Compare commits

..

143 Commits

Author SHA1 Message Date
Mikayla
56377ef595 Merge pull request #322 from MikaylaFischler/devel
2023.08.22 Hotfix 2
2023-08-22 21:49:32 -04:00
Mikayla Fischler
95c300e450 #321 fixed boiler flow indicators on flow monitor 2023-08-22 21:46:34 -04:00
Mikayla
2985898b7e Merge pull request #320 from MikaylaFischler/devel
2023.08.22 Hotfix
2023-08-22 20:05:53 -04:00
Mikayla Fischler
57d50e6745 #319 updated installer version 2023-08-22 19:56:47 -04:00
Mikayla Fischler
3dc1a06969 #319 fixed installer bug on fresh install 2023-08-22 19:55:34 -04:00
Mikayla Fischler
fcba935240 updated readme with new installer 2023-08-22 19:13:34 -04:00
Mikayla Fischler
9b32bb4675 deleted legacy install manifest for v1.0 installer 2023-08-22 19:06:36 -04:00
Mikayla
f59f484e7b Merge pull request #317 from MikaylaFischler/devel
2023.08.22 Release
2023-08-22 18:42:21 -04:00
Mikayla Fischler
0fe9b391d8 #313 installer self-update fix, added update command for it 2023-08-21 22:47:00 -04:00
Mikayla
97f0191875 #313 installer self update 2023-08-22 02:18:25 +00:00
Mikayla Fischler
70db8d782c fixed unit dynamic tank state indicator 2023-08-21 22:05:02 -04:00
Mikayla
2acd166c3e Merge pull request #316 from MikaylaFischler/232-waste-valve-and-flow-monitoring-display
232 Waste Valve and Flow Monitoring Display
2023-08-21 21:54:22 -04:00
Mikayla Fischler
c78f7e173a #232 cleanup, changed antimatter rate to be integer on main display 2023-08-21 21:53:31 -04:00
Mikayla Fischler
99a0b0a55a #232 documentation and refactor 2023-08-21 21:44:15 -04:00
Mikayla Fischler
6e51e70b62 #232 cleanup and fixes 2023-08-21 21:37:56 -04:00
Mikayla Fischler
fd2abad5cf changed some green/red indicators to be green/gray for contrast 2023-08-21 21:35:32 -04:00
Mikayla Fischler
b93c6b7c6e fixes per luacheck 2023-08-20 23:53:49 -04:00
Mikayla Fischler
8b3f558f68 Merge branch 'devel' into 232-waste-valve-and-flow-monitoring-display 2023-08-20 23:43:07 -04:00
Mikayla Fischler
8c5289867c #232 updated coordinator monitor disconnect/reconnect handling for changes 2023-08-20 23:28:48 -04:00
Mikayla Fischler
d179920565 #232 option to disable flow view screen for legacy setups 2023-08-20 23:23:23 -04:00
Mikayla Fischler
504ee0594f #315 switch off dynamic tank fill mode if emergency coolant is required 2023-08-20 22:56:51 -04:00
Mikayla Fischler
a92f182156 #232 fixed incorrect arrows on turbine flow view 2023-08-20 22:53:14 -04:00
Mikayla Fischler
c5d38a5584 #232 added container mode indicators for tanks 2023-08-20 17:30:34 -04:00
Mikayla Fischler
9bf07e6c3e completed work on updated pipenet 2023-08-20 17:04:14 -04:00
Mikayla Fischler
7656936982 #232 cleanup, added general stats 2023-08-20 16:52:12 -04:00
Mikayla Fischler
f477ad9426 #232 re-indexed valve IDs 2023-08-19 23:28:03 -04:00
Mikayla Fischler
59950e9d15 #232 connected valve indicators 2023-08-19 23:24:20 -04:00
Mikayla Fischler
11d86d92eb #232 bugfixes and linked up indicators to data 2023-08-19 20:06:37 -04:00
Mikayla Fischler
1275f61113 #232 refactor and fixed sv config verify 2023-08-19 13:42:07 -04:00
Mikayla Fischler
d17e2b8321 #232 completed display of flow/dynamic tank/sps, dynamically sized 2023-08-19 13:38:05 -04:00
Mikayla Fischler
ce780c3d72 added common color pairs to coordinator style 2023-08-13 00:51:37 -04:00
Mikayla Fischler
76ab4e17bf #232 WIP full flow view drawn out 2023-08-13 00:11:58 -04:00
Mikayla Fischler
ac1733c46e #314 20s grace period for coordinator render to finish to prevent timeouts 2023-08-12 15:16:37 -04:00
Mikayla
17731de61b #312 improved reactor peripheral handling 2023-08-11 14:20:13 +00:00
Mikayla Fischler
d85385c1fe #232 continued work on flow monitor, added SPS display 2023-08-10 23:31:38 -04:00
Mikayla Fischler
e0809f52a6 #232 WIP coordinator flow view 2023-08-09 23:26:06 -04:00
Mikayla Fischler
b2c55f9d4b #303 check modem message distance for nil 2023-08-02 10:13:54 -04:00
Mikayla
ba896ea163 Merge pull request #302 from MikaylaFischler/common-cleanup
Common Cleanup
2023-07-30 21:38:18 -04:00
Mikayla Fischler
1a64591256 #282 version the common directory 2023-07-30 20:46:04 -04:00
Mikayla Fischler
9ce75eb4bd #283 common cleanup, added lockbox version to crash dump, changed crash handler to pcall requires for graphics/lockbox 2023-07-30 12:24:54 -04:00
Mikayla
451f804f87 Merge pull request #301 from MikaylaFischler/rtu-speaker-system
RTU Speaker System and Pocket Diagnostics
2023-07-30 00:14:49 -04:00
Mikayla Fischler
724d13510d optimizations and cleanup for pull request 2023-07-30 00:13:26 -04:00
Mikayla Fischler
3f01ce7ec5 lowered SVS queue process time limit warning to debug level 2023-07-29 18:44:17 -04:00
Mikayla Fischler
df67795239 #290 pocket page management and alarm test tool, supervisor pocket diagnostics system 2023-07-29 18:16:59 -04:00
Mikayla Fischler
775d4dc95b #264 improvements to RTU speaker sounder 2023-07-29 17:57:51 -04:00
Mikayla Fischler
b3c7263bc4 #299 fixed mouse events passing to hidden elements 2023-07-29 00:25:20 -04:00
Mikayla Fischler
9f8732830c #264, #280 fixed sounder issues 2023-07-26 22:37:25 -04:00
Mikayla Fischler
1c87ef18a1 #297 added tone packet to valid MGMT packet types 2023-07-26 21:33:43 -04:00
Mikayla Fischler
f111b711c5 #264, #280 send tones to RTUs 2023-07-26 21:02:34 -04:00
Mikayla Fischler
92d1945bea #264 WIP RTU alarm sounders 2023-07-26 20:48:44 -04:00
Mikayla Fischler
4192ea426c #280 moved alarm sounder logic to supervisor and tone control to common 2023-07-26 20:48:11 -04:00
Mikayla
7bd8f34773 update README.md 2023-07-19 20:06:13 -04:00
Mikayla
bdbb3071b3 Merge pull request #294 from MikaylaFischler/devel
2023.07.19 Hotfix
2023-07-19 19:18:48 -04:00
Mikayla Fischler
def02a94d2 #293 fixed race condition with graphics element IDs 2023-07-19 11:27:33 -04:00
Mikayla Fischler
681bb0963e #291 RTU comms thread no longer yields every packet 2023-07-18 22:28:43 -04:00
Mikayla
8f7d7c3ead Merge pull request #288 from MikaylaFischler/devel
2023.07.17 Hotfix
2023-07-17 22:48:03 -04:00
Mikayla Fischler
c0f45cfb8b updated comments 2023-07-17 22:47:19 -04:00
Mikayla Fischler
455653074a #287 fixed coordinator not notifying supervisor of auto waste config 2023-07-17 22:09:21 -04:00
Mikayla Fischler
1202289fab #285 #286 mitigated false trips 2023-07-17 20:59:45 -04:00
Mikayla
acb7b5b4cb update README.md with new installer pastebin 2023-07-16 21:29:41 -04:00
Mikayla
9bd79dacad Merge pull request #281 from MikaylaFischler/devel
2023.07.16 Release
2023-07-16 21:25:00 -04:00
Mikayla Fischler
c544d140bf installer key handling improvements 2023-07-16 21:21:33 -04:00
Mikayla Fischler
353cb3622b improved installer any key detection 2023-07-16 21:11:27 -04:00
Mikayla Fischler
b54f15bad6 #274 bugfixes and optimizations 2023-07-16 21:07:37 -04:00
Mikayla Fischler
4d9783beca fixed installer clean bug 2023-07-16 20:58:34 -04:00
Mikayla Fischler
5529774b0e changed installer press enter to continue to any key, fixed some text colors 2023-07-16 20:53:39 -04:00
Mikayla Fischler
2a541ef3fe #274 cleanup functionality added to installer 2023-07-16 19:42:20 -04:00
Mikayla Fischler
e1b4d72ef8 updated legacy install manifest 2023-07-15 13:33:51 -04:00
Mikayla Fischler
6a0992c7a4 removed unused variable 2023-07-15 13:33:18 -04:00
Mikayla Fischler
cff7c724be #272 fixed bug with transmitting unit dynamic tank table 2023-07-15 13:31:48 -04:00
Mikayla Fischler
47bda73afe #272 basic dynamic tank data in supervisor and coordinator 2023-07-15 13:16:36 -04:00
Mikayla
8daedc109c added discord info to readme 2023-07-13 13:50:17 -04:00
Mikayla Fischler
a164c18a50 removed unused fields from dynamic tank rtu 2023-07-13 12:19:25 -04:00
Mikayla Fischler
4d663ada8d added high contrast yellow to rtu/plc/coord front panels 2023-07-12 13:38:37 -04:00
Mikayla Fischler
084a153a79 #268 fixed incorrect info print on extra wireless modem connection 2023-07-11 21:06:47 -04:00
Mikayla Fischler
4ed6ec1c63 correctly print new messages without overwrites in dmesg even if a prior message is a progress one 2023-07-11 21:01:24 -04:00
Mikayla Fischler
d3c2ba7bee update install manifest 2023-07-11 20:32:37 -04:00
Mikayla Fischler
55ff9dad4b #249 coordinator handle monitor disconnects/reconnects 2023-07-11 20:32:10 -04:00
Mikayla Fischler
0d6022f5e3 fixed always reporting failure to connect to supervisor even when inaccurate 2023-07-11 18:31:53 -04:00
Mikayla Fischler
8b136d78a8 #268 better handling of wireless modem peripherals 2023-07-11 18:22:09 -04:00
Mikayla Fischler
a5214730ef #260 added dynamic tank RTU 2023-07-11 17:27:03 -04:00
Mikayla Fischler
9f3ad3caf0 removed PLC establish packet handling when already linked 2023-07-11 16:17:24 -04:00
Mikayla
9bb2a99be5 Merge pull request #279 from MikaylaFischler/265-coordinator-front-panel
265 coordinator front panel
2023-07-11 15:37:17 -04:00
Mikayla Fischler
65ace26258 corrected comments 2023-07-11 15:36:41 -04:00
Mikayla Fischler
61d975d13f updated error messages for consistency 2023-07-11 15:15:44 -04:00
Mikayla Fischler
1d7d6e9817 update legacy install manifest 2023-07-11 13:38:21 -04:00
Mikayla Fischler
a2e0999cea combine coordinator supervisor connection event loop with main loop 2023-07-11 13:32:26 -04:00
Mikayla Fischler
1edee7f64b updated graphics comments 2023-07-09 23:42:44 -04:00
Mikayla Fischler
df61ec2c62 #265 coordinator front panel 2023-07-09 23:31:56 -04:00
Mikayla Fischler
bf7a316b04 don't start flasher if already started 2023-07-09 23:24:41 -04:00
Mikayla Fischler
96c4444184 corrected some comments 2023-07-09 23:22:24 -04:00
Mikayla Fischler
59eac62c33 #270 validate reactor PLC status packet types 2023-07-08 18:07:40 -04:00
Mikayla
ab193db153 Merge pull request #277 from MikaylaFischler/25-process-waste-control
25 process waste control
2023-07-08 17:12:23 -04:00
Mikayla Fischler
7d65bba589 fixes/cleanups for pull request 2023-07-08 17:11:51 -04:00
Mikayla Fischler
dcef5a96f0 removed unused function 2023-07-08 16:57:41 -04:00
Mikayla Fischler
ba0900ac65 #25 sna/sps integration, plutonium fallback, waste rate reporting 2023-07-08 16:57:13 -04:00
Mikayla Fischler
8f54e95519 #25 continued WIP waste control, main view updated and unit fields modified 2023-07-06 01:36:06 -04:00
Mikayla Fischler
7b9824b6f9 added checkbox graphics element 2023-07-01 19:40:33 -04:00
Mikayla Fischler
b6835fc7d1 #276 updated readme 2023-06-29 16:54:46 -04:00
Mikayla
bc5a94cd3b Update README.md 2023-06-29 12:57:25 -04:00
Mikayla
2a3d868402 Merge pull request #273 from MikaylaFischler/devel
2023.06.29 Release
2023-06-29 12:33:12 -04:00
Mikayla Fischler
b998634da1 installer fixes 2023-06-29 12:29:30 -04:00
Mikayla
5225380523 Merge pull request #271 from MikaylaFischler/51-hmac-message-authentication
HMAC Message Authentication
2023-06-27 19:09:38 -04:00
Mikayla Fischler
0e7ea7102c removed extra verbose comment in configs 2023-06-27 19:08:33 -04:00
Mikayla Fischler
8924ba4e99 cleanup and luacheck fixes 2023-06-27 19:05:51 -04:00
Mikayla Fischler
a8071db08e #51 send serialized data to properly MAC 2023-06-27 18:36:16 -04:00
Mikayla Fischler
fb3c7ded06 updated lockbox benchmark 2023-06-26 20:44:55 -04:00
Mikayla Fischler
f6b0a49904 added graphics version to crash dump 2023-06-26 14:03:36 -04:00
Mikayla Fischler
bfbbfb164b #51 include versioned lockbox in installer, reduced installer file size 2023-06-25 17:53:02 -04:00
Mikayla Fischler
57763702ff #51 init mac component from config key 2023-06-25 14:00:18 -04:00
Mikayla Fischler
f469754bb7 #51 network file cleanup 2023-06-25 13:06:03 -04:00
Mikayla Fischler
336662de62 #51 nic integration with rtu and supervisor 2023-06-25 12:59:38 -04:00
Mikayla Fischler
9073009eb0 #51 usage of nic.receive and some cleanup 2023-06-23 14:12:41 -04:00
Mikayla Fischler
ffac6996ed #51 PLC changes for new networking 2023-06-23 13:52:24 -04:00
Mikayla Fischler
da3c92b3bf Merge branch 'devel' into 51-hmac-message-authentication 2023-06-22 16:05:46 -04:00
Mikayla
712c7a8f3b #266 added health check to ppm and strengthened reliability of RTU hw state reporting 2023-06-22 19:46:17 +00:00
Mikayla
737afe586d renamed lockbox benchmark 2023-06-22 14:22:32 +00:00
Mikayla
d69796b607 lockbox benchmark cleanup 2023-06-22 14:21:00 +00:00
Mikayla
1cdf66a8c3 #51 WIP network interface controller 2023-06-21 23:04:39 +00:00
Mikayla
282c7db3eb Merge branch 'devel' into 51-hmac-message-authentication 2023-06-18 19:23:56 +00:00
Mikayla Fischler
a02529b9f7 #263 fixed bug with supervisor group map length not matching number of reactors 2023-06-18 15:19:01 -04:00
Mikayla Fischler
af38025f50 #262 don't ever abort RTU unit parsing on error, just skip 2023-06-18 14:26:38 -04:00
Mikayla Fischler
b28e4d1e95 #258 installer bugfix 2023-06-18 14:04:49 -04:00
Mikayla Fischler
75dfa3ae73 #258 luacheck fix 2023-06-18 13:16:28 -04:00
Mikayla Fischler
4a3455fa60 #258 luacheck fix 2023-06-18 13:13:34 -04:00
Mikayla Fischler
a2fa6570dc #258 installer improvement 2023-06-18 13:12:34 -04:00
Mikayla Fischler
aef8281ad6 #258 more installer fixes 2023-06-18 01:19:00 -04:00
Mikayla Fischler
d42327a20d #258 bugfixes 2023-06-18 01:09:46 -04:00
Mikayla Fischler
49db75f34d #258 installer bugfix 2023-06-18 01:04:40 -04:00
Mikayla Fischler
bc87030491 #258 installer improvements and test change to graphics version 2023-06-18 00:48:06 -04:00
Mikayla Fischler
9266d7d8e1 #258 versioned graphics component 2023-06-18 00:40:01 -04:00
Mikayla
ef5567ad46 #51 hmac verification 2023-06-11 18:26:55 +00:00
Mikayla Fischler
302f3d913f unlikely to use ldoc due to incompatibilities with vscode lua extension luadocs 2023-06-08 11:39:07 -04:00
Mikayla Fischler
650b9c1811 #244 luadoc actions fixes 2023-06-08 10:58:06 -04:00
Mikayla Fischler
543ac8c9fe updated ldoc version 2023-06-08 10:50:39 -04:00
Mikayla Fischler
7f19f76c0b update comment to force re-run 2023-06-08 10:46:35 -04:00
Mikayla
8d76c86309 fixed pages.yml format error 2023-06-08 10:42:49 -04:00
Mikayla Fischler
a4be6a6dde #244 luadoc in github actions 2023-06-08 10:41:44 -04:00
Mikayla Fischler
8b926a0978 #257 tick supervisor version to force installers to re-pull graphics 2023-06-07 21:42:21 -04:00
Mikayla Fischler
775ffc8094 added graphics to supervisor depends 2023-06-07 21:25:42 -04:00
Mikayla
13a8435f6c Merge pull request #256 from MikaylaFischler/devel
2023.06.07 Hotfix
2023-06-07 18:42:29 -04:00
Mikayla Fischler
5d6dda5619 #255 fixed rectangle element not offsetting mouse events 2023-06-07 18:38:00 -04:00
Mikayla
f8221ad0f1 update README.md with new pastebin link 2023-06-07 18:16:36 -04:00
136 changed files with 6761 additions and 5034 deletions

View File

@@ -1,5 +1,5 @@
# Simple workflow for deploying static content to GitHub Pages # Deploy installation manifests and shields versions
name: Deploy Installation Manifests and Versions name: Deploy Installation Data
on: on:
workflow_dispatch: workflow_dispatch:

2
.gitignore vendored
View File

@@ -1,2 +1,2 @@
_notes/ _notes/
program.sh /*program.sh

View File

@@ -7,6 +7,29 @@ Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fi
![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=latest&label=latest) ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=latest&label=latest)
![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=devel&label=devel) ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=devel&label=devel)
### [Join](https://discord.gg/R9NSCkhcwt) the Discord!
![Discord](https://img.shields.io/discord/1129075839288496259)
## Released Component Versions
![Installer](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Finstaller.json)
![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
![Graphics](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fgraphics.json)
![Lockbox](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Flockbox.json)
![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
![RTU](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Frtu.json)
![Supervisor](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fsupervisor.json)
![Coordinator](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcoordinator.json)
![Pocket](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fpocket.json)
## Requirements
Mod Requirements: Mod Requirements:
- CC: Tweaked - CC: Tweaked
- Mekanism v10.1+ - Mekanism v10.1+
@@ -16,32 +39,11 @@ Mod Recommendations:
v10.1+ is required due the complete support of CC:Tweaked added in Mekanism v10.1 v10.1+ is required due the complete support of CC:Tweaked added in Mekanism v10.1
There was also an apparent bug with boilers disconnecting and reconnecting when active in my test world on 10.0.24, so it may not even have been an option to fully implement this with support for 10.0.
## Released Component Versions
### Core
![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
### Utilities
![Installer](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Finstaller.json)
### Applications
![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
![RTU](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Frtu.json)
![Supervisor](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fsupervisor.json)
![Coordinator](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcoordinator.json)
![Pocket](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fpocket.json)
## Installation ## Installation
You can install this on a ComputerCraft computer using either: You can install this on a ComputerCraft computer using either:
* `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua` * `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua`
* `pastebin get iUMjgW0C ccmsi.lua` * `pastebin get sqUN6VUb ccmsi.lua`
## [SCADA](https://en.wikipedia.org/wiki/SCADA) ## [SCADA](https://en.wikipedia.org/wiki/SCADA)
> Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery. > Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery.
@@ -86,14 +88,8 @@ A vaguely-modbus [modbus](https://en.wikipedia.org/wiki/Modbus) communication pr
- Input Registers: Multi-Byte Read-Only (analog inputs) - Input Registers: Multi-Byte Read-Only (analog inputs)
- Holding Registers: Multi-Byte Read/Write (analog I/O) - Holding Registers: Multi-Byte Read/Write (analog I/O)
### Security and Encryption ### Security
TBD, I am planning on AES symmetric encryption for security + HMAC to prevent replay attacks. This will be done utilizing this codebase: https://github.com/somesocks/lua-lockbox. HMAC message authentication is available as a configuration option to prevent replay attacks and generally prevent control or false data reporting within a system's network. This is done utilizing the [lua-lockbox](https://github.com/somesocks/lua-lockbox) project.
This is somewhat important here as otherwise anyone can just control your setup, which is undeseriable. Unlike normal Minecraft PVP chaos, it would be very difficult to identify who is messing with your system, as with an Ender Modem they can do it from effectively anywhere and the server operators would have to check every computer's filesystem to find suspicious code. The other, simpler security feature is to enforce a maximum authorized transmission range, which is also a configurable feature on each device.
The other security mitigation for commanding (no effect on monitoring) is to enforce a maximum authorized transmission range, which has been added as a configurable feature.
## Known Issues
None yet since the switch to requiring 10.1+!

