_sys.conn_watchdog
-- event loop
while true do
local event, param1, param2, param3, param4, param5 = util.pull_event()
-- handle event
if event == "peripheral_detach" then
local type, device = ppm.handle_unmount(param1)
if type ~= nil and device ~= nil then
if type == "modem" then
-- we only really care if this is our wireless modem
-- if it is another modem, handle other peripheral losses separately
if nic.is_modem(device) then
nic.disconnect()
log_sys("comms modem disconnected")
local other_modem = ppm.get_wireless_modem()
if other_modem then
log_sys("found another wireless modem, using it for comms")
nic.connect(other_modem)
else
-- close out main UI
renderer.close_ui()
-- alert user to status
log_sys("awaiting comms modem reconnect...")
iocontrol.fp_has_modem(false)
end
else
log_sys("non-comms modem disconnected")
end
elseif type == "monitor" then
smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_DISCONNECT, device)
elseif type == "speaker" then
log_sys("lost alarm sounder speaker")
iocontrol.fp_has_speaker(false)
end
end
elseif event == "peripheral" then
local type, device = ppm.mount(param1)
if type ~= nil and device ~= nil then
if type == "modem" then
if device.isWireless() and not nic.is_connected() then
-- reconnected modem
log_sys("comms modem reconnected")
nic.connect(device)
iocontrol.fp_has_modem(true)
elseif device.isWireless() then
log.info("unused wireless modem reconnected")
else
log_sys("wired modem reconnected")
end
elseif type == "monitor" then
smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_CONNECT, { name = param1, device = device })
elseif type == "speaker" then
log_sys("alarm sounder speaker reconnected")
sounder.reconnect(device)
iocontrol.fp_has_speaker(true)
end
end
elseif event == "monitor_resize" then
smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_RESIZE, param1)
elseif event == "timer" then
if loop_clock.is_clock(param1) then
-- main loop tick
-- toggle heartbeat
iocontrol.heartbeat()
-- maintain connection
if nic.is_connected() then
local ok, start_ui = coord_comms.try_connect()
if not ok then
crd_state.link_fail = true
crd_state.shutdown = true
log_sys("supervisor connection failed, shutting down...")
log.fatal("failed to connect to supervisor")
break
elseif start_ui then
log_sys("supervisor connected, dispatching main UI start")
smem.q.mq_render.push_command(MQ__RENDER_CMD.START_MAIN_UI)
end
end
-- iterate sessions and free any closed ones
apisessions.iterate_all()
apisessions.free_all_closed()
if renderer.ui_ready() then
-- update clock used on main and flow monitors
iocontrol.get_db().facility.ps.publish("date_time", os.date(smem.date_format))
end
loop_clock.start()
elseif conn_watchdog.is_timer(param1) then
-- supervisor watchdog timeout
log_comms("supervisor server timeout")
-- close connection, main UI, and stop sounder
coord_comms.close()
renderer.close_ui()
sounder.stop()
else
-- a non-clock/main watchdog timer event
-- check API watchdogs
apisessions.check_all_watchdogs(param1)
-- notify timer callback dispatcher
tcd.handle(param1)
end
elseif event == "modem_message" then
-- got a packet
local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
-- handle then check if it was a disconnect
if coord_comms.handle_packet(packet) then
log_comms("supervisor closed connection")
-- close connection, main UI, and stop sounder
coord_comms.close()
renderer.close_ui()
sounder.stop()
end
elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
event == "mouse_drag" or event == "mouse_scroll" or event == "double_click" then
-- handle a mouse event
renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
elseif event == "speaker_audio_empty" then
-- handle speaker buffer emptied
sounder.continue()
end
-- check for termination request or UI crash
if event == "terminate" or ppm.should_terminate() then
crd_state.shutdown = true
log.info("terminate requested, main thread exiting")
elseif not crd_state.ui_ok then
crd_state.shutdown = true
log.info("terminating due to fatal UI error")
end
if crd_state.shutdown then
-- handle closing supervisor connection
coord_comms.try_connect(true)
if coord_comms.is_linked() then
log_comms("closing supervisor connection...")
else crd_state.link_fail = true end
coord_comms.close()
log_comms("supervisor connection closed")
-- handle API sessions
log_comms("closing api sessions...")
apisessions.close_all()
log_comms("api sessions closed")
break
end
end
end
-- execute the thread in a protected mode, retrying it on return if not shutting down
function public.p_exec()
local crd_state = smem.crd_state
while not crd_state.shutdown do
local status, result = pcall(public.exec)
if status == false then
log.fatal(util.strval(result))
end
iocontrol.fp_rt_status("main", false)
-- if status is true, then we are probably exiting, so this won't matter
-- this thread cannot be slept because it will miss events (namely "terminate")
if not crd_state.shutdown then
log.info("main thread restarting now...")
end
end
end
return public
end
-- coordinator renderer thread, tasked with long duration draws
---@nodiscard
---@param smem crd_shared_memory
function threads.thread__render(smem)
---@class parallel_thread
local public = {}
-- execute thread
function public.exec()
iocontrol.fp_rt_status("render", true)
log.debug("render thread start")
-- load in from shared memory
local crd_state = smem.crd_state
local render_queue = smem.q.mq_render
local last_update = util.time()
-- thread loop
while true do
-- check for messages in the message queue
while render_queue.ready() and not crd_state.shutdown do
local msg = render_queue.pop()
if msg ~= nil then
if msg.qtype == mqueue.TYPE.COMMAND then
-- received a command
if msg.message == MQ__RENDER_CMD.START_MAIN_UI then
-- stop the UI if it was already started
-- this may occur on a quick supervisor disconnect -> connect
if renderer.ui_ready() then
log_render("closing main UI before executing new request to start")
renderer.close_ui()
end
-- start up the main UI
log_render("starting main UI...")
local draw_start = util.time_ms()
local ui_message
crd_state.ui_ok, ui_message = renderer.try_start_ui()
if not crd_state.ui_ok then
log_render(util.c("main UI error: ", ui_message))
log.fatal(util.c("main GUI render failed with error ", ui_message))
else
log_render("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
end
end
elseif msg.qtype == mqueue.TYPE.DATA then
-- received data
local cmd = msg.message ---@type queue_data
if cmd.key == MQ__RENDER_DATA.MON_CONNECT then
-- monitor connected
if renderer.handle_reconnect(cmd.val.name, cmd.val.device) then
log_sys(util.c("configured monitor ", cmd.val.name, " reconnected"))
else
log_sys(util.c("unused monitor ", cmd.val.name, " connected"))
end
elseif cmd.key == MQ__RENDER_DATA.MON_DISCONNECT then
-- monitor disconnected
if renderer.handle_disconnect(cmd.val) then
log_sys("lost a configured monitor")
else
log_sys("lost an unused monitor")
end
elseif cmd.key == MQ__RENDER_DATA.MON_RESIZE then
-- monitor resized
local is_used, is_ok = renderer.handle_resize(cmd.val)
if is_used then
log_sys(util.c("configured monitor ", cmd.val, " resized, ", util.trinary(is_ok, "display fits", "display does not fit")))
end
end
elseif msg.qtype == mqueue.TYPE.PACKET then
-- received a packet
end
end
-- quick yield
util.nop()
end
-- check for termination request
if crd_state.shutdown then
log.info("render thread exiting")
break
end
-- delay before next check
last_update = util.adaptive_delay(RENDER_SLEEP, last_update)
end
end
-- execute the thread in a protected mode, retrying it on return if not shutting down
function public.p_exec()
local crd_state = smem.crd_state
while not crd_state.shutdown do
local status, result = pcall(public.exec)
if status == false then
log.fatal(util.strval(result))
end
iocontrol.fp_rt_status("render", false)
if not crd_state.shutdown then
log.info("render thread restarting in 5 seconds...")
util.psleep(5)
end
end
end
return public
end
return threads

View File

@@ -1,3 +1,5 @@
local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
local core = require("graphics.core") local core = require("graphics.core")
@@ -9,8 +11,8 @@ local DataIndicator = require("graphics.elements.indicators.data")
local StateIndicator = require("graphics.elements.indicators.state") local StateIndicator = require("graphics.elements.indicators.state")
local VerticalBar = require("graphics.elements.indicators.vbar") local VerticalBar = require("graphics.elements.indicators.vbar")
local cpair = core.graphics.cpair local cpair = core.cpair
local border = core.graphics.border local border = core.border
-- new boiler view -- new boiler view
---@param root graphics_element parent ---@param root graphics_element parent
@@ -18,33 +20,35 @@ local border = core.graphics.border
---@param y integer top left y ---@param y integer top left y
---@param ps psil ps interface ---@param ps psil ps interface
local function new_view(root, x, y, ps) local function new_view(root, x, y, ps)
local boiler = Rectangle{parent=root,border=border(1, colors.gray, true),width=31,height=7,x=x,y=y} local text_fg = style.theme.text_fg
local lu_col = style.lu_colors
local text_fg_bg = cpair(colors.black, colors.lightGray) local db = iocontrol.get_db()
local lu_col = cpair(colors.gray, colors.gray)
local boiler = Rectangle{parent=root,border=border(1,colors.gray,true),width=31,height=7,x=x,y=y}
local status = StateIndicator{parent=boiler,x=9,y=1,states=style.boiler.states,value=1,min_width=12} local status = StateIndicator{parent=boiler,x=9,y=1,states=style.boiler.states,value=1,min_width=12}
local temp = DataIndicator{parent=boiler,x=5,y=3,lu_colors=lu_col,label="Temp:",unit="K",format="%10.2f",value=0,width=22,fg_bg=text_fg_bg} local temp = DataIndicator{parent=boiler,x=5,y=3,lu_colors=lu_col,label="Temp:",unit=db.temp_label,format="%10.2f",value=0,commas=true,width=22,fg_bg=text_fg}
local boil_r = DataIndicator{parent=boiler,x=5,y=4,lu_colors=lu_col,label="Boil:",unit="mB/t",format="%10.0f",value=0,commas=true,width=22,fg_bg=text_fg_bg} local boil_r = DataIndicator{parent=boiler,x=5,y=4,lu_colors=lu_col,label="Boil:",unit="mB/t",format="%10.0f",value=0,commas=true,width=22,fg_bg=text_fg}
ps.subscribe("computed_status", status.update) status.register(ps, "computed_status", status.update)
ps.subscribe("temperature", temp.update) temp.register(ps, "temperature", function (t) temp.update(db.temp_convert(t)) end)
ps.subscribe("boil_rate", boil_r.update) boil_r.register(ps, "boil_rate", boil_r.update)
TextBox{parent=boiler,text="H",x=2,y=5,height=1,width=1,fg_bg=text_fg_bg} TextBox{parent=boiler,text="H",x=2,y=5,width=1,fg_bg=text_fg}
TextBox{parent=boiler,text="W",x=3,y=5,height=1,width=1,fg_bg=text_fg_bg} TextBox{parent=boiler,text="W",x=3,y=5,width=1,fg_bg=text_fg}
TextBox{parent=boiler,text="S",x=27,y=5,height=1,width=1,fg_bg=text_fg_bg} TextBox{parent=boiler,text="S",x=27,y=5,width=1,fg_bg=text_fg}
TextBox{parent=boiler,text="C",x=28,y=5,height=1,width=1,fg_bg=text_fg_bg} TextBox{parent=boiler,text="C",x=28,y=5,width=1,fg_bg=text_fg}
local hcool = VerticalBar{parent=boiler,x=2,y=1,fg_bg=cpair(colors.orange,colors.gray),height=4,width=1} local hcool = VerticalBar{parent=boiler,x=2,y=1,fg_bg=cpair(colors.orange,colors.gray),height=4,width=1}
local water = VerticalBar{parent=boiler,x=3,y=1,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1} local water = VerticalBar{parent=boiler,x=3,y=1,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1}
local steam = VerticalBar{parent=boiler,x=27,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1} local steam = VerticalBar{parent=boiler,x=27,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
local ccool = VerticalBar{parent=boiler,x=28,y=1,fg_bg=cpair(colors.lightBlue,colors.gray),height=4,width=1} local ccool = VerticalBar{parent=boiler,x=28,y=1,fg_bg=cpair(colors.lightBlue,colors.gray),height=4,width=1}
ps.subscribe("hcool_fill", hcool.update) hcool.register(ps, "hcool_fill", hcool.update)
ps.subscribe("water_fill", water.update) water.register(ps, "water_fill", water.update)
ps.subscribe("steam_fill", steam.update) steam.register(ps, "steam_fill", steam.update)
ps.subscribe("ccool_fill", ccool.update) ccool.register(ps, "ccool_fill", ccool.update)
end end
return new_view return new_view

View File

@@ -1,5 +1,7 @@
local util = require("scada-common.util") local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
local core = require("graphics.core") local core = require("graphics.core")
@@ -9,14 +11,15 @@ local Rectangle = require("graphics.elements.rectangle")
local TextBox = require("graphics.elements.textbox") local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data") local DataIndicator = require("graphics.elements.indicators.data")
local IndicatorLight = require("graphics.elements.indicators.light")
local PowerIndicator = require("graphics.elements.indicators.power") local PowerIndicator = require("graphics.elements.indicators.power")
local StateIndicator = require("graphics.elements.indicators.state") local StateIndicator = require("graphics.elements.indicators.state")
local VerticalBar = require("graphics.elements.indicators.vbar") local VerticalBar = require("graphics.elements.indicators.vbar")
local cpair = core.graphics.cpair local cpair = core.cpair
local border = core.graphics.border local border = core.border
local TEXT_ALIGN = core.graphics.TEXT_ALIGN local ALIGN = core.ALIGN
-- new induction matrix view -- new induction matrix view
---@param root graphics_element parent ---@param root graphics_element parent
@@ -26,71 +29,122 @@ local TEXT_ALIGN = core.graphics.TEXT_ALIGN
---@param ps psil ps interface ---@param ps psil ps interface
---@param id number? matrix ID ---@param id number? matrix ID
local function new_view(root, x, y, data, ps, id) local function new_view(root, x, y, data, ps, id)
local label_fg = style.theme.label_fg
local text_fg = style.theme.text_fg
local lu_col = style.lu_colors
local ind_yel = style.ind_yel
local ind_wht = style.ind_wht
local db = iocontrol.get_db()
local title = "INDUCTION MATRIX" local title = "INDUCTION MATRIX"
if type(id) == "number" then title = title .. id end if type(id) == "number" then title = title .. id end
local matrix = Div{parent=root,fg_bg=style.root,width=33,height=24,x=x,y=y} local matrix = Div{parent=root,fg_bg=style.root,width=33,height=24,x=x,y=y}
TextBox{parent=matrix,text=" ",width=33,height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)} -- black has low contrast with dark gray, so if background is black use white instead
TextBox{parent=matrix,text=title,alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.gray)} local cutout_fg_bg = cpair(util.trinary(style.theme.bg == colors.black, colors.white, style.theme.bg), colors.gray)
TextBox{parent=matrix,text=" ",width=33,x=1,y=1,fg_bg=cutout_fg_bg}
TextBox{parent=matrix,text=title,alignment=ALIGN.CENTER,width=33,x=1,y=2,fg_bg=cutout_fg_bg}
local rect = Rectangle{parent=matrix,border=border(1,colors.gray,true),width=33,height=22,x=1,y=3} local rect = Rectangle{parent=matrix,border=border(1,colors.gray,true),width=33,height=22,x=1,y=3}
local text_fg_bg = cpair(colors.black, colors.lightGray) local status = StateIndicator{parent=rect,x=10,y=1,states=style.imatrix.states,value=1,min_width=14}
local label_fg_bg = cpair(colors.gray, colors.lightGray) local capacity = PowerIndicator{parent=rect,x=7,y=3,lu_colors=lu_col,label="Capacity:",unit=db.energy_label,format="%8.2f",value=0,width=26,fg_bg=text_fg}
local lu_col = cpair(colors.gray, colors.gray) local energy = PowerIndicator{parent=rect,x=7,y=4,lu_colors=lu_col,label="Energy: ",unit=db.energy_label,format="%8.2f",value=0,width=26,fg_bg=text_fg}
local avg_chg = PowerIndicator{parent=rect,x=7,y=5,lu_colors=lu_col,label="\xb7Average:",unit=db.energy_label,format="%8.2f",value=0,width=26,fg_bg=text_fg}
local input = PowerIndicator{parent=rect,x=7,y=6,lu_colors=lu_col,label="Input: ",unit=db.energy_label,format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
local avg_in = PowerIndicator{parent=rect,x=7,y=7,lu_colors=lu_col,label="\xb7Average:",unit=db.energy_label,format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
local output = PowerIndicator{parent=rect,x=7,y=8,lu_colors=lu_col,label="Output: ",unit=db.energy_label,format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
local avg_out = PowerIndicator{parent=rect,x=7,y=9,lu_colors=lu_col,label="\xb7Average:",unit=db.energy_label,format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
local trans_cap = PowerIndicator{parent=rect,x=7,y=10,lu_colors=lu_col,label="Max I/O: ",unit=db.energy_label,format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
local status = StateIndicator{parent=rect,x=10,y=1,states=style.imatrix.states,value=1,min_width=14} status.register(ps, "computed_status", status.update)
local energy = PowerIndicator{parent=rect,x=7,y=3,lu_colors=lu_col,label="Energy: ",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg} capacity.register(ps, "max_energy", function (val) capacity.update(db.energy_convert(val)) end)
local capacity = PowerIndicator{parent=rect,x=7,y=4,lu_colors=lu_col,label="Capacity:",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg} energy.register(ps, "energy", function (val) energy.update(db.energy_convert(val)) end)
local input = PowerIndicator{parent=rect,x=7,y=5,lu_colors=lu_col,label="Input: ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg} avg_chg.register(ps, "avg_charge", avg_chg.update)
local output = PowerIndicator{parent=rect,x=7,y=6,lu_colors=lu_col,label="Output: ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg} input.register(ps, "last_input", function (val) input.update(db.energy_convert(val)) end)
avg_in.register(ps, "avg_inflow", avg_in.update)
output.register(ps, "last_output", function (val) output.update(db.energy_convert(val)) end)
avg_out.register(ps, "avg_outflow", avg_out.update)
trans_cap.register(ps, "transfer_cap", function (val) trans_cap.update(db.energy_convert(val)) end)
local avg_chg = PowerIndicator{parent=rect,x=7,y=8,lu_colors=lu_col,label="Avg. Chg:",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg} local fill = DataIndicator{parent=rect,x=11,y=12,lu_colors=lu_col,label="Fill: ",format="%7.2f",unit="%",value=0,width=20,fg_bg=text_fg}
local avg_in = PowerIndicator{parent=rect,x=7,y=9,lu_colors=lu_col,label="Avg. In: ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg} local cells = DataIndicator{parent=rect,x=11,y=13,lu_colors=lu_col,label="Cells: ",format="%7d",value=0,width=18,fg_bg=text_fg}
local avg_out = PowerIndicator{parent=rect,x=7,y=10,lu_colors=lu_col,label="Avg. Out:",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg} local providers = DataIndicator{parent=rect,x=11,y=14,lu_colors=lu_col,label="Providers:",format="%7d",value=0,width=18,fg_bg=text_fg}
ps.subscribe("computed_status", status.update) fill.register(ps, "energy_fill", function (val) fill.update(val * 100) end)
ps.subscribe("energy", function (val) energy.update(util.joules_to_fe(val)) end) cells.register(ps, "cells", cells.update)
ps.subscribe("max_energy", function (val) capacity.update(util.joules_to_fe(val)) end) providers.register(ps, "providers", providers.update)
ps.subscribe("last_input", function (val) input.update(util.joules_to_fe(val)) end)
ps.subscribe("last_output", function (val) output.update(util.joules_to_fe(val)) end)
ps.subscribe("avg_charge", avg_chg.update) local chging = IndicatorLight{parent=rect,x=11,y=16,label="Charging",colors=ind_wht}
ps.subscribe("avg_inflow", avg_in.update) local dischg = IndicatorLight{parent=rect,x=11,y=17,label="Discharging",colors=ind_wht}
ps.subscribe("avg_outflow", avg_out.update) local max_io = IndicatorLight{parent=rect,x=11,y=18,label="Max I/O Rate",colors=ind_yel}
local fill = DataIndicator{parent=rect,x=11,y=12,lu_colors=lu_col,label="Fill:",unit="%",format="%8.2f",value=0,width=18,fg_bg=text_fg_bg} chging.register(ps, "is_charging", chging.update)
dischg.register(ps, "is_discharging", dischg.update)
local cells = DataIndicator{parent=rect,x=11,y=14,lu_colors=lu_col,label="Cells: ",format="%7d",value=0,width=18,fg_bg=text_fg_bg} max_io.register(ps, "at_max_io", max_io.update)
local providers = DataIndicator{parent=rect,x=11,y=15,lu_colors=lu_col,label="Providers:",format="%7d",value=0,width=18,fg_bg=text_fg_bg}
TextBox{parent=rect,text="Transfer Capacity",x=11,y=17,height=1,width=17,fg_bg=label_fg_bg}
local trans_cap = PowerIndicator{parent=rect,x=19,y=18,lu_colors=lu_col,label="",format="%5.2f",rate=true,value=0,width=12,fg_bg=text_fg_bg}
ps.subscribe("cells", cells.update)
ps.subscribe("providers", providers.update)
ps.subscribe("energy_fill", function (val) fill.update(val * 100) end)
ps.subscribe("transfer_cap", function (val) trans_cap.update(util.joules_to_fe(val)) end)
local charge = VerticalBar{parent=rect,x=2,y=2,fg_bg=cpair(colors.green,colors.gray),height=17,width=4} local charge = VerticalBar{parent=rect,x=2,y=2,fg_bg=cpair(colors.green,colors.gray),height=17,width=4}
local in_cap = VerticalBar{parent=rect,x=7,y=12,fg_bg=cpair(colors.red,colors.gray),height=7,width=1} local in_cap = VerticalBar{parent=rect,x=7,y=12,fg_bg=cpair(colors.red,colors.gray),height=7,width=1}
local out_cap = VerticalBar{parent=rect,x=9,y=12,fg_bg=cpair(colors.blue,colors.gray),height=7,width=1} local out_cap = VerticalBar{parent=rect,x=9,y=12,fg_bg=cpair(colors.blue,colors.gray),height=7,width=1}
TextBox{parent=rect,text="FILL",x=2,y=20,height=1,width=4,fg_bg=text_fg_bg} TextBox{parent=rect,text="FILL I/O",x=2,y=20,width=8,fg_bg=label_fg}
TextBox{parent=rect,text="I/O",x=7,y=20,height=1,width=3,fg_bg=text_fg_bg}
local function calc_saturation(val) local function calc_saturation(val)
if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then
return val / data.build.transfer_cap return val / data.build.transfer_cap
else else return 0 end
return 0
end
end end
ps.subscribe("energy_fill", charge.update) charge.register(ps, "energy_fill", charge.update)
ps.subscribe("last_input", function (val) in_cap.update(calc_saturation(val)) end) in_cap.register(ps, "last_input", function (val) in_cap.update(calc_saturation(val)) end)
ps.subscribe("last_output", function (val) out_cap.update(calc_saturation(val)) end) out_cap.register(ps, "last_output", function (val) out_cap.update(calc_saturation(val)) end)
local eta = TextBox{parent=rect,x=11,y=20,width=20,text="ETA Unknown",alignment=ALIGN.CENTER,fg_bg=style.theme.field_box}
eta.register(ps, "eta_ms", function (eta_ms)
local str, pre = "", util.trinary(eta_ms >= 0, "Full in ", "Empty in ")
local seconds = math.abs(eta_ms) / 1000
local minutes = seconds / 60
local hours = minutes / 60
local days = hours / 24
if math.abs(eta_ms) < 1000 or (eta_ms ~= eta_ms) then
-- really small or NaN
str = "No ETA"
elseif days < 1000 then
days = math.floor(days)
hours = math.floor(hours % 24)
minutes = math.floor(minutes % 60)
seconds = math.floor(seconds % 60)
if days > 0 then
str = days .. "d"
elseif hours > 0 then
str = hours .. "h " .. minutes .. "m"
elseif minutes > 0 then
str = minutes .. "m " .. seconds .. "s"
elseif seconds > 0 then
str = seconds .. "s"
end
str = pre .. str
else
local years = math.floor(days / 365.25)
if years <= 99999999 then
str = pre .. years .. "y"
else
str = pre .. "eras"
end
end
eta.set_value(str)
end)
end end
return new_view return new_view

View File

@@ -0,0 +1,55 @@
--
-- Pocket Connection Entry
--
local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local ALIGN = core.ALIGN
local cpair = core.cpair
-- create a pocket list entry
---@param parent graphics_element parent
---@param id integer PKT session ID
local function init(parent, id)
local s_hi_box = style.fp_theme.highlight_box
local s_hi_bright = style.fp_theme.highlight_box_bright
local label_fg = style.fp.label_fg
local ps = iocontrol.get_db().fp.ps
-- root div
local root = Div{parent=parent,x=2,y=2,height=4,width=parent.get_width()-2,hidden=true}
local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=s_hi_bright}
local ps_prefix = "pkt_" .. id .. "_"
TextBox{parent=entry,x=1,y=1,text="",width=8,fg_bg=s_hi_box}
local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=ALIGN.CENTER,width=8,fg_bg=s_hi_box,nav_active=cpair(colors.gray,colors.black)}
TextBox{parent=entry,x=1,y=3,text="",width=8,fg_bg=s_hi_box}
pkt_addr.register(ps, ps_prefix .. "addr", pkt_addr.set_value)
TextBox{parent=entry,x=10,y=2,text="FW:",width=3}
local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,fg_bg=label_fg}
pkt_fw_v.register(ps, ps_prefix .. "fw", pkt_fw_v.set_value)
TextBox{parent=entry,x=35,y=2,text="RTT:",width=4}
local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=label_fg}
TextBox{parent=entry,x=46,y=2,text="ms",width=4,fg_bg=label_fg}
pkt_rtt.register(ps, ps_prefix .. "rtt", pkt_rtt.update)
pkt_rtt.register(ps, ps_prefix .. "rtt_color", pkt_rtt.recolor)
return root
end
return init

View File

@@ -0,0 +1,370 @@
local tcd = require("scada-common.tcd")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local process = require("coordinator.process")
local style = require("coordinator.ui.style")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local Rectangle = require("graphics.elements.rectangle")
local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local IndicatorLight = require("graphics.elements.indicators.light")
local RadIndicator = require("graphics.elements.indicators.rad")
local StateIndicator = require("graphics.elements.indicators.state")
local TriIndicatorLight = require("graphics.elements.indicators.trilight")
local Checkbox = require("graphics.elements.controls.checkbox")
local HazardButton = require("graphics.elements.controls.hazard_button")
local RadioButton = require("graphics.elements.controls.radio_button")
local SpinboxNumeric = require("graphics.elements.controls.spinbox_numeric")
local ALIGN = core.ALIGN
local cpair = core.cpair
local border = core.border
local bw_fg_bg = style.bw_fg_bg
local period = core.flasher.PERIOD
-- new process control view
---@param root graphics_element parent
---@param x integer top left x
---@param y integer top left y
local function new_view(root, x, y)
local s_hi_box = style.theme.highlight_box
local s_field = style.theme.field_box
local lu_cpair = style.lu_colors
local hzd_fg_bg = style.hzd_fg_bg
local dis_colors = style.dis_colors
local arrow_fg_bg = cpair(style.theme.label, s_hi_box.bkg)
local ind_grn = style.ind_grn
local ind_yel = style.ind_yel
local ind_red = style.ind_red
local ind_wht = style.ind_wht
assert(root.get_height() >= (y + 24), "main display not of sufficient vertical resolution (add an additional row of monitors)")
local black = cpair(colors.black, colors.black)
local blk_brn = cpair(colors.black, colors.brown)
local blk_pur = cpair(colors.black, colors.purple)
local db = iocontrol.get_db()
local facility = db.facility
local units = db.units
local main = Div{parent=root,width=128,height=24,x=x,y=y}
local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
local ack_a = HazardButton{parent=main,x=16,y=1,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=process.fac_ack_alarms,fg_bg=hzd_fg_bg}
facility.scram_ack = scram.on_response
facility.ack_alarms_ack = ack_a.on_response
local all_ok = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=ind_grn}
local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=style.ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd}
local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=ind_grn}
local sps = IndicatorLight{parent=main,label="SPS Connected",colors=ind_grn}
all_ok.register(facility.ps, "all_sys_ok", all_ok.update)
rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update)
ind_mat.register(facility.induction_ps_tbl[1], "computed_status", function (status) ind_mat.update(status > 1) end)
sps.register(facility.sps_ps_tbl[1], "computed_status", function (status) sps.update(status > 1) end)
main.line_break()
local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=ind_grn}
local auto_act = IndicatorLight{parent=main,label="Process Active",colors=ind_grn}
local auto_ramp = IndicatorLight{parent=main,label="Process Ramping",colors=ind_wht,flash=true,period=period.BLINK_250_MS}
local auto_sat = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=ind_yel}
auto_ready.register(facility.ps, "auto_ready", auto_ready.update)
auto_act.register(facility.ps, "auto_active", auto_act.update)
auto_ramp.register(facility.ps, "auto_ramping", auto_ramp.update)
auto_sat.register(facility.ps, "auto_saturated", auto_sat.update)
main.line_break()
local auto_scram = IndicatorLight{parent=main,label="Automatic SCRAM",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local matrix_dc = IndicatorLight{parent=main,label="Matrix Disconnected",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=ind_red,flash=true,period=period.BLINK_500_MS}
local unit_crit = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local fac_rad_h = IndicatorLight{parent=main,label="Facility Radiation High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local gen_fault = IndicatorLight{parent=main,label="Gen. Control Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
auto_scram.register(facility.ps, "auto_scram", auto_scram.update)
matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update)
matrix_fill.register(facility.ps, "as_matrix_fill", matrix_fill.update)
unit_crit.register(facility.ps, "as_crit_alarm", unit_crit.update)
fac_rad_h.register(facility.ps, "as_radiation", fac_rad_h.update)
gen_fault.register(facility.ps, "as_gen_fault", gen_fault.update)
TextBox{parent=main,y=23,text="Radiation",width=13,fg_bg=style.label}
local radiation = RadIndicator{parent=main,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=s_field}
radiation.register(facility.ps, "radiation", radiation.update)
TextBox{parent=main,x=15,y=23,text="Linked RTUs",width=11,fg_bg=style.label}
local rtu_count = DataIndicator{parent=main,x=15,y=24,label="",format="%11d",value=0,lu_colors=lu_cpair,width=11,fg_bg=s_field}
rtu_count.register(facility.ps, "rtu_count", rtu_count.update)
---------------------
-- process control --
---------------------
local proc = Div{parent=main,width=103,height=24,x=27,y=1}
-----------------------------
-- process control targets --
-----------------------------
local targets = Div{parent=proc,width=31,height=24,x=1,y=1}
local burn_tag = Div{parent=targets,x=1,y=1,width=8,height=4,fg_bg=blk_pur}
TextBox{parent=burn_tag,x=2,y=2,text="Burn Target",width=7,height=2}
local burn_target = Div{parent=targets,x=9,y=1,width=23,height=3,fg_bg=s_hi_box}
local b_target = SpinboxNumeric{parent=burn_target,x=11,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
TextBox{parent=burn_target,x=18,y=2,text="mB/t",fg_bg=style.theme.label_fg}
local burn_sum = DataIndicator{parent=targets,x=9,y=4,label="",format="%18.1f",value=0,unit="mB/t",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
b_target.register(facility.ps, "process_burn_target", b_target.set_value)
burn_sum.register(facility.ps, "burn_sum", burn_sum.update)
local chg_tag = Div{parent=targets,x=1,y=6,width=8,height=4,fg_bg=blk_pur}
TextBox{parent=chg_tag,x=2,y=2,text="Charge Target",width=7,height=2}
local chg_target = Div{parent=targets,x=9,y=6,width=23,height=3,fg_bg=s_hi_box}
local c_target = SpinboxNumeric{parent=chg_target,x=2,y=1,whole_num_precision=15,fractional_precision=0,min=0,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
TextBox{parent=chg_target,x=18,y=2,text="M"..db.energy_label,fg_bg=style.theme.label_fg}
local cur_charge = DataIndicator{parent=targets,x=9,y=9,label="",format="%19d",value=0,unit="M"..db.energy_label,commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
c_target.register(facility.ps, "process_charge_target", c_target.set_value)
cur_charge.register(facility.induction_ps_tbl[1], "avg_charge", function (fe) cur_charge.update(db.energy_convert_from_fe(fe) / 1000000) end)
local gen_tag = Div{parent=targets,x=1,y=11,width=8,height=4,fg_bg=blk_pur}
TextBox{parent=gen_tag,x=2,y=2,text="Gen. Target",width=7,height=2}
local gen_target = Div{parent=targets,x=9,y=11,width=23,height=3,fg_bg=s_hi_box}
local g_target = SpinboxNumeric{parent=gen_target,x=8,y=1,whole_num_precision=9,fractional_precision=0,min=0,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
TextBox{parent=gen_target,x=18,y=2,text="k"..db.energy_label.."/t",fg_bg=style.theme.label_fg}
local cur_gen = DataIndicator{parent=targets,x=9,y=14,label="",format="%17d",value=0,unit="k"..db.energy_label.."/t",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
g_target.register(facility.ps, "process_gen_target", g_target.set_value)
cur_gen.register(facility.induction_ps_tbl[1], "last_input", function (j) cur_gen.update(util.round(db.energy_convert(j) / 1000)) end)
-----------------
-- unit limits --
-----------------
local limit_div = Div{parent=proc,width=21,height=19,x=34,y=6}
local rate_limits = {}
for i = 1, 4 do
local unit
local tag_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
local lim_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
local label_fg = style.theme.disabled_fg
local cur_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
local cur_lu = style.theme.disabled
if i <= facility.num_units then
unit = units[i] ---@type ioctl_unit
tag_fg_bg = cpair(colors.black, colors.lightBlue)
lim_fg_bg = s_hi_box
label_fg = style.theme.label_fg
cur_fg_bg = blk_brn
cur_lu = colors.black
end
local _y = ((i - 1) * 5) + 1
local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2}
local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=s_hi_box}
local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled,fg_bg=lim_fg_bg}
TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,fg_bg=label_fg}
local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(cur_lu,cur_lu),width=14,fg_bg=cur_fg_bg}
if i <= facility.num_units then
rate_limits[i] = lim
rate_limits[i].register(unit.unit_ps, "max_burn", rate_limits[i].set_max)
rate_limits[i].register(unit.unit_ps, "burn_limit", rate_limits[i].set_value)
cur_burn.register(unit.unit_ps, "act_burn_rate", cur_burn.update)
else
lim.disable()
end
end
-------------------
-- unit statuses --
-------------------
local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6}
for i = 1, 4 do
local tag_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
local ind_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
local ind_off = style.theme.disabled
if i <= facility.num_units then
tag_fg_bg = cpair(colors.black, colors.cyan)
ind_fg_bg = cpair(style.theme.text, s_hi_box.bkg)
ind_off = style.ind_hi_box_bg
end
local _y = ((i - 1) * 5) + 1
local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2}
local lights = Div{parent=stat_div,x=9,y=_y,width=14,height=4,fg_bg=ind_fg_bg}
local ready = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(ind_grn.fgd,ind_off)}
local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(ind_red.fgd,ind_off),flash=true,period=period.BLINK_250_MS}
if i <= facility.num_units then
local unit = units[i] ---@type ioctl_unit
ready.register(unit.unit_ps, "U_AutoReady", ready.update)
degraded.register(unit.unit_ps, "U_AutoDegraded", degraded.update)
end
end
-------------------------
-- controls and status --
-------------------------
local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" }
local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.purple}
mode.register(facility.ps, "process_mode", mode.set_value)
local u_stat = Rectangle{parent=proc,border=border(1,colors.gray,true),thin=true,width=31,height=4,x=1,y=16,fg_bg=bw_fg_bg}
local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=31,alignment=ALIGN.CENTER,fg_bg=bw_fg_bg}
local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=31,alignment=ALIGN.CENTER,fg_bg=cpair(colors.gray,colors.white)}
stat_line_1.register(facility.ps, "status_line_1", stat_line_1.set_value)
stat_line_2.register(facility.ps, "status_line_2", stat_line_2.set_value)
local auto_controls = Div{parent=proc,x=1,y=20,width=31,height=5,fg_bg=s_hi_box}
-- save the automatic process control configuration without starting
local function _save_cfg()
local limits = {}
for i = 1, #rate_limits do limits[i] = rate_limits[i].get_value() end
process.save(mode.get_value(), b_target.get_value(),
db.energy_convert_to_fe(c_target.get_value()),
db.energy_convert_to_fe(g_target.get_value()),
limits)
end
-- start automatic control after saving process control settings
local function _start_auto()
_save_cfg()
process.start_auto()
end
local save = HazardButton{parent=auto_controls,x=2,y=2,text="SAVE",accent=colors.purple,dis_colors=dis_colors,callback=_save_cfg,fg_bg=hzd_fg_bg}
local start = HazardButton{parent=auto_controls,x=13,y=2,text="START",accent=colors.lightBlue,dis_colors=dis_colors,callback=_start_auto,fg_bg=hzd_fg_bg}
local stop = HazardButton{parent=auto_controls,x=23,y=2,text="STOP",accent=colors.red,dis_colors=dis_colors,callback=process.stop_auto,fg_bg=hzd_fg_bg}
facility.start_ack = start.on_response
facility.stop_ack = stop.on_response
function facility.save_cfg_ack(ack)
tcd.dispatch(0.2, function () save.on_response(ack) end)
end
start.register(facility.ps, "auto_ready", function (ready)
if ready and (not facility.auto_active) then start.enable() else start.disable() end
end)
-- REGISTER_NOTE: for optimization/brevity, due to not deleting anything but the whole element tree when it comes
-- to the process control display and coordinator GUI as a whole, child elements will not directly be registered here
-- (preventing garbage collection until the parent 'proc' is deleted)
proc.register(facility.ps, "auto_active", function (active)
if active then
b_target.disable()
c_target.disable()
g_target.disable()
mode.disable()
start.disable()
for i = 1, #rate_limits do rate_limits[i].disable() end
else
b_target.enable()
c_target.enable()
g_target.enable()
mode.enable()
if facility.auto_ready then start.enable() end
for i = 1, #rate_limits do rate_limits[i].enable() end
end
end)
------------------------------
-- waste production control --
------------------------------
local waste_status = Div{parent=proc,width=24,height=4,x=57,y=1,}
for i = 1, facility.num_units do
local unit = units[i] ---@type ioctl_unit
TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8}
local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=ind_wht}
local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6}
a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update)
waste_m.register(unit.unit_ps, "U_WasteProduct", waste_m.update)
end
local waste_sel = Div{parent=proc,width=21,height=24,x=81,y=1}
local cutout_fg_bg = cpair(style.theme.bg, colors.brown)
TextBox{parent=waste_sel,text=" ",width=21,x=1,y=1,fg_bg=cutout_fg_bg}
TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=ALIGN.CENTER,width=21,x=1,y=2,fg_bg=cutout_fg_bg}
local rect = Rectangle{parent=waste_sel,border=border(1,colors.brown,true),width=21,height=22,x=1,y=3}
local status = StateIndicator{parent=rect,x=2,y=1,states=style.waste.states,value=1,min_width=17}
status.register(facility.ps, "current_waste_product", status.update)
local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.brown}
waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value)
local fb_active = IndicatorLight{parent=rect,x=2,y=7,label="Fallback Active",colors=ind_wht}
local sps_disabled = IndicatorLight{parent=rect,x=2,y=8,label="SPS Disabled LC",colors=ind_yel}
fb_active.register(facility.ps, "pu_fallback_active", fb_active.update)
sps_disabled.register(facility.ps, "sps_disabled_low_power", sps_disabled.update)
local pu_fallback = Checkbox{parent=rect,x=2,y=10,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.brown,style.theme.checkbox_bg)}
TextBox{parent=rect,x=2,y=12,height=3,text="Switch to Pu when SNAs cannot keep up with waste.",fg_bg=style.label}
local lc_sps = Checkbox{parent=rect,x=2,y=16,label="Low Charge SPS",callback=process.set_sps_low_power,box_fg_bg=cpair(colors.brown,style.theme.checkbox_bg)}
TextBox{parent=rect,x=2,y=18,height=3,text="Use SPS at low charge, otherwise switches to Po.",fg_bg=style.label}
pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
lc_sps.register(facility.ps, "process_sps_low_power", lc_sps.set_value)
end
return new_view