696
ccmsi.lua
View File

@@ -1,8 +1,6 @@
--
-- ComputerCraft Mekanism SCADA System Installer Utility
--
--[[ --[[
CC-MEK-SCADA Installer Utility
Copyright (c) 2023 Mikayla Fischler Copyright (c) 2023 Mikayla Fischler
Permission is hereby granted, free of charge, to any person obtaining a copy of this software and Permission is hereby granted, free of charge, to any person obtaining a copy of this software and
@@ -20,30 +18,97 @@ SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
local function println(message) print(tostring(message)) end local function println(message) print(tostring(message)) end
local function print(message) term.write(tostring(message)) end local function print(message) term.write(tostring(message)) end
local CCMSI_VERSION = "v1.2" local CCMSI_VERSION = "v1.9a"
local install_dir = "/.install-cache" local install_dir = "/.install-cache"
local manifest_path = "https://mikaylafischler.github.io/cc-mek-scada/manifests/" local manifest_path = "https://mikaylafischler.github.io/cc-mek-scada/manifests/"
local repo_path = "http://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/" local repo_path = "http://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/"
local opts = { ... } local opts = { ... }
local mode = nil local mode, app, target
local app = nil local install_manifest = manifest_path .. "main/install_manifest.json"
local function red() term.setTextColor(colors.red) end
local function orange() term.setTextColor(colors.orange) end
local function yellow() term.setTextColor(colors.yellow) end
local function green() term.setTextColor(colors.green) end
local function blue() term.setTextColor(colors.blue) end
local function white() term.setTextColor(colors.white) end
local function lgray() term.setTextColor(colors.lightGray) end
-- get command line option in list
local function get_opt(opt, options)
for _, v in pairs(options) do if opt == v then return v end end
return nil
end
-- wait for any key to be pressed
---@diagnostic disable-next-line: undefined-field
local function any_key() os.pullEvent("key_up") end
-- ask the user yes or no
local function ask_y_n(question, default)
print(question)
if default == true then print(" (Y/n)? ") else print(" (y/N)? ") end
local response = read();any_key()
if response == "" then return default
elseif response == "Y" or response == "y" then return true
elseif response == "N" or response == "n" then return false
else return nil end
end
-- print out a white + blue text message
local function pkg_message(message, package) white();print(message .. " ");blue();println(package);white() end
-- indicate actions to be taken based on package differences for installs/updates
local function show_pkg_change(name, v)
if v.v_local ~= nil then
if v.v_local ~= v.v_remote then
print("[" .. name .. "] updating ");blue();print(v.v_local);white();print(" \xbb ");blue();println(v.v_remote);white()
elseif mode == "install" then
pkg_message("[" .. name .. "] reinstalling", v.v_local)
end
else pkg_message("[" .. name .. "] new install of", v.v_remote) end
return v.v_local ~= v.v_remote
end
-- read the local manifest file
local function read_local_manifest()
local local_ok = false
local local_manifest = {}
local imfile = fs.open("install_manifest.json", "r")
if imfile ~= nil then
local_ok, local_manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
imfile.close()
end
return local_ok, local_manifest
end
-- get the manifest from GitHub
local function get_remote_manifest()
local response, error = http.get(install_manifest)
if response == nil then
orange();println("Failed to get installation manifest from GitHub, cannot update or install.")
red();println("HTTP error: " .. error);white()
return false, {}
end
local ok, manifest = pcall(function () return textutils.unserializeJSON(response.readAll()) end)
if not ok then red();println("error parsing remote installation manifest");white() end
return ok, manifest
end
-- record the local installation manifest -- record the local installation manifest
---@param manifest table
---@param dependencies table
local function write_install_manifest(manifest, dependencies) local function write_install_manifest(manifest, dependencies)
local versions = {} local versions = {}
for key, value in pairs(manifest.versions) do for key, value in pairs(manifest.versions) do
local is_dependency = false local is_dependency = false
for _, dependency in pairs(dependencies) do for _, dependency in pairs(dependencies) do
if key == "bootloader" and dependency == "system" then if (key == "bootloader" and dependency == "system") or key == dependency then
is_dependency = true is_dependency = true;break
break
end end
end end
if key == app or key == "comms" or is_dependency then versions[key] = value end if key == app or key == "comms" or is_dependency then versions[key] = value end
end end
@@ -54,116 +119,141 @@ local function write_install_manifest(manifest, dependencies)
imfile.close() imfile.close()
end end
-- -- recursively build a tree out of the file manifest
local function gen_tree(manifest)
local function _tree_add(tree, split)
if #split > 1 then
local name = table.remove(split, 1)
if tree[name] == nil then tree[name] = {} end
table.insert(tree[name], _tree_add(tree[name], split))
else return split[1] end
return nil
end
local list, tree = {}, {}
-- make a list of each and every file
for _, files in pairs(manifest.files) do for i = 1, #files do table.insert(list, files[i]) end end
for i = 1, #list do
local split = {}
string.gsub(list[i], "([^/]+)", function(c) split[#split + 1] = c end)
if #split == 1 then table.insert(tree, list[i])
else table.insert(tree, _tree_add(tree, split)) end
end
return tree
end
local function _in_array(val, array)
for _, v in pairs(array) do if v == val then return true end end
return false
end
local function _clean_dir(dir, tree)
if tree == nil then tree = {} end
local ls = fs.list(dir)
for _, val in pairs(ls) do
local path = dir .. "/" .. val
if fs.isDir(path) then
_clean_dir(path, tree[val])
if #fs.list(path) == 0 then fs.delete(path);println("deleted " .. path) end
elseif not _in_array(val, tree) then
fs.delete(path)
println("deleted " .. path)
end
end
end
-- go through app/common directories to delete unused files
local function clean(manifest)
local root_ext = false
local tree = gen_tree(manifest)
table.insert(tree, "install_manifest.json")
table.insert(tree, "ccmsi.lua")
table.insert(tree, "log.txt")
lgray()
local ls = fs.list("/")
for _, val in pairs(ls) do
if fs.isDir(val) then
if tree[val] ~= nil then _clean_dir("/" .. val, tree[val]) end
if #fs.list(val) == 0 then fs.delete(val);println("deleted " .. val) end
elseif not _in_array(val, tree) then
root_ext = true
yellow();println(val .. " not used")
end
end
white()
if root_ext then println("Files in root directory won't be automatically deleted.") end
end
-- get and validate command line options -- get and validate command line options
--
println("-- CC Mekanism SCADA Installer " .. CCMSI_VERSION .. " --") println("-- CC Mekanism SCADA Installer " .. CCMSI_VERSION .. " --")
if #opts == 0 or opts[1] == "help" then if #opts == 0 or opts[1] == "help" then
println("usage: ccmsi <mode> <app> <tag/branch>") println("usage: ccmsi <mode> <app> <branch>")
println("<mode>") println("<mode>")
term.setTextColor(colors.lightGray) lgray()
println(" check - check latest versions avilable") println(" check - check latest versions avilable")
term.setTextColor(colors.yellow) yellow()
println(" ccmsi check <tag/branch> for target") println(" ccmsi check <branch> for target")
term.setTextColor(colors.lightGray) lgray()
println(" install - fresh install, overwrites config") println(" install - fresh install, overwrites config")
println(" update - update files EXCEPT for config/logs") println(" update - update files EXCEPT for config/logs")
println(" remove - delete files EXCEPT for config/logs") println(" remove - delete files EXCEPT for config/logs")
println(" purge - delete files INCLUDING config/logs") println(" purge - delete files INCLUDING config/logs")
term.setTextColor(colors.white) white();println("<app>");lgray()
println("<app>")
term.setTextColor(colors.lightGray)
println(" reactor-plc - reactor PLC firmware") println(" reactor-plc - reactor PLC firmware")
println(" rtu - RTU firmware") println(" rtu - RTU firmware")
println(" supervisor - supervisor server application") println(" supervisor - supervisor server application")
println(" coordinator - coordinator application") println(" coordinator - coordinator application")
println(" pocket - pocket application") println(" pocket - pocket application")
term.setTextColor(colors.white) println(" installer - ccmsi installer (update only)")
println("<tag/branch>") white();println("<branch>")
term.setTextColor(colors.yellow) lgray();println(" main (default) | latest | devel");white()
println(" second parameter when used with check")
term.setTextColor(colors.lightGray)
println(" note: defaults to main")
println(" target GitHub tag or branch name")
return return
else else
for _, v in pairs({ "check", "install", "update", "remove", "purge" }) do mode = get_opt(opts[1], { "check", "install", "update", "remove", "purge" })
if opts[1] == v then
mode = v
break
end
end
if mode == nil then if mode == nil then
println("unrecognized mode") red();println("Unrecognized mode.");white()
return return
end end
for _, v in pairs({ "reactor-plc", "rtu", "supervisor", "coordinator", "pocket" }) do app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket", "installer" })
if opts[2] == v then
app = v
break
end
end
if app == nil and mode ~= "check" then if app == nil and mode ~= "check" then
println("unrecognized application") red();println("Unrecognized application.");white()
return
elseif app == "installer" and mode ~= "update" then
red();println("Installer app only supports 'update' option.");white()
return return
end end
-- determine target
if mode == "check" then target = opts[2] else target = opts[3] end
if (target ~= "main") and (target ~= "latest") and (target ~= "devel") then
if (target and target ~= "") then yellow();println("Unknown target, defaulting to 'main'");white() end
target = "main"
end
-- set paths
install_manifest = manifest_path .. target .. "/install_manifest.json"
repo_path = repo_path .. target .. "/"
end end
--
-- run selected mode -- run selected mode
--
if mode == "check" then if mode == "check" then
------------------------- local ok, manifest = get_remote_manifest()
-- GET REMOTE MANIFEST -- if not ok then return end
-------------------------
if opts[2] then manifest_path = manifest_path .. opts[2] .. "/" else manifest_path = manifest_path .. "main/" end
local install_manifest = manifest_path .. "install_manifest.json"
local response, error = http.get(install_manifest)
if response == nil then
term.setTextColor(colors.orange)
println("failed to get installation manifest from GitHub, cannot update or install")
term.setTextColor(colors.red)
println("HTTP error: " .. error)
term.setTextColor(colors.white)
return
end
local ok, manifest = pcall(function () return textutils.unserializeJSON(response.readAll()) end)
if not ok then
term.setTextColor(colors.red)
println("error parsing remote installation manifest")
term.setTextColor(colors.white)
return
end
------------------------
-- GET LOCAL MANIFEST --
------------------------
local imfile = fs.open("install_manifest.json", "r")
local local_ok = false
local local_manifest = {}
if imfile ~= nil then
local_ok, local_manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
imfile.close()
end
local local_ok, local_manifest = read_local_manifest()
if not local_ok then if not local_ok then
term.setTextColor(colors.yellow) yellow();println("failed to load local installation information");white()
println("failed to load local installation information")
term.setTextColor(colors.white)
local_manifest = { versions = { installer = CCMSI_VERSION } } local_manifest = { versions = { installer = CCMSI_VERSION } }
else else
local_manifest.versions.installer = CCMSI_VERSION local_manifest.versions.installer = CCMSI_VERSION
@@ -174,190 +264,107 @@ if mode == "check" then
term.setTextColor(colors.purple) term.setTextColor(colors.purple)
print(string.format("%-14s", "[" .. key .. "]")) print(string.format("%-14s", "[" .. key .. "]"))
if key == "installer" or (local_ok and (local_manifest.versions[key] ~= nil)) then if key == "installer" or (local_ok and (local_manifest.versions[key] ~= nil)) then
term.setTextColor(colors.blue) blue();print(local_manifest.versions[key])
print(local_manifest.versions[key])
if value ~= local_manifest.versions[key] then if value ~= local_manifest.versions[key] then
term.setTextColor(colors.white) white();print(" (")
print(" (")
term.setTextColor(colors.cyan) term.setTextColor(colors.cyan)
print(value) print(value);white();println(" available)")
term.setTextColor(colors.white) else green();println(" (up to date)") end
println(" available)")
else else
term.setTextColor(colors.green) lgray();print("not installed");white();print(" (latest ")
println(" (up to date)")
end
else
term.setTextColor(colors.lightGray)
print("not installed")
term.setTextColor(colors.white)
print(" (latest ")
term.setTextColor(colors.cyan) term.setTextColor(colors.cyan)
print(value) print(value);white();println(")")
term.setTextColor(colors.white)
println(")")
end end
end end
if manifest.versions.installer ~= local_manifest.versions.installer then
yellow();println("\nA newer version of the installer is available, it is recommended to update (use 'ccmsi update installer').");white()
end
elseif mode == "install" or mode == "update" then elseif mode == "install" or mode == "update" then
------------------------- local update_installer = app == "installer"
-- GET REMOTE MANIFEST -- local ok, manifest = get_remote_manifest()
------------------------- if not ok then return end
if opts[3] then repo_path = repo_path .. opts[3] .. "/" else repo_path = repo_path .. "main/" end local ver = {
if opts[3] then manifest_path = manifest_path .. opts[3] .. "/" else manifest_path = manifest_path .. "main/" end app = { v_local = nil, v_remote = nil, changed = false },
local install_manifest = manifest_path .. "install_manifest.json" boot = { v_local = nil, v_remote = nil, changed = false },
comms = { v_local = nil, v_remote = nil, changed = false },
local response, error = http.get(install_manifest) common = { v_local = nil, v_remote = nil, changed = false },
graphics = { v_local = nil, v_remote = nil, changed = false },
if response == nil then lockbox = { v_local = nil, v_remote = nil, changed = false }
term.setTextColor(colors.orange) }
println("failed to get installation manifest from GitHub, cannot update or install")
term.setTextColor(colors.red)
println("HTTP error: " .. error)
term.setTextColor(colors.white)
return
end
local ok, manifest = pcall(function () return textutils.unserializeJSON(response.readAll()) end)
if not ok then
term.setTextColor(colors.red)
println("error parsing remote installation manifest")
term.setTextColor(colors.white)
end
------------------------
-- GET LOCAL MANIFEST --
------------------------
local imfile = fs.open("install_manifest.json", "r")
local local_ok = false
local local_manifest = {}
if imfile ~= nil then
local_ok, local_manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
imfile.close()
end
local local_app_version = nil
local local_comms_version = nil
local local_boot_version = nil
-- try to find local versions -- try to find local versions
local local_ok, lmnf = read_local_manifest()
if not local_ok then if not local_ok then
if mode == "update" then if mode == "update" then
term.setTextColor(colors.red) red();println("Failed to load local installation information, cannot update.");white()
println("failed to load local installation information, cannot update")
term.setTextColor(colors.white)
return return
end end
else elseif not update_installer then
local_app_version = local_manifest.versions[app] ver.boot.v_local = lmnf.versions.bootloader
local_comms_version = local_manifest.versions.comms ver.app.v_local = lmnf.versions[app]
local_boot_version = local_manifest.versions.bootloader ver.comms.v_local = lmnf.versions.comms
ver.common.v_local = lmnf.versions.common
ver.graphics.v_local = lmnf.versions.graphics
ver.lockbox.v_local = lmnf.versions.lockbox
if local_manifest.versions[app] == nil then if lmnf.versions[app] == nil then
term.setTextColor(colors.red) red();println("Another application is already installed, please purge it before installing a new application.");white()
println("another application is already installed, please purge it before installing a new application")
term.setTextColor(colors.white)
return return
end end
end
local_manifest.versions.installer = CCMSI_VERSION
if manifest.versions.installer ~= CCMSI_VERSION then if manifest.versions.installer ~= CCMSI_VERSION then
term.setTextColor(colors.yellow) if not update_installer then yellow();println("A newer version of the installer is available, it is recommended to update to it.");white() end
println("a newer version of the installer is available, consider downloading it") if update_installer or ask_y_n("Would you like to update now") then
term.setTextColor(colors.white) lgray();println("GET ccmsi.lua")
end local dl, err = http.get(repo_path .. "ccmsi.lua")
if dl == nil then
red();println("HTTP Error " .. err)
println("Installer download failed.");white()
else
local handle = fs.open(debug.getinfo(1, "S").source:sub(2), "w") -- this file, regardless of name or location
handle.write(dl.readAll())
handle.close()
green();println("Installer updated successfully.");white()
end end
local remote_app_version = manifest.versions[app] return
local remote_comms_version = manifest.versions.comms end
local remote_boot_version = manifest.versions.bootloader elseif update_installer then
green();println("Installer already up-to-date.");white()
return
end
term.setTextColor(colors.green) ver.boot.v_remote = manifest.versions.bootloader
ver.app.v_remote = manifest.versions[app]
ver.comms.v_remote = manifest.versions.comms
ver.common.v_remote = manifest.versions.common
ver.graphics.v_remote = manifest.versions.graphics
ver.lockbox.v_remote = manifest.versions.lockbox
green()
if mode == "install" then if mode == "install" then
println("installing " .. app .. " files...") println("Installing " .. app .. " files...")
elseif mode == "update" then elseif mode == "update" then
println("updating " .. app .. " files... (keeping old config.lua)") println("Updating " .. app .. " files... (keeping old config.lua)")
end end
term.setTextColor(colors.white) white()
-- display bootloader version change information ver.boot.changed = show_pkg_change("bootldr", ver.boot)
if local_boot_version ~= nil then ver.common.changed = show_pkg_change("common", ver.common)
if local_boot_version ~= remote_boot_version then ver.comms.changed = show_pkg_change("comms", ver.comms)
print("[bootldr] updating ") if ver.comms.changed and ver.comms.v_local ~= nil then
term.setTextColor(colors.blue) print("[comms] ");yellow();println("other devices on the network will require an update");white()
print(local_boot_version)
term.setTextColor(colors.white)
print(" \xbb ")
term.setTextColor(colors.blue)
println(remote_boot_version)
term.setTextColor(colors.white)
elseif mode == "install" then
print("[bootldr] reinstalling ")
term.setTextColor(colors.blue)
println(local_boot_version)
term.setTextColor(colors.white)
end
else
print("[bootldr] new install of ")
term.setTextColor(colors.blue)
println(remote_boot_version)
term.setTextColor(colors.white)
end end
ver.app.changed = show_pkg_change(app, ver.app)
ver.graphics.changed = show_pkg_change("graphics", ver.graphics)
ver.lockbox.changed = show_pkg_change("lockbox", ver.lockbox)
-- display app version change information -- ask for confirmation
if local_app_version ~= nil then if not ask_y_n("Continue", false) then return end
if local_app_version ~= remote_app_version then
print("[" .. app .. "] updating ")
term.setTextColor(colors.blue)
print(local_app_version)
term.setTextColor(colors.white)
print(" \xbb ")
term.setTextColor(colors.blue)
println(remote_app_version)
term.setTextColor(colors.white)
elseif mode == "install" then
print("[" .. app .. "] reinstalling ")
term.setTextColor(colors.blue)
println(local_app_version)
term.setTextColor(colors.white)
end
else
print("[" .. app .. "] new install of ")
term.setTextColor(colors.blue)
println(remote_app_version)
term.setTextColor(colors.white)
end
-- display comms version change information
if local_comms_version ~= nil then
if local_comms_version ~= remote_comms_version then
print("[comms] updating ")
term.setTextColor(colors.blue)
print(local_comms_version)
term.setTextColor(colors.white)
print(" \xbb ")
term.setTextColor(colors.blue)
println(remote_comms_version)
term.setTextColor(colors.white)
print("[comms] ")
term.setTextColor(colors.yellow)
println("other devices on the network will require an update")
term.setTextColor(colors.white)
elseif mode == "install" then
print("[comms] reinstalling ")
term.setTextColor(colors.blue)
println(local_comms_version)
term.setTextColor(colors.white)
end
else
print("[comms] new install of ")
term.setTextColor(colors.blue)
println(remote_comms_version)
term.setTextColor(colors.white)
end
-------------------------- --------------------------
-- START INSTALL/UPDATE -- -- START INSTALL/UPDATE --
@@ -382,54 +389,45 @@ elseif mode == "install" or mode == "update" then
-- check space constraints -- check space constraints
if space_available < space_required then if space_available < space_required then
single_file_mode = true single_file_mode = true
term.setTextColor(colors.yellow) yellow();println("WARNING: Insufficient space available for a full download!");white()
println("WARNING: Insufficient space available for a full download!")
term.setTextColor(colors.white)
println("Files can be downloaded one by one, so if you are replacing a current install this will not be a problem unless installation fails.") println("Files can be downloaded one by one, so if you are replacing a current install this will not be a problem unless installation fails.")
println("Do you wish to continue? (y/N)") if mode == "update" then println("If installation still fails, delete this device's log file or uninstall the app (not purge) and try again.") end
if not ask_y_n("Do you wish to continue", false) then
local confirm = read() println("Operation cancelled.")
if confirm ~= "y" and confirm ~= "Y" then
println("installation cancelled")
return return
end end
end end
---@diagnostic disable-next-line: undefined-field
os.sleep(2)
local success = true local success = true
if not single_file_mode then -- helper function to check if a dependency is unchanged
if fs.exists(install_dir) then local function unchanged(dependency)
fs.delete(install_dir) if dependency == "system" then return not ver.boot.changed
fs.makeDir(install_dir) elseif dependency == "graphics" then return not ver.graphics.changed
elseif dependency == "lockbox" then return not ver.lockbox.changed
elseif dependency == "common" then return not (ver.common.changed or ver.comms.changed)
elseif dependency == app then return not ver.app.changed
else return true end
end end
if not single_file_mode then
if fs.exists(install_dir) then fs.delete(install_dir);fs.makeDir(install_dir) end
-- download all dependencies -- download all dependencies
for _, dependency in pairs(dependencies) do for _, dependency in pairs(dependencies) do
if mode == "update" and ((dependency == "system" and local_boot_version == remote_boot_version) or (local_app_version == remote_app_version)) then if mode == "update" and unchanged(dependency) then
-- skip system package if unchanged, skip app package if not changed pkg_message("skipping download of unchanged package", dependency)
-- skip packages that have no version if app version didn't change
term.setTextColor(colors.white)
print("skipping download of unchanged package ")
term.setTextColor(colors.blue)
println(dependency)
else else
term.setTextColor(colors.white) pkg_message("downloading package", dependency)
print("downloading package ") lgray()
term.setTextColor(colors.blue)
println(dependency)
term.setTextColor(colors.lightGray)
local files = file_list[dependency] local files = file_list[dependency]
for _, file in pairs(files) do for _, file in pairs(files) do
println("GET " .. file) println("GET " .. file)
local dl, err = http.get(repo_path .. file) local dl, err = http.get(repo_path .. file)
if dl == nil then if dl == nil then
term.setTextColor(colors.red) red();println("HTTP Error " .. err)
println("GET HTTP Error " .. err)
success = false success = false
break break
else else
@@ -444,20 +442,12 @@ elseif mode == "install" or mode == "update" then
-- copy in downloaded files (installation) -- copy in downloaded files (installation)
if success then if success then
for _, dependency in pairs(dependencies) do for _, dependency in pairs(dependencies) do
if mode == "update" and ((dependency == "system" and local_boot_version == remote_boot_version) or (local_app_version == remote_app_version)) then if mode == "update" and unchanged(dependency) then
-- skip system package if unchanged, skip app package if not changed pkg_message("skipping install of unchanged package", dependency)
-- skip packages that have no version if app version didn't change
term.setTextColor(colors.white)
print("skipping install of unchanged package ")
term.setTextColor(colors.blue)
println(dependency)
else else
term.setTextColor(colors.white) pkg_message("installing package", dependency)
print("installing package ") lgray()
term.setTextColor(colors.blue)
println(dependency)
term.setTextColor(colors.lightGray)
local files = file_list[dependency] local files = file_list[dependency]
for _, file in pairs(files) do for _, file in pairs(files) do
if mode == "install" or file ~= config_file then if mode == "install" or file ~= config_file then
@@ -473,41 +463,28 @@ elseif mode == "install" or mode == "update" then
fs.delete(install_dir) fs.delete(install_dir)
if success then if success then
-- if we made it here, then none of the file system functions threw exceptions
-- that means everything is OK
write_install_manifest(manifest, dependencies) write_install_manifest(manifest, dependencies)
term.setTextColor(colors.green) green()
if mode == "install" then if mode == "install" then
println("installation completed successfully") println("Installation completed successfully.")
else else println("Update completed successfully.") end
println("update completed successfully") white();println("Ready to clean up unused files, press any key to continue...")
end any_key();clean(manifest)
white();println("Done.")
else else
if mode == "install" then if mode == "install" then
term.setTextColor(colors.red) red();println("Installation failed.")
println("installation failed") else orange();println("Update failed, existing files unmodified.") end
else
term.setTextColor(colors.orange)
println("update failed, existing files unmodified")
end
end end
else else
-- go through all files and replace one by one -- go through all files and replace one by one
for _, dependency in pairs(dependencies) do for _, dependency in pairs(dependencies) do
if mode == "update" and ((dependency == "system" and local_boot_version == remote_boot_version) or (local_app_version == remote_app_version)) then if mode == "update" and unchanged(dependency) then
-- skip system package if unchanged, skip app package if not changed pkg_message("skipping install of unchanged package", dependency)
-- skip packages that have no version if app version didn't change
term.setTextColor(colors.white)
print("skipping install of unchanged package ")
term.setTextColor(colors.blue)
println(dependency)
else else
term.setTextColor(colors.white) pkg_message("installing package", dependency)
print("installing package ") lgray()
term.setTextColor(colors.blue)
println(dependency)
term.setTextColor(colors.lightGray)
local files = file_list[dependency] local files = file_list[dependency]
for _, file in pairs(files) do for _, file in pairs(files) do
if mode == "install" or file ~= config_file then if mode == "install" or file ~= config_file then
@@ -515,7 +492,7 @@ elseif mode == "install" or mode == "update" then
local dl, err = http.get(repo_path .. file) local dl, err = http.get(repo_path .. file)
if dl == nil then if dl == nil then
println("GET HTTP Error " .. err) red();println("HTTP Error " .. err)
success = false success = false
break break
else else
@@ -529,55 +506,43 @@ elseif mode == "install" or mode == "update" then
end end
if success then if success then
-- if we made it here, then none of the file system functions threw exceptions
-- that means everything is OK
write_install_manifest(manifest, dependencies) write_install_manifest(manifest, dependencies)
term.setTextColor(colors.green) green()
if mode == "install" then if mode == "install" then
println("installation completed successfully") println("Installation completed successfully.")
else println("Update completed successfully.") end
white();println("Ready to clean up unused files, press any key to continue...")
any_key();clean(manifest)
white();println("Done.")
else else
println("update completed successfully") red()
end
else
term.setTextColor(colors.red)
if mode == "install" then if mode == "install" then
println("installation failed, files may have been skipped") println("Installation failed, files may have been skipped.")
else else println("Update failed, files may have been skipped.") end
println("update failed, files may have been skipped")
end
end end
end end
elseif mode == "remove" or mode == "purge" then elseif mode == "remove" or mode == "purge" then
local imfile = fs.open("install_manifest.json", "r") local ok, manifest = read_local_manifest()
local ok = false
local manifest = {}
if imfile ~= nil then
ok, manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
imfile.close()
end
if not ok then if not ok then
term.setTextColor(colors.red) red();println("Error parsing local installation manifest.");white()
println("error parsing local installation manifest")
term.setTextColor(colors.white)
return return
elseif mode == "remove" and manifest.versions[app] == nil then elseif mode == "remove" and manifest.versions[app] == nil then
term.setTextColor(colors.red) red();println(app .. " is not installed, cannot remove.");white()
println(app .. " is not installed")
term.setTextColor(colors.white)
return return
end end
term.setTextColor(colors.orange) orange()
if mode == "remove" then if mode == "remove" then
println("removing all " .. app .. " files except for config.lua and log.txt...") println("Removing all " .. app .. " files except for config and log...")
elseif mode == "purge" then elseif mode == "purge" then
println("purging all " .. app .. " files...") println("Purging all " .. app .. " files including config and log...")
end end
---@diagnostic disable-next-line: undefined-field -- ask for confirmation
os.sleep(2) if not ask_y_n("Continue", false) then return end
-- delete unused files first
clean(manifest)
local file_list = manifest.files local file_list = manifest.files
local dependencies = manifest.depends[app] local dependencies = manifest.depends[app]
@@ -585,9 +550,8 @@ elseif mode == "remove" or mode == "purge" then
table.insert(dependencies, app) table.insert(dependencies, app)
term.setTextColor(colors.lightGray)
-- delete log file if purging -- delete log file if purging
lgray()
if mode == "purge" and fs.exists(config_file) then if mode == "purge" and fs.exists(config_file) then
local log_deleted = pcall(function () local log_deleted = pcall(function ()
local config = require(app .. ".config") local config = require(app .. ".config")
@@ -598,11 +562,9 @@ elseif mode == "remove" or mode == "purge" then
end) end)
if not log_deleted then if not log_deleted then
term.setTextColor(colors.red) red();println("Failed to delete log file.")
println("failed to delete log file") white();println("press any key to continue...")
term.setTextColor(colors.lightGray) any_key();lgray()
---@diagnostic disable-next-line: undefined-field
os.sleep(1)
end end
end end
@@ -611,10 +573,7 @@ elseif mode == "remove" or mode == "purge" then
local files = file_list[dependency] local files = file_list[dependency]
for _, file in pairs(files) do for _, file in pairs(files) do
if mode == "purge" or file ~= config_file then if mode == "purge" or file ~= config_file then
if fs.exists(file) then if fs.exists(file) then fs.delete(file);println("deleted " .. file) end
fs.delete(file)
println("deleted " .. file)
end
end end
end end
@@ -623,11 +582,7 @@ elseif mode == "remove" or mode == "purge" then
local folder = files[1] local folder = files[1]
while true do while true do
local dir = fs.getDir(folder) local dir = fs.getDir(folder)
if dir == "" or dir == ".." then if dir == "" or dir == ".." then break else folder = dir end
break
else
folder = dir
end
end end
if fs.isDir(folder) then if fs.isDir(folder) then
@@ -635,19 +590,15 @@ elseif mode == "remove" or mode == "purge" then
println("deleted directory " .. folder) println("deleted directory " .. folder)
end end
elseif dependency == app then elseif dependency == app then
-- delete individual subdirectories so we can leave the config
for _, folder in pairs(files) do for _, folder in pairs(files) do
while true do while true do
local dir = fs.getDir(folder) local dir = fs.getDir(folder)
if dir == "" or dir == ".." or dir == app then if dir == "" or dir == ".." or dir == app then break else folder = dir end
break
else
folder = dir
end
end end
if folder ~= app and fs.isDir(folder) then if folder ~= app and fs.isDir(folder) then
fs.delete(folder) fs.delete(folder);println("deleted app subdirectory " .. folder)
println("deleted app subdirectory " .. folder)
end end
end end
end end
@@ -660,13 +611,12 @@ elseif mode == "remove" or mode == "purge" then
else else
-- remove all data from versions list to show nothing is installed -- remove all data from versions list to show nothing is installed
manifest.versions = {} manifest.versions = {}
imfile = fs.open("install_manifest.json", "w") local imfile = fs.open("install_manifest.json", "w")
imfile.write(textutils.serializeJSON(manifest)) imfile.write(textutils.serializeJSON(manifest))
imfile.close() imfile.close()
end end
term.setTextColor(colors.green) green();println("Done!")
println("done!")
end end
term.setTextColor(colors.white) white()

View File

@@ -11,6 +11,10 @@ config.TRUSTED_RANGE = 0
-- time in seconds (>= 2) before assuming a remote device is no longer active -- time in seconds (>= 2) before assuming a remote device is no longer active
config.SV_TIMEOUT = 5 config.SV_TIMEOUT = 5
config.API_TIMEOUT = 5 config.API_TIMEOUT = 5
-- facility authentication key (do NOT use one of your passwords)
-- this enables verifying that messages are authentic
-- all devices on the same network must use the same key
-- config.AUTH_KEY = "SCADAfacility123"
-- expected number of reactor units, used only to require that number of unit monitors -- expected number of reactor units, used only to require that number of unit monitors
config.NUM_UNITS = 4 config.NUM_UNITS = 4
@@ -22,6 +26,9 @@ config.SOUNDER_VOLUME = 1.0
-- true for 24 hour time on main view screen -- true for 24 hour time on main view screen
config.TIME_24_HOUR = true config.TIME_24_HOUR = true
-- disable flow view (for legacy layouts)
config.DISABLE_FLOW_VIEW = false
-- log path -- log path
config.LOG_PATH = "/log.txt" config.LOG_PATH = "/log.txt"
-- log mode -- log mode

View File

@@ -2,6 +2,7 @@ local comms = require("scada-common.comms")
local log = require("scada-common.log") local log = require("scada-common.log")
local ppm = require("scada-common.ppm") local ppm = require("scada-common.ppm")
local util = require("scada-common.util") local util = require("scada-common.util")
local types = require("scada-common.types")
local iocontrol = require("coordinator.iocontrol") local iocontrol = require("coordinator.iocontrol")
local process = require("coordinator.process") local process = require("coordinator.process")
@@ -12,7 +13,6 @@ local dialog = require("coordinator.ui.dialog")
local print = util.print local print = util.print
local println = util.println local println = util.println
local println_ts = util.println_ts
local PROTOCOL = comms.PROTOCOL local PROTOCOL = comms.PROTOCOL
local DEVICE_TYPE = comms.DEVICE_TYPE local DEVICE_TYPE = comms.DEVICE_TYPE
@@ -22,6 +22,8 @@ local SCADA_CRDN_TYPE = comms.SCADA_CRDN_TYPE
local UNIT_COMMAND = comms.UNIT_COMMAND local UNIT_COMMAND = comms.UNIT_COMMAND
local FAC_COMMAND = comms.FAC_COMMAND local FAC_COMMAND = comms.FAC_COMMAND
local LINK_TIMEOUT = 60.0
local coordinator = {} local coordinator = {}
-- request the user to select a monitor -- request the user to select a monitor
@@ -47,12 +49,15 @@ end
-- configure monitor layout -- configure monitor layout
---@param num_units integer number of units expected ---@param num_units integer number of units expected
---@param disable_flow_view boolean disable flow view (legacy)
---@return boolean success, monitors_struct? monitors ---@return boolean success, monitors_struct? monitors
function coordinator.configure_monitors(num_units) function coordinator.configure_monitors(num_units, disable_flow_view)
---@class monitors_struct ---@class monitors_struct
local monitors = { local monitors = {
primary = nil, primary = nil,
primary_name = "", primary_name = "",
flow = nil,
flow_name = "",
unit_displays = {}, unit_displays = {},
unit_name_map = {} unit_name_map = {}
} }
@@ -67,8 +72,8 @@ function coordinator.configure_monitors(num_units)
table.insert(available, iface) table.insert(available, iface)
end end
-- we need a certain number of monitors (1 per unit + 1 primary display) -- we need a certain number of monitors (1 per unit + 1 primary display + 1 flow display)
local num_displays_needed = num_units + 1 local num_displays_needed = num_units + util.trinary(disable_flow_view, 1, 2)
if #names < num_displays_needed then if #names < num_displays_needed then
local message = "not enough monitors connected (need " .. num_displays_needed .. ")" local message = "not enough monitors connected (need " .. num_displays_needed .. ")"
println(message) println(message)
@@ -81,10 +86,12 @@ function coordinator.configure_monitors(num_units)
log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)") log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)")
else else
local _primary = settings.get("PRIMARY_DISPLAY") local _primary = settings.get("PRIMARY_DISPLAY")
local _flow = settings.get("FLOW_DISPLAY")
local _unitd = settings.get("UNIT_DISPLAYS") local _unitd = settings.get("UNIT_DISPLAYS")
-- filter out already assigned monitors -- filter out already assigned monitors
util.filter_table(available, function (x) return x ~= _primary end) util.filter_table(available, function (x) return x ~= _primary end)
util.filter_table(available, function (x) return x ~= _flow end)
if type(_unitd) == "table" then if type(_unitd) == "table" then
util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end) util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end)
end end
@@ -104,7 +111,6 @@ function coordinator.configure_monitors(num_units)
end end
while iface_primary_display == nil and #available > 0 do while iface_primary_display == nil and #available > 0 do
-- lets get a monitor
iface_primary_display = ask_monitor(available) iface_primary_display = ask_monitor(available)
end end
@@ -116,6 +122,33 @@ function coordinator.configure_monitors(num_units)
monitors.primary = ppm.get_periph(iface_primary_display) monitors.primary = ppm.get_periph(iface_primary_display)
monitors.primary_name = iface_primary_display monitors.primary_name = iface_primary_display
--------------------------
-- FLOW MONITOR DISPLAY --
--------------------------
if not disable_flow_view then
local iface_flow_display = settings.get("FLOW_DISPLAY") ---@type boolean|string|nil
if not util.table_contains(names, iface_flow_display) then
println("flow monitor display is not connected")
local response = dialog.ask_y_n("would you like to change it", true)
if response == false then return false end
iface_flow_display = nil
end
while iface_flow_display == nil and #available > 0 do
iface_flow_display = ask_monitor(available)
end
if type(iface_flow_display) ~= "string" then return false end
settings.set("FLOW_DISPLAY", iface_flow_display)
util.filter_table(available, function (x) return x ~= iface_flow_display end)
monitors.flow = ppm.get_periph(iface_flow_display)
monitors.flow_name = iface_flow_display
end
------------------- -------------------
-- UNIT DISPLAYS -- -- UNIT DISPLAYS --
------------------- -------------------
@@ -128,7 +161,6 @@ function coordinator.configure_monitors(num_units)
local display = nil local display = nil
while display == nil and #available > 0 do while display == nil and #available > 0 do
-- lets get a monitor
println("please select monitor for unit #" .. i) println("please select monitor for unit #" .. i)
display = ask_monitor(available) display = ask_monitor(available)
end end
@@ -150,7 +182,6 @@ function coordinator.configure_monitors(num_units)
end end
while display == nil and #available > 0 do while display == nil and #available > 0 do
-- lets get a monitor
display = ask_monitor(available) display = ask_monitor(available)
end end
@@ -183,7 +214,8 @@ local function log_dmesg(message, dmesg_tag, working)
GRAPHICS = colors.green, GRAPHICS = colors.green,
SYSTEM = colors.cyan, SYSTEM = colors.cyan,
BOOT = colors.blue, BOOT = colors.blue,
COMMS = colors.purple COMMS = colors.purple,
CRYPTO = colors.yellow
} }
if working then if working then
@@ -197,6 +229,7 @@ function coordinator.log_graphics(message) log_dmesg(message, "GRAPHICS") end
function coordinator.log_sys(message) log_dmesg(message, "SYSTEM") end function coordinator.log_sys(message) log_dmesg(message, "SYSTEM") end
function coordinator.log_boot(message) log_dmesg(message, "BOOT") end function coordinator.log_boot(message) log_dmesg(message, "BOOT") end
function coordinator.log_comms(message) log_dmesg(message, "COMMS") end function coordinator.log_comms(message) log_dmesg(message, "COMMS") end
function coordinator.log_crypto(message) log_dmesg(message, "CRYPTO") end
-- log a message for communications connecting, providing access to progress indication control functions -- log a message for communications connecting, providing access to progress indication control functions
---@nodiscard ---@nodiscard
@@ -212,38 +245,38 @@ end
-- coordinator communications -- coordinator communications
---@nodiscard ---@nodiscard
---@param version string coordinator version ---@param version string coordinator version
---@param modem table modem device ---@param nic nic network interface device
---@param num_units integer number of configured units for number of monitors, checked against SV
---@param crd_channel integer port of configured supervisor ---@param crd_channel integer port of configured supervisor
---@param svr_channel integer listening port for supervisor replys ---@param svr_channel integer listening port for supervisor replys
---@param pkt_channel integer listening port for pocket API ---@param pkt_channel integer listening port for pocket API
---@param range integer trusted device connection range ---@param range integer trusted device connection range
---@param sv_watchdog watchdog ---@param sv_watchdog watchdog
function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel, range, sv_watchdog) function coordinator.comms(version, nic, num_units, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
local self = { local self = {
sv_linked = false, sv_linked = false,
sv_addr = comms.BROADCAST, sv_addr = comms.BROADCAST,
sv_seq_num = 0, sv_seq_num = 0,
sv_r_seq_num = nil, sv_r_seq_num = nil,
sv_config_err = false, sv_config_err = false,
connected = false,
last_est_ack = ESTABLISH_ACK.ALLOW, last_est_ack = ESTABLISH_ACK.ALLOW,
last_api_est_acks = {} last_api_est_acks = {},
est_start = 0,
est_last = 0,
est_tick_waiting = nil,
est_task_done = nil
} }
comms.set_trusted_range(range) comms.set_trusted_range(range)
-- PRIVATE FUNCTIONS -- -- PRIVATE FUNCTIONS --
-- configure modem channels -- configure network channels
local function _conf_channels() nic.closeAll()
modem.closeAll() nic.open(crd_channel)
modem.open(crd_channel)
end
_conf_channels() -- link nic to apisessions
apisessions.init(nic)
-- link modem to apisessions
apisessions.init(modem)
-- send a packet to the supervisor -- send a packet to the supervisor
---@param msg_type SCADA_MGMT_TYPE|SCADA_CRDN_TYPE ---@param msg_type SCADA_MGMT_TYPE|SCADA_CRDN_TYPE
@@ -263,7 +296,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
pkt.make(msg_type, msg) pkt.make(msg_type, msg)
s_pkt.make(self.sv_addr, self.sv_seq_num, protocol, pkt.raw_sendable()) s_pkt.make(self.sv_addr, self.sv_seq_num, protocol, pkt.raw_sendable())
modem.transmit(svr_channel, crd_channel, s_pkt.raw_sendable()) nic.transmit(svr_channel, crd_channel, s_pkt)
self.sv_seq_num = self.sv_seq_num + 1 self.sv_seq_num = self.sv_seq_num + 1
end end
@@ -277,7 +310,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
m_pkt.make(SCADA_MGMT_TYPE.ESTABLISH, { ack }) m_pkt.make(SCADA_MGMT_TYPE.ESTABLISH, { ack })
s_pkt.make(packet.src_addr(), packet.seq_num() + 1, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable()) s_pkt.make(packet.src_addr(), packet.seq_num() + 1, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
modem.transmit(pkt_channel, crd_channel, s_pkt.raw_sendable()) nic.transmit(pkt_channel, crd_channel, s_pkt)
self.last_api_est_acks[packet.src_addr()] = ack self.last_api_est_acks[packet.src_addr()] = ack
end end
@@ -297,63 +330,30 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
---@class coord_comms ---@class coord_comms
local public = {} local public = {}
-- reconnect a newly connected modem -- try to connect to the supervisor if not already linked
---@param new_modem table ---@param abort boolean? true to print out cancel info if not linked (use on program terminate)
function public.reconnect_modem(new_modem) ---@return boolean ok, boolean start_ui
modem = new_modem function public.try_connect(abort)
apisessions.relink_modem(new_modem) local ok = true
_conf_channels() local start_ui = false
end
-- close the connection to the server if not self.sv_linked then
function public.close() if self.est_tick_waiting == nil then
sv_watchdog.cancel() self.est_start = util.time_s()
self.sv_addr = comms.BROADCAST self.est_last = self.est_start
self.sv_linked = false
self.sv_r_seq_num = nil
_send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.CLOSE, {})
end
-- attempt to connect to the subervisor self.est_tick_waiting, self.est_task_done =
---@nodiscard coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. svr_channel)
---@param timeout_s number timeout in seconds
---@param tick_dmesg_waiting function callback to tick dmesg waiting
---@param task_done function callback to show done on dmesg
---@return boolean sv_linked true if connected, false otherwise
--- EVENT_CONSUMER: this function consumes events
function public.sv_connect(timeout_s, tick_dmesg_waiting, task_done)
local clock = util.new_clock(1)
local start = util.time_s()
local terminated = false
_send_establish() _send_establish()
else
clock.start() self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (util.time_s() - self.est_start)))
while (util.time_s() - start) < timeout_s and (not self.sv_linked) and (not self.sv_config_err) do
local event, p1, p2, p3, p4, p5 = util.pull_event()
if event == "timer" and clock.is_clock(p1) then
-- timed out attempt, try again
tick_dmesg_waiting(math.max(0, timeout_s - (util.time_s() - start)))
_send_establish()
clock.start()
elseif event == "timer" then
-- keep checking watchdog timers
apisessions.check_all_watchdogs(p1)
elseif event == "modem_message" then
-- handle message
local packet = public.parse_packet(p1, p2, p3, p4, p5)
public.handle_packet(packet)
elseif event == "terminate" then
terminated = true
break
end
end end
task_done(self.sv_linked) if abort or (util.time_s() - self.est_start) >= LINK_TIMEOUT then
self.est_task_done(false)
if terminated then if abort then
coordinator.log_comms("supervisor connection attempt cancelled by user") coordinator.log_comms("supervisor connection attempt cancelled by user")
elseif self.sv_config_err then elseif self.sv_config_err then
coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file") coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
@@ -369,13 +369,39 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
end end
end end
return self.sv_linked ok = false
elseif self.sv_config_err then
coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
ok = false
elseif (util.time_s() - self.est_last) > 1.0 then
_send_establish()
self.est_last = util.time_s()
end
elseif self.est_tick_waiting ~= nil then
self.est_task_done(true)
self.est_tick_waiting = nil
self.est_task_done = nil
start_ui = true
end
return ok, start_ui
end
-- close the connection to the server
function public.close()
sv_watchdog.cancel()
self.sv_addr = comms.BROADCAST
self.sv_linked = false
self.sv_r_seq_num = nil
iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
_send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.CLOSE, {})
end end
-- send a facility command -- send a facility command
---@param cmd FAC_COMMAND command ---@param cmd FAC_COMMAND command
function public.send_fac_command(cmd) ---@param option any? optional option options for the optional options (like waste mode)
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd }) function public.send_fac_command(cmd, option)
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd, option })
end end
-- send the auto process control configuration with a start command -- send the auto process control configuration with a start command
@@ -389,7 +415,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
-- send a unit command -- send a unit command
---@param cmd UNIT_COMMAND command ---@param cmd UNIT_COMMAND command
---@param unit integer unit ID ---@param unit integer unit ID
---@param option any? optional option options for the optional options (like burn rate) (does option still look like a word?) ---@param option any? optional option options for the optional options (like burn rate)
function public.send_unit_command(cmd, unit, option) function public.send_unit_command(cmd, unit, option)
_send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_CMD, { cmd, unit, option }) _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
end end
@@ -402,13 +428,10 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
---@param distance integer ---@param distance integer
---@return mgmt_frame|crdn_frame|capi_frame|nil packet ---@return mgmt_frame|crdn_frame|capi_frame|nil packet
function public.parse_packet(side, sender, reply_to, message, distance) function public.parse_packet(side, sender, reply_to, message, distance)
local s_pkt = nic.receive(side, sender, reply_to, message, distance)
local pkt = nil local pkt = nil
local s_pkt = comms.scada_packet()
-- parse packet as generic SCADA packet if s_pkt then
s_pkt.receive(side, sender, reply_to, message, distance)
if s_pkt.is_valid() then
-- get as SCADA management packet -- get as SCADA management packet
if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then
local mgmt_pkt = comms.mgmt_packet() local mgmt_pkt = comms.mgmt_packet()
@@ -437,7 +460,10 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
-- handle a packet -- handle a packet
---@param packet mgmt_frame|crdn_frame|capi_frame|nil ---@param packet mgmt_frame|crdn_frame|capi_frame|nil
---@return boolean close_ui
function public.handle_packet(packet) function public.handle_packet(packet)
local was_linked = self.sv_linked
if packet ~= nil then if packet ~= nil then
local l_chan = packet.scada_frame.local_channel() local l_chan = packet.scada_frame.local_channel()
local r_chan = packet.scada_frame.remote_channel() local r_chan = packet.scada_frame.remote_channel()
@@ -447,7 +473,9 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
if l_chan ~= crd_channel then if l_chan ~= crd_channel then
log.debug("received packet on unconfigured channel " .. l_chan, true) log.debug("received packet on unconfigured channel " .. l_chan, true)
elseif r_chan == pkt_channel then elseif r_chan == pkt_channel then
if protocol == PROTOCOL.COORD_API then if not self.sv_linked then
log.debug("discarding pocket API packet before linked to supervisor")
elseif protocol == PROTOCOL.COORD_API then
---@cast packet capi_frame ---@cast packet capi_frame
-- look for an associated session -- look for an associated session
local session = apisessions.find_session(src_addr) local session = apisessions.find_session(src_addr)
@@ -486,7 +514,6 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
elseif dev_type == DEVICE_TYPE.PKT then elseif dev_type == DEVICE_TYPE.PKT then
-- pocket linking request -- pocket linking request
local id = apisessions.establish_session(src_addr, firmware_v) local id = apisessions.establish_session(src_addr, firmware_v)
println(util.c("[API] pocket (", firmware_v, ") [@", src_addr, "] \xbb connected"))
coordinator.log_comms(util.c("API_ESTABLISH: pocket (", firmware_v, ") [@", src_addr, "] connected with session ID ", id)) coordinator.log_comms(util.c("API_ESTABLISH: pocket (", firmware_v, ") [@", src_addr, "] connected with session ID ", id))
_send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW) _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW)
@@ -509,12 +536,12 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
-- check sequence number -- check sequence number
if self.sv_r_seq_num == nil then if self.sv_r_seq_num == nil then
self.sv_r_seq_num = packet.scada_frame.seq_num() self.sv_r_seq_num = packet.scada_frame.seq_num()
elseif self.connected and ((self.sv_r_seq_num + 1) ~= packet.scada_frame.seq_num()) then elseif self.sv_linked and ((self.sv_r_seq_num + 1) ~= packet.scada_frame.seq_num()) then
log.warning("sequence out-of-order: last = " .. self.sv_r_seq_num .. ", new = " .. packet.scada_frame.seq_num()) log.warning("sequence out-of-order: last = " .. self.sv_r_seq_num .. ", new = " .. packet.scada_frame.seq_num())
return return false
elseif self.sv_linked and src_addr ~= self.sv_addr then elseif self.sv_linked and src_addr ~= self.sv_addr then
log.debug("received packet from unknown computer " .. src_addr .. " while linked; channel in use by another system?") log.debug("received packet from unknown computer " .. src_addr .. " while linked; channel in use by another system?")
return return false
else else
self.sv_r_seq_num = packet.scada_frame.seq_num() self.sv_r_seq_num = packet.scada_frame.seq_num()
end end
@@ -576,6 +603,10 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
end end
elseif cmd == FAC_COMMAND.ACK_ALL_ALARMS then elseif cmd == FAC_COMMAND.ACK_ALL_ALARMS then
iocontrol.get_db().facility.ack_alarms_ack(ack) iocontrol.get_db().facility.ack_alarms_ack(ack)
elseif cmd == FAC_COMMAND.SET_WASTE_MODE then
process.waste_ack_handle(packet.data[2])
elseif cmd == FAC_COMMAND.SET_PU_FB then
process.pu_fb_ack_handle(packet.data[2])
else else
log.debug(util.c("received facility command ack with unknown command ", cmd)) log.debug(util.c("received facility command ack with unknown command ", cmd))
end end
@@ -640,70 +671,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
end end
elseif protocol == PROTOCOL.SCADA_MGMT then elseif protocol == PROTOCOL.SCADA_MGMT then
---@cast packet mgmt_frame ---@cast packet mgmt_frame
if packet.type == SCADA_MGMT_TYPE.ESTABLISH then if self.sv_linked then
-- connection with supervisor established
if packet.length == 2 then
local est_ack = packet.data[1]
local config = packet.data[2]
if est_ack == ESTABLISH_ACK.ALLOW then
if type(config) == "table" and #config > 1 then
-- get configuration
---@class facility_conf
local conf = {
num_units = config[1], ---@type integer
defs = {} -- boilers and turbines
}
if (#config - 1) == (conf.num_units * 2) then
-- record sequence of pairs of [#boilers, #turbines] per unit
for i = 2, #config do
table.insert(conf.defs, config[i])
end
-- init io controller
iocontrol.init(conf, public)
self.sv_addr = src_addr
self.sv_linked = true
self.sv_config_err = false
else
self.sv_config_err = true
log.warning("invalid supervisor configuration definitions received, establish failed")
end
else
log.debug("invalid supervisor configuration table received, establish failed")
end
else
log.debug("SCADA_MGMT establish packet reply (len = 2) unsupported")
end
self.last_est_ack = est_ack
elseif packet.length == 1 then
local est_ack = packet.data[1]
if est_ack == ESTABLISH_ACK.DENY then
if self.last_est_ack ~= est_ack then
log.info("supervisor connection denied")
end
elseif est_ack == ESTABLISH_ACK.COLLISION then
if self.last_est_ack ~= est_ack then
log.warning("supervisor connection denied due to collision")
end
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
if self.last_est_ack ~= est_ack then
log.warning("supervisor comms version mismatch")
end
else
log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported")
end
self.last_est_ack = est_ack
else
log.debug("SCADA_MGMT establish packet length mismatch")
end
elseif self.sv_linked then
if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-- keep alive request received, echo back -- keep alive request received, echo back
if packet.length == 1 then if packet.length == 1 then
@@ -728,11 +696,78 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
self.sv_addr = comms.BROADCAST self.sv_addr = comms.BROADCAST
self.sv_linked = false self.sv_linked = false
self.sv_r_seq_num = nil self.sv_r_seq_num = nil
println_ts("server connection closed by remote host") iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
log.info("server connection closed by remote host") log.info("server connection closed by remote host")
else else
log.debug("received unknown SCADA_MGMT packet type " .. packet.type) log.debug("received unknown SCADA_MGMT packet type " .. packet.type)
end end
elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
-- connection with supervisor established
if packet.length == 2 then
local est_ack = packet.data[1]
local config = packet.data[2]
if est_ack == ESTABLISH_ACK.ALLOW then
-- reset to disconnected before validating
iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
if type(config) == "table" and #config == 2 then
-- get configuration
---@class facility_conf
local conf = {
num_units = config[1], ---@type integer
cooling = config[2] ---@type sv_cooling_conf
}
if conf.num_units == num_units then
-- init io controller
iocontrol.init(conf, public)
self.sv_addr = src_addr
self.sv_linked = true
self.sv_r_seq_num = nil
self.sv_config_err = false
iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED)
else
self.sv_config_err = true
log.warning("supervisor config's number of units don't match coordinator's config, establish failed")
end
else
log.debug("invalid supervisor configuration table received, establish failed")
end
else
log.debug("SCADA_MGMT establish packet reply (len = 2) unsupported")
end
self.last_est_ack = est_ack
elseif packet.length == 1 then
local est_ack = packet.data[1]
if est_ack == ESTABLISH_ACK.DENY then
if self.last_est_ack ~= est_ack then
iocontrol.fp_link_state(types.PANEL_LINK_STATE.DENIED)
log.info("supervisor connection denied")
end
elseif est_ack == ESTABLISH_ACK.COLLISION then
if self.last_est_ack ~= est_ack then
iocontrol.fp_link_state(types.PANEL_LINK_STATE.COLLISION)
log.warning("supervisor connection denied due to collision")
end
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
if self.last_est_ack ~= est_ack then
iocontrol.fp_link_state(types.PANEL_LINK_STATE.BAD_VERSION)
log.warning("supervisor comms version mismatch")
end
else
log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported")
end
self.last_est_ack = est_ack
else
log.debug("SCADA_MGMT establish packet length mismatch")
end
else else
log.debug("discarding non-link SCADA_MGMT packet before linked") log.debug("discarding non-link SCADA_MGMT packet before linked")
end end
@@ -743,6 +778,8 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
log.debug("received packet for unknown channel " .. r_chan, true) log.debug("received packet for unknown channel " .. r_chan, true)
end end
end end
return was_linked and not self.sv_linked
end end
-- check if the coordinator is still linked to the supervisor -- check if the coordinator is still linked to the supervisor

View File

@@ -10,9 +10,15 @@ local util = require("scada-common.util")
local process = require("coordinator.process") local process = require("coordinator.process")
local sounder = require("coordinator.sounder") local sounder = require("coordinator.sounder")
local pgi = require("coordinator.ui.pgi")
local ALARM_STATE = types.ALARM_STATE local ALARM_STATE = types.ALARM_STATE
local PROCESS = types.PROCESS local PROCESS = types.PROCESS
-- nominal RTT is ping (0ms to 10ms usually) + 500ms for CRD main loop tick
local WARN_RTT = 1000 -- 2x as long as expected w/ 0 ping
local HIGH_RTT = 1500 -- 3.33x as long as expected w/ 0 ping
local iocontrol = {} local iocontrol = {}
---@class ioctl ---@class ioctl
@@ -27,13 +33,27 @@ local function __generic_ack(success) end
-- luacheck: unused args -- luacheck: unused args
-- initialize front panel PSIL
---@param firmware_v string coordinator version
---@param comms_v string comms version
function iocontrol.init_fp(firmware_v, comms_v)
---@class ioctl_front_panel
io.fp = { ps = psil.create() }
io.fp.ps.publish("version", firmware_v)
io.fp.ps.publish("comms_version", comms_v)
end
-- initialize the coordinator IO controller -- initialize the coordinator IO controller
---@param conf facility_conf configuration ---@param conf facility_conf configuration
---@param comms coord_comms comms reference ---@param comms coord_comms comms reference
function iocontrol.init(conf, comms) function iocontrol.init(conf, comms)
-- facility data structure
---@class ioctl_facility ---@class ioctl_facility
io.facility = { io.facility = {
num_units = conf.num_units, ---@type integer num_units = conf.num_units,
tank_mode = conf.cooling.fac_tank_mode,
tank_defs = conf.cooling.fac_tank_defs,
all_sys_ok = false, all_sys_ok = false,
rtu_count = 0, rtu_count = 0,
@@ -52,6 +72,10 @@ function iocontrol.init(conf, comms)
gen_fault = false gen_fault = false
}, },
---@type WASTE_PRODUCT
auto_current_waste_product = types.WASTE_PRODUCT.PLUTONIUM,
auto_pu_fallback_active = false,
radiation = types.new_zero_radiation_reading(), radiation = types.new_zero_radiation_reading(),
save_cfg_ack = __generic_ack, save_cfg_ack = __generic_ack,
@@ -60,22 +84,124 @@ function iocontrol.init(conf, comms)
scram_ack = __generic_ack, scram_ack = __generic_ack,
ack_alarms_ack = __generic_ack, ack_alarms_ack = __generic_ack,
alarm_tones = { false, false, false, false, false, false, false, false },
ps = psil.create(), ps = psil.create(),
induction_ps_tbl = {}, induction_ps_tbl = {},
induction_data_tbl = {}, induction_data_tbl = {},
sps_ps_tbl = {},
sps_data_tbl = {},
tank_ps_tbl = {},
tank_data_tbl = {},
env_d_ps = psil.create(), env_d_ps = psil.create(),
env_d_data = {} env_d_data = {}
} }
-- create induction tables (currently only 1 is supported) -- create induction and SPS tables (currently only 1 of each is supported)
for _ = 1, conf.num_units do
local data = {} ---@type imatrix_session_db
table.insert(io.facility.induction_ps_tbl, psil.create()) table.insert(io.facility.induction_ps_tbl, psil.create())
table.insert(io.facility.induction_data_tbl, data) table.insert(io.facility.induction_data_tbl, {})
table.insert(io.facility.sps_ps_tbl, psil.create())
table.insert(io.facility.sps_data_tbl, {})
-- determine tank information
if io.facility.tank_mode == 0 then
io.facility.tank_defs = {}
-- on facility tank mode 0, setup tank defs to match unit TANK option
for i = 1, conf.num_units do
io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TANK, 1, 0)
end end
io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
else
-- decode the layout of tanks from the connections definitions
local tank_mode = io.facility.tank_mode
local tank_defs = io.facility.tank_defs
local tank_list = { table.unpack(tank_defs) }
local function calc_fdef(start_idx, end_idx)
local first = 4
for i = start_idx, end_idx do
if io.facility.tank_defs[i] == 2 then
if i < first then first = i end
end
end
return first
end
if tank_mode == 1 then
-- (1) 1 total facility tank (A A A A)
local first_fdef = calc_fdef(1, #tank_defs)
for i = 1, #tank_defs do
if i > first_fdef and tank_defs[i] == 2 then
tank_list[i] = 0
end
end
elseif tank_mode == 2 then
-- (2) 2 total facility tanks (A A A B)
local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
for i = 1, #tank_defs do
if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 3 then
-- (3) 2 total facility tanks (A A B B)
for _, a in pairs({ 1, 3 }) do
local b = a + 1
if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
tank_list[b] = 0
end
end
elseif tank_mode == 4 then
-- (4) 2 total facility tanks (A B B B)
local first_fdef = calc_fdef(2, #tank_defs)
for i = 1, #tank_defs do
if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 5 then
-- (5) 3 total facility tanks (A A B C)
local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
for i = 1, #tank_defs do
if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 6 then
-- (6) 3 total facility tanks (A B B C)
local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
for i = 1, #tank_defs do
if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
elseif tank_mode == 7 then
-- (7) 3 total facility tanks (A B C C)
local first_fdef = calc_fdef(3, #tank_defs)
for i = 1, #tank_defs do
if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
tank_list[i] = 0
end
end
end
io.facility.tank_list = tank_list
end
-- create facility tank tables
for i = 1, #io.facility.tank_list do
if io.facility.tank_list[i] == 2 then
table.insert(io.facility.tank_ps_tbl, psil.create())
table.insert(io.facility.tank_data_tbl, {})
end
end
-- create unit data structures
io.units = {} io.units = {}
for i = 1, conf.num_units do for i = 1, conf.num_units do
local function ack(alarm) process.ack_alarm(i, alarm) end local function ack(alarm) process.ack_alarm(i, alarm) end
@@ -87,11 +213,16 @@ function iocontrol.init(conf, comms)
num_boilers = 0, num_boilers = 0,
num_turbines = 0, num_turbines = 0,
num_snas = 0,
has_tank = conf.cooling.r_cool[i].TANK,
control_state = false, control_state = false,
burn_rate_cmd = 0.0, burn_rate_cmd = 0.0,
waste_control = 0,
radiation = types.new_zero_radiation_reading(), radiation = types.new_zero_radiation_reading(),
sna_prod_rate = 0.0,
waste_mode = types.WASTE_MODE.MANUAL_PLUTONIUM,
waste_product = types.WASTE_PRODUCT.PLUTONIUM,
-- auto control group -- auto control group
a_group = 0, a_group = 0,
@@ -101,9 +232,9 @@ function iocontrol.init(conf, comms)
reset_rps = function () process.reset_rps(i) end, reset_rps = function () process.reset_rps(i) end,
ack_alarms = function () process.ack_all_alarms(i) end, ack_alarms = function () process.ack_all_alarms(i) end,
set_burn = function (rate) process.set_rate(i, rate) end, ---@param rate number burn rate set_burn = function (rate) process.set_rate(i, rate) end, ---@param rate number burn rate
set_waste = function (mode) process.set_waste(i, mode) end, ---@param mode integer waste processing mode set_waste = function (mode) process.set_unit_waste(i, mode) end, ---@param mode WASTE_MODE waste processing mode
set_group = function (grp) process.set_group(i, grp) end, ---@param grp integer|0 group ID or 0 set_group = function (grp) process.set_group(i, grp) end, ---@param grp integer|0 group ID or 0 for manual
start_ack = __generic_ack, start_ack = __generic_ack,
scram_ack = __generic_ack, scram_ack = __generic_ack,
@@ -152,21 +283,33 @@ function iocontrol.init(conf, comms)
boiler_data_tbl = {}, boiler_data_tbl = {},
turbine_ps_tbl = {}, turbine_ps_tbl = {},
turbine_data_tbl = {} turbine_data_tbl = {},
tank_ps_tbl = {},
tank_data_tbl = {}
} }
-- on other facility modes, overwrite unit TANK option with facility tank defs
if io.facility.tank_mode ~= 0 then
entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
end
-- create boiler tables -- create boiler tables
for _ = 1, conf.defs[(i * 2) - 1] do for _ = 1, conf.cooling.r_cool[i].BOILERS do
local data = {} ---@type boilerv_session_db
table.insert(entry.boiler_ps_tbl, psil.create()) table.insert(entry.boiler_ps_tbl, psil.create())
table.insert(entry.boiler_data_tbl, data) table.insert(entry.boiler_data_tbl, {})
end end
-- create turbine tables -- create turbine tables
for _ = 1, conf.defs[i * 2] do for _ = 1, conf.cooling.r_cool[i].TURBINES do
local data = {} ---@type turbinev_session_db
table.insert(entry.turbine_ps_tbl, psil.create()) table.insert(entry.turbine_ps_tbl, psil.create())
table.insert(entry.turbine_data_tbl, data) table.insert(entry.turbine_data_tbl, {})
end
-- create tank tables
if io.facility.tank_defs[i] == 1 then
table.insert(entry.tank_ps_tbl, psil.create())
table.insert(entry.tank_data_tbl, {})
end end
entry.num_boilers = #entry.boiler_data_tbl entry.num_boilers = #entry.boiler_data_tbl
@@ -179,6 +322,102 @@ function iocontrol.init(conf, comms)
process.init(io, comms) process.init(io, comms)
end end
--#region Front Panel PSIL
-- toggle heartbeat indicator
function iocontrol.heartbeat() io.fp.ps.toggle("heartbeat") end
-- report presence of the wireless modem
---@param has_modem boolean
function iocontrol.fp_has_modem(has_modem) io.fp.ps.publish("has_modem", has_modem) end
-- report presence of the speaker
---@param has_speaker boolean
function iocontrol.fp_has_speaker(has_speaker) io.fp.ps.publish("has_speaker", has_speaker) end
-- report supervisor link state
---@param state integer
function iocontrol.fp_link_state(state) io.fp.ps.publish("link_state", state) end
-- report monitor connection state
---@param id string|integer unit ID for unit monitor, "main" for main monitor, or "flow" for flow monitor
function iocontrol.fp_monitor_state(id, connected)
local name = nil
if id == "main" then
name = "main_monitor"
elseif id == "flow" then
name = "flow_monitor"
elseif type(id) == "number" then
name = "unit_monitor_" .. id
end
if name ~= nil then
io.fp.ps.publish(name, connected)
end
end
-- report PKT firmware version and PKT session connection state
---@param session_id integer PKT session
---@param fw string firmware version
---@param s_addr integer PKT computer ID
function iocontrol.fp_pkt_connected(session_id, fw, s_addr)
io.fp.ps.publish("pkt_" .. session_id .. "_fw", fw)
io.fp.ps.publish("pkt_" .. session_id .. "_addr", util.sprintf("@ C% 3d", s_addr))
pgi.create_pkt_entry(session_id)
end
-- report PKT session disconnected
---@param session_id integer PKT session
function iocontrol.fp_pkt_disconnected(session_id)
pgi.delete_pkt_entry(session_id)
end
-- transmit PKT session RTT
---@param session_id integer PKT session
---@param rtt integer round trip time
function iocontrol.fp_pkt_rtt(session_id, rtt)
io.fp.ps.publish("pkt_" .. session_id .. "_rtt", rtt)
if rtt > HIGH_RTT then
io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.red)
elseif rtt > WARN_RTT then
io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.yellow_hc)
else
io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.green)
end
end
--#endregion
--#region Builds
-- record and publish multiblock RTU build data
---@param id integer
---@param entry table
---@param data_tbl table
---@param ps_tbl table
---@param create boolean? true to create an entry if non exists, false to fail on missing
---@return boolean ok true if data saved, false if invalid ID
local function _record_multiblock_build(id, entry, data_tbl, ps_tbl, create)
local exists = type(data_tbl[id]) == "table"
if exists or create then
if not exists then
ps_tbl[id] = psil.create()
data_tbl[id] = {}
end
data_tbl[id].formed = entry[1] ---@type boolean
data_tbl[id].build = entry[2] ---@type table
ps_tbl[id].publish("formed", entry[1])
for key, val in pairs(data_tbl[id].build) do ps_tbl[id].publish(key, val) end
end
return exists or (create == true)
end
-- populate facility structure builds -- populate facility structure builds
---@param build table ---@param build table
---@return boolean valid ---@return boolean valid
@@ -191,21 +430,29 @@ function iocontrol.record_facility_builds(build)
-- induction matricies -- induction matricies
if type(build.induction) == "table" then if type(build.induction) == "table" then
for id, matrix in pairs(build.induction) do for id, matrix in pairs(build.induction) do
if type(fac.induction_data_tbl[id]) == "table" then if not _record_multiblock_build(id, matrix, fac.induction_data_tbl, fac.induction_ps_tbl) then
fac.induction_data_tbl[id].formed = matrix[1] ---@type boolean
fac.induction_data_tbl[id].build = matrix[2] ---@type table
fac.induction_ps_tbl[id].publish("formed", matrix[1])
for key, val in pairs(fac.induction_data_tbl[id].build) do
fac.induction_ps_tbl[id].publish(key, val)
end
else
log.debug(util.c("iocontrol.record_facility_builds: invalid induction matrix id ", id)) log.debug(util.c("iocontrol.record_facility_builds: invalid induction matrix id ", id))
valid = false valid = false
end end
end end
end end
-- SPS
if type(build.sps) == "table" then
for id, sps in pairs(build.sps) do
if not _record_multiblock_build(id, sps, fac.sps_data_tbl, fac.sps_ps_tbl) then
log.debug(util.c("iocontrol.record_facility_builds: invalid SPS id ", id))
valid = false
end
end
end
-- dynamic tanks
if type(build.tanks) == "table" then
for id, tank in pairs(build.tanks) do
_record_multiblock_build(id, tank, fac.tank_data_tbl, fac.tank_ps_tbl, true)
end
end
else else
log.debug("facility builds not a table") log.debug("facility builds not a table")
valid = false valid = false
@@ -249,16 +496,7 @@ function iocontrol.record_unit_builds(builds)
-- boiler builds -- boiler builds
if type(build.boilers) == "table" then if type(build.boilers) == "table" then
for b_id, boiler in pairs(build.boilers) do for b_id, boiler in pairs(build.boilers) do
if type(unit.boiler_data_tbl[b_id]) == "table" then if not _record_multiblock_build(b_id, boiler, unit.boiler_data_tbl, unit.boiler_ps_tbl) then
unit.boiler_data_tbl[b_id].formed = boiler[1] ---@type boolean
unit.boiler_data_tbl[b_id].build = boiler[2] ---@type table
unit.boiler_ps_tbl[b_id].publish("formed", boiler[1])
for key, val in pairs(unit.boiler_data_tbl[b_id].build) do
unit.boiler_ps_tbl[b_id].publish(key, val)
end
else
log.debug(util.c(log_header, "invalid boiler id ", b_id)) log.debug(util.c(log_header, "invalid boiler id ", b_id))
valid = false valid = false
end end
@@ -268,27 +506,49 @@ function iocontrol.record_unit_builds(builds)
-- turbine builds -- turbine builds
if type(build.turbines) == "table" then if type(build.turbines) == "table" then
for t_id, turbine in pairs(build.turbines) do for t_id, turbine in pairs(build.turbines) do
if type(unit.turbine_data_tbl[t_id]) == "table" then if not _record_multiblock_build(t_id, turbine, unit.turbine_data_tbl, unit.turbine_ps_tbl) then
unit.turbine_data_tbl[t_id].formed = turbine[1] ---@type boolean
unit.turbine_data_tbl[t_id].build = turbine[2] ---@type table
unit.turbine_ps_tbl[t_id].publish("formed", turbine[1])
for key, val in pairs(unit.turbine_data_tbl[t_id].build) do
unit.turbine_ps_tbl[t_id].publish(key, val)
end
else
log.debug(util.c(log_header, "invalid turbine id ", t_id)) log.debug(util.c(log_header, "invalid turbine id ", t_id))
valid = false valid = false
end end
end end
end end
-- dynamic tank builds
if type(build.tanks) == "table" then
for d_id, d_tank in pairs(build.tanks) do
_record_multiblock_build(d_id, d_tank, unit.tank_data_tbl, unit.tank_ps_tbl, true)
end
end
end end
end end
return valid return valid
end end
--#endregion
--#region Statuses
-- record and publish multiblock status data
---@param entry any
---@param data imatrix_session_db|sps_session_db|dynamicv_session_db|turbinev_session_db|boilerv_session_db
---@param ps psil
---@return boolean is_faulted
local function _record_multiblock_status(entry, data, ps)
local is_faulted = entry[1] ---@type boolean
data.formed = entry[2] ---@type boolean
data.state = entry[3] ---@type table
data.tanks = entry[4] ---@type table
ps.publish("formed", data.formed)
ps.publish("faulted", is_faulted)
for key, val in pairs(data.state) do ps.publish(key, val) end
for key, val in pairs(data.tanks) do ps.publish(key, val) end
return is_faulted
end
-- update facility status -- update facility status
---@param status table ---@param status table
---@return boolean valid ---@return boolean valid
@@ -306,7 +566,7 @@ function iocontrol.update_facility_status(status)
local ctl_status = status[1] local ctl_status = status[1]
if type(ctl_status) == "table" and #ctl_status == 14 then if type(ctl_status) == "table" and #ctl_status == 16 then
fac.all_sys_ok = ctl_status[1] fac.all_sys_ok = ctl_status[1]
fac.auto_ready = ctl_status[2] fac.auto_ready = ctl_status[2]
@@ -354,6 +614,12 @@ function iocontrol.update_facility_status(status)
io.units[i].unit_ps.publish("auto_group", names[group_map[i] + 1]) io.units[i].unit_ps.publish("auto_group", names[group_map[i] + 1])
end end
end end
fac.auto_current_waste_product = ctl_status[15]
fac.auto_pu_fallback_active = ctl_status[16]
fac.ps.publish("current_waste_product", fac.auto_current_waste_product)
fac.ps.publish("pu_fallback_active", fac.auto_pu_fallback_active)
else else
log.debug(log_header .. "control status not a table or length mismatch") log.debug(log_header .. "control status not a table or length mismatch")
valid = false valid = false
@@ -390,36 +656,23 @@ function iocontrol.update_facility_status(status)
for id, matrix in pairs(rtu_statuses.induction) do for id, matrix in pairs(rtu_statuses.induction) do
if type(fac.induction_data_tbl[id]) == "table" then if type(fac.induction_data_tbl[id]) == "table" then
local rtu_faulted = matrix[1] ---@type boolean
fac.induction_data_tbl[id].formed = matrix[2] ---@type boolean
fac.induction_data_tbl[id].state = matrix[3] ---@type table
fac.induction_data_tbl[id].tanks = matrix[4] ---@type table
local data = fac.induction_data_tbl[id] ---@type imatrix_session_db local data = fac.induction_data_tbl[id] ---@type imatrix_session_db
local ps = fac.induction_ps_tbl[id] ---@type psil
fac.induction_ps_tbl[id].publish("formed", data.formed) local rtu_faulted = _record_multiblock_status(matrix, data, ps)
fac.induction_ps_tbl[id].publish("faulted", rtu_faulted)
if data.formed then
if rtu_faulted then if rtu_faulted then
fac.induction_ps_tbl[id].publish("computed_status", 3) -- faulted ps.publish("computed_status", 3) -- faulted
elseif data.tanks.energy_fill >= 0.99 then elseif data.formed then
fac.induction_ps_tbl[id].publish("computed_status", 6) -- full if data.tanks.energy_fill >= 0.99 then
ps.publish("computed_status", 6) -- full
elseif data.tanks.energy_fill <= 0.01 then elseif data.tanks.energy_fill <= 0.01 then
fac.induction_ps_tbl[id].publish("computed_status", 5) -- empty ps.publish("computed_status", 5) -- empty
else else
fac.induction_ps_tbl[id].publish("computed_status", 4) -- on-line ps.publish("computed_status", 4) -- on-line
end end
else else
fac.induction_ps_tbl[id].publish("computed_status", 2) -- not formed ps.publish("computed_status", 2) -- not formed
end
for key, val in pairs(fac.induction_data_tbl[id].state) do
fac.induction_ps_tbl[id].publish(key, val)
end
for key, val in pairs(fac.induction_data_tbl[id].tanks) do
fac.induction_ps_tbl[id].publish(key, val)
end end
else else
log.debug(util.c(log_header, "invalid induction matrix id ", id)) log.debug(util.c(log_header, "invalid induction matrix id ", id))
@@ -430,6 +683,82 @@ function iocontrol.update_facility_status(status)
valid = false valid = false
end end
-- SPS statuses
if type(rtu_statuses.sps) == "table" then
for id = 1, #fac.sps_ps_tbl do
if rtu_statuses.sps[id] == nil then
-- disconnected
fac.sps_ps_tbl[id].publish("computed_status", 1)
end
end
for id, sps in pairs(rtu_statuses.sps) do
if type(fac.sps_data_tbl[id]) == "table" then
local data = fac.sps_data_tbl[id] ---@type sps_session_db
local ps = fac.sps_ps_tbl[id] ---@type psil
local rtu_faulted = _record_multiblock_status(sps, data, ps)
if rtu_faulted then
ps.publish("computed_status", 3) -- faulted
elseif data.formed then
if data.state.process_rate > 0 then
ps.publish("computed_status", 5) -- active
else
ps.publish("computed_status", 4) -- idle
end
else
ps.publish("computed_status", 2) -- not formed
end
io.facility.ps.publish("am_rate", data.state.process_rate * 1000)
else
log.debug(util.c(log_header, "invalid sps id ", id))
end
end
else
log.debug(log_header .. "sps list not a table")
valid = false
end
-- dynamic tank statuses
if type(rtu_statuses.tanks) == "table" then
for id = 1, #fac.tank_ps_tbl do
if rtu_statuses.tanks[id] == nil then
-- disconnected
fac.tank_ps_tbl[id].publish("computed_status", 1)
end
end
for id, tank in pairs(rtu_statuses.tanks) do
if type(fac.tank_data_tbl[id]) == "table" then
local data = fac.tank_data_tbl[id] ---@type dynamicv_session_db
local ps = fac.tank_ps_tbl[id] ---@type psil
local rtu_faulted = _record_multiblock_status(tank, data, ps)
if rtu_faulted then
ps.publish("computed_status", 3) -- faulted
elseif data.formed then
if data.tanks.fill >= 0.99 then
ps.publish("computed_status", 6) -- full
elseif data.tanks.fill < 0.20 then
ps.publish("computed_status", 5) -- low
else
ps.publish("computed_status", 4) -- on-line
end
else
ps.publish("computed_status", 2) -- not formed
end
else
log.debug(util.c(log_header, "invalid dynamic tank id ", id))
end
end
else
log.debug(log_header .. "dyanmic tank list not a table")
valid = false
end
-- environment detector status -- environment detector status
if type(rtu_statuses.rad_mon) == "table" then if type(rtu_statuses.rad_mon) == "table" then
if #rtu_statuses.rad_mon > 0 then if #rtu_statuses.rad_mon > 0 then
@@ -453,6 +782,16 @@ function iocontrol.update_facility_status(status)
end end
fac.ps.publish("rtu_count", fac.rtu_count) fac.ps.publish("rtu_count", fac.rtu_count)
-- alarm tone commands
if (type(status[3]) == "table") and (#status[3] == 8) then
fac.alarm_tones = status[3]
sounder.set(fac.alarm_tones)
else
log.debug(log_header .. "alarm tones not a table or length mismatch")
valid = false
end
end end
return valid return valid
@@ -472,6 +811,8 @@ function iocontrol.update_unit_statuses(statuses)
valid = false valid = false
else else
local burn_rate_sum = 0.0 local burn_rate_sum = 0.0
local sna_count_sum = 0
local pu_rate, po_rate, po_pl_rate, po_am_rate, spent_rate = 0.0, 0.0, 0.0, 0.0, 0.0
-- get all unit statuses -- get all unit statuses
for i = 1, #statuses do for i = 1, #statuses do
@@ -480,7 +821,9 @@ function iocontrol.update_unit_statuses(statuses)
local unit = io.units[i] ---@type ioctl_unit local unit = io.units[i] ---@type ioctl_unit
local status = statuses[i] local status = statuses[i]
if type(status) ~= "table" or #status ~= 5 then local burn_rate = 0.0
if type(status) ~= "table" or #status ~= 6 then
log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)") log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)")
valid = false valid = false
else else
@@ -515,7 +858,8 @@ function iocontrol.update_unit_statuses(statuses)
-- if status hasn't been received, mek_status = {} -- if status hasn't been received, mek_status = {}
if type(unit.reactor_data.mek_status.act_burn_rate) == "number" then if type(unit.reactor_data.mek_status.act_burn_rate) == "number" then
burn_rate_sum = burn_rate_sum + unit.reactor_data.mek_status.act_burn_rate burn_rate = unit.reactor_data.mek_status.act_burn_rate
burn_rate_sum = burn_rate_sum + burn_rate
end end
if unit.reactor_data.mek_status.status then if unit.reactor_data.mek_status.status then
@@ -562,6 +906,8 @@ function iocontrol.update_unit_statuses(statuses)
if type(rtu_statuses) == "table" then if type(rtu_statuses) == "table" then
-- boiler statuses -- boiler statuses
if type(rtu_statuses.boilers) == "table" then if type(rtu_statuses.boilers) == "table" then
local boil_sum = 0
for id = 1, #unit.boiler_ps_tbl do for id = 1, #unit.boiler_ps_tbl do
if rtu_statuses.boilers[i] == nil then if rtu_statuses.boilers[i] == nil then
-- disconnected -- disconnected
@@ -571,40 +917,31 @@ function iocontrol.update_unit_statuses(statuses)
for id, boiler in pairs(rtu_statuses.boilers) do for id, boiler in pairs(rtu_statuses.boilers) do
if type(unit.boiler_data_tbl[id]) == "table" then if type(unit.boiler_data_tbl[id]) == "table" then
local rtu_faulted = boiler[1] ---@type boolean
unit.boiler_data_tbl[id].formed = boiler[2] ---@type boolean
unit.boiler_data_tbl[id].state = boiler[3] ---@type table
unit.boiler_data_tbl[id].tanks = boiler[4] ---@type table
local data = unit.boiler_data_tbl[id] ---@type boilerv_session_db local data = unit.boiler_data_tbl[id] ---@type boilerv_session_db
local ps = unit.boiler_ps_tbl[id] ---@type psil
unit.boiler_ps_tbl[id].publish("formed", data.formed) local rtu_faulted = _record_multiblock_status(boiler, data, ps)
unit.boiler_ps_tbl[id].publish("faulted", rtu_faulted)
if rtu_faulted then if rtu_faulted then
unit.boiler_ps_tbl[id].publish("computed_status", 3) -- faulted ps.publish("computed_status", 3) -- faulted
elseif data.formed then elseif data.formed then
boil_sum = boil_sum + data.state.boil_rate
if data.state.boil_rate > 0 then if data.state.boil_rate > 0 then
unit.boiler_ps_tbl[id].publish("computed_status", 5) -- active ps.publish("computed_status", 5) -- active
else else
unit.boiler_ps_tbl[id].publish("computed_status", 4) -- idle ps.publish("computed_status", 4) -- idle
end end
else else
unit.boiler_ps_tbl[id].publish("computed_status", 2) -- not formed ps.publish("computed_status", 2) -- not formed
end
for key, val in pairs(unit.boiler_data_tbl[id].state) do
unit.boiler_ps_tbl[id].publish(key, val)
end
for key, val in pairs(unit.boiler_data_tbl[id].tanks) do
unit.boiler_ps_tbl[id].publish(key, val)
end end
else else
log.debug(util.c(log_header, "invalid boiler id ", id)) log.debug(util.c(log_header, "invalid boiler id ", id))
valid = false valid = false
end end
end end
unit.unit_ps.publish("boiler_boil_sum", boil_sum)
else else
log.debug(log_header .. "boiler list not a table") log.debug(log_header .. "boiler list not a table")
valid = false valid = false
@@ -612,6 +949,8 @@ function iocontrol.update_unit_statuses(statuses)
-- turbine statuses -- turbine statuses
if type(rtu_statuses.turbines) == "table" then if type(rtu_statuses.turbines) == "table" then
local flow_sum = 0
for id = 1, #unit.turbine_ps_tbl do for id = 1, #unit.turbine_ps_tbl do
if rtu_statuses.turbines[i] == nil then if rtu_statuses.turbines[i] == nil then
-- disconnected -- disconnected
@@ -621,47 +960,93 @@ function iocontrol.update_unit_statuses(statuses)
for id, turbine in pairs(rtu_statuses.turbines) do for id, turbine in pairs(rtu_statuses.turbines) do
if type(unit.turbine_data_tbl[id]) == "table" then if type(unit.turbine_data_tbl[id]) == "table" then
local rtu_faulted = turbine[1] ---@type boolean
unit.turbine_data_tbl[id].formed = turbine[2] ---@type boolean
unit.turbine_data_tbl[id].state = turbine[3] ---@type table
unit.turbine_data_tbl[id].tanks = turbine[4] ---@type table
local data = unit.turbine_data_tbl[id] ---@type turbinev_session_db local data = unit.turbine_data_tbl[id] ---@type turbinev_session_db
local ps = unit.turbine_ps_tbl[id] ---@type psil
unit.turbine_ps_tbl[id].publish("formed", data.formed) local rtu_faulted = _record_multiblock_status(turbine, data, ps)
unit.turbine_ps_tbl[id].publish("faulted", rtu_faulted)
if rtu_faulted then if rtu_faulted then
unit.turbine_ps_tbl[id].publish("computed_status", 3) -- faulted ps.publish("computed_status", 3) -- faulted
elseif data.formed then elseif data.formed then
flow_sum = flow_sum + data.state.flow_rate
if data.tanks.energy_fill >= 0.99 then if data.tanks.energy_fill >= 0.99 then
unit.turbine_ps_tbl[id].publish("computed_status", 6) -- trip ps.publish("computed_status", 6) -- trip
elseif data.state.flow_rate < 100 then elseif data.state.flow_rate < 100 then
unit.turbine_ps_tbl[id].publish("computed_status", 4) -- idle ps.publish("computed_status", 4) -- idle
else else
unit.turbine_ps_tbl[id].publish("computed_status", 5) -- active ps.publish("computed_status", 5) -- active
end end
else else
unit.turbine_ps_tbl[id].publish("computed_status", 2) -- not formed ps.publish("computed_status", 2) -- not formed
end
for key, val in pairs(unit.turbine_data_tbl[id].state) do
unit.turbine_ps_tbl[id].publish(key, val)
end
for key, val in pairs(unit.turbine_data_tbl[id].tanks) do
unit.turbine_ps_tbl[id].publish(key, val)
end end
else else
log.debug(util.c(log_header, "invalid turbine id ", id)) log.debug(util.c(log_header, "invalid turbine id ", id))
valid = false valid = false
end end
end end
unit.unit_ps.publish("turbine_flow_sum", flow_sum)
else else
log.debug(log_header .. "turbine list not a table") log.debug(log_header .. "turbine list not a table")
valid = false valid = false
end end
-- dynamic tank statuses
if type(rtu_statuses.tanks) == "table" then
for id = 1, #unit.tank_ps_tbl do
if rtu_statuses.tanks[i] == nil then
-- disconnected
unit.tank_ps_tbl[id].publish("computed_status", 1)
end
end
for id, tank in pairs(rtu_statuses.tanks) do
if type(unit.tank_data_tbl[id]) == "table" then
local data = unit.tank_data_tbl[id] ---@type dynamicv_session_db
local ps = unit.tank_ps_tbl[id] ---@type psil
local rtu_faulted = _record_multiblock_status(tank, data, ps)
if rtu_faulted then
ps.publish("computed_status", 3) -- faulted
elseif data.formed then
if data.tanks.fill >= 0.99 then
ps.publish("computed_status", 6) -- full
elseif data.tanks.fill < 0.20 then
ps.publish("computed_status", 5) -- low
else
ps.publish("computed_status", 4) -- on-line
end
else
ps.publish("computed_status", 2) -- not formed
end
else
log.debug(util.c(log_header, "invalid dynamic tank id ", id))
valid = false
end
end
else
log.debug(log_header .. "dynamic tank list not a table")
valid = false
end
-- solar neutron activator status info
if type(rtu_statuses.sna) == "table" then
unit.num_snas = rtu_statuses.sna[1] ---@type integer
unit.sna_prod_rate = rtu_statuses.sna[2] ---@type number
unit.sna_peak_rate = rtu_statuses.sna[3] ---@type number
unit.unit_ps.publish("sna_count", unit.num_snas)
unit.unit_ps.publish("sna_prod_rate", unit.sna_prod_rate)
unit.unit_ps.publish("sna_peak_rate", unit.sna_peak_rate)
sna_count_sum = sna_count_sum + unit.num_snas
else
log.debug(log_header .. "sna statistic list not a table")
valid = false
end
-- environment detector status -- environment detector status
if type(rtu_statuses.rad_mon) == "table" then if type(rtu_statuses.rad_mon) == "table" then
if #rtu_statuses.rad_mon > 0 then if #rtu_statuses.rad_mon > 0 then
@@ -739,12 +1124,17 @@ function iocontrol.update_unit_statuses(statuses)
local unit_state = status[5] local unit_state = status[5]
if type(unit_state) == "table" then if type(unit_state) == "table" then
if #unit_state == 5 then if #unit_state == 6 then
unit.waste_mode = unit_state[5]
unit.waste_product = unit_state[6]
unit.unit_ps.publish("U_StatusLine1", unit_state[1]) unit.unit_ps.publish("U_StatusLine1", unit_state[1])
unit.unit_ps.publish("U_StatusLine2", unit_state[2]) unit.unit_ps.publish("U_StatusLine2", unit_state[2])
unit.unit_ps.publish("U_WasteMode", unit_state[3]) unit.unit_ps.publish("U_AutoReady", unit_state[3])
unit.unit_ps.publish("U_AutoReady", unit_state[4]) unit.unit_ps.publish("U_AutoDegraded", unit_state[4])
unit.unit_ps.publish("U_AutoDegraded", unit_state[5]) unit.unit_ps.publish("U_AutoWaste", unit.waste_mode == types.WASTE_MODE.AUTO)
unit.unit_ps.publish("U_WasteMode", unit.waste_mode)
unit.unit_ps.publish("U_WasteProduct", unit.waste_product)
else else
log.debug(log_header .. "unit state length mismatch") log.debug(log_header .. "unit state length mismatch")
valid = false valid = false
@@ -753,18 +1143,81 @@ function iocontrol.update_unit_statuses(statuses)
log.debug(log_header .. "unit state not a table") log.debug(log_header .. "unit state not a table")
valid = false valid = false
end end
-- valve states
local valve_states = status[6]
if type(valve_states) == "table" then
if #valve_states == 5 then
unit.unit_ps.publish("V_pu_conn", valve_states[1] > 0)
unit.unit_ps.publish("V_pu_state", valve_states[1] == 2)
unit.unit_ps.publish("V_po_conn", valve_states[2] > 0)
unit.unit_ps.publish("V_po_state", valve_states[2] == 2)
unit.unit_ps.publish("V_pl_conn", valve_states[3] > 0)
unit.unit_ps.publish("V_pl_state", valve_states[3] == 2)
unit.unit_ps.publish("V_am_conn", valve_states[4] > 0)
unit.unit_ps.publish("V_am_state", valve_states[4] == 2)
unit.unit_ps.publish("V_emc_conn", valve_states[5] > 0)
unit.unit_ps.publish("V_emc_state", valve_states[5] == 2)
else
log.debug(log_header .. "valve states length mismatch")
valid = false
end
else
log.debug(log_header .. "valve states not a table")
valid = false
end
-- determine waste production for this unit, add to statistics
local is_pu = unit.waste_product == types.WASTE_PRODUCT.PLUTONIUM
local waste_rate = burn_rate / 10.0
local u_spent_rate = waste_rate
local u_pu_rate = util.trinary(is_pu, waste_rate, 0.0)
local u_po_rate = util.trinary(not is_pu, math.min(waste_rate, unit.sna_prod_rate), 0.0)
unit.unit_ps.publish("pu_rate", u_pu_rate)
unit.unit_ps.publish("po_rate", u_po_rate)
unit.unit_ps.publish("sna_in", util.trinary(is_pu, 0, burn_rate))
if unit.waste_product == types.WASTE_PRODUCT.POLONIUM then
unit.unit_ps.publish("po_pl_rate", u_po_rate)
unit.unit_ps.publish("po_am_rate", 0)
po_pl_rate = po_pl_rate + u_po_rate
elseif unit.waste_product == types.WASTE_PRODUCT.ANTI_MATTER then
unit.unit_ps.publish("po_pl_rate", 0)
unit.unit_ps.publish("po_am_rate", u_po_rate)
po_am_rate = po_am_rate + u_po_rate
u_spent_rate = 0
else
unit.unit_ps.publish("po_pl_rate", 0)
unit.unit_ps.publish("po_am_rate", 0)
end
unit.unit_ps.publish("ws_rate", u_spent_rate)
pu_rate = pu_rate + u_pu_rate
po_rate = po_rate + u_po_rate
spent_rate = spent_rate + u_spent_rate
end end
end end
io.facility.ps.publish("burn_sum", burn_rate_sum) io.facility.ps.publish("burn_sum", burn_rate_sum)
io.facility.ps.publish("sna_count", sna_count_sum)
-- update alarm sounder io.facility.ps.publish("pu_rate", pu_rate)
sounder.eval(io.units) io.facility.ps.publish("po_rate", po_rate)
io.facility.ps.publish("po_pl_rate", po_pl_rate)
io.facility.ps.publish("po_am_rate", po_am_rate)
io.facility.ps.publish("spent_waste_rate", spent_rate)
end end
return valid return valid
end end
--#endregion
-- get the IO controller database -- get the IO controller database
function iocontrol.get_db() return io end function iocontrol.get_db() return io end