View File

@@ -1,267 +0,0 @@
local tcd = require("scada-common.tcallbackdsp")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local process = require("coordinator.process")
local style = require("coordinator.ui.style")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local Rectangle = require("graphics.elements.rectangle")
local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local IndicatorLight = require("graphics.elements.indicators.light")
local RadIndicator = require("graphics.elements.indicators.rad")
local TriIndicatorLight = require("graphics.elements.indicators.trilight")
local HazardButton = require("graphics.elements.controls.hazard_button")
local RadioButton = require("graphics.elements.controls.radio_button")
local SpinboxNumeric = require("graphics.elements.controls.spinbox_numeric")
local TEXT_ALIGN = core.graphics.TEXT_ALIGN
local cpair = core.graphics.cpair
local border = core.graphics.border
local period = core.flasher.PERIOD
-- new process control view
---@param root graphics_element parent
---@param x integer top left x
---@param y integer top left y
local function new_view(root, x, y)
assert(root.height() >= (y + 24), "main display not of sufficient vertical resolution (add an additional row of monitors)")
local facility = iocontrol.get_db().facility
local units = iocontrol.get_db().units
local bw_fg_bg = cpair(colors.black, colors.white)
local hzd_fg_bg = cpair(colors.white, colors.gray)
local lu_cpair = cpair(colors.gray, colors.gray)
local dis_colors = cpair(colors.white, colors.lightGray)
local main = Div{parent=root,width=104,height=24,x=x,y=y}
local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
local ack_a = HazardButton{parent=main,x=16,y=1,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=process.fac_ack_alarms,fg_bg=hzd_fg_bg}
facility.scram_ack = scram.on_response
facility.ack_alarms_ack = ack_a.on_response
local all_ok = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=cpair(colors.green,colors.red)}
local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=cpair(colors.green,colors.gray)}
local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
facility.ps.subscribe("all_sys_ok", all_ok.update)
facility.induction_ps_tbl[1].subscribe("computed_status", function (status) ind_mat.update(status > 1) end)
facility.ps.subscribe("rad_computed_status", rad_mon.update)
main.line_break()
local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=cpair(colors.green,colors.red)}
local auto_act = IndicatorLight{parent=main,label="Process Active",colors=cpair(colors.green,colors.gray)}
local auto_ramp = IndicatorLight{parent=main,label="Process Ramping",colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_250_MS}
local auto_sat = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=cpair(colors.yellow,colors.gray)}
facility.ps.subscribe("auto_ready", auto_ready.update)
facility.ps.subscribe("auto_active", auto_act.update)
facility.ps.subscribe("auto_ramping", auto_ramp.update)
facility.ps.subscribe("auto_saturated", auto_sat.update)
main.line_break()
local auto_scram = IndicatorLight{parent=main,label="Automatic SCRAM",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
local matrix_dc = IndicatorLight{parent=main,label="Matrix Disconnected",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_500_MS}
local unit_crit = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
local fac_rad_h = IndicatorLight{parent=main,label="Facility Radiation High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
local gen_fault = IndicatorLight{parent=main,label="Gen. Control Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
facility.ps.subscribe("auto_scram", auto_scram.update)
facility.ps.subscribe("as_matrix_dc", matrix_dc.update)
facility.ps.subscribe("as_matrix_fill", matrix_fill.update)
facility.ps.subscribe("as_crit_alarm", unit_crit.update)
facility.ps.subscribe("as_radiation", fac_rad_h.update)
facility.ps.subscribe("as_gen_fault", gen_fault.update)
TextBox{parent=main,y=23,text="Radiation",height=1,width=13,fg_bg=style.label}
local radiation = RadIndicator{parent=main,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
facility.ps.subscribe("radiation", radiation.update)
TextBox{parent=main,x=15,y=23,text="Linked RTUs",height=1,width=11,fg_bg=style.label}
local rtu_count = DataIndicator{parent=main,x=15,y=24,label="",format="%11d",value=0,lu_colors=lu_cpair,width=11,fg_bg=bw_fg_bg}
facility.ps.subscribe("rtu_count", rtu_count.update)
---------------------
-- process control --
---------------------
local proc = Div{parent=main,width=78,height=24,x=27,y=1}
-----------------------------
-- process control targets --
-----------------------------
local targets = Div{parent=proc,width=31,height=24,x=1,y=1}
local burn_tag = Div{parent=targets,x=1,y=1,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
TextBox{parent=burn_tag,x=2,y=2,text="Burn Target",width=7,height=2}
local burn_target = Div{parent=targets,x=9,y=1,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
local b_target = SpinboxNumeric{parent=burn_target,x=11,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
TextBox{parent=burn_target,x=18,y=2,text="mB/t"}
local burn_sum = DataIndicator{parent=targets,x=9,y=4,label="",format="%18.1f",value=0,unit="mB/t",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
facility.ps.subscribe("process_burn_target", b_target.set_value)
facility.ps.subscribe("burn_sum", burn_sum.update)
local chg_tag = Div{parent=targets,x=1,y=6,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
TextBox{parent=chg_tag,x=2,y=2,text="Charge Target",width=7,height=2}
local chg_target = Div{parent=targets,x=9,y=6,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
local c_target = SpinboxNumeric{parent=chg_target,x=2,y=1,whole_num_precision=15,fractional_precision=0,min=0,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
TextBox{parent=chg_target,x=18,y=2,text="MFE"}
local cur_charge = DataIndicator{parent=targets,x=9,y=9,label="",format="%19d",value=0,unit="MFE",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
facility.ps.subscribe("process_charge_target", c_target.set_value)
facility.induction_ps_tbl[1].subscribe("energy", function (j) cur_charge.update(util.joules_to_fe(j) / 1000000) end)
local gen_tag = Div{parent=targets,x=1,y=11,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
TextBox{parent=gen_tag,x=2,y=2,text="Gen. Target",width=7,height=2}
local gen_target = Div{parent=targets,x=9,y=11,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
local g_target = SpinboxNumeric{parent=gen_target,x=8,y=1,whole_num_precision=9,fractional_precision=0,min=0,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
TextBox{parent=gen_target,x=18,y=2,text="kFE/t"}
local cur_gen = DataIndicator{parent=targets,x=9,y=14,label="",format="%17d",value=0,unit="kFE/t",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
facility.ps.subscribe("process_gen_target", g_target.set_value)
facility.induction_ps_tbl[1].subscribe("last_input", function (j) cur_gen.update(util.round(util.joules_to_fe(j) / 1000)) end)
-----------------
-- unit limits --
-----------------
local limit_div = Div{parent=proc,width=21,height=19,x=34,y=6}
local rate_limits = {}
for i = 1, facility.num_units do
local unit = units[i] ---@type ioctl_unit
local _y = ((i - 1) * 5) + 1
local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)}
TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2}
local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(colors.gray,colors.white)}
rate_limits[i] = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1}
unit.unit_ps.subscribe("max_burn", rate_limits[i].set_max)
unit.unit_ps.subscribe("burn_limit", rate_limits[i].set_value)
local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(colors.black,colors.black),width=14,fg_bg=cpair(colors.black,colors.brown)}
unit.unit_ps.subscribe("act_burn_rate", cur_burn.update)
end
-------------------
-- unit statuses --
-------------------
local stat_div = Div{parent=proc,width=38,height=19,x=57,y=6}
for i = 1, facility.num_units do
local unit = units[i] ---@type ioctl_unit
local _y = ((i - 1) * 5) + 1
local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)}
TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2}
local lights = Div{parent=stat_div,x=9,y=_y,width=12,height=4,fg_bg=bw_fg_bg}
local ready = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,colors.gray)}
local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
unit.unit_ps.subscribe("U_AutoReady", ready.update)
unit.unit_ps.subscribe("U_AutoDegraded", degraded.update)
end
-------------------------
-- controls and status --
-------------------------
local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" }
local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.purple,colors.black),radio_bg=colors.gray}
facility.ps.subscribe("process_mode", mode.set_value)
local u_stat = Rectangle{parent=proc,border=border(1,colors.gray,true),thin=true,width=31,height=4,x=1,y=16,fg_bg=bw_fg_bg}
local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=31,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=bw_fg_bg}
local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=31,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.gray, colors.white)}
facility.ps.subscribe("status_line_1", stat_line_1.set_value)
facility.ps.subscribe("status_line_2", stat_line_2.set_value)
local auto_controls = Div{parent=proc,x=1,y=20,width=31,height=5,fg_bg=cpair(colors.gray,colors.white)}
-- save the automatic process control configuration without starting
local function _save_cfg()
local limits = {}
for i = 1, #rate_limits do limits[i] = rate_limits[i].get_value() end
process.save(mode.get_value(), b_target.get_value(), c_target.get_value(), g_target.get_value(), limits)
end
-- start automatic control after saving process control settings
local function _start_auto()
_save_cfg()
process.start_auto()
end
local save = HazardButton{parent=auto_controls,x=2,y=2,text="SAVE",accent=colors.purple,dis_colors=dis_colors,callback=_save_cfg,fg_bg=hzd_fg_bg}
local start = HazardButton{parent=auto_controls,x=13,y=2,text="START",accent=colors.lightBlue,dis_colors=dis_colors,callback=_start_auto,fg_bg=hzd_fg_bg}
local stop = HazardButton{parent=auto_controls,x=23,y=2,text="STOP",accent=colors.red,dis_colors=dis_colors,callback=process.stop_auto,fg_bg=hzd_fg_bg}
facility.start_ack = start.on_response
facility.stop_ack = stop.on_response
function facility.save_cfg_ack(ack)
tcd.dispatch(0.2, function () save.on_response(ack) end)
end
facility.ps.subscribe("auto_ready", function (ready)
if ready and (not facility.auto_active) then start.enable() else start.disable() end
end)
facility.ps.subscribe("auto_active", function (active)
if active then
b_target.disable()
c_target.disable()
g_target.disable()
mode.disable()
start.disable()
for i = 1, #rate_limits do
rate_limits[i].disable()
end
else
b_target.enable()
c_target.enable()
g_target.enable()
mode.enable()
if facility.auto_ready then start.enable() end
for i = 1, #rate_limits do
rate_limits[i].enable()
end
end
end)
end
return new_view

View File

@@ -1,5 +1,7 @@
local types = require("scada-common.types") local types = require("scada-common.types")
local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
local core = require("graphics.core") local core = require("graphics.core")
@@ -11,44 +13,45 @@ local DataIndicator = require("graphics.elements.indicators.data")
local HorizontalBar = require("graphics.elements.indicators.hbar") local HorizontalBar = require("graphics.elements.indicators.hbar")
local StateIndicator = require("graphics.elements.indicators.state") local StateIndicator = require("graphics.elements.indicators.state")
local cpair = core.graphics.cpair local cpair = core.cpair
local border = core.graphics.border local border = core.border
-- create new reactor view -- create new reactor view
---@param root graphics_element parent ---@param root graphics_element parent
---@param x integer top left x ---@param x integer top left x
---@param y integer top left y ---@param y integer top left y
---@param data reactor_db reactor data
---@param ps psil ps interface ---@param ps psil ps interface
local function new_view(root, x, y, data, ps) local function new_view(root, x, y, ps)
local reactor = Rectangle{parent=root,border=border(1, colors.gray, true),width=30,height=7,x=x,y=y} local text_fg = style.theme.text_fg
local lu_col = style.lu_colors
local text_fg_bg = cpair(colors.black, colors.lightGray) local db = iocontrol.get_db()
local lu_col = cpair(colors.gray, colors.gray)
local reactor = Rectangle{parent=root,border=border(1,colors.gray,true),width=30,height=7,x=x,y=y}
local status = StateIndicator{parent=reactor,x=6,y=1,states=style.reactor.states,value=1,min_width=16} local status = StateIndicator{parent=reactor,x=6,y=1,states=style.reactor.states,value=1,min_width=16}
local core_temp = DataIndicator{parent=reactor,x=2,y=3,lu_colors=lu_col,label="Core Temp:",unit="K",format="%10.2f",value=0,width=26,fg_bg=text_fg_bg} local core_temp = DataIndicator{parent=reactor,x=2,y=3,lu_colors=lu_col,label="Core Temp:",unit=db.temp_label,format="%10.2f",value=0,commas=true,width=26,fg_bg=text_fg}
local burn_r = DataIndicator{parent=reactor,x=2,y=4,lu_colors=lu_col,label="Burn Rate:",unit="mB/t",format="%10.2f",value=0,width=26,fg_bg=text_fg_bg} local burn_r = DataIndicator{parent=reactor,x=2,y=4,lu_colors=lu_col,label="Burn Rate:",unit="mB/t",format="%10.2f",value=0,width=26,fg_bg=text_fg}
local heating_r = DataIndicator{parent=reactor,x=2,y=5,lu_colors=lu_col,label="Heating:",unit="mB/t",format="%12.0f",value=0,commas=true,width=26,fg_bg=text_fg_bg} local heating_r = DataIndicator{parent=reactor,x=2,y=5,lu_colors=lu_col,label="Heating:",unit="mB/t",format="%12.0f",value=0,commas=true,width=26,fg_bg=text_fg}
ps.subscribe("computed_status", status.update) status.register(ps, "computed_status", status.update)
ps.subscribe("temp", core_temp.update) core_temp.register(ps, "temp", function (t) core_temp.update(db.temp_convert(t)) end)
ps.subscribe("act_burn_rate", burn_r.update) burn_r.register(ps, "act_burn_rate", burn_r.update)
ps.subscribe("heating_rate", heating_r.update) heating_r.register(ps, "heating_rate", heating_r.update)
local reactor_fills = Rectangle{parent=root,border=border(1, colors.gray, true),width=24,height=7,x=(x + 29),y=y} local reactor_fills = Rectangle{parent=root,border=border(1, colors.gray, true),width=24,height=7,x=(x + 29),y=y}
TextBox{parent=reactor_fills,text="FUEL",x=2,y=1,height=1,fg_bg=text_fg_bg} TextBox{parent=reactor_fills,text="FUEL",x=2,y=1,fg_bg=text_fg}
TextBox{parent=reactor_fills,text="COOL",x=2,y=2,height=1,fg_bg=text_fg_bg} TextBox{parent=reactor_fills,text="COOL",x=2,y=2,fg_bg=text_fg}
TextBox{parent=reactor_fills,text="HCOOL",x=2,y=4,height=1,fg_bg=text_fg_bg} TextBox{parent=reactor_fills,text="HCOOL",x=2,y=4,fg_bg=text_fg}
TextBox{parent=reactor_fills,text="WASTE",x=2,y=5,height=1,fg_bg=text_fg_bg} TextBox{parent=reactor_fills,text="WASTE",x=2,y=5,fg_bg=text_fg}
local fuel = HorizontalBar{parent=reactor_fills,x=8,y=1,show_percent=true,bar_fg_bg=cpair(colors.black,colors.gray),height=1,width=14} local fuel = HorizontalBar{parent=reactor_fills,x=8,y=1,show_percent=true,bar_fg_bg=cpair(style.theme.fuel_color,colors.gray),height=1,width=14}
local ccool = HorizontalBar{parent=reactor_fills,x=8,y=2,show_percent=true,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=14} local ccool = HorizontalBar{parent=reactor_fills,x=8,y=2,show_percent=true,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=14}
local hcool = HorizontalBar{parent=reactor_fills,x=8,y=4,show_percent=true,bar_fg_bg=cpair(colors.white,colors.gray),height=1,width=14} local hcool = HorizontalBar{parent=reactor_fills,x=8,y=4,show_percent=true,bar_fg_bg=cpair(colors.white,colors.gray),height=1,width=14}
local waste = HorizontalBar{parent=reactor_fills,x=8,y=5,show_percent=true,bar_fg_bg=cpair(colors.brown,colors.gray),height=1,width=14} local waste = HorizontalBar{parent=reactor_fills,x=8,y=5,show_percent=true,bar_fg_bg=cpair(colors.brown,colors.gray),height=1,width=14}
ps.subscribe("ccool_type", function (type) ccool.register(ps, "ccool_type", function (type)
if type == types.FLUID.SODIUM then if type == types.FLUID.SODIUM then
ccool.recolor(cpair(colors.lightBlue, colors.gray)) ccool.recolor(cpair(colors.lightBlue, colors.gray))
else else
@@ -56,7 +59,7 @@ local function new_view(root, x, y, data, ps)
end end
end) end)
ps.subscribe("hcool_type", function (type) hcool.register(ps, "hcool_type", function (type)
if type == types.FLUID.SUPERHEATED_SODIUM then if type == types.FLUID.SUPERHEATED_SODIUM then
hcool.recolor(cpair(colors.orange, colors.gray)) hcool.recolor(cpair(colors.orange, colors.gray))
else else
@@ -64,10 +67,10 @@ local function new_view(root, x, y, data, ps)
end end
end) end)
ps.subscribe("fuel_fill", fuel.update) fuel.register(ps, "fuel_fill", fuel.update)
ps.subscribe("ccool_fill", ccool.update) ccool.register(ps, "ccool_fill", ccool.update)
ps.subscribe("hcool_fill", hcool.update) hcool.register(ps, "hcool_fill", hcool.update)
ps.subscribe("waste_fill", waste.update) waste.register(ps, "waste_fill", waste.update)
end end
return new_view return new_view

View File

@@ -1,4 +1,4 @@
local util = require("scada-common.util") local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
@@ -12,8 +12,8 @@ local PowerIndicator = require("graphics.elements.indicators.power")
local StateIndicator = require("graphics.elements.indicators.state") local StateIndicator = require("graphics.elements.indicators.state")
local VerticalBar = require("graphics.elements.indicators.vbar") local VerticalBar = require("graphics.elements.indicators.vbar")
local cpair = core.graphics.cpair local cpair = core.cpair
local border = core.graphics.border local border = core.border
-- new turbine view -- new turbine view
---@param root graphics_element parent ---@param root graphics_element parent
@@ -21,27 +21,29 @@ local border = core.graphics.border
---@param y integer top left y ---@param y integer top left y
---@param ps psil ps interface ---@param ps psil ps interface
local function new_view(root, x, y, ps) local function new_view(root, x, y, ps)
local turbine = Rectangle{parent=root,border=border(1, colors.gray, true),width=23,height=7,x=x,y=y} local text_fg = style.theme.text_fg
local lu_col = style.lu_colors
local text_fg_bg = cpair(colors.black, colors.lightGray) local db = iocontrol.get_db()
local lu_col = cpair(colors.gray, colors.gray)
local turbine = Rectangle{parent=root,border=border(1,colors.gray,true),width=23,height=7,x=x,y=y}
local status = StateIndicator{parent=turbine,x=7,y=1,states=style.turbine.states,value=1,min_width=12} local status = StateIndicator{parent=turbine,x=7,y=1,states=style.turbine.states,value=1,min_width=12}
local prod_rate = PowerIndicator{parent=turbine,x=5,y=3,lu_colors=lu_col,label="",format="%10.2f",value=0,rate=true,width=16,fg_bg=text_fg_bg} local prod_rate = PowerIndicator{parent=turbine,x=5,y=3,lu_colors=lu_col,label="",unit=db.energy_label,format="%10.2f",value=0,rate=true,width=16,fg_bg=text_fg}
local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg} local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg}
ps.subscribe("computed_status", status.update) status.register(ps, "computed_status", status.update)
ps.subscribe("prod_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end) prod_rate.register(ps, "prod_rate", function (val) prod_rate.update(db.energy_convert(val)) end)
ps.subscribe("flow_rate", flow_rate.update) flow_rate.register(ps, "steam_input_rate", flow_rate.update)
local steam = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1} local steam = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
local energy = VerticalBar{parent=turbine,x=3,y=1,fg_bg=cpair(colors.green,colors.gray),height=4,width=1} local energy = VerticalBar{parent=turbine,x=3,y=1,fg_bg=cpair(colors.green,colors.gray),height=4,width=1}
TextBox{parent=turbine,text="S",x=2,y=5,height=1,width=1,fg_bg=text_fg_bg} TextBox{parent=turbine,text="S",x=2,y=5,width=1,fg_bg=text_fg}
TextBox{parent=turbine,text="E",x=3,y=5,height=1,width=1,fg_bg=text_fg_bg} TextBox{parent=turbine,text="E",x=3,y=5,width=1,fg_bg=text_fg}
ps.subscribe("steam_fill", steam.update) steam.register(ps, "steam_fill", steam.update)
ps.subscribe("energy_fill", energy.update) energy.register(ps, "energy_fill", energy.update)
end end
return new_view return new_view

View File

@@ -2,6 +2,9 @@
-- Reactor Unit SCADA Coordinator GUI -- Reactor Unit SCADA Coordinator GUI
-- --
local types = require("scada-common.types")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol") local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
@@ -26,129 +29,126 @@ local PushButton = require("graphics.elements.controls.push_button")
local RadioButton = require("graphics.elements.controls.radio_button") local RadioButton = require("graphics.elements.controls.radio_button")
local SpinboxNumeric = require("graphics.elements.controls.spinbox_numeric") local SpinboxNumeric = require("graphics.elements.controls.spinbox_numeric")
local TEXT_ALIGN = core.graphics.TEXT_ALIGN local ALIGN = core.ALIGN
local cpair = core.graphics.cpair local cpair = core.cpair
local border = core.graphics.border local border = core.border
local bw_fg_bg = style.bw_fg_bg
local gry_wht = style.gray_white
local period = core.flasher.PERIOD local period = core.flasher.PERIOD
local waste_opts = {
{
text = "Auto",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.white, colors.gray)
},
{
text = "Pu",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.green)
},
{
text = "Po",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.cyan)
},
{
text = "AM",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.purple)
}
}
-- create a unit view -- create a unit view
---@param parent graphics_element parent ---@param parent graphics_element parent
---@param id integer ---@param id integer
local function init(parent, id) local function init(parent, id)
local unit = iocontrol.get_db().units[id] ---@type ioctl_unit local s_hi_box = style.theme.highlight_box
local f_ps = iocontrol.get_db().facility.ps local s_hi_bright = style.theme.highlight_box_bright
local s_field = style.theme.field_box
local hc_text = style.hc_text
local lu_cpair = style.lu_colors
local hzd_fg_bg = style.hzd_fg_bg
local dis_colors = style.dis_colors
local arrow_fg_bg = cpair(style.theme.label, s_hi_box.bkg)
local ind_bkg = style.ind_bkg
local ind_grn = style.ind_grn
local ind_yel = style.ind_yel
local ind_red = style.ind_red
local ind_wht = style.ind_wht
local db = iocontrol.get_db()
local unit = db.units[id] ---@type ioctl_unit
local f_ps = db.facility.ps
local main = Div{parent=parent,x=1,y=1}
if unit == nil then return main end
local u_ps = unit.unit_ps local u_ps = unit.unit_ps
local b_ps = unit.boiler_ps_tbl local b_ps = unit.boiler_ps_tbl
local t_ps = unit.turbine_ps_tbl local t_ps = unit.turbine_ps_tbl
local main = Div{parent=parent,x=1,y=1} TextBox{parent=main,text="Reactor Unit #" .. id,alignment=ALIGN.CENTER,fg_bg=style.theme.header}
TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
local bw_fg_bg = cpair(colors.black, colors.white)
local hzd_fg_bg = cpair(colors.white, colors.gray)
local lu_cpair = cpair(colors.gray, colors.gray)
----------------------------- -----------------------------
-- main stats and core map -- -- main stats and core map --
----------------------------- -----------------------------
local core_map = CoreMap{parent=main,x=2,y=3,reactor_l=18,reactor_w=18} local core_map = CoreMap{parent=main,x=2,y=3,reactor_l=18,reactor_w=18}
u_ps.subscribe("temp", core_map.update) core_map.register(u_ps, "temp", core_map.update)
u_ps.subscribe("size", function (s) core_map.resize(s[1], s[2]) end) core_map.register(u_ps, "size", function (s) core_map.resize(s[1], s[2]) end)
TextBox{parent=main,x=12,y=22,text="Heating Rate",height=1,width=12,fg_bg=style.label} TextBox{parent=main,x=12,y=22,text="Heating Rate",width=12,fg_bg=style.label}
local heating_r = DataIndicator{parent=main,x=12,label="",format="%14.0f",value=0,unit="mB/t",commas=true,lu_colors=lu_cpair,width=19,fg_bg=bw_fg_bg} local heating_r = DataIndicator{parent=main,x=12,label="",format="%14.0f",value=0,unit="mB/t",commas=true,lu_colors=lu_cpair,width=19,fg_bg=s_field}
u_ps.subscribe("heating_rate", heating_r.update) heating_r.register(u_ps, "heating_rate", heating_r.update)
TextBox{parent=main,x=12,y=25,text="Commanded Burn Rate",height=1,width=19,fg_bg=style.label} TextBox{parent=main,x=12,y=25,text="Commanded Burn Rate",width=19,fg_bg=style.label}
local burn_r = DataIndicator{parent=main,x=12,label="",format="%14.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=19,fg_bg=bw_fg_bg} local burn_r = DataIndicator{parent=main,x=12,label="",format="%14.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=19,fg_bg=s_field}
u_ps.subscribe("burn_rate", burn_r.update) burn_r.register(u_ps, "burn_rate", burn_r.update)
TextBox{parent=main,text="F",x=2,y=22,width=1,height=1,fg_bg=style.label} TextBox{parent=main,text="F",x=2,y=22,width=1,fg_bg=style.label}
TextBox{parent=main,text="C",x=4,y=22,width=1,height=1,fg_bg=style.label} TextBox{parent=main,text="C",x=4,y=22,width=1,fg_bg=style.label}
TextBox{parent=main,text="\x1a",x=6,y=24,width=1,height=1,fg_bg=style.label} TextBox{parent=main,text="\x1a",x=6,y=24,width=1,fg_bg=style.label}
TextBox{parent=main,text="\x1a",x=6,y=25,width=1,height=1,fg_bg=style.label} TextBox{parent=main,text="\x1a",x=6,y=25,width=1,fg_bg=style.label}
TextBox{parent=main,text="H",x=8,y=22,width=1,height=1,fg_bg=style.label} TextBox{parent=main,text="H",x=8,y=22,width=1,fg_bg=style.label}
TextBox{parent=main,text="W",x=10,y=22,width=1,height=1,fg_bg=style.label} TextBox{parent=main,text="W",x=10,y=22,width=1,fg_bg=style.label}
local fuel = VerticalBar{parent=main,x=2,y=23,fg_bg=cpair(colors.black,colors.gray),height=4,width=1} local fuel = VerticalBar{parent=main,x=2,y=23,fg_bg=cpair(style.theme.fuel_color,colors.gray),height=4,width=1}
local ccool = VerticalBar{parent=main,x=4,y=23,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1} local ccool = VerticalBar{parent=main,x=4,y=23,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1}
local hcool = VerticalBar{parent=main,x=8,y=23,fg_bg=cpair(colors.white,colors.gray),height=4,width=1} local hcool = VerticalBar{parent=main,x=8,y=23,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
local waste = VerticalBar{parent=main,x=10,y=23,fg_bg=cpair(colors.brown,colors.gray),height=4,width=1} local waste = VerticalBar{parent=main,x=10,y=23,fg_bg=cpair(colors.brown,colors.gray),height=4,width=1}
u_ps.subscribe("fuel_fill", fuel.update) fuel.register(u_ps, "fuel_fill", fuel.update)
u_ps.subscribe("ccool_fill", ccool.update) ccool.register(u_ps, "ccool_fill", ccool.update)
u_ps.subscribe("hcool_fill", hcool.update) hcool.register(u_ps, "hcool_fill", hcool.update)
u_ps.subscribe("waste_fill", waste.update) waste.register(u_ps, "waste_fill", waste.update)
u_ps.subscribe("ccool_type", function (type) ccool.register(u_ps, "ccool_type", function (type)
if type == "mekanism:sodium" then if type == types.FLUID.SODIUM then
ccool.recolor(cpair(colors.lightBlue, colors.gray)) ccool.recolor(cpair(colors.lightBlue, colors.gray))
else else
ccool.recolor(cpair(colors.blue, colors.gray)) ccool.recolor(cpair(colors.blue, colors.gray))
end end
end) end)
u_ps.subscribe("hcool_type", function (type) hcool.register(u_ps, "hcool_type", function (type)
if type == "mekanism:superheated_sodium" then if type == types.FLUID.SUPERHEATED_SODIUM then
hcool.recolor(cpair(colors.orange, colors.gray)) hcool.recolor(cpair(colors.orange, colors.gray))
else else
hcool.recolor(cpair(colors.white, colors.gray)) hcool.recolor(cpair(colors.white, colors.gray))
end end
end) end)
TextBox{parent=main,x=32,y=22,text="Core Temp",height=1,width=9,fg_bg=style.label} TextBox{parent=main,x=32,y=22,text="Core Temp",width=9,fg_bg=style.label}
local core_temp = DataIndicator{parent=main,x=32,label="",format="%11.2f",value=0,unit="K",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg} local fmt = util.trinary(string.len(db.temp_label) == 2, "%10.2f", "%11.2f")
u_ps.subscribe("temp", core_temp.update) local core_temp = DataIndicator{parent=main,x=32,label="",format=fmt,value=0,commas=true,unit=db.temp_label,lu_colors=lu_cpair,width=13,fg_bg=s_field}
core_temp.register(u_ps, "temp", function (t) core_temp.update(db.temp_convert(t)) end)
TextBox{parent=main,x=32,y=25,text="Burn Rate",height=1,width=9,fg_bg=style.label} TextBox{parent=main,x=32,y=25,text="Burn Rate",width=9,fg_bg=style.label}
local act_burn_r = DataIndicator{parent=main,x=32,label="",format="%8.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg} local act_burn_r = DataIndicator{parent=main,x=32,label="",format="%8.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=13,fg_bg=s_field}
u_ps.subscribe("act_burn_rate", act_burn_r.update) act_burn_r.register(u_ps, "act_burn_rate", act_burn_r.update)
TextBox{parent=main,x=32,y=28,text="Damage",height=1,width=6,fg_bg=style.label} TextBox{parent=main,x=32,y=28,text="Damage",width=6,fg_bg=style.label}
local damage_p = DataIndicator{parent=main,x=32,label="",format="%11.0f",value=0,unit="%",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg} local damage_p = DataIndicator{parent=main,x=32,label="",format="%11.0f",value=0,unit="%",lu_colors=lu_cpair,width=13,fg_bg=s_field}
u_ps.subscribe("damage", damage_p.update) damage_p.register(u_ps, "damage", damage_p.update)
TextBox{parent=main,x=32,y=31,text="Radiation",height=1,width=21,fg_bg=style.label} TextBox{parent=main,x=32,y=31,text="Radiation",width=21,fg_bg=style.label}
local radiation = RadIndicator{parent=main,x=32,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg} local radiation = RadIndicator{parent=main,x=32,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=s_field}
u_ps.subscribe("radiation", radiation.update) radiation.register(u_ps, "radiation", radiation.update)
------------------- -------------------
-- system status -- -- system status --
------------------- -------------------
local u_stat = Rectangle{parent=main,border=border(1,colors.gray,true),thin=true,width=33,height=4,x=46,y=3,fg_bg=bw_fg_bg} local u_stat = Rectangle{parent=main,border=border(1,colors.gray,true),thin=true,width=33,height=4,x=46,y=3,fg_bg=bw_fg_bg}
local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=33,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=bw_fg_bg} local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=33,alignment=ALIGN.CENTER,fg_bg=bw_fg_bg}
local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=33,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.gray, colors.white)} local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=33,alignment=ALIGN.CENTER,fg_bg=gry_wht}
u_ps.subscribe("U_StatusLine1", stat_line_1.set_value) stat_line_1.register(u_ps, "U_StatusLine1", stat_line_1.set_value)
u_ps.subscribe("U_StatusLine2", stat_line_2.set_value) stat_line_2.register(u_ps, "U_StatusLine2", stat_line_2.set_value)
----------------- -----------------
-- annunciator -- -- annunciator --
@@ -159,188 +159,214 @@ local function init(parent, id)
local annunciator = Div{parent=main,width=23,height=18,x=22,y=3} local annunciator = Div{parent=main,width=23,height=18,x=22,y=3}
-- connectivity -- connectivity
local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)} local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(ind_grn.fgd,ind_red.fgd)}
local plc_hbeat = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=cpair(colors.white,colors.gray)} local plc_hbeat = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=ind_wht}
local rad_mon = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green} local rad_mon = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd}
u_ps.subscribe("PLCOnline", plc_online.update) plc_online.register(u_ps, "PLCOnline", plc_online.update)
u_ps.subscribe("PLCHeartbeat", plc_hbeat.update) plc_hbeat.register(u_ps, "PLCHeartbeat", plc_hbeat.update)
u_ps.subscribe("RadiationMonitor", rad_mon.update) rad_mon.register(u_ps, "RadiationMonitor", rad_mon.update)
annunciator.line_break() annunciator.line_break()
-- operating state -- operating state
local r_active = IndicatorLight{parent=annunciator,label="Active",colors=cpair(colors.green,colors.gray)} local r_active = IndicatorLight{parent=annunciator,label="Active",colors=ind_grn}
local r_auto = IndicatorLight{parent=annunciator,label="Automatic Control",colors=cpair(colors.white,colors.gray)} local r_auto = IndicatorLight{parent=annunciator,label="Automatic Control",colors=ind_wht}
u_ps.subscribe("status", r_active.update) r_active.register(u_ps, "status", r_active.update)
u_ps.subscribe("AutoControl", r_auto.update) r_auto.register(u_ps, "AutoControl", r_auto.update)
-- main unit transient/warning annunciator panel -- main unit transient/warning annunciator panel
local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=ind_red}
local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=ind_red}
local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=ind_red}
local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=cpair(colors.yellow,colors.gray)} local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=ind_yel}
local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=cpair(colors.red,colors.gray)} local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=ind_red}
local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=cpair(colors.yellow,colors.gray)} local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=ind_yel}
local r_clow = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=cpair(colors.yellow,colors.gray)} local r_clow = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=ind_yel}
local r_temp = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=cpair(colors.red,colors.gray)} local r_temp = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=ind_red}
local r_rhdt = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=cpair(colors.yellow,colors.gray)} local r_rhdt = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=ind_yel}
local r_firl = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=cpair(colors.yellow,colors.gray)} local r_firl = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=ind_yel}
local r_wloc = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=cpair(colors.yellow,colors.gray)} local r_wloc = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=ind_yel}
local r_hsrt = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=cpair(colors.yellow,colors.gray)} local r_hsrt = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=ind_yel}
u_ps.subscribe("ReactorSCRAM", r_scram.update) r_scram.register(u_ps, "ReactorSCRAM", r_scram.update)
u_ps.subscribe("ManualReactorSCRAM", r_mscrm.update) r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update)
u_ps.subscribe("AutoReactorSCRAM", r_ascrm.update) r_ascrm.register(u_ps, "AutoReactorSCRAM", r_ascrm.update)
u_ps.subscribe("RadiationWarning", rad_wrn.update) rad_wrn.register(u_ps, "RadiationWarning", rad_wrn.update)
u_ps.subscribe("RCPTrip", r_rtrip.update) r_rtrip.register(u_ps, "RCPTrip", r_rtrip.update)
u_ps.subscribe("RCSFlowLow", r_cflow.update) r_cflow.register(u_ps, "RCSFlowLow", r_cflow.update)
u_ps.subscribe("CoolantLevelLow", r_clow.update) r_clow.register(u_ps, "CoolantLevelLow", r_clow.update)
u_ps.subscribe("ReactorTempHigh", r_temp.update) r_temp.register(u_ps, "ReactorTempHigh", r_temp.update)
u_ps.subscribe("ReactorHighDeltaT", r_rhdt.update) r_rhdt.register(u_ps, "ReactorHighDeltaT", r_rhdt.update)
u_ps.subscribe("FuelInputRateLow", r_firl.update) r_firl.register(u_ps, "FuelInputRateLow", r_firl.update)
u_ps.subscribe("WasteLineOcclusion", r_wloc.update) r_wloc.register(u_ps, "WasteLineOcclusion", r_wloc.update)
u_ps.subscribe("HighStartupRate", r_hsrt.update) r_hsrt.register(u_ps, "HighStartupRate", r_hsrt.update)
-- RPS annunciator panel -- RPS annunciator panel
TextBox{parent=main,text="REACTOR PROTECTION SYSTEM",fg_bg=cpair(colors.black,colors.cyan),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=8} TextBox{parent=main,text="REACTOR PROTECTION SYSTEM",fg_bg=cpair(colors.black,colors.cyan),alignment=ALIGN.CENTER,width=33,x=46,y=8}
local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9} local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9}
local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1} local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1}
local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=cpair(colors.yellow,colors.gray)} local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=ind_yel}
local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=cpair(colors.yellow,colors.gray)} local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=ind_yel}
local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=cpair(colors.yellow,colors.gray)} local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=ind_yel}
local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=cpair(colors.yellow,colors.gray)} local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=ind_yel}
local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=ind_red,flash=true,period=period.BLINK_500_MS}
u_ps.subscribe("rps_tripped", rps_trp.update) rps_trp.register(u_ps, "rps_tripped", rps_trp.update)
u_ps.subscribe("high_dmg", rps_dmg.update) rps_dmg.register(u_ps, "high_dmg", rps_dmg.update)
u_ps.subscribe("ex_hcool", rps_exh.update) rps_exh.register(u_ps, "ex_hcool", rps_exh.update)
u_ps.subscribe("ex_waste", rps_exw.update) rps_exw.register(u_ps, "ex_waste", rps_exw.update)
u_ps.subscribe("high_temp", rps_tmp.update) rps_tmp.register(u_ps, "high_temp", rps_tmp.update)
u_ps.subscribe("no_fuel", rps_nof.update) rps_nof.register(u_ps, "no_fuel", rps_nof.update)
u_ps.subscribe("low_cool", rps_loc.update) rps_loc.register(u_ps, "low_cool", rps_loc.update)
u_ps.subscribe("fault", rps_flt.update) rps_flt.register(u_ps, "fault", rps_flt.update)
u_ps.subscribe("timeout", rps_tmo.update) rps_tmo.register(u_ps, "timeout", rps_tmo.update)
u_ps.subscribe("sys_fail", rps_sfl.update) rps_sfl.register(u_ps, "sys_fail", rps_sfl.update)
-- cooling annunciator panel -- cooling annunciator panel
TextBox{parent=main,text="REACTOR COOLANT SYSTEM",fg_bg=cpair(colors.black,colors.blue),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=22} TextBox{parent=main,text="REACTOR COOLANT SYSTEM",fg_bg=cpair(colors.black,colors.blue),alignment=ALIGN.CENTER,width=33,x=46,y=22}
local rcs = Rectangle{parent=main,border=border(1,colors.blue,true),thin=true,width=33,height=24,x=46,y=23} local rcs = Rectangle{parent=main,border=border(1,colors.blue,true),thin=true,width=33,height=24,x=46,y=23}
local rcs_annunc = Div{parent=rcs,width=27,height=23,x=2,y=1} local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1}
local rcs_tags = Div{parent=rcs,width=2,height=14,x=29,y=9} local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7}
local c_flt = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=cpair(colors.yellow,colors.gray)} local c_flt = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=ind_yel}
local c_emg = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green} local c_emg = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=ind_bkg,c2=ind_wht.fgd,c3=ind_grn.fgd}
local c_cfm = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_cfm = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=ind_yel}
local c_brm = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_brm = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=ind_yel}
local c_sfm = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_sfm = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=ind_yel}
local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=cpair(colors.yellow,colors.gray)} local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=ind_yel}
local c_tbnt = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
u_ps.subscribe("RCSFault", c_flt.update) c_flt.register(u_ps, "RCSFault", c_flt.update)
u_ps.subscribe("EmergencyCoolant", c_emg.update) c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
u_ps.subscribe("CoolantFeedMismatch", c_cfm.update) c_cfm.register(u_ps, "CoolantFeedMismatch", c_cfm.update)
u_ps.subscribe("BoilRateMismatch", c_brm.update) c_brm.register(u_ps, "BoilRateMismatch", c_brm.update)
u_ps.subscribe("SteamFeedMismatch", c_sfm.update) c_sfm.register(u_ps, "SteamFeedMismatch", c_sfm.update)
u_ps.subscribe("MaxWaterReturnFeed", c_mwrf.update) c_mwrf.register(u_ps, "MaxWaterReturnFeed", c_mwrf.update)
u_ps.subscribe("TurbineTrip", c_tbnt.update)
rcs_annunc.line_break() local available_space = 16 - (unit.num_boilers * 2 + unit.num_turbines * 4)
local function _add_space()
-- if we have some extra space, add padding
rcs_tags.line_break()
rcs_annunc.line_break()
end
-- boiler annunciator panel(s) -- boiler annunciator panel(s)
if unit.num_boilers > 0 then if unit.num_boilers > 0 then
TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg} if available_space > 0 then _add_space() end
local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
b_ps[1].subscribe("WasterLevelLow", b1_wll.update)
TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,x=1,text="B1",width=2,fg_bg=hc_text}
local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)} local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
b_ps[1].subscribe("HeatingRateLow", b1_hr.update) b1_wll.register(b_ps[1], "WaterLevelLow", b1_wll.update)
TextBox{parent=rcs_tags,text="B1",width=2,fg_bg=hc_text}
local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update)
end end
if unit.num_boilers > 1 then if unit.num_boilers > 1 then
TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg} -- note, can't (shouldn't for sure...) have 0 turbines
local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)} if (available_space > 2 and unit.num_turbines == 1) or
b_ps[2].subscribe("WasterLevelLow", b2_wll.update) (available_space > 3 and unit.num_turbines == 2) or
(available_space > 4) then
_add_space()
end
TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="B2",width=2,fg_bg=hc_text}
local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)} local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
b_ps[2].subscribe("HeatingRateLow", b2_hr.update) b2_wll.register(b_ps[2], "WaterLevelLow", b2_wll.update)
TextBox{parent=rcs_tags,text="B2",width=2,fg_bg=hc_text}
local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update)
end end
-- turbine annunciator panels -- turbine annunciator panels
if unit.num_boilers == 0 then if available_space > 1 then _add_space() end
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
else
rcs_tags.line_break()
rcs_annunc.line_break()
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
end
local t1_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red} TextBox{parent=rcs_tags,text="T1",width=2,fg_bg=hc_text}
t_ps[1].subscribe("SteamDumpOpen", t1_sdo.update) local t1_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,fg_bg=hc_text}
local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t_ps[1].subscribe("TurbineOverSpeed", t1_tos.update) t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,fg_bg=hc_text}
local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t_ps[1].subscribe("TurbineTrip", t1_trp.update) t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update)
TextBox{parent=rcs_tags,text="T1",width=2,fg_bg=hc_text}
local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update)
if unit.num_turbines > 1 then if unit.num_turbines > 1 then
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} if (available_space > 2 and unit.num_turbines == 2) or available_space > 3 then
local t2_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red} _add_space()
t_ps[2].subscribe("SteamDumpOpen", t2_sdo.update) end
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,fg_bg=hc_text}
local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t2_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
t_ps[2].subscribe("TurbineOverSpeed", t2_tos.update) t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update)
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,fg_bg=hc_text}
local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t_ps[2].subscribe("TurbineTrip", t2_trp.update) t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update)
TextBox{parent=rcs_tags,text="T2",width=2,fg_bg=hc_text}
local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update)
TextBox{parent=rcs_tags,text="T2",width=2,fg_bg=hc_text}
local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update)
end end
if unit.num_turbines > 2 then if unit.num_turbines > 2 then
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} if available_space > 3 then _add_space() end
local t3_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red}
t_ps[3].subscribe("SteamDumpOpen", t3_sdo.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,fg_bg=hc_text}
local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t3_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
t_ps[3].subscribe("TurbineOverSpeed", t3_tos.update) t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,fg_bg=hc_text}
local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t_ps[3].subscribe("TurbineTrip", t3_trp.update) t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update)
TextBox{parent=rcs_tags,text="T3",width=2,fg_bg=hc_text}
local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update)
TextBox{parent=rcs_tags,text="T3",width=2,fg_bg=hc_text}
local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update)
end end
util.nop()
---------------------- ----------------------
-- reactor controls -- -- reactor controls --
---------------------- ----------------------
local dis_colors = cpair(colors.white, colors.lightGray) local burn_control = Div{parent=main,x=12,y=28,width=19,height=3,fg_bg=s_hi_box}
local burn_rate = SpinboxNumeric{parent=burn_control,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
local burn_control = Div{parent=main,x=12,y=28,width=19,height=3,fg_bg=cpair(colors.gray,colors.white)} TextBox{parent=burn_control,x=9,y=2,text="mB/t",fg_bg=style.theme.label_fg}
local burn_rate = SpinboxNumeric{parent=burn_control,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
TextBox{parent=burn_control,x=9,y=2,text="mB/t"}
local set_burn = function () unit.set_burn(burn_rate.get_value()) end local set_burn = function () unit.set_burn(burn_rate.get_value()) end
local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=dis_colors,callback=set_burn} local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=dis_colors,callback=set_burn}
u_ps.subscribe("burn_rate", burn_rate.set_value) burn_rate.register(u_ps, "burn_rate", burn_rate.set_value)
u_ps.subscribe("max_burn", burn_rate.set_max) burn_rate.register(u_ps, "max_burn", burn_rate.set_max)
local start = HazardButton{parent=main,x=2,y=28,text="START",accent=colors.lightBlue,dis_colors=dis_colors,callback=unit.start,fg_bg=hzd_fg_bg} local start = HazardButton{parent=main,x=2,y=28,text="START",accent=colors.lightBlue,dis_colors=dis_colors,callback=unit.start,fg_bg=hzd_fg_bg}
local ack_a = HazardButton{parent=main,x=12,y=32,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=unit.ack_alarms,fg_bg=hzd_fg_bg} local ack_a = HazardButton{parent=main,x=12,y=32,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=unit.ack_alarms,fg_bg=hzd_fg_bg}
@@ -361,53 +387,56 @@ local function init(parent, id)
end end
end end
u_ps.subscribe("status", start_button_en_check) start.register(u_ps, "status", start_button_en_check)
u_ps.subscribe("rps_tripped", start_button_en_check) start.register(u_ps, "rps_tripped", start_button_en_check)
u_ps.subscribe("rps_tripped", function (active) if active then reset.enable() else reset.disable() end end) start.register(u_ps, "auto_group_id", start_button_en_check)
start.register(u_ps, "AutoControl", start_button_en_check)
TextBox{parent=main,text="WASTE PROCESSING",fg_bg=cpair(colors.black,colors.brown),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=48} reset.register(u_ps, "rps_tripped", function (active) if active then reset.enable() else reset.disable() end end)
TextBox{parent=main,text="WASTE PROCESSING",fg_bg=cpair(colors.black,colors.brown),alignment=ALIGN.CENTER,width=33,x=46,y=48}
local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49} local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49}
local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1} local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1}
local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=waste_opts,callback=unit.set_waste,min_width=6} local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=style.waste.unit_opts,callback=unit.set_waste,min_width=6}
u_ps.subscribe("U_WasteMode", waste_mode.set_value) waste_mode.register(u_ps, "U_WasteMode", waste_mode.set_value)
---------------------- ----------------------
-- alarm management -- -- alarm management --
---------------------- ----------------------
local alarm_panel = Div{parent=main,x=2,y=36,width=29,height=16,fg_bg=bw_fg_bg} local alarm_panel = Div{parent=main,x=2,y=36,width=29,height=16,fg_bg=s_hi_bright}
local a_brc = AlarmLight{parent=alarm_panel,x=6,y=2,label="Containment Breach",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_brc = AlarmLight{parent=alarm_panel,x=6,y=2,label="Containment Breach",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
local a_rad = AlarmLight{parent=alarm_panel,x=6,label="Containment Radiation",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_rad = AlarmLight{parent=alarm_panel,x=6,label="Containment Radiation",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
local a_dmg = AlarmLight{parent=alarm_panel,x=6,label="Critical Damage",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_dmg = AlarmLight{parent=alarm_panel,x=6,label="Critical Damage",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
alarm_panel.line_break() alarm_panel.line_break()
local a_rcl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Lost",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_rcl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Lost",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
local a_rcd = AlarmLight{parent=alarm_panel,x=6,label="Reactor Damage",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_rcd = AlarmLight{parent=alarm_panel,x=6,label="Reactor Damage",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
local a_rot = AlarmLight{parent=alarm_panel,x=6,label="Reactor Over Temp",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_rot = AlarmLight{parent=alarm_panel,x=6,label="Reactor Over Temp",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
local a_rht = AlarmLight{parent=alarm_panel,x=6,label="Reactor High Temp",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS} local a_rht = AlarmLight{parent=alarm_panel,x=6,label="Reactor High Temp",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
local a_rwl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste Leak",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_rwl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste Leak",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
local a_rwh = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste High",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS} local a_rwh = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste High",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
alarm_panel.line_break() alarm_panel.line_break()
local a_rps = AlarmLight{parent=alarm_panel,x=6,label="RPS Transient",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS} local a_rps = AlarmLight{parent=alarm_panel,x=6,label="RPS Transient",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
local a_clt = AlarmLight{parent=alarm_panel,x=6,label="RCS Transient",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS} local a_clt = AlarmLight{parent=alarm_panel,x=6,label="RCS Transient",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
local a_tbt = AlarmLight{parent=alarm_panel,x=6,label="Turbine Trip",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS} local a_tbt = AlarmLight{parent=alarm_panel,x=6,label="Turbine Trip",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
u_ps.subscribe("Alarm_1", a_brc.update) a_brc.register(u_ps, "Alarm_1", a_brc.update)
u_ps.subscribe("Alarm_2", a_rad.update) a_rad.register(u_ps, "Alarm_2", a_rad.update)
u_ps.subscribe("Alarm_4", a_dmg.update) a_dmg.register(u_ps, "Alarm_4", a_dmg.update)
u_ps.subscribe("Alarm_3", a_rcl.update) a_rcl.register(u_ps, "Alarm_3", a_rcl.update)
u_ps.subscribe("Alarm_5", a_rcd.update) a_rcd.register(u_ps, "Alarm_5", a_rcd.update)
u_ps.subscribe("Alarm_6", a_rot.update) a_rot.register(u_ps, "Alarm_6", a_rot.update)
u_ps.subscribe("Alarm_7", a_rht.update) a_rht.register(u_ps, "Alarm_7", a_rht.update)
u_ps.subscribe("Alarm_8", a_rwl.update) a_rwl.register(u_ps, "Alarm_8", a_rwl.update)
u_ps.subscribe("Alarm_9", a_rwh.update) a_rwh.register(u_ps, "Alarm_9", a_rwh.update)
u_ps.subscribe("Alarm_10", a_rps.update) a_rps.register(u_ps, "Alarm_10", a_rps.update)
u_ps.subscribe("Alarm_11", a_clt.update) a_clt.register(u_ps, "Alarm_11", a_clt.update)
u_ps.subscribe("Alarm_12", a_tbt.update) a_tbt.register(u_ps, "Alarm_12", a_tbt.update)
-- ack's and resets -- ack's and resets
@@ -445,72 +474,63 @@ local function init(parent, id)
-- color tags -- color tags
TextBox{parent=alarm_panel,x=5,y=13,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.cyan)} TextBox{parent=alarm_panel,x=5,y=13,text="\x95",width=1,fg_bg=cpair(s_hi_bright.bkg,colors.cyan)}
TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.blue)} TextBox{parent=alarm_panel,x=5,text="\x95",width=1,fg_bg=cpair(s_hi_bright.bkg,colors.blue)}
TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.blue)} TextBox{parent=alarm_panel,x=5,text="\x95",width=1,fg_bg=cpair(s_hi_bright.bkg,colors.blue)}
-------------------------------- --------------------------------
-- automatic control settings -- -- automatic control settings --
-------------------------------- --------------------------------
TextBox{parent=main,text="AUTO CTRL",fg_bg=cpair(colors.black,colors.purple),alignment=TEXT_ALIGN.CENTER,width=13,height=1,x=32,y=36} TextBox{parent=main,text="AUTO CTRL",fg_bg=cpair(colors.black,colors.purple),alignment=ALIGN.CENTER,width=13,x=32,y=36}
local auto_ctl = Rectangle{parent=main,border=border(1,colors.purple,true),thin=true,width=13,height=15,x=32,y=37} local auto_ctl = Rectangle{parent=main,border=border(1,colors.purple,true),thin=true,width=13,height=15,x=32,y=37}
local auto_div = Div{parent=auto_ctl,width=13,height=15,x=1,y=1} local auto_div = Div{parent=auto_ctl,width=13,height=15,x=1,y=1}
local ctl_opts = { "Manual", "Primary", "Secondary", "Tertiary", "Backup" } local ctl_opts = { "Manual", "Primary", "Secondary", "Tertiary", "Backup" }
local group = RadioButton{parent=auto_div,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.blue,colors.white),radio_bg=colors.gray} local group = RadioButton{parent=auto_div,options=ctl_opts,callback=function()end,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.purple}
u_ps.subscribe("auto_group_id", function (gid) group.set_value(gid + 1) end) group.register(u_ps, "auto_group_id", function (gid) group.set_value(gid + 1) end)
auto_div.line_break() auto_div.line_break()
local function set_group() unit.set_group(group.get_value() - 1) end local function set_group() unit.set_group(group.get_value() - 1) end
local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group} local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=gry_wht,callback=set_group}
auto_div.line_break() auto_div.line_break()
TextBox{parent=auto_div,text="Prio. Group",height=1,width=11,fg_bg=style.label} TextBox{parent=auto_div,text="Prio. Group",width=11,fg_bg=style.label}
local auto_grp = TextBox{parent=auto_div,text="Manual",height=1,width=11,fg_bg=bw_fg_bg} local auto_grp = TextBox{parent=auto_div,text="Manual",width=11,fg_bg=s_field}
u_ps.subscribe("auto_group", auto_grp.set_value) auto_grp.register(u_ps, "auto_group", auto_grp.set_value)
auto_div.line_break() auto_div.line_break()
local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=cpair(colors.green,colors.gray)} local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=ind_grn}
local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_1000_MS} local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=ind_wht,flash=true,period=period.BLINK_1000_MS}
u_ps.subscribe("U_AutoReady", a_rdy.update) a_rdy.register(u_ps, "U_AutoReady", a_rdy.update)
-- update standby indicator -- update standby indicator
u_ps.subscribe("status", function (active) a_stb.register(u_ps, "status", function (active)
a_stb.update(unit.annunciator.AutoControl and (not active)) a_stb.update(unit.annunciator.AutoControl and (not active))
end) end)
a_stb.register(u_ps, "AutoControl", function (auto_active)
-- enable and disable controls based on group assignment
u_ps.subscribe("auto_group_id", function (gid)
start_button_en_check()
if gid == 0 then
burn_rate.enable()
set_burn_btn.enable()
else
burn_rate.disable()
set_burn_btn.disable()
end
end)
-- enable and disable controls based on auto control state (start button is handled separately)
u_ps.subscribe("AutoControl", function (auto_active)
start_button_en_check()
if auto_active then if auto_active then
a_stb.update(unit.reactor_data.mek_status.status == false) a_stb.update(unit.reactor_data.mek_status.status == false)
else a_stb.update(false) end else a_stb.update(false) end
end) end)
-- enable/disable controls based on group assignment (start button is separate)
burn_rate.register(u_ps, "auto_group_id", function (gid)
if gid == 0 then burn_rate.enable() else burn_rate.disable() end
end)
set_burn_btn.register(u_ps, "auto_group_id", function (gid)
if gid == 0 then set_burn_btn.enable() else set_burn_btn.disable() end
end)
-- can't change group if auto is engaged regardless of if this unit is part of auto control -- can't change group if auto is engaged regardless of if this unit is part of auto control
f_ps.subscribe("auto_active", function (auto_active) set_grp_btn.register(f_ps, "auto_active", function (auto_active)
if auto_active then set_grp_btn.disable() else set_grp_btn.enable() end if auto_active then set_grp_btn.disable() else set_grp_btn.enable() end
end) end)