View File

@@ -11,6 +11,7 @@ local FAC_COMMAND = comms.FAC_COMMAND
local UNIT_COMMAND = comms.UNIT_COMMAND local UNIT_COMMAND = comms.UNIT_COMMAND
local PROCESS = types.PROCESS local PROCESS = types.PROCESS
local PRODUCT = types.WASTE_PRODUCT
---@class process_controller ---@class process_controller
local process = {} local process = {}
@@ -24,7 +25,9 @@ local self = {
burn_target = 0.0, burn_target = 0.0,
charge_target = 0.0, charge_target = 0.0,
gen_target = 0.0, gen_target = 0.0,
limits = {} limits = {},
waste_product = PRODUCT.PLUTONIUM,
pu_fallback = false
} }
} }
@@ -48,19 +51,23 @@ function process.init(iocontrol, coord_comms)
log.error("process.init(): failed to load coordinator settings file") log.error("process.init(): failed to load coordinator settings file")
end end
-- facility auto control configuration
local config = settings.get("PROCESS") ---@type coord_auto_config|nil local config = settings.get("PROCESS") ---@type coord_auto_config|nil
if type(config) == "table" then if type(config) == "table" then
self.config.mode = config.mode self.config.mode = config.mode
self.config.burn_target = config.burn_target self.config.burn_target = config.burn_target
self.config.charge_target = config.charge_target self.config.charge_target = config.charge_target
self.config.gen_target = config.gen_target self.config.gen_target = config.gen_target
self.config.limits = config.limits self.config.limits = config.limits
self.config.waste_product = config.waste_product
self.config.pu_fallback = config.pu_fallback
self.io.facility.ps.publish("process_mode", self.config.mode) self.io.facility.ps.publish("process_mode", self.config.mode)
self.io.facility.ps.publish("process_burn_target", self.config.burn_target) self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
self.io.facility.ps.publish("process_charge_target", self.config.charge_target) self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
self.io.facility.ps.publish("process_gen_target", self.config.gen_target) self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
self.io.facility.ps.publish("process_waste_product", self.config.waste_product)
self.io.facility.ps.publish("process_pu_fallback", self.config.pu_fallback)
for id = 1, math.min(#self.config.limits, self.io.facility.num_units) do for id = 1, math.min(#self.config.limits, self.io.facility.num_units) do
local unit = self.io.units[id] ---@type ioctl_unit local unit = self.io.units[id] ---@type ioctl_unit
@@ -68,20 +75,24 @@ function process.init(iocontrol, coord_comms)
end end
log.info("PROCESS: loaded auto control settings from coord.settings") log.info("PROCESS: loaded auto control settings from coord.settings")
-- notify supervisor of auto waste config
self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, self.config.waste_product)
self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, self.config.pu_fallback)
end end
local waste_mode = settings.get("WASTE_MODES") ---@type table|nil -- unit waste states
local waste_modes = settings.get("WASTE_MODES") ---@type table|nil
if type(waste_mode) == "table" then if type(waste_modes) == "table" then
for id, mode in pairs(waste_mode) do for id, mode in pairs(waste_modes) do
self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode) self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
end end
log.info("PROCESS: loaded waste mode settings from coord.settings") log.info("PROCESS: loaded unit waste mode settings from coord.settings")
end end
-- unit priority groups
local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil
if type(prio_groups) == "table" then if type(prio_groups) == "table" then
for id, group in pairs(prio_groups) do for id, group in pairs(prio_groups) do
self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group) self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group)
@@ -137,7 +148,7 @@ end
-- set waste mode -- set waste mode
---@param id integer unit ID ---@param id integer unit ID
---@param mode integer waste mode ---@param mode integer waste mode
function process.set_waste(id, mode) function process.set_unit_waste(id, mode)
-- publish so that if it fails then it gets reset -- publish so that if it fails then it gets reset
self.io.units[id].unit_ps.publish("U_WasteMode", mode) self.io.units[id].unit_ps.publish("U_WasteMode", mode)
@@ -153,7 +164,7 @@ function process.set_waste(id, mode)
settings.set("WASTE_MODES", waste_mode) settings.set("WASTE_MODES", waste_mode)
if not settings.save("/coord.settings") then if not settings.save("/coord.settings") then
log.error("process.set_waste(): failed to save coordinator settings file") log.error("process.set_unit_waste(): failed to save coordinator settings file")
end end
end end
@@ -204,6 +215,24 @@ end
-- AUTO PROCESS CONTROL -- -- AUTO PROCESS CONTROL --
-------------------------- --------------------------
-- write auto process control to config file
local function _write_auto_config()
-- attempt to load settings
if not settings.load("/coord.settings") then
log.warning("process._write_auto_config(): failed to load coordinator settings file")
end
-- save config
settings.set("PROCESS", self.config)
local saved = settings.save("/coord.settings")
if not saved then
log.warning("process._write_auto_config(): failed to save coordinator settings file")
end
return not not saved
end
-- stop automatic process control -- stop automatic process control
function process.stop_auto() function process.stop_auto()
self.comms.send_fac_command(FAC_COMMAND.STOP) self.comms.send_fac_command(FAC_COMMAND.STOP)
@@ -216,6 +245,30 @@ function process.start_auto()
log.debug("PROCESS: START AUTO CTL") log.debug("PROCESS: START AUTO CTL")
end end
-- set automatic process control waste mode
---@param product WASTE_PRODUCT waste product for auto control
function process.set_process_waste(product)
self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, product)
log.debug(util.c("PROCESS: SET WASTE ", product))
-- update config table and save
self.config.waste_product = product
_write_auto_config()
end
-- set automatic process control plutonium fallback
---@param enabled boolean whether to enable plutonium fallback
function process.set_pu_fallback(enabled)
self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, enabled)
log.debug(util.c("PROCESS: SET PU FALLBACK ", enabled))
-- update config table and save
self.config.pu_fallback = enabled
_write_auto_config()
end
-- save process control settings -- save process control settings
---@param mode PROCESS control mode ---@param mode PROCESS control mode
---@param burn_target number burn rate target ---@param burn_target number burn rate target
@@ -223,29 +276,17 @@ end
---@param gen_target number generation rate target ---@param gen_target number generation rate target
---@param limits table unit burn rate limits ---@param limits table unit burn rate limits
function process.save(mode, burn_target, charge_target, gen_target, limits) function process.save(mode, burn_target, charge_target, gen_target, limits)
-- attempt to load settings log.debug("PROCESS: SAVE")
if not settings.load("/coord.settings") then
log.warning("process.save(): failed to load coordinator settings file")
end
-- config table -- update config table
self.config = { self.config.mode = mode
mode = mode, self.config.burn_target = burn_target
burn_target = burn_target, self.config.charge_target = charge_target
charge_target = charge_target, self.config.gen_target = gen_target
gen_target = gen_target, self.config.limits = limits
limits = limits
}
-- save config -- save config
settings.set("PROCESS", self.config) self.io.facility.save_cfg_ack(_write_auto_config())
local saved = settings.save("/coord.settings")
if not saved then
log.warning("process.save(): failed to save coordinator settings file")
end
self.io.facility.save_cfg_ack(saved)
end end
-- handle a start command acknowledgement -- handle a start command acknowledgement
@@ -258,16 +299,33 @@ function process.start_ack_handle(response)
self.config.charge_target = response[4] self.config.charge_target = response[4]
self.config.gen_target = response[5] self.config.gen_target = response[5]
for i = 1, #response[6] do for i = 1, math.min(#response[6], self.io.facility.num_units) do
self.config.limits[i] = response[6][i] self.config.limits[i] = response[6][i]
local unit = self.io.units[i] ---@type ioctl_unit
unit.unit_ps.publish("burn_limit", self.config.limits[i])
end end
self.io.facility.ps.publish("auto_mode", self.config.mode) self.io.facility.ps.publish("process_mode", self.config.mode)
self.io.facility.ps.publish("burn_target", self.config.burn_target) self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
self.io.facility.ps.publish("charge_target", self.config.charge_target) self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
self.io.facility.ps.publish("gen_target", self.config.gen_target) self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
self.io.facility.start_ack(ack) self.io.facility.start_ack(ack)
end end
-- record waste product state after attempting to change it
---@param response WASTE_PRODUCT supervisor waste product state
function process.waste_ack_handle(response)
self.config.waste_product = response
self.io.facility.ps.publish("process_waste_product", response)
end
-- record plutonium fallback state after attempting to change it
---@param response boolean supervisor plutonium fallback state
function process.pu_fb_ack_handle(response)
self.config.pu_fallback = response
self.io.facility.ps.publish("process_pu_fallback", response)
end
return process return process

View File

@@ -5,8 +5,13 @@
local log = require("scada-common.log") local log = require("scada-common.log")
local util = require("scada-common.util") local util = require("scada-common.util")
local style = require("coordinator.ui.style") local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style")
local pgi = require("coordinator.ui.pgi")
local flow_view = require("coordinator.ui.layout.flow_view")
local panel_view = require("coordinator.ui.layout.front_panel")
local main_view = require("coordinator.ui.layout.main_view") local main_view = require("coordinator.ui.layout.main_view")
local unit_view = require("coordinator.ui.layout.unit_view") local unit_view = require("coordinator.ui.layout.unit_view")
@@ -21,10 +26,14 @@ local engine = {
monitors = nil, ---@type monitors_struct|nil monitors = nil, ---@type monitors_struct|nil
dmesg_window = nil, ---@type table|nil dmesg_window = nil, ---@type table|nil
ui_ready = false, ui_ready = false,
fp_ready = false,
ui = { ui = {
front_panel = nil, ---@type graphics_element|nil
main_display = nil, ---@type graphics_element|nil main_display = nil, ---@type graphics_element|nil
flow_display = nil, ---@type graphics_element|nil
unit_displays = {} unit_displays = {}
} },
disable_flow_view = false
} }
-- init a display to the "default", but set text scale to 0.5 -- init a display to the "default", but set text scale to 0.5
@@ -42,39 +51,44 @@ local function _init_display(monitor)
end end
end end
-- disable the flow view
---@param disable boolean
function renderer.legacy_disable_flow_view(disable)
engine.disable_flow_view = disable
end
-- link to the monitor peripherals -- link to the monitor peripherals
---@param monitors monitors_struct ---@param monitors monitors_struct
function renderer.set_displays(monitors) function renderer.set_displays(monitors)
engine.monitors = monitors engine.monitors = monitors
end
-- check if the renderer is configured to use a given monitor peripheral -- report to front panel as connected
---@nodiscard iocontrol.fp_monitor_state("main", engine.monitors.primary ~= nil)
---@param periph table peripheral iocontrol.fp_monitor_state("flow", engine.monitors.flow ~= nil)
---@return boolean is_used for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end
function renderer.is_monitor_used(periph)
if engine.monitors ~= nil then
if engine.monitors.primary == periph then
return true
else
for _, monitor in ipairs(engine.monitors.unit_displays) do
if monitor == periph then return true end
end
end
end
return false
end end
-- init all displays in use by the renderer -- init all displays in use by the renderer
function renderer.init_displays() function renderer.init_displays()
-- init primary monitor -- init primary and flow monitors
_init_display(engine.monitors.primary) _init_display(engine.monitors.primary)
if not engine.disable_flow_view then _init_display(engine.monitors.flow) end
-- init unit displays -- init unit displays
for _, monitor in ipairs(engine.monitors.unit_displays) do for _, monitor in ipairs(engine.monitors.unit_displays) do
_init_display(monitor) _init_display(monitor)
end end
-- init terminal
term.setTextColor(colors.white)
term.setBackgroundColor(colors.black)
term.clear()
term.setCursorPos(1, 1)
-- set overridden colors
for i = 1, #style.fp.colors do
term.setPaletteColor(style.fp.colors[i].c, style.fp.colors[i].hex)
end
end end
-- check main display width -- check main display width
@@ -85,6 +99,14 @@ function renderer.validate_main_display_width()
return w == 164 return w == 164
end end
-- check flow display width
---@nodiscard
---@return boolean width_okay
function renderer.validate_flow_display_width()
local w, _ = engine.monitors.flow.getSize()
return w == 164
end
-- check display sizes -- check display sizes
---@nodiscard ---@nodiscard
---@return boolean valid all unit display dimensions OK ---@return boolean valid all unit display dimensions OK
@@ -109,6 +131,51 @@ function renderer.init_dmesg()
log.direct_dmesg(engine.dmesg_window) log.direct_dmesg(engine.dmesg_window)
end end
-- start the coordinator front panel
function renderer.start_fp()
if not engine.fp_ready then
-- show front panel view on terminal
engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
-- start flasher callback task
flasher.run()
-- report front panel as ready
engine.fp_ready = true
end
end
-- close out the front panel
function renderer.close_fp()
if engine.fp_ready then
if not engine.ui_ready then
-- stop blinking indicators
flasher.clear()
end
-- disable PGI
pgi.unlink()
-- hide to stop animation callbacks and clear root UI elements
engine.ui.front_panel.hide()
engine.ui.front_panel = nil
engine.fp_ready = false
-- restore colors
for i = 1, #style.colors do
local r, g, b = term.nativePaletteColor(style.colors[i].c)
term.setPaletteColor(style.colors[i].c, r, g, b)
end
-- reset terminal
term.setTextColor(colors.white)
term.setBackgroundColor(colors.black)
term.clear()
term.setCursorPos(1, 1)
end
end
-- start the coordinator GUI -- start the coordinator GUI
function renderer.start_ui() function renderer.start_ui()
if not engine.ui_ready then if not engine.ui_ready then
@@ -116,13 +183,21 @@ function renderer.start_ui()
engine.dmesg_window.setVisible(false) engine.dmesg_window.setVisible(false)
-- show main view on main monitor -- show main view on main monitor
if engine.monitors.primary ~= nil then
engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root} engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root}
main_view(engine.ui.main_display) main_view(engine.ui.main_display)
end
-- show flow view on flow monitor
if engine.monitors.flow ~= nil then
engine.ui.flow_display = DisplayBox{window=engine.monitors.flow,fg_bg=style.root}
flow_view(engine.ui.flow_display)
end
-- show unit views on unit displays -- show unit views on unit displays
for i = 1, #engine.monitors.unit_displays do for idx, display in pairs(engine.monitors.unit_displays) do
engine.ui.unit_displays[i] = DisplayBox{window=engine.monitors.unit_displays[i],fg_bg=style.root} engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
unit_view(engine.ui.unit_displays[i], i) unit_view(engine.ui.unit_displays[idx], idx)
end end
-- start flasher callback task -- start flasher callback task
@@ -135,18 +210,22 @@ end
-- close out the UI -- close out the UI
function renderer.close_ui() function renderer.close_ui()
if not engine.fp_ready then
-- stop blinking indicators -- stop blinking indicators
flasher.clear() flasher.clear()
end
-- delete element trees -- delete element trees
if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end
for _, display in ipairs(engine.ui.unit_displays) do display.delete() end if engine.ui.flow_display ~= nil then engine.ui.flow_display.delete() end
for _, display in pairs(engine.ui.unit_displays) do display.delete() end
-- report ui as not ready -- report ui as not ready
engine.ui_ready = false engine.ui_ready = false
-- clear root UI elements -- clear root UI elements
engine.ui.main_display = nil engine.ui.main_display = nil
engine.ui.flow_display = nil
engine.ui.unit_displays = {} engine.ui.unit_displays = {}
-- clear unit monitors -- clear unit monitors
@@ -157,22 +236,145 @@ function renderer.close_ui()
engine.dmesg_window.redraw() engine.dmesg_window.redraw()
end end
-- is the front panel ready?
---@nodiscard
---@return boolean ready
function renderer.fp_ready() return engine.fp_ready end
-- is the UI ready? -- is the UI ready?
---@nodiscard ---@nodiscard
---@return boolean ready ---@return boolean ready
function renderer.ui_ready() return engine.ui_ready end function renderer.ui_ready() return engine.ui_ready end
-- handle a monitor peripheral being disconnected
---@param device table monitor
---@return boolean is_used if the monitor is one of the configured monitors
function renderer.handle_disconnect(device)
local is_used = false
if engine.monitors ~= nil then
if engine.monitors.primary == device then
if engine.ui.main_display ~= nil then
-- delete element tree and clear root UI elements
engine.ui.main_display.delete()
end
is_used = true
engine.monitors.primary = nil
engine.ui.main_display = nil
iocontrol.fp_monitor_state("main", false)
elseif engine.monitors.flow == device then
if engine.ui.flow_display ~= nil then
-- delete element tree and clear root UI elements
engine.ui.flow_display.delete()
end
is_used = true
engine.monitors.flow = nil
engine.ui.flow_display = nil
iocontrol.fp_monitor_state("flow", false)
else
for idx, monitor in pairs(engine.monitors.unit_displays) do
if monitor == device then
if engine.ui.unit_displays[idx] ~= nil then
engine.ui.unit_displays[idx].delete()
end
is_used = true
engine.monitors.unit_displays[idx] = nil
engine.ui.unit_displays[idx] = nil
iocontrol.fp_monitor_state(idx, false)
break
end
end
end
end
return is_used
end
-- handle a monitor peripheral being reconnected
---@param name string monitor name
---@param device table monitor
---@return boolean is_used if the monitor is one of the configured monitors
function renderer.handle_reconnect(name, device)
local is_used = false
if engine.monitors ~= nil then
if engine.monitors.primary_name == name then
is_used = true
_init_display(device)
engine.monitors.primary = device
local disp_x, disp_y = engine.monitors.primary.getSize()
engine.dmesg_window.reposition(1, 1, disp_x, disp_y, engine.monitors.primary)
if engine.ui_ready and (engine.ui.main_display == nil) then
engine.dmesg_window.setVisible(false)
engine.ui.main_display = DisplayBox{window=device,fg_bg=style.root}
main_view(engine.ui.main_display)
else
engine.dmesg_window.setVisible(true)
engine.dmesg_window.redraw()
end
iocontrol.fp_monitor_state("main", true)
elseif engine.monitors.flow_name == name then
is_used = true
_init_display(device)
engine.monitors.flow = device
if engine.ui_ready and (engine.ui.flow_display == nil) then
engine.ui.flow_display = DisplayBox{window=device,fg_bg=style.root}
flow_view(engine.ui.flow_display)
end
iocontrol.fp_monitor_state("flow", true)
else
for idx, monitor in ipairs(engine.monitors.unit_name_map) do
if monitor == name then
is_used = true
_init_display(device)
engine.monitors.unit_displays[idx] = device
if engine.ui_ready and (engine.ui.unit_displays[idx] == nil) then
engine.ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
unit_view(engine.ui.unit_displays[idx], idx)
end
iocontrol.fp_monitor_state(idx, true)
break
end
end
end
end
return is_used
end
-- handle a touch event -- handle a touch event
---@param event mouse_interaction|nil ---@param event mouse_interaction|nil
function renderer.handle_mouse(event) function renderer.handle_mouse(event)
if engine.ui_ready and event ~= nil then if event ~= nil then
if engine.fp_ready and event.monitor == "terminal" then
engine.ui.front_panel.handle_mouse(event)
elseif engine.ui_ready then
if event.monitor == engine.monitors.primary_name then if event.monitor == engine.monitors.primary_name then
engine.ui.main_display.handle_mouse(event) engine.ui.main_display.handle_mouse(event)
elseif event.monitor == engine.monitors.flow_name then
engine.ui.flow_display.handle_mouse(event)
else else
for id, monitor in ipairs(engine.monitors.unit_name_map) do for id, monitor in ipairs(engine.monitors.unit_name_map) do
if event.monitor == monitor then if event.monitor == monitor then
local layout = engine.ui.unit_displays[id] ---@type graphics_element local layout = engine.ui.unit_displays[id] ---@type graphics_element
layout.handle_mouse(event) layout.handle_mouse(event)
break
end
end end
end end
end end

View File

@@ -4,13 +4,14 @@ local mqueue = require("scada-common.mqueue")
local util = require("scada-common.util") local util = require("scada-common.util")
local config = require("coordinator.config") local config = require("coordinator.config")
local iocontrol = require("coordinator.iocontrol")
local pocket = require("coordinator.session.pocket") local pocket = require("coordinator.session.pocket")
local apisessions = {} local apisessions = {}
local self = { local self = {
modem = nil, nic = nil,
next_id = 0, next_id = 0,
sessions = {} sessions = {}
} }
@@ -31,7 +32,7 @@ local function _api_handle_outq(session)
if msg ~= nil then if msg ~= nil then
if msg.qtype == mqueue.TYPE.PACKET then if msg.qtype == mqueue.TYPE.PACKET then
-- handle a packet to be sent -- handle a packet to be sent
self.modem.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message.raw_sendable()) self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
elseif msg.qtype == mqueue.TYPE.COMMAND then elseif msg.qtype == mqueue.TYPE.COMMAND then
-- handle instruction/notification -- handle instruction/notification
elseif msg.qtype == mqueue.TYPE.DATA then elseif msg.qtype == mqueue.TYPE.DATA then
@@ -58,7 +59,7 @@ local function _shutdown(session)
while session.out_queue.ready() do while session.out_queue.ready() do
local msg = session.out_queue.pop() local msg = session.out_queue.pop()
if msg ~= nil and msg.qtype == mqueue.TYPE.PACKET then if msg ~= nil and msg.qtype == mqueue.TYPE.PACKET then
self.modem.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message.raw_sendable()) self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
end end
end end
@@ -68,15 +69,9 @@ end
-- PUBLIC FUNCTIONS -- -- PUBLIC FUNCTIONS --
-- initialize apisessions -- initialize apisessions
---@param modem table ---@param nic nic
function apisessions.init(modem) function apisessions.init(nic)
self.modem = modem self.nic = nic
end
-- re-link the modem
---@param modem table
function apisessions.relink_modem(modem)
self.modem = modem
end end
-- find a session by remote port -- find a session by remote port
@@ -118,6 +113,7 @@ function apisessions.establish_session(source_addr, version)
setmetatable(pkt_s, mt) setmetatable(pkt_s, mt)
iocontrol.fp_pkt_connected(id, version, source_addr)
log.debug(util.c("[API] established new session: ", pkt_s)) log.debug(util.c("[API] established new session: ", pkt_s))
self.next_id = id + 1 self.next_id = id + 1

View File

@@ -3,14 +3,14 @@ local log = require("scada-common.log")
local mqueue = require("scada-common.mqueue") local mqueue = require("scada-common.mqueue")
local util = require("scada-common.util") local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local pocket = {} local pocket = {}
local PROTOCOL = comms.PROTOCOL local PROTOCOL = comms.PROTOCOL
-- local CAPI_TYPE = comms.CAPI_TYPE -- local CAPI_TYPE = comms.CAPI_TYPE
local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
local println = util.println
-- retry time constants in ms -- retry time constants in ms
-- local INITIAL_WAIT = 1500 -- local INITIAL_WAIT = 1500
-- local RETRY_PERIOD = 1000 -- local RETRY_PERIOD = 1000
@@ -69,6 +69,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
local function _close() local function _close()
self.conn_watchdog.cancel() self.conn_watchdog.cancel()
self.connected = false self.connected = false
iocontrol.fp_pkt_disconnected(id)
end end
-- send a CAPI packet -- send a CAPI packet
@@ -140,6 +141,8 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
-- log.debug(log_header .. "PKT RTT = " .. self.last_rtt .. "ms") -- log.debug(log_header .. "PKT RTT = " .. self.last_rtt .. "ms")
-- log.debug(log_header .. "PKT TT = " .. (srv_now - api_send) .. "ms") -- log.debug(log_header .. "PKT TT = " .. (srv_now - api_send) .. "ms")
iocontrol.fp_pkt_rtt(id, self.last_rtt)
else else
log.debug(log_header .. "SCADA keep alive packet length mismatch") log.debug(log_header .. "SCADA keep alive packet length mismatch")
end end
@@ -172,7 +175,6 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
function public.close() function public.close()
_close() _close()
_send_mgmt(SCADA_MGMT_TYPE.CLOSE, {}) _send_mgmt(SCADA_MGMT_TYPE.CLOSE, {})
println("connection to pocket session " .. id .. " closed by server")
log.info(log_header .. "session closed by server") log.info(log_header .. "session closed by server")
end end
@@ -211,7 +213,6 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
-- exit if connection was closed -- exit if connection was closed
if not self.connected then if not self.connected then
println("connection to pocket session " .. id .. " closed by remote host")
log.info(log_header .. "session closed by remote host") log.info(log_header .. "session closed by remote host")
return self.connected return self.connected
end end

View File

@@ -2,269 +2,25 @@
-- Alarm Sounder -- Alarm Sounder
-- --
local audio = require("scada-common.audio")
local log = require("scada-common.log") local log = require("scada-common.log")
local types = require("scada-common.types")
local util = require("scada-common.util")
local ALARM = types.ALARM
local ALARM_STATE = types.ALARM_STATE
---@class sounder ---@class sounder
local sounder = {} local sounder = {}
-- note: max samples = 0x20000 (128 * 1024 samples)
local _2_PI = 2 * math.pi -- 2 whole pies, hope you're hungry
local _DRATE = 48000 -- 48kHz audio
local _MAX_VAL = 127 / 2 -- max signed integer in this 8-bit audio
local _05s_SAMPLES = 24000 -- half a second worth of samples
local test_alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
local alarm_ctl = { local alarm_ctl = {
speaker = nil, speaker = nil,
volume = 0.5, volume = 0.5,
playing = false, stream = audio.new_stream()
num_active = 0,
next_block = 1,
-- split audio up into 0.5s samples so specific components can be ended quicker
quad_buffer = { {}, {}, {}, {} }
} }
-- sounds modeled after https://www.e2s.com/references-and-guidelines/listen-and-download-alarm-tones
local T_340Hz_Int_2Hz = 1
local T_544Hz_440Hz_Alt = 2
local T_660Hz_Int_125ms = 3
local T_745Hz_Int_1Hz = 4
local T_800Hz_Int = 5
local T_800Hz_1000Hz_Alt = 6
local T_1000Hz_Int = 7
local T_1800Hz_Int_4Hz = 8
local TONES = {
{ active = false, component = { {}, {}, {}, {} } }, -- 340Hz @ 2Hz Intermittent
{ active = false, component = { {}, {}, {}, {} } }, -- 544Hz 100mS / 440Hz 400mS Alternating
{ active = false, component = { {}, {}, {}, {} } }, -- 660Hz @ 125ms On 125ms Off
{ active = false, component = { {}, {}, {}, {} } }, -- 745Hz @ 1Hz Intermittent
{ active = false, component = { {}, {}, {}, {} } }, -- 800Hz @ 0.25s On 1.75s Off
{ active = false, component = { {}, {}, {}, {} } }, -- 800/1000Hz @ 0.25s Alternating
{ active = false, component = { {}, {}, {}, {} } }, -- 1KHz 1s on, 1s off Intermittent
{ active = false, component = { {}, {}, {}, {} } } -- 1.8KHz @ 4Hz Intermittent
}
-- calculate how many samples are in the given number of milliseconds
---@nodiscard
---@param ms integer milliseconds
---@return integer samples
local function ms_to_samples(ms) return math.floor(ms * 48) end
--#region Tone Generation (the Maths)
-- 340Hz @ 2Hz Intermittent
local function gen_tone_1()
local t, dt = 0, _2_PI * 340 / _DRATE
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[1].component[1][i] = val
TONES[1].component[3][i] = val
TONES[1].component[2][i] = 0
TONES[1].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 544Hz 100mS / 440Hz 400mS Alternating
local function gen_tone_2()
local t1, dt1 = 0, _2_PI * 544 / _DRATE
local t2, dt2 = 0, _2_PI * 440 / _DRATE
local alternate_at = ms_to_samples(100)
for i = 1, _05s_SAMPLES do
local value
if i <= alternate_at then
value = math.floor(math.sin(t1) * _MAX_VAL)
t1 = (t1 + dt1) % _2_PI
else
value = math.floor(math.sin(t2) * _MAX_VAL)
t2 = (t2 + dt2) % _2_PI
end
TONES[2].component[1][i] = value
TONES[2].component[2][i] = value
TONES[2].component[3][i] = value
TONES[2].component[4][i] = value
end
end
-- 660Hz @ 125ms On 125ms Off
local function gen_tone_3()
local elapsed_samples = 0
local alternate_after = ms_to_samples(125)
local alternate_at = alternate_after
local mode = true
local t, dt = 0, _2_PI * 660 / _DRATE
for set = 1, 4 do
for i = 1, _05s_SAMPLES do
if mode then
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[3].component[set][i] = val
t = (t + dt) % _2_PI
else
t = 0
TONES[3].component[set][i] = 0
end
if elapsed_samples == alternate_at then
mode = not mode
alternate_at = elapsed_samples + alternate_after
end
elapsed_samples = elapsed_samples + 1
end
end
end
-- 745Hz @ 1Hz Intermittent
local function gen_tone_4()
local t, dt = 0, _2_PI * 745 / _DRATE
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[4].component[1][i] = val
TONES[4].component[3][i] = val
TONES[4].component[2][i] = 0
TONES[4].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 800Hz @ 0.25s On 1.75s Off
local function gen_tone_5()
local t, dt = 0, _2_PI * 800 / _DRATE
local stop_at = ms_to_samples(250)
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
if i > stop_at then
TONES[5].component[1][i] = val
else
TONES[5].component[1][i] = 0
end
TONES[5].component[2][i] = 0
TONES[5].component[3][i] = 0
TONES[5].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 1000/800Hz @ 0.25s Alternating
local function gen_tone_6()
local t1, dt1 = 0, _2_PI * 1000 / _DRATE
local t2, dt2 = 0, _2_PI * 800 / _DRATE
local alternate_at = ms_to_samples(250)
for i = 1, _05s_SAMPLES do
local val
if i <= alternate_at then
val = math.floor(math.sin(t1) * _MAX_VAL)
t1 = (t1 + dt1) % _2_PI
else
val = math.floor(math.sin(t2) * _MAX_VAL)
t2 = (t2 + dt2) % _2_PI
end
TONES[6].component[1][i] = val
TONES[6].component[2][i] = val
TONES[6].component[3][i] = val
TONES[6].component[4][i] = val
end
end
-- 1KHz 1s on, 1s off Intermittent
local function gen_tone_7()
local t, dt = 0, _2_PI * 1000 / _DRATE
for i = 1, _05s_SAMPLES do
local val = math.floor(math.sin(t) * _MAX_VAL)
TONES[7].component[1][i] = val
TONES[7].component[2][i] = val
TONES[7].component[3][i] = 0
TONES[7].component[4][i] = 0
t = (t + dt) % _2_PI
end
end
-- 1800Hz @ 4Hz Intermittent
local function gen_tone_8()
local t, dt = 0, _2_PI * 1800 / _DRATE
local off_at = ms_to_samples(250)
for i = 1, _05s_SAMPLES do
local val = 0
if i <= off_at then
val = math.floor(math.sin(t) * _MAX_VAL)
t = (t + dt) % _2_PI
end
TONES[8].component[1][i] = val
TONES[8].component[2][i] = val
TONES[8].component[3][i] = val
TONES[8].component[4][i] = val
end
end
--#endregion
-- hard audio limiter
---@nodiscard
---@param output number output level
---@return number limited -128.0 to 127.0
local function limit(output)
return math.max(-128, math.min(127, output))
end
-- zero the alarm audio buffer
local function zero()
for i = 1, 4 do
for s = 1, _05s_SAMPLES do alarm_ctl.quad_buffer[i][s] = 0 end
end
end
-- add an alarm to the output buffer
---@param alarm_idx integer tone ID
local function add(alarm_idx)
alarm_ctl.num_active = alarm_ctl.num_active + 1
TONES[alarm_idx].active = true
for i = 1, 4 do
for s = 1, _05s_SAMPLES do
alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] + TONES[alarm_idx].component[i][s])
end
end
end
-- start audio or continue audio on buffer empty -- start audio or continue audio on buffer empty
---@return boolean success successfully added buffer to audio output ---@return boolean success successfully added buffer to audio output
local function play() local function play()
if not alarm_ctl.playing then if not alarm_ctl.playing then
alarm_ctl.playing = true alarm_ctl.playing = true
alarm_ctl.next_block = 1
return sounder.continue() return sounder.continue()
else else return true end
return true
end
end end
-- initialize the annunciator alarm system -- initialize the annunciator alarm system
@@ -273,23 +29,10 @@ end
function sounder.init(speaker, volume) function sounder.init(speaker, volume)
alarm_ctl.speaker = speaker alarm_ctl.speaker = speaker
alarm_ctl.speaker.stop() alarm_ctl.speaker.stop()
alarm_ctl.volume = volume alarm_ctl.volume = volume
alarm_ctl.playing = false alarm_ctl.stream.stop()
alarm_ctl.num_active = 0
alarm_ctl.next_block = 1
zero() audio.generate_tones()
-- generate tones
gen_tone_1()
gen_tone_2()
gen_tone_3()
gen_tone_4()
gen_tone_5()
gen_tone_6()
gen_tone_7()
gen_tone_8()
end end
-- reconnect the speaker peripheral -- reconnect the speaker peripheral
@@ -297,173 +40,40 @@ end
function sounder.reconnect(speaker) function sounder.reconnect(speaker)
alarm_ctl.speaker = speaker alarm_ctl.speaker = speaker
alarm_ctl.playing = false alarm_ctl.playing = false
alarm_ctl.next_block = 1 alarm_ctl.stream.stop()
alarm_ctl.num_active = 0
for id = 1, #TONES do TONES[id].active = false end
end end
-- check alarm state to enable/disable alarms -- set alarm tones
---@param units table|nil unit list or nil to use test mode ---@param states table alarm tone commands from supervisor
function sounder.eval(units) function sounder.set(states)
local changed = false -- set tone states
local any_active = false for id = 1, #states do alarm_ctl.stream.set_active(id, states[id]) end
local new_states = { false, false, false, false, false, false, false, false }
local alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
if units ~= nil then -- re-compute output if needed, then play audio if available
-- check all alarms for all units if alarm_ctl.stream.is_recompute_needed() then alarm_ctl.stream.compute_buffer() end
for i = 1, #units do if alarm_ctl.stream.has_next_block() then play() else sounder.stop() end
local unit = units[i] ---@type ioctl_unit
for id = 1, #unit.alarms do
alarms[id] = alarms[id] or (unit.alarms[id] == ALARM_STATE.TRIPPED)
end
end
else
alarms = test_alarms
end
-- containment breach is worst case CRITICAL alarm, this takes priority
if alarms[ALARM.ContainmentBreach] then
new_states[T_1800Hz_Int_4Hz] = true
else
-- critical damage is highest priority CRITICAL level alarm
if alarms[ALARM.CriticalDamage] then
new_states[T_660Hz_Int_125ms] = true
else
-- EMERGENCY level alarms + URGENT over temp
if alarms[ALARM.ReactorDamage] or alarms[ALARM.ReactorOverTemp] or alarms[ALARM.ReactorWasteLeak] then
new_states[T_544Hz_440Hz_Alt] = true
-- URGENT level turbine trip
elseif alarms[ALARM.TurbineTrip] then
new_states[T_745Hz_Int_1Hz] = true
-- URGENT level reactor lost
elseif alarms[ALARM.ReactorLost] then
new_states[T_340Hz_Int_2Hz] = true
-- TIMELY level alarms
elseif alarms[ALARM.ReactorHighTemp] or alarms[ALARM.ReactorHighWaste] or alarms[ALARM.RCSTransient] then
new_states[T_800Hz_Int] = true
end
end
-- check RPS transient URGENT level alarm
if alarms[ALARM.RPSTransient] then
new_states[T_1000Hz_Int] = true
-- disable really painful audio combination
new_states[T_340Hz_Int_2Hz] = false
end
end
-- radiation is a big concern, always play this CRITICAL level alarm if active
if alarms[ALARM.ContainmentRadiation] then
new_states[T_800Hz_1000Hz_Alt] = true
-- we are going to disable the RPS trip alarm audio due to conflict, and if it was enabled
-- then we can re-enable the reactor lost alarm audio since it doesn't painfully combine with this one
if new_states[T_1000Hz_Int] and alarms[ALARM.ReactorLost] then new_states[T_340Hz_Int_2Hz] = true end
-- it sounds *really* bad if this is in conjunction with these other tones, so disable them
new_states[T_745Hz_Int_1Hz] = false
new_states[T_800Hz_Int] = false
new_states[T_1000Hz_Int] = false
end
-- check if any changed, check if any active, update active flags
for id = 1, #TONES do
if new_states[id] ~= TONES[id].active then
TONES[id].active = new_states[id]
changed = true
end
if TONES[id].active then any_active = true end
end
-- zero and re-add tones if changed
if changed then
zero()
for id = 1, #TONES do
if TONES[id].active then add(id) end
end
end
if any_active then play() else sounder.stop() end
end end
-- stop all audio and clear output buffer -- stop all audio and clear output buffer
function sounder.stop() function sounder.stop()
alarm_ctl.playing = false alarm_ctl.playing = false
alarm_ctl.speaker.stop() alarm_ctl.speaker.stop()
alarm_ctl.next_block = 1 alarm_ctl.stream.stop()
alarm_ctl.num_active = 0
for id = 1, #TONES do TONES[id].active = false end
zero()
end end
-- continue audio on buffer empty -- continue audio on buffer empty
---@return boolean success successfully added buffer to audio output ---@return boolean success successfully added buffer to audio output
function sounder.continue() function sounder.continue()
local success = false
if alarm_ctl.playing then if alarm_ctl.playing then
if alarm_ctl.speaker ~= nil and #alarm_ctl.quad_buffer[alarm_ctl.next_block] > 0 then if alarm_ctl.speaker ~= nil and alarm_ctl.stream.has_next_block() then
local success = alarm_ctl.speaker.playAudio(alarm_ctl.quad_buffer[alarm_ctl.next_block], alarm_ctl.volume) success = alarm_ctl.speaker.playAudio(alarm_ctl.stream.get_next_block(), alarm_ctl.volume)
if not success then log.error("SOUNDER: error playing audio") end
alarm_ctl.next_block = alarm_ctl.next_block + 1 end
if alarm_ctl.next_block > 4 then alarm_ctl.next_block = 1 end
if not success then
log.debug("SOUNDER: error playing audio")
end end
return success return success
else
return false
end end
else
return false
end
end
--#region Test Functions
function sounder.test_1() add(1) play() end -- play tone T_340Hz_Int_2Hz
function sounder.test_2() add(2) play() end -- play tone T_544Hz_440Hz_Alt
function sounder.test_3() add(3) play() end -- play tone T_660Hz_Int_125ms
function sounder.test_4() add(4) play() end -- play tone T_745Hz_Int_1Hz
function sounder.test_5() add(5) play() end -- play tone T_800Hz_Int
function sounder.test_6() add(6) play() end -- play tone T_800Hz_1000Hz_Alt
function sounder.test_7() add(7) play() end -- play tone T_1000Hz_Int
function sounder.test_8() add(8) play() end -- play tone T_1800Hz_Int_4Hz
function sounder.test_breach(active) test_alarms[ALARM.ContainmentBreach] = active end ---@param active boolean
function sounder.test_rad(active) test_alarms[ALARM.ContainmentRadiation] = active end ---@param active boolean
function sounder.test_lost(active) test_alarms[ALARM.ReactorLost] = active end ---@param active boolean
function sounder.test_crit(active) test_alarms[ALARM.CriticalDamage] = active end ---@param active boolean
function sounder.test_dmg(active) test_alarms[ALARM.ReactorDamage] = active end ---@param active boolean
function sounder.test_overtemp(active) test_alarms[ALARM.ReactorOverTemp] = active end ---@param active boolean
function sounder.test_hightemp(active) test_alarms[ALARM.ReactorHighTemp] = active end ---@param active boolean
function sounder.test_wasteleak(active) test_alarms[ALARM.ReactorWasteLeak] = active end ---@param active boolean
function sounder.test_highwaste(active) test_alarms[ALARM.ReactorHighWaste] = active end ---@param active boolean
function sounder.test_rps(active) test_alarms[ALARM.RPSTransient] = active end ---@param active boolean
function sounder.test_rcs(active) test_alarms[ALARM.RCSTransient] = active end ---@param active boolean
function sounder.test_turbinet(active) test_alarms[ALARM.TurbineTrip] = active end ---@param active boolean
-- power rescaling limiter test
function sounder.test_power_scale()
local start = util.time_ms()
zero()
for id = 1, #TONES do
if TONES[id].active then
for i = 1, 4 do
for s = 1, _05s_SAMPLES do
alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] +
(TONES[id].component[i][s] / math.sqrt(alarm_ctl.num_active)))
end
end
end
end
log.debug("SOUNDER: power rescale test took " .. (util.time_ms() - start) .. "ms")
end
--#endregion
return sounder return sounder

View File

@@ -4,8 +4,10 @@
require("/initenv").init_env() require("/initenv").init_env()
local comms = require("scada-common.comms")
local crash = require("scada-common.crash") local crash = require("scada-common.crash")
local log = require("scada-common.log") local log = require("scada-common.log")
local network = require("scada-common.network")
local ppm = require("scada-common.ppm") local ppm = require("scada-common.ppm")
local tcd = require("scada-common.tcd") local tcd = require("scada-common.tcd")
local util = require("scada-common.util") local util = require("scada-common.util")
@@ -20,7 +22,7 @@ local sounder = require("coordinator.sounder")
local apisessions = require("coordinator.session.apisessions") local apisessions = require("coordinator.session.apisessions")
local COORDINATOR_VERSION = "v0.16.0" local COORDINATOR_VERSION = "v1.0.2"
local println = util.println local println = util.println
local println_ts = util.println_ts local println_ts = util.println_ts
@@ -29,7 +31,7 @@ local log_graphics = coordinator.log_graphics
local log_sys = coordinator.log_sys local log_sys = coordinator.log_sys
local log_boot = coordinator.log_boot local log_boot = coordinator.log_boot
local log_comms = coordinator.log_comms local log_comms = coordinator.log_comms
local log_comms_connecting = coordinator.log_comms_connecting local log_crypto = coordinator.log_crypto
---------------------------------------- ----------------------------------------
-- config validation -- config validation
@@ -78,8 +80,11 @@ local function main()
-- mount connected devices -- mount connected devices
ppm.mount_all() ppm.mount_all()
-- report versions/init fp PSIL
iocontrol.init_fp(COORDINATOR_VERSION, comms.version)
-- setup monitors -- setup monitors
local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS) local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS, config.DISABLE_FLOW_VIEW == true)
if not configured or monitors == nil then if not configured or monitors == nil then
println("startup> monitor setup failed") println("startup> monitor setup failed")
log.fatal("monitor configuration failed") log.fatal("monitor configuration failed")
@@ -87,6 +92,7 @@ local function main()
end end
-- init renderer -- init renderer
renderer.legacy_disable_flow_view(config.DISABLE_FLOW_VIEW == true)
renderer.set_displays(monitors) renderer.set_displays(monitors)
renderer.init_displays() renderer.init_displays()
@@ -94,6 +100,10 @@ local function main()
println("startup> main display must be 8 blocks wide") println("startup> main display must be 8 blocks wide")
log.fatal("main display not wide enough") log.fatal("main display not wide enough")
return return
elseif (config.DISABLE_FLOW_VIEW ~= true) and not renderer.validate_flow_display_width() then
println("startup> flow display must be 8 blocks wide")
log.fatal("flow display not wide enough")
return
elseif not renderer.validate_unit_display_sizes() then elseif not renderer.validate_unit_display_sizes() then
println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks") println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks")
log.fatal("unit display dimensions incorrect") log.fatal("unit display dimensions incorrect")
@@ -125,12 +135,19 @@ local function main()
sounder.init(speaker, config.SOUNDER_VOLUME) sounder.init(speaker, config.SOUNDER_VOLUME)
log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms") log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms")
log_sys("annunciator alarm configured") log_sys("annunciator alarm configured")
iocontrol.fp_has_speaker(true)
end end
---------------------------------------- ----------------------------------------
-- setup communications -- setup communications
---------------------------------------- ----------------------------------------
-- message authentication init
if type(config.AUTH_KEY) == "string" then
local init_time = network.init_mac(config.AUTH_KEY)
log_crypto("HMAC init took " .. init_time .. "ms")
end
-- get the communications modem -- get the communications modem
local modem = ppm.get_wireless_modem() local modem = ppm.get_wireless_modem()
if modem == nil then if modem == nil then
@@ -140,6 +157,7 @@ local function main()
return return
else else
log_comms("wireless modem connected") log_comms("wireless modem connected")
iocontrol.fp_has_modem(true)
end end
-- create connection watchdog -- create connection watchdog
@@ -147,9 +165,10 @@ local function main()
conn_watchdog.cancel() conn_watchdog.cancel()
log.debug("startup> conn watchdog created") log.debug("startup> conn watchdog created")
-- start comms, open all channels -- create network interface then setup comms
local coord_comms = coordinator.comms(COORDINATOR_VERSION, modem, config.CRD_CHANNEL, config.SVR_CHANNEL, local nic = network.nic(modem)
config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog) local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.NUM_UNITS, config.CRD_CHANNEL,
config.SVR_CHANNEL, config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
log.debug("startup> comms init") log.debug("startup> comms init")
log_comms("comms initialized") log_comms("comms initialized")
@@ -158,78 +177,54 @@ local function main()
local loop_clock = util.new_clock(MAIN_CLOCK) local loop_clock = util.new_clock(MAIN_CLOCK)
---------------------------------------- ----------------------------------------
-- connect to the supervisor -- start front panel & UI start function
---------------------------------------- ----------------------------------------
-- attempt to connect to the supervisor or exit log_graphics("starting front panel UI...")
local function init_connect_sv()
local tick_waiting, task_done = log_comms_connecting("attempting to connect to configured supervisor on channel " .. config.SVR_CHANNEL)
-- attempt to establish a connection with the supervisory computer local fp_ok, fp_message = pcall(renderer.start_fp)
if not coord_comms.sv_connect(60, tick_waiting, task_done) then if not fp_ok then
log_sys("supervisor connection failed, shutting down...") renderer.close_fp()
log.fatal("failed to connect to supervisor") log_graphics(util.c("front panel UI error: ", fp_message))
return false println_ts("front panel UI creation failed")
end log.fatal(util.c("front panel GUI render failed with error ", fp_message))
return true
end
if not init_connect_sv() then
println("startup> failed to connect to supervisor")
log_sys("system shutdown")
return return
else else log_graphics("front panel ready") end
log_sys("supervisor connected, proceeding to UI start")
end
---------------------------------------- -- start up the main UI
-- start the UI
----------------------------------------
-- start up the UI
---@return boolean ui_ok started ok ---@return boolean ui_ok started ok
local function init_start_ui() local function start_main_ui()
log_graphics("starting UI...") log_graphics("starting main UI...")
local draw_start = util.time_ms() local draw_start = util.time_ms()
local ui_ok, message = pcall(renderer.start_ui) local ui_ok, ui_message = pcall(renderer.start_ui)
if not ui_ok then if not ui_ok then
renderer.close_ui() renderer.close_ui()
log_graphics(util.c("UI crashed: ", message)) log_graphics(util.c("main UI error: ", ui_message))
println_ts("UI crashed") log.fatal(util.c("main GUI render failed with error ", ui_message))
log.fatal(util.c("GUI crashed with error ", message))
else else
log_graphics("first UI draw took " .. (util.time_ms() - draw_start) .. "ms") log_graphics("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
-- start clock
loop_clock.start()
end end
return ui_ok return ui_ok
end end
local ui_ok = init_start_ui()
---------------------------------------- ----------------------------------------
-- main event loop -- main event loop
---------------------------------------- ----------------------------------------
local link_failed = false
local ui_ok = true
local date_format = util.trinary(config.TIME_24_HOUR, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y") local date_format = util.trinary(config.TIME_24_HOUR, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y")
local no_modem = false -- start clock
loop_clock.start()
if ui_ok then
-- start connection watchdog
conn_watchdog.feed()
log.debug("startup> conn watchdog started")
log_sys("system started successfully") log_sys("system started successfully")
end
-- main event loop -- main event loop
while ui_ok do while true do
local event, param1, param2, param3, param4, param5 = util.pull_event() local event, param1, param2, param3, param4, param5 = util.pull_event()
-- handle event -- handle event
@@ -239,33 +234,36 @@ local function main()
if type ~= nil and device ~= nil then if type ~= nil and device ~= nil then
if type == "modem" then if type == "modem" then
-- we only really care if this is our wireless modem -- we only really care if this is our wireless modem
if device == modem then -- if it is another modem, handle other peripheral losses separately
no_modem = true if nic.is_modem(device) then
nic.disconnect()
log_sys("comms modem disconnected") log_sys("comms modem disconnected")
println_ts("wireless modem disconnected!")
-- close out UI local other_modem = ppm.get_wireless_modem()
if other_modem then
log_sys("found another wireless modem, using it for comms")
nic.connect(other_modem)
else
-- close out main UI
renderer.close_ui() renderer.close_ui()
-- alert user to status -- alert user to status
log_sys("awaiting comms modem reconnect...") log_sys("awaiting comms modem reconnect...")
iocontrol.fp_has_modem(false)
end
else else
log_sys("non-comms modem disconnected") log_sys("non-comms modem disconnected")
end end
elseif type == "monitor" then elseif type == "monitor" then
if renderer.is_monitor_used(device) then if renderer.handle_disconnect(device) then
-- "halt and catch fire" style handling log_sys("lost a configured monitor")
local msg = "lost a configured monitor, system will now exit"
println_ts(msg)
log_sys(msg)
break
else else
log_sys("lost unused monitor, ignoring") log_sys("lost an unused monitor")
end end
elseif type == "speaker" then elseif type == "speaker" then
local msg = "lost alarm sounder speaker" log_sys("lost alarm sounder speaker")
println_ts(msg) iocontrol.fp_has_speaker(false)
log_sys(msg)
end end
end end
elseif event == "peripheral" then elseif event == "peripheral" then
@@ -273,34 +271,50 @@ local function main()
if type ~= nil and device ~= nil then if type ~= nil and device ~= nil then
if type == "modem" then if type == "modem" then
if device.isWireless() then if device.isWireless() and not nic.is_connected() then
-- reconnected modem -- reconnected modem
no_modem = false
modem = device
coord_comms.reconnect_modem(modem)
log_sys("comms modem reconnected") log_sys("comms modem reconnected")
println_ts("wireless modem reconnected.") nic.connect(device)
iocontrol.fp_has_modem(true)
-- re-init system elseif device.isWireless() then
if not init_connect_sv() then break end log.info("unused wireless modem reconnected")
ui_ok = init_start_ui()
else else
log_sys("wired modem reconnected") log_sys("wired modem reconnected")
end end
-- elseif type == "monitor" then elseif type == "monitor" then
-- not supported, system will exit on loss of in-use monitors if renderer.handle_reconnect(param1, device) then
log_sys(util.c("configured monitor ", param1, " reconnected"))
else
log_sys(util.c("unused monitor ", param1, " connected"))
end
elseif type == "speaker" then elseif type == "speaker" then
local msg = "alarm sounder speaker reconnected" log_sys("alarm sounder speaker reconnected")
println_ts(msg)
log_sys(msg)
sounder.reconnect(device) sounder.reconnect(device)
iocontrol.fp_has_speaker(true)
end end
end end
elseif event == "timer" then elseif event == "timer" then
if loop_clock.is_clock(param1) then if loop_clock.is_clock(param1) then
-- main loop tick -- main loop tick
-- toggle heartbeat
iocontrol.heartbeat()
-- maintain connection
if nic.is_connected() then
local ok, start_ui = coord_comms.try_connect()
if not ok then
link_failed = true
log_sys("supervisor connection failed, shutting down...")
log.fatal("failed to connect to supervisor")
break
elseif start_ui then
log_sys("supervisor connected, proceeding to main UI start")
ui_ok = start_main_ui()
if not ui_ok then break end
end
end
-- iterate sessions -- iterate sessions
apisessions.iterate_all() apisessions.iterate_all()
@@ -308,25 +322,19 @@ local function main()
apisessions.free_all_closed() apisessions.free_all_closed()
-- update date and time string for main display -- update date and time string for main display
if coord_comms.is_linked() then
iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format)) iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
end
loop_clock.start() loop_clock.start()
elseif conn_watchdog.is_timer(param1) then elseif conn_watchdog.is_timer(param1) then
-- supervisor watchdog timeout -- supervisor watchdog timeout
local msg = "supervisor server timeout" log_comms("supervisor server timeout")
log_comms(msg)
println_ts(msg)
-- close connection, UI, and stop sounder -- close connection, main UI, and stop sounder
coord_comms.close() coord_comms.close()
renderer.close_ui() renderer.close_ui()
sounder.stop() sounder.stop()
if not no_modem then
-- try to re-connect to the supervisor
if not init_connect_sv() then break end
ui_ok = init_start_ui()
end
else else
-- a non-clock/main watchdog timer event -- a non-clock/main watchdog timer event
@@ -339,25 +347,19 @@ local function main()
elseif event == "modem_message" then elseif event == "modem_message" then
-- got a packet -- got a packet
local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5) local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
coord_comms.handle_packet(packet)
-- check if it was a disconnect -- handle then check if it was a disconnect
if not coord_comms.is_linked() then if coord_comms.handle_packet(packet) then
log_comms("supervisor closed connection") log_comms("supervisor closed connection")
-- close connection, UI, and stop sounder -- close connection, main UI, and stop sounder
coord_comms.close() coord_comms.close()
renderer.close_ui() renderer.close_ui()
sounder.stop() sounder.stop()
if not no_modem then
-- try to re-connect to the supervisor
if not init_connect_sv() then break end
ui_ok = init_start_ui()
end end
end elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
elseif event == "monitor_touch" then event == "mouse_drag" or event == "mouse_scroll" then
-- handle a monitor touch event -- handle a mouse event
renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3)) renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
elseif event == "speaker_audio_empty" then elseif event == "speaker_audio_empty" then
-- handle speaker buffer emptied -- handle speaker buffer emptied
@@ -366,10 +368,17 @@ local function main()
-- check for termination request -- check for termination request
if event == "terminate" or ppm.should_terminate() then if event == "terminate" or ppm.should_terminate() then
println_ts("terminate requested, closing connections...") -- handle supervisor connection
coord_comms.try_connect(true)
if coord_comms.is_linked() then
log_comms("terminate requested, closing supervisor connection...") log_comms("terminate requested, closing supervisor connection...")
else link_failed = true end
coord_comms.close() coord_comms.close()
log_comms("supervisor connection closed") log_comms("supervisor connection closed")
-- handle API sessions
log_comms("closing api sessions...") log_comms("closing api sessions...")
apisessions.close_all() apisessions.close_all()
log_comms("api sessions closed") log_comms("api sessions closed")
@@ -378,15 +387,20 @@ local function main()
end end
renderer.close_ui() renderer.close_ui()
renderer.close_fp()
sounder.stop() sounder.stop()
log_sys("system shutdown") log_sys("system shutdown")
if link_failed then println_ts("failed to connect to supervisor") end
if not ui_ok then println_ts("main UI creation failed") end
println_ts("exited") println_ts("exited")
log.info("exited") log.info("exited")
end end
if not xpcall(main, crash.handler) then if not xpcall(main, crash.handler) then
pcall(renderer.close_ui) pcall(renderer.close_ui)
pcall(renderer.close_fp)
pcall(sounder.stop) pcall(sounder.stop)
crash.exit() crash.exit()
else else

View File

@@ -83,9 +83,7 @@ local function new_view(root, x, y, data, ps, id)
local function calc_saturation(val) local function calc_saturation(val)
if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then
return val / data.build.transfer_cap return val / data.build.transfer_cap
else else return 0 end
return 0
end
end end
charge.register(ps, "energy_fill", charge.update) charge.register(ps, "energy_fill", charge.update)

View File

@@ -0,0 +1,48 @@
--
-- Pocket Connection Entry
--
local iocontrol = require("coordinator.iocontrol")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair
-- create a pocket list entry
---@param parent graphics_element parent
---@param id integer PKT session ID
local function init(parent, id)
local ps = iocontrol.get_db().fp.ps
-- root div
local root = Div{parent=parent,x=2,y=2,height=4,width=parent.get_width()-2,hidden=true}
local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=cpair(colors.black,colors.white)}
local ps_prefix = "pkt_" .. id .. "_"
TextBox{parent=entry,x=1,y=1,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=TEXT_ALIGN.CENTER,width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray),nav_active=cpair(colors.gray,colors.black)}
TextBox{parent=entry,x=1,y=3,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
pkt_addr.register(ps, ps_prefix .. "addr", pkt_addr.set_value)
TextBox{parent=entry,x=10,y=2,text="FW:",width=3,height=1}
local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
pkt_fw_v.register(ps, ps_prefix .. "fw", pkt_fw_v.set_value)
TextBox{parent=entry,x=35,y=2,text="RTT:",width=4,height=1}
local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=cpair(colors.lightGray,colors.white)}
TextBox{parent=entry,x=46,y=2,text="ms",width=4,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
pkt_rtt.register(ps, ps_prefix .. "rtt", pkt_rtt.update)
pkt_rtt.register(ps, ps_prefix .. "rtt_color", pkt_rtt.recolor)
return root
end
return init