View File

@@ -0,0 +1,229 @@
--
-- Basic Unit Flow Overview
--
local util = require("scada-common.util")
local style = require("coordinator.ui.style")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local PipeNetwork = require("graphics.elements.pipenet")
local TextBox = require("graphics.elements.textbox")
local Rectangle = require("graphics.elements.rectangle")
local DataIndicator = require("graphics.elements.indicators.data")
local IndicatorLight = require("graphics.elements.indicators.light")
local TriIndicatorLight = require("graphics.elements.indicators.trilight")
local ALIGN = core.ALIGN
local sprintf = util.sprintf
local border = core.border
local cpair = core.cpair
local pipe = core.pipe
local wh_gray = style.wh_gray
local lg_gray = style.lg_gray
-- make a new unit flow window
---@param parent graphics_element parent
---@param x integer top left x
---@param y integer top left y
---@param wide boolean whether to render wide version
---@param unit ioctl_unit unit database entry
local function make(parent, x, y, wide, unit)
local s_field = style.theme.field_box
local text_c = style.text_colors
local lu_c = style.lu_colors
local lu_c_d = style.lu_colors_dark
local ind_grn = style.ind_grn
local ind_wht = style.ind_wht
local height = 16
local v_start = 1 + ((unit.unit_id - 1) * 5)
local prv_start = 1 + ((unit.unit_id - 1) * 3)
local v_fields = { "pu", "po", "pl", "am" }
local v_names = {
sprintf("PV%02d-PU", v_start),
sprintf("PV%02d-PO", v_start + 1),
sprintf("PV%02d-PL", v_start + 2),
sprintf("PV%02d-AM", v_start + 3),
sprintf("PRV%02d", prv_start),
sprintf("PRV%02d", prv_start + 1),
sprintf("PRV%02d", prv_start + 2)
}
assert(parent.get_height() >= (y + height), "flow display not of sufficient vertical resolution (add an additional row of monitors) " .. y .. "," .. parent.get_height())
local function _wide(a, b) return util.trinary(wide, a, b) end
-- bounding box div
local root = Div{parent=parent,x=x,y=y,width=_wide(136, 114),height=height}
------------------
-- COOLING LOOP --
------------------
local reactor = Rectangle{parent=root,x=1,y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=reactor,y=1,text="FISSION REACTOR",alignment=ALIGN.CENTER}
TextBox{parent=reactor,y=3,text="UNIT #"..unit.unit_id,alignment=ALIGN.CENTER}
TextBox{parent=root,x=19,y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
TextBox{parent=root,x=3,y=5,text="\x19",width=1,fg_bg=lg_gray}
local rc_pipes = {}
local emc_x = 42 -- emergency coolant connection x point
if unit.num_boilers > 0 then
table.insert(rc_pipes, pipe(0, 1, _wide(28, 19), 1, colors.lightBlue, true))
table.insert(rc_pipes, pipe(0, 3, _wide(28, 19), 3, colors.orange, true))
table.insert(rc_pipes, pipe(_wide(46 ,39), 1, _wide(72,58), 1, colors.blue, true))
table.insert(rc_pipes, pipe(_wide(46,39), 3, _wide(72,58), 3, colors.white, true))
else
emc_x = 3
table.insert(rc_pipes, pipe(0, 1, _wide(72,58), 1, colors.blue, true))
table.insert(rc_pipes, pipe(0, 3, _wide(72,58), 3, colors.white, true))
end
if unit.has_tank then
table.insert(rc_pipes, pipe(emc_x, 1, emc_x, 0, colors.blue, true, true))
end
local prv_yo = math.max(3 - unit.num_turbines, 0)
for i = 1, unit.num_turbines do
local py = 2 * (i - 1) + prv_yo
table.insert(rc_pipes, pipe(_wide(92, 78), py, _wide(104, 83), py, colors.white, true))
end
PipeNetwork{parent=root,x=20,y=1,pipes=rc_pipes,bg=style.theme.bg}
if unit.num_boilers > 0 then
local cc_rate = DataIndicator{parent=root,x=_wide(25,22),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
local hc_rate = DataIndicator{parent=root,x=_wide(25,22),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
cc_rate.register(unit.unit_ps, "boiler_boil_sum", function (sum) cc_rate.update(sum * 10) end)
hc_rate.register(unit.unit_ps, "heating_rate", hc_rate.update)
local boiler = Rectangle{parent=root,x=_wide(47,40),y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=boiler,y=1,text="THERMO-ELECTRIC",alignment=ALIGN.CENTER}
TextBox{parent=boiler,y=3,text=util.trinary(unit.num_boilers>1,"BOILERS","BOILER"),alignment=ALIGN.CENTER}
TextBox{parent=root,x=_wide(47,40),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
TextBox{parent=root,x=_wide(65,58),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
local wt_rate = DataIndicator{parent=root,x=_wide(71,61),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
local st_rate = DataIndicator{parent=root,x=_wide(71,61),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
st_rate.register(unit.unit_ps, "boiler_boil_sum", st_rate.update)
else
local wt_rate = DataIndicator{parent=root,x=28,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
local st_rate = DataIndicator{parent=root,x=28,y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
st_rate.register(unit.unit_ps, "heating_rate", st_rate.update)
end
local turbine = Rectangle{parent=root,x=_wide(93,79),y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=turbine,y=1,text="STEAM TURBINE",alignment=ALIGN.CENTER}
TextBox{parent=turbine,y=3,text=util.trinary(unit.num_turbines>1,"GENERATORS","GENERATOR"),alignment=ALIGN.CENTER}
TextBox{parent=root,x=_wide(93,79),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
for i = 1, unit.num_turbines do
local ry = 1 + (2 * (i - 1)) + prv_yo
TextBox{parent=root,x=_wide(125,103),y=ry,text="\x10\x11\x7f",fg_bg=text_c,width=3}
local state = TriIndicatorLight{parent=root,x=_wide(129,107),y=ry,label=v_names[i+4],c1=style.ind_bkg,c2=style.ind_yel.fgd,c3=style.ind_red.fgd}
state.register(unit.turbine_ps_tbl[i], "SteamDumpOpen", state.update)
end
----------------------
-- WASTE PROCESSING --
----------------------
local waste = Div{parent=root,x=3,y=6}
local waste_c = style.theme.fuel_color
local waste_pipes = {
pipe(0, 0, _wide(19, 16), 1, colors.brown, true),
pipe(_wide(14, 13), 1, _wide(19, 17), 5, colors.brown, true),
pipe(_wide(22, 19), 1, _wide(49, 45), 1, colors.brown, true),
pipe(_wide(22, 19), 5, _wide(28, 24), 5, colors.brown, true),
pipe(_wide(64, 53), 1, _wide(95, 81), 1, colors.green, true),
pipe(_wide(48, 43), 4, _wide(71, 61), 4, colors.cyan, true),
pipe(_wide(66, 57), 4, _wide(71, 61), 8, colors.cyan, true),
pipe(_wide(74, 63), 4, _wide(95, 81), 4, colors.cyan, true),
pipe(_wide(74, 63), 8, _wide(133, 111), 8, colors.cyan, true),
pipe(_wide(108, 94), 1, _wide(132, 110), 6, waste_c, true, true),
pipe(_wide(108, 94), 4, _wide(111, 95), 1, waste_c, true, true),
pipe(_wide(132, 110), 6, _wide(130, 108), 6, waste_c, true, true)
}
PipeNetwork{parent=waste,x=1,y=1,pipes=waste_pipes,bg=style.theme.bg}
local function _valve(vx, vy, n)
TextBox{parent=waste,x=vx,y=vy,text="\x10\x11",fg_bg=text_c,width=2}
local conn = IndicatorLight{parent=waste,x=vx-3,y=vy+1,label=v_names[n],colors=ind_grn}
local open = IndicatorLight{parent=waste,x=vx-3,y=vy+2,label="OPEN",colors=ind_wht}
conn.register(unit.unit_ps, util.c("V_", v_fields[n], "_conn"), conn.update)
open.register(unit.unit_ps, util.c("V_", v_fields[n], "_state"), open.update)
end
local function _machine(mx, my, name)
local l = string.len(name) + 2
TextBox{parent=waste,x=mx,y=my,text=string.rep("\x8f",l),alignment=ALIGN.CENTER,fg_bg=cpair(style.theme.bg,style.theme.header.bkg),width=l}
TextBox{parent=waste,x=mx,y=my+1,text=name,alignment=ALIGN.CENTER,fg_bg=style.theme.header,width=l}
end
local waste_rate = DataIndicator{parent=waste,x=1,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
local pu_rate = DataIndicator{parent=waste,x=_wide(82,70),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=s_field}
local po_rate = DataIndicator{parent=waste,x=_wide(52,45),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
local popl_rate = DataIndicator{parent=waste,x=_wide(82,70),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
local poam_rate = DataIndicator{parent=waste,x=_wide(82,70),y=10,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
local spent_rate = DataIndicator{parent=waste,x=_wide(117,98),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%8.3f",value=0,width=13,fg_bg=s_field}
waste_rate.register(unit.unit_ps, "act_burn_rate", waste_rate.update)
pu_rate.register(unit.unit_ps, "pu_rate", pu_rate.update)
po_rate.register(unit.unit_ps, "po_rate", po_rate.update)
popl_rate.register(unit.unit_ps, "po_pl_rate", popl_rate.update)
poam_rate.register(unit.unit_ps, "po_am_rate", poam_rate.update)
spent_rate.register(unit.unit_ps, "ws_rate", spent_rate.update)
_valve(_wide(21, 18), 2, 1)
_valve(_wide(21, 18), 6, 2)
_valve(_wide(73, 62), 5, 3)
_valve(_wide(73, 62), 9, 4)
_machine(_wide(51, 45), 1, "CENTRIFUGE \x1a");
_machine(_wide(97, 83), 1, "PRC [Pu] \x1a");
_machine(_wide(97, 83), 4, "PRC [Po] \x1a");
_machine(_wide(116, 94), 6, "SPENT WASTE \x1b")
TextBox{parent=waste,x=_wide(30,25),y=3,text="SNAs [Po]",alignment=ALIGN.CENTER,width=19,fg_bg=wh_gray}
local sna_po = Rectangle{parent=waste,x=_wide(30,25),y=4,border=border(1,colors.gray,true),width=19,height=7,thin=true,fg_bg=style.theme.highlight_box_bright}
local sna_act = IndicatorLight{parent=sna_po,label="ACTIVE",colors=ind_grn}
local sna_cnt = DataIndicator{parent=sna_po,x=12,y=1,lu_colors=lu_c_d,label="CNT",unit="",format="%2d",value=0,width=7}
local sna_pk = DataIndicator{parent=sna_po,y=3,lu_colors=lu_c_d,label="PEAK",unit="mB/t",format="%7.2f",value=0,width=17}
local sna_max = DataIndicator{parent=sna_po,lu_colors=lu_c_d,label="MAX",unit="mB/t",format="%8.2f",value=0,width=17}
local sna_in = DataIndicator{parent=sna_po,lu_colors=lu_c_d,label="IN",unit="mB/t",format="%9.2f",value=0,width=17}
sna_act.register(unit.unit_ps, "po_rate", function (r) sna_act.update(r > 0) end)
sna_cnt.register(unit.unit_ps, "sna_count", sna_cnt.update)
sna_pk.register(unit.unit_ps, "sna_peak_rate", sna_pk.update)
sna_max.register(unit.unit_ps, "sna_max_rate", sna_max.update)
sna_in.register(unit.unit_ps, "sna_in", sna_in.update)
return root
end
return make

View File

@@ -14,9 +14,9 @@ local Div = require("graphics.elements.div")
local PipeNetwork = require("graphics.elements.pipenet") local PipeNetwork = require("graphics.elements.pipenet")
local TextBox = require("graphics.elements.textbox") local TextBox = require("graphics.elements.textbox")
local TEXT_ALIGN = core.graphics.TEXT_ALIGN local ALIGN = core.ALIGN
local pipe = core.graphics.pipe local pipe = core.pipe
-- make a new unit overview window -- make a new unit overview window
---@param parent graphics_element parent ---@param parent graphics_element parent
@@ -24,34 +24,33 @@ local pipe = core.graphics.pipe
---@param y integer top left y ---@param y integer top left y
---@param unit ioctl_unit unit database entry ---@param unit ioctl_unit unit database entry
local function make(parent, x, y, unit) local function make(parent, x, y, unit)
local height = 0
local num_boilers = #unit.boiler_data_tbl local num_boilers = #unit.boiler_data_tbl
local num_turbines = #unit.turbine_data_tbl local num_turbines = #unit.turbine_data_tbl
assert(num_boilers >= 0 and num_boilers <= 2, "minimum 0 boilers, maximum 2 boilers") assert(num_boilers >= 0 and num_boilers <= 2, "minimum 0 boilers, maximum 2 boilers")
assert(num_turbines >= 1 and num_turbines <= 3, "minimum 1 turbine, maximum 3 turbines") assert(num_turbines >= 1 and num_turbines <= 3, "minimum 1 turbine, maximum 3 turbines")
local height = 25
if num_boilers == 0 and num_turbines == 1 then if num_boilers == 0 and num_turbines == 1 then
height = 9 height = 9
elseif num_boilers == 1 and num_turbines <= 2 then elseif num_boilers <= 1 and num_turbines <= 2 then
height = 17 height = 17
else
height = 25
end end
assert(parent.height() >= (y + height), "main display not of sufficient vertical resolution (add an additional row of monitors)") assert(parent.get_height() >= (y + height), "main display not of sufficient vertical resolution (add an additional row of monitors)")
-- bounding box div -- bounding box div
local root = Div{parent=parent,x=x,y=y,width=80,height=height} local root = Div{parent=parent,x=x,y=y,width=80,height=height}
-- unit header message -- unit header message
TextBox{parent=root,text="Unit #"..unit.unit_id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header} TextBox{parent=root,text="Unit #"..unit.unit_id,alignment=ALIGN.CENTER,fg_bg=style.theme.header}
------------- -------------
-- REACTOR -- -- REACTOR --
------------- -------------
reactor_view(root, 1, 3, unit.reactor_data, unit.unit_ps) reactor_view(root, 1, 3, unit.unit_ps)
if num_boilers > 0 then if num_boilers > 0 then
local coolant_pipes = {} local coolant_pipes = {}
@@ -67,7 +66,7 @@ local function make(parent, x, y, unit)
table.insert(coolant_pipes, pipe(2, 0, 11, 11, colors.orange)) table.insert(coolant_pipes, pipe(2, 0, 11, 11, colors.orange))
end end
PipeNetwork{parent=root,x=4,y=10,pipes=coolant_pipes,bg=colors.lightGray} PipeNetwork{parent=root,x=4,y=10,pipes=coolant_pipes,bg=style.theme.bg}
end end
------------- -------------
@@ -165,10 +164,10 @@ local function make(parent, x, y, unit)
table.insert(steam_pipes_b, pipe(0, 18, 2, 18, colors.blue, false, true)) -- water boiler 2 to turbine 2 junction table.insert(steam_pipes_b, pipe(0, 18, 2, 18, colors.blue, false, true)) -- water boiler 2 to turbine 2 junction
end end
PipeNetwork{parent=root,x=47,y=11,pipes=steam_pipes_a,bg=colors.lightGray} PipeNetwork{parent=root,x=47,y=11,pipes=steam_pipes_a,bg=style.theme.bg}
end end
PipeNetwork{parent=root,x=54,y=3,pipes=steam_pipes_b,bg=colors.lightGray} PipeNetwork{parent=root,x=54,y=3,pipes=steam_pipes_b,bg=style.theme.bg}
return root return root
end end

View File

@@ -1,33 +0,0 @@
--
-- Reactor Unit Waiting Spinner
--
local style = require("coordinator.ui.style")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local TextBox = require("graphics.elements.textbox")
local WaitingAnim = require("graphics.elements.animations.waiting")
local TEXT_ALIGN = core.graphics.TEXT_ALIGN
local cpair = core.graphics.cpair
-- create a unit waiting view
---@param parent graphics_element parent
---@param y integer y offset
local function init(parent, y)
-- bounding box div
local root = Div{parent=parent,x=1,y=y,height=5}
local waiting_x = math.floor(parent.width() / 2) - 2
TextBox{parent=root,text="Waiting for status...",alignment=TEXT_ALIGN.CENTER,y=1,height=1,fg_bg=cpair(colors.black,style.root.bkg)}
WaitingAnim{parent=root,x=waiting_x,y=3,fg_bg=cpair(colors.blue,style.root.bkg)}
return root
end
return init

View File

@@ -1,52 +0,0 @@
local completion = require("cc.completion")
local util = require("scada-common.util")
local print = util.print
local dialog = {}
-- ask the user yes or no
---@nodiscard
---@param question string
---@param default boolean
---@return boolean|nil
function dialog.ask_y_n(question, default)
print(question)
if default == true then
print(" (Y/n)? ")
else
print(" (y/N)? ")
end
local response = read(nil, nil)
if response == "" then
return default
elseif response == "Y" or response == "y" then
return true
elseif response == "N" or response == "n" then
return false
else
return nil
end
end
-- ask the user for an input within a set of options
---@nodiscard
---@param options table
---@param cancel string
---@return boolean|string|nil
function dialog.ask_options(options, cancel)
print("> ")
local response = read(nil, nil, function(text) return completion.choice(text, options) end)
if response == cancel then return false end
if util.table_contains(options, response) then
return response
else return nil end
end
return dialog

View File

@@ -0,0 +1,393 @@
--
-- Flow Monitor GUI
--
local types = require("scada-common.types")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style")
local unit_flow = require("coordinator.ui.components.unit_flow")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local PipeNetwork = require("graphics.elements.pipenet")
local Rectangle = require("graphics.elements.rectangle")
local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local HorizontalBar = require("graphics.elements.indicators.hbar")
local IndicatorLight = require("graphics.elements.indicators.light")
local StateIndicator = require("graphics.elements.indicators.state")
local CONTAINER_MODE = types.CONTAINER_MODE
local ALIGN = core.ALIGN
local cpair = core.cpair
local border = core.border
local pipe = core.pipe
local wh_gray = style.wh_gray
-- create new flow view
---@param main graphics_element main displaybox
local function init(main)
local s_hi_bright = style.theme.highlight_box_bright
local s_field = style.theme.field_box
local text_col = style.text_colors
local lu_col = style.lu_colors
local lu_c_d = style.lu_colors_dark
local facility = iocontrol.get_db().facility
local units = iocontrol.get_db().units
local tank_defs = facility.tank_defs
local tank_list = facility.tank_list
-- window header message
local header = TextBox{parent=main,y=1,text="Facility Coolant and Waste Flow Monitor",alignment=ALIGN.CENTER,fg_bg=style.theme.header}
-- max length example: "01:23:45 AM - Wednesday, September 28 2022"
local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=ALIGN.RIGHT,width=42,fg_bg=style.theme.header}
datetime.register(facility.ps, "date_time", datetime.set_value)
local po_pipes = {}
local water_pipes = {}
-- get the y offset for this unit index
---@param idx integer unit index
local function y_ofs(idx) return ((idx - 1) * 20) end
-- determinte facility tank start/end from the definitions list
---@param start_idx integer start index of table iteration
---@param end_idx integer end index of table iteration
local function find_fdef(start_idx, end_idx)
local first, last = 4, 0
for i = start_idx, end_idx do
if tank_defs[i] == 2 then
last = i
if i < first then first = i end
end
end
return first, last
end
if facility.tank_mode == 0 or facility.tank_mode == 8 then
-- (0) tanks belong to reactor units OR (8) 4 total facility tanks (A B C D)
for i = 1, facility.num_units do
if units[i].has_tank then
local y = y_ofs(i)
table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
local u = units[i] ---@type ioctl_unit
local x = util.trinary(u.num_boilers == 0, 45, 84)
table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
end
end
else
-- setup connections for units with emergency coolant, always the same
for i = 1, #tank_defs do
if tank_defs[i] > 0 then
local y = y_ofs(i)
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(1, y, 21, y, colors.blue, true))
else
table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
end
local u = units[i] ---@type ioctl_unit
local x = util.trinary(u.num_boilers == 0, 45, 84)
table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
end
end
if facility.tank_mode == 1 then
-- (1) 1 total facility tank (A A A A)
local first_fdef, last_fdef = find_fdef(1, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 2 then
-- (2) 2 total facility tanks (A A A B)
local first_fdef, last_fdef = find_fdef(1, math.min(3, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 3 then
-- (3) 2 total facility tanks (A A B B)
for _, a in pairs({ 1, 3 }) do
local b = a + 1
if tank_defs[a] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(a), 1, y_ofs(a) + 6, colors.blue, true))
if tank_defs[b] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(b) - 13, 1, y_ofs(b), colors.blue, true))
end
elseif tank_defs[b] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(b), 1, y_ofs(b) + 6, colors.blue, true))
end
end
elseif facility.tank_mode == 4 then
-- (4) 2 total facility tanks (A B B B)
local first_fdef, last_fdef = find_fdef(2, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 5 then
-- (5) 3 total facility tanks (A A B C)
local first_fdef, last_fdef = find_fdef(1, math.min(2, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 3 or i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 6 then
-- (6) 3 total facility tanks (A B B C)
local first_fdef, last_fdef = find_fdef(2, math.min(3, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 or i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 7 then
-- (7) 3 total facility tanks (A B C C)
local first_fdef, last_fdef = find_fdef(3, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 or i == 2 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
end
end
local flow_x = 3
if #water_pipes > 0 then
flow_x = 25
PipeNetwork{parent=main,x=2,y=3,pipes=water_pipes,bg=style.theme.bg}
end
for i = 1, facility.num_units do
local y_offset = y_ofs(i)
unit_flow(main, flow_x, 5 + y_offset, #water_pipes == 0, units[i])
table.insert(po_pipes, pipe(0, 3 + y_offset, 4, 0, colors.cyan, true, true))
util.nop()
end
PipeNetwork{parent=main,x=139,y=15,pipes=po_pipes,bg=style.theme.bg}
-----------------
-- tank valves --
-----------------
local next_f_id = 1
for i = 1, #tank_defs do
if tank_defs[i] > 0 then
local vy = 3 + y_ofs(i)
TextBox{parent=main,x=12,y=vy,text="\x10\x11",fg_bg=text_col,width=2}
local conn = IndicatorLight{parent=main,x=9,y=vy+1,label=util.sprintf("PV%02d-EMC", i * 5),colors=style.ind_grn}
local open = IndicatorLight{parent=main,x=9,y=vy+2,label="OPEN",colors=style.ind_wht}
conn.register(units[i].unit_ps, "V_emc_conn", conn.update)
open.register(units[i].unit_ps, "V_emc_state", open.update)
end
end
-------------------
-- dynamic tanks --
-------------------
for i = 1, #tank_list do
if tank_list[i] > 0 then
local id = "U-" .. i
local f_id = next_f_id
if tank_list[i] == 2 then
id = "F-" .. next_f_id
next_f_id = next_f_id + 1
end
local y_offset = y_ofs(i)
local tank = Div{parent=main,x=3,y=7+y_offset,width=20,height=14}
TextBox{parent=tank,text=" ",x=1,y=1,fg_bg=style.lg_gray}
TextBox{parent=tank,text="DYNAMIC TANK "..id,alignment=ALIGN.CENTER,fg_bg=style.wh_gray}
local tank_box = Rectangle{parent=tank,border=border(1,colors.gray,true),width=20,height=12}
local status = StateIndicator{parent=tank_box,x=3,y=1,states=style.dtank.states,value=1,min_width=14}
TextBox{parent=tank_box,x=2,y=3,text="Fill",width=10,fg_bg=style.label}
local tank_pcnt = DataIndicator{parent=tank_box,x=10,y=3,label="",format="%5.2f",value=100,unit="%",lu_colors=lu_col,width=8,fg_bg=text_col}
local tank_amnt = DataIndicator{parent=tank_box,x=2,label="",format="%13d",value=0,commas=true,unit="mB",lu_colors=lu_col,width=16,fg_bg=s_field}
TextBox{parent=tank_box,x=2,y=6,text="Water Level",width=11,fg_bg=style.label}
local level = HorizontalBar{parent=tank_box,x=2,y=7,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=16}
TextBox{parent=tank_box,x=2,y=9,text="In/Out Mode",width=11,fg_bg=style.label}
local can_fill = IndicatorLight{parent=tank_box,x=2,y=10,label="FILL",colors=style.ind_wht}
local can_empty = IndicatorLight{parent=tank_box,x=10,y=10,label="EMPTY",colors=style.ind_wht}
local function _can_fill(mode)
can_fill.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.FILL))
end
local function _can_empty(mode)
can_empty.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.EMPTY))
end
if tank_list[i] == 1 then
status.register(units[i].tank_ps_tbl[1], "computed_status", status.update)
tank_pcnt.register(units[i].tank_ps_tbl[1], "fill", function (f) tank_pcnt.update(f * 100) end)
tank_amnt.register(units[i].tank_ps_tbl[1], "stored", function (sto) tank_amnt.update(sto.amount) end)
level.register(units[i].tank_ps_tbl[1], "fill", level.update)
can_fill.register(units[i].tank_ps_tbl[1], "container_mode", _can_fill)
can_empty.register(units[i].tank_ps_tbl[1], "container_mode", _can_empty)
else
status.register(facility.tank_ps_tbl[f_id], "computed_status", status.update)
tank_pcnt.register(facility.tank_ps_tbl[f_id], "fill", function (f) tank_pcnt.update(f * 100) end)
tank_amnt.register(facility.tank_ps_tbl[f_id], "stored", function (sto) tank_amnt.update(sto.amount) end)
level.register(facility.tank_ps_tbl[f_id], "fill", level.update)
can_fill.register(facility.tank_ps_tbl[f_id], "container_mode", _can_fill)
can_empty.register(facility.tank_ps_tbl[f_id], "container_mode", _can_empty)
end
end
end
util.nop()
---------
-- SPS --
---------
local sps = Div{parent=main,x=140,y=3,height=12}
TextBox{parent=sps,text=" ",width=24,x=1,y=1,fg_bg=style.lg_gray}
TextBox{parent=sps,text="SPS",alignment=ALIGN.CENTER,width=24,fg_bg=wh_gray}
local sps_box = Rectangle{parent=sps,border=border(1,colors.gray,true),width=24,height=10}
local status = StateIndicator{parent=sps_box,x=5,y=1,states=style.sps.states,value=1,min_width=14}
status.register(facility.sps_ps_tbl[1], "computed_status", status.update)
TextBox{parent=sps_box,x=2,y=3,text="Input Rate",width=10,fg_bg=style.label}
local sps_in = DataIndicator{parent=sps_box,x=2,label="",format="%15.2f",value=0,unit="mB/t",lu_colors=lu_col,width=20,fg_bg=s_field}
sps_in.register(facility.ps, "po_am_rate", sps_in.update)
TextBox{parent=sps_box,x=2,y=6,text="Production Rate",width=15,fg_bg=style.label}
local sps_rate = DataIndicator{parent=sps_box,x=2,label="",format="%15d",value=0,unit="\xb5B/t",lu_colors=lu_col,width=20,fg_bg=s_field}
sps_rate.register(facility.sps_ps_tbl[1], "process_rate", function (r) sps_rate.update(r * 1000) end)
----------------
-- statistics --
----------------
TextBox{parent=main,x=145,y=16,text="RAW WASTE",alignment=ALIGN.CENTER,width=19,fg_bg=wh_gray}
local raw_waste = Rectangle{parent=main,x=145,y=17,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=s_hi_bright}
local sum_raw_waste = DataIndicator{parent=raw_waste,lu_colors=lu_c_d,label="SUM",unit="mB/t",format="%8.2f",value=0,width=17}
sum_raw_waste.register(facility.ps, "burn_sum", sum_raw_waste.update)
TextBox{parent=main,x=145,y=21,text="PROC. WASTE",alignment=ALIGN.CENTER,width=19,fg_bg=wh_gray}
local pr_waste = Rectangle{parent=main,x=145,y=22,border=border(1,colors.gray,true),width=19,height=5,thin=true,fg_bg=s_hi_bright}
local pu = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="Pu",unit="mB/t",format="%9.3f",value=0,width=17}
local po = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="Po",unit="mB/t",format="%9.2f",value=0,width=17}
local popl = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="PoPl",unit="mB/t",format="%7.2f",value=0,width=17}
pu.register(facility.ps, "pu_rate", pu.update)
po.register(facility.ps, "po_rate", po.update)
popl.register(facility.ps, "po_pl_rate", popl.update)
TextBox{parent=main,x=145,y=28,text="SPENT WASTE",alignment=ALIGN.CENTER,width=19,fg_bg=wh_gray}
local sp_waste = Rectangle{parent=main,x=145,y=29,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=s_hi_bright}
local sum_sp_waste = DataIndicator{parent=sp_waste,lu_colors=lu_c_d,label="SUM",unit="mB/t",format="%8.3f",value=0,width=17}
sum_sp_waste.register(facility.ps, "spent_waste_rate", sum_sp_waste.update)
end
return init

View File

@@ -0,0 +1,168 @@
--
-- Coordinator Front Panel GUI
--
local types = require("scada-common.types")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local pgi = require("coordinator.ui.pgi")
local style = require("coordinator.ui.style")
local pkt_entry = require("coordinator.ui.components.pkt_entry")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local ListBox = require("graphics.elements.listbox")
local MultiPane = require("graphics.elements.multipane")
local TextBox = require("graphics.elements.textbox")
local TabBar = require("graphics.elements.controls.tabbar")
local LED = require("graphics.elements.indicators.led")
local LEDPair = require("graphics.elements.indicators.ledpair")
local RGBLED = require("graphics.elements.indicators.ledrgb")
local LINK_STATE = types.PANEL_LINK_STATE
local ALIGN = core.ALIGN
local cpair = core.cpair
local led_grn = style.led_grn
-- create new front panel view
---@param panel graphics_element main displaybox
---@param num_units integer number of units (number of unit monitors)
local function init(panel, num_units)
local ps = iocontrol.get_db().fp.ps
TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=ALIGN.CENTER,fg_bg=style.fp_theme.header}
local page_div = Div{parent=panel,x=1,y=3}
--
-- system indicators
--
local main_page = Div{parent=page_div,x=1,y=1}
local system = Div{parent=main_page,width=14,height=17,x=2,y=2}
local status = LED{parent=system,label="STATUS",colors=cpair(colors.green,colors.red)}
local heartbeat = LED{parent=system,label="HEARTBEAT",colors=led_grn}
status.update(true)
system.line_break()
heartbeat.register(ps, "heartbeat", heartbeat.update)
local modem = LED{parent=system,label="MODEM",colors=led_grn}
if not style.colorblind then
local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,style.fp_ind_bkg}}
network.update(types.PANEL_LINK_STATE.DISCONNECTED)
network.register(ps, "link_state", network.update)
else
local nt_lnk = LEDPair{parent=system,label="NT LINKED",off=style.fp_ind_bkg,c1=colors.red,c2=colors.green}
local nt_ver = LEDPair{parent=system,label="NT VERSION",off=style.fp_ind_bkg,c1=colors.red,c2=colors.green}
nt_lnk.register(ps, "link_state", function (state)
local value = 2
if state == LINK_STATE.DISCONNECTED then
value = 1
elseif state == LINK_STATE.LINKED then
value = 3
end
nt_lnk.update(value)
end)
nt_ver.register(ps, "link_state", function (state)
local value = 3
if state == LINK_STATE.BAD_VERSION then
value = 2
elseif state == LINK_STATE.DISCONNECTED then
value = 1
end
nt_ver.update(value)
end)
end
system.line_break()
modem.register(ps, "has_modem", modem.update)
local speaker = LED{parent=system,label="SPEAKER",colors=led_grn}
speaker.register(ps, "has_speaker", speaker.update)
system.line_break()
local rt_main = LED{parent=system,label="RT MAIN",colors=led_grn}
local rt_render = LED{parent=system,label="RT RENDER",colors=led_grn}
rt_main.register(ps, "routine__main", rt_main.update)
rt_render.register(ps, "routine__render", rt_render.update)
---@diagnostic disable-next-line: undefined-field
local comp_id = util.sprintf("(%d)", os.getComputerID())
TextBox{parent=system,x=9,y=4,width=6,text=comp_id,fg_bg=style.fp.disabled_fg}
local monitors = Div{parent=main_page,width=16,height=17,x=18,y=2}
local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=led_grn}
main_monitor.register(ps, "main_monitor", main_monitor.update)
local flow_monitor = LED{parent=monitors,label="FLOW MONITOR",colors=led_grn}
flow_monitor.register(ps, "flow_monitor", flow_monitor.update)
monitors.line_break()
for i = 1, num_units do
local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=led_grn}
unit_monitor.register(ps, "unit_monitor_" .. i, unit_monitor.update)
end
--
-- about footer
--
local about = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=style.fp.disabled_fg}
local fw_v = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00"}
local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00"}
fw_v.register(ps, "version", function (version) fw_v.set_value(util.c("FW: ", version)) end)
comms_v.register(ps, "comms_version", function (version) comms_v.set_value(util.c("NT: v", version)) end)
--
-- page handling
--
-- API page
local api_page = Div{parent=page_div,x=1,y=1,hidden=true}
local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=style.fp.text_fg,nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
local _ = Div{parent=api_list,height=1,hidden=true} -- padding
-- assemble page panes
local panes = { main_page, api_page }
local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
local tabs = {
{ name = "CRD", color = style.fp.text },
{ name = "API", color = style.fp.text },
}
TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=style.fp_theme.highlight_box_bright}
-- link pocket API list management to PGI
pgi.link_elements(api_list, pkt_entry)
end
return init

View File

@@ -5,46 +5,37 @@
local util = require("scada-common.util") local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol") local iocontrol = require("coordinator.iocontrol")
local sounder = require("coordinator.sounder")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
local imatrix = require("coordinator.ui.components.imatrix") local imatrix = require("coordinator.ui.components.imatrix")
local process_ctl = require("coordinator.ui.components.processctl") local process_ctl = require("coordinator.ui.components.process_ctl")
local unit_overview = require("coordinator.ui.components.unit_overview") local unit_overview = require("coordinator.ui.components.unit_overview")
local core = require("graphics.core") local core = require("graphics.core")
local ColorMap = require("graphics.elements.colormap")
local DisplayBox = require("graphics.elements.displaybox")
local Div = require("graphics.elements.div")
local TextBox = require("graphics.elements.textbox") local TextBox = require("graphics.elements.textbox")
local PushButton = require("graphics.elements.controls.push_button")
local SwitchButton = require("graphics.elements.controls.switch_button")
local DataIndicator = require("graphics.elements.indicators.data") local DataIndicator = require("graphics.elements.indicators.data")
local TEXT_ALIGN = core.graphics.TEXT_ALIGN local ALIGN = core.ALIGN
local cpair = core.graphics.cpair
-- create new main view -- create new main view
---@param monitor table main viewscreen ---@param main graphics_element main displaybox
local function init(monitor) local function init(main)
local s_header = style.theme.header
local facility = iocontrol.get_db().facility local facility = iocontrol.get_db().facility
local units = iocontrol.get_db().units local units = iocontrol.get_db().units
local main = DisplayBox{window=monitor,fg_bg=style.root}
-- window header message -- window header message
local header = TextBox{parent=main,y=1,text="Nuclear Generation Facility SCADA Coordinator",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header} local header = TextBox{parent=main,y=1,text="Nuclear Generation Facility SCADA Coordinator",alignment=ALIGN.CENTER,fg_bg=s_header}
local ping = DataIndicator{parent=main,x=1,y=1,label="SVTT",format="%d",value=0,unit="ms",lu_colors=cpair(colors.lightGray, colors.white),width=12,fg_bg=style.header} local ping = DataIndicator{parent=main,x=1,y=1,label="SVTT",format="%d",value=0,unit="ms",lu_colors=style.lg_white,width=12,fg_bg=s_header}
-- max length example: "01:23:45 AM - Wednesday, September 28 2022" -- max length example: "01:23:45 AM - Wednesday, September 28 2022"
local datetime = TextBox{parent=main,x=(header.width()-42),y=1,text="",alignment=TEXT_ALIGN.RIGHT,width=42,height=1,fg_bg=style.header} local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=ALIGN.RIGHT,width=42,fg_bg=s_header}
facility.ps.subscribe("sv_ping", ping.update) ping.register(facility.ps, "sv_ping", ping.update)
facility.ps.subscribe("date_time", datetime.set_value) datetime.register(facility.ps, "date_time", datetime.set_value)
local uo_1, uo_2, uo_3, uo_4 ---@type graphics_element local uo_1, uo_2, uo_3, uo_4 ---@type graphics_element
@@ -54,47 +45,49 @@ local function init(monitor)
-- unit overviews -- unit overviews
if facility.num_units >= 1 then if facility.num_units >= 1 then
uo_1 = unit_overview(main, 2, 3, units[1]) uo_1 = unit_overview(main, 2, 3, units[1])
row_1_height = uo_1.height() row_1_height = uo_1.get_height()
end end
if facility.num_units >= 2 then if facility.num_units >= 2 then
uo_2 = unit_overview(main, 84, 3, units[2]) uo_2 = unit_overview(main, 84, 3, units[2])
row_1_height = math.max(row_1_height, uo_2.height()) row_1_height = math.max(row_1_height, uo_2.get_height())
end end
cnc_y_start = cnc_y_start + row_1_height + 1 cnc_y_start = cnc_y_start + row_1_height + 1
util.nop()
if facility.num_units >= 3 then if facility.num_units >= 3 then
-- base offset 3, spacing 1, max height of units 1 and 2 -- base offset 3, spacing 1, max height of units 1 and 2
local row_2_offset = cnc_y_start local row_2_offset = cnc_y_start
uo_3 = unit_overview(main, 2, row_2_offset, units[3]) uo_3 = unit_overview(main, 2, row_2_offset, units[3])
cnc_y_start = row_2_offset + uo_3.height() + 1 cnc_y_start = row_2_offset + uo_3.get_height() + 1
if facility.num_units == 4 then if facility.num_units == 4 then
uo_4 = unit_overview(main, 84, row_2_offset, units[4]) uo_4 = unit_overview(main, 84, row_2_offset, units[4])
cnc_y_start = math.max(cnc_y_start, row_2_offset + uo_4.height() + 1) cnc_y_start = math.max(cnc_y_start, row_2_offset + uo_4.get_height() + 1)
end end
util.nop()
end end
-- command & control -- command & control
cnc_y_start = cnc_y_start
-- induction matrix and process control interfaces are 24 tall + space needed for divider -- induction matrix and process control interfaces are 24 tall + space needed for divider
local cnc_bottom_align_start = main.height() - 26 local cnc_bottom_align_start = main.get_height() - 26
assert(cnc_bottom_align_start >= cnc_y_start, "main display not of sufficient vertical resolution (add an additional row of monitors)") assert(cnc_bottom_align_start >= cnc_y_start, "main display not of sufficient vertical resolution (add an additional row of monitors)")
TextBox{parent=main,y=cnc_bottom_align_start,text=util.strrep("\x8c", header.width()),alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=cpair(colors.lightGray,colors.gray)} TextBox{parent=main,y=cnc_bottom_align_start,text=string.rep("\x8c", header.get_width()),alignment=ALIGN.CENTER,fg_bg=style.lg_gray}
cnc_bottom_align_start = cnc_bottom_align_start + 2 cnc_bottom_align_start = cnc_bottom_align_start + 2
process_ctl(main, 2, cnc_bottom_align_start) process_ctl(main, 2, cnc_bottom_align_start)
imatrix(main, 131, cnc_bottom_align_start, facility.induction_data_tbl[1], facility.induction_ps_tbl[1]) util.nop()
return main imatrix(main, 131, cnc_bottom_align_start, facility.induction_data_tbl[1], facility.induction_ps_tbl[1])
end end
return init return init