View File

@@ -15,8 +15,10 @@ local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data") local DataIndicator = require("graphics.elements.indicators.data")
local IndicatorLight = require("graphics.elements.indicators.light") local IndicatorLight = require("graphics.elements.indicators.light")
local RadIndicator = require("graphics.elements.indicators.rad") local RadIndicator = require("graphics.elements.indicators.rad")
local StateIndicator = require("graphics.elements.indicators.state")
local TriIndicatorLight = require("graphics.elements.indicators.trilight") local TriIndicatorLight = require("graphics.elements.indicators.trilight")
local Checkbox = require("graphics.elements.controls.checkbox")
local HazardButton = require("graphics.elements.controls.hazard_button") local HazardButton = require("graphics.elements.controls.hazard_button")
local RadioButton = require("graphics.elements.controls.radio_button") local RadioButton = require("graphics.elements.controls.radio_button")
local SpinboxNumeric = require("graphics.elements.controls.spinbox_numeric") local SpinboxNumeric = require("graphics.elements.controls.spinbox_numeric")
@@ -26,6 +28,16 @@ local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair local cpair = core.cpair
local border = core.border local border = core.border
local bw_fg_bg = style.bw_fg_bg
local lu_cpair = style.lu_colors
local hzd_fg_bg = style.hzd_fg_bg
local dis_colors = style.dis_colors
local ind_grn = style.ind_grn
local ind_yel = style.ind_yel
local ind_red = style.ind_red
local ind_wht = style.ind_wht
local period = core.flasher.PERIOD local period = core.flasher.PERIOD
-- new process control view -- new process control view
@@ -38,12 +50,7 @@ local function new_view(root, x, y)
local facility = iocontrol.get_db().facility local facility = iocontrol.get_db().facility
local units = iocontrol.get_db().units local units = iocontrol.get_db().units
local bw_fg_bg = cpair(colors.black, colors.white) local main = Div{parent=root,width=128,height=24,x=x,y=y}
local hzd_fg_bg = cpair(colors.white, colors.gray)
local lu_cpair = cpair(colors.gray, colors.gray)
local dis_colors = cpair(colors.white, colors.lightGray)
local main = Div{parent=root,width=104,height=24,x=x,y=y}
local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg} local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
local ack_a = HazardButton{parent=main,x=16,y=1,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=process.fac_ack_alarms,fg_bg=hzd_fg_bg} local ack_a = HazardButton{parent=main,x=16,y=1,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=process.fac_ack_alarms,fg_bg=hzd_fg_bg}
@@ -51,20 +58,22 @@ local function new_view(root, x, y)
facility.scram_ack = scram.on_response facility.scram_ack = scram.on_response
facility.ack_alarms_ack = ack_a.on_response facility.ack_alarms_ack = ack_a.on_response
local all_ok = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=cpair(colors.green,colors.red)} local all_ok = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=ind_grn}
local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=cpair(colors.green,colors.gray)}
local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green} local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=ind_grn}
local sps = IndicatorLight{parent=main,label="SPS Connected",colors=ind_grn}
all_ok.register(facility.ps, "all_sys_ok", all_ok.update) all_ok.register(facility.ps, "all_sys_ok", all_ok.update)
ind_mat.register(facility.induction_ps_tbl[1], "computed_status", function (status) ind_mat.update(status > 1) end)
rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update) rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update)
ind_mat.register(facility.induction_ps_tbl[1], "computed_status", function (status) ind_mat.update(status > 1) end)
sps.register(facility.sps_ps_tbl[1], "computed_status", function (status) sps.update(status > 1) end)
main.line_break() main.line_break()
local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=cpair(colors.green,colors.red)} local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=ind_grn}
local auto_act = IndicatorLight{parent=main,label="Process Active",colors=cpair(colors.green,colors.gray)} local auto_act = IndicatorLight{parent=main,label="Process Active",colors=ind_grn}
local auto_ramp = IndicatorLight{parent=main,label="Process Ramping",colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_250_MS} local auto_ramp = IndicatorLight{parent=main,label="Process Ramping",colors=ind_wht,flash=true,period=period.BLINK_250_MS}
local auto_sat = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=cpair(colors.yellow,colors.gray)} local auto_sat = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=ind_yel}
auto_ready.register(facility.ps, "auto_ready", auto_ready.update) auto_ready.register(facility.ps, "auto_ready", auto_ready.update)
auto_act.register(facility.ps, "auto_active", auto_act.update) auto_act.register(facility.ps, "auto_active", auto_act.update)
@@ -73,12 +82,12 @@ local function new_view(root, x, y)
main.line_break() main.line_break()
local auto_scram = IndicatorLight{parent=main,label="Automatic SCRAM",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local auto_scram = IndicatorLight{parent=main,label="Automatic SCRAM",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local matrix_dc = IndicatorLight{parent=main,label="Matrix Disconnected",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local matrix_dc = IndicatorLight{parent=main,label="Matrix Disconnected",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_500_MS} local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=ind_red,flash=true,period=period.BLINK_500_MS}
local unit_crit = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local unit_crit = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local fac_rad_h = IndicatorLight{parent=main,label="Facility Radiation High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local fac_rad_h = IndicatorLight{parent=main,label="Facility Radiation High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local gen_fault = IndicatorLight{parent=main,label="Gen. Control Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local gen_fault = IndicatorLight{parent=main,label="Gen. Control Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
auto_scram.register(facility.ps, "auto_scram", auto_scram.update) auto_scram.register(facility.ps, "auto_scram", auto_scram.update)
matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update) matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update)
@@ -99,7 +108,7 @@ local function new_view(root, x, y)
-- process control -- -- process control --
--------------------- ---------------------
local proc = Div{parent=main,width=78,height=24,x=27,y=1} local proc = Div{parent=main,width=103,height=24,x=27,y=1}
----------------------------- -----------------------------
-- process control targets -- -- process control targets --
@@ -148,54 +157,85 @@ local function new_view(root, x, y)
local rate_limits = {} local rate_limits = {}
for i = 1, facility.num_units do for i = 1, 4 do
local unit = units[i] ---@type ioctl_unit local unit
local tag_fg_bg = cpair(colors.gray,colors.white)
local lim_fg_bg = cpair(colors.lightGray,colors.white)
local ctl_fg = colors.lightGray
local cur_fg_bg = cpair(colors.lightGray,colors.white)
local cur_lu = colors.lightGray
if i <= facility.num_units then
unit = units[i] ---@type ioctl_unit
tag_fg_bg = cpair(colors.black,colors.lightBlue)
lim_fg_bg = bw_fg_bg
ctl_fg = colors.gray
cur_fg_bg = cpair(colors.black,colors.brown)
cur_lu = colors.black
end
local _y = ((i - 1) * 5) + 1 local _y = ((i - 1) * 5) + 1
local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)} local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2} TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2}
local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(colors.gray,colors.white)} local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(ctl_fg,colors.white)}
rate_limits[i] = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg} local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=lim_fg_bg}
TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1} TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1}
local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(cur_lu,cur_lu),width=14,fg_bg=cur_fg_bg}
if i <= facility.num_units then
rate_limits[i] = lim
rate_limits[i].register(unit.unit_ps, "max_burn", rate_limits[i].set_max) rate_limits[i].register(unit.unit_ps, "max_burn", rate_limits[i].set_max)
rate_limits[i].register(unit.unit_ps, "burn_limit", rate_limits[i].set_value) rate_limits[i].register(unit.unit_ps, "burn_limit", rate_limits[i].set_value)
local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(colors.black,colors.black),width=14,fg_bg=cpair(colors.black,colors.brown)}
cur_burn.register(unit.unit_ps, "act_burn_rate", cur_burn.update) cur_burn.register(unit.unit_ps, "act_burn_rate", cur_burn.update)
else
lim.disable()
end
end end
------------------- -------------------
-- unit statuses -- -- unit statuses --
------------------- -------------------
local stat_div = Div{parent=proc,width=38,height=19,x=57,y=6} local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6}
for i = 1, facility.num_units do for i = 1, 4 do
local unit = units[i] ---@type ioctl_unit local tag_fg_bg = cpair(colors.gray, colors.white)
local ind_fg_bg = cpair(colors.lightGray, colors.white)
local ind_off = colors.lightGray
if i <= facility.num_units then
tag_fg_bg = cpair(colors.black, colors.cyan)
ind_fg_bg = bw_fg_bg
ind_off = colors.gray
end
local _y = ((i - 1) * 5) + 1 local _y = ((i - 1) * 5) + 1
local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)} local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2} TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2}
local lights = Div{parent=stat_div,x=9,y=_y,width=12,height=4,fg_bg=bw_fg_bg} local lights = Div{parent=stat_div,x=9,y=_y,width=14,height=4,fg_bg=ind_fg_bg}
local ready = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,colors.gray)} local ready = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,ind_off)}
local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,ind_off),flash=true,period=period.BLINK_250_MS}
if i <= facility.num_units then
local unit = units[i] ---@type ioctl_unit
ready.register(unit.unit_ps, "U_AutoReady", ready.update) ready.register(unit.unit_ps, "U_AutoReady", ready.update)
degraded.register(unit.unit_ps, "U_AutoDegraded", degraded.update) degraded.register(unit.unit_ps, "U_AutoDegraded", degraded.update)
end end
end
------------------------- -------------------------
-- controls and status -- -- controls and status --
------------------------- -------------------------
local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" } local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" }
local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.purple,colors.black),radio_bg=colors.gray} local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.purple}
mode.register(facility.ps, "process_mode", mode.set_value) mode.register(facility.ps, "process_mode", mode.set_value)
@@ -261,6 +301,60 @@ local function new_view(root, x, y)
for i = 1, #rate_limits do rate_limits[i].enable() end for i = 1, #rate_limits do rate_limits[i].enable() end
end end
end) end)
------------------------------
-- waste production control --
------------------------------
local waste_status = Div{parent=proc,width=24,height=4,x=57,y=1,}
for i = 1, facility.num_units do
local unit = units[i] ---@type ioctl_unit
TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8,height=1}
local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=ind_wht}
local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6}
a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update)
waste_m.register(unit.unit_ps, "U_WasteProduct", waste_m.update)
end
local waste_sel = Div{parent=proc,width=21,height=24,x=81,y=1}
TextBox{parent=waste_sel,text=" ",width=21,height=1,x=1,y=1,fg_bg=cpair(colors.black,colors.brown)}
TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=TEXT_ALIGN.CENTER,width=21,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.brown)}
local rect = Rectangle{parent=waste_sel,border=border(1,colors.brown,true),width=21,height=22,x=1,y=3}
local status = StateIndicator{parent=rect,x=2,y=1,states=style.waste.states,value=1,min_width=17}
status.register(facility.ps, "current_waste_product", status.update)
local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.brown}
local pu_fallback = Checkbox{parent=rect,x=2,y=7,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.green,colors.black)}
waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value)
pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
local fb_active = IndicatorLight{parent=rect,x=2,y=9,label="Fallback Active",colors=ind_wht}
fb_active.register(facility.ps, "pu_fallback_active", fb_active.update)
TextBox{parent=rect,x=2,y=11,text="Plutonium Rate",height=1,width=17,fg_bg=style.label}
local pu_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
TextBox{parent=rect,x=2,y=14,text="Polonium Rate",height=1,width=17,fg_bg=style.label}
local po_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
TextBox{parent=rect,x=2,y=17,text="Antimatter Rate",height=1,width=17,fg_bg=style.label}
local am_rate = DataIndicator{parent=rect,x=2,label="",unit="\xb5B/t",format="%12d",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
pu_rate.register(facility.ps, "pu_rate", pu_rate.update)
po_rate.register(facility.ps, "po_rate", po_rate.update)
am_rate.register(facility.ps, "am_rate", am_rate.update)
local sna_count = DataIndicator{parent=rect,x=2,y=20,label="Linked SNAs:",format="%4d",value=0,lu_colors=lu_cpair,width=17}
sna_count.register(facility.ps, "sna_count", sna_count.update)
end end
return new_view return new_view

View File

@@ -31,7 +31,7 @@ local function new_view(root, x, y, ps)
local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg} local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg}
status.register(ps, "computed_status", status.update) status.register(ps, "computed_status", status.update)
prod_rate.register(ps, "prod_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end) prod_rate.register(ps, "steam_input_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end)
flow_rate.register(ps, "flow_rate", flow_rate.update) flow_rate.register(ps, "flow_rate", flow_rate.update)
local steam = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1} local steam = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}

View File

@@ -31,30 +31,16 @@ local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair local cpair = core.cpair
local border = core.border local border = core.border
local period = core.flasher.PERIOD local bw_fg_bg = style.bw_fg_bg
local lu_cpair = style.lu_colors
local hzd_fg_bg = style.hzd_fg_bg
local waste_opts = { local ind_grn = style.ind_grn
{ local ind_yel = style.ind_yel
text = "Auto", local ind_red = style.ind_red
fg_bg = cpair(colors.black, colors.lightGray), local ind_wht = style.ind_wht
active_fg_bg = cpair(colors.white, colors.gray)
}, local period = core.flasher.PERIOD
{
text = "Pu",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.green)
},
{
text = "Po",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.cyan)
},
{
text = "AM",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.purple)
}
}
-- create a unit view -- create a unit view
---@param parent graphics_element parent ---@param parent graphics_element parent
@@ -62,18 +48,17 @@ local waste_opts = {
local function init(parent, id) local function init(parent, id)
local unit = iocontrol.get_db().units[id] ---@type ioctl_unit local unit = iocontrol.get_db().units[id] ---@type ioctl_unit
local f_ps = iocontrol.get_db().facility.ps local f_ps = iocontrol.get_db().facility.ps
local main = Div{parent=parent,x=1,y=1}
if unit == nil then return main end
local u_ps = unit.unit_ps local u_ps = unit.unit_ps
local b_ps = unit.boiler_ps_tbl local b_ps = unit.boiler_ps_tbl
local t_ps = unit.turbine_ps_tbl local t_ps = unit.turbine_ps_tbl
local main = Div{parent=parent,x=1,y=1}
TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header} TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
local bw_fg_bg = cpair(colors.black, colors.white)
local hzd_fg_bg = cpair(colors.white, colors.gray)
local lu_cpair = cpair(colors.gray, colors.gray)
----------------------------- -----------------------------
-- main stats and core map -- -- main stats and core map --
----------------------------- -----------------------------
@@ -160,7 +145,7 @@ local function init(parent, id)
-- connectivity -- connectivity
local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)} local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)}
local plc_hbeat = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=cpair(colors.white,colors.gray)} local plc_hbeat = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=ind_wht}
local rad_mon = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green} local rad_mon = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
plc_online.register(u_ps, "PLCOnline", plc_online.update) plc_online.register(u_ps, "PLCOnline", plc_online.update)
@@ -170,25 +155,25 @@ local function init(parent, id)
annunciator.line_break() annunciator.line_break()
-- operating state -- operating state
local r_active = IndicatorLight{parent=annunciator,label="Active",colors=cpair(colors.green,colors.gray)} local r_active = IndicatorLight{parent=annunciator,label="Active",colors=ind_grn}
local r_auto = IndicatorLight{parent=annunciator,label="Automatic Control",colors=cpair(colors.white,colors.gray)} local r_auto = IndicatorLight{parent=annunciator,label="Automatic Control",colors=ind_wht}
r_active.register(u_ps, "status", r_active.update) r_active.register(u_ps, "status", r_active.update)
r_auto.register(u_ps, "AutoControl", r_auto.update) r_auto.register(u_ps, "AutoControl", r_auto.update)
-- main unit transient/warning annunciator panel -- main unit transient/warning annunciator panel
local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=ind_red}
local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=ind_red}
local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=cpair(colors.red,colors.gray)} local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=ind_red}
local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=cpair(colors.yellow,colors.gray)} local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=ind_yel}
local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=cpair(colors.red,colors.gray)} local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=ind_red}
local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=cpair(colors.yellow,colors.gray)} local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=ind_yel}
local r_clow = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=cpair(colors.yellow,colors.gray)} local r_clow = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=ind_yel}
local r_temp = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=cpair(colors.red,colors.gray)} local r_temp = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=ind_red}
local r_rhdt = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=cpair(colors.yellow,colors.gray)} local r_rhdt = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=ind_yel}
local r_firl = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=cpair(colors.yellow,colors.gray)} local r_firl = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=ind_yel}
local r_wloc = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=cpair(colors.yellow,colors.gray)} local r_wloc = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=ind_yel}
local r_hsrt = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=cpair(colors.yellow,colors.gray)} local r_hsrt = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=ind_yel}
r_scram.register(u_ps, "ReactorSCRAM", r_scram.update) r_scram.register(u_ps, "ReactorSCRAM", r_scram.update)
r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update) r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update)
@@ -209,15 +194,15 @@ local function init(parent, id)
local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9} local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9}
local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1} local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1}
local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=cpair(colors.yellow,colors.gray)} local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=ind_yel}
local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=cpair(colors.yellow,colors.gray)} local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=ind_yel}
local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=cpair(colors.yellow,colors.gray)} local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=ind_yel}
local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=cpair(colors.yellow,colors.gray)} local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=ind_yel}
local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS} local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS}
rps_trp.register(u_ps, "rps_tripped", rps_trp.update) rps_trp.register(u_ps, "rps_tripped", rps_trp.update)
@@ -238,12 +223,12 @@ local function init(parent, id)
local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1} local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1}
local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7} local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7}
local c_flt = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=cpair(colors.yellow,colors.gray)} local c_flt = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=ind_yel}
local c_emg = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green} local c_emg = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green}
local c_cfm = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_cfm = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=ind_yel}
local c_brm = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_brm = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=ind_yel}
local c_sfm = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=cpair(colors.yellow,colors.gray)} local c_sfm = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=ind_yel}
local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=cpair(colors.yellow,colors.gray)} local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=ind_yel}
c_flt.register(u_ps, "RCSFault", c_flt.update) c_flt.register(u_ps, "RCSFault", c_flt.update)
c_emg.register(u_ps, "EmergencyCoolant", c_emg.update) c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
@@ -266,11 +251,11 @@ local function init(parent, id)
if unit.num_boilers > 0 then if unit.num_boilers > 0 then
TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)} local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update) b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update)
TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)} local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update) b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update)
end end
if unit.num_boilers > 1 then if unit.num_boilers > 1 then
@@ -282,11 +267,11 @@ local function init(parent, id)
end end
TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)} local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update) b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update)
TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)} local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update) b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update)
end end
@@ -299,15 +284,15 @@ local function init(parent, id)
t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update) t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update) t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS} local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update) t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update)
TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update) t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update)
if unit.num_turbines > 1 then if unit.num_turbines > 1 then
@@ -320,15 +305,15 @@ local function init(parent, id)
t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update) t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update)
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update) t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update)
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS} local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update) t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update)
TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update) t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update)
end end
@@ -340,15 +325,15 @@ local function init(parent, id)
t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update) t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)} local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update) t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS} local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update) t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update)
TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg} TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS} local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update) t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update)
end end
@@ -363,7 +348,7 @@ local function init(parent, id)
TextBox{parent=burn_control,x=9,y=2,text="mB/t"} TextBox{parent=burn_control,x=9,y=2,text="mB/t"}
local set_burn = function () unit.set_burn(burn_rate.get_value()) end local set_burn = function () unit.set_burn(burn_rate.get_value()) end
local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=dis_colors,callback=set_burn} local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=dis_colors,callback=set_burn}
burn_rate.register(u_ps, "burn_rate", burn_rate.set_value) burn_rate.register(u_ps, "burn_rate", burn_rate.set_value)
burn_rate.register(u_ps, "max_burn", burn_rate.set_max) burn_rate.register(u_ps, "max_burn", burn_rate.set_max)
@@ -398,7 +383,7 @@ local function init(parent, id)
local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49} local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49}
local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1} local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1}
local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=waste_opts,callback=unit.set_waste,min_width=6} local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=style.waste.unit_opts,callback=unit.set_waste,min_width=6}
waste_mode.register(u_ps, "U_WasteMode", waste_mode.set_value) waste_mode.register(u_ps, "U_WasteMode", waste_mode.set_value)
@@ -495,7 +480,7 @@ local function init(parent, id)
auto_div.line_break() auto_div.line_break()
local function set_group() unit.set_group(group.get_value() - 1) end local function set_group() unit.set_group(group.get_value() - 1) end
local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group} local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
auto_div.line_break() auto_div.line_break()
@@ -506,8 +491,8 @@ local function init(parent, id)
auto_div.line_break() auto_div.line_break()
local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=cpair(colors.green,colors.gray)} local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=ind_grn}
local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_1000_MS} local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=ind_wht,flash=true,period=period.BLINK_1000_MS}
a_rdy.register(u_ps, "U_AutoReady", a_rdy.update) a_rdy.register(u_ps, "U_AutoReady", a_rdy.update)

View File

@@ -0,0 +1,225 @@
--
-- Basic Unit Flow Overview
--
local util = require("scada-common.util")
local style = require("coordinator.ui.style")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local PipeNetwork = require("graphics.elements.pipenet")
local TextBox = require("graphics.elements.textbox")
local Rectangle = require("graphics.elements.rectangle")
local DataIndicator = require("graphics.elements.indicators.data")
local IndicatorLight = require("graphics.elements.indicators.light")
local TriIndicatorLight = require("graphics.elements.indicators.trilight")
local TEXT_ALIGN = core.TEXT_ALIGN
local sprintf = util.sprintf
local cpair = core.cpair
local border = core.border
local pipe = core.pipe
local wh_gray = style.wh_gray
local bw_fg_bg = style.bw_fg_bg
local text_c = style.text_colors
local lu_c = style.lu_colors
local ind_grn = style.ind_grn
local ind_wht = style.ind_wht
-- make a new unit flow window
---@param parent graphics_element parent
---@param x integer top left x
---@param y integer top left y
---@param wide boolean whether to render wide version
---@param unit ioctl_unit unit database entry
local function make(parent, x, y, wide, unit)
local height = 16
local v_start = 1 + ((unit.unit_id - 1) * 5)
local prv_start = 1 + ((unit.unit_id - 1) * 3)
local v_fields = { "pu", "po", "pl", "am" }
local v_names = {
sprintf("PV%02d-PU", v_start),
sprintf("PV%02d-PO", v_start + 1),
sprintf("PV%02d-PL", v_start + 2),
sprintf("PV%02d-AM", v_start + 3),
sprintf("PRV%02d", prv_start),
sprintf("PRV%02d", prv_start + 1),
sprintf("PRV%02d", prv_start + 2)
}
assert(parent.get_height() >= (y + height), "flow display not of sufficient vertical resolution (add an additional row of monitors) " .. y .. "," .. parent.get_height())
local function _wide(a, b) return util.trinary(wide, a, b) end
-- bounding box div
local root = Div{parent=parent,x=x,y=y,width=_wide(136, 114),height=height}
local lg_gray = cpair(colors.lightGray, colors.gray)
------------------
-- COOLING LOOP --
------------------
local reactor = Rectangle{parent=root,x=1,y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=reactor,y=1,text="FISSION REACTOR",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=reactor,y=3,text="UNIT #"..unit.unit_id,alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=root,x=19,y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
TextBox{parent=root,x=3,y=5,text="\x19",width=1,height=1,fg_bg=lg_gray}
local rc_pipes = {}
local emc_x = 42 -- emergency coolant connection x point
if unit.num_boilers > 0 then
table.insert(rc_pipes, pipe(0, 1, _wide(28, 19), 1, colors.lightBlue, true))
table.insert(rc_pipes, pipe(0, 3, _wide(28, 19), 3, colors.orange, true))
table.insert(rc_pipes, pipe(_wide(46 ,39), 1, _wide(72,58), 1, colors.blue, true))
table.insert(rc_pipes, pipe(_wide(46,39), 3, _wide(72,58), 3, colors.white, true))
else
emc_x = 3
table.insert(rc_pipes, pipe(0, 1, _wide(72,58), 1, colors.blue, true))
table.insert(rc_pipes, pipe(0, 3, _wide(72,58), 3, colors.white, true))
end
if unit.has_tank then
table.insert(rc_pipes, pipe(emc_x, 1, emc_x, 0, colors.blue, true, true))
end
local prv_yo = math.max(3 - unit.num_turbines, 0)
for i = 1, unit.num_turbines do
local py = 2 * (i - 1) + prv_yo
table.insert(rc_pipes, pipe(_wide(92, 78), py, _wide(104, 83), py, colors.white, true))
end
PipeNetwork{parent=root,x=20,y=1,pipes=rc_pipes,bg=colors.lightGray}
if unit.num_boilers > 0 then
local cc_rate = DataIndicator{parent=root,x=_wide(25,22),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
local hc_rate = DataIndicator{parent=root,x=_wide(25,22),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
cc_rate.register(unit.unit_ps, "boiler_boil_sum", function (sum) cc_rate.update(sum * 10) end)
hc_rate.register(unit.unit_ps, "heating_rate", hc_rate.update)
local boiler = Rectangle{parent=root,x=_wide(47,40),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=boiler,y=1,text="THERMO-ELECTRIC",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=boiler,y=3,text="BOILERS",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=root,x=_wide(47,40),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
TextBox{parent=root,x=_wide(65,58),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
local wt_rate = DataIndicator{parent=root,x=_wide(71,61),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
local st_rate = DataIndicator{parent=root,x=_wide(71,61),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
st_rate.register(unit.unit_ps, "boiler_boil_sum", st_rate.update)
else
local wt_rate = DataIndicator{parent=root,x=28,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
local st_rate = DataIndicator{parent=root,x=28,y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
st_rate.register(unit.unit_ps, "heating_rate", st_rate.update)
end
local turbine = Rectangle{parent=root,x=_wide(93,79),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
TextBox{parent=turbine,y=1,text="STEAM TURBINE",alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=turbine,y=3,text=util.trinary(unit.num_turbines>1,"GENERATORS","GENERATOR"),alignment=TEXT_ALIGN.CENTER,height=1}
TextBox{parent=root,x=_wide(93,79),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
for i = 1, unit.num_turbines do
local ry = 1 + (2 * (i - 1)) + prv_yo
TextBox{parent=root,x=_wide(125,103),y=ry,text="\x10\x11\x7f",fg_bg=text_c,width=3,height=1}
local state = TriIndicatorLight{parent=root,x=_wide(129,107),y=ry,label=v_names[i+4],c1=colors.gray,c2=colors.yellow,c3=colors.red}
state.register(unit.turbine_ps_tbl[i], "SteamDumpOpen", state.update)
end
----------------------
-- WASTE PROCESSING --
----------------------
local waste = Div{parent=root,x=3,y=6}
local waste_pipes = {
pipe(0, 0, _wide(19, 16), 1, colors.brown, true),
pipe(_wide(14, 13), 1, _wide(19, 17), 5, colors.brown, true),
pipe(_wide(22, 19), 1, _wide(49, 45), 1, colors.brown, true),
pipe(_wide(22, 19), 5, _wide(28, 24), 5, colors.brown, true),
pipe(_wide(64, 53), 1, _wide(95, 81), 1, colors.green, true),
pipe(_wide(48, 43), 4, _wide(71, 61), 4, colors.cyan, true),
pipe(_wide(66, 57), 4, _wide(71, 61), 8, colors.cyan, true),
pipe(_wide(74, 63), 4, _wide(95, 81), 4, colors.cyan, true),
pipe(_wide(74, 63), 8, _wide(133, 111), 8, colors.cyan, true),
pipe(_wide(108, 94), 1, _wide(132, 110), 6, colors.black, true, true),
pipe(_wide(108, 94), 4, _wide(111, 95), 1, colors.black, true, true),
pipe(_wide(132, 110), 6, _wide(130, 108), 6, colors.black, true, true)
}
PipeNetwork{parent=waste,x=1,y=1,pipes=waste_pipes,bg=colors.lightGray}
local function _valve(vx, vy, n)
TextBox{parent=waste,x=vx,y=vy,text="\x10\x11",fg_bg=text_c,width=2,height=1}
local conn = IndicatorLight{parent=waste,x=vx-3,y=vy+1,label=v_names[n],colors=ind_grn}
local open = IndicatorLight{parent=waste,x=vx-3,y=vy+2,label="OPEN",colors=ind_wht}
conn.register(unit.unit_ps, util.c("V_", v_fields[n], "_conn"), conn.update)
open.register(unit.unit_ps, util.c("V_", v_fields[n], "_state"), open.update)
end
local function _machine(mx, my, name)
local l = string.len(name) + 2
TextBox{parent=waste,x=mx,y=my,text=string.rep("\x8f",l),alignment=TEXT_ALIGN.CENTER,fg_bg=lg_gray,width=l,height=1}
TextBox{parent=waste,x=mx,y=my+1,text=name,alignment=TEXT_ALIGN.CENTER,fg_bg=wh_gray,width=l,height=1}
end
local waste_rate = DataIndicator{parent=waste,x=1,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=bw_fg_bg}
local pu_rate = DataIndicator{parent=waste,x=_wide(82,70),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local po_rate = DataIndicator{parent=waste,x=_wide(52,45),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local popl_rate = DataIndicator{parent=waste,x=_wide(82,70),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local poam_rate = DataIndicator{parent=waste,x=_wide(82,70),y=10,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
local spent_rate = DataIndicator{parent=waste,x=_wide(117,99),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
waste_rate.register(unit.unit_ps, "act_burn_rate", waste_rate.update)
pu_rate.register(unit.unit_ps, "pu_rate", pu_rate.update)
po_rate.register(unit.unit_ps, "po_rate", po_rate.update)
popl_rate.register(unit.unit_ps, "po_pl_rate", popl_rate.update)
poam_rate.register(unit.unit_ps, "po_am_rate", poam_rate.update)
spent_rate.register(unit.unit_ps, "ws_rate", spent_rate.update)
_valve(_wide(21, 18), 2, 1)
_valve(_wide(21, 18), 6, 2)
_valve(_wide(73, 62), 5, 3)
_valve(_wide(73, 62), 9, 4)
_machine(_wide(51, 45), 1, "CENTRIFUGE \x1a");
_machine(_wide(97, 83), 1, "PRC [Pu] \x1a");
_machine(_wide(97, 83), 4, "PRC [Po] \x1a");
_machine(_wide(116, 94), 6, "SPENT WASTE \x1b")
TextBox{parent=waste,x=_wide(30,25),y=3,text="SNAs [Po]",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
local sna_po = Rectangle{parent=waste,x=_wide(30,25),y=4,border=border(1,colors.gray,true),width=19,height=7,thin=true,fg_bg=bw_fg_bg}
local sna_act = IndicatorLight{parent=sna_po,label="ACTIVE",colors=ind_grn}
local sna_cnt = DataIndicator{parent=sna_po,x=12,y=1,lu_colors=lu_c,label="CNT",unit="",format="%2d",value=0,width=7}
local sna_pk = DataIndicator{parent=sna_po,y=3,lu_colors=lu_c,label="PEAK",unit="mB/t",format="%7.2f",value=0,width=17}
local sna_max = DataIndicator{parent=sna_po,lu_colors=lu_c,label="MAX",unit="mB/t",format="%8.2f",value=0,width=17}
local sna_in = DataIndicator{parent=sna_po,lu_colors=lu_c,label="IN",unit="mB/t",format="%9.2f",value=0,width=17}
sna_act.register(unit.unit_ps, "po_rate", function (r) sna_act.update(r > 0) end)
sna_cnt.register(unit.unit_ps, "sna_count", sna_cnt.update)
sna_pk.register(unit.unit_ps, "sna_peak_rate", sna_pk.update)
sna_max.register(unit.unit_ps, "sna_prod_rate", sna_max.update)
sna_in.register(unit.unit_ps, "sna_in", sna_in.update)
return root
end
return make

View File

@@ -0,0 +1,381 @@
--
-- Flow Monitor GUI
--
local types = require("scada-common.types")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style")
local unit_flow = require("coordinator.ui.components.unit_flow")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local PipeNetwork = require("graphics.elements.pipenet")
local Rectangle = require("graphics.elements.rectangle")
local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local HorizontalBar = require("graphics.elements.indicators.hbar")
local IndicatorLight = require("graphics.elements.indicators.light")
local StateIndicator = require("graphics.elements.indicators.state")
local CONTAINER_MODE = types.CONTAINER_MODE
local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair
local border = core.border
local pipe = core.pipe
local wh_gray = style.wh_gray
local bw_fg_bg = style.bw_fg_bg
local text_col = style.text_colors
local lu_col = style.lu_colors
-- create new flow view
---@param main graphics_element main displaybox
local function init(main)
local facility = iocontrol.get_db().facility
local units = iocontrol.get_db().units
local tank_defs = facility.tank_defs
local tank_list = facility.tank_list
-- window header message
local header = TextBox{parent=main,y=1,text="Facility Coolant and Waste Flow Monitor",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
-- max length example: "01:23:45 AM - Wednesday, September 28 2022"
local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=TEXT_ALIGN.RIGHT,width=42,height=1,fg_bg=style.header}
datetime.register(facility.ps, "date_time", datetime.set_value)
local po_pipes = {}
local water_pipes = {}
-- get the y offset for this unit index
---@param idx integer unit index
local function y_ofs(idx) return ((idx - 1) * 20) end
-- determinte facility tank start/end from the definitions list
---@param start_idx integer start index of table iteration
---@param end_idx integer end index of table iteration
local function find_fdef(start_idx, end_idx)
local first, last = 4, 0
for i = start_idx, end_idx do
if tank_defs[i] == 2 then
last = i
if i < first then first = i end
end
end
return first, last
end
if facility.tank_mode == 0 or facility.tank_mode == 8 then
-- (0) tanks belong to reactor units OR (8) 4 total facility tanks (A B C D)
for i = 1, facility.num_units do
if units[i].has_tank then
local y = y_ofs(i)
table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
local u = units[i] ---@type ioctl_unit
local x = util.trinary(u.num_boilers == 0, 45, 84)
table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
end
end
else
-- setup connections for units with emergency coolant, always the same
for i = 1, #tank_defs do
if tank_defs[i] > 0 then
local y = y_ofs(i)
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(1, y, 21, y, colors.blue, true))
else
table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
end
local u = units[i] ---@type ioctl_unit
local x = util.trinary(u.num_boilers == 0, 45, 84)
table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
end
end
if facility.tank_mode == 1 then
-- (1) 1 total facility tank (A A A A)
local first_fdef, last_fdef = find_fdef(1, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 2 then
-- (2) 2 total facility tanks (A A A B)
local first_fdef, last_fdef = find_fdef(1, math.min(3, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 3 then
-- (3) 2 total facility tanks (A A B B)
for _, a in pairs({ 1, 3 }) do
local b = a + 1
if tank_defs[a] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(a), 1, y_ofs(a) + 6, colors.blue, true))
if tank_defs[b] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(b) - 13, 1, y_ofs(b), colors.blue, true))
end
elseif tank_defs[b] == 2 then
table.insert(water_pipes, pipe(0, y_ofs(b), 1, y_ofs(b) + 6, colors.blue, true))
end
end
elseif facility.tank_mode == 4 then
-- (4) 2 total facility tanks (A B B B)
local first_fdef, last_fdef = find_fdef(2, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 5 then
-- (5) 3 total facility tanks (A A B C)
local first_fdef, last_fdef = find_fdef(1, math.min(2, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 3 or i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 6 then
-- (6) 3 total facility tanks (A B B C)
local first_fdef, last_fdef = find_fdef(2, math.min(3, #tank_defs))
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 or i == 4 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
elseif facility.tank_mode == 7 then
-- (7) 3 total facility tanks (A B C C)
local first_fdef, last_fdef = find_fdef(3, #tank_defs)
for i = 1, #tank_defs do
local y = y_ofs(i)
if i == 1 or i == 2 then
if tank_defs[i] == 2 then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
end
elseif i == first_fdef then
table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
elseif i > first_fdef then
if i == last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
elseif i < last_fdef then
table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
end
end
end
end
end
local flow_x = 3
if #water_pipes > 0 then
flow_x = 25
PipeNetwork{parent=main,x=2,y=3,pipes=water_pipes,bg=colors.lightGray}
end
for i = 1, facility.num_units do
local y_offset = y_ofs(i)
unit_flow(main, flow_x, 5 + y_offset, #water_pipes == 0, units[i])
table.insert(po_pipes, pipe(0, 3 + y_offset, 4, 0, colors.cyan, true, true))
end
PipeNetwork{parent=main,x=139,y=15,pipes=po_pipes,bg=colors.lightGray}
-----------------
-- tank valves --
-----------------
local next_f_id = 1
for i = 1, #tank_defs do
if tank_defs[i] > 0 then
local vy = 3 + y_ofs(i)
TextBox{parent=main,x=12,y=vy,text="\x10\x11",fg_bg=cpair(colors.black,colors.lightGray),width=2,height=1}
local conn = IndicatorLight{parent=main,x=9,y=vy+1,label=util.sprintf("PV%02d-EMC", i * 5),colors=style.ind_grn}
local open = IndicatorLight{parent=main,x=9,y=vy+2,label="OPEN",colors=style.ind_wht}
conn.register(units[i].unit_ps, "V_emc_conn", conn.update)
open.register(units[i].unit_ps, "V_emc_state", open.update)
end
end
-------------------
-- dynamic tanks --
-------------------
for i = 1, #tank_list do
if tank_list[i] > 0 then
local id = "U-" .. i
local f_id = next_f_id
if tank_list[i] == 2 then
id = "F-" .. next_f_id
next_f_id = next_f_id + 1
end
local y_offset = y_ofs(i)
local tank = Div{parent=main,x=3,y=7+y_offset,width=20,height=14}
TextBox{parent=tank,text=" ",height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
TextBox{parent=tank,text="DYNAMIC TANK "..id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.wh_gray}
local tank_box = Rectangle{parent=tank,border=border(1,colors.gray,true),width=20,height=12}
local status = StateIndicator{parent=tank_box,x=3,y=1,states=style.dtank.states,value=1,min_width=14}
TextBox{parent=tank_box,x=2,y=3,text="Fill",height=1,width=10,fg_bg=style.label}
local tank_pcnt = DataIndicator{parent=tank_box,x=10,y=3,label="",format="%5.2f",value=100,unit="%",lu_colors=lu_col,width=8,fg_bg=text_col}
local tank_amnt = DataIndicator{parent=tank_box,x=2,label="",format="%13d",value=0,unit="mB",lu_colors=lu_col,width=16,fg_bg=bw_fg_bg}
TextBox{parent=tank_box,x=2,y=6,text="Water Level",height=1,width=11,fg_bg=style.label}
local level = HorizontalBar{parent=tank_box,x=2,y=7,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=16}
TextBox{parent=tank_box,x=2,y=9,text="In/Out Mode",height=1,width=11,fg_bg=style.label}
local can_fill = IndicatorLight{parent=tank_box,x=2,y=10,label="FILL",colors=style.ind_wht}
local can_empty = IndicatorLight{parent=tank_box,x=10,y=10,label="EMPTY",colors=style.ind_wht}
local function _can_fill(mode)
can_fill.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.FILL))
end
local function _can_empty(mode)
can_empty.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.EMPTY))
end
if tank_list[i] == 1 then
status.register(units[i].tank_ps_tbl[1], "computed_status", status.update)
tank_pcnt.register(units[i].tank_ps_tbl[1], "fill", function (f) tank_pcnt.update(f * 100) end)
tank_amnt.register(units[i].tank_ps_tbl[1], "stored", function (sto) tank_amnt.update(sto.amount) end)
level.register(units[i].tank_ps_tbl[1], "fill", level.update)
can_fill.register(units[i].tank_ps_tbl[1], "container_mode", _can_fill)
can_empty.register(units[i].tank_ps_tbl[1], "container_mode", _can_empty)
else
status.register(facility.tank_ps_tbl[f_id], "computed_status", status.update)
tank_pcnt.register(facility.tank_ps_tbl[f_id], "fill", function (f) tank_pcnt.update(f * 100) end)
tank_amnt.register(facility.tank_ps_tbl[f_id], "stored", function (sto) tank_amnt.update(sto.amount) end)
level.register(facility.tank_ps_tbl[f_id], "fill", level.update)
can_fill.register(facility.tank_ps_tbl[f_id], "container_mode", _can_fill)
can_empty.register(facility.tank_ps_tbl[f_id], "container_mode", _can_empty)
end
end
end
---------
-- SPS --
---------
local sps = Div{parent=main,x=140,y=3,height=12}
TextBox{parent=sps,text=" ",width=24,height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
TextBox{parent=sps,text="SPS",alignment=TEXT_ALIGN.CENTER,width=24,height=1,fg_bg=wh_gray}
local sps_box = Rectangle{parent=sps,border=border(1,colors.gray,true),width=24,height=10}
local status = StateIndicator{parent=sps_box,x=5,y=1,states=style.sps.states,value=1,min_width=14}
status.register(facility.sps_ps_tbl[1], "computed_status", status.update)
TextBox{parent=sps_box,x=2,y=3,text="Input Rate",height=1,width=10,fg_bg=style.label}
local sps_in = DataIndicator{parent=sps_box,x=2,label="",format="%15.3f",value=0,unit="mB/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
sps_in.register(facility.ps, "po_am_rate", sps_in.update)
TextBox{parent=sps_box,x=2,y=6,text="Production Rate",height=1,width=15,fg_bg=style.label}
local sps_rate = DataIndicator{parent=sps_box,x=2,label="",format="%15d",value=0,unit="\xb5B/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
sps_rate.register(facility.sps_ps_tbl[1], "process_rate", function (r) sps_rate.update(r * 1000) end)
----------------
-- statistics --
----------------
TextBox{parent=main,x=145,y=16,text="PROC. WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
local pr_waste = Rectangle{parent=main,x=145,y=17,border=border(1,colors.gray,true),width=19,height=5,thin=true,fg_bg=bw_fg_bg}
local pu = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Pu",unit="mB/t",format="%9.3f",value=0,width=17}
local po = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Po",unit="mB/t",format="%9.3f",value=0,width=17}
local popl = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="PoPl",unit="mB/t",format="%7.3f",value=0,width=17}
pu.register(facility.ps, "pu_rate", pu.update)
po.register(facility.ps, "po_rate", po.update)
popl.register(facility.ps, "po_pl_rate", popl.update)
TextBox{parent=main,x=145,y=23,text="SPENT WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
local sp_waste = Rectangle{parent=main,x=145,y=24,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=bw_fg_bg}
local sum_sp_waste = DataIndicator{parent=sp_waste,lu_colors=lu_col,label="SUM",unit="mB/t",format="%8.3f",value=0,width=17}
sum_sp_waste.register(facility.ps, "spent_waste_rate", sum_sp_waste.update)
end
return init