View File

@@ -2,21 +2,13 @@
-- Reactor Unit SCADA Coordinator GUI -- Reactor Unit SCADA Coordinator GUI
-- --
local style = require("coordinator.ui.style")
local unit_detail = require("coordinator.ui.components.unit_detail") local unit_detail = require("coordinator.ui.components.unit_detail")
local DisplayBox = require("graphics.elements.displaybox")
-- create a unit view -- create a unit view
---@param monitor table ---@param main graphics_element main displaybox
---@param id integer ---@param id integer
local function init(monitor, id) local function init(main, id)
local main = DisplayBox{window=monitor,fg_bg=style.root}
unit_detail(main, id) unit_detail(main, id)
return main
end end
return init return init

60
coordinator/ui/pgi.lua Normal file
View File

@@ -0,0 +1,60 @@
--
-- Protected Graphics Interface
--
local log = require("scada-common.log")
local util = require("scada-common.util")
local pgi = {}
local data = {
pkt_list = nil, ---@type nil|graphics_element
pkt_entry = nil, ---@type function
-- session entries
s_entries = { pkt = {} }
}
-- link list boxes
---@param pkt_list graphics_element pocket list element
---@param pkt_entry function pocket entry constructor
function pgi.link_elements(pkt_list, pkt_entry)
data.pkt_list = pkt_list
data.pkt_entry = pkt_entry
end
-- unlink all fields, disabling the PGI
function pgi.unlink()
data.pkt_list = nil
data.pkt_entry = nil
end
-- add a PKT entry to the PKT list
---@param session_id integer pocket session
function pgi.create_pkt_entry(session_id)
if data.pkt_list ~= nil and data.pkt_entry ~= nil then
local success, result = pcall(data.pkt_entry, data.pkt_list, session_id)
if success then
data.s_entries.pkt[session_id] = result
else
log.error(util.c("PGI: failed to create PKT entry (", result, ")"), true)
end
end
end
-- delete a PKT entry from the PKT list
---@param session_id integer pocket session
function pgi.delete_pkt_entry(session_id)
if data.s_entries.pkt[session_id] ~= nil then
local success, result = pcall(data.s_entries.pkt[session_id].delete)
data.s_entries.pkt[session_id] = nil
if not success then
log.error(util.c("PGI: failed to delete PKT entry (", result, ")"), true)
end
else
log.debug(util.c("PGI: tried to delete unknown PKT entry ", session_id))
end
end
return pgi

View File

@@ -2,38 +2,149 @@
-- Graphics Style Options -- Graphics Style Options
-- --
local core = require("graphics.core") local util = require("scada-common.util")
local core = require("graphics.core")
local themes = require("graphics.themes")
---@class crd_style
local style = {} local style = {}
local cpair = core.graphics.cpair local cpair = core.cpair
-- GLOBAL -- -- front panel styling
style.root = cpair(colors.black, colors.lightGray) style.fp_theme = themes.sandstone
style.header = cpair(colors.white, colors.gray) style.fp = themes.get_fp_style(style.fp_theme)
style.label = cpair(colors.gray, colors.lightGray)
style.colors = { style.led_grn = cpair(colors.green, colors.green_off)
{ c = colors.red, hex = 0xdf4949 },
{ c = colors.orange, hex = 0xffb659 }, -- main GUI styling
{ c = colors.yellow, hex = 0xfffc79 },
{ c = colors.lime, hex = 0x80ff80 }, ---@class theme
{ c = colors.green, hex = 0x4aee8a }, local smooth_stone = {
{ c = colors.cyan, hex = 0x34bac8 }, text = colors.black,
{ c = colors.lightBlue, hex = 0x6cc0f2 }, text_inv = colors.white,
{ c = colors.blue, hex = 0x0096ff }, label = colors.gray,
{ c = colors.purple, hex = 0xb156ee }, label_dark = colors.gray,
{ c = colors.pink, hex = 0xf26ba2 }, disabled = colors.lightGray,
{ c = colors.magenta, hex = 0xf9488a }, bg = colors.lightGray,
-- { c = colors.white, hex = 0xf0f0f0 }, checkbox_bg = colors.black,
{ c = colors.lightGray, hex = 0xcacaca }, accent_light = colors.white,
{ c = colors.gray, hex = 0x575757 }, accent_dark = colors.gray,
-- { c = colors.black, hex = 0x191919 },
-- { c = colors.brown, hex = 0x7f664c } fuel_color = colors.black,
header = cpair(colors.white, colors.gray),
text_fg = cpair(colors.black, colors._INHERIT),
label_fg = cpair(colors.gray, colors._INHERIT),
disabled_fg = cpair(colors.lightGray, colors._INHERIT),
highlight_box = cpair(colors.black, colors.white),
highlight_box_bright = cpair(colors.black, colors.white),
field_box = cpair(colors.black, colors.white),
colors = themes.smooth_stone.colors,
-- color re-mappings for assistive modes
color_modes = themes.smooth_stone.color_modes
} }
-- MAIN LAYOUT -- ---@type theme
local deepslate = {
text = colors.white,
text_inv = colors.black,
label = colors.lightGray,
label_dark = colors.gray,
disabled = colors.gray,
bg = colors.black,
checkbox_bg = colors.gray,
accent_light = colors.gray,
accent_dark = colors.lightGray,
fuel_color = colors.lightGray,
header = cpair(colors.white, colors.gray),
text_fg = cpair(colors.white, colors._INHERIT),
label_fg = cpair(colors.lightGray, colors._INHERIT),
disabled_fg = cpair(colors.gray, colors._INHERIT),
highlight_box = cpair(colors.white, colors.gray),
highlight_box_bright = cpair(colors.black, colors.lightGray),
field_box = cpair(colors.white, colors.gray),
colors = themes.deepslate.colors,
-- color re-mappings for assistive modes
color_modes = themes.deepslate.color_modes
}
style.theme = smooth_stone
-- set themes per configurations
---@param main UI_THEME main UI theme
---@param fp FP_THEME front panel theme
---@param color_mode COLOR_MODE the color mode to use
function style.set_themes(main, fp, color_mode)
local colorblind = color_mode ~= themes.COLOR_MODE.STANDARD and color_mode ~= themes.COLOR_MODE.STD_ON_BLACK
local gray_ind_off = color_mode == themes.COLOR_MODE.STANDARD or color_mode == themes.COLOR_MODE.BLUE_IND
style.ind_bkg = colors.gray
style.fp_ind_bkg = util.trinary(gray_ind_off, colors.gray, colors.black)
style.ind_hi_box_bg = util.trinary(gray_ind_off, colors.gray, colors.black)
if main == themes.UI_THEME.SMOOTH_STONE then
style.theme = smooth_stone
style.ind_bkg = util.trinary(gray_ind_off, colors.gray, colors.black)
elseif main == themes.UI_THEME.DEEPSLATE then
style.theme = deepslate
style.ind_hi_box_bg = util.trinary(gray_ind_off, colors.lightGray, colors.black)
end
style.colorblind = colorblind
style.root = cpair(style.theme.text, style.theme.bg)
style.label = cpair(style.theme.label, style.theme.bg)
-- high contrast text (also tags)
style.hc_text = cpair(style.theme.text, style.theme.text_inv)
-- text on default background
style.text_colors = cpair(style.theme.text, style.theme.bg)
-- label & unit colors
style.lu_colors = cpair(style.theme.label, style.theme.label)
-- label & unit colors (darker if set)
style.lu_colors_dark = cpair(style.theme.label_dark, style.theme.label_dark)
style.ind_grn = cpair(util.trinary(colorblind, colors.blue, colors.green), style.ind_bkg)
style.ind_yel = cpair(colors.yellow, style.ind_bkg)
style.ind_red = cpair(colors.red, style.ind_bkg)
style.ind_wht = cpair(colors.white, style.ind_bkg)
if fp == themes.FP_THEME.SANDSTONE then
style.fp_theme = themes.sandstone
elseif fp == themes.FP_THEME.BASALT then
style.fp_theme = themes.basalt
end
style.fp = themes.get_fp_style(style.fp_theme)
end
-- COMMON COLOR PAIRS --
style.wh_gray = cpair(colors.white, colors.gray)
style.bw_fg_bg = cpair(colors.black, colors.white)
style.hzd_fg_bg = style.wh_gray
style.dis_colors = cpair(colors.white, colors.lightGray)
style.lg_gray = cpair(colors.lightGray, colors.gray)
style.lg_white = cpair(colors.lightGray, colors.white)
style.gray_white = cpair(colors.gray, colors.white)
-- UI COMPONENTS --
style.reactor = { style.reactor = {
-- reactor states -- reactor states
@@ -151,8 +262,121 @@ style.imatrix = {
{ {
color = cpair(colors.black, colors.yellow), color = cpair(colors.black, colors.yellow),
text = "HIGH CHARGE" text = "HIGH CHARGE"
}
}
}
style.sps = {
-- SPS states
states = {
{
color = cpair(colors.black, colors.yellow),
text = "OFF-LINE"
},
{
color = cpair(colors.black, colors.orange),
text = "NOT FORMED"
},
{
color = cpair(colors.black, colors.orange),
text = "RTU FAULT"
},
{
color = cpair(colors.white, colors.gray),
text = "IDLE"
},
{
color = cpair(colors.black, colors.green),
text = "ACTIVE"
}
}
}
style.dtank = {
-- dynamic tank states
states = {
{
color = cpair(colors.black, colors.yellow),
text = "OFF-LINE"
},
{
color = cpair(colors.black, colors.orange),
text = "NOT FORMED"
},
{
color = cpair(colors.black, colors.orange),
text = "RTU FAULT"
},
{
color = cpair(colors.black, colors.green),
text = "ONLINE"
},
{
color = cpair(colors.black, colors.yellow),
text = "LOW FILL"
},
{
color = cpair(colors.black, colors.green),
text = "FILLED"
}, },
} }
} }
style.waste = {
-- auto waste processing states
states = {
{
color = cpair(colors.black, colors.green),
text = "PLUTONIUM"
},
{
color = cpair(colors.black, colors.cyan),
text = "POLONIUM"
},
{
color = cpair(colors.black, colors.purple),
text = "ANTI MATTER"
}
},
states_abbrv = {
{
color = cpair(colors.black, colors.green),
text = "Pu"
},
{
color = cpair(colors.black, colors.cyan),
text = "Po"
},
{
color = cpair(colors.black, colors.purple),
text = "AM"
}
},
-- process radio button options
options = { "Plutonium", "Polonium", "Antimatter" },
-- unit waste selection
unit_opts = {
{
text = "Auto",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.white, colors.gray)
},
{
text = "Pu",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.green)
},
{
text = "Po",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.cyan)
},
{
text = "AM",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.purple)
}
}
}
return style return style

View File

@@ -1,44 +1,21 @@
-- --
-- Graphics Core Functions and Objects -- Graphics Core Types, Checks, and Constructors
-- --
local events = require("graphics.events")
local flasher = require("graphics.flasher")
local core = {} local core = {}
local flasher = require("graphics.flasher") core.version = "2.3.3"
core.flasher = flasher core.flasher = flasher
local events = {}
---@class monitor_touch
---@field monitor string
---@field x integer
---@field y integer
-- create a new touch event definition
---@nodiscard
---@param monitor string
---@param x integer
---@param y integer
---@return monitor_touch
function events.touch(monitor, x, y)
return {
monitor = monitor,
x = x,
y = y
}
end
core.events = events core.events = events
local graphics = {} -- Core Types
---@enum TEXT_ALIGN ---@enum ALIGN
graphics.TEXT_ALIGN = { core.ALIGN = { LEFT = 1, CENTER = 2, RIGHT = 3 }
LEFT = 1,
CENTER = 2,
RIGHT = 3
}
---@class graphics_border ---@class graphics_border
---@field width integer ---@field width integer
@@ -53,12 +30,8 @@ graphics.TEXT_ALIGN = {
---@param color color border color ---@param color color border color
---@param even? boolean whether to pad width extra to account for rectangular pixels, defaults to false ---@param even? boolean whether to pad width extra to account for rectangular pixels, defaults to false
---@return graphics_border ---@return graphics_border
function graphics.border(width, color, even) function core.border(width, color, even)
return { return { width = width, color = color, even = even or false }
width = width,
color = color,
even = even or false -- convert nil to false
}
end end
---@class graphics_frame ---@class graphics_frame
@@ -74,13 +47,8 @@ end
---@param w integer ---@param w integer
---@param h integer ---@param h integer
---@return graphics_frame ---@return graphics_frame
function graphics.gframe(x, y, w, h) function core.gframe(x, y, w, h)
return { return { x = x, y = y, w = w, h = h }
x = x,
y = y,
w = w,
h = h
}
end end
---@class cpair ---@class cpair
@@ -93,23 +61,20 @@ end
---@field blit_fgd string ---@field blit_fgd string
---@field blit_bkg string ---@field blit_bkg string
-- add inherited flag, 3 isn't a pure color so it wouldn't be used
colors._INHERIT = 3
-- create a new color pair definition -- create a new color pair definition
---@nodiscard ---@nodiscard
---@param a color ---@param a color
---@param b color ---@param b color
---@return cpair ---@return cpair
function graphics.cpair(a, b) function core.cpair(a, b)
return { return {
-- color pairs -- color pairs
color_a = a, color_a = a, color_b = b, blit_a = colors.toBlit(a), blit_b = colors.toBlit(b),
color_b = b,
blit_a = colors.toBlit(a),
blit_b = colors.toBlit(b),
-- aliases -- aliases
fgd = a, fgd = a, bkg = b, blit_fgd = colors.toBlit(a), blit_bkg = colors.toBlit(b)
bkg = b,
blit_fgd = colors.toBlit(a),
blit_bkg = colors.toBlit(b)
} }
end end
@@ -135,7 +100,7 @@ end
---@param thin? boolean true for 1 subpixel, false (default) for 2 ---@param thin? boolean true for 1 subpixel, false (default) for 2
---@param align_tr? boolean false to align bottom left (default), true to align top right ---@param align_tr? boolean false to align bottom left (default), true to align top right
---@return pipe ---@return pipe
function graphics.pipe(x1, y1, x2, y2, color, thin, align_tr) function core.pipe(x1, y1, x2, y2, color, thin, align_tr)
return { return {
x1 = x1, x1 = x1,
y1 = y1, y1 = y1,
@@ -149,6 +114,215 @@ function graphics.pipe(x1, y1, x2, y2, color, thin, align_tr)
} }
end end
core.graphics = graphics -- Assertion Handling
-- extract the custom element assert message, dropping the path to the element file
function core.extract_assert_msg(msg)
return string.sub(msg, (string.find(msg, "@") or 0) + 1)
end
-- Interactive Field Manager
---@param e graphics_base
---@param max_len any
---@param fg_bg any
---@param dis_fg_bg any
function core.new_ifield(e, max_len, fg_bg, dis_fg_bg)
local self = {
frame_start = 1,
visible_text = e.value,
cursor_pos = string.len(e.value) + 1,
selected_all = false
}
-- update visible text
local function _update_visible()
self.visible_text = string.sub(e.value, self.frame_start, self.frame_start + math.min(string.len(e.value), e.frame.w) - 1)
end
-- try shifting frame left
local function _try_lshift()
if self.frame_start > 1 then
self.frame_start = self.frame_start - 1
return true
end
end
-- try shifting frame right
local function _try_rshift()
if (self.frame_start + e.frame.w - 1) <= string.len(e.value) then
self.frame_start = self.frame_start + 1
return true
end
end
---@class ifield
local public = {}
-- censor the display (for private info, for example) with the provided character<br>
-- disable by passing no argument
---@param censor string? character to hide data with
function public.censor(censor)
if type(censor) == "string" and string.len(censor) == 1 then
self.censor = censor
else self.censor = nil end
public.show()
end
-- show the field
function public.show()
_update_visible()
if e.enabled then
e.w_set_bkg(fg_bg.bkg)
e.w_set_fgd(fg_bg.fgd)
elseif dis_fg_bg ~= nil then
e.w_set_bkg(dis_fg_bg.bkg)
e.w_set_fgd(dis_fg_bg.fgd)
end
-- clear and print
e.w_set_cur(1, 1)
e.w_write(string.rep(" ", e.frame.w))
e.w_set_cur(1, 1)
local function _write()
if self.censor then
e.w_write(string.rep(self.censor, string.len(self.visible_text)))
else
e.w_write(self.visible_text)
end
end
if e.is_focused() and e.enabled then
-- write text with cursor
if self.selected_all then
e.w_set_bkg(fg_bg.fgd)
e.w_set_fgd(fg_bg.bkg)
_write()
elseif self.cursor_pos >= (string.len(self.visible_text) + 1) then
-- write text with cursor at the end, no need to blit
_write()
e.w_set_fgd(colors.lightGray)
e.w_write("_")
else
local a, b = "", ""
if self.cursor_pos <= string.len(self.visible_text) then
a = fg_bg.blit_bkg
b = fg_bg.blit_fgd
end
local b_fgd = string.rep(fg_bg.blit_fgd, self.cursor_pos - 1) .. a .. string.rep(fg_bg.blit_fgd, string.len(self.visible_text) - self.cursor_pos)
local b_bkg = string.rep(fg_bg.blit_bkg, self.cursor_pos - 1) .. b .. string.rep(fg_bg.blit_bkg, string.len(self.visible_text) - self.cursor_pos)
if self.censor then
e.w_blit(string.rep(self.censor, string.len(self.visible_text)), b_fgd, b_bkg)
else
e.w_blit(self.visible_text, b_fgd, b_bkg)
end
end
else
self.selected_all = false
-- write text without cursor
_write()
end
end
-- move cursor to x
---@param x integer
function public.move_cursor(x)
self.selected_all = false
self.cursor_pos = math.min(x, string.len(self.visible_text) + 1)
public.show()
end
-- select all text
function public.select_all()
self.selected_all = true
public.show()
end
-- set field value
---@param val string
function public.set_value(val)
e.value = string.sub(val, 1, math.min(max_len, string.len(val)))
public.nav_end()
end
-- try to insert a character if there is space
---@param char string
function public.try_insert_char(char)
-- limit length
if string.len(e.value) >= max_len then return end
-- replace if selected all, insert otherwise
if self.selected_all then
self.selected_all = false
self.cursor_pos = 2
self.frame_start = 1
e.value = char
public.show()
else
e.value = string.sub(e.value, 1, self.frame_start + self.cursor_pos - 2) .. char .. string.sub(e.value, self.frame_start + self.cursor_pos - 1, string.len(e.value))
_update_visible()
public.nav_right()
end
end
-- remove charcter before cursor if there is anything to remove, or delete all if selected all
function public.backspace()
if self.selected_all then
self.selected_all = false
e.value = ""
self.cursor_pos = 1
self.frame_start = 1
public.show()
else
if self.frame_start + self.cursor_pos > 2 then
e.value = string.sub(e.value, 1, self.frame_start + self.cursor_pos - 3) .. string.sub(e.value, self.frame_start + self.cursor_pos - 1, string.len(e.value))
if self.cursor_pos > 1 then
self.cursor_pos = self.cursor_pos - 1
public.show()
elseif _try_lshift() then public.show() end
end
end
end
-- move cursor left by one
function public.nav_left()
if self.cursor_pos > 1 then
self.cursor_pos = self.cursor_pos - 1
public.show()
elseif _try_lshift() then public.show() end
end
-- move cursor right by one
function public.nav_right()
if self.cursor_pos < math.min(string.len(self.visible_text) + 1, e.frame.w) then
self.cursor_pos = self.cursor_pos + 1
public.show()
elseif _try_rshift() then public.show() end
end
-- move cursor to the start
function public.nav_start()
self.cursor_pos = 1
self.frame_start = 1
public.show()
end
-- move cursor to the end
function public.nav_end()
self.frame_start = math.max(1, string.len(e.value) - e.frame.w + 2)
_update_visible()
self.cursor_pos = string.len(self.visible_text) + 1
public.show()
end
return public
end
return core return core

File diff suppressed because it is too large Load Diff

View File

@@ -1,6 +1,6 @@
-- Loading/Waiting Animation Graphics Element -- Loading/Waiting Animation Graphics Element
local tcd = require("scada-common.tcallbackdsp") local tcd = require("scada-common.tcd")
local element = require("graphics.element") local element = require("graphics.element")
@@ -8,8 +8,9 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new waiting animation element -- new waiting animation element
---@param args waiting_args ---@param args waiting_args
@@ -35,49 +36,49 @@ local function waiting(args)
if state >= 0 and state < 7 then if state >= 0 and state < 7 then
-- top -- top
e.window.setCursorPos(1 + math.floor(state / 2), 1) e.w_set_cur(1 + math.floor(state / 2), 1)
if state % 2 == 0 then if state % 2 == 0 then
e.window.blit("\x8f", blit_fg, blit_bg) e.w_blit("\x8f", blit_fg, blit_bg)
else else
e.window.blit("\x8a\x85", blit_fg_2x, blit_bg_2x) e.w_blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
end end
-- bottom -- bottom
e.window.setCursorPos(4 - math.ceil(state / 2), 3) e.w_set_cur(4 - math.ceil(state / 2), 3)
if state % 2 == 0 then if state % 2 == 0 then
e.window.blit("\x8f", blit_fg, blit_bg) e.w_blit("\x8f", blit_fg, blit_bg)
else else
e.window.blit("\x8a\x85", blit_fg_2x, blit_bg_2x) e.w_blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
end end
else else
local st = state - 7 local st = state - 7
-- right -- right
if st % 3 == 0 then if st % 3 == 0 then
e.window.setCursorPos(4, 1 + math.floor(st / 3)) e.w_set_cur(4, 1 + math.floor(st / 3))
e.window.blit("\x83", blit_bg, blit_fg) e.w_blit("\x83", blit_bg, blit_fg)
elseif st % 3 == 1 then elseif st % 3 == 1 then
e.window.setCursorPos(4, 1 + math.floor(st / 3)) e.w_set_cur(4, 1 + math.floor(st / 3))
e.window.blit("\x8f", blit_bg, blit_fg) e.w_blit("\x8f", blit_bg, blit_fg)
e.window.setCursorPos(4, 2 + math.floor(st / 3)) e.w_set_cur(4, 2 + math.floor(st / 3))
e.window.blit("\x83", blit_fg, blit_bg) e.w_blit("\x83", blit_fg, blit_bg)
else else
e.window.setCursorPos(4, 2 + math.floor(st / 3)) e.w_set_cur(4, 2 + math.floor(st / 3))
e.window.blit("\x8f", blit_fg, blit_bg) e.w_blit("\x8f", blit_fg, blit_bg)
end end
-- left -- left
if st % 3 == 0 then if st % 3 == 0 then
e.window.setCursorPos(1, 3 - math.floor(st / 3)) e.w_set_cur(1, 3 - math.floor(st / 3))
e.window.blit("\x83", blit_fg, blit_bg) e.w_blit("\x83", blit_fg, blit_bg)
e.window.setCursorPos(1, 2 - math.floor(st / 3)) e.w_set_cur(1, 2 - math.floor(st / 3))
e.window.blit("\x8f", blit_bg, blit_fg) e.w_blit("\x8f", blit_bg, blit_fg)
elseif st % 3 == 1 then elseif st % 3 == 1 then
e.window.setCursorPos(1, 2 - math.floor(st / 3)) e.w_set_cur(1, 2 - math.floor(st / 3))
e.window.blit("\x83", blit_bg, blit_fg) e.w_blit("\x83", blit_bg, blit_fg)
else else
e.window.setCursorPos(1, 2 - math.floor(st / 3)) e.w_set_cur(1, 2 - math.floor(st / 3))
e.window.blit("\x8f", blit_fg, blit_bg) e.w_blit("\x8f", blit_fg, blit_bg)
end end
end end
@@ -85,7 +86,7 @@ local function waiting(args)
if state >= 12 then state = 0 end if state >= 12 then state = 0 end
if run_animation then if run_animation then
tcd.dispatch_unique(0.5, animate) tcd.dispatch_unique(0.15, animate)
end end
end end
@@ -102,7 +103,7 @@ local function waiting(args)
e.start_anim() e.start_anim()
return e.get() return e.complete()
end end
return waiting return waiting

View File

@@ -0,0 +1,109 @@
-- App Page Multi-Pane Display Graphics Element
local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element")
local events = require("graphics.events")
local MOUSE_CLICK = core.events.MOUSE_CLICK
---@class app_multipane_args
---@field panes table panes to swap between
---@field nav_colors cpair on/off colors (a/b respectively) for page navigator
---@field scroll_nav boolean? true to allow scrolling to change the active pane
---@field drag_nav boolean? true to allow mouse dragging to change the active pane (on mouse up)
---@field callback function? function to call when pane is changed by mouse interaction
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted
---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new app multipane element
---@nodiscard
---@param args app_multipane_args
---@return graphics_element element, element_id id
local function multipane(args)
element.assert(type(args.panes) == "table", "panes is a required field")
-- create new graphics element base object
local e = element.new(args)
e.value = 1
local nav_x_start = math.floor((e.frame.w / 2) - (#args.panes / 2)) + 1
local nav_x_end = math.floor((e.frame.w / 2) - (#args.panes / 2)) + #args.panes
-- show the selected pane
function e.redraw()
for i = 1, #args.panes do args.panes[i].hide() end
args.panes[e.value].show()
-- draw page indicator dots
for i = 1, #args.panes do
e.w_set_cur(nav_x_start + (i - 1), e.frame.h)
e.w_set_fgd(util.trinary(i == e.value, args.nav_colors.color_a, args.nav_colors.color_b))
e.w_write("\x07")
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
local initial = e.value
if e.enabled then
if event.current.y == e.frame.h and event.current.x >= nav_x_start and event.current.x <= nav_x_end then
local id = event.current.x - nav_x_start + 1
if event.type == MOUSE_CLICK.TAP then
e.set_value(id)
elseif event.type == MOUSE_CLICK.UP then
e.set_value(id)
end
end
end
if args.scroll_nav then
if event.type == events.MOUSE_CLICK.SCROLL_DOWN then
e.set_value(e.value + 1)
elseif event.type == events.MOUSE_CLICK.SCROLL_UP then
e.set_value(e.value - 1)
end
end
if args.drag_nav then
local x1, x2 = event.initial.x, event.current.x
if event.type == events.MOUSE_CLICK.UP and e.in_frame_bounds(x1, event.initial.y) and e.in_frame_bounds(x1, event.current.y) then
if x2 > x1 then
e.set_value(e.value - 1)
elseif x2 < x1 then
e.set_value(e.value + 1)
end
end
end
if e.value ~= initial and type(args.callback) == "function" then args.callback(e.value) end
end
-- select which pane is shown
---@param value integer pane to show
function e.set_value(value)
if (e.value ~= value) and (value > 0) and (value <= #args.panes) then
e.value = value
e.redraw()
end
end
-- initial draw
e.redraw()
return e.complete()
end
return multipane

View File

@@ -1,21 +1,20 @@
-- Color Map Graphics Element -- Color Map Graphics Element
local util = require("scada-common.util")
local element = require("graphics.element") local element = require("graphics.element")
---@class colormap_args ---@class colormap_args
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field hidden? boolean true to hide on initial draw
-- new color map -- new color map
---@param args colormap_args ---@param args colormap_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function colormap(args) local function colormap(args)
local bkg = "008877FFCCEE114455DD9933BBAA2266" local bkg = "008877FFCCEE114455DD9933BBAA2266"
local spaces = util.spaces(32) local spaces = string.rep(" ", 32)
args.width = 32 args.width = 32
args.height = 1 args.height = 1
@@ -24,10 +23,15 @@ local function colormap(args)
local e = element.new(args) local e = element.new(args)
-- draw color map -- draw color map
e.window.setCursorPos(1, 1) function e.redraw()
e.window.blit(spaces, bkg, bkg) e.w_set_cur(1, 1)
e.w_blit(spaces, bkg, bkg)
end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return colormap return colormap

View File

@@ -0,0 +1,132 @@
-- App Button Graphics Element
local tcd = require("scada-common.tcd")
local core = require("graphics.core")
local element = require("graphics.element")
local MOUSE_CLICK = core.events.MOUSE_CLICK
---@class app_button_args
---@field text string app icon text
---@field title string app title text
---@field callback function function to call on touch
---@field app_fg_bg cpair app icon foreground/background colors
---@field active_fg_bg? cpair foreground/background colors when pressed
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new app button
---@param args app_button_args
---@return graphics_element element, element_id id
local function app_button(args)
element.assert(type(args.text) == "string", "text is a required field")
element.assert(type(args.title) == "string", "title is a required field")
element.assert(type(args.callback) == "function", "callback is a required field")
element.assert(type(args.app_fg_bg) == "table", "app_fg_bg is a required field")
args.height = 4
args.width = 7
-- create new graphics element base object
local e = element.new(args)
-- draw the app button
local function draw()
local fgd = args.app_fg_bg.fgd
local bkg = args.app_fg_bg.bkg
if e.value then
fgd = args.active_fg_bg.fgd
bkg = args.active_fg_bg.bkg
end
-- draw icon
e.w_set_cur(2, 1)
e.w_set_fgd(fgd)
e.w_set_bkg(bkg)
e.w_write("\x9f\x83\x83\x83")
e.w_set_fgd(bkg)
e.w_set_bkg(fgd)
e.w_write("\x90")
e.w_set_fgd(fgd)
e.w_set_bkg(bkg)
e.w_set_cur(2, 2)
e.w_write("\x95 ")
e.w_set_fgd(bkg)
e.w_set_bkg(fgd)
e.w_write("\x95")
e.w_set_cur(2, 3)
e.w_write("\x82\x8f\x8f\x8f\x81")
-- write the icon text
e.w_set_cur(4, 2)
e.w_set_fgd(fgd)
e.w_set_bkg(bkg)
e.w_write(args.text)
end
-- draw the app button as pressed (if active_fg_bg set)
local function show_pressed()
if e.enabled and args.active_fg_bg ~= nil then
e.value = true
e.w_set_fgd(args.active_fg_bg.fgd)
e.w_set_bkg(args.active_fg_bg.bkg)
draw()
end
end
-- draw the app button as unpressed (if active_fg_bg set)
local function show_unpressed()
if e.enabled and args.active_fg_bg ~= nil then
e.value = false
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
draw()
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
if e.enabled then
if event.type == MOUSE_CLICK.TAP then
show_pressed()
-- show as unpressed in 0.25 seconds
if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
args.callback()
elseif event.type == MOUSE_CLICK.DOWN then
show_pressed()
elseif event.type == MOUSE_CLICK.UP then
show_unpressed()
if e.in_frame_bounds(event.current.x, event.current.y) then
args.callback()
end
end
end
end
-- set the value (true simulates pressing the app button)
---@param val boolean new value
function e.set_value(val)
if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
end
-- element redraw
function e.redraw()
e.w_set_cur(math.floor((e.frame.w - string.len(args.title)) / 2) + 1, 4)
e.w_write(args.title)
draw()
end
-- initial draw
e.redraw()
return e.complete()
end
return app_button

View File

@@ -0,0 +1,121 @@
-- Checkbox Graphics Element
local core = require("graphics.core")
local element = require("graphics.element")
---@class checkbox_args
---@field label string checkbox text
---@field box_fg_bg cpair colors for checkbox
---@field default? boolean default value
---@field callback? function function to call on press
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new checkbox control
---@param args checkbox_args
---@return graphics_element element, element_id id
local function checkbox(args)
element.assert(type(args.label) == "string", "label is a required field")
element.assert(type(args.box_fg_bg) == "table", "box_fg_bg is a required field")
args.can_focus = true
args.height = 1
args.width = 2 + string.len(args.label)
-- create new graphics element base object
local e = element.new(args)
e.value = args.default == true
-- show the button state
local function draw()
e.w_set_cur(1, 1)
if e.value then
-- show as selected
e.w_set_fgd(args.box_fg_bg.bkg)
e.w_set_bkg(args.box_fg_bg.fgd)
e.w_write("\x88")
e.w_set_fgd(args.box_fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
e.w_write("\x95")
else
-- show as unselected
e.w_set_fgd(e.fg_bg.bkg)
e.w_set_bkg(args.box_fg_bg.bkg)
e.w_write("\x88")
e.w_set_fgd(args.box_fg_bg.bkg)
e.w_set_bkg(e.fg_bg.bkg)
e.w_write("\x95")
end
end
-- write label text
local function draw_label()
if e.enabled and e.is_focused() then
e.w_set_cur(3, 1)
e.w_set_fgd(e.fg_bg.bkg)
e.w_set_bkg(e.fg_bg.fgd)
e.w_write(args.label)
else
e.w_set_cur(3, 1)
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
e.w_write(args.label)
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
e.value = not e.value
draw()
if type(args.callback) == "function" then args.callback(e.value) end
end
end
-- handle keyboard interaction
---@param event key_interaction key event
function e.handle_key(event)
if event.type == core.events.KEY_CLICK.DOWN then
if event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter then
e.value = not e.value
draw()
if type(args.callback) == "function" then args.callback(e.value) end
end
end
end
-- set the value
---@param val integer new value
function e.set_value(val)
e.value = val
draw()
end
-- handle focus
e.on_focused = draw_label
e.on_unfocused = draw_label
-- handle enable
e.on_enabled = draw_label
e.on_disabled = draw_label
-- element redraw
function e.redraw()
draw()
draw_label()
end
-- initial draw
e.redraw()
return e.complete()
end
return checkbox

View File

@@ -1,7 +1,6 @@
-- Hazard-bordered Button Graphics Element -- Hazard-bordered Button Graphics Element
local tcd = require("scada-common.tcallbackdsp") local tcd = require("scada-common.tcd")
local util = require("scada-common.util")
local core = require("graphics.core") local core = require("graphics.core")
local element = require("graphics.element") local element = require("graphics.element")
@@ -14,54 +13,50 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new hazard button -- new hazard button
---@param args hazard_button_args ---@param args hazard_button_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function hazard_button(args) local function hazard_button(args)
assert(type(args.text) == "string", "graphics.elements.controls.hazard_button: text is a required field") element.assert(type(args.text) == "string", "text is a required field")
assert(type(args.accent) == "number", "graphics.elements.controls.hazard_button: accent is a required field") element.assert(type(args.accent) == "number", "accent is a required field")
assert(type(args.callback) == "function", "graphics.elements.controls.hazard_button: callback is a required field") element.assert(type(args.callback) == "function", "callback is a required field")
-- static dimensions
args.height = 3 args.height = 3
args.width = string.len(args.text) + 4 args.width = string.len(args.text) + 4
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- write the button text
e.window.setCursorPos(3, 2)
e.window.write(args.text)
-- draw border -- draw border
---@param accent color accent color ---@param accent color accent color
local function draw_border(accent) local function draw_border(accent)
-- top -- top
e.window.setTextColor(accent) e.w_set_fgd(accent)
e.window.setBackgroundColor(args.fg_bg.bkg) e.w_set_bkg(args.fg_bg.bkg)
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
e.window.write("\x99" .. util.strrep("\x89", args.width - 2) .. "\x99") e.w_write("\x99" .. string.rep("\x89", args.width - 2) .. "\x99")
-- center left -- center left
e.window.setCursorPos(1, 2) e.w_set_cur(1, 2)
e.window.setTextColor(args.fg_bg.bkg) e.w_set_fgd(args.fg_bg.bkg)
e.window.setBackgroundColor(accent) e.w_set_bkg(accent)
e.window.write("\x99") e.w_write("\x99")
-- center right -- center right
e.window.setTextColor(args.fg_bg.bkg) e.w_set_fgd(args.fg_bg.bkg)
e.window.setBackgroundColor(accent) e.w_set_bkg(accent)
e.window.setCursorPos(args.width, 2) e.w_set_cur(args.width, 2)
e.window.write("\x99") e.w_write("\x99")
-- bottom -- bottom
e.window.setTextColor(accent) e.w_set_fgd(accent)
e.window.setBackgroundColor(args.fg_bg.bkg) e.w_set_bkg(args.fg_bg.bkg)
e.window.setCursorPos(1, 3) e.w_set_cur(1, 3)
e.window.write("\x99" .. util.strrep("\x98", args.width - 2) .. "\x99") e.w_write("\x99" .. string.rep("\x98", args.width - 2) .. "\x99")
end end
-- on request timeout: recursively calls itself to double flash button text -- on request timeout: recursively calls itself to double flash button text
@@ -72,9 +67,9 @@ local function hazard_button(args)
if n == 0 then if n == 0 then
-- go back off -- go back off
e.window.setTextColor(args.fg_bg.fgd) e.w_set_fgd(args.fg_bg.fgd)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
end end
if n >= 4 then if n >= 4 then
@@ -82,18 +77,18 @@ local function hazard_button(args)
elseif n % 2 == 0 then elseif n % 2 == 0 then
-- toggle text color on after 0.25 seconds -- toggle text color on after 0.25 seconds
tcd.dispatch(0.25, function () tcd.dispatch(0.25, function ()
e.window.setTextColor(args.accent) e.w_set_fgd(args.accent)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
on_timeout(n + 1) on_timeout(n + 1)
on_timeout(n + 1) on_timeout(n + 1)
end) end)
elseif n % 1 then elseif n % 1 then
-- toggle text color off after 0.25 seconds -- toggle text color off after 0.25 seconds
tcd.dispatch(0.25, function () tcd.dispatch(0.25, function ()
e.window.setTextColor(args.fg_bg.fgd) e.w_set_fgd(args.fg_bg.fgd)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
on_timeout(n + 1) on_timeout(n + 1)
end) end)
end end
@@ -101,9 +96,9 @@ local function hazard_button(args)
-- blink routine for success indication -- blink routine for success indication
local function on_success() local function on_success()
e.window.setTextColor(args.fg_bg.fgd) e.w_set_fgd(args.fg_bg.fgd)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
end end
-- blink routine for failure indication -- blink routine for failure indication
@@ -114,9 +109,9 @@ local function hazard_button(args)
if n == 0 then if n == 0 then
-- go back off -- go back off
e.window.setTextColor(args.fg_bg.fgd) e.w_set_fgd(args.fg_bg.fgd)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
end end
if n >= 2 then if n >= 2 then
@@ -124,31 +119,30 @@ local function hazard_button(args)
elseif n % 2 == 0 then elseif n % 2 == 0 then
-- toggle text color on after 0.5 seconds -- toggle text color on after 0.5 seconds
tcd.dispatch(0.5, function () tcd.dispatch(0.5, function ()
e.window.setTextColor(args.accent) e.w_set_fgd(args.accent)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
on_failure(n + 1) on_failure(n + 1)
end) end)
elseif n % 1 then elseif n % 1 then
-- toggle text color off after 0.25 seconds -- toggle text color off after 0.25 seconds
tcd.dispatch(0.25, function () tcd.dispatch(0.25, function ()
e.window.setTextColor(args.fg_bg.fgd) e.w_set_fgd(args.fg_bg.fgd)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
on_failure(n + 1) on_failure(n + 1)
end) end)
end end
end end
-- handle touch -- handle mouse interaction
---@param event monitor_touch monitor touch event ---@param event mouse_interaction mouse event
---@diagnostic disable-next-line: unused-local function e.handle_mouse(event)
function e.handle_touch(event) if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
if e.enabled then
-- change text color to indicate clicked -- change text color to indicate clicked
e.window.setTextColor(args.accent) e.w_set_fgd(args.accent)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
-- abort any other callbacks -- abort any other callbacks
tcd.abort(on_timeout) tcd.abort(on_timeout)
@@ -158,7 +152,6 @@ local function hazard_button(args)
-- 1.5 second timeout -- 1.5 second timeout
tcd.dispatch(1.5, on_timeout) tcd.dispatch(1.5, on_timeout)
-- call the touch callback
args.callback() args.callback()
end end
end end
@@ -167,42 +160,45 @@ local function hazard_button(args)
---@param result boolean true for success, false for failure ---@param result boolean true for success, false for failure
function e.response_callback(result) function e.response_callback(result)
tcd.abort(on_timeout) tcd.abort(on_timeout)
if result then on_success() else on_failure(0) end
if result then
on_success()
else
on_failure(0)
end
end end
-- set the value (true simulates pressing the button) -- set the value (true simulates pressing the button)
---@param val boolean new value ---@param val boolean new value
function e.set_value(val) function e.set_value(val)
if val then e.handle_touch(core.events.touch("", 1, 1)) end if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
end end
-- show the button as disabled -- show the button as disabled
function e.disable() function e.on_disabled()
if args.dis_colors then if args.dis_colors then
draw_border(args.dis_colors.color_a) draw_border(args.dis_colors.color_a)
e.window.setTextColor(args.dis_colors.color_b) e.w_set_fgd(args.dis_colors.color_b)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
end end
end end
-- show the button as enabled -- show the button as enabled
function e.enable() function e.on_enabled()
draw_border(args.accent) draw_border(args.accent)
e.window.setTextColor(args.fg_bg.fgd) e.w_set_fgd(args.fg_bg.fgd)
e.window.setCursorPos(3, 2) e.w_set_cur(3, 2)
e.window.write(args.text) e.w_write(args.text)
end end
-- initial draw of border -- element redraw
draw_border(args.accent) function e.redraw()
-- write the button text and draw border
e.w_set_cur(3, 2)
e.w_write(args.text)
draw_border(args.accent)
end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return hazard_button return hazard_button

View File

@@ -2,13 +2,13 @@
local util = require("scada-common.util") local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element") local element = require("graphics.element")
---@class button_option ---@class button_option
---@field text string ---@field text string
---@field fg_bg cpair ---@field fg_bg cpair
---@field active_fg_bg cpair ---@field active_fg_bg cpair
---@field _lpad integer automatically calculated left pad
---@field _start_x integer starting touch x range (inclusive) ---@field _start_x integer starting touch x range (inclusive)
---@field _end_x integer ending touch x range (inclusive) ---@field _end_x integer ending touch x range (inclusive)
@@ -20,21 +20,20 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new multi button (latch selection, exclusively one button at a time) -- new multi button (latch selection, exclusively one button at a time)
---@param args multi_button_args ---@param args multi_button_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function multi_button(args) local function multi_button(args)
assert(type(args.options) == "table", "graphics.elements.controls.multi_button: options is a required field") element.assert(type(args.options) == "table", "options is a required field")
assert(#args.options > 0, "graphics.elements.controls.multi_button: at least one option is required") element.assert(#args.options > 0, "at least one option is required")
assert(type(args.callback) == "function", "graphics.elements.controls.multi_button: callback is a required field") element.assert(type(args.callback) == "function", "callback is a required field")
assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
"graphics.elements.controls.multi_button: default must be nil or a number > 0") element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
"graphics.elements.controls.multi_button: min_width must be nil or a number > 0")
-- single line -- single line
args.height = 1 args.height = 1
@@ -62,9 +61,7 @@ local function multi_button(args)
local next_x = 2 local next_x = 2
for i = 1, #args.options do for i = 1, #args.options do
local opt = args.options[i] ---@type button_option local opt = args.options[i] ---@type button_option
local w = string.len(opt.text)
opt._lpad = math.floor((e.frame.w - w) / 2)
opt._start_x = next_x opt._start_x = next_x
opt._end_x = next_x + button_width - 1 opt._end_x = next_x + button_width - 1
@@ -72,39 +69,52 @@ local function multi_button(args)
end end
-- show the button state -- show the button state
local function draw() function e.redraw()
for i = 1, #args.options do for i = 1, #args.options do
local opt = args.options[i] ---@type button_option local opt = args.options[i] ---@type button_option
e.window.setCursorPos(opt._start_x, 1) e.w_set_cur(opt._start_x, 1)
if e.value == i then if e.value == i then
-- show as pressed -- show as pressed
e.window.setTextColor(opt.active_fg_bg.fgd) e.w_set_fgd(opt.active_fg_bg.fgd)
e.window.setBackgroundColor(opt.active_fg_bg.bkg) e.w_set_bkg(opt.active_fg_bg.bkg)
else else
-- show as unpressed -- show as unpressed
e.window.setTextColor(opt.fg_bg.fgd) e.w_set_fgd(opt.fg_bg.fgd)
e.window.setBackgroundColor(opt.fg_bg.bkg) e.w_set_bkg(opt.fg_bg.bkg)
end end
e.window.write(util.pad(opt.text, button_width)) e.w_write(util.pad(opt.text, button_width))
end end
end end
-- handle touch -- check which button a given x is within
---@param event monitor_touch monitor touch event ---@return integer|nil button index or nil if not within a button
function e.handle_touch(event) local function which_button(x)
-- determine what was pressed for i = 1, #args.options do
if e.enabled and event.y == 1 then local opt = args.options[i] ---@type button_option
for i = 1, #args.options do if x >= opt._start_x and x <= opt._end_x then return i end
local opt = args.options[i] ---@type button_option end
if event.x >= opt._start_x and event.x <= opt._end_x then return nil
e.value = i end
draw()
args.callback(e.value) -- handle mouse interaction
end ---@param event mouse_interaction mouse event
function e.handle_mouse(event)
-- if enabled and the button row was pressed...
if e.enabled and core.events.was_clicked(event.type) then
-- a button may have been pressed, which one was it?
local button_ini = which_button(event.initial.x)
local button_cur = which_button(event.current.x)
-- mouse up must always have started with a mouse down on the same button to count as a click
-- tap always has identical coordinates, so this always passes for taps
if button_ini == button_cur and button_cur ~= nil then
e.value = button_cur
e.redraw()
args.callback(e.value)
end end
end end
end end
@@ -113,13 +123,13 @@ local function multi_button(args)
---@param val integer new value ---@param val integer new value
function e.set_value(val) function e.set_value(val)
e.value = val e.value = val
draw() e.redraw()
end end
-- initial draw -- initial draw
draw() e.redraw()
return e.get() return e.complete()
end end
return multi_button return multi_button

View File

@@ -1,110 +1,166 @@
-- Button Graphics Element -- Button Graphics Element
local tcd = require("scada-common.tcallbackdsp") local tcd = require("scada-common.tcd")
local util = require("scada-common.util")
local core = require("graphics.core") local core = require("graphics.core")
local element = require("graphics.element") local element = require("graphics.element")
local ALIGN = core.ALIGN
local MOUSE_CLICK = core.events.MOUSE_CLICK
local KEY_CLICK = core.events.KEY_CLICK
---@class push_button_args ---@class push_button_args
---@field text string button text ---@field text string button text
---@field callback function function to call on touch ---@field callback function function to call on touch
---@field min_width? integer text length + 2 if omitted ---@field min_width? integer text length if omitted
---@field alignment? ALIGN text align if min width > length
---@field active_fg_bg? cpair foreground/background colors when pressed ---@field active_fg_bg? cpair foreground/background colors when pressed
---@field dis_fg_bg? cpair foreground/background colors when disabled ---@field dis_fg_bg? cpair foreground/background colors when disabled
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new push button -- new push button
---@param args push_button_args ---@param args push_button_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function push_button(args) local function push_button(args)
assert(type(args.text) == "string", "graphics.elements.controls.push_button: text is a required field") element.assert(type(args.text) == "string", "text is a required field")
assert(type(args.callback) == "function", "graphics.elements.controls.push_button: callback is a required field") element.assert(type(args.callback) == "function", "callback is a required field")
element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
local text_width = string.len(args.text) local text_width = string.len(args.text)
local alignment = args.alignment or ALIGN.CENTER
-- single line height, calculate width -- set automatic settings
args.height = 1 args.can_focus = true
args.min_width = args.min_width or 0 args.min_width = args.min_width or 0
args.width = math.max(text_width, args.min_width) args.width = math.max(text_width, args.min_width)
-- create new graphics element base object -- provide a constraint condition to element creation to prefer a single line button
local e = element.new(args) ---@param frame graphics_frame
local function constrain(frame)
local h_pad = math.floor((e.frame.w - text_width) / 2) + 1 return frame.w, math.max(1, #util.strwrap(args.text, frame.w))
local v_pad = math.floor(e.frame.h / 2) + 1
-- draw the button
local function draw()
e.window.clear()
-- write the button text
e.window.setCursorPos(h_pad, v_pad)
e.window.write(args.text)
end end
-- handle touch -- create new graphics element base object
---@param event monitor_touch monitor touch event local e = element.new(args, constrain)
---@diagnostic disable-next-line: unused-local
function e.handle_touch(event)
if e.enabled then
if args.active_fg_bg ~= nil then
-- show as pressed
e.value = true
e.window.setTextColor(args.active_fg_bg.fgd)
e.window.setBackgroundColor(args.active_fg_bg.bkg)
draw()
-- show as unpressed in 0.25 seconds local text_lines = util.strwrap(args.text, e.frame.w)
tcd.dispatch(0.25, function ()
e.value = false -- draw the button
if e.enabled then function e.redraw()
e.window.setTextColor(e.fg_bg.fgd) e.window.clear()
e.window.setBackgroundColor(e.fg_bg.bkg)
end for i = 1, #text_lines do
draw() if i > e.frame.h then break end
end)
local len = string.len(text_lines[i])
-- use cursor position to align this line
if alignment == ALIGN.CENTER then
e.w_set_cur(math.floor((e.frame.w - len) / 2) + 1, i)
elseif alignment == ALIGN.RIGHT then
e.w_set_cur((e.frame.w - len) + 1, i)
else
e.w_set_cur(1, i)
end end
-- call the touch callback e.w_write(text_lines[i])
args.callback() end
end
-- draw the button as pressed (if active_fg_bg set)
local function show_pressed()
if e.enabled and args.active_fg_bg ~= nil then
e.value = true
e.w_set_fgd(args.active_fg_bg.fgd)
e.w_set_bkg(args.active_fg_bg.bkg)
e.redraw()
end
end
-- draw the button as unpressed (if active_fg_bg set)
local function show_unpressed()
if e.enabled and args.active_fg_bg ~= nil then
e.value = false
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
e.redraw()
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
if e.enabled then
if event.type == MOUSE_CLICK.TAP then
show_pressed()
-- show as unpressed in 0.25 seconds
if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
args.callback()
elseif event.type == MOUSE_CLICK.DOWN then
show_pressed()
elseif event.type == MOUSE_CLICK.UP then
show_unpressed()
if e.in_frame_bounds(event.current.x, event.current.y) then
args.callback()
end
end
end
end
-- handle keyboard interaction
---@param event key_interaction key event
function e.handle_key(event)
if event.type == KEY_CLICK.DOWN then
if event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter then
args.callback()
-- visualize click without unfocusing
show_unpressed()
if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_pressed) end
end
end end
end end
-- set the value (true simulates pressing the button) -- set the value (true simulates pressing the button)
---@param val boolean new value ---@param val boolean new value
function e.set_value(val) function e.set_value(val)
if val then e.handle_touch(core.events.touch("", 1, 1)) end if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
end end
-- show butten as enabled -- show butten as enabled
function e.enable() function e.on_enabled()
if args.dis_fg_bg ~= nil then if args.dis_fg_bg ~= nil then
e.value = false e.value = false
e.window.setTextColor(e.fg_bg.fgd) e.w_set_fgd(e.fg_bg.fgd)
e.window.setBackgroundColor(e.fg_bg.bkg) e.w_set_bkg(e.fg_bg.bkg)
draw() e.redraw()
end end
end end
-- show button as disabled -- show button as disabled
function e.disable() function e.on_disabled()
if args.dis_fg_bg ~= nil then if args.dis_fg_bg ~= nil then
e.value = false e.value = false
e.window.setTextColor(args.dis_fg_bg.fgd) e.w_set_fgd(args.dis_fg_bg.fgd)
e.window.setBackgroundColor(args.dis_fg_bg.bkg) e.w_set_bkg(args.dis_fg_bg.bkg)
draw() e.redraw()
end end
end end
-- initial draw -- handle focus
draw() e.on_focused = show_pressed
e.on_unfocused = show_unpressed
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return push_button return push_button

View File

@@ -0,0 +1,203 @@
-- 2D Radio Button Graphics Element
local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element")
---@class radio_2d_args
---@field rows integer
---@field columns integer
---@field options table
---@field radio_colors cpair radio button colors (inner & outer)
---@field select_color? color color for radio button when selected
---@field color_map? table colors for each radio button when selected
---@field disable_color? color color for radio button when disabled
---@field disable_fg_bg? cpair text colors when disabled
---@field default? integer default state, defaults to options[1]
---@field callback? function function to call on touch
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new 2D radio button list (latch selection, exclusively one color at a time)
---@param args radio_2d_args
---@return graphics_element element, element_id id
local function radio_2d_button(args)
element.assert(type(args.options) == "table" and #args.options > 0, "options should be a table with length >= 1")
element.assert(util.is_int(args.rows) and util.is_int(args.columns), "rows/columns must be integers")
element.assert((args.rows * args.columns) >= #args.options, "rows x columns size insufficient for provided number of options")
element.assert(type(args.radio_colors) == "table", "radio_colors is a required field")
element.assert(type(args.select_color) == "number" or type(args.color_map) == "table", "select_color or color_map is required")
element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
local array = {}
local col_widths = {}
local next_idx = 1
local total_width = 0
local max_rows = 1
local focused_opt = 1
local focus_x, focus_y = 1, 1
-- build table to display
for col = 1, args.columns do
local max_width = 0
array[col] = {}
for row = 1, args.rows do
local len = string.len(args.options[next_idx])
if len > max_width then max_width = len end
if row > max_rows then max_rows = row end
table.insert(array[col], { text = args.options[next_idx], id = next_idx, x_1 = 1 + total_width, x_2 = 2 + total_width + len })
next_idx = next_idx + 1
if next_idx > #args.options then break end
end
table.insert(col_widths, max_width + 3)
total_width = total_width + max_width + 3
if next_idx > #args.options then break end
end
args.can_focus = true
args.width = total_width
args.height = max_rows
-- create new graphics element base object
local e = element.new(args)
-- selected option (convert nil to 1 if missing)
e.value = args.default or 1
-- draw the element
function e.redraw()
local col_x = 1
local radio_color_b = util.trinary(type(args.disable_color) == "number" and not e.enabled, args.disable_color, args.radio_colors.color_b)
for col = 1, #array do
for row = 1, #array[col] do
local opt = array[col][row]
local select_color = args.select_color
if type(args.color_map) == "table" and args.color_map[opt.id] then
select_color = args.color_map[opt.id]
end
local inner_color = util.trinary((e.value == opt.id) and e.enabled, radio_color_b, args.radio_colors.color_a)
local outer_color = util.trinary((e.value == opt.id) and e.enabled, select_color, radio_color_b)
e.w_set_cur(col_x, row)
e.w_set_fgd(inner_color)
e.w_set_bkg(outer_color)
e.w_write("\x88")
e.w_set_fgd(outer_color)
e.w_set_bkg(e.fg_bg.bkg)
e.w_write("\x95")
if opt.id == focused_opt then
focus_x, focus_y = row, col
end
-- write button text
if opt.id == focused_opt and e.is_focused() and e.enabled then
e.w_set_fgd(e.fg_bg.bkg)
e.w_set_bkg(e.fg_bg.fgd)
elseif type(args.disable_fg_bg) == "table" and not e.enabled then
e.w_set_fgd(args.disable_fg_bg.fgd)
e.w_set_bkg(args.disable_fg_bg.bkg)
else
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
end
e.w_write(opt.text)
end
col_x = col_x + col_widths[col]
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
if e.enabled and core.events.was_clicked(event.type) and (event.initial.y == event.current.y) then
-- determine what was pressed
for _, row in ipairs(array) do
local elem = row[event.current.y]
if elem ~= nil and event.initial.x >= elem.x_1 and event.initial.x <= elem.x_2 and event.current.x >= elem.x_1 and event.current.x <= elem.x_2 then
e.value = elem.id
focused_opt = elem.id
e.redraw()
if type(args.callback) == "function" then args.callback(e.value) end
break
end
end
end
end
-- handle keyboard interaction
---@param event key_interaction key event
function e.handle_key(event)
if event.type == core.events.KEY_CLICK.DOWN or event.type == core.events.KEY_CLICK.HELD then
if event.type == core.events.KEY_CLICK.DOWN and (event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter) then
e.value = focused_opt
e.redraw()
if type(args.callback) == "function" then args.callback(e.value) end
elseif event.key == keys.down then
if focused_opt < #args.options then
focused_opt = focused_opt + 1
e.redraw()
end
elseif event.key == keys.up then
if focused_opt > 1 then
focused_opt = focused_opt - 1
e.redraw()
end
elseif event.key == keys.right then
if array[focus_y + 1] and array[focus_y + 1][focus_x] then
focused_opt = array[focus_y + 1][focus_x].id
else focused_opt = array[1][focus_x].id end
e.redraw()
elseif event.key == keys.left then
if array[focus_y - 1] and array[focus_y - 1][focus_x] then
focused_opt = array[focus_y - 1][focus_x].id
e.redraw()
elseif array[#array][focus_x] then
focused_opt = array[#array][focus_x].id
e.redraw()
end
end
end
end
-- set the value
---@param val integer new value
function e.set_value(val)
if type(val) == "number" and val > 0 and val <= #args.options then
e.value = val
e.redraw()
end
end
-- handle focus & enable
e.on_focused = e.redraw
e.on_unfocused = e.redraw
e.on_enabled = e.redraw
e.on_disabled = e.redraw
-- initial draw
e.redraw()
return e.complete()
end
return radio_2d_button

View File

@@ -1,34 +1,36 @@
-- Radio Button Graphics Element -- Radio Button Graphics Element
local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element") local element = require("graphics.element")
local KEY_CLICK = core.events.KEY_CLICK
---@class radio_button_args ---@class radio_button_args
---@field options table button options ---@field options table button options
---@field callback function function to call on touch ---@field radio_colors cpair radio button colors (inner & outer)
---@field radio_colors cpair colors for radio button center dot when active (a) or inactive (b) ---@field select_color color color for radio button border when selected
---@field radio_bg color background color of radio button
---@field default? integer default state, defaults to options[1] ---@field default? integer default state, defaults to options[1]
---@field min_width? integer text length + 2 if omitted ---@field min_width? integer text length + 2 if omitted
---@field callback? function function to call on touch
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new radio button list (latch selection, exclusively one button at a time) -- new radio button list (latch selection, exclusively one button at a time)
---@param args radio_button_args ---@param args radio_button_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function radio_button(args) local function radio_button(args)
assert(type(args.options) == "table", "graphics.elements.controls.radio_button: options is a required field") element.assert(type(args.options) == "table", "options is a required field")
assert(#args.options > 0, "graphics.elements.controls.radio_button: at least one option is required") element.assert(#args.options > 0, "at least one option is required")
assert(type(args.callback) == "function", "graphics.elements.controls.radio_button: callback is a required field") element.assert(type(args.radio_colors) == "table", "radio_colors is a required field")
assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), element.assert(type(args.select_color) == "number", "select_color is a required field")
"graphics.elements.controls.radio_button: default must be nil or a number > 0") element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
"graphics.elements.controls.radio_button: min_width must be nil or a number > 0")
-- one line per option
args.height = #args.options
-- determine widths -- determine widths
local max_width = 1 local max_width = 1
@@ -41,53 +43,83 @@ local function radio_button(args)
local button_text_width = math.max(max_width, args.min_width or 0) local button_text_width = math.max(max_width, args.min_width or 0)
-- set automatic args
args.can_focus = true
args.width = button_text_width + 2 args.width = button_text_width + 2
args.height = #args.options -- one line per option
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
local focused_opt = 1
-- button state (convert nil to 1 if missing) -- button state (convert nil to 1 if missing)
e.value = args.default or 1 e.value = args.default or 1
-- show the button state -- show the button state
local function draw() function e.redraw()
for i = 1, #args.options do for i = 1, #args.options do
local opt = args.options[i] ---@type string local opt = args.options[i] ---@type string
e.window.setCursorPos(1, i) local inner_color = util.trinary(e.value == i, args.radio_colors.color_b, args.radio_colors.color_a)
local outer_color = util.trinary(e.value == i, args.select_color, args.radio_colors.color_b)
if e.value == i then e.w_set_cur(1, i)
-- show as selected
e.window.setTextColor(args.radio_colors.color_a)
e.window.setBackgroundColor(args.radio_bg)
else
-- show as unselected
e.window.setTextColor(args.radio_colors.color_b)
e.window.setBackgroundColor(args.radio_bg)
end
e.window.write("\x88") e.w_set_fgd(inner_color)
e.w_set_bkg(outer_color)
e.w_write("\x88")
e.window.setTextColor(args.radio_bg) e.w_set_fgd(outer_color)
e.window.setBackgroundColor(e.fg_bg.bkg) e.w_set_bkg(e.fg_bg.bkg)
e.window.write("\x95") e.w_write("\x95")
-- write button text -- write button text
e.window.setTextColor(e.fg_bg.fgd) if i == focused_opt and e.is_focused() and e.enabled then
e.window.setBackgroundColor(e.fg_bg.bkg) e.w_set_fgd(e.fg_bg.bkg)
e.window.write(opt) e.w_set_bkg(e.fg_bg.fgd)
else
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
end
e.w_write(opt)
end end
end end
-- handle touch -- handle mouse interaction
---@param event monitor_touch monitor touch event ---@param event mouse_interaction mouse event
function e.handle_touch(event) function e.handle_mouse(event)
-- determine what was pressed if e.enabled and core.events.was_clicked(event.type) and
if e.enabled then (event.initial.y == event.current.y) and e.in_frame_bounds(event.current.x, event.current.y) then
if args.options[event.y] ~= nil then -- determine what was pressed
e.value = event.y if args.options[event.current.y] ~= nil then
draw() e.value = event.current.y
args.callback(e.value) focused_opt = e.value
e.redraw()
if type(args.callback) == "function" then args.callback(e.value) end
end
end
end
-- handle keyboard interaction
---@param event key_interaction key event
function e.handle_key(event)
if event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
if event.type == KEY_CLICK.DOWN and (event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter) then
e.value = focused_opt
e.redraw()
if type(args.callback) == "function" then args.callback(e.value) end
elseif event.key == keys.down then
if focused_opt < #args.options then
focused_opt = focused_opt + 1
e.redraw()
end
elseif event.key == keys.up then
if focused_opt > 1 then
focused_opt = focused_opt - 1
e.redraw()
end
end end
end end
end end
@@ -95,14 +127,22 @@ local function radio_button(args)
-- set the value -- set the value
---@param val integer new value ---@param val integer new value
function e.set_value(val) function e.set_value(val)
e.value = val if type(val) == "number" and val > 0 and val <= #args.options then
draw() e.value = val
e.redraw()
end
end end
-- initial draw -- handle focus & enable
draw() e.on_focused = e.redraw
e.on_unfocused = e.redraw
e.on_enabled = e.redraw
e.on_disabled = e.redraw
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return radio_button return radio_button

View File

@@ -0,0 +1,168 @@
-- Sidebar Graphics Element
local tcd = require("scada-common.tcd")
local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element")
local MOUSE_CLICK = core.events.MOUSE_CLICK
---@class sidebar_args
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new sidebar tab selector
---@param args sidebar_args
---@return graphics_element element, element_id id
local function sidebar(args)
args.width = 3
-- create new graphics element base object
local e = element.new(args)
-- default to 1st tab
e.value = 1
local was_pressed = false
local tabs = {}
-- show the button state
---@param pressed? boolean if the currently selected tab should appear as actively pressed
---@param pressed_idx? integer optional index to show as held (that is not yet selected)
local function draw(pressed, pressed_idx)
pressed = util.trinary(pressed == nil, was_pressed, pressed)
was_pressed = pressed
pressed_idx = pressed_idx or e.value
-- clear
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
for y = 1, e.frame.h do
e.w_set_cur(1, y)
e.w_write(" ")
end
-- draw tabs
for i = 1, #tabs do
local tab = tabs[i] ---@type sidebar_tab
local y = tab.y_start
e.w_set_cur(1, y)
if pressed and i == pressed_idx then
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
else
e.w_set_fgd(tab.color.fgd)
e.w_set_bkg(tab.color.bkg)
end
if tab.tall then
e.w_write(" ")
e.w_set_cur(1, y + 1)
end
e.w_write(tab.label)
if tab.tall then
e.w_set_cur(1, y + 2)
e.w_write(" ")
end
end
end
-- determine which tab was pressed
---@param y integer y coordinate
local function find_tab(y)
for i = 1, #tabs do
local tab = tabs[i] ---@type sidebar_tab
if y >= tab.y_start and y <= tab.y_end then
return i
end
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
-- determine what was pressed
if e.enabled then
local cur_idx = find_tab(event.current.y)
local ini_idx = find_tab(event.initial.y)
local tab = tabs[cur_idx]
-- handle press if a callback was provided
if tab ~= nil and type(tab.callback) == "function" then
if event.type == MOUSE_CLICK.TAP then
e.value = cur_idx
draw(true)
-- show as unpressed in 0.25 seconds
tcd.dispatch(0.25, function () draw(false) end)
tab.callback()
elseif event.type == MOUSE_CLICK.DOWN then
draw(true, cur_idx)
elseif event.type == MOUSE_CLICK.UP then
if cur_idx == ini_idx and e.in_frame_bounds(event.current.x, event.current.y) then
e.value = cur_idx
draw(false)
tab.callback()
else draw(false) end
end
elseif event.type == MOUSE_CLICK.UP then
draw(false)
end
end
end
-- set the value
---@param val integer new value
function e.set_value(val)
e.value = val
draw(false)
end
-- update the sidebar navigation options
---@param items table sidebar entries
function e.on_update(items)
local next_y = 1
tabs = {}
for i = 1, #items do
local item = items[i]
local height = util.trinary(item.tall, 3, 1)
---@class sidebar_tab
local entry = {
y_start = next_y, ---@type integer
y_end = next_y + height - 1, ---@type integer
tall = item.tall, ---@type boolean
label = item.label, ---@type string
color = item.color, ---@type cpair
callback = item.callback ---@type function|nil
}
next_y = next_y + height
tabs[i] = entry
end
draw()
end
-- element redraw
e.redraw = draw
e.redraw()
return e.complete()
end
return sidebar

View File

@@ -2,6 +2,7 @@
local util = require("scada-common.util") local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element") local element = require("graphics.element")
---@class spinbox_args ---@class spinbox_args
@@ -15,8 +16,9 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new spinbox control (minimum value is 0) -- new spinbox control (minimum value is 0)
---@param args spinbox_args ---@param args spinbox_args
@@ -27,11 +29,10 @@ local function spinbox(args)
local wn_prec = args.whole_num_precision local wn_prec = args.whole_num_precision
local fr_prec = args.fractional_precision local fr_prec = args.fractional_precision
assert(util.is_int(wn_prec), "graphics.element.controls.spinbox_numeric: whole number precision must be an integer") element.assert(util.is_int(wn_prec), "whole number precision must be an integer")
assert(util.is_int(fr_prec), "graphics.element.controls.spinbox_numeric: fractional precision must be an integer") element.assert(util.is_int(fr_prec), "fractional precision must be an integer")
local fmt = "" local fmt, fmt_init ---@type string, string
local fmt_init = ""
if fr_prec > 0 then if fr_prec > 0 then
fmt = "%" .. (wn_prec + fr_prec + 1) .. "." .. fr_prec .. "f" fmt = "%" .. (wn_prec + fr_prec + 1) .. "." .. fr_prec .. "f"
@@ -43,7 +44,7 @@ local function spinbox(args)
local dec_point_x = args.whole_num_precision + 1 local dec_point_x = args.whole_num_precision + 1
assert(type(args.arrow_fg_bg) == "table", "graphics.element.spinbox_numeric: arrow_fg_bg is a required field") element.assert(type(args.arrow_fg_bg) == "table", "arrow_fg_bg is a required field")
-- determine widths -- determine widths
args.width = wn_prec + fr_prec + util.trinary(fr_prec > 0, 1, 0) args.width = wn_prec + fr_prec + util.trinary(fr_prec > 0, 1, 0)
@@ -57,22 +58,20 @@ local function spinbox(args)
-- draw the arrows -- draw the arrows
local function draw_arrows(color) local function draw_arrows(color)
e.window.setBackgroundColor(args.arrow_fg_bg.bkg) e.w_set_bkg(args.arrow_fg_bg.bkg)
e.window.setTextColor(color) e.w_set_fgd(color)
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
e.window.write(util.strrep("\x1e", wn_prec)) e.w_write(string.rep("\x1e", wn_prec))
e.window.setCursorPos(1, 3) e.w_set_cur(1, 3)
e.window.write(util.strrep("\x1f", wn_prec)) e.w_write(string.rep("\x1f", wn_prec))
if fr_prec > 0 then if fr_prec > 0 then
e.window.setCursorPos(1 + wn_prec, 1) e.w_set_cur(1 + wn_prec, 1)
e.window.write(" " .. util.strrep("\x1e", fr_prec)) e.w_write(" " .. string.rep("\x1e", fr_prec))
e.window.setCursorPos(1 + wn_prec, 3) e.w_set_cur(1 + wn_prec, 3)
e.window.write(" " .. util.strrep("\x1f", fr_prec)) e.w_write(" " .. string.rep("\x1f", fr_prec))
end end
end end
draw_arrows(args.arrow_fg_bg.fgd)
-- populate digits from current value -- populate digits from current value
local function set_digits() local function set_digits()
local initial_str = util.sprintf(fmt_init, e.value) local initial_str = util.sprintf(fmt_init, e.value)
@@ -118,27 +117,24 @@ local function spinbox(args)
end end
-- draw -- draw
e.window.setBackgroundColor(e.fg_bg.bkg) e.w_set_bkg(e.fg_bg.bkg)
e.window.setTextColor(e.fg_bg.fgd) e.w_set_fgd(e.fg_bg.fgd)
e.window.setCursorPos(1, 2) e.w_set_cur(1, 2)
e.window.write(util.sprintf(fmt, e.value)) e.w_write(util.sprintf(fmt, e.value))
end end
-- init with the default value -- handle mouse interaction
show_num() ---@param event mouse_interaction mouse event
function e.handle_mouse(event)
-- handle touch
---@param event monitor_touch monitor touch event
function e.handle_touch(event)
-- only handle if on an increment or decrement arrow -- only handle if on an increment or decrement arrow
if e.enabled and event.x ~= dec_point_x then if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) and
local idx = util.trinary(event.x > dec_point_x, event.x - 1, event.x) (event.current.x ~= dec_point_x) and (event.current.y ~= 2) and
(event.current.x == event.initial.x) and (event.current.y == event.initial.y) then
local idx = util.trinary(event.current.x > dec_point_x, event.current.x - 1, event.current.x)
if digits[idx] ~= nil then if digits[idx] ~= nil then
if event.y == 1 then if event.current.y == 1 then
-- increment
digits[idx] = digits[idx] + 1 digits[idx] = digits[idx] + 1
elseif event.y == 3 then elseif event.current.y == 3 then
-- decrement
digits[idx] = digits[idx] - 1 digits[idx] = digits[idx] - 1
end end
@@ -172,20 +168,21 @@ local function spinbox(args)
end end
-- enable this input -- enable this input
function e.enable() function e.on_enabled() draw_arrows(args.arrow_fg_bg.fgd) end
draw_arrows(args.arrow_fg_bg.fgd)
end
-- disable this input -- disable this input
function e.disable() function e.on_disabled() draw_arrows(args.arrow_disable or colors.lightGray) end
draw_arrows(args.arrow_disable or colors.lightGray)
-- element redraw
function e.redraw()
show_num()
draw_arrows(util.trinary(e.enabled, args.arrow_fg_bg.fgd, args.arrow_disable or colors.lightGray))
end end
-- default to zero, init digits table -- initial draw
e.value = 0 e.redraw()
set_digits()
return e.get() return e.complete()
end end
return spinbox return spinbox

View File

@@ -1,5 +1,6 @@
-- Button Graphics Element -- Button Graphics Element
local core = require("graphics.core")
local element = require("graphics.element") local element = require("graphics.element")
---@class switch_button_args ---@class switch_button_args
@@ -11,80 +12,70 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new switch button (latch high/low) -- new switch button (latch high/low)
---@param args switch_button_args ---@param args switch_button_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function switch_button(args) local function switch_button(args)
assert(type(args.text) == "string", "graphics.elements.controls.switch_button: text is a required field") element.assert(type(args.text) == "string", "text is a required field")
assert(type(args.callback) == "function", "graphics.elements.controls.switch_button: callback is a required field") element.assert(type(args.callback) == "function", "callback is a required field")
assert(type(args.active_fg_bg) == "table", "graphics.elements.controls.switch_button: active_fg_bg is a required field") element.assert(type(args.active_fg_bg) == "table", "active_fg_bg is a required field")
element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
-- single line
args.height = 1
-- determine widths
local text_width = string.len(args.text) local text_width = string.len(args.text)
args.width = math.max(text_width + 2, args.min_width)
args.height = 1
args.min_width = args.min_width or 0
args.width = math.max(text_width, args.min_width)
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- button state (convert nil to false if missing)
e.value = args.default or false e.value = args.default or false
local h_pad = math.floor((e.frame.w - text_width) / 2) + 1 local h_pad = math.floor((e.frame.w - text_width) / 2) + 1
local v_pad = math.floor(e.frame.h / 2) + 1 local v_pad = math.floor(e.frame.h / 2) + 1
-- show the button state -- show the button state
local function draw_state() function e.redraw()
if e.value then if e.value then
-- show as pressed e.w_set_fgd(args.active_fg_bg.fgd)
e.window.setTextColor(args.active_fg_bg.fgd) e.w_set_bkg(args.active_fg_bg.bkg)
e.window.setBackgroundColor(args.active_fg_bg.bkg)
else else
-- show as unpressed e.w_set_fgd(e.fg_bg.fgd)
e.window.setTextColor(e.fg_bg.fgd) e.w_set_bkg(e.fg_bg.bkg)
e.window.setBackgroundColor(e.fg_bg.bkg)
end end
-- clear to redraw background
e.window.clear() e.window.clear()
e.w_set_cur(h_pad, v_pad)
-- write the button text e.w_write(args.text)
e.window.setCursorPos(h_pad, v_pad)
e.window.write(args.text)
end end
-- initial draw -- handle mouse interaction
draw_state() ---@param event mouse_interaction mouse event
function e.handle_mouse(event)
-- handle touch if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
---@param event monitor_touch monitor touch event
---@diagnostic disable-next-line: unused-local
function e.handle_touch(event)
if e.enabled then
-- toggle state
e.value = not e.value e.value = not e.value
draw_state() e.redraw()
-- call the touch callback with state
args.callback(e.value) args.callback(e.value)
end end
end end
-- set the value -- set the value (does not call the callback)
---@param val boolean new value ---@param val boolean new value
function e.set_value(val) function e.set_value(val)
-- set state
e.value = val e.value = val
draw_state() e.redraw()
end end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return switch_button return switch_button

View File

@@ -0,0 +1,129 @@
-- Tab Bar Graphics Element
local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element")
---@class tabbar_tab
---@field name string tab name
---@field color cpair tab colors (fg/bg)
---@field _start_x integer starting touch x range (inclusive)
---@field _end_x integer ending touch x range (inclusive)
---@class tabbar_args
---@field tabs table tab options
---@field callback function function to call on tab change
---@field min_width? integer text length + 2 if omitted
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new tab selector
---@param args tabbar_args
---@return graphics_element element, element_id id
local function tabbar(args)
element.assert(type(args.tabs) == "table", "tabs is a required field")
element.assert(#args.tabs > 0, "at least one tab is required")
element.assert(type(args.callback) == "function", "callback is a required field")
element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
args.height = 1
-- determine widths
local max_width = 1
for i = 1, #args.tabs do
local opt = args.tabs[i] ---@type tabbar_tab
if string.len(opt.name) > max_width then
max_width = string.len(opt.name)
end
end
local button_width = math.max(max_width, args.min_width or 0)
-- create new graphics element base object
local e = element.new(args)
element.assert(e.frame.w >= (button_width * #args.tabs), "width insufficent to display all tabs")
-- default to 1st tab
e.value = 1
-- calculate required tab dimension information
local next_x = 1
for i = 1, #args.tabs do
local tab = args.tabs[i] ---@type tabbar_tab
tab._start_x = next_x
tab._end_x = next_x + button_width - 1
next_x = next_x + button_width
end
-- show the tab state
function e.redraw()
for i = 1, #args.tabs do
local tab = args.tabs[i] ---@type tabbar_tab
e.w_set_cur(tab._start_x, 1)
if e.value == i then
e.w_set_fgd(tab.color.fgd)
e.w_set_bkg(tab.color.bkg)
else
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
end
e.w_write(util.pad(tab.name, button_width))
end
end
-- check which tab a given x is within
---@return integer|nil button index or nil if not within a tab
local function which_tab(x)
for i = 1, #args.tabs do
local tab = args.tabs[i] ---@type tabbar_tab
if x >= tab._start_x and x <= tab._end_x then return i end
end
return nil
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
-- determine what was pressed
if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
-- a button may have been pressed, which one was it?
local tab_ini = which_tab(event.initial.x)
local tab_cur = which_tab(event.current.x)
-- mouse up must always have started with a mouse down on the same tab to count as a click
-- tap always has identical coordinates, so this always passes for taps
if tab_ini == tab_cur and tab_cur ~= nil then
e.value = tab_cur
e.redraw()
args.callback(e.value)
end
end
end
-- set the value
---@param val integer new value
function e.set_value(val)
e.value = val
e.redraw()
end
-- initial draw
e.redraw()
return e.complete()
end
return tabbar

View File

@@ -4,19 +4,22 @@ local element = require("graphics.element")
---@class displaybox_args ---@class displaybox_args
---@field window table ---@field window table
---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer 1 if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new root display box -- new root display box
---@nodiscard ---@nodiscard
---@param args displaybox_args ---@param args displaybox_args
---@return graphics_element element, element_id id
local function displaybox(args) local function displaybox(args)
-- create new graphics element base object -- create new graphics element base object
return element.new(args).get() return element.new(args).complete()
end end
return displaybox return displaybox

View File

@@ -6,11 +6,12 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new div element -- new div element
---@nodiscard ---@nodiscard
@@ -18,7 +19,7 @@ local element = require("graphics.element")
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function div(args) local function div(args)
-- create new graphics element base object -- create new graphics element base object
return element.new(args).get() return element.new(args).complete()
end end
return div return div

View File

@@ -0,0 +1,197 @@
-- Numeric Value Entry Graphics Element
local util = require("scada-common.util")
local core = require("graphics.core")
local element = require("graphics.element")
local KEY_CLICK = core.events.KEY_CLICK
local MOUSE_CLICK = core.events.MOUSE_CLICK
---@class number_field_args
---@field default? number default value, defaults to 0
---@field min? number minimum, enforced on unfocus
---@field max? number maximum, enforced on unfocus
---@field max_chars? integer maximum number of characters, defaults to width
---@field max_int_digits? integer maximum number of integer digits, enforced on unfocus
---@field max_frac_digits? integer maximum number of fractional digits, enforced on unfocus
---@field allow_decimal? boolean true to allow decimals
---@field allow_negative? boolean true to allow negative numbers
---@field dis_fg_bg? cpair foreground/background colors when disabled
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new numeric entry field
---@param args number_field_args
---@return graphics_element element, element_id id
local function number_field(args)
element.assert(args.max_int_digits == nil or (util.is_int(args.max_int_digits) and args.max_int_digits > 0), "max_int_digits must be an integer greater than zero if supplied")
element.assert(args.max_frac_digits == nil or (util.is_int(args.max_frac_digits) and args.max_frac_digits > 0), "max_frac_digits must be an integer greater than zero if supplied")
args.height = 1
args.can_focus = true
-- create new graphics element base object
local e = element.new(args)
local has_decimal = false
args.max_chars = args.max_chars or e.frame.w
-- set initial value
e.value = "" .. (args.default or 0)
-- make an interactive field manager
local ifield = core.new_ifield(e, args.max_chars, args.fg_bg, args.dis_fg_bg)
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
-- only handle if on an increment or decrement arrow
if e.enabled and e.in_frame_bounds(event.current.x, event.current.y) then
if core.events.was_clicked(event.type) then
e.take_focus()
if event.type == MOUSE_CLICK.UP then
ifield.move_cursor(event.current.x)
end
elseif event.type == MOUSE_CLICK.DOUBLE_CLICK then
ifield.select_all()
end
end
end
-- handle keyboard interaction
---@param event key_interaction key event
function e.handle_key(event)
if event.type == KEY_CLICK.CHAR and string.len(e.value) < args.max_chars then
if tonumber(event.name) then
if e.value == 0 then e.value = "" end
ifield.try_insert_char(event.name)
end
elseif event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
if (event.key == keys.backspace or event.key == keys.delete) and (string.len(e.value) > 0) then
ifield.backspace()
has_decimal = string.find(e.value, "%.") ~= nil
elseif (event.key == keys.period or event.key == keys.numPadDecimal) and (not has_decimal) and args.allow_decimal then
has_decimal = true
ifield.try_insert_char(".")
elseif (event.key == keys.minus or event.key == keys.numPadSubtract) and (string.len(e.value) == 0) and args.allow_negative then
ifield.set_value("-")
elseif event.key == keys.left then
ifield.nav_left()
elseif event.key == keys.right then
ifield.nav_right()
elseif event.key == keys.a and event.ctrl then
ifield.select_all()
elseif event.key == keys.home or event.key == keys.up then
ifield.nav_start()
elseif event.key == keys["end"] or event.key == keys.down then
ifield.nav_end()
end
end
end
-- set the value (must be a number)
---@param val number number to show
function e.set_value(val)
if tonumber(val) then ifield.set_value("" .. tonumber(val)) end
end
-- set minimum input value
---@param min integer minimum allowed value
function e.set_min(min)
args.min = min
e.on_unfocused()
end
-- set maximum input value
---@param max integer maximum allowed value
function e.set_max(max)
args.max = max
e.on_unfocused()
end
-- replace text with pasted text if its a number
---@param text string string pasted
function e.handle_paste(text)
if tonumber(text) then
ifield.set_value("" .. tonumber(text))
else
ifield.set_value("0")
end
end
-- handle unfocused
function e.on_unfocused()
local val = tonumber(e.value)
local max = tonumber(args.max)
local min = tonumber(args.min)
if type(val) == "number" then
if args.max_int_digits or args.max_frac_digits then
local str = e.value
local ceil = false
if string.find(str, "-") then str = string.sub(e.value, 2) end
local parts = util.strtok(str, ".")
if parts[1] and args.max_int_digits then
if string.len(parts[1]) > args.max_int_digits then
parts[1] = string.rep("9", args.max_int_digits)
ceil = true
end
end
if args.allow_decimal and args.max_frac_digits then
if ceil then
parts[2] = string.rep("9", args.max_frac_digits)
elseif parts[2] and (string.len(parts[2]) > args.max_frac_digits) then
-- add a half of the highest precision fractional value in order to round using floor
local scaled = math.fmod(val, 1) * (10 ^ (args.max_frac_digits))
local value = math.floor(scaled + 0.5)
local unscaled = value * (10 ^ (-args.max_frac_digits))
parts[2] = string.sub(tostring(unscaled), 3) -- remove starting "0."
end
end
if parts[2] then parts[2] = "." .. parts[2] else parts[2] = "" end
val = tonumber((parts[1] or "") .. parts[2])
end
if type(args.max) == "number" and val > max then
e.value = "" .. max
ifield.nav_start()
elseif type(args.min) == "number" and val < min then
e.value = "" .. min
ifield.nav_start()
else
e.value = "" .. val
ifield.nav_end()
end
else
e.value = ""
end
ifield.show()
end
-- handle focus (not unfocus), enable, and redraw with show()
e.on_focused = ifield.show
e.on_enabled = ifield.show
e.on_disabled = ifield.show
e.redraw = ifield.show
-- initial draw
e.redraw()
return e.complete()
end
return number_field

View File

@@ -0,0 +1,105 @@
-- Text Value Entry Graphics Element
local core = require("graphics.core")
local element = require("graphics.element")
local KEY_CLICK = core.events.KEY_CLICK
local MOUSE_CLICK = core.events.MOUSE_CLICK
---@class text_field_args
---@field value? string initial value
---@field max_len? integer maximum string length
---@field censor? string character to replace text with when printing to screen
---@field dis_fg_bg? cpair foreground/background colors when disabled
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new text entry field
---@param args text_field_args
---@return graphics_element element, element_id id, function censor_ctl
local function text_field(args)
args.height = 1
args.can_focus = true
-- create new graphics element base object
local e = element.new(args)
-- set initial value
e.value = args.value or ""
-- make an interactive field manager
local ifield = core.new_ifield(e, args.max_len or e.frame.w, args.fg_bg, args.dis_fg_bg)
ifield.censor(args.censor)
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
-- only handle if on an increment or decrement arrow
if e.enabled and e.in_frame_bounds(event.current.x, event.current.y) then
if core.events.was_clicked(event.type) then
e.take_focus()
if event.type == MOUSE_CLICK.UP then
ifield.move_cursor(event.current.x)
end
elseif event.type == MOUSE_CLICK.DOUBLE_CLICK then
ifield.select_all()
end
end
end
-- handle keyboard interaction
---@param event key_interaction key event
function e.handle_key(event)
if event.type == KEY_CLICK.CHAR then
ifield.try_insert_char(event.name)
elseif event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
if (event.key == keys.backspace or event.key == keys.delete) then
ifield.backspace()
elseif event.key == keys.left then
ifield.nav_left()
elseif event.key == keys.right then
ifield.nav_right()
elseif event.key == keys.a and event.ctrl then
ifield.select_all()
elseif event.key == keys.home or event.key == keys.up then
ifield.nav_start()
elseif event.key == keys["end"] or event.key == keys.down then
ifield.nav_end()
end
end
end
-- set the value
---@param val string string to set
function e.set_value(val)
ifield.set_value(val)
end
-- replace text with pasted text
---@param text string string to set
function e.handle_paste(text)
ifield.set_value(text)
end
-- handle focus, enable, and redraw with show()
e.on_focused = ifield.show
e.on_unfocused = ifield.show
e.on_enabled = ifield.show
e.on_disabled = ifield.show
e.redraw = ifield.show
-- initial draw
e.redraw()
local elem, id = e.complete()
return elem, id, ifield.censor
end
return text_field