View File

@@ -0,0 +1,124 @@
--
-- Coordinator Front Panel GUI
--
local types = require("scada-common.types")
local util = require("scada-common.util")
local iocontrol = require("coordinator.iocontrol")
local pgi = require("coordinator.ui.pgi")
local style = require("coordinator.ui.style")
local pkt_entry = require("coordinator.ui.components.pkt_entry")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local ListBox = require("graphics.elements.listbox")
local MultiPane = require("graphics.elements.multipane")
local TextBox = require("graphics.elements.textbox")
local TabBar = require("graphics.elements.controls.tabbar")
local LED = require("graphics.elements.indicators.led")
local RGBLED = require("graphics.elements.indicators.ledrgb")
local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair
-- create new front panel view
---@param panel graphics_element main displaybox
---@param num_units integer number of units (number of unit monitors)
local function init(panel, num_units)
local ps = iocontrol.get_db().fp.ps
TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.fp.header}
local page_div = Div{parent=panel,x=1,y=3}
--
-- system indicators
--
local main_page = Div{parent=page_div,x=1,y=1}
local system = Div{parent=main_page,width=14,height=17,x=2,y=2}
local status = LED{parent=system,label="STATUS",colors=cpair(colors.green,colors.red)}
local heartbeat = LED{parent=system,label="HEARTBEAT",colors=cpair(colors.green,colors.green_off)}
status.update(true)
system.line_break()
heartbeat.register(ps, "heartbeat", heartbeat.update)
local modem = LED{parent=system,label="MODEM",colors=cpair(colors.green,colors.green_off)}
local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,colors.gray}}
network.update(types.PANEL_LINK_STATE.DISCONNECTED)
system.line_break()
modem.register(ps, "has_modem", modem.update)
network.register(ps, "link_state", network.update)
local speaker = LED{parent=system,label="SPEAKER",colors=cpair(colors.green,colors.green_off)}
speaker.register(ps, "has_speaker", speaker.update)
---@diagnostic disable-next-line: undefined-field
local comp_id = util.sprintf("(%d)", os.getComputerID())
TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)}
local monitors = Div{parent=main_page,width=16,height=17,x=18,y=2}
local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=cpair(colors.green,colors.green_off)}
main_monitor.register(ps, "main_monitor", main_monitor.update)
local flow_monitor = LED{parent=monitors,label="FLOW MONITOR",colors=cpair(colors.green,colors.green_off)}
flow_monitor.register(ps, "flow_monitor", flow_monitor.update)
monitors.line_break()
for i = 1, num_units do
local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=cpair(colors.green,colors.green_off)}
unit_monitor.register(ps, "unit_monitor_" .. i, unit_monitor.update)
end
--
-- about footer
--
local about = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=cpair(colors.lightGray,colors.ivory)}
local fw_v = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
fw_v.register(ps, "version", function (version) fw_v.set_value(util.c("FW: ", version)) end)
comms_v.register(ps, "comms_version", function (version) comms_v.set_value(util.c("NT: v", version)) end)
--
-- page handling
--
-- API page
local api_page = Div{parent=page_div,x=1,y=1,hidden=true}
local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=cpair(colors.black,colors.ivory),nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
local _ = Div{parent=api_list,height=1,hidden=true} -- padding
-- assemble page panes
local panes = { main_page, api_page }
local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
local tabs = {
{ name = "CRD", color = cpair(colors.black, colors.ivory) },
{ name = "API", color = cpair(colors.black, colors.ivory) },
}
TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=cpair(colors.black,colors.white)}
-- link pocket API list management to PGI
pgi.link_elements(api_list, pkt_entry)
end
return init

View File

@@ -9,7 +9,7 @@ local iocontrol = require("coordinator.iocontrol")
local style = require("coordinator.ui.style") local style = require("coordinator.ui.style")
local imatrix = require("coordinator.ui.components.imatrix") local imatrix = require("coordinator.ui.components.imatrix")
local process_ctl = require("coordinator.ui.components.processctl") local process_ctl = require("coordinator.ui.components.process_ctl")
local unit_overview = require("coordinator.ui.components.unit_overview") local unit_overview = require("coordinator.ui.components.unit_overview")
local core = require("graphics.core") local core = require("graphics.core")

60
coordinator/ui/pgi.lua Normal file
View File

@@ -0,0 +1,60 @@
--
-- Protected Graphics Interface
--
local log = require("scada-common.log")
local util = require("scada-common.util")
local pgi = {}
local data = {
pkt_list = nil, ---@type nil|graphics_element
pkt_entry = nil, ---@type function
-- session entries
s_entries = { pkt = {} }
}
-- link list boxes
---@param pkt_list graphics_element pocket list element
---@param pkt_entry function pocket entry constructor
function pgi.link_elements(pkt_list, pkt_entry)
data.pkt_list = pkt_list
data.pkt_entry = pkt_entry
end
-- unlink all fields, disabling the PGI
function pgi.unlink()
data.pkt_list = nil
data.pkt_entry = nil
end
-- add a PKT entry to the PKT list
---@param session_id integer pocket session
function pgi.create_pkt_entry(session_id)
if data.pkt_list ~= nil and data.pkt_entry ~= nil then
local success, result = pcall(data.pkt_entry, data.pkt_list, session_id)
if success then
data.s_entries.pkt[session_id] = result
else
log.error(util.c("PGI: failed to create PKT entry (", result, ")"), true)
end
end
end
-- delete a PKT entry from the PKT list
---@param session_id integer pocket session
function pgi.delete_pkt_entry(session_id)
if data.s_entries.pkt[session_id] ~= nil then
local success, result = pcall(data.s_entries.pkt[session_id].delete)
data.s_entries.pkt[session_id] = nil
if not success then
log.error(util.c("PGI: failed to delete PKT entry (", result, ")"), true)
end
else
log.debug(util.c("PGI: tried to delete unknown PKT entry ", session_id))
end
end
return pgi

View File

@@ -10,6 +10,41 @@ local cpair = core.cpair
-- GLOBAL -- -- GLOBAL --
-- add color mappings for front panel
colors.ivory = colors.pink
colors.yellow_hc = colors.purple
colors.red_off = colors.brown
colors.yellow_off = colors.magenta
colors.green_off = colors.lime
-- front panel styling
style.fp = {}
style.fp.root = cpair(colors.black, colors.ivory)
style.fp.header = cpair(colors.black, colors.lightGray)
style.fp.colors = {
{ c = colors.red, hex = 0xdf4949 }, -- RED ON
{ c = colors.orange, hex = 0xffb659 },
{ c = colors.yellow, hex = 0xf9fb53 }, -- YELLOW ON
{ c = colors.lime, hex = 0x16665a }, -- GREEN OFF
{ c = colors.green, hex = 0x6be551 }, -- GREEN ON
{ c = colors.cyan, hex = 0x34bac8 },
{ c = colors.lightBlue, hex = 0x6cc0f2 },
{ c = colors.blue, hex = 0x0096ff },
{ c = colors.purple, hex = 0xb156ee }, -- YELLOW HIGH CONTRAST
{ c = colors.pink, hex = 0xdcd9ca }, -- IVORY
{ c = colors.magenta, hex = 0x85862c }, -- YELLOW OFF
-- { c = colors.white, hex = 0xdcd9ca },
{ c = colors.lightGray, hex = 0xb1b8b3 },
{ c = colors.gray, hex = 0x575757 },
-- { c = colors.black, hex = 0x191919 },
{ c = colors.brown, hex = 0x672223 } -- RED OFF
}
-- main GUI styling
style.root = cpair(colors.black, colors.lightGray) style.root = cpair(colors.black, colors.lightGray)
style.header = cpair(colors.white, colors.gray) style.header = cpair(colors.white, colors.gray)
style.label = cpair(colors.gray, colors.lightGray) style.label = cpair(colors.gray, colors.lightGray)
@@ -33,7 +68,22 @@ style.colors = {
-- { c = colors.brown, hex = 0x7f664c } -- { c = colors.brown, hex = 0x7f664c }
} }
-- MAIN LAYOUT -- -- COMMON COLOR PAIRS --
style.wh_gray = cpair(colors.white, colors.gray)
style.bw_fg_bg = cpair(colors.black, colors.white)
style.text_colors = cpair(colors.black, colors.lightGray)
style.lu_colors = cpair(colors.gray, colors.gray)
style.hzd_fg_bg = style.wh_gray
style.dis_colors = cpair(colors.white, colors.lightGray)
style.ind_grn = cpair(colors.green, colors.gray)
style.ind_yel = cpair(colors.yellow, colors.gray)
style.ind_red = cpair(colors.red, colors.gray)
style.ind_wht = style.wh_gray
-- UI COMPONENTS --
style.reactor = { style.reactor = {
-- reactor states -- reactor states
@@ -151,8 +201,121 @@ style.imatrix = {
{ {
color = cpair(colors.black, colors.yellow), color = cpair(colors.black, colors.yellow),
text = "HIGH CHARGE" text = "HIGH CHARGE"
}
}
}
style.sps = {
-- SPS states
states = {
{
color = cpair(colors.black, colors.yellow),
text = "OFF-LINE"
},
{
color = cpair(colors.black, colors.orange),
text = "NOT FORMED"
},
{
color = cpair(colors.black, colors.orange),
text = "RTU FAULT"
},
{
color = cpair(colors.white, colors.gray),
text = "IDLE"
},
{
color = cpair(colors.black, colors.green),
text = "ACTIVE"
}
}
}
style.dtank = {
-- dynamic tank states
states = {
{
color = cpair(colors.black, colors.yellow),
text = "OFF-LINE"
},
{
color = cpair(colors.black, colors.orange),
text = "NOT FORMED"
},
{
color = cpair(colors.black, colors.orange),
text = "RTU FAULT"
},
{
color = cpair(colors.black, colors.green),
text = "ONLINE"
},
{
color = cpair(colors.black, colors.yellow),
text = "LOW FILL"
},
{
color = cpair(colors.black, colors.green),
text = "FILLED"
}, },
} }
} }
style.waste = {
-- auto waste processing states
states = {
{
color = cpair(colors.black, colors.green),
text = "PLUTONIUM"
},
{
color = cpair(colors.black, colors.cyan),
text = "POLONIUM"
},
{
color = cpair(colors.black, colors.purple),
text = "ANTI MATTER"
}
},
states_abbrv = {
{
color = cpair(colors.black, colors.green),
text = "Pu"
},
{
color = cpair(colors.black, colors.cyan),
text = "Po"
},
{
color = cpair(colors.black, colors.purple),
text = "AM"
}
},
-- process radio button options
options = { "Plutonium", "Polonium", "Antimatter" },
-- unit waste selection
unit_opts = {
{
text = "Auto",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.white, colors.gray)
},
{
text = "Pu",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.green)
},
{
text = "Po",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.cyan)
},
{
text = "AM",
fg_bg = cpair(colors.black, colors.lightGray),
active_fg_bg = cpair(colors.black, colors.purple)
}
}
}
return style return style

View File

@@ -7,6 +7,8 @@ local flasher = require("graphics.flasher")
local core = {} local core = {}
core.version = "1.1.1"
core.flasher = flasher core.flasher = flasher
core.events = events core.events = events

View File

@@ -20,6 +20,8 @@ local element = {}
---@alias graphics_args graphics_args_generic ---@alias graphics_args graphics_args_generic
---|waiting_args ---|waiting_args
---|app_button_args
---|checkbox_args
---|hazard_button_args ---|hazard_button_args
---|multi_button_args ---|multi_button_args
---|push_button_args ---|push_button_args
@@ -60,7 +62,9 @@ local element = {}
-- a base graphics element, should not be created on its own -- a base graphics element, should not be created on its own
---@nodiscard ---@nodiscard
---@param args graphics_args arguments ---@param args graphics_args arguments
function element.new(args) ---@param child_offset_x? integer mouse event offset x
---@param child_offset_y? integer mouse event offset y
function element.new(args, child_offset_x, child_offset_y)
local self = { local self = {
id = nil, ---@type element_id|nil id = nil, ---@type element_id|nil
elem_type = debug.getinfo(2).name, elem_type = debug.getinfo(2).name,
@@ -68,7 +72,8 @@ function element.new(args)
p_window = nil, ---@type table p_window = nil, ---@type table
position = { x = 1, y = 1 }, ---@type coordinate_2d position = { x = 1, y = 1 }, ---@type coordinate_2d
bounds = { x1 = 1, y1 = 1, x2 = 1, y2 = 1 }, ---@class element_bounds bounds = { x1 = 1, y1 = 1, x2 = 1, y2 = 1 }, ---@class element_bounds
next_y = 1, next_y = 1, -- next child y coordinate
next_id = 0, -- next child ID
subscriptions = {}, subscriptions = {},
mt = {} mt = {}
} }
@@ -101,8 +106,10 @@ function element.new(args)
------------------------- -------------------------
-- prepare the template -- prepare the template
---@param offset_x integer x offset for mouse events
---@param offset_y integer y offset for mouse events
---@param next_y integer next line if no y was provided ---@param next_y integer next line if no y was provided
function protected.prepare_template(next_y) function protected.prepare_template(offset_x, offset_y, next_y)
-- get frame coordinates/size -- get frame coordinates/size
if args.gframe ~= nil then if args.gframe ~= nil then
protected.frame.x = args.gframe.x protected.frame.x = args.gframe.x
@@ -150,7 +157,11 @@ function element.new(args)
-- record position -- record position
self.position.x, self.position.y = protected.window.getPosition() self.position.x, self.position.y = protected.window.getPosition()
-- calculate bounds -- shift per parent child offset
self.position.x = self.position.x + offset_x
self.position.y = self.position.y + offset_y
-- calculate mouse event bounds
self.bounds.x1 = self.position.x self.bounds.x1 = self.position.x
self.bounds.x2 = self.position.x + f.w - 1 self.bounds.x2 = self.position.x + f.w - 1
self.bounds.y1 = self.position.y self.bounds.y1 = self.position.y
@@ -283,7 +294,7 @@ function element.new(args)
-- prepare the template -- prepare the template
if args.parent == nil then if args.parent == nil then
self.id = args.id or "__ROOT__" self.id = args.id or "__ROOT__"
protected.prepare_template(1) protected.prepare_template(0, 0, 1)
else else
self.id = args.parent.__add_child(args.id, protected) self.id = args.parent.__add_child(args.id, protected)
end end
@@ -337,19 +348,20 @@ function element.new(args)
---@param child graphics_base ---@param child graphics_base
---@return integer|string key ---@return integer|string key
function public.__add_child(key, child) function public.__add_child(key, child)
child.prepare_template(self.next_y) child.prepare_template(child_offset_x or 0, child_offset_y or 0, self.next_y)
self.next_y = child.frame.y + child.frame.h self.next_y = child.frame.y + child.frame.h
local child_element = child.get() local child_element = child.get()
if key == nil then local id = key ---@type string|integer|nil
table.insert(protected.children, child_element) if id == nil then
return #protected.children id = self.next_id
else self.next_id = self.next_id + 1
protected.children[key] = child_element
return key
end end
protected.children[id] = child_element
return id
end end
-- remove a child element -- remove a child element
@@ -504,9 +516,10 @@ function element.new(args)
-- FUNCTION CALLBACKS -- -- FUNCTION CALLBACKS --
-- handle a monitor touch or mouse click -- handle a monitor touch or mouse click if this element is visible
---@param event mouse_interaction mouse interaction event ---@param event mouse_interaction mouse interaction event
function public.handle_mouse(event) function public.handle_mouse(event)
if protected.window.isVisible() then
local x_ini, y_ini = event.initial.x, event.initial.y local x_ini, y_ini = event.initial.x, event.initial.y
local ini_in = protected.in_window_bounds(x_ini, y_ini) local ini_in = protected.in_window_bounds(x_ini, y_ini)
@@ -519,6 +532,7 @@ function element.new(args)
for _, child in pairs(protected.children) do child.handle_mouse(event_T) end for _, child in pairs(protected.children) do child.handle_mouse(event_T) end
end end
end end
end
-- draw the element given new data -- draw the element given new data
---@vararg any new data ---@vararg any new data

View File

@@ -8,7 +8,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -8,7 +8,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw
-- new color map -- new color map

View File

@@ -0,0 +1,130 @@
-- App Button Graphics Element
local tcd = require("scada-common.tcd")
local core = require("graphics.core")
local element = require("graphics.element")
local CLICK_TYPE = core.events.CLICK_TYPE
---@class app_button_args
---@field text string app icon text
---@field title string app title text
---@field callback function function to call on touch
---@field app_fg_bg cpair app icon foreground/background colors
---@field active_fg_bg? cpair foreground/background colors when pressed
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new app button
---@param args app_button_args
---@return graphics_element element, element_id id
local function app_button(args)
assert(type(args.text) == "string", "graphics.elements.controls.app: text is a required field")
assert(type(args.title) == "string", "graphics.elements.controls.app: title is a required field")
assert(type(args.callback) == "function", "graphics.elements.controls.app: callback is a required field")
assert(type(args.app_fg_bg) == "table", "graphics.elements.controls.app: app_fg_bg is a required field")
args.height = 4
args.width = 5
-- create new graphics element base object
local e = element.new(args)
-- write app title, centered
e.window.setCursorPos(1, 4)
e.window.setCursorPos(math.floor((e.frame.w - string.len(args.title)) / 2) + 1, 4)
e.window.write(args.title)
-- draw the app button
local function draw()
local fgd = args.app_fg_bg.fgd
local bkg = args.app_fg_bg.bkg
if e.value then
fgd = args.active_fg_bg.fgd
bkg = args.active_fg_bg.bkg
end
-- draw icon
e.window.setCursorPos(1, 1)
e.window.setTextColor(fgd)
e.window.setBackgroundColor(bkg)
e.window.write("\x9f\x83\x83\x83")
e.window.setTextColor(bkg)
e.window.setBackgroundColor(fgd)
e.window.write("\x90")
e.window.setTextColor(fgd)
e.window.setBackgroundColor(bkg)
e.window.setCursorPos(1, 2)
e.window.write("\x95 ")
e.window.setTextColor(bkg)
e.window.setBackgroundColor(fgd)
e.window.write("\x95")
e.window.setCursorPos(1, 3)
e.window.write("\x82\x8f\x8f\x8f\x81")
-- write the icon text
e.window.setCursorPos(3, 2)
e.window.setTextColor(fgd)
e.window.setBackgroundColor(bkg)
e.window.write(args.text)
end
-- draw the app button as pressed (if active_fg_bg set)
local function show_pressed()
if e.enabled and args.active_fg_bg ~= nil then
e.value = true
e.window.setTextColor(args.active_fg_bg.fgd)
e.window.setBackgroundColor(args.active_fg_bg.bkg)
draw()
end
end
-- draw the app button as unpressed (if active_fg_bg set)
local function show_unpressed()
if e.enabled and args.active_fg_bg ~= nil then
e.value = false
e.window.setTextColor(e.fg_bg.fgd)
e.window.setBackgroundColor(e.fg_bg.bkg)
draw()
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
if e.enabled then
if event.type == CLICK_TYPE.TAP then
show_pressed()
-- show as unpressed in 0.25 seconds
if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
args.callback()
elseif event.type == CLICK_TYPE.DOWN then
show_pressed()
elseif event.type == CLICK_TYPE.UP then
show_unpressed()
if e.in_frame_bounds(event.current.x, event.current.y) then
args.callback()
end
end
end
end
-- set the value (true simulates pressing the app button)
---@param val boolean new value
function e.set_value(val)
if val then e.handle_mouse(core.events.mouse_generic(core.events.CLICK_TYPE.UP, 1, 1)) end
end
-- initial draw
draw()
return e.complete()
end
return app_button

View File

@@ -0,0 +1,85 @@
-- Checkbox Graphics Element
local core = require("graphics.core")
local element = require("graphics.element")
---@class checkbox_args
---@field label string checkbox text
---@field box_fg_bg cpair colors for checkbox
---@field callback function function to call on press
---@field parent graphics_element
---@field id? string element id
---@field x? integer 1 if omitted
---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw
-- new checkbox control
---@param args checkbox_args
---@return graphics_element element, element_id id
local function checkbox(args)
assert(type(args.label) == "string", "graphics.elements.controls.checkbox: label is a required field")
assert(type(args.box_fg_bg) == "table", "graphics.elements.controls.checkbox: box_fg_bg is a required field")
assert(type(args.callback) == "function", "graphics.elements.controls.checkbox: callback is a required field")
args.height = 1
args.width = 3 + string.len(args.label)
-- create new graphics element base object
local e = element.new(args)
e.value = false
-- show the button state
local function draw()
e.window.setCursorPos(1, 1)
if e.value then
-- show as selected
e.window.setTextColor(args.box_fg_bg.bkg)
e.window.setBackgroundColor(args.box_fg_bg.fgd)
e.window.write("\x88")
e.window.setTextColor(args.box_fg_bg.fgd)
e.window.setBackgroundColor(e.fg_bg.bkg)
e.window.write("\x95")
else
-- show as unselected
e.window.setTextColor(e.fg_bg.bkg)
e.window.setBackgroundColor(args.box_fg_bg.bkg)
e.window.write("\x88")
e.window.setTextColor(args.box_fg_bg.bkg)
e.window.setBackgroundColor(e.fg_bg.bkg)
e.window.write("\x95")
end
end
-- handle mouse interaction
---@param event mouse_interaction mouse event
function e.handle_mouse(event)
if e.enabled and core.events.was_clicked(event.type) then
e.value = not e.value
draw()
args.callback(e.value)
end
end
-- set the value
---@param val integer new value
function e.set_value(val)
e.value = val
draw()
end
-- write label text
e.window.setCursorPos(3, 1)
e.window.setTextColor(e.fg_bg.fgd)
e.window.setBackgroundColor(e.fg_bg.bkg)
e.window.write(args.label)
-- initial draw
draw()
return e.complete()
end
return checkbox

View File

@@ -14,7 +14,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -20,7 +20,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -16,7 +16,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -13,7 +13,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -17,7 +17,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -16,7 +16,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -12,7 +12,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -18,7 +18,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -6,7 +6,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height

View File

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -11,7 +11,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
-- new core map box -- new core map box
---@nodiscard ---@nodiscard

View File

@@ -14,7 +14,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width integer length ---@field width integer length
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -10,7 +10,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height

View File

@@ -16,7 +16,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -14,7 +14,7 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -9,7 +9,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -14,7 +14,7 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -13,7 +13,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width integer length ---@field width integer length
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -14,7 +14,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width integer length ---@field width integer length
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -15,7 +15,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field height? integer 1 if omitted, must be an odd number ---@field height? integer 1 if omitted, must be an odd number
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field fg_bg? cpair foreground/background colors ---@field fg_bg? cpair foreground/background colors
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw

View File

@@ -8,7 +8,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height

View File

@@ -15,7 +15,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height

View File

@@ -7,7 +7,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height

View File

@@ -11,9 +11,15 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field hidden? boolean true to hide on initial draw ---@field hidden? boolean true to hide on initial draw
---@class _pipe_map_entry
---@field atr boolean align top right (or bottom left for false)
---@field thin boolean thin pipe or not
---@field fg string foreground blit
---@field bg string background blit
-- new pipe network -- new pipe network
---@param args pipenet_args ---@param args pipenet_args
---@return graphics_element element, element_id id ---@return graphics_element element, element_id id
@@ -44,6 +50,14 @@ local function pipenet(args)
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args)
-- determine if there are any thin pipes involved
local any_thin = false
for p = 1, #args.pipes do
any_thin = args.pipes[p].thin
if any_thin then break end
end
if not any_thin then
-- draw all pipes -- draw all pipes
for p = 1, #args.pipes do for p = 1, #args.pipes do
local pipe = args.pipes[p] ---@type pipe local pipe = args.pipes[p] ---@type pipe
@@ -54,6 +68,11 @@ local function pipenet(args)
local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1) local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1) local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
if pipe.thin then
x_step = util.trinary(pipe.x1 == pipe.x2, 0, x_step)
y_step = util.trinary(pipe.y1 == pipe.y2, 0, y_step)
end
e.window.setCursorPos(x, y) e.window.setCursorPos(x, y)
local c = core.cpair(pipe.color, e.fg_bg.bkg) local c = core.cpair(pipe.color, e.fg_bg.bkg)
@@ -106,8 +125,10 @@ local function pipenet(args)
-- corner -- corner
if y_step < 0 then if y_step < 0 then
e.window.blit("\x97", c.blit_bkg, c.blit_fgd) e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
else elseif y_step > 0 then
e.window.blit("\x8d", c.blit_fgd, c.blit_bkg) e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
else
e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
end end
else else
e.window.blit("\x95", c.blit_fgd, c.blit_bkg) e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
@@ -139,7 +160,154 @@ local function pipenet(args)
end end
end end
end end
end
else
-- build map if using thin pipes, easist way to check adjacent blocks (cannot 'cheat' like with standard width)
local map = {}
-- allocate map
for x = 1, args.width do
table.insert(map, {})
for _ = 1, args.height do table.insert(map[x], false) end
end
-- build map
for p = 1, #args.pipes do
local pipe = args.pipes[p] ---@type pipe
local x = 1 + pipe.x1
local y = 1 + pipe.y1
local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
local entry = { atr = pipe.align_tr, thin = pipe.thin, fg = colors.toBlit(pipe.color), bg = e.fg_bg.blit_bkg }
if pipe.align_tr then
-- cross width then height
for _ = 1, pipe.w do
map[x][y] = entry
x = x + x_step
end
x = x - x_step -- back up one
for _ = 1, pipe.h do
map[x][y] = entry
y = y + y_step
end
else
-- cross height then width
for _ = 1, pipe.h do
map[x][y] = entry
y = y + y_step
end
y = y - y_step -- back up one
for _ = 1, pipe.w do
map[x][y] = entry
x = x + x_step
end
end
end
-- render
for x = 1, args.width do
for y = 1, args.height do
local entry = map[x][y] ---@type _pipe_map_entry|false
local char
local invert = false
if entry ~= false then
local function check(cx, cy)
return (map[cx] ~= nil) and (map[cx][cy] ~= nil) and (map[cx][cy] ~= false) and (map[cx][cy].fg == entry.fg)
end
if entry.thin then
if check(x - 1, y) then -- if left
if check(x, y - 1) then -- if above
if check(x + 1, y) then -- if right
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x91", "\x9d")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8e", "\x8d")
end
else -- not right
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x91", "\x95")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8e", "\x85")
end
end
elseif check(x, y + 1) then-- not above, if below
if check(x + 1, y) then -- if right
char = util.trinary(entry.atr, "\x93", "\x9c")
invert = entry.atr
else -- not right
char = util.trinary(entry.atr, "\x93", "\x94")
invert = entry.atr
end
else -- not above, not below
char = "\x8c"
end
elseif check(x + 1, y) then -- not left, if right
if check(x, y - 1) then -- if above
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x95", "\x9d")
invert = entry.atr
else -- not below
char = util.trinary(entry.atr, "\x8a", "\x8d")
end
else -- not above
if check(x, y + 1) then -- if below
char = util.trinary(entry.atr, "\x97", "\x9c")
invert = entry.atr
else -- not below
char = "\x8c"
end
end
else -- not left, not right
char = "\x95"
invert = entry.atr
end
else
if check(x, y - 1) then -- above
-- not below and (if left or right)
if (not check(x, y + 1)) and (check(x - 1, y) or check(x + 1, y)) then
char = util.trinary(entry.atr, "\x8f", " ")
invert = not entry.atr
else -- not below w/ sides only
char = " "
invert = true
end
elseif check(x, y + 1) then -- not above, if below
-- if left or right
if (check(x - 1, y) or check(x + 1, y)) then
char = "\x83"
invert = true
else -- not left or right
char = " "
invert = true
end
else -- not above, not below
char = util.trinary(entry.atr, "\x8f", "\x83")
invert = not entry.atr
end
end
e.window.setCursorPos(x, y)
if invert then
e.window.blit(char, entry.bg, entry.fg)
else
e.window.blit(char, entry.fg, entry.bg)
end
end
end
end
end end
return e.complete() return e.complete()

View File

@@ -11,7 +11,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height
@@ -45,7 +45,7 @@ local function rectangle(args)
end end
-- create new graphics element base object -- create new graphics element base object
local e = element.new(args) local e = element.new(args, offset_x, offset_y)
-- create content window for child elements -- create content window for child elements
e.content_window = window.create(e.window, 1 + offset_x, 1 + offset_y, e.frame.w - (2 * offset_x), e.frame.h - (2 * offset_y)) e.content_window = window.create(e.window, 1 + offset_x, 1 + offset_y, e.frame.w - (2 * offset_x), e.frame.h - (2 * offset_y))

View File

@@ -13,7 +13,7 @@ local TEXT_ALIGN = core.TEXT_ALIGN
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height

View File

@@ -11,7 +11,7 @@ local element = require("graphics.element")
---@field parent graphics_element ---@field parent graphics_element
---@field id? string element id ---@field id? string element id
---@field x? integer 1 if omitted ---@field x? integer 1 if omitted
---@field y? integer 1 if omitted ---@field y? integer auto incremented if omitted
---@field width? integer parent width if omitted ---@field width? integer parent width if omitted
---@field height? integer parent height if omitted ---@field height? integer parent height if omitted
---@field gframe? graphics_frame frame instead of x/y/width/height ---@field gframe? graphics_frame frame instead of x/y/width/height

View File

@@ -43,9 +43,11 @@ end
-- start/resume the flasher periodic -- start/resume the flasher periodic
function flasher.run() function flasher.run()
if not active then
active = true active = true
callback_250ms() callback_250ms()
end end
end
-- clear all blinking indicators and stop the flasher periodic -- clear all blinking indicators and stop the flasher periodic
function flasher.clear() function flasher.clear()