View File

@@ -16,21 +16,22 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new alarm indicator light -- new alarm indicator light
---@nodiscard ---@nodiscard
---@param args alarm_indicator_light ---@param args alarm_indicator_light
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function alarm_indicator_light(args) local function alarm_indicator_light(args)
assert(type(args.label) == "string", "graphics.elements.indicators.alight: label is a required field") element.assert(type(args.label) == "string", "label is a required field")
assert(type(args.c1) == "number", "graphics.elements.indicators.alight: c1 is a required field") element.assert(type(args.c1) == "number", "c1 is a required field")
assert(type(args.c2) == "number", "graphics.elements.indicators.alight: c2 is a required field") element.assert(type(args.c2) == "number", "c2 is a required field")
assert(type(args.c3) == "number", "graphics.elements.indicators.alight: c3 is a required field") element.assert(type(args.c3) == "number", "c3 is a required field")
if args.flash then if args.flash then
assert(util.is_int(args.period), "graphics.elements.indicators.alight: period is a required field if flash is enabled") element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
end end
-- single line -- single line
@@ -50,19 +51,21 @@ local function alarm_indicator_light(args)
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
e.value = 1
-- called by flasher when enabled -- called by flasher when enabled
local function flash_callback() local function flash_callback()
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
if flash_on then if flash_on then
if e.value == 2 then if e.value == 2 then
e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
end end
else else
if e.value == 3 then if e.value == 3 then
e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
else else
e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
end end
end end
@@ -75,7 +78,7 @@ local function alarm_indicator_light(args)
local was_off = e.value ~= 2 local was_off = e.value ~= 2
e.value = new_state e.value = new_state
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
if args.flash then if args.flash then
if was_off and (new_state == 2) then if was_off and (new_state == 2) then
@@ -86,17 +89,17 @@ local function alarm_indicator_light(args)
flasher.stop(flash_callback) flasher.stop(flash_callback)
if new_state == 3 then if new_state == 3 then
e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
else else
e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
end end
end end
elseif new_state == 2 then elseif new_state == 2 then
e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
elseif new_state == 3 then elseif new_state == 3 then
e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
else else
e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
end end
end end
@@ -104,11 +107,16 @@ local function alarm_indicator_light(args)
---@param val integer indicator state ---@param val integer indicator state
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- write label and initial indicator light -- draw label and indicator light
e.on_update(1) function e.redraw()
e.window.write(args.label) e.on_update(e.value)
e.w_write(args.label)
end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return alarm_indicator_light return alarm_indicator_light

View File

@@ -11,26 +11,28 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
-- new core map box -- new core map box
---@nodiscard ---@nodiscard
---@param args core_map_args ---@param args core_map_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function core_map(args) local function core_map(args)
assert(util.is_int(args.reactor_l), "graphics.elements.indicators.coremap: reactor_l is a required field") element.assert(util.is_int(args.reactor_l), "reactor_l is a required field")
assert(util.is_int(args.reactor_w), "graphics.elements.indicators.coremap: reactor_w is a required field") element.assert(util.is_int(args.reactor_w), "reactor_w is a required field")
-- require max dimensions -- require max dimensions
args.width = 18 args.width = 18
args.height = 18 args.height = 18
-- inherit only foreground color -- inherit only foreground color
args.fg_bg = core.graphics.cpair(args.parent.get_fg_bg().fgd, colors.gray) args.fg_bg = core.cpair(args.parent.get_fg_bg().fgd, colors.gray)
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
e.value = 0
local alternator = true local alternator = true
local core_l = args.reactor_l - 2 local core_l = args.reactor_l - 2
@@ -47,25 +49,25 @@ local function core_map(args)
-- create coordinate grid and frame -- create coordinate grid and frame
local function draw_frame() local function draw_frame()
e.window.setTextColor(colors.white) e.w_set_fgd(colors.white)
for x = 0, (inner_width - 1) do for x = 0, (inner_width - 1) do
e.window.setCursorPos(x + start_x, 1) e.w_set_cur(x + start_x, 1)
e.window.write(util.sprintf("%X", x)) e.w_write(util.sprintf("%X", x))
end end
for y = 0, (inner_height - 1) do for y = 0, (inner_height - 1) do
e.window.setCursorPos(1, y + start_y) e.w_set_cur(1, y + start_y)
e.window.write(util.sprintf("%X", y)) e.w_write(util.sprintf("%X", y))
end end
-- even out bottom edge -- even out bottom edge
e.window.setTextColor(e.fg_bg.bkg) e.w_set_fgd(e.fg_bg.bkg)
e.window.setBackgroundColor(args.parent.get_fg_bg().bkg) e.w_set_bkg(args.parent.get_fg_bg().bkg)
e.window.setCursorPos(1, e.frame.h) e.w_set_cur(1, e.frame.h)
e.window.write(util.strrep("\x8f", e.frame.w)) e.w_write(string.rep("\x8f", e.frame.w))
e.window.setTextColor(e.fg_bg.fgd) e.w_set_fgd(e.fg_bg.fgd)
e.window.setBackgroundColor(e.fg_bg.bkg) e.w_set_bkg(e.fg_bg.bkg)
end end
-- draw the core -- draw the core
@@ -73,7 +75,7 @@ local function core_map(args)
local function draw_core(t) local function draw_core(t)
local i = 1 local i = 1
local back_c = "F" local back_c = "F"
local text_c = "8" local text_c ---@type string
-- determine fuel assembly coloring -- determine fuel assembly coloring
if t <= 300 then if t <= 300 then
@@ -102,13 +104,13 @@ local function core_map(args)
-- draw pattern -- draw pattern
for y = start_y, inner_height + (start_y - 1) do for y = start_y, inner_height + (start_y - 1) do
e.window.setCursorPos(start_x, y) e.w_set_cur(start_x, y)
for _ = 1, inner_width do for _ = 1, inner_width do
if alternator then if alternator then
i = i + 1 i = i + 1
e.window.blit("\x07", text_c, back_c) e.w_blit("\x07", text_c, back_c)
else else
e.window.blit("\x07", "7", "8") e.w_blit("\x07", "7", "8")
end end
alternator = not alternator alternator = not alternator
@@ -157,13 +159,16 @@ local function core_map(args)
e.on_update(e.value) e.on_update(e.value)
end end
-- initial (one-time except for resize()) frame draw -- redraw both frame and core
draw_frame() function e.redraw()
draw_frame()
draw_core(e.value)
end
-- initial draw -- initial draw
e.on_update(0) e.redraw()
return e.get() return e.complete()
end end
return core_map return core_map

View File

@@ -14,37 +14,31 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width integer length ---@field width integer length
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new data indicator -- new data indicator
---@nodiscard ---@nodiscard
---@param args data_indicator_args ---@param args data_indicator_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function data(args) local function data(args)
assert(type(args.label) == "string", "graphics.elements.indicators.data: label is a required field") element.assert(type(args.label) == "string", "label is a required field")
assert(type(args.format) == "string", "graphics.elements.indicators.data: format is a required field") element.assert(type(args.format) == "string", "format is a required field")
assert(args.value ~= nil, "graphics.elements.indicators.data: value is a required field") element.assert(args.value ~= nil, "value is a required field")
assert(util.is_int(args.width), "graphics.elements.indicators.data: width is a required field") element.assert(util.is_int(args.width), "width is a required field")
-- single line
args.height = 1 args.height = 1
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- label color e.value = args.value
if args.lu_colors ~= nil then
e.window.setTextColor(args.lu_colors.color_a)
end
-- write label local value_color = e.fg_bg.fgd
e.window.setCursorPos(1, 1) local label_len = string.len(args.label)
e.window.write(args.label) local data_start = 1
local label_len = string.len(args.label)
local data_start = 1
local clear_width = args.width local clear_width = args.width
if label_len > 0 then if label_len > 0 then
@@ -58,25 +52,25 @@ local function data(args)
e.value = value e.value = value
-- clear old data and label -- clear old data and label
e.window.setCursorPos(data_start, 1) e.w_set_cur(data_start, 1)
e.window.write(util.spaces(clear_width)) e.w_write(util.spaces(clear_width))
-- write data -- write data
local data_str = util.sprintf(args.format, value) local data_str = util.sprintf(args.format, value)
e.window.setCursorPos(data_start, 1) e.w_set_cur(data_start, 1)
e.window.setTextColor(e.fg_bg.fgd) e.w_set_fgd(value_color)
if args.commas then if args.commas then
e.window.write(util.comma_format(data_str)) e.w_write(util.comma_format(data_str))
else else
e.window.write(data_str) e.w_write(data_str)
end end
-- write label -- write label
if args.unit ~= nil then if args.unit ~= nil then
if args.lu_colors ~= nil then if args.lu_colors ~= nil then
e.window.setTextColor(args.lu_colors.color_b) e.w_set_fgd(args.lu_colors.color_b)
end end
e.window.write(" " .. args.unit) e.w_write(" " .. args.unit)
end end
end end
@@ -84,10 +78,26 @@ local function data(args)
---@param val any new value ---@param val any new value
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- initial value draw -- change the foreground color of the value, or all text if no label/unit colors provided
e.on_update(args.value) ---@param c color
function e.recolor(c)
value_color = c
e.on_update(e.value)
end
return e.get() -- element redraw
function e.redraw()
if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
e.w_set_cur(1, 1)
e.w_write(args.label)
e.on_update(e.value)
end
-- initial draw
e.redraw()
return e.complete()
end end
return data return data

View File

@@ -10,27 +10,29 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new horizontal bar -- new horizontal bar
---@nodiscard ---@nodiscard
---@param args hbar_args ---@param args hbar_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function hbar(args) local function hbar(args)
-- properties/state
local last_num_bars = -1
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
e.value = 0.0
-- bar width is width - 5 characters for " 100%" if showing percent -- bar width is width - 5 characters for " 100%" if showing percent
local bar_width = util.trinary(args.show_percent, e.frame.w - 5, e.frame.w) local bar_width = util.trinary(args.show_percent, e.frame.w - 5, e.frame.w)
assert(bar_width > 0, "graphics.elements.indicators.hbar: too small for bar") element.assert(bar_width > 0, "too small for bar")
local last_num_bars = -1
-- determine bar colors -- determine bar colors
local bar_bkg = e.fg_bg.blit_bkg local bar_bkg = e.fg_bg.blit_bkg
@@ -86,16 +88,16 @@ local function hbar(args)
-- draw bar -- draw bar
for y = 1, e.frame.h do for y = 1, e.frame.h do
e.window.setCursorPos(1, y) e.w_set_cur(1, y)
-- intentionally swapped fgd/bkg since we use spaces as fill, but they are the opposite -- intentionally swapped fgd/bkg since we use spaces as fill, but they are the opposite
e.window.blit(spaces, bkg, fgd) e.w_blit(spaces, bkg, fgd)
end end
end end
-- update percentage -- update percentage
if args.show_percent then if args.show_percent then
e.window.setCursorPos(bar_width + 2, math.max(1, math.ceil(e.frame.h / 2))) e.w_set_cur(bar_width + 2, math.max(1, math.ceil(e.frame.h / 2)))
e.window.write(util.sprintf("%3.0f%%", fraction * 100)) e.w_write(util.sprintf("%3.0f%%", fraction * 100))
end end
end end
@@ -104,22 +106,23 @@ local function hbar(args)
function e.recolor(bar_fg_bg) function e.recolor(bar_fg_bg)
bar_bkg = bar_fg_bg.blit_bkg bar_bkg = bar_fg_bg.blit_bkg
bar_fgd = bar_fg_bg.blit_fgd bar_fgd = bar_fg_bg.blit_fgd
e.redraw()
-- re-draw
last_num_bars = 0
if type(e.value) == "number" then
e.on_update(e.value)
end
end end
-- set the percentage value -- set the percentage value
---@param val number 0.0 to 1.0 ---@param val number 0.0 to 1.0
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- initialize to 0 -- element redraw
e.on_update(0) function e.redraw()
last_num_bars = -1
e.on_update(e.value)
end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return hbar return hbar

View File

@@ -1,7 +1,5 @@
-- Icon Indicator Graphics Element -- Icon Indicator Graphics Element
local util = require("scada-common.util")
local element = require("graphics.element") local element = require("graphics.element")
---@class icon_sym_color ---@class icon_sym_color
@@ -11,31 +9,32 @@ local element = require("graphics.element")
---@class icon_indicator_args ---@class icon_indicator_args
---@field label string indicator label ---@field label string indicator label
---@field states table state color and symbol table ---@field states table state color and symbol table
---@field value? integer default state, defaults to 1 ---@field value? integer|boolean default state, defaults to 1 (true = 2, false = 1)
---@field min_label_width? integer label length if omitted ---@field min_label_width? integer label length if omitted
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new icon indicator -- new icon indicator
---@nodiscard ---@nodiscard
---@param args icon_indicator_args ---@param args icon_indicator_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function icon(args) local function icon(args)
assert(type(args.label) == "string", "graphics.elements.indicators.icon: label is a required field") element.assert(type(args.label) == "string", "label is a required field")
assert(type(args.states) == "table", "graphics.elements.indicators.icon: states is a required field") element.assert(type(args.states) == "table", "states is a required field")
-- single line
args.height = 1 args.height = 1
-- determine width
args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 4 args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 4
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
e.value = args.value or 1
if e.value == true then e.value = 2 end
-- state blit strings -- state blit strings
local state_blit_cmds = {} local state_blit_cmds = {}
for i = 1, #args.states do for i = 1, #args.states do
@@ -43,32 +42,39 @@ local function icon(args)
table.insert(state_blit_cmds, { table.insert(state_blit_cmds, {
text = " " .. sym_color.symbol .. " ", text = " " .. sym_color.symbol .. " ",
fgd = util.strrep(sym_color.color.blit_fgd, 3), fgd = string.rep(sym_color.color.blit_fgd, 3),
bkg = util.strrep(sym_color.color.blit_bkg, 3) bkg = string.rep(sym_color.color.blit_bkg, 3)
}) })
end end
-- write label and initial indicator light
e.window.setCursorPos(5, 1)
e.window.write(args.label)
-- on state change -- on state change
---@param new_state integer indicator state ---@param new_state integer|boolean indicator state
function e.on_update(new_state) function e.on_update(new_state)
new_state = new_state or 1
if new_state == true then new_state = 2 end
local blit_cmd = state_blit_cmds[new_state] local blit_cmd = state_blit_cmds[new_state]
e.value = new_state e.value = new_state
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
e.window.blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg) e.w_blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
end end
-- set indicator state -- set indicator state
---@param val integer indicator state ---@param val integer|boolean indicator state
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- initial icon draw -- element redraw
e.on_update(args.value or 1) function e.redraw()
e.w_set_cur(5, 1)
e.w_write(args.label)
return e.get() e.on_update(e.value)
end
-- initial draw
e.redraw()
return e.complete()
end end
return icon return icon

View File

@@ -0,0 +1,104 @@
-- Indicator "LED" Graphics Element
local util = require("scada-common.util")
local element = require("graphics.element")
local flasher = require("graphics.flasher")
---@class indicator_led_args
---@field label string indicator label
---@field colors cpair on/off colors (a/b respectively)
---@field min_label_width? integer label length if omitted
---@field flash? boolean whether to flash on true rather than stay on
---@field period? PERIOD flash period
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new indicator LED
---@nodiscard
---@param args indicator_led_args
---@return graphics_element element, element_id id
local function indicator_led(args)
element.assert(type(args.label) == "string", "label is a required field")
element.assert(type(args.colors) == "table", "colors is a required field")
if args.flash then
element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
end
args.height = 1
args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
local flash_on = true
-- create new graphics element base object
local e = element.new(args)
e.value = false
-- called by flasher when enabled
local function flash_callback()
e.w_set_cur(1, 1)
if flash_on then
e.w_blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
else
e.w_blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
end
flash_on = not flash_on
end
-- enable light or start flashing
local function enable()
if args.flash then
flash_on = true
flasher.start(flash_callback, args.period)
else
e.w_set_cur(1, 1)
e.w_blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
end
end
-- disable light or stop flashing
local function disable()
if args.flash then
flash_on = false
flasher.stop(flash_callback)
end
e.w_set_cur(1, 1)
e.w_blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
end
-- on state change
---@param new_state boolean indicator state
function e.on_update(new_state)
e.value = new_state
if new_state then enable() else disable() end
end
-- set indicator state
---@param val boolean indicator state
function e.set_value(val) e.on_update(val) end
-- draw label and indicator light
function e.redraw()
e.on_update(e.value)
if string.len(args.label) > 0 then
e.w_set_cur(3, 1)
e.w_write(args.label)
end
end
-- initial draw
e.redraw()
return e.complete()
end
return indicator_led

View File

@@ -0,0 +1,113 @@
-- Indicator LED Pair Graphics Element (two LEDs provide: off, color_a, color_b)
local util = require("scada-common.util")
local element = require("graphics.element")
local flasher = require("graphics.flasher")
---@class indicator_led_pair_args
---@field label string indicator label
---@field off color color for off
---@field c1 color color for #1 on
---@field c2 color color for #2 on
---@field min_label_width? integer label length if omitted
---@field flash? boolean whether to flash when on rather than stay on
---@field period? PERIOD flash period
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new dual LED indicator light
---@nodiscard
---@param args indicator_led_pair_args
---@return graphics_element element, element_id id
local function indicator_led_pair(args)
element.assert(type(args.label) == "string", "label is a required field")
element.assert(type(args.off) == "number", "off is a required field")
element.assert(type(args.c1) == "number", "c1 is a required field")
element.assert(type(args.c2) == "number", "c2 is a required field")
if args.flash then
element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
end
args.height = 1
args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
local flash_on = true
local co = colors.toBlit(args.off)
local c1 = colors.toBlit(args.c1)
local c2 = colors.toBlit(args.c2)
-- create new graphics element base object
local e = element.new(args)
e.value = 1
-- called by flasher when enabled
local function flash_callback()
e.w_set_cur(1, 1)
if flash_on then
if e.value == 2 then
e.w_blit("\x8c", c1, e.fg_bg.blit_bkg)
elseif e.value == 3 then
e.w_blit("\x8c", c2, e.fg_bg.blit_bkg)
end
else
e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
end
flash_on = not flash_on
end
-- on state change
---@param new_state integer indicator state
function e.on_update(new_state)
local was_off = e.value <= 1
e.value = new_state
e.w_set_cur(1, 1)
if args.flash then
if was_off and (new_state > 1) then
flash_on = true
flasher.start(flash_callback, args.period)
elseif new_state <= 1 then
flash_on = false
flasher.stop(flash_callback)
e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
end
elseif new_state == 2 then
e.w_blit("\x8c", c1, e.fg_bg.blit_bkg)
elseif new_state == 3 then
e.w_blit("\x8c", c2, e.fg_bg.blit_bkg)
else
e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
end
end
-- set indicator state
---@param val integer indicator state
function e.set_value(val) e.on_update(val) end
-- draw label and indicator light
function e.redraw()
e.on_update(e.value)
if string.len(args.label) > 0 then
e.w_set_cur(3, 1)
e.w_write(args.label)
end
end
-- initial draw
e.redraw()
return e.complete()
end
return indicator_led_pair

View File

@@ -0,0 +1,61 @@
-- Indicator RGB LED Graphics Element
local element = require("graphics.element")
---@class indicator_led_rgb_args
---@field label string indicator label
---@field colors table colors to use
---@field min_label_width? integer label length if omitted
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new RGB LED indicator light
---@nodiscard
---@param args indicator_led_rgb_args
---@return graphics_element element, element_id id
local function indicator_led_rgb(args)
element.assert(type(args.label) == "string", "label is a required field")
element.assert(type(args.colors) == "table", "colors is a required field")
args.height = 1
args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
-- create new graphics element base object
local e = element.new(args)
e.value = 1
-- on state change
---@param new_state integer indicator state
function e.on_update(new_state)
e.value = new_state
e.w_set_cur(1, 1)
if type(args.colors[new_state]) == "number" then
e.w_blit("\x8c", colors.toBlit(args.colors[new_state]), e.fg_bg.blit_bkg)
end
end
-- set indicator state
---@param val integer indicator state
function e.set_value(val) e.on_update(val) end
-- draw label and indicator light
function e.redraw()
e.on_update(e.value)
if string.len(args.label) > 0 then
e.w_set_cur(3, 1)
e.w_write(args.label)
end
end
-- initial draw
e.redraw()
return e.complete()
end
return indicator_led_rgb

View File

@@ -14,41 +14,40 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new indicator light -- new indicator light
---@nodiscard ---@nodiscard
---@param args indicator_light_args ---@param args indicator_light_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function indicator_light(args) local function indicator_light(args)
assert(type(args.label) == "string", "graphics.elements.indicators.light: label is a required field") element.assert(type(args.label) == "string", "label is a required field")
assert(type(args.colors) == "table", "graphics.elements.indicators.light: colors is a required field") element.assert(type(args.colors) == "table", "colors is a required field")
if args.flash then if args.flash then
assert(util.is_int(args.period), "graphics.elements.indicators.light: period is a required field if flash is enabled") element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
end end
-- single line
args.height = 1 args.height = 1
-- determine width
args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2 args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2
-- flasher state
local flash_on = true local flash_on = true
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
e.value = false
-- called by flasher when enabled -- called by flasher when enabled
local function flash_callback() local function flash_callback()
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
if flash_on then if flash_on then
e.window.blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
else else
e.window.blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
end end
flash_on = not flash_on flash_on = not flash_on
@@ -60,8 +59,8 @@ local function indicator_light(args)
flash_on = true flash_on = true
flasher.start(flash_callback, args.period) flasher.start(flash_callback, args.period)
else else
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
e.window.blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
end end
end end
@@ -72,8 +71,8 @@ local function indicator_light(args)
flasher.stop(flash_callback) flasher.stop(flash_callback)
end end
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
e.window.blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
end end
-- on state change -- on state change
@@ -87,12 +86,17 @@ local function indicator_light(args)
---@param val boolean indicator state ---@param val boolean indicator state
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- write label and initial indicator light -- draw label and indicator light
e.on_update(false) function e.redraw()
e.window.setCursorPos(3, 1) e.on_update(false)
e.window.write(args.label) e.w_set_cur(3, 1)
e.w_write(args.label)
end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return indicator_light return indicator_light

View File

@@ -6,80 +6,86 @@ local element = require("graphics.element")
---@class power_indicator_args ---@class power_indicator_args
---@field label string indicator label ---@field label string indicator label
---@field unit string energy unit
---@field format string power format override (lua string format) ---@field format string power format override (lua string format)
---@field rate boolean? whether to append /t to the end (power per tick) ---@field rate boolean? whether to append /t to the end (power per tick)
---@field lu_colors? cpair label foreground color (a), unit foreground color (b) ---@field lu_colors? cpair label foreground color (a), unit foreground color (b)
---@field value any default value ---@field value number default value
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width integer length ---@field width integer length
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new power indicator -- new power indicator
---@nodiscard ---@nodiscard
---@param args power_indicator_args ---@param args power_indicator_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function power(args) local function power(args)
assert(args.value ~= nil, "graphics.elements.indicators.power: value is a required field") element.assert(type(args.label) == "string", "label is a required field")
assert(util.is_int(args.width), "graphics.elements.indicators.power: width is a required field") element.assert(type(args.unit) == "string", "unit is a required field")
element.assert(type(args.value) == "number", "value is a required field")
element.assert(util.is_int(args.width), "width is a required field")
-- single line
args.height = 1 args.height = 1
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- label color e.value = args.value
if args.lu_colors ~= nil then
e.window.setTextColor(args.lu_colors.color_a)
end
-- write label local data_start = 0
e.window.setCursorPos(1, 1)
e.window.write(args.label)
local data_start = string.len(args.label) + 2
if string.len(args.label) == 0 then data_start = 1 end
-- on state change -- on state change
---@param value any new value ---@param value any new value
function e.on_update(value) function e.on_update(value)
e.value = value e.value = value
local data_str, unit = util.power_format(value, false, args.format) local data_str, unit = util.power_format(value, args.unit, false, args.format)
-- write data -- write data
e.window.setCursorPos(data_start, 1) e.w_set_cur(data_start, 1)
e.window.setTextColor(e.fg_bg.fgd) e.w_set_fgd(e.fg_bg.fgd)
e.window.write(util.comma_format(data_str)) e.w_write(util.comma_format(data_str))
-- write unit -- write unit
if args.lu_colors ~= nil then if args.lu_colors ~= nil then
e.window.setTextColor(args.lu_colors.color_b) e.w_set_fgd(args.lu_colors.color_b)
end end
-- append per tick if rate is set -- append per tick if rate is set
-- add space to FE so we don't end up with FEE (after having kFE for example)
if args.rate == true then if args.rate == true then
unit = unit .. "/t" unit = unit .. "/t"
if unit == "FE/t" then unit = "FE/t " end
else
if unit == "FE" then unit = "FE " end
end end
e.window.write(" " .. unit) -- add space to unit so we don't end up with something like FEE after having kFE
unit = util.strminw(unit, 5)
e.w_write(" " .. unit)
end end
-- set the value -- set the value
---@param val any new value ---@param val any new value
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- initial value draw -- element redraw
e.on_update(args.value) function e.redraw()
if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
e.w_set_cur(1, 1)
e.w_write(args.label)
return e.get() data_start = string.len(args.label) + 2
if string.len(args.label) == 0 then data_start = 1 end
e.on_update(e.value)
end
-- initial draw
e.redraw()
return e.complete()
end end
return power return power

View File

@@ -10,37 +10,30 @@ local element = require("graphics.element")
---@field format string data format (lua string format) ---@field format string data format (lua string format)
---@field commas? boolean whether to use commas if a number is given (default to false) ---@field commas? boolean whether to use commas if a number is given (default to false)
---@field lu_colors? cpair label foreground color (a), unit foreground color (b) ---@field lu_colors? cpair label foreground color (a), unit foreground color (b)
---@field value any default value ---@field value? radiation_reading default value
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width integer length ---@field width integer length
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new radiation indicator -- new radiation indicator
---@nodiscard ---@nodiscard
---@param args rad_indicator_args ---@param args rad_indicator_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function rad(args) local function rad(args)
assert(type(args.label) == "string", "graphics.elements.indicators.rad: label is a required field") element.assert(type(args.label) == "string", "label is a required field")
assert(type(args.format) == "string", "graphics.elements.indicators.rad: format is a required field") element.assert(type(args.format) == "string", "format is a required field")
assert(util.is_int(args.width), "graphics.elements.indicators.rad: width is a required field") element.assert(util.is_int(args.width), "width is a required field")
-- single line
args.height = 1 args.height = 1
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- label color e.value = args.value or types.new_zero_radiation_reading()
if args.lu_colors ~= nil then
e.window.setTextColor(args.lu_colors.color_a)
end
-- write label
e.window.setCursorPos(1, 1)
e.window.write(args.label)
local label_len = string.len(args.label) local label_len = string.len(args.label)
local data_start = 1 local data_start = 1
@@ -57,34 +50,43 @@ local function rad(args)
e.value = value.radiation e.value = value.radiation
-- clear old data and label -- clear old data and label
e.window.setCursorPos(data_start, 1) e.w_set_cur(data_start, 1)
e.window.write(util.spaces(clear_width)) e.w_write(util.spaces(clear_width))
-- write data -- write data
local data_str = util.sprintf(args.format, e.value) local data_str = util.sprintf(args.format, e.value)
e.window.setCursorPos(data_start, 1) e.w_set_cur(data_start, 1)
e.window.setTextColor(e.fg_bg.fgd) e.w_set_fgd(e.fg_bg.fgd)
if args.commas then if args.commas then
e.window.write(util.comma_format(data_str)) e.w_write(util.comma_format(data_str))
else else
e.window.write(data_str) e.w_write(data_str)
end end
-- write unit -- write unit
if args.lu_colors ~= nil then if args.lu_colors ~= nil then
e.window.setTextColor(args.lu_colors.color_b) e.w_set_fgd(args.lu_colors.color_b)
end end
e.window.write(" " .. value.unit) e.w_write(" " .. value.unit)
end end
-- set the value -- set the value
---@param val any new value ---@param val any new value
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- initial value draw -- element redraw
e.on_update(types.new_zero_radiation_reading()) function e.redraw()
if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
e.w_set_cur(1, 1)
e.w_write(args.label)
return e.get() e.on_update(e.value)
end
-- initial draw
e.redraw()
return e.complete()
end end
return rad return rad

View File

@@ -0,0 +1,85 @@
-- Signal Bars Graphics Element
local util = require("scada-common.util")
local element = require("graphics.element")
---@class signal_bar_args
---@field compact? boolean true to use a single character (works better against edges that extend out colors)
---@field colors_low_med? cpair color a for low signal quality, color b for medium signal quality
---@field disconnect_color? color color for the 'x' on disconnect
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors (foreground is used for high signal quality)
---@field hidden? boolean true to hide on initial draw
-- new signal bar
---@nodiscard
---@param args signal_bar_args
---@return graphics_element element, element_id id
local function signal_bar(args)
args.height = 1
args.width = util.trinary(args.compact, 1, 2)
-- create new graphics element base object
local e = element.new(args)
e.value = 0
local blit_bkg = args.fg_bg.blit_bkg
local blit_0, blit_1, blit_2, blit_3 = args.fg_bg.blit_fgd, args.fg_bg.blit_fgd, args.fg_bg.blit_fgd, args.fg_bg.blit_fgd
if type(args.colors_low_med) == "table" then
blit_1 = args.colors_low_med.blit_a or blit_1
blit_2 = args.colors_low_med.blit_b or blit_2
end
if util.is_int(args.disconnect_color) then blit_0 = colors.toBlit(args.disconnect_color) end
-- on state change (0 = offline, 1 through 3 = low to high signal)
---@param new_state integer signal state
function e.on_update(new_state)
e.value = new_state
e.redraw()
end
-- set signal state (0 = offline, 1 through 3 = low to high signal)
---@param val integer signal state
function e.set_value(val) e.on_update(val) end
-- draw label and signal bar
function e.redraw()
e.w_set_cur(1, 1)
if args.compact then
if e.value == 1 then
e.w_blit("\x90", blit_1, blit_bkg)
elseif e.value == 2 then
e.w_blit("\x94", blit_2, blit_bkg)
elseif e.value == 3 then
e.w_blit("\x95", blit_3, blit_bkg)
else
e.w_blit("x", blit_0, blit_bkg)
end
else
if e.value == 1 then
e.w_blit("\x9f ", blit_bkg .. blit_bkg, blit_1 .. blit_bkg)
elseif e.value == 2 then
e.w_blit("\x9f\x94", blit_bkg .. blit_2, blit_2 .. blit_bkg)
elseif e.value == 3 then
e.w_blit("\x9f\x81", blit_bkg .. blit_bkg, blit_3 .. blit_3)
else
e.w_blit(" x", blit_0 .. blit_0, blit_bkg .. blit_bkg)
end
end
end
-- initial draw
e.redraw()
return e.complete()
end
return signal_bar

View File

@@ -15,25 +15,22 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer 1 if omitted, must be an odd number ---@field height? integer 1 if omitted, must be an odd number
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new state indicator -- new state indicator
---@nodiscard ---@nodiscard
---@param args state_indicator_args ---@param args state_indicator_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function state_indicator(args) local function state_indicator(args)
assert(type(args.states) == "table", "graphics.elements.indicators.state: states is a required field") element.assert(type(args.states) == "table", "states is a required field")
-- determine height
if util.is_int(args.height) then if util.is_int(args.height) then
assert(args.height % 2 == 1, "graphics.elements.indicators.state: height should be an odd number") element.assert(args.height % 2 == 1, "height should be an odd number")
else else args.height = 1 end
args.height = 1
end
-- initial guess at width
args.width = args.min_width or 1 args.width = args.min_width or 1
-- state blit strings -- state blit strings
@@ -41,7 +38,6 @@ local function state_indicator(args)
for i = 1, #args.states do for i = 1, #args.states do
local state_def = args.states[i] ---@type state_text_color local state_def = args.states[i] ---@type state_text_color
-- re-determine width
if string.len(state_def.text) > args.width then if string.len(state_def.text) > args.width then
args.width = string.len(state_def.text) args.width = string.len(state_def.text)
end end
@@ -50,21 +46,28 @@ local function state_indicator(args)
table.insert(state_blit_cmds, { table.insert(state_blit_cmds, {
text = text, text = text,
fgd = util.strrep(state_def.color.blit_fgd, string.len(text)), fgd = string.rep(state_def.color.blit_fgd, string.len(text)),
bkg = util.strrep(state_def.color.blit_bkg, string.len(text)) bkg = string.rep(state_def.color.blit_bkg, string.len(text))
}) })
end end
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
e.value = args.value or 1
-- element redraw
function e.redraw()
local blit_cmd = state_blit_cmds[e.value]
e.w_set_cur(1, 1)
e.w_blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
end
-- on state change -- on state change
---@param new_state integer indicator state ---@param new_state integer indicator state
function e.on_update(new_state) function e.on_update(new_state)
local blit_cmd = state_blit_cmds[new_state]
e.value = new_state e.value = new_state
e.window.setCursorPos(1, 1) e.redraw()
e.window.blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
end end
-- set indicator state -- set indicator state
@@ -72,9 +75,9 @@ local function state_indicator(args)
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- initial draw -- initial draw
e.on_update(args.value or 1) e.redraw()
return e.get() return e.complete()
end end
return state_indicator return state_indicator

View File

@@ -16,55 +16,50 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new tri-state indicator light -- new tri-state indicator light
---@nodiscard ---@nodiscard
---@param args tristate_indicator_light_args ---@param args tristate_indicator_light_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function tristate_indicator_light(args) local function tristate_indicator_light(args)
assert(type(args.label) == "string", "graphics.elements.indicators.trilight: label is a required field") element.assert(type(args.label) == "string", "label is a required field")
assert(type(args.c1) == "number", "graphics.elements.indicators.trilight: c1 is a required field") element.assert(type(args.c1) == "number", "c1 is a required field")
assert(type(args.c2) == "number", "graphics.elements.indicators.trilight: c2 is a required field") element.assert(type(args.c2) == "number", "c2 is a required field")
assert(type(args.c3) == "number", "graphics.elements.indicators.trilight: c3 is a required field") element.assert(type(args.c3) == "number", "c3 is a required field")
if args.flash then if args.flash then
assert(util.is_int(args.period), "graphics.elements.indicators.trilight: period is a required field if flash is enabled") element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
end end
-- single line
args.height = 1 args.height = 1
-- determine width
args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2 args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2
-- flasher state
local flash_on = true
-- blit translations
local c1 = colors.toBlit(args.c1)
local c2 = colors.toBlit(args.c2)
local c3 = colors.toBlit(args.c3)
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- init value for initial check in on_update
e.value = 1 e.value = 1
local flash_on = true
local c1 = colors.toBlit(args.c1)
local c2 = colors.toBlit(args.c2)
local c3 = colors.toBlit(args.c3)
-- called by flasher when enabled -- called by flasher when enabled
local function flash_callback() local function flash_callback()
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
if flash_on then if flash_on then
if e.value == 2 then if e.value == 2 then
e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
elseif e.value == 3 then elseif e.value == 3 then
e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
end end
else else
e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
end end
flash_on = not flash_on flash_on = not flash_on
@@ -76,7 +71,7 @@ local function tristate_indicator_light(args)
local was_off = e.value <= 1 local was_off = e.value <= 1
e.value = new_state e.value = new_state
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
if args.flash then if args.flash then
if was_off and (new_state > 1) then if was_off and (new_state > 1) then
@@ -86,14 +81,14 @@ local function tristate_indicator_light(args)
flash_on = false flash_on = false
flasher.stop(flash_callback) flasher.stop(flash_callback)
e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
end end
elseif new_state == 2 then elseif new_state == 2 then
e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
elseif new_state == 3 then elseif new_state == 3 then
e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
else else
e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg) e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
end end
end end
@@ -101,11 +96,16 @@ local function tristate_indicator_light(args)
---@param val integer indicator state ---@param val integer indicator state
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
-- write label and initial indicator light -- draw light and label
e.on_update(1) function e.redraw()
e.window.write(args.label) e.on_update(1)
e.w_write(args.label)
end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return tristate_indicator_light return tristate_indicator_light

View File

@@ -8,29 +8,30 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new vertical bar -- new vertical bar
---@nodiscard ---@nodiscard
---@param args vbar_args ---@param args vbar_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function vbar(args) local function vbar(args)
-- properties/state
local last_num_bars = -1
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- blit strings e.value = 0.0
local fgd = util.strrep(e.fg_bg.blit_fgd, e.frame.w)
local bkg = util.strrep(e.fg_bg.blit_bkg, e.frame.w) local last_num_bars = -1
local fgd = string.rep(e.fg_bg.blit_fgd, e.frame.w)
local bkg = string.rep(e.fg_bg.blit_bkg, e.frame.w)
local spaces = util.spaces(e.frame.w) local spaces = util.spaces(e.frame.w)
local one_third = util.strrep("\x8f", e.frame.w) local one_third = string.rep("\x8f", e.frame.w)
local two_thirds = util.strrep("\x83", e.frame.w) local two_thirds = string.rep("\x83", e.frame.w)
-- handle data changes -- handle data changes
---@param fraction number 0.0 to 1.0 ---@param fraction number 0.0 to 1.0
@@ -51,55 +52,56 @@ local function vbar(args)
if num_bars ~= last_num_bars then if num_bars ~= last_num_bars then
last_num_bars = num_bars last_num_bars = num_bars
-- start bottom up
local y = e.frame.h local y = e.frame.h
e.w_set_cur(1, y)
-- start at base of vertical bar
e.window.setCursorPos(1, y)
-- fill percentage -- fill percentage
for _ = 1, num_bars / 3 do for _ = 1, num_bars / 3 do
e.window.blit(spaces, bkg, fgd) e.w_blit(spaces, bkg, fgd)
y = y - 1 y = y - 1
e.window.setCursorPos(1, y) e.w_set_cur(1, y)
end end
-- add fractional bar if needed -- add fractional bar if needed
if num_bars % 3 == 1 then if num_bars % 3 == 1 then
e.window.blit(one_third, bkg, fgd) e.w_blit(one_third, bkg, fgd)
y = y - 1 y = y - 1
elseif num_bars % 3 == 2 then elseif num_bars % 3 == 2 then
e.window.blit(two_thirds, bkg, fgd) e.w_blit(two_thirds, bkg, fgd)
y = y - 1 y = y - 1
end end
-- fill the rest blank -- fill the rest blank
while y > 0 do while y > 0 do
e.window.setCursorPos(1, y) e.w_set_cur(1, y)
e.window.blit(spaces, fgd, bkg) e.w_blit(spaces, fgd, bkg)
y = y - 1 y = y - 1
end end
end end
end end
-- change bar color
---@param fg_bg cpair new bar colors
function e.recolor(fg_bg)
fgd = util.strrep(fg_bg.blit_fgd, e.frame.w)
bkg = util.strrep(fg_bg.blit_bkg, e.frame.w)
-- re-draw
last_num_bars = 0
if type(e.value) == "number" then
e.on_update(e.value)
end
end
-- set the percentage value -- set the percentage value
---@param val number 0.0 to 1.0 ---@param val number 0.0 to 1.0
function e.set_value(val) e.on_update(val) end function e.set_value(val) e.on_update(val) end
return e.get() -- element redraw
function e.redraw()
last_num_bars = -1
e.on_update(e.value)
end
-- change bar color
---@param fg_bg cpair new bar colors
function e.recolor(fg_bg)
fgd = string.rep(fg_bg.blit_fgd, e.frame.w)
bkg = string.rep(fg_bg.blit_bkg, e.frame.w)
e.redraw()
end
-- initial draw
e.redraw()
return e.complete()
end end
return vbar return vbar

View File

@@ -0,0 +1,348 @@
-- Scroll-able List Box Display Graphics Element
-- local log = require("scada-common.log")
local tcd = require("scada-common.tcd")
local core = require("graphics.core")
local element = require("graphics.element")
local KEY_CLICK = core.events.KEY_CLICK
local MOUSE_CLICK = core.events.MOUSE_CLICK
---@class listbox_args
---@field scroll_height integer height of internal scrolling container (must fit all elements vertically tiled)
---@field item_pad? integer spacing (lines) between items in the list (default 0)
---@field nav_fg_bg? cpair foreground/background colors for scroll arrows and bar area
---@field nav_active? cpair active colors for bar held down or arrow held down
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted
---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
---@class listbox_item
---@field id string|integer element ID
---@field e graphics_element element
---@field y integer y position
---@field h integer element height
-- new listbox element
---@nodiscard
---@param args listbox_args
---@return graphics_element element, element_id id
local function listbox(args)
args.can_focus = true
-- create new graphics element base object
local e = element.new(args)
-- create content window for child elements
local scroll_frame = window.create(e.window, 1, 1, e.frame.w - 1, args.scroll_height, false)
e.content_window = scroll_frame
-- item list and scroll management
local list = {}
local item_pad = args.item_pad or 0
local scroll_offset = 0
local content_height = 0
local max_down_scroll = 0
-- bar control/tracking variables
local max_bar_height = e.frame.h - 2
local bar_height = 0 -- full height of bar
local bar_bounds = { 0, 0 } -- top and bottom of bar
local bar_is_scaled = false -- if the scrollbar doesn't have a 1:1 ratio with lines
local holding_bar = false -- bar is being held by mouse
local bar_grip_pos = 0 -- where the bar was gripped by mouse down
local mouse_last_y = 0 -- last reported y coordinate of drag
-- draw scroll bar arrows, optionally showing one of them as pressed
---@param pressed_arrow? 1|0|-1 arrow to show as pressed (1 = scroll up, 0 = neither, -1 = scroll down)
local function draw_arrows(pressed_arrow)
local nav_fg_bg = args.nav_fg_bg or e.fg_bg
local active_fg_bg = args.nav_active or nav_fg_bg
-- draw up/down arrows
if pressed_arrow == 1 then
e.w_set_fgd(active_fg_bg.fgd)
e.w_set_bkg(active_fg_bg.bkg)
e.w_set_cur(e.frame.w, 1)
e.w_write("\x1e")
e.w_set_fgd(nav_fg_bg.fgd)
e.w_set_bkg(nav_fg_bg.bkg)
e.w_set_cur(e.frame.w, e.frame.h)
e.w_write("\x1f")
elseif pressed_arrow == -1 then
e.w_set_fgd(nav_fg_bg.fgd)
e.w_set_bkg(nav_fg_bg.bkg)
e.w_set_cur(e.frame.w, 1)
e.w_write("\x1e")
e.w_set_fgd(active_fg_bg.fgd)
e.w_set_bkg(active_fg_bg.bkg)
e.w_set_cur(e.frame.w, e.frame.h)
e.w_write("\x1f")
else
e.w_set_fgd(nav_fg_bg.fgd)
e.w_set_bkg(nav_fg_bg.bkg)
e.w_set_cur(e.frame.w, 1)
e.w_write("\x1e")
e.w_set_cur(e.frame.w, e.frame.h)
e.w_write("\x1f")
end
e.w_set_fgd(e.fg_bg.fgd)
e.w_set_bkg(e.fg_bg.bkg)
end
-- render the scroll bar and re-cacluate height & bounds
local function draw_bar()
local offset = 2 + math.abs(scroll_offset)
bar_height = math.min(max_bar_height + max_down_scroll, max_bar_height)
if bar_height < 1 then
bar_is_scaled = true
-- can't do a 1:1 ratio
-- use minimum size bar with scaled offset
local scroll_progress = scroll_offset / max_down_scroll
offset = 2 + math.floor(scroll_progress * (max_bar_height - 1))
bar_height = 1
else
bar_is_scaled = false
end
bar_bounds = { offset, (bar_height + offset) - 1 }
for i = 2, e.frame.h - 1 do
if (i >= offset and i < (bar_height + offset)) and (bar_height ~= max_bar_height) then
if args.nav_fg_bg ~= nil then
e.w_set_bkg(args.nav_fg_bg.fgd)
else
e.w_set_bkg(e.fg_bg.fgd)
end
else
if args.nav_fg_bg ~= nil then
e.w_set_bkg(args.nav_fg_bg.bkg)
else
e.w_set_bkg(e.fg_bg.bkg)
end
end
e.w_set_cur(e.frame.w, i)
if e.is_focused() then e.w_write("\x7f") else e.w_write(" ") end
end
e.w_set_bkg(e.fg_bg.bkg)
end
-- update item y positions and move elements
local function update_positions()
local next_y = 1
scroll_frame.setVisible(false)
scroll_frame.setBackgroundColor(e.fg_bg.bkg)
scroll_frame.setTextColor(e.fg_bg.fgd)
scroll_frame.clear()
for i = 1, #list do
local item = list[i] ---@type listbox_item
item.y = next_y
next_y = next_y + item.h + item_pad
item.e.reposition(1, item.y)
item.e.show()
-- log.debug("iterated " .. item.e.get_id())
end
content_height = next_y
max_down_scroll = math.min(-1 * (content_height - (e.frame.h + 1 + item_pad)), 0)
if scroll_offset < max_down_scroll then scroll_offset = max_down_scroll end
scroll_frame.reposition(1, 1 + scroll_offset)
scroll_frame.setVisible(true)
-- shift mouse events
e.mouse_window_shift.y = scroll_offset
draw_bar()
end
-- determine where to scroll to based on a scrollbar being dragged without a 1:1 relationship
---@param direction -1|1 negative 1 to scroll up by one, positive 1 to scroll down by one
local function scaled_bar_scroll(direction)
local scroll_progress = scroll_offset / max_down_scroll
local bar_position = math.floor(scroll_progress * (max_bar_height - 1))
-- check what moving the scroll bar up or down would mean for the scroll progress
scroll_progress = (bar_position + direction) / (max_bar_height - 1)
return math.max(math.floor(scroll_progress * max_down_scroll), max_down_scroll)
end
-- scroll down the list
local function scroll_down(scaled)
if scroll_offset > max_down_scroll then
if scaled then
scroll_offset = scaled_bar_scroll(1)
else
scroll_offset = scroll_offset - 1
end
update_positions()
end
end
-- scroll up the list
local function scroll_up(scaled)
if scroll_offset < 0 then
if scaled then
scroll_offset = scaled_bar_scroll(-1)
else
scroll_offset = scroll_offset + 1
end
update_positions()
end
end
-- handle a child element having been added to the list
---@param id element_id element identifier
---@param child graphics_element child element
function e.on_added(id, child)
table.insert(list, { id = id, e = child, y = 0, h = child.get_height() })
-- log.debug("added child " .. id .. " into slot " .. #list)
update_positions()
end
-- handle a child element having been removed from the list
---@param id element_id element identifier
function e.on_removed(id)
for idx, elem in ipairs(list) do
if elem.id == id then
table.remove(list, idx)
-- log.debug("removed child " .. id .. " from slot " .. idx)
update_positions()
return
end
end
-- log.debug("failed to remove child " .. id)
end
-- handle focus
e.on_focused = draw_bar
e.on_unfocused = draw_bar
-- handle a child in the list being focused, make sure it is visible
function e.on_child_focused(child)
for i = 1, #list do
local item = list[i] ---@type listbox_item
if item.e == child then
if (item.y + scroll_offset) <= 0 then
scroll_offset = 1 - item.y
update_positions()
draw_bar()
elseif (item.y + scroll_offset) == 1 then
-- do nothing, it's right at the top (if the bottom doesn't fit we can't easily fix that)
elseif ((item.h + item.y - 1) + scroll_offset) > e.frame.h then
scroll_offset = 1 - ((item.h + item.y) - e.frame.h)
update_positions()
draw_bar()
end
return
end
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
if e.enabled then
if event.type == MOUSE_CLICK.TAP then
if event.current.x == e.frame.w then
if event.current.y == 1 or event.current.y < bar_bounds[1] then
scroll_up()
if event.current.y == 1 then
draw_arrows(1)
if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
end
elseif event.current.y == e.frame.h or event.current.y > bar_bounds[2] then
scroll_down()
if event.current.y == e.frame.h then
draw_arrows(-1)
if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
end
end
end
elseif event.type == MOUSE_CLICK.DOWN then
if event.current.x == e.frame.w then
if event.current.y == 1 or event.current.y < bar_bounds[1] then
scroll_up()
if event.current.y == 1 then draw_arrows(1) end
elseif event.current.y == e.frame.h or event.current.y > bar_bounds[2] then
scroll_down()
if event.current.y == e.frame.h then draw_arrows(-1) end
else
-- clicked on bar
holding_bar = true
bar_grip_pos = event.current.y - bar_bounds[1]
mouse_last_y = event.current.y
end
end
elseif event.type == MOUSE_CLICK.UP then
holding_bar = false
draw_arrows(0)
elseif event.type == MOUSE_CLICK.DRAG then
if holding_bar then
-- if mouse is within vertical frame, including the grip point
if event.current.y > (1 + bar_grip_pos) and event.current.y <= ((e.frame.h - bar_height) + bar_grip_pos) then
if event.current.y < mouse_last_y then
scroll_up(bar_is_scaled)
elseif event.current.y > mouse_last_y then
scroll_down(bar_is_scaled)
end
mouse_last_y = event.current.y
end
end
elseif event.type == MOUSE_CLICK.SCROLL_DOWN then
scroll_down()
elseif event.type == MOUSE_CLICK.SCROLL_UP then
scroll_up()
end
end
end
-- handle keyboard interaction
---@param event key_interaction key event
function e.handle_key(event)
if event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
if event.key == keys.up then
scroll_up()
elseif event.key == keys.down then
scroll_down()
elseif event.key == keys.home then
scroll_offset = 0
update_positions()
elseif event.key == keys["end"] then
scroll_offset = max_down_scroll
update_positions()
end
end
end
-- element redraw
function e.redraw()
draw_arrows(0)
draw_bar()
end
-- initial draw
e.redraw()
return e.complete()
end
return listbox

View File

@@ -0,0 +1,50 @@
-- Multi-Pane Display Graphics Element
local element = require("graphics.element")
---@class multipane_args
---@field panes table panes to swap between
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted
---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new multipane element
---@nodiscard
---@param args multipane_args
---@return graphics_element element, element_id id
local function multipane(args)
element.assert(type(args.panes) == "table", "panes is a required field")
-- create new graphics element base object
local e = element.new(args)
e.value = 1
-- show the selected pane
function e.redraw()
for i = 1, #args.panes do args.panes[i].hide() end
args.panes[e.value].show()
end
-- select which pane is shown
---@param value integer pane to show
function e.set_value(value)
if (e.value ~= value) and (value > 0) and (value <= #args.panes) then
e.value = value
e.redraw()
end
end
-- initial draw
e.redraw()
return e.complete()
end
return multipane

View File

@@ -11,18 +11,24 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field hidden? boolean true to hide on initial draw
---@class _pipe_map_entry
---@field atr boolean align top right (or bottom left for false)
---@field thin boolean thin pipe or not
---@field fg string foreground blit
---@field bg string background blit
-- new pipe network -- new pipe network
---@param args pipenet_args ---@param args pipenet_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function pipenet(args) local function pipenet(args)
assert(type(args.pipes) == "table", "graphics.elements.indicators.pipenet: pipes is a required field") element.assert(type(args.pipes) == "table", "pipes is a required field")
args.width = 0 args.width = 0
args.height = 0 args.height = 0
-- determine width/height
for i = 1, #args.pipes do for i = 1, #args.pipes do
local pipe = args.pipes[i] ---@type pipe local pipe = args.pipes[i] ---@type pipe
@@ -37,111 +43,289 @@ local function pipenet(args)
args.y = args.y or 1 args.y = args.y or 1
if args.bg ~= nil then if args.bg ~= nil then
args.fg_bg = core.graphics.cpair(args.bg, args.bg) args.fg_bg = core.cpair(args.bg, args.bg)
end end
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- draw all pipes -- determine if there are any thin pipes involved
local any_thin = false
for p = 1, #args.pipes do for p = 1, #args.pipes do
local pipe = args.pipes[p] ---@type pipe any_thin = args.pipes[p].thin
if any_thin then break end
end
local x = 1 + pipe.x1 -- draw all pipes by drawing out lines
local y = 1 + pipe.y1 local function vector_draw()
for p = 1, #args.pipes do
local pipe = args.pipes[p] ---@type pipe
local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1) local x = 1 + pipe.x1
local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1) local y = 1 + pipe.y1
e.window.setCursorPos(x, y) local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
local c = core.graphics.cpair(pipe.color, e.fg_bg.bkg) if pipe.thin then
x_step = util.trinary(pipe.x1 == pipe.x2, 0, x_step)
if pipe.align_tr then y_step = util.trinary(pipe.y1 == pipe.y2, 0, y_step)
-- cross width then height
for i = 1, pipe.w do
if pipe.thin then
if i == pipe.w then
-- corner
if y_step > 0 then
e.window.blit("\x93", c.blit_bkg, c.blit_fgd)
else
e.window.blit("\x8e", c.blit_fgd, c.blit_bkg)
end
else
e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
end
else
if i == pipe.w and y_step > 0 then
-- corner
e.window.blit(" ", c.blit_bkg, c.blit_fgd)
else
e.window.blit("\x8f", c.blit_fgd, c.blit_bkg)
end
end
x = x + x_step
e.window.setCursorPos(x, y)
end end
-- back up one e.w_set_cur(x, y)
x = x - x_step
for _ = 1, pipe.h - 1 do local c = core.cpair(pipe.color, e.fg_bg.bkg)
y = y + y_step
e.window.setCursorPos(x, y)
if pipe.thin then if pipe.align_tr then
e.window.blit("\x95", c.blit_bkg, c.blit_fgd) -- cross width then height
else for i = 1, pipe.w do
e.window.blit(" ", c.blit_bkg, c.blit_fgd) if pipe.thin then
if i == pipe.w then
-- corner
if y_step > 0 then
e.w_blit("\x93", c.blit_bkg, c.blit_fgd)
else
e.w_blit("\x8e", c.blit_fgd, c.blit_bkg)
end
else
e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
end
else
if i == pipe.w and y_step > 0 then
-- corner
e.w_blit(" ", c.blit_bkg, c.blit_fgd)
else
e.w_blit("\x8f", c.blit_fgd, c.blit_bkg)
end
end
x = x + x_step
e.w_set_cur(x, y)
end end
-- back up one
x = x - x_step
for _ = 1, pipe.h - 1 do
y = y + y_step
e.w_set_cur(x, y)
if pipe.thin then
e.w_blit("\x95", c.blit_bkg, c.blit_fgd)
else
e.w_blit(" ", c.blit_bkg, c.blit_fgd)
end
end
else
-- cross height then width
for i = 1, pipe.h do
if pipe.thin then
if i == pipe.h then
-- corner
if y_step < 0 then
e.w_blit("\x97", c.blit_bkg, c.blit_fgd)
elseif y_step > 0 then
e.w_blit("\x8d", c.blit_fgd, c.blit_bkg)
else
e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
end
else
e.w_blit("\x95", c.blit_fgd, c.blit_bkg)
end
else
if i == pipe.h and y_step < 0 then
-- corner
e.w_blit("\x83", c.blit_bkg, c.blit_fgd)
else
e.w_blit(" ", c.blit_bkg, c.blit_fgd)
end
end
y = y + y_step
e.w_set_cur(x, y)
end
-- back up one
y = y - y_step
for _ = 1, pipe.w - 1 do
x = x + x_step
e.w_set_cur(x, y)
if pipe.thin then
e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
else
e.w_blit("\x83", c.blit_bkg, c.blit_fgd)
end
end
end
end
end
-- draw a particular map cell
---@param map table 2D cell map
---@param x integer x coord
---@param y integer y coord
local function draw_map_cell(map, x, y)
local entry = map[x][y] ---@type _pipe_map_entry already confirmed not false
local char
local invert = false
local function check(cx, cy)
return (map[cx] ~= nil) and (map[cx][cy] ~= nil) and (map[cx][cy] ~= false) and (map[cx][cy].fg == entry.fg)
end
if entry.thin then
if check(x - 1, y) then -- if left
if check(x, y - 1) then -- if above
if check(x + 1, y) then -- if right
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x91", "\x9d")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8e", "\x8d")
end
else -- not right
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x91", "\x95")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8e", "\x85")
end
end
elseif check(x, y + 1) then-- not above, if below
if check(x + 1, y) then -- if right
char = util.trinary(entry.atr, "\x93", "\x9c")
invert = entry.atr
else -- not right
char = util.trinary(entry.atr, "\x93", "\x94")
invert = entry.atr
end
else -- not above, not below
char = "\x8c"
end
elseif check(x + 1, y) then -- not left, if right
if check(x, y - 1) then -- if above
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x95", "\x9d")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8a", "\x8d")
end
else -- not above
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x97", "\x9c")
invert = entry.atr
else -- not below
char = "\x8c"
end
end
else -- not left, not right
char = "\x95"
invert = entry.atr
end end
else else
-- cross height then width if check(x, y - 1) then -- above
for i = 1, pipe.h do -- not below and (if left or right)
if pipe.thin then if (not check(x, y + 1)) and (check(x - 1, y) or check(x + 1, y)) then
if i == pipe.h then char = util.trinary(entry.atr, "\x8f", " ")
-- corner invert = not entry.atr
if y_step < 0 then else -- not below w/ sides only
e.window.blit("\x97", c.blit_bkg, c.blit_fgd) char = " "
else invert = true
e.window.blit("\x8d", c.blit_fgd, c.blit_bkg) end
end elseif check(x, y + 1) then -- not above, if below
else -- if left or right
e.window.blit("\x95", c.blit_fgd, c.blit_bkg) if (check(x - 1, y) or check(x + 1, y)) then
end char = "\x83"
else invert = true
if i == pipe.h and y_step < 0 then else -- not left or right
-- corner char = " "
e.window.blit("\x83", c.blit_bkg, c.blit_fgd) invert = true
else end
e.window.blit(" ", c.blit_bkg, c.blit_fgd) else -- not above, not below
end char = util.trinary(entry.atr, "\x8f", "\x83")
invert = not entry.atr
end
end
e.w_set_cur(x, y)
if invert then
e.w_blit(char, entry.bg, entry.fg)
else
e.w_blit(char, entry.fg, entry.bg)
end
end
-- draw all pipes by assembling and marking up a 2D map<br>
-- this is an easy way to check adjacent blocks, which is required to properly draw thin pipes
local function map_draw()
local map = {}
for x = 1, args.width do
table.insert(map, {})
for _ = 1, args.height do table.insert(map[x], false) end
end
-- build map
for p = 1, #args.pipes do
local pipe = args.pipes[p] ---@type pipe
local x = 1 + pipe.x1
local y = 1 + pipe.y1
local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
local entry = { atr = pipe.align_tr, thin = pipe.thin, fg = colors.toBlit(pipe.color), bg = e.fg_bg.blit_bkg }
if pipe.align_tr then
-- cross width then height
for _ = 1, pipe.w do
map[x][y] = entry
x = x + x_step
end end
y = y + y_step x = x - x_step -- back up one
e.window.setCursorPos(x, y)
end
-- back up one for _ = 1, pipe.h do
y = y - y_step map[x][y] = entry
y = y + y_step
end
else
-- cross height then width
for _ = 1, pipe.h do
map[x][y] = entry
y = y + y_step
end
for _ = 1, pipe.w - 1 do y = y - y_step -- back up one
x = x + x_step
e.window.setCursorPos(x, y)
if pipe.thin then for _ = 1, pipe.w do
e.window.blit("\x8c", c.blit_fgd, c.blit_bkg) map[x][y] = entry
else x = x + x_step
e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
end end
end end
end end
-- render
for x = 1, args.width do
for y = 1, args.height do
if map[x][y] ~= false then draw_map_cell(map, x, y) end
end
end
end end
return e.get() -- element redraw
function e.redraw()
if any_thin then map_draw() else vector_draw() end
end
-- initial draw
e.redraw()
return e.complete()
end end
return pipenet return pipenet

View File

@@ -7,20 +7,22 @@ local element = require("graphics.element")
---@class rectangle_args ---@class rectangle_args
---@field border? graphics_border ---@field border? graphics_border
---@field thin? boolean true to use extra thin even borders ---@field thin? boolean true to use extra thin even borders
---@field even_inner? boolean true to make the inner area of a border even
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new rectangle -- new rectangle
---@param args rectangle_args ---@param args rectangle_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function rectangle(args) local function rectangle(args)
assert(args.border ~= nil or args.thin ~= true, "graphics.elements.rectangle: thin requires border to be provided") element.assert(args.border ~= nil or args.thin ~= true, "thin requires border to be provided")
-- if thin, then width will always need to be 1 -- if thin, then width will always need to be 1
if args.thin == true then if args.thin == true then
@@ -29,63 +31,84 @@ local function rectangle(args)
end end
-- offset children -- offset children
local offset_x = 0
local offset_y = 0
if args.border ~= nil then if args.border ~= nil then
args.offset_x = args.border.width offset_x = args.border.width
args.offset_y = args.border.width offset_y = args.border.width
-- slightly different y offset if the border is set to even -- slightly different y offset if the border is set to even
if args.border.even then if args.border.even then
local width_x2 = (2 * args.border.width) local width_x2 = (2 * args.border.width)
args.offset_y = math.floor(width_x2 / 3) + util.trinary(width_x2 % 3 > 0, 1, 0) offset_y = math.floor(width_x2 / 3) + util.trinary(width_x2 % 3 > 0, 1, 0)
end end
end end
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args, nil, offset_x, offset_y)
-- create content window for child elements
e.content_window = window.create(e.window, 1 + offset_x, 1 + offset_y, e.frame.w - (2 * offset_x), e.frame.h - (2 * offset_y))
e.content_window.setBackgroundColor(e.fg_bg.bkg)
e.content_window.setTextColor(e.fg_bg.fgd)
e.content_window.clear()
-- draw bordered box if requested -- draw bordered box if requested
-- element constructor will have drawn basic colored rectangle regardless -- element constructor will have drawn basic colored rectangle regardless
if args.border ~= nil then if args.border ~= nil then
e.window.setCursorPos(1, 1) e.w_set_cur(1, 1)
local border_width = args.offset_x local border_width = offset_x
local border_height = args.offset_y local border_height = offset_y
local border_blit = colors.toBlit(args.border.color) local border_blit = colors.toBlit(args.border.color)
local width_x2 = border_width * 2 local width_x2 = border_width * 2
local inner_width = e.frame.w - width_x2 local inner_width = e.frame.w - width_x2
-- check dimensions -- check dimensions
assert(width_x2 <= e.frame.w, "graphics.elements.rectangle: border too thick for width") element.assert(width_x2 <= e.frame.w, "border too thick for width")
assert(width_x2 <= e.frame.h, "graphics.elements.rectangle: border too thick for height") element.assert(width_x2 <= e.frame.h, "border too thick for height")
-- form the basic line strings and top/bottom blit strings -- form the basic line strings and top/bottom blit strings
local spaces = util.spaces(e.frame.w) local spaces = util.spaces(e.frame.w)
local blit_fg = util.strrep(e.fg_bg.blit_fgd, e.frame.w) local blit_fg = string.rep(e.fg_bg.blit_fgd, e.frame.w)
local blit_fg_sides = blit_fg local blit_fg_sides = blit_fg
local blit_bg_sides = "" local blit_bg_sides = ""
local blit_bg_top_bot = util.strrep(border_blit, e.frame.w) local blit_bg_top_bot = string.rep(border_blit, e.frame.w)
-- partial bars -- partial bars
local p_a = util.spaces(border_width) .. util.strrep("\x8f", inner_width) .. util.spaces(border_width) local p_a, p_b, p_s
local p_b = util.spaces(border_width) .. util.strrep("\x83", inner_width) .. util.spaces(border_width)
local p_s = spaces
if args.thin == true then if args.thin == true then
p_a = "\x97" .. util.strrep("\x83", inner_width) .. "\x94" if args.even_inner == true then
p_b = "\x8a" .. util.strrep("\x8f", inner_width) .. "\x85" p_a = "\x9c" .. string.rep("\x8c", inner_width) .. "\x93"
p_b = "\x8d" .. string.rep("\x8c", inner_width) .. "\x8e"
else
p_a = "\x97" .. string.rep("\x83", inner_width) .. "\x94"
p_b = "\x8a" .. string.rep("\x8f", inner_width) .. "\x85"
end
p_s = "\x95" .. util.spaces(inner_width) .. "\x95" p_s = "\x95" .. util.spaces(inner_width) .. "\x95"
else
if args.even_inner == true then
p_a = string.rep("\x83", inner_width + width_x2)
p_b = string.rep("\x8f", inner_width + width_x2)
else
p_a = util.spaces(border_width) .. string.rep("\x8f", inner_width) .. util.spaces(border_width)
p_b = util.spaces(border_width) .. string.rep("\x83", inner_width) .. util.spaces(border_width)
end
p_s = spaces
end end
local p_inv_fg = util.strrep(border_blit, border_width) .. util.strrep(e.fg_bg.blit_bkg, inner_width) .. local p_inv_fg = string.rep(border_blit, border_width) .. string.rep(e.fg_bg.blit_bkg, inner_width) ..
util.strrep(border_blit, border_width) string.rep(border_blit, border_width)
local p_inv_bg = util.strrep(e.fg_bg.blit_bkg, border_width) .. util.strrep(border_blit, inner_width) .. local p_inv_bg = string.rep(e.fg_bg.blit_bkg, border_width) .. string.rep(border_blit, inner_width) ..
util.strrep(e.fg_bg.blit_bkg, border_width) string.rep(e.fg_bg.blit_bkg, border_width)
if args.thin == true then if args.thin == true then
p_inv_fg = e.fg_bg.blit_bkg .. util.strrep(e.fg_bg.blit_bkg, inner_width) .. util.strrep(border_blit, border_width) p_inv_fg = e.fg_bg.blit_bkg .. string.rep(e.fg_bg.blit_bkg, inner_width) .. string.rep(border_blit, border_width)
p_inv_bg = border_blit .. util.strrep(border_blit, inner_width) .. util.strrep(e.fg_bg.blit_bkg, border_width) p_inv_bg = border_blit .. string.rep(border_blit, inner_width) .. string.rep(e.fg_bg.blit_bkg, border_width)
blit_fg_sides = border_blit .. util.strrep(e.fg_bg.blit_bkg, inner_width) .. e.fg_bg.blit_bkg blit_fg_sides = border_blit .. string.rep(e.fg_bg.blit_bkg, inner_width) .. e.fg_bg.blit_bkg
end end
-- form the body blit strings (sides are border, inside is normal) -- form the body blit strings (sides are border, inside is normal)
@@ -103,57 +126,72 @@ local function rectangle(args)
end end
-- draw rectangle with borders -- draw rectangle with borders
for y = 1, e.frame.h do function e.redraw()
e.window.setCursorPos(1, y) for y = 1, e.frame.h do
-- top border e.w_set_cur(1, y)
if y <= border_height then -- top border
-- partial pixel fill if y <= border_height then
if args.border.even and y == border_height then -- partial pixel fill
if args.thin == true then if args.border.even and y == border_height then
e.window.blit(p_a, p_inv_bg, p_inv_fg) if args.thin == true then
else e.w_blit(p_a, p_inv_bg, p_inv_fg)
if width_x2 % 3 == 1 then
e.window.blit(p_b, p_inv_bg, p_inv_fg)
elseif width_x2 % 3 == 2 then
e.window.blit(p_a, p_inv_bg, p_inv_fg)
else else
-- skip line local _fg = util.trinary(args.even_inner == true, string.rep(e.fg_bg.blit_bkg, e.frame.w), p_inv_bg)
e.window.blit(spaces, blit_fg, blit_bg_sides) local _bg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
if width_x2 % 3 == 1 then
e.w_blit(p_b, _fg, _bg)
elseif width_x2 % 3 == 2 then
e.w_blit(p_a, _fg, _bg)
else
-- skip line
e.w_blit(spaces, blit_fg, blit_bg_sides)
end
end end
else
e.w_blit(spaces, blit_fg, blit_bg_top_bot)
end
-- bottom border
elseif y > (e.frame.h - border_width) then
-- partial pixel fill
if args.border.even and y == ((e.frame.h - border_width) + 1) then
if args.thin == true then
if args.even_inner == true then
e.w_blit(p_b, blit_bg_top_bot, string.rep(e.fg_bg.blit_bkg, e.frame.w))
else
e.w_blit(p_b, string.rep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
end
else
local _fg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
local _bg = util.trinary(args.even_inner == true, string.rep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
if width_x2 % 3 == 1 then
e.w_blit(p_a, _fg, _bg)
elseif width_x2 % 3 == 2 then
e.w_blit(p_b, _fg, _bg)
else
-- skip line
e.w_blit(spaces, blit_fg, blit_bg_sides)
end
end
else
e.w_blit(spaces, blit_fg, blit_bg_top_bot)
end end
else else
e.window.blit(spaces, blit_fg, blit_bg_top_bot)
end
-- bottom border
elseif y > (e.frame.h - border_width) then
-- partial pixel fill
if args.border.even and y == ((e.frame.h - border_width) + 1) then
if args.thin == true then if args.thin == true then
e.window.blit(p_b, util.strrep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot) e.w_blit(p_s, blit_fg_sides, blit_bg_sides)
else else
if width_x2 % 3 == 1 then e.w_blit(p_s, blit_fg, blit_bg_sides)
e.window.blit(p_a, p_inv_fg, blit_bg_top_bot)
elseif width_x2 % 3 == 2 or (args.thin == true) then
e.window.blit(p_b, p_inv_fg, blit_bg_top_bot)
else
-- skip line
e.window.blit(spaces, blit_fg, blit_bg_sides)
end
end end
else
e.window.blit(spaces, blit_fg, blit_bg_top_bot)
end
else
if args.thin == true then
e.window.blit(p_s, blit_fg_sides, blit_bg_sides)
else
e.window.blit(p_s, blit_fg, blit_bg_sides)
end end
end end
end end
-- initial draw of border
e.redraw()
end end
return e.get() return e.complete()
end end
return rectangle return rectangle

View File

@@ -5,66 +5,87 @@ local util = require("scada-common.util")
local core = require("graphics.core") local core = require("graphics.core")
local element = require("graphics.element") local element = require("graphics.element")
local TEXT_ALIGN = core.graphics.TEXT_ALIGN local ALIGN = core.ALIGN
---@class textbox_args ---@class textbox_args
---@field text string text to show ---@field text string text to show
---@field alignment? TEXT_ALIGN text alignment, left by default ---@field alignment? ALIGN text alignment, left by default
---@field anchor? boolean true to use this as an anchor, making it focusable
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer minimum necessary height for wrapped text if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new text box -- new text box
---@param args textbox_args ---@param args textbox_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function textbox(args) local function textbox(args)
assert(type(args.text) == "string", "graphics.elements.textbox: text is a required field") element.assert(type(args.text) == "string", "text is a required field")
if args.anchor == true then args.can_focus = true end
-- provide a constraint condition to element creation to prevent an pointlessly tall text box
---@param frame graphics_frame
local function constrain(frame)
local new_height = math.max(1, #util.strwrap(args.text, frame.w))
if args.height then
new_height = math.max(frame.h, new_height)
end
return frame.w, new_height
end
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args, constrain)
local alignment = args.alignment or TEXT_ALIGN.LEFT e.value = args.text
local alignment = args.alignment or ALIGN.LEFT
-- draw textbox -- draw textbox
function e.redraw()
e.window.clear()
local function display_text(text) local lines = util.strwrap(e.value, e.frame.w)
e.value = text
local lines = util.strwrap(text, e.frame.w)
for i = 1, #lines do for i = 1, #lines do
if i > e.frame.h then break end if i > e.frame.h then break end
-- trim leading/trailing whitespace
lines[i] = util.trim(lines[i])
local len = string.len(lines[i]) local len = string.len(lines[i])
-- use cursor position to align this line -- use cursor position to align this line
if alignment == TEXT_ALIGN.CENTER then if alignment == ALIGN.CENTER then
e.window.setCursorPos(math.floor((e.frame.w - len) / 2) + 1, i) e.w_set_cur(math.floor((e.frame.w - len) / 2) + 1, i)
elseif alignment == TEXT_ALIGN.RIGHT then elseif alignment == ALIGN.RIGHT then
e.window.setCursorPos((e.frame.w - len) + 1, i) e.w_set_cur((e.frame.w - len) + 1, i)
else else
e.window.setCursorPos(1, i) e.w_set_cur(1, i)
end end
e.window.write(lines[i]) e.w_write(lines[i])
end end
end end
display_text(args.text)
-- set the string value and re-draw the text -- set the string value and re-draw the text
---@param val string value ---@param val string value
function e.set_value(val) function e.set_value(val)
e.window.clear() e.value = val
display_text(val) e.redraw()
end end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return textbox return textbox

View File

@@ -11,23 +11,22 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new tiling box -- new tiling box
---@param args tiling_args ---@param args tiling_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
local function tiling(args) local function tiling(args)
assert(type(args.fill_c) == "table", "graphics.elements.tiling: fill_c is a required field") element.assert(type(args.fill_c) == "table", "fill_c is a required field")
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- draw tiling box
local fill_a = args.fill_c.blit_a local fill_a = args.fill_c.blit_a
local fill_b = args.fill_c.blit_b local fill_b = args.fill_c.blit_b
@@ -37,13 +36,9 @@ local function tiling(args)
local start_y = 1 local start_y = 1
local inner_width = math.floor(e.frame.w / util.trinary(even, 2, 1)) local inner_width = math.floor(e.frame.w / util.trinary(even, 2, 1))
local inner_height = e.frame.h local inner_height = e.frame.h
local alternator = true
-- border -- border
if args.border_c ~= nil then if args.border_c ~= nil then
e.window.setBackgroundColor(args.border_c)
e.window.clear()
start_x = 1 + util.trinary(even, 2, 1) start_x = 1 + util.trinary(even, 2, 1)
start_y = 2 start_y = 2
@@ -52,36 +47,49 @@ local function tiling(args)
end end
-- check dimensions -- check dimensions
assert(inner_width > 0, "graphics.elements.tiling: inner_width <= 0") element.assert(inner_width > 0, "inner_width <= 0")
assert(inner_height > 0, "graphics.elements.tiling: inner_height <= 0") element.assert(inner_height > 0, "inner_height <= 0")
assert(start_x <= inner_width, "graphics.elements.tiling: start_x > inner_width") element.assert(start_x <= inner_width, "start_x > inner_width")
assert(start_y <= inner_height, "graphics.elements.tiling: start_y > inner_height") element.assert(start_y <= inner_height, "start_y > inner_height")
-- create pattern -- draw tiling box
for y = start_y, inner_height + (start_y - 1) do function e.redraw()
e.window.setCursorPos(start_x, y) local alternator = true
for _ = 1, inner_width do
if alternator then
if even then
e.window.blit(" ", "00", fill_a .. fill_a)
else
e.window.blit(" ", "0", fill_a)
end
else
if even then
e.window.blit(" ", "00", fill_b .. fill_b)
else
e.window.blit(" ", "0", fill_b)
end
end
alternator = not alternator if args.border_c ~= nil then
e.w_set_bkg(args.border_c)
e.window.clear()
end end
if inner_width % 2 == 0 then alternator = not alternator end -- draw pattern
for y = start_y, inner_height + (start_y - 1) do
e.w_set_cur(start_x, y)
for _ = 1, inner_width do
if alternator then
if even then
e.w_blit(" ", "00", fill_a .. fill_a)
else
e.w_blit(" ", "0", fill_a)
end
else
if even then
e.w_blit(" ", "00", fill_b .. fill_b)
else
e.w_blit(" ", "0", fill_b)
end
end
alternator = not alternator
end
if inner_width % 2 == 0 then alternator = not alternator end
end
end end
return e.get() -- initial draw
e.redraw()
return e.complete()
end end
return tiling return tiling

254
graphics/events.lua Normal file
View File

@@ -0,0 +1,254 @@
--
-- Graphics Events and Event Handlers
--
local util = require("scada-common.util")
local DOUBLE_CLICK_MS = 500
local events = {}
---@enum CLICK_BUTTON
local CLICK_BUTTON = {
GENERIC = 0,
LEFT_BUTTON = 1,
RIGHT_BUTTON = 2,
MID_BUTTON = 3
}
events.CLICK_BUTTON = CLICK_BUTTON
---@enum MOUSE_CLICK
local MOUSE_CLICK = {
TAP = 1, -- screen tap (complete click)
DOWN = 2, -- button down
UP = 3, -- button up (completed a click)
DRAG = 4, -- mouse dragged
SCROLL_DOWN = 5, -- scroll down
SCROLL_UP = 6, -- scroll up
DOUBLE_CLICK = 7 -- double left click
}
events.MOUSE_CLICK = MOUSE_CLICK
---@enum KEY_CLICK
local KEY_CLICK = {
DOWN = 1,
HELD = 2,
UP = 3,
CHAR = 4
}
events.KEY_CLICK = KEY_CLICK
-- create a new 2D coordinate
---@param x integer
---@param y integer
---@return coordinate_2d
local function _coord2d(x, y) return { x = x, y = y } end
events.new_coord_2d = _coord2d
---@class mouse_interaction
---@field monitor string
---@field button CLICK_BUTTON
---@field type MOUSE_CLICK
---@field initial coordinate_2d
---@field current coordinate_2d
---@class key_interaction
---@field type KEY_CLICK
---@field key number key code
---@field name string key character name
---@field shift boolean shift held
---@field ctrl boolean ctrl held
---@field alt boolean alt held
local handler = {
-- left, right, middle button down tracking
button_down = { _coord2d(0, 0), _coord2d(0, 0), _coord2d(0, 0) },
-- keyboard modifiers
shift = false,
alt = false,
ctrl = false,
-- double click tracking
dc_start = 0,
dc_step = 1,
dc_coord = _coord2d(0, 0)
}
-- create a new monitor touch mouse interaction event
---@nodiscard
---@param monitor string
---@param x integer
---@param y integer
---@return mouse_interaction
local function _monitor_touch(monitor, x, y)
return {
monitor = monitor,
button = CLICK_BUTTON.GENERIC,
type = MOUSE_CLICK.TAP,
initial = _coord2d(x, y),
current = _coord2d(x, y)
}
end
-- create a new mouse button mouse interaction event
---@nodiscard
---@param button CLICK_BUTTON mouse button
---@param type MOUSE_CLICK click type
---@param x1 integer initial x
---@param y1 integer initial y
---@param x2 integer current x
---@param y2 integer current y
---@return mouse_interaction
local function _mouse_event(button, type, x1, y1, x2, y2)
return {
monitor = "terminal",
button = button,
type = type,
initial = _coord2d(x1, y1),
current = _coord2d(x2, y2)
}
end
-- create a new generic mouse interaction event
---@nodiscard
---@param type MOUSE_CLICK
---@param x integer
---@param y integer
---@return mouse_interaction
function events.mouse_generic(type, x, y)
return {
monitor = "",
button = CLICK_BUTTON.GENERIC,
type = type,
initial = _coord2d(x, y),
current = _coord2d(x, y)
}
end
-- create a new transposed mouse interaction event using the event's monitor/button fields
---@nodiscard
---@param event mouse_interaction
---@param elem_pos_x integer element's x position: new x = (event x - element x) + 1
---@param elem_pos_y integer element's y position: new y = (event y - element y) + 1
---@return mouse_interaction
function events.mouse_transposed(event, elem_pos_x, elem_pos_y)
return {
monitor = event.monitor,
button = event.button,
type = event.type,
initial = _coord2d((event.initial.x - elem_pos_x) + 1, (event.initial.y - elem_pos_y) + 1),
current = _coord2d((event.current.x - elem_pos_x) + 1, (event.current.y - elem_pos_y) + 1)
}
end
-- check if an event qualifies as a click (tap or up)
---@nodiscard
---@param t MOUSE_CLICK
function events.was_clicked(t) return t == MOUSE_CLICK.TAP or t == MOUSE_CLICK.UP end
-- create a new mouse event to pass onto graphics renderer<br>
-- supports: mouse_click, mouse_up, mouse_drag, mouse_scroll, and monitor_touch
---@param event_type os_event OS event to handle
---@param opt integer|string button, scroll direction, or monitor for monitor touch
---@param x integer x coordinate
---@param y integer y coordinate
---@return mouse_interaction|nil
function events.new_mouse_event(event_type, opt, x, y)
local h = handler
if event_type == "mouse_click" then
---@cast opt 1|2|3
local init = true
if opt == 1 and (h.dc_step % 2) == 1 then
if h.dc_step ~= 1 and h.dc_coord.x == x and h.dc_coord.y == y and (util.time_ms() - h.dc_start) < DOUBLE_CLICK_MS then
init = false
h.dc_step = h.dc_step + 1
end
end
if init then
h.dc_start = util.time_ms()
h.dc_coord = _coord2d(x, y)
h.dc_step = 2
end
h.button_down[opt] = _coord2d(x, y)
return _mouse_event(opt, MOUSE_CLICK.DOWN, x, y, x, y)
elseif event_type == "mouse_up" then
---@cast opt 1|2|3
if opt == 1 and (h.dc_step % 2) == 0 and h.dc_coord.x == x and h.dc_coord.y == y and
(util.time_ms() - h.dc_start) < DOUBLE_CLICK_MS then
if h.dc_step == 4 then
util.push_event("double_click", 1, x, y)
h.dc_step = 1
else h.dc_step = h.dc_step + 1 end
else h.dc_step = 1 end
local initial = h.button_down[opt] ---@type coordinate_2d
return _mouse_event(opt, MOUSE_CLICK.UP, initial.x, initial.y, x, y)
elseif event_type == "monitor_touch" then
---@cast opt string
return _monitor_touch(opt, x, y)
elseif event_type == "mouse_drag" then
---@cast opt 1|2|3
local initial = h.button_down[opt] ---@type coordinate_2d
return _mouse_event(opt, MOUSE_CLICK.DRAG, initial.x, initial.y, x, y)
elseif event_type == "mouse_scroll" then
---@cast opt 1|-1
local scroll_direction = util.trinary(opt == 1, MOUSE_CLICK.SCROLL_DOWN, MOUSE_CLICK.SCROLL_UP)
return _mouse_event(CLICK_BUTTON.GENERIC, scroll_direction, x, y, x, y)
elseif event_type == "double_click" then
return _mouse_event(CLICK_BUTTON.LEFT_BUTTON, MOUSE_CLICK.DOUBLE_CLICK, x, y, x, y)
end
end
-- create a new keyboard interaction event
---@nodiscard
---@param click_type KEY_CLICK key click type
---@param key integer|string keyboard key code or character for 'char' event
---@return key_interaction
local function _key_event(click_type, key)
local name = key
if type(key) == "number" then name = keys.getName(key) end
return { type = click_type, key = key, name = name, shift = handler.shift, ctrl = handler.ctrl, alt = handler.alt }
end
-- create a new keyboard event to pass onto graphics renderer<br>
-- supports: char, key, and key_up
---@param event_type os_event OS event to handle
---@param key integer keyboard key code
---@param held boolean? if the key is being held (for 'key' event)
---@return key_interaction|nil
function events.new_key_event(event_type, key, held)
if event_type == "char" then
return _key_event(KEY_CLICK.CHAR, key)
elseif event_type == "key" then
if key == keys.leftShift or key == keys.rightShift then
handler.shift = true
elseif key == keys.leftCtrl or key == keys.rightCtrl then
handler.ctrl = true
elseif key == keys.leftAlt or key == keys.rightAlt then
handler.alt = true
else
return _key_event(util.trinary(held, KEY_CLICK.HELD, KEY_CLICK.DOWN), key)
end
elseif event_type == "key_up" then
if key == keys.leftShift or key == keys.rightShift then
handler.shift = false
elseif key == keys.leftCtrl or key == keys.rightCtrl then
handler.ctrl = false
elseif key == keys.leftAlt or key == keys.rightAlt then
handler.alt = false
else
return _key_event(KEY_CLICK.UP, key)
end
end
end
return events

View File

@@ -2,7 +2,7 @@
-- Indicator Light Flasher -- Indicator Light Flasher
-- --
local tcd = require("scada-common.tcallbackdsp") local tcd = require("scada-common.tcd")
local flasher = {} local flasher = {}
@@ -43,8 +43,10 @@ end
-- start/resume the flasher periodic -- start/resume the flasher periodic
function flasher.run() function flasher.run()
active = true if not active then
callback_250ms() active = true
callback_250ms()
end
end end
-- clear all blinking indicators and stop the flasher periodic -- clear all blinking indicators and stop the flasher periodic

418
graphics/themes.lua Normal file
View File

@@ -0,0 +1,418 @@
--
-- Graphics Themes
--
local core = require("graphics.core")
local cpair = core.cpair
---@class graphics_themes
local themes = {}
-- add color mappings for front panels
colors.ivory = colors.pink
colors.green_hc = colors.cyan
colors.yellow_hc = colors.purple
colors.red_off = colors.brown
colors.yellow_off = colors.magenta
colors.green_off = colors.lime
--#region Types
---@enum UI_THEME
themes.UI_THEME = { SMOOTH_STONE = 1, DEEPSLATE = 2 }
themes.UI_THEME_NAMES = { "Smooth Stone", "Deepslate" }
-- attempts to get the string name of a main ui theme
---@nodiscard
---@param id any
---@return string|nil
function themes.ui_theme_name(id)
if id == themes.UI_THEME.SMOOTH_STONE or
id == themes.UI_THEME.DEEPSLATE then
return themes.UI_THEME_NAMES[id]
else return nil end
end
---@enum FP_THEME
themes.FP_THEME = { SANDSTONE = 1, BASALT = 2 }
themes.FP_THEME_NAMES = { "Sandstone", "Basalt" }
-- attempts to get the string name of a front panel theme
---@nodiscard
---@param id any
---@return string|nil
function themes.fp_theme_name(id)
if id == themes.FP_THEME.SANDSTONE or
id == themes.FP_THEME.BASALT then
return themes.FP_THEME_NAMES[id]
else return nil end
end
---@enum COLOR_MODE
themes.COLOR_MODE = {
STANDARD = 1,
DEUTERANOPIA = 2,
PROTANOPIA = 3,
TRITANOPIA = 4,
BLUE_IND = 5,
STD_ON_BLACK = 6,
BLUE_ON_BLACK = 7,
NUM_MODES = 8
}
themes.COLOR_MODE_NAMES = {
"Standard",
"Deuteranopia",
"Protanopia",
"Tritanopia",
"Blue for 'Good'",
"Standard + Black",
"Blue + Black"
}
-- attempts to get the string name of a color mode
---@nodiscard
---@param id any
---@return string|nil
function themes.color_mode_name(id)
if id == themes.COLOR_MODE.STANDARD or
id == themes.COLOR_MODE.DEUTERANOPIA or
id == themes.COLOR_MODE.PROTANOPIA or
id == themes.COLOR_MODE.TRITANOPIA or
id == themes.COLOR_MODE.BLUE_IND or
id == themes.COLOR_MODE.STD_ON_BLACK or
id == themes.COLOR_MODE.BLUE_ON_BLACK then
return themes.COLOR_MODE_NAMES[id]
else return nil end
end
--#endregion
--#region Front Panel Themes
---@class fp_theme
themes.sandstone = {
text = colors.black,
label = colors.lightGray,
label_dark = colors.gray,
disabled = colors.lightGray,
bg = colors.ivory,
header = cpair(colors.black, colors.lightGray),
highlight_box = cpair(colors.black, colors.lightGray),
highlight_box_bright = cpair(colors.black, colors.white),
field_box = cpair(colors.gray, colors.white),
colors = {
{ c = colors.red, hex = 0xdf4949 },
{ c = colors.orange, hex = 0xffb659 },
{ c = colors.yellow, hex = 0xf9fb53 },
{ c = colors.green_off, hex = 0x16665a },
{ c = colors.green, hex = 0x6be551 },
{ c = colors.green_hc, hex = 0x6be551 },
{ c = colors.lightBlue, hex = 0x6cc0f2 },
{ c = colors.blue, hex = 0x0096ff },
{ c = colors.yellow_hc, hex = 0xe3bc2a },
{ c = colors.ivory, hex = 0xdcd9ca },
{ c = colors.yellow_off, hex = 0x85862c },
{ c = colors.white, hex = 0xf0f0f0 },
{ c = colors.lightGray, hex = 0xb1b8b3 },
{ c = colors.gray, hex = 0x575757 },
{ c = colors.black, hex = 0x191919 },
{ c = colors.red_off, hex = 0x672223 }
},
-- color re-mappings for assistive modes
color_modes = {
-- standard
{},
-- deuteranopia
{
{ c = colors.green, hex = 0x1081ff },
{ c = colors.green_hc, hex = 0x1081ff },
{ c = colors.green_off, hex = 0x141414 },
{ c = colors.yellow, hex = 0xf7c311 },
{ c = colors.yellow_off, hex = 0x141414 },
{ c = colors.red, hex = 0xfb5615 },
{ c = colors.red_off, hex = 0x141414 }
},
-- protanopia
{
{ c = colors.green, hex = 0x1081ff },
{ c = colors.green_hc, hex = 0x1081ff },
{ c = colors.green_off, hex = 0x141414 },
{ c = colors.yellow, hex = 0xf5e633 },
{ c = colors.yellow_off, hex = 0x141414 },
{ c = colors.red, hex = 0xff521a },
{ c = colors.red_off, hex = 0x141414 }
},
-- tritanopia
{
{ c = colors.green, hex = 0x40cbd7 },
{ c = colors.green_hc, hex = 0x40cbd7 },
{ c = colors.green_off, hex = 0x141414 },
{ c = colors.yellow, hex = 0xffbc00 },
{ c = colors.yellow_off, hex = 0x141414 },
{ c = colors.red, hex = 0xff0000 },
{ c = colors.red_off, hex = 0x141414 }
},
-- blue indicators
{
{ c = colors.green, hex = 0x1081ff },
{ c = colors.green_hc, hex = 0x1081ff },
{ c = colors.green_off, hex = 0x053466 },
},
-- standard, black backgrounds
{
{ c = colors.green_off, hex = 0x141414 },
{ c = colors.yellow_off, hex = 0x141414 },
{ c = colors.red_off, hex = 0x141414 }
},
-- blue indicators, black backgrounds
{
{ c = colors.green, hex = 0x1081ff },
{ c = colors.green_hc, hex = 0x1081ff },
{ c = colors.green_off, hex = 0x141414 },
{ c = colors.yellow_off, hex = 0x141414 },
{ c = colors.red_off, hex = 0x141414 }
}
}
}
---@type fp_theme
themes.basalt = {
text = colors.white,
label = colors.gray,
label_dark = colors.ivory,
disabled = colors.lightGray,
bg = colors.ivory,
header = cpair(colors.white, colors.gray),
highlight_box = cpair(colors.white, colors.gray),
highlight_box_bright = cpair(colors.black, colors.lightGray),
field_box = cpair(colors.white, colors.gray),
colors = {
{ c = colors.red, hex = 0xf18486 },
{ c = colors.orange, hex = 0xffb659 },
{ c = colors.yellow, hex = 0xefe37c },
{ c = colors.green_off, hex = 0x436b41 },
{ c = colors.green, hex = 0x7ae175 },
{ c = colors.green_hc, hex = 0x7ae175 },
{ c = colors.lightBlue, hex = 0x7dc6f2 },
{ c = colors.blue, hex = 0x56aae6 },
{ c = colors.yellow_hc, hex = 0xe9cd68 },
{ c = colors.ivory, hex = 0x4d4e52 },
{ c = colors.yellow_off, hex = 0x757040 },
{ c = colors.white, hex = 0xbfbfbf },
{ c = colors.lightGray, hex = 0x848794 },
{ c = colors.gray, hex = 0x5c5f68 },
{ c = colors.black, hex = 0x333333 },
{ c = colors.red_off, hex = 0x512d2d }
},
color_modes = {
-- standard
{},
-- deuteranopia
{
{ c = colors.green, hex = 0x65aeff },
{ c = colors.green_hc, hex = 0x99c9ff },
{ c = colors.green_off, hex = 0x333333 },
{ c = colors.yellow, hex = 0xf7c311 },
{ c = colors.yellow_off, hex = 0x333333 },
{ c = colors.red, hex = 0xf18486 },
{ c = colors.red_off, hex = 0x333333 }
},
-- protanopia
{
{ c = colors.green, hex = 0x65aeff },
{ c = colors.green_hc, hex = 0x99c9ff },
{ c = colors.green_off, hex = 0x333333 },
{ c = colors.yellow, hex = 0xf5e633 },
{ c = colors.yellow_off, hex = 0x333333 },
{ c = colors.red, hex = 0xff8058 },
{ c = colors.red_off, hex = 0x333333 }
},
-- tritanopia
{
{ c = colors.green, hex = 0x00ecff },
{ c = colors.green_hc, hex = 0x00ecff },
{ c = colors.green_off, hex = 0x333333 },
{ c = colors.yellow, hex = 0xffbc00 },
{ c = colors.yellow_off, hex = 0x333333 },
{ c = colors.red, hex = 0xdf4949 },
{ c = colors.red_off, hex = 0x333333 }
},
-- blue indicators
{
{ c = colors.green, hex = 0x65aeff },
{ c = colors.green_hc, hex = 0x99c9ff },
{ c = colors.green_off, hex = 0x365e8a },
},
-- standard, black backgrounds
{
{ c = colors.green_off, hex = 0x333333 },
{ c = colors.yellow_off, hex = 0x333333 },
{ c = colors.red_off, hex = 0x333333 }
},
-- blue indicators, black backgrounds
{
{ c = colors.green, hex = 0x65aeff },
{ c = colors.green_hc, hex = 0x99c9ff },
{ c = colors.green_off, hex = 0x333333 },
{ c = colors.yellow_off, hex = 0x333333 },
{ c = colors.red_off, hex = 0x333333 }
}
}
}
-- get style fields for a front panel based on the provided theme
---@param theme fp_theme
function themes.get_fp_style(theme)
---@class fp_style
local style = {
root = cpair(theme.text, theme.bg),
text = cpair(theme.text, theme.bg),
text_fg = cpair(theme.text, colors._INHERIT),
label_fg = cpair(theme.label, colors._INHERIT),
label_d_fg = cpair(theme.label_dark, colors._INHERIT),
disabled_fg = cpair(theme.disabled, colors._INHERIT)
}
return style
end
--#endregion
--#region Main UI Color Palettes
---@class ui_palette
themes.smooth_stone = {
colors = {
{ c = colors.red, hex = 0xdf4949 },
{ c = colors.orange, hex = 0xffb659 },
{ c = colors.yellow, hex = 0xfffc79 },
{ c = colors.lime, hex = 0x80ff80 },
{ c = colors.green, hex = 0x4aee8a },
{ c = colors.cyan, hex = 0x34bac8 },
{ c = colors.lightBlue, hex = 0x6cc0f2 },
{ c = colors.blue, hex = 0x0096ff },
{ c = colors.purple, hex = 0xb156ee },
{ c = colors.pink, hex = 0xf26ba2 },
{ c = colors.magenta, hex = 0xf9488a },
{ c = colors.white, hex = 0xf0f0f0 },
{ c = colors.lightGray, hex = 0xcacaca },
{ c = colors.gray, hex = 0x575757 },
{ c = colors.black, hex = 0x191919 },
{ c = colors.brown, hex = 0x7f664c }
},
-- color re-mappings for assistive modes
color_modes = {
-- standard
{},
-- deuteranopia
{
{ c = colors.blue, hex = 0x1081ff },
{ c = colors.yellow, hex = 0xf7c311 },
{ c = colors.red, hex = 0xfb5615 }
},
-- protanopia
{
{ c = colors.blue, hex = 0x1081ff },
{ c = colors.yellow, hex = 0xf5e633 },
{ c = colors.red, hex = 0xff521a }
},
-- tritanopia
{
{ c = colors.blue, hex = 0x40cbd7 },
{ c = colors.yellow, hex = 0xffbc00 },
{ c = colors.red, hex = 0xff0000 }
},
-- blue indicators
{
{ c = colors.blue, hex = 0x1081ff },
{ c = colors.yellow, hex = 0xfffc79 },
{ c = colors.red, hex = 0xdf4949 }
},
-- standard, black backgrounds
{},
-- blue indicators, black backgrounds
{
{ c = colors.blue, hex = 0x1081ff },
{ c = colors.yellow, hex = 0xfffc79 },
{ c = colors.red, hex = 0xdf4949 }
}
}
}
---@type ui_palette
themes.deepslate = {
colors = {
{ c = colors.red, hex = 0xeb6a6c },
{ c = colors.orange, hex = 0xf2b86c },
{ c = colors.yellow, hex = 0xd9cf81 },
{ c = colors.lime, hex = 0x80ff80 },
{ c = colors.green, hex = 0x70e19b },
{ c = colors.cyan, hex = 0x7ccdd0 },
{ c = colors.lightBlue, hex = 0x99ceef },
{ c = colors.blue, hex = 0x60bcff },
{ c = colors.purple, hex = 0xc38aea },
{ c = colors.pink, hex = 0xff7fb8 },
{ c = colors.magenta, hex = 0xf980dd },
{ c = colors.white, hex = 0xd9d9d9 },
{ c = colors.lightGray, hex = 0x949494 },
{ c = colors.gray, hex = 0x575757 },
{ c = colors.black, hex = 0x262626 },
{ c = colors.brown, hex = 0xb18f6a }
},
-- color re-mappings for assistive modes
color_modes = {
-- standard
{},
-- deuteranopia
{
{ c = colors.blue, hex = 0x65aeff },
{ c = colors.yellow, hex = 0xf7c311 },
{ c = colors.red, hex = 0xfb5615 }
},
-- protanopia
{
{ c = colors.blue, hex = 0x65aeff },
{ c = colors.yellow, hex = 0xf5e633 },
{ c = colors.red, hex = 0xff8058 }
},
-- tritanopia
{
{ c = colors.blue, hex = 0x00ecff },
{ c = colors.yellow, hex = 0xffbc00 },
{ c = colors.red, hex = 0xdf4949 }
},
-- blue indicators
{
{ c = colors.blue, hex = 0x65aeff },
{ c = colors.yellow, hex = 0xd9cf81 },
{ c = colors.red, hex = 0xeb6a6c }
},
-- standard, black backgrounds
{},
-- blue indicators, black backgrounds
{
{ c = colors.blue, hex = 0x65aeff },
{ c = colors.yellow, hex = 0xd9cf81 },
{ c = colors.red, hex = 0xeb6a6c }
}
}
}
--#endregion
return themes

View File

@@ -1,18 +1,8 @@
--
-- Initialize the Post-Boot Module Environment
--
return { return {
-- initialize booted environment -- initialize booted environment
init_env = function () init_env = function ()
local _require = require("cc.require") local _require, _env = require("cc.require"), setmetatable({}, { __index = _ENV })
local _env = setmetatable({}, { __index = _ENV }) require, package = _require.make(_env, "/")
term.clear(); term.setCursorPos(1, 1)
-- overwrite require/package globals end
require, package = _require.make(_env, "/")
-- reset terminal
term.clear()
term.setCursorPos(1, 1)
end
} }

View File

@@ -1 +0,0 @@
{"versions": {"installer": "v1.0", "bootloader": "0.2", "comms": "1.4.0", "reactor-plc": "v1.0.0", "rtu": "v0.13.0", "supervisor": "v0.14.0", "coordinator": "v0.12.2", "pocket": "alpha-v0.0.0"}, "files": {"system": ["initenv.lua", "startup.lua"], "common": ["scada-common/crypto.lua", "scada-common/ppm.lua", "scada-common/comms.lua", "scada-common/psil.lua", "scada-common/tcallbackdsp.lua", "scada-common/rsio.lua", "scada-common/constants.lua", "scada-common/mqueue.lua", "scada-common/crash.lua", "scada-common/log.lua", "scada-common/types.lua", "scada-common/util.lua"], "graphics": ["graphics/element.lua", "graphics/flasher.lua", "graphics/core.lua", "graphics/elements/textbox.lua", "graphics/elements/displaybox.lua", "graphics/elements/pipenet.lua", "graphics/elements/rectangle.lua", "graphics/elements/div.lua", "graphics/elements/tiling.lua", "graphics/elements/colormap.lua", "graphics/elements/indicators/alight.lua", "graphics/elements/indicators/icon.lua", "graphics/elements/indicators/power.lua", "graphics/elements/indicators/rad.lua", "graphics/elements/indicators/state.lua", "graphics/elements/indicators/light.lua", "graphics/elements/indicators/vbar.lua", "graphics/elements/indicators/coremap.lua", "graphics/elements/indicators/data.lua", "graphics/elements/indicators/hbar.lua", "graphics/elements/indicators/trilight.lua", "graphics/elements/controls/switch_button.lua", "graphics/elements/controls/spinbox_numeric.lua", "graphics/elements/controls/hazard_button.lua", "graphics/elements/controls/push_button.lua", "graphics/elements/controls/radio_button.lua", "graphics/elements/controls/multi_button.lua", "graphics/elements/animations/waiting.lua"], "lockbox": ["lockbox/init.lua", "lockbox/LICENSE", "lockbox/kdf/pbkdf2.lua", "lockbox/util/bit.lua", "lockbox/util/array.lua", "lockbox/util/stream.lua", "lockbox/util/queue.lua", "lockbox/digest/sha2_224.lua", "lockbox/digest/sha1.lua", "lockbox/digest/sha2_256.lua", "lockbox/cipher/aes128.lua", "lockbox/cipher/aes256.lua", "lockbox/cipher/aes192.lua", "lockbox/cipher/mode/ofb.lua", "lockbox/cipher/mode/cbc.lua", "lockbox/cipher/mode/ctr.lua", "lockbox/cipher/mode/cfb.lua", "lockbox/mac/hmac.lua", "lockbox/padding/ansix923.lua", "lockbox/padding/pkcs7.lua", "lockbox/padding/zero.lua", "lockbox/padding/isoiec7816.lua"], "reactor-plc": ["reactor-plc/threads.lua", "reactor-plc/plc.lua", "reactor-plc/config.lua", "reactor-plc/startup.lua"], "rtu": ["rtu/threads.lua", "rtu/rtu.lua", "rtu/modbus.lua", "rtu/config.lua", "rtu/startup.lua", "rtu/dev/sps_rtu.lua", "rtu/dev/envd_rtu.lua", "rtu/dev/boilerv_rtu.lua", "rtu/dev/redstone_rtu.lua", "rtu/dev/sna_rtu.lua", "rtu/dev/imatrix_rtu.lua", "rtu/dev/turbinev_rtu.lua"], "supervisor": ["supervisor/supervisor.lua", "supervisor/unit.lua", "supervisor/config.lua", "supervisor/startup.lua", "supervisor/unitlogic.lua", "supervisor/facility.lua", "supervisor/session/coordinator.lua", "supervisor/session/svqtypes.lua", "supervisor/session/svsessions.lua", "supervisor/session/rtu.lua", "supervisor/session/plc.lua", "supervisor/session/rsctl.lua", "supervisor/session/rtu/boilerv.lua", "supervisor/session/rtu/txnctrl.lua", "supervisor/session/rtu/unit_session.lua", "supervisor/session/rtu/turbinev.lua", "supervisor/session/rtu/envd.lua", "supervisor/session/rtu/imatrix.lua", "supervisor/session/rtu/sps.lua", "supervisor/session/rtu/qtypes.lua", "supervisor/session/rtu/sna.lua", "supervisor/session/rtu/redstone.lua"], "coordinator": ["coordinator/coordinator.lua", "coordinator/renderer.lua", "coordinator/iocontrol.lua", "coordinator/sounder.lua", "coordinator/config.lua", "coordinator/startup.lua", "coordinator/apisessions.lua", "coordinator/process.lua", "coordinator/ui/dialog.lua", "coordinator/ui/style.lua", "coordinator/ui/layout/main_view.lua", "coordinator/ui/layout/unit_view.lua", "coordinator/ui/components/reactor.lua", "coordinator/ui/components/processctl.lua", "coordinator/ui/components/unit_overview.lua", "coordinator/ui/components/boiler.lua", "coordinator/ui/components/unit_detail.lua", "coordinator/ui/components/imatrix.lua", "coordinator/ui/components/unit_waiting.lua", "coordinator/ui/components/turbine.lua"], "pocket": ["pocket/config.lua", "pocket/startup.lua"]}, "depends": {"reactor-plc": ["system", "common"], "rtu": ["system", "common"], "supervisor": ["system", "common"], "coordinator": ["system", "common", "graphics"], "pocket": ["system", "common", "graphics"]}, "sizes": {"manifest": 4646, "system": 1982, "common": 91084, "graphics": 99858, "lockbox": 100797, "reactor-plc": 75529, "rtu": 82913, "supervisor": 274491, "coordinator": 180346, "pocket": 335}}

View File

@@ -1,415 +0,0 @@
local Array = require("lockbox.util.array");
local Bit = require("lockbox.util.bit");
local XOR = Bit.bxor;
local SBOX = {
[0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
local ISBOX = {
[0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
local ROW_SHIFT = { 1, 6, 11, 16, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, };
local IROW_SHIFT = { 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3, 16, 13, 10, 7, 4, };
local ETABLE = {
[0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
local LTABLE = {
[0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
local MIXTABLE = {
0x02, 0x03, 0x01, 0x01,
0x01, 0x02, 0x03, 0x01,
0x01, 0x01, 0x02, 0x03,
0x03, 0x01, 0x01, 0x02};
local IMIXTABLE = {
0x0E, 0x0B, 0x0D, 0x09,
0x09, 0x0E, 0x0B, 0x0D,
0x0D, 0x09, 0x0E, 0x0B,
0x0B, 0x0D, 0x09, 0x0E};
local RCON = {
[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
local GMUL = function(A, B)
if(A == 0x01) then return B; end
if(B == 0x01) then return A; end
if(A == 0x00) then return 0; end
if(B == 0x00) then return 0; end
local LA = LTABLE[A];
local LB = LTABLE[B];
local sum = LA + LB;
if (sum > 0xFF) then sum = sum - 0xFF; end
return ETABLE[sum];
end
local byteSub = Array.substitute;
local shiftRow = Array.permute;
local mixCol = function(i, mix)
local out = {};
local a, b, c, d;
a = GMUL(i[ 1], mix[ 1]);
b = GMUL(i[ 2], mix[ 2]);
c = GMUL(i[ 3], mix[ 3]);
d = GMUL(i[ 4], mix[ 4]);
out[ 1] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 5]);
b = GMUL(i[ 2], mix[ 6]);
c = GMUL(i[ 3], mix[ 7]);
d = GMUL(i[ 4], mix[ 8]);
out[ 2] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 9]);
b = GMUL(i[ 2], mix[10]);
c = GMUL(i[ 3], mix[11]);
d = GMUL(i[ 4], mix[12]);
out[ 3] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[13]);
b = GMUL(i[ 2], mix[14]);
c = GMUL(i[ 3], mix[15]);
d = GMUL(i[ 4], mix[16]);
out[ 4] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 1]);
b = GMUL(i[ 6], mix[ 2]);
c = GMUL(i[ 7], mix[ 3]);
d = GMUL(i[ 8], mix[ 4]);
out[ 5] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 5]);
b = GMUL(i[ 6], mix[ 6]);
c = GMUL(i[ 7], mix[ 7]);
d = GMUL(i[ 8], mix[ 8]);
out[ 6] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 9]);
b = GMUL(i[ 6], mix[10]);
c = GMUL(i[ 7], mix[11]);
d = GMUL(i[ 8], mix[12]);
out[ 7] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[13]);
b = GMUL(i[ 6], mix[14]);
c = GMUL(i[ 7], mix[15]);
d = GMUL(i[ 8], mix[16]);
out[ 8] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 1]);
b = GMUL(i[10], mix[ 2]);
c = GMUL(i[11], mix[ 3]);
d = GMUL(i[12], mix[ 4]);
out[ 9] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 5]);
b = GMUL(i[10], mix[ 6]);
c = GMUL(i[11], mix[ 7]);
d = GMUL(i[12], mix[ 8]);
out[10] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 9]);
b = GMUL(i[10], mix[10]);
c = GMUL(i[11], mix[11]);
d = GMUL(i[12], mix[12]);
out[11] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[13]);
b = GMUL(i[10], mix[14]);
c = GMUL(i[11], mix[15]);
d = GMUL(i[12], mix[16]);
out[12] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 1]);
b = GMUL(i[14], mix[ 2]);
c = GMUL(i[15], mix[ 3]);
d = GMUL(i[16], mix[ 4]);
out[13] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 5]);
b = GMUL(i[14], mix[ 6]);
c = GMUL(i[15], mix[ 7]);
d = GMUL(i[16], mix[ 8]);
out[14] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 9]);
b = GMUL(i[14], mix[10]);
c = GMUL(i[15], mix[11]);
d = GMUL(i[16], mix[12]);
out[15] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[13]);
b = GMUL(i[14], mix[14]);
c = GMUL(i[15], mix[15]);
d = GMUL(i[16], mix[16]);
out[16] = XOR(XOR(a, b), XOR(c, d));
return out;
end
local keyRound = function(key, round)
local out = {};
out[ 1] = XOR(key[ 1], XOR(SBOX[key[14]], RCON[round]));
out[ 2] = XOR(key[ 2], SBOX[key[15]]);
out[ 3] = XOR(key[ 3], SBOX[key[16]]);
out[ 4] = XOR(key[ 4], SBOX[key[13]]);
out[ 5] = XOR(out[ 1], key[ 5]);
out[ 6] = XOR(out[ 2], key[ 6]);
out[ 7] = XOR(out[ 3], key[ 7]);
out[ 8] = XOR(out[ 4], key[ 8]);
out[ 9] = XOR(out[ 5], key[ 9]);
out[10] = XOR(out[ 6], key[10]);
out[11] = XOR(out[ 7], key[11]);
out[12] = XOR(out[ 8], key[12]);
out[13] = XOR(out[ 9], key[13]);
out[14] = XOR(out[10], key[14]);
out[15] = XOR(out[11], key[15]);
out[16] = XOR(out[12], key[16]);
return out;
end
local keyExpand = function(key)
local keys = {};
local temp = key;
keys[1] = temp;
for i = 1, 10 do
temp = keyRound(temp, i);
keys[i + 1] = temp;
end
return keys;
end
local addKey = Array.XOR;
local AES = {};
AES.blockSize = 16;
AES.encrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[1]);
--round 1
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[2]);
--round 2
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[3]);
--round 3
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[4]);
--round 4
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[5]);
--round 5
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[6]);
--round 6
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[7]);
--round 7
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[8]);
--round 8
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[9]);
--round 9
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[10]);
--round 10
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = addKey(block, key[11]);
return block;
end
AES.decrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[11]);
--round 1
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[10]);
block = mixCol(block, IMIXTABLE);
--round 2
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[9]);
block = mixCol(block, IMIXTABLE);
--round 3
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[8]);
block = mixCol(block, IMIXTABLE);
--round 4
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[7]);
block = mixCol(block, IMIXTABLE);
--round 5
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[6]);
block = mixCol(block, IMIXTABLE);
--round 6
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[5]);
block = mixCol(block, IMIXTABLE);
--round 7
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[4]);
block = mixCol(block, IMIXTABLE);
--round 8
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[3]);
block = mixCol(block, IMIXTABLE);
--round 9
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[2]);
block = mixCol(block, IMIXTABLE);
--round 10
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[1]);
return block;
end
return AES;

View File

@@ -1,462 +0,0 @@
local Array = require("lockbox.util.array");
local Bit = require("lockbox.util.bit");
local XOR = Bit.bxor;
local SBOX = {
[0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
local ISBOX = {
[0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
local ROW_SHIFT = { 1, 6, 11, 16, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, };
local IROW_SHIFT = { 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3, 16, 13, 10, 7, 4, };
local ETABLE = {
[0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
local LTABLE = {
[0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
local MIXTABLE = {
0x02, 0x03, 0x01, 0x01,
0x01, 0x02, 0x03, 0x01,
0x01, 0x01, 0x02, 0x03,
0x03, 0x01, 0x01, 0x02};
local IMIXTABLE = {
0x0E, 0x0B, 0x0D, 0x09,
0x09, 0x0E, 0x0B, 0x0D,
0x0D, 0x09, 0x0E, 0x0B,
0x0B, 0x0D, 0x09, 0x0E};
local RCON = {
[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
local GMUL = function(A, B)
if(A == 0x01) then return B; end
if(B == 0x01) then return A; end
if(A == 0x00) then return 0; end
if(B == 0x00) then return 0; end
local LA = LTABLE[A];
local LB = LTABLE[B];
local sum = LA + LB;
if (sum > 0xFF) then sum = sum - 0xFF; end
return ETABLE[sum];
end
local byteSub = Array.substitute;
local shiftRow = Array.permute;
local mixCol = function(i, mix)
local out = {};
local a, b, c, d;
a = GMUL(i[ 1], mix[ 1]);
b = GMUL(i[ 2], mix[ 2]);
c = GMUL(i[ 3], mix[ 3]);
d = GMUL(i[ 4], mix[ 4]);
out[ 1] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 5]);
b = GMUL(i[ 2], mix[ 6]);
c = GMUL(i[ 3], mix[ 7]);
d = GMUL(i[ 4], mix[ 8]);
out[ 2] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 9]);
b = GMUL(i[ 2], mix[10]);
c = GMUL(i[ 3], mix[11]);
d = GMUL(i[ 4], mix[12]);
out[ 3] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[13]);
b = GMUL(i[ 2], mix[14]);
c = GMUL(i[ 3], mix[15]);
d = GMUL(i[ 4], mix[16]);
out[ 4] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 1]);
b = GMUL(i[ 6], mix[ 2]);
c = GMUL(i[ 7], mix[ 3]);
d = GMUL(i[ 8], mix[ 4]);
out[ 5] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 5]);
b = GMUL(i[ 6], mix[ 6]);
c = GMUL(i[ 7], mix[ 7]);
d = GMUL(i[ 8], mix[ 8]);
out[ 6] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 9]);
b = GMUL(i[ 6], mix[10]);
c = GMUL(i[ 7], mix[11]);
d = GMUL(i[ 8], mix[12]);
out[ 7] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[13]);
b = GMUL(i[ 6], mix[14]);
c = GMUL(i[ 7], mix[15]);
d = GMUL(i[ 8], mix[16]);
out[ 8] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 1]);
b = GMUL(i[10], mix[ 2]);
c = GMUL(i[11], mix[ 3]);
d = GMUL(i[12], mix[ 4]);
out[ 9] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 5]);
b = GMUL(i[10], mix[ 6]);
c = GMUL(i[11], mix[ 7]);
d = GMUL(i[12], mix[ 8]);
out[10] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 9]);
b = GMUL(i[10], mix[10]);
c = GMUL(i[11], mix[11]);
d = GMUL(i[12], mix[12]);
out[11] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[13]);
b = GMUL(i[10], mix[14]);
c = GMUL(i[11], mix[15]);
d = GMUL(i[12], mix[16]);
out[12] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 1]);
b = GMUL(i[14], mix[ 2]);
c = GMUL(i[15], mix[ 3]);
d = GMUL(i[16], mix[ 4]);
out[13] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 5]);
b = GMUL(i[14], mix[ 6]);
c = GMUL(i[15], mix[ 7]);
d = GMUL(i[16], mix[ 8]);
out[14] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 9]);
b = GMUL(i[14], mix[10]);
c = GMUL(i[15], mix[11]);
d = GMUL(i[16], mix[12]);
out[15] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[13]);
b = GMUL(i[14], mix[14]);
c = GMUL(i[15], mix[15]);
d = GMUL(i[16], mix[16]);
out[16] = XOR(XOR(a, b), XOR(c, d));
return out;
end
local keyRound = function(key, round)
local i = (round - 1) * 24;
local out = key;
out[25 + i] = XOR(key[ 1 + i], XOR(SBOX[key[22 + i]], RCON[round]));
out[26 + i] = XOR(key[ 2 + i], SBOX[key[23 + i]]);
out[27 + i] = XOR(key[ 3 + i], SBOX[key[24 + i]]);
out[28 + i] = XOR(key[ 4 + i], SBOX[key[21 + i]]);
out[29 + i] = XOR(out[25 + i], key[ 5 + i]);
out[30 + i] = XOR(out[26 + i], key[ 6 + i]);
out[31 + i] = XOR(out[27 + i], key[ 7 + i]);
out[32 + i] = XOR(out[28 + i], key[ 8 + i]);
out[33 + i] = XOR(out[29 + i], key[ 9 + i]);
out[34 + i] = XOR(out[30 + i], key[10 + i]);
out[35 + i] = XOR(out[31 + i], key[11 + i]);
out[36 + i] = XOR(out[32 + i], key[12 + i]);
out[37 + i] = XOR(out[33 + i], key[13 + i]);
out[38 + i] = XOR(out[34 + i], key[14 + i]);
out[39 + i] = XOR(out[35 + i], key[15 + i]);
out[40 + i] = XOR(out[36 + i], key[16 + i]);
out[41 + i] = XOR(out[37 + i], key[17 + i]);
out[42 + i] = XOR(out[38 + i], key[18 + i]);
out[43 + i] = XOR(out[39 + i], key[19 + i]);
out[44 + i] = XOR(out[40 + i], key[20 + i]);
out[45 + i] = XOR(out[41 + i], key[21 + i]);
out[46 + i] = XOR(out[42 + i], key[22 + i]);
out[47 + i] = XOR(out[43 + i], key[23 + i]);
out[48 + i] = XOR(out[44 + i], key[24 + i]);
return out;
end
local keyExpand = function(key)
local bytes = Array.copy(key);
for i = 1, 8 do
keyRound(bytes, i);
end
local keys = {};
keys[ 1] = Array.slice(bytes, 1, 16);
keys[ 2] = Array.slice(bytes, 17, 32);
keys[ 3] = Array.slice(bytes, 33, 48);
keys[ 4] = Array.slice(bytes, 49, 64);
keys[ 5] = Array.slice(bytes, 65, 80);
keys[ 6] = Array.slice(bytes, 81, 96);
keys[ 7] = Array.slice(bytes, 97, 112);
keys[ 8] = Array.slice(bytes, 113, 128);
keys[ 9] = Array.slice(bytes, 129, 144);
keys[10] = Array.slice(bytes, 145, 160);
keys[11] = Array.slice(bytes, 161, 176);
keys[12] = Array.slice(bytes, 177, 192);
keys[13] = Array.slice(bytes, 193, 208);
return keys;
end
local addKey = Array.XOR;
local AES = {};
AES.blockSize = 16;
AES.encrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[1]);
--round 1
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[2]);
--round 2
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[3]);
--round 3
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[4]);
--round 4
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[5]);
--round 5
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[6]);
--round 6
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[7]);
--round 7
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[8]);
--round 8
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[9]);
--round 9
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[10]);
--round 10
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[11]);
--round 11
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[12]);
--round 12
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = addKey(block, key[13]);
return block;
end
AES.decrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[13]);
--round 1
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[12]);
block = mixCol(block, IMIXTABLE);
--round 2
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[11]);
block = mixCol(block, IMIXTABLE);
--round 3
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[10]);
block = mixCol(block, IMIXTABLE);
--round 4
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[9]);
block = mixCol(block, IMIXTABLE);
--round 5
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[8]);
block = mixCol(block, IMIXTABLE);
--round 6
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[7]);
block = mixCol(block, IMIXTABLE);
--round 7
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[6]);
block = mixCol(block, IMIXTABLE);
--round 8
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[5]);
block = mixCol(block, IMIXTABLE);
--round 9
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[4]);
block = mixCol(block, IMIXTABLE);
--round 10
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[3]);
block = mixCol(block, IMIXTABLE);
--round 11
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[2]);
block = mixCol(block, IMIXTABLE);
--round 12
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[1]);
return block;
end
return AES;

View File

@@ -1,498 +0,0 @@
local Array = require("lockbox.util.array");
local Bit = require("lockbox.util.bit");
local XOR = Bit.bxor;
local SBOX = {
[0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
local ISBOX = {
[0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
local ROW_SHIFT = { 1, 6, 11, 16, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, };
local IROW_SHIFT = { 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3, 16, 13, 10, 7, 4, };
local ETABLE = {
[0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
local LTABLE = {
[0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
local MIXTABLE = {
0x02, 0x03, 0x01, 0x01,
0x01, 0x02, 0x03, 0x01,
0x01, 0x01, 0x02, 0x03,
0x03, 0x01, 0x01, 0x02};
local IMIXTABLE = {
0x0E, 0x0B, 0x0D, 0x09,
0x09, 0x0E, 0x0B, 0x0D,
0x0D, 0x09, 0x0E, 0x0B,
0x0B, 0x0D, 0x09, 0x0E};
local RCON = {
[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
local GMUL = function(A, B)
if(A == 0x01) then return B; end
if(B == 0x01) then return A; end
if(A == 0x00) then return 0; end
if(B == 0x00) then return 0; end
local LA = LTABLE[A];
local LB = LTABLE[B];
local sum = LA + LB;
if (sum > 0xFF) then sum = sum - 0xFF; end
return ETABLE[sum];
end
local byteSub = Array.substitute;
local shiftRow = Array.permute;
local mixCol = function(i, mix)
local out = {};
local a, b, c, d;
a = GMUL(i[ 1], mix[ 1]);
b = GMUL(i[ 2], mix[ 2]);
c = GMUL(i[ 3], mix[ 3]);
d = GMUL(i[ 4], mix[ 4]);
out[ 1] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 5]);
b = GMUL(i[ 2], mix[ 6]);
c = GMUL(i[ 3], mix[ 7]);
d = GMUL(i[ 4], mix[ 8]);
out[ 2] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 9]);
b = GMUL(i[ 2], mix[10]);
c = GMUL(i[ 3], mix[11]);
d = GMUL(i[ 4], mix[12]);
out[ 3] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[13]);
b = GMUL(i[ 2], mix[14]);
c = GMUL(i[ 3], mix[15]);
d = GMUL(i[ 4], mix[16]);
out[ 4] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 1]);
b = GMUL(i[ 6], mix[ 2]);
c = GMUL(i[ 7], mix[ 3]);
d = GMUL(i[ 8], mix[ 4]);
out[ 5] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 5]);
b = GMUL(i[ 6], mix[ 6]);
c = GMUL(i[ 7], mix[ 7]);
d = GMUL(i[ 8], mix[ 8]);
out[ 6] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 9]);
b = GMUL(i[ 6], mix[10]);
c = GMUL(i[ 7], mix[11]);
d = GMUL(i[ 8], mix[12]);
out[ 7] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[13]);
b = GMUL(i[ 6], mix[14]);
c = GMUL(i[ 7], mix[15]);
d = GMUL(i[ 8], mix[16]);
out[ 8] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 1]);
b = GMUL(i[10], mix[ 2]);
c = GMUL(i[11], mix[ 3]);
d = GMUL(i[12], mix[ 4]);
out[ 9] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 5]);
b = GMUL(i[10], mix[ 6]);
c = GMUL(i[11], mix[ 7]);
d = GMUL(i[12], mix[ 8]);
out[10] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 9]);
b = GMUL(i[10], mix[10]);
c = GMUL(i[11], mix[11]);
d = GMUL(i[12], mix[12]);
out[11] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[13]);
b = GMUL(i[10], mix[14]);
c = GMUL(i[11], mix[15]);
d = GMUL(i[12], mix[16]);
out[12] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 1]);
b = GMUL(i[14], mix[ 2]);
c = GMUL(i[15], mix[ 3]);
d = GMUL(i[16], mix[ 4]);
out[13] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 5]);
b = GMUL(i[14], mix[ 6]);
c = GMUL(i[15], mix[ 7]);
d = GMUL(i[16], mix[ 8]);
out[14] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 9]);
b = GMUL(i[14], mix[10]);
c = GMUL(i[15], mix[11]);
d = GMUL(i[16], mix[12]);
out[15] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[13]);
b = GMUL(i[14], mix[14]);
c = GMUL(i[15], mix[15]);
d = GMUL(i[16], mix[16]);
out[16] = XOR(XOR(a, b), XOR(c, d));
return out;
end
local keyRound = function(key, round)
local i = (round - 1) * 32;
local out = key;
out[33 + i] = XOR(key[ 1 + i], XOR(SBOX[key[30 + i]], RCON[round]));
out[34 + i] = XOR(key[ 2 + i], SBOX[key[31 + i]]);
out[35 + i] = XOR(key[ 3 + i], SBOX[key[32 + i]]);
out[36 + i] = XOR(key[ 4 + i], SBOX[key[29 + i]]);
out[37 + i] = XOR(out[33 + i], key[ 5 + i]);
out[38 + i] = XOR(out[34 + i], key[ 6 + i]);
out[39 + i] = XOR(out[35 + i], key[ 7 + i]);
out[40 + i] = XOR(out[36 + i], key[ 8 + i]);
out[41 + i] = XOR(out[37 + i], key[ 9 + i]);
out[42 + i] = XOR(out[38 + i], key[10 + i]);
out[43 + i] = XOR(out[39 + i], key[11 + i]);
out[44 + i] = XOR(out[40 + i], key[12 + i]);
out[45 + i] = XOR(out[41 + i], key[13 + i]);
out[46 + i] = XOR(out[42 + i], key[14 + i]);
out[47 + i] = XOR(out[43 + i], key[15 + i]);
out[48 + i] = XOR(out[44 + i], key[16 + i]);
out[49 + i] = XOR(SBOX[out[45 + i]], key[17 + i]);
out[50 + i] = XOR(SBOX[out[46 + i]], key[18 + i]);
out[51 + i] = XOR(SBOX[out[47 + i]], key[19 + i]);
out[52 + i] = XOR(SBOX[out[48 + i]], key[20 + i]);
out[53 + i] = XOR(out[49 + i], key[21 + i]);
out[54 + i] = XOR(out[50 + i], key[22 + i]);
out[55 + i] = XOR(out[51 + i], key[23 + i]);
out[56 + i] = XOR(out[52 + i], key[24 + i]);
out[57 + i] = XOR(out[53 + i], key[25 + i]);
out[58 + i] = XOR(out[54 + i], key[26 + i]);
out[59 + i] = XOR(out[55 + i], key[27 + i]);
out[60 + i] = XOR(out[56 + i], key[28 + i]);
out[61 + i] = XOR(out[57 + i], key[29 + i]);
out[62 + i] = XOR(out[58 + i], key[30 + i]);
out[63 + i] = XOR(out[59 + i], key[31 + i]);
out[64 + i] = XOR(out[60 + i], key[32 + i]);
return out;
end
local keyExpand = function(key)
local bytes = Array.copy(key);
for i = 1, 7 do
keyRound(bytes, i);
end
local keys = {};
keys[ 1] = Array.slice(bytes, 1, 16);
keys[ 2] = Array.slice(bytes, 17, 32);
keys[ 3] = Array.slice(bytes, 33, 48);
keys[ 4] = Array.slice(bytes, 49, 64);
keys[ 5] = Array.slice(bytes, 65, 80);
keys[ 6] = Array.slice(bytes, 81, 96);
keys[ 7] = Array.slice(bytes, 97, 112);
keys[ 8] = Array.slice(bytes, 113, 128);
keys[ 9] = Array.slice(bytes, 129, 144);
keys[10] = Array.slice(bytes, 145, 160);
keys[11] = Array.slice(bytes, 161, 176);
keys[12] = Array.slice(bytes, 177, 192);
keys[13] = Array.slice(bytes, 193, 208);
keys[14] = Array.slice(bytes, 209, 224);
keys[15] = Array.slice(bytes, 225, 240);
return keys;
end
local addKey = Array.XOR;
local AES = {};
AES.blockSize = 16;
AES.encrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[1]);
--round 1
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[2]);
--round 2
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[3]);
--round 3
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[4]);
--round 4
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[5]);
--round 5
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[6]);
--round 6
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[7]);
--round 7
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[8]);
--round 8
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[9]);
--round 9
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[10]);
--round 10
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[11]);
--round 11
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[12]);
--round 12
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[13]);
--round 13
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[14]);
--round 14
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = addKey(block, key[15]);
return block;
end
AES.decrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[15]);
--round 1
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[14]);
block = mixCol(block, IMIXTABLE);
--round 2
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[13]);
block = mixCol(block, IMIXTABLE);
--round 3
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[12]);
block = mixCol(block, IMIXTABLE);
--round 4
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[11]);
block = mixCol(block, IMIXTABLE);
--round 5
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[10]);
block = mixCol(block, IMIXTABLE);
--round 6
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[9]);
block = mixCol(block, IMIXTABLE);
--round 7
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[8]);
block = mixCol(block, IMIXTABLE);
--round 8
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[7]);
block = mixCol(block, IMIXTABLE);
--round 9
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[6]);
block = mixCol(block, IMIXTABLE);
--round 10
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[5]);
block = mixCol(block, IMIXTABLE);
--round 11
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[4]);
block = mixCol(block, IMIXTABLE);
--round 12
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[3]);
block = mixCol(block, IMIXTABLE);
--round 13
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[2]);
block = mixCol(block, IMIXTABLE);
--round 14
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[1]);
return block;
end
return AES;

View File

@@ -1,164 +0,0 @@
local Array = require("lockbox.util.array");
local Stream = require("lockbox.util.stream");
local Queue = require("lockbox.util.queue");
local CBC = {};
CBC.Cipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = Array.XOR(iv, block);
out = blockCipher.encrypt(key, out);
Array.writeToQueue(outputQueue, out);
iv = out;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
CBC.Decipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = block;
out = blockCipher.decrypt(key, out);
out = Array.XOR(iv, out);
Array.writeToQueue(outputQueue, out);
iv = block;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
return CBC;

View File

@@ -1,163 +0,0 @@
local Array = require("lockbox.util.array");
local Stream = require("lockbox.util.stream");
local Queue = require("lockbox.util.queue");
local CFB = {};
CFB.Cipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
iv = out;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
CFB.Decipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
iv = block;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
return CFB;

View File

@@ -1,248 +0,0 @@
local Array = require("lockbox.util.array");
local Stream = require("lockbox.util.stream");
local Queue = require("lockbox.util.queue");
local Bit = require("lockbox.util.bit");
local AND = Bit.band;
local CTR = {};
CTR.Cipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
local updateIV = function()
iv[16] = iv[16] + 1;
if iv[16] <= 0xFF then return; end
iv[16] = AND(iv[16], 0xFF);
iv[15] = iv[15] + 1;
if iv[15] <= 0xFF then return; end
iv[15] = AND(iv[15], 0xFF);
iv[14] = iv[14] + 1;
if iv[14] <= 0xFF then return; end
iv[14] = AND(iv[14], 0xFF);
iv[13] = iv[13] + 1;
if iv[13] <= 0xFF then return; end
iv[13] = AND(iv[13], 0xFF);
iv[12] = iv[12] + 1;
if iv[12] <= 0xFF then return; end
iv[12] = AND(iv[12], 0xFF);
iv[11] = iv[11] + 1;
if iv[11] <= 0xFF then return; end
iv[11] = AND(iv[11], 0xFF);
iv[10] = iv[10] + 1;
if iv[10] <= 0xFF then return; end
iv[10] = AND(iv[10], 0xFF);
iv[9] = iv[9] + 1;
if iv[9] <= 0xFF then return; end
iv[9] = AND(iv[9], 0xFF);
return;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
updateIV();
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
CTR.Decipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
local updateIV = function()
iv[16] = iv[16] + 1;
if iv[16] <= 0xFF then return; end
iv[16] = AND(iv[16], 0xFF);
iv[15] = iv[15] + 1;
if iv[15] <= 0xFF then return; end
iv[15] = AND(iv[15], 0xFF);
iv[14] = iv[14] + 1;
if iv[14] <= 0xFF then return; end
iv[14] = AND(iv[14], 0xFF);
iv[13] = iv[13] + 1;
if iv[13] <= 0xFF then return; end
iv[13] = AND(iv[13], 0xFF);
iv[12] = iv[12] + 1;
if iv[12] <= 0xFF then return; end
iv[12] = AND(iv[12], 0xFF);
iv[11] = iv[11] + 1;
if iv[11] <= 0xFF then return; end
iv[11] = AND(iv[11], 0xFF);
iv[10] = iv[10] + 1;
if iv[10] <= 0xFF then return; end
iv[10] = AND(iv[10], 0xFF);
iv[9] = iv[9] + 1;
if iv[9] <= 0xFF then return; end
iv[9] = AND(iv[9], 0xFF);
return;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
updateIV();
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
return CTR;

Some files were not shown because too many files have changed in this diff Show More