View File

@@ -23,11 +23,11 @@ def dir_size(path):
return total return total
# get the version of an application at the provided path # get the version of an application at the provided path
def get_version(path, is_comms = False): def get_version(path, is_lib = False):
ver = "" ver = ""
string = "comms.version = \"" string = ".version = \""
if not is_comms: if not is_lib:
string = "_VERSION = \"" string = "_VERSION = \""
f = open(path, "r") f = open(path, "r")
@@ -48,7 +48,10 @@ def make_manifest(size):
"versions" : { "versions" : {
"installer" : get_version("./ccmsi.lua"), "installer" : get_version("./ccmsi.lua"),
"bootloader" : get_version("./startup.lua"), "bootloader" : get_version("./startup.lua"),
"common" : get_version("./scada-common/util.lua", True),
"comms" : get_version("./scada-common/comms.lua", True), "comms" : get_version("./scada-common/comms.lua", True),
"graphics" : get_version("./graphics/core.lua", True),
"lockbox" : get_version("./lockbox/init.lua", True),
"reactor-plc" : get_version("./reactor-plc/startup.lua"), "reactor-plc" : get_version("./reactor-plc/startup.lua"),
"rtu" : get_version("./rtu/startup.lua"), "rtu" : get_version("./rtu/startup.lua"),
"supervisor" : get_version("./supervisor/startup.lua"), "supervisor" : get_version("./supervisor/startup.lua"),
@@ -69,11 +72,11 @@ def make_manifest(size):
"pocket" : list_files("./pocket"), "pocket" : list_files("./pocket"),
}, },
"depends" : { "depends" : {
"reactor-plc" : [ "system", "common", "graphics" ], "reactor-plc" : [ "system", "common", "graphics", "lockbox" ],
"rtu" : [ "system", "common", "graphics" ], "rtu" : [ "system", "common", "graphics", "lockbox" ],
"supervisor" : [ "system", "common" ], "supervisor" : [ "system", "common", "graphics", "lockbox" ],
"coordinator" : [ "system", "common", "graphics" ], "coordinator" : [ "system", "common", "graphics", "lockbox" ],
"pocket" : [ "system", "common", "graphics" ] "pocket" : [ "system", "common", "graphics", "lockbox" ]
}, },
"sizes" : { "sizes" : {
# manifest file estimate # manifest file estimate

File diff suppressed because one or more lines are too long

View File

@@ -1,415 +0,0 @@
local Array = require("lockbox.util.array");
local Bit = require("lockbox.util.bit");
local XOR = Bit.bxor;
local SBOX = {
[0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
local ISBOX = {
[0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
local ROW_SHIFT = { 1, 6, 11, 16, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, };
local IROW_SHIFT = { 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3, 16, 13, 10, 7, 4, };
local ETABLE = {
[0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
local LTABLE = {
[0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
local MIXTABLE = {
0x02, 0x03, 0x01, 0x01,
0x01, 0x02, 0x03, 0x01,
0x01, 0x01, 0x02, 0x03,
0x03, 0x01, 0x01, 0x02};
local IMIXTABLE = {
0x0E, 0x0B, 0x0D, 0x09,
0x09, 0x0E, 0x0B, 0x0D,
0x0D, 0x09, 0x0E, 0x0B,
0x0B, 0x0D, 0x09, 0x0E};
local RCON = {
[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
local GMUL = function(A, B)
if(A == 0x01) then return B; end
if(B == 0x01) then return A; end
if(A == 0x00) then return 0; end
if(B == 0x00) then return 0; end
local LA = LTABLE[A];
local LB = LTABLE[B];
local sum = LA + LB;
if (sum > 0xFF) then sum = sum - 0xFF; end
return ETABLE[sum];
end
local byteSub = Array.substitute;
local shiftRow = Array.permute;
local mixCol = function(i, mix)
local out = {};
local a, b, c, d;
a = GMUL(i[ 1], mix[ 1]);
b = GMUL(i[ 2], mix[ 2]);
c = GMUL(i[ 3], mix[ 3]);
d = GMUL(i[ 4], mix[ 4]);
out[ 1] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 5]);
b = GMUL(i[ 2], mix[ 6]);
c = GMUL(i[ 3], mix[ 7]);
d = GMUL(i[ 4], mix[ 8]);
out[ 2] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 9]);
b = GMUL(i[ 2], mix[10]);
c = GMUL(i[ 3], mix[11]);
d = GMUL(i[ 4], mix[12]);
out[ 3] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[13]);
b = GMUL(i[ 2], mix[14]);
c = GMUL(i[ 3], mix[15]);
d = GMUL(i[ 4], mix[16]);
out[ 4] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 1]);
b = GMUL(i[ 6], mix[ 2]);
c = GMUL(i[ 7], mix[ 3]);
d = GMUL(i[ 8], mix[ 4]);
out[ 5] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 5]);
b = GMUL(i[ 6], mix[ 6]);
c = GMUL(i[ 7], mix[ 7]);
d = GMUL(i[ 8], mix[ 8]);
out[ 6] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 9]);
b = GMUL(i[ 6], mix[10]);
c = GMUL(i[ 7], mix[11]);
d = GMUL(i[ 8], mix[12]);
out[ 7] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[13]);
b = GMUL(i[ 6], mix[14]);
c = GMUL(i[ 7], mix[15]);
d = GMUL(i[ 8], mix[16]);
out[ 8] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 1]);
b = GMUL(i[10], mix[ 2]);
c = GMUL(i[11], mix[ 3]);
d = GMUL(i[12], mix[ 4]);
out[ 9] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 5]);
b = GMUL(i[10], mix[ 6]);
c = GMUL(i[11], mix[ 7]);
d = GMUL(i[12], mix[ 8]);
out[10] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 9]);
b = GMUL(i[10], mix[10]);
c = GMUL(i[11], mix[11]);
d = GMUL(i[12], mix[12]);
out[11] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[13]);
b = GMUL(i[10], mix[14]);
c = GMUL(i[11], mix[15]);
d = GMUL(i[12], mix[16]);
out[12] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 1]);
b = GMUL(i[14], mix[ 2]);
c = GMUL(i[15], mix[ 3]);
d = GMUL(i[16], mix[ 4]);
out[13] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 5]);
b = GMUL(i[14], mix[ 6]);
c = GMUL(i[15], mix[ 7]);
d = GMUL(i[16], mix[ 8]);
out[14] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 9]);
b = GMUL(i[14], mix[10]);
c = GMUL(i[15], mix[11]);
d = GMUL(i[16], mix[12]);
out[15] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[13]);
b = GMUL(i[14], mix[14]);
c = GMUL(i[15], mix[15]);
d = GMUL(i[16], mix[16]);
out[16] = XOR(XOR(a, b), XOR(c, d));
return out;
end
local keyRound = function(key, round)
local out = {};
out[ 1] = XOR(key[ 1], XOR(SBOX[key[14]], RCON[round]));
out[ 2] = XOR(key[ 2], SBOX[key[15]]);
out[ 3] = XOR(key[ 3], SBOX[key[16]]);
out[ 4] = XOR(key[ 4], SBOX[key[13]]);
out[ 5] = XOR(out[ 1], key[ 5]);
out[ 6] = XOR(out[ 2], key[ 6]);
out[ 7] = XOR(out[ 3], key[ 7]);
out[ 8] = XOR(out[ 4], key[ 8]);
out[ 9] = XOR(out[ 5], key[ 9]);
out[10] = XOR(out[ 6], key[10]);
out[11] = XOR(out[ 7], key[11]);
out[12] = XOR(out[ 8], key[12]);
out[13] = XOR(out[ 9], key[13]);
out[14] = XOR(out[10], key[14]);
out[15] = XOR(out[11], key[15]);
out[16] = XOR(out[12], key[16]);
return out;
end
local keyExpand = function(key)
local keys = {};
local temp = key;
keys[1] = temp;
for i = 1, 10 do
temp = keyRound(temp, i);
keys[i + 1] = temp;
end
return keys;
end
local addKey = Array.XOR;
local AES = {};
AES.blockSize = 16;
AES.encrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[1]);
--round 1
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[2]);
--round 2
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[3]);
--round 3
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[4]);
--round 4
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[5]);
--round 5
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[6]);
--round 6
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[7]);
--round 7
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[8]);
--round 8
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[9]);
--round 9
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[10]);
--round 10
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = addKey(block, key[11]);
return block;
end
AES.decrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[11]);
--round 1
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[10]);
block = mixCol(block, IMIXTABLE);
--round 2
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[9]);
block = mixCol(block, IMIXTABLE);
--round 3
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[8]);
block = mixCol(block, IMIXTABLE);
--round 4
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[7]);
block = mixCol(block, IMIXTABLE);
--round 5
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[6]);
block = mixCol(block, IMIXTABLE);
--round 6
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[5]);
block = mixCol(block, IMIXTABLE);
--round 7
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[4]);
block = mixCol(block, IMIXTABLE);
--round 8
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[3]);
block = mixCol(block, IMIXTABLE);
--round 9
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[2]);
block = mixCol(block, IMIXTABLE);
--round 10
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[1]);
return block;
end
return AES;

View File

@@ -1,462 +0,0 @@
local Array = require("lockbox.util.array");
local Bit = require("lockbox.util.bit");
local XOR = Bit.bxor;
local SBOX = {
[0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
local ISBOX = {
[0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
local ROW_SHIFT = { 1, 6, 11, 16, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, };
local IROW_SHIFT = { 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3, 16, 13, 10, 7, 4, };
local ETABLE = {
[0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
local LTABLE = {
[0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
local MIXTABLE = {
0x02, 0x03, 0x01, 0x01,
0x01, 0x02, 0x03, 0x01,
0x01, 0x01, 0x02, 0x03,
0x03, 0x01, 0x01, 0x02};
local IMIXTABLE = {
0x0E, 0x0B, 0x0D, 0x09,
0x09, 0x0E, 0x0B, 0x0D,
0x0D, 0x09, 0x0E, 0x0B,
0x0B, 0x0D, 0x09, 0x0E};
local RCON = {
[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
local GMUL = function(A, B)
if(A == 0x01) then return B; end
if(B == 0x01) then return A; end
if(A == 0x00) then return 0; end
if(B == 0x00) then return 0; end
local LA = LTABLE[A];
local LB = LTABLE[B];
local sum = LA + LB;
if (sum > 0xFF) then sum = sum - 0xFF; end
return ETABLE[sum];
end
local byteSub = Array.substitute;
local shiftRow = Array.permute;
local mixCol = function(i, mix)
local out = {};
local a, b, c, d;
a = GMUL(i[ 1], mix[ 1]);
b = GMUL(i[ 2], mix[ 2]);
c = GMUL(i[ 3], mix[ 3]);
d = GMUL(i[ 4], mix[ 4]);
out[ 1] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 5]);
b = GMUL(i[ 2], mix[ 6]);
c = GMUL(i[ 3], mix[ 7]);
d = GMUL(i[ 4], mix[ 8]);
out[ 2] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 9]);
b = GMUL(i[ 2], mix[10]);
c = GMUL(i[ 3], mix[11]);
d = GMUL(i[ 4], mix[12]);
out[ 3] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[13]);
b = GMUL(i[ 2], mix[14]);
c = GMUL(i[ 3], mix[15]);
d = GMUL(i[ 4], mix[16]);
out[ 4] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 1]);
b = GMUL(i[ 6], mix[ 2]);
c = GMUL(i[ 7], mix[ 3]);
d = GMUL(i[ 8], mix[ 4]);
out[ 5] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 5]);
b = GMUL(i[ 6], mix[ 6]);
c = GMUL(i[ 7], mix[ 7]);
d = GMUL(i[ 8], mix[ 8]);
out[ 6] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 9]);
b = GMUL(i[ 6], mix[10]);
c = GMUL(i[ 7], mix[11]);
d = GMUL(i[ 8], mix[12]);
out[ 7] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[13]);
b = GMUL(i[ 6], mix[14]);
c = GMUL(i[ 7], mix[15]);
d = GMUL(i[ 8], mix[16]);
out[ 8] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 1]);
b = GMUL(i[10], mix[ 2]);
c = GMUL(i[11], mix[ 3]);
d = GMUL(i[12], mix[ 4]);
out[ 9] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 5]);
b = GMUL(i[10], mix[ 6]);
c = GMUL(i[11], mix[ 7]);
d = GMUL(i[12], mix[ 8]);
out[10] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 9]);
b = GMUL(i[10], mix[10]);
c = GMUL(i[11], mix[11]);
d = GMUL(i[12], mix[12]);
out[11] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[13]);
b = GMUL(i[10], mix[14]);
c = GMUL(i[11], mix[15]);
d = GMUL(i[12], mix[16]);
out[12] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 1]);
b = GMUL(i[14], mix[ 2]);
c = GMUL(i[15], mix[ 3]);
d = GMUL(i[16], mix[ 4]);
out[13] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 5]);
b = GMUL(i[14], mix[ 6]);
c = GMUL(i[15], mix[ 7]);
d = GMUL(i[16], mix[ 8]);
out[14] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 9]);
b = GMUL(i[14], mix[10]);
c = GMUL(i[15], mix[11]);
d = GMUL(i[16], mix[12]);
out[15] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[13]);
b = GMUL(i[14], mix[14]);
c = GMUL(i[15], mix[15]);
d = GMUL(i[16], mix[16]);
out[16] = XOR(XOR(a, b), XOR(c, d));
return out;
end
local keyRound = function(key, round)
local i = (round - 1) * 24;
local out = key;
out[25 + i] = XOR(key[ 1 + i], XOR(SBOX[key[22 + i]], RCON[round]));
out[26 + i] = XOR(key[ 2 + i], SBOX[key[23 + i]]);
out[27 + i] = XOR(key[ 3 + i], SBOX[key[24 + i]]);
out[28 + i] = XOR(key[ 4 + i], SBOX[key[21 + i]]);
out[29 + i] = XOR(out[25 + i], key[ 5 + i]);
out[30 + i] = XOR(out[26 + i], key[ 6 + i]);
out[31 + i] = XOR(out[27 + i], key[ 7 + i]);
out[32 + i] = XOR(out[28 + i], key[ 8 + i]);
out[33 + i] = XOR(out[29 + i], key[ 9 + i]);
out[34 + i] = XOR(out[30 + i], key[10 + i]);
out[35 + i] = XOR(out[31 + i], key[11 + i]);
out[36 + i] = XOR(out[32 + i], key[12 + i]);
out[37 + i] = XOR(out[33 + i], key[13 + i]);
out[38 + i] = XOR(out[34 + i], key[14 + i]);
out[39 + i] = XOR(out[35 + i], key[15 + i]);
out[40 + i] = XOR(out[36 + i], key[16 + i]);
out[41 + i] = XOR(out[37 + i], key[17 + i]);
out[42 + i] = XOR(out[38 + i], key[18 + i]);
out[43 + i] = XOR(out[39 + i], key[19 + i]);
out[44 + i] = XOR(out[40 + i], key[20 + i]);
out[45 + i] = XOR(out[41 + i], key[21 + i]);
out[46 + i] = XOR(out[42 + i], key[22 + i]);
out[47 + i] = XOR(out[43 + i], key[23 + i]);
out[48 + i] = XOR(out[44 + i], key[24 + i]);
return out;
end
local keyExpand = function(key)
local bytes = Array.copy(key);
for i = 1, 8 do
keyRound(bytes, i);
end
local keys = {};
keys[ 1] = Array.slice(bytes, 1, 16);
keys[ 2] = Array.slice(bytes, 17, 32);
keys[ 3] = Array.slice(bytes, 33, 48);
keys[ 4] = Array.slice(bytes, 49, 64);
keys[ 5] = Array.slice(bytes, 65, 80);
keys[ 6] = Array.slice(bytes, 81, 96);
keys[ 7] = Array.slice(bytes, 97, 112);
keys[ 8] = Array.slice(bytes, 113, 128);
keys[ 9] = Array.slice(bytes, 129, 144);
keys[10] = Array.slice(bytes, 145, 160);
keys[11] = Array.slice(bytes, 161, 176);
keys[12] = Array.slice(bytes, 177, 192);
keys[13] = Array.slice(bytes, 193, 208);
return keys;
end
local addKey = Array.XOR;
local AES = {};
AES.blockSize = 16;
AES.encrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[1]);
--round 1
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[2]);
--round 2
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[3]);
--round 3
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[4]);
--round 4
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[5]);
--round 5
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[6]);
--round 6
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[7]);
--round 7
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[8]);
--round 8
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[9]);
--round 9
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[10]);
--round 10
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[11]);
--round 11
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[12]);
--round 12
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = addKey(block, key[13]);
return block;
end
AES.decrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[13]);
--round 1
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[12]);
block = mixCol(block, IMIXTABLE);
--round 2
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[11]);
block = mixCol(block, IMIXTABLE);
--round 3
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[10]);
block = mixCol(block, IMIXTABLE);
--round 4
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[9]);
block = mixCol(block, IMIXTABLE);
--round 5
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[8]);
block = mixCol(block, IMIXTABLE);
--round 6
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[7]);
block = mixCol(block, IMIXTABLE);
--round 7
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[6]);
block = mixCol(block, IMIXTABLE);
--round 8
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[5]);
block = mixCol(block, IMIXTABLE);
--round 9
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[4]);
block = mixCol(block, IMIXTABLE);
--round 10
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[3]);
block = mixCol(block, IMIXTABLE);
--round 11
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[2]);
block = mixCol(block, IMIXTABLE);
--round 12
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[1]);
return block;
end
return AES;

View File

@@ -1,498 +0,0 @@
local Array = require("lockbox.util.array");
local Bit = require("lockbox.util.bit");
local XOR = Bit.bxor;
local SBOX = {
[0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
local ISBOX = {
[0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
local ROW_SHIFT = { 1, 6, 11, 16, 5, 10, 15, 4, 9, 14, 3, 8, 13, 2, 7, 12, };
local IROW_SHIFT = { 1, 14, 11, 8, 5, 2, 15, 12, 9, 6, 3, 16, 13, 10, 7, 4, };
local ETABLE = {
[0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
local LTABLE = {
[0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
local MIXTABLE = {
0x02, 0x03, 0x01, 0x01,
0x01, 0x02, 0x03, 0x01,
0x01, 0x01, 0x02, 0x03,
0x03, 0x01, 0x01, 0x02};
local IMIXTABLE = {
0x0E, 0x0B, 0x0D, 0x09,
0x09, 0x0E, 0x0B, 0x0D,
0x0D, 0x09, 0x0E, 0x0B,
0x0B, 0x0D, 0x09, 0x0E};
local RCON = {
[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
local GMUL = function(A, B)
if(A == 0x01) then return B; end
if(B == 0x01) then return A; end
if(A == 0x00) then return 0; end
if(B == 0x00) then return 0; end
local LA = LTABLE[A];
local LB = LTABLE[B];
local sum = LA + LB;
if (sum > 0xFF) then sum = sum - 0xFF; end
return ETABLE[sum];
end
local byteSub = Array.substitute;
local shiftRow = Array.permute;
local mixCol = function(i, mix)
local out = {};
local a, b, c, d;
a = GMUL(i[ 1], mix[ 1]);
b = GMUL(i[ 2], mix[ 2]);
c = GMUL(i[ 3], mix[ 3]);
d = GMUL(i[ 4], mix[ 4]);
out[ 1] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 5]);
b = GMUL(i[ 2], mix[ 6]);
c = GMUL(i[ 3], mix[ 7]);
d = GMUL(i[ 4], mix[ 8]);
out[ 2] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[ 9]);
b = GMUL(i[ 2], mix[10]);
c = GMUL(i[ 3], mix[11]);
d = GMUL(i[ 4], mix[12]);
out[ 3] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 1], mix[13]);
b = GMUL(i[ 2], mix[14]);
c = GMUL(i[ 3], mix[15]);
d = GMUL(i[ 4], mix[16]);
out[ 4] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 1]);
b = GMUL(i[ 6], mix[ 2]);
c = GMUL(i[ 7], mix[ 3]);
d = GMUL(i[ 8], mix[ 4]);
out[ 5] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 5]);
b = GMUL(i[ 6], mix[ 6]);
c = GMUL(i[ 7], mix[ 7]);
d = GMUL(i[ 8], mix[ 8]);
out[ 6] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[ 9]);
b = GMUL(i[ 6], mix[10]);
c = GMUL(i[ 7], mix[11]);
d = GMUL(i[ 8], mix[12]);
out[ 7] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 5], mix[13]);
b = GMUL(i[ 6], mix[14]);
c = GMUL(i[ 7], mix[15]);
d = GMUL(i[ 8], mix[16]);
out[ 8] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 1]);
b = GMUL(i[10], mix[ 2]);
c = GMUL(i[11], mix[ 3]);
d = GMUL(i[12], mix[ 4]);
out[ 9] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 5]);
b = GMUL(i[10], mix[ 6]);
c = GMUL(i[11], mix[ 7]);
d = GMUL(i[12], mix[ 8]);
out[10] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[ 9]);
b = GMUL(i[10], mix[10]);
c = GMUL(i[11], mix[11]);
d = GMUL(i[12], mix[12]);
out[11] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[ 9], mix[13]);
b = GMUL(i[10], mix[14]);
c = GMUL(i[11], mix[15]);
d = GMUL(i[12], mix[16]);
out[12] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 1]);
b = GMUL(i[14], mix[ 2]);
c = GMUL(i[15], mix[ 3]);
d = GMUL(i[16], mix[ 4]);
out[13] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 5]);
b = GMUL(i[14], mix[ 6]);
c = GMUL(i[15], mix[ 7]);
d = GMUL(i[16], mix[ 8]);
out[14] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[ 9]);
b = GMUL(i[14], mix[10]);
c = GMUL(i[15], mix[11]);
d = GMUL(i[16], mix[12]);
out[15] = XOR(XOR(a, b), XOR(c, d));
a = GMUL(i[13], mix[13]);
b = GMUL(i[14], mix[14]);
c = GMUL(i[15], mix[15]);
d = GMUL(i[16], mix[16]);
out[16] = XOR(XOR(a, b), XOR(c, d));
return out;
end
local keyRound = function(key, round)
local i = (round - 1) * 32;
local out = key;
out[33 + i] = XOR(key[ 1 + i], XOR(SBOX[key[30 + i]], RCON[round]));
out[34 + i] = XOR(key[ 2 + i], SBOX[key[31 + i]]);
out[35 + i] = XOR(key[ 3 + i], SBOX[key[32 + i]]);
out[36 + i] = XOR(key[ 4 + i], SBOX[key[29 + i]]);
out[37 + i] = XOR(out[33 + i], key[ 5 + i]);
out[38 + i] = XOR(out[34 + i], key[ 6 + i]);
out[39 + i] = XOR(out[35 + i], key[ 7 + i]);
out[40 + i] = XOR(out[36 + i], key[ 8 + i]);
out[41 + i] = XOR(out[37 + i], key[ 9 + i]);
out[42 + i] = XOR(out[38 + i], key[10 + i]);
out[43 + i] = XOR(out[39 + i], key[11 + i]);
out[44 + i] = XOR(out[40 + i], key[12 + i]);
out[45 + i] = XOR(out[41 + i], key[13 + i]);
out[46 + i] = XOR(out[42 + i], key[14 + i]);
out[47 + i] = XOR(out[43 + i], key[15 + i]);
out[48 + i] = XOR(out[44 + i], key[16 + i]);
out[49 + i] = XOR(SBOX[out[45 + i]], key[17 + i]);
out[50 + i] = XOR(SBOX[out[46 + i]], key[18 + i]);
out[51 + i] = XOR(SBOX[out[47 + i]], key[19 + i]);
out[52 + i] = XOR(SBOX[out[48 + i]], key[20 + i]);
out[53 + i] = XOR(out[49 + i], key[21 + i]);
out[54 + i] = XOR(out[50 + i], key[22 + i]);
out[55 + i] = XOR(out[51 + i], key[23 + i]);
out[56 + i] = XOR(out[52 + i], key[24 + i]);
out[57 + i] = XOR(out[53 + i], key[25 + i]);
out[58 + i] = XOR(out[54 + i], key[26 + i]);
out[59 + i] = XOR(out[55 + i], key[27 + i]);
out[60 + i] = XOR(out[56 + i], key[28 + i]);
out[61 + i] = XOR(out[57 + i], key[29 + i]);
out[62 + i] = XOR(out[58 + i], key[30 + i]);
out[63 + i] = XOR(out[59 + i], key[31 + i]);
out[64 + i] = XOR(out[60 + i], key[32 + i]);
return out;
end
local keyExpand = function(key)
local bytes = Array.copy(key);
for i = 1, 7 do
keyRound(bytes, i);
end
local keys = {};
keys[ 1] = Array.slice(bytes, 1, 16);
keys[ 2] = Array.slice(bytes, 17, 32);
keys[ 3] = Array.slice(bytes, 33, 48);
keys[ 4] = Array.slice(bytes, 49, 64);
keys[ 5] = Array.slice(bytes, 65, 80);
keys[ 6] = Array.slice(bytes, 81, 96);
keys[ 7] = Array.slice(bytes, 97, 112);
keys[ 8] = Array.slice(bytes, 113, 128);
keys[ 9] = Array.slice(bytes, 129, 144);
keys[10] = Array.slice(bytes, 145, 160);
keys[11] = Array.slice(bytes, 161, 176);
keys[12] = Array.slice(bytes, 177, 192);
keys[13] = Array.slice(bytes, 193, 208);
keys[14] = Array.slice(bytes, 209, 224);
keys[15] = Array.slice(bytes, 225, 240);
return keys;
end
local addKey = Array.XOR;
local AES = {};
AES.blockSize = 16;
AES.encrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[1]);
--round 1
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[2]);
--round 2
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[3]);
--round 3
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[4]);
--round 4
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[5]);
--round 5
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[6]);
--round 6
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[7]);
--round 7
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[8]);
--round 8
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[9]);
--round 9
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[10]);
--round 10
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[11]);
--round 11
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[12]);
--round 12
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[13]);
--round 13
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = mixCol(block, MIXTABLE);
block = addKey(block, key[14]);
--round 14
block = byteSub(block, SBOX);
block = shiftRow(block, ROW_SHIFT);
block = addKey(block, key[15]);
return block;
end
AES.decrypt = function(_key, block)
local key = keyExpand(_key);
--round 0
block = addKey(block, key[15]);
--round 1
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[14]);
block = mixCol(block, IMIXTABLE);
--round 2
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[13]);
block = mixCol(block, IMIXTABLE);
--round 3
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[12]);
block = mixCol(block, IMIXTABLE);
--round 4
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[11]);
block = mixCol(block, IMIXTABLE);
--round 5
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[10]);
block = mixCol(block, IMIXTABLE);
--round 6
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[9]);
block = mixCol(block, IMIXTABLE);
--round 7
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[8]);
block = mixCol(block, IMIXTABLE);
--round 8
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[7]);
block = mixCol(block, IMIXTABLE);
--round 9
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[6]);
block = mixCol(block, IMIXTABLE);
--round 10
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[5]);
block = mixCol(block, IMIXTABLE);
--round 11
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[4]);
block = mixCol(block, IMIXTABLE);
--round 12
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[3]);
block = mixCol(block, IMIXTABLE);
--round 13
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[2]);
block = mixCol(block, IMIXTABLE);
--round 14
block = shiftRow(block, IROW_SHIFT);
block = byteSub(block, ISBOX);
block = addKey(block, key[1]);
return block;
end
return AES;

View File

@@ -1,164 +0,0 @@
local Array = require("lockbox.util.array");
local Stream = require("lockbox.util.stream");
local Queue = require("lockbox.util.queue");
local CBC = {};
CBC.Cipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = Array.XOR(iv, block);
out = blockCipher.encrypt(key, out);
Array.writeToQueue(outputQueue, out);
iv = out;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
CBC.Decipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = block;
out = blockCipher.decrypt(key, out);
out = Array.XOR(iv, out);
Array.writeToQueue(outputQueue, out);
iv = block;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
return CBC;

View File

@@ -1,163 +0,0 @@
local Array = require("lockbox.util.array");
local Stream = require("lockbox.util.stream");
local Queue = require("lockbox.util.queue");
local CFB = {};
CFB.Cipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
iv = out;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
CFB.Decipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
iv = block;
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
return CFB;

View File

@@ -1,248 +0,0 @@
local Array = require("lockbox.util.array");
local Stream = require("lockbox.util.stream");
local Queue = require("lockbox.util.queue");
local Bit = require("lockbox.util.bit");
local AND = Bit.band;
local CTR = {};
CTR.Cipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
local updateIV = function()
iv[16] = iv[16] + 1;
if iv[16] <= 0xFF then return; end
iv[16] = AND(iv[16], 0xFF);
iv[15] = iv[15] + 1;
if iv[15] <= 0xFF then return; end
iv[15] = AND(iv[15], 0xFF);
iv[14] = iv[14] + 1;
if iv[14] <= 0xFF then return; end
iv[14] = AND(iv[14], 0xFF);
iv[13] = iv[13] + 1;
if iv[13] <= 0xFF then return; end
iv[13] = AND(iv[13], 0xFF);
iv[12] = iv[12] + 1;
if iv[12] <= 0xFF then return; end
iv[12] = AND(iv[12], 0xFF);
iv[11] = iv[11] + 1;
if iv[11] <= 0xFF then return; end
iv[11] = AND(iv[11], 0xFF);
iv[10] = iv[10] + 1;
if iv[10] <= 0xFF then return; end
iv[10] = AND(iv[10], 0xFF);
iv[9] = iv[9] + 1;
if iv[9] <= 0xFF then return; end
iv[9] = AND(iv[9], 0xFF);
return;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
updateIV();
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
CTR.Decipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
local updateIV = function()
iv[16] = iv[16] + 1;
if iv[16] <= 0xFF then return; end
iv[16] = AND(iv[16], 0xFF);
iv[15] = iv[15] + 1;
if iv[15] <= 0xFF then return; end
iv[15] = AND(iv[15], 0xFF);
iv[14] = iv[14] + 1;
if iv[14] <= 0xFF then return; end
iv[14] = AND(iv[14], 0xFF);
iv[13] = iv[13] + 1;
if iv[13] <= 0xFF then return; end
iv[13] = AND(iv[13], 0xFF);
iv[12] = iv[12] + 1;
if iv[12] <= 0xFF then return; end
iv[12] = AND(iv[12], 0xFF);
iv[11] = iv[11] + 1;
if iv[11] <= 0xFF then return; end
iv[11] = AND(iv[11], 0xFF);
iv[10] = iv[10] + 1;
if iv[10] <= 0xFF then return; end
iv[10] = AND(iv[10], 0xFF);
iv[9] = iv[9] + 1;
if iv[9] <= 0xFF then return; end
iv[9] = AND(iv[9], 0xFF);
return;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
updateIV();
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
return CTR;

View File

@@ -1,164 +0,0 @@
local Array = require("lockbox.util.array");
local Stream = require("lockbox.util.stream");
local Queue = require("lockbox.util.queue");
local OFB = {};
OFB.Cipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
iv = out;
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
OFB.Decipher = function()
local public = {};
local key;
local blockCipher;
local padding;
local inputQueue;
local outputQueue;
local iv;
public.setKey = function(keyBytes)
key = keyBytes;
return public;
end
public.setBlockCipher = function(cipher)
blockCipher = cipher;
return public;
end
public.setPadding = function(paddingMode)
padding = paddingMode;
return public;
end
public.init = function()
inputQueue = Queue();
outputQueue = Queue();
iv = nil;
return public;
end
public.update = function(messageStream)
local byte = messageStream();
while (byte ~= nil) do
inputQueue.push(byte);
if(inputQueue.size() >= blockCipher.blockSize) then
local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
if(iv == nil) then
iv = block;
else
local out = iv;
out = blockCipher.encrypt(key, out);
iv = out;
out = Array.XOR(out, block);
Array.writeToQueue(outputQueue, out);
end
end
byte = messageStream();
end
return public;
end
public.finish = function()
local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
public.update(paddingStream);
return public;
end
public.getOutputQueue = function()
return outputQueue;
end
public.asHex = function()
return Stream.toHex(outputQueue.pop);
end
public.asBytes = function()
return Stream.toArray(outputQueue.pop);
end
return public;
end
return OFB;

201
lockbox/digest/md5.lua Normal file
View File

@@ -0,0 +1,201 @@
require("lockbox").insecure();
local Bit = require("lockbox.util.bit");
local String = require("string");
local Math = require("math");
local Queue = require("lockbox.util.queue");
local SHIFT = {
7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22,
5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20,
4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23,
6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21};
local CONSTANTS = {
0xd76aa478, 0xe8c7b756, 0x242070db, 0xc1bdceee,
0xf57c0faf, 0x4787c62a, 0xa8304613, 0xfd469501,
0x698098d8, 0x8b44f7af, 0xffff5bb1, 0x895cd7be,
0x6b901122, 0xfd987193, 0xa679438e, 0x49b40821,
0xf61e2562, 0xc040b340, 0x265e5a51, 0xe9b6c7aa,
0xd62f105d, 0x02441453, 0xd8a1e681, 0xe7d3fbc8,
0x21e1cde6, 0xc33707d6, 0xf4d50d87, 0x455a14ed,
0xa9e3e905, 0xfcefa3f8, 0x676f02d9, 0x8d2a4c8a,
0xfffa3942, 0x8771f681, 0x6d9d6122, 0xfde5380c,
0xa4beea44, 0x4bdecfa9, 0xf6bb4b60, 0xbebfbc70,
0x289b7ec6, 0xeaa127fa, 0xd4ef3085, 0x04881d05,
0xd9d4d039, 0xe6db99e5, 0x1fa27cf8, 0xc4ac5665,
0xf4292244, 0x432aff97, 0xab9423a7, 0xfc93a039,
0x655b59c3, 0x8f0ccc92, 0xffeff47d, 0x85845dd1,
0x6fa87e4f, 0xfe2ce6e0, 0xa3014314, 0x4e0811a1,
0xf7537e82, 0xbd3af235, 0x2ad7d2bb, 0xeb86d391};
local AND = Bit.band;
local OR = Bit.bor;
local NOT = Bit.bnot;
local XOR = Bit.bxor;
local LROT = Bit.lrotate;
local LSHIFT = Bit.lshift;
local RSHIFT = Bit.rshift;
--MD5 is little-endian
local bytes2word = function(b0, b1, b2, b3)
local i = b3; i = LSHIFT(i, 8);
i = OR(i, b2); i = LSHIFT(i, 8);
i = OR(i, b1); i = LSHIFT(i, 8);
i = OR(i, b0);
return i;
end
local word2bytes = function(word)
local b0, b1, b2, b3;
b0 = AND(word, 0xFF); word = RSHIFT(word, 8);
b1 = AND(word, 0xFF); word = RSHIFT(word, 8);
b2 = AND(word, 0xFF); word = RSHIFT(word, 8);
b3 = AND(word, 0xFF);
return b0, b1, b2, b3;
end
local dword2bytes = function(i)
local b4, b5, b6, b7 = word2bytes(Math.floor(i / 0x100000000));
local b0, b1, b2, b3 = word2bytes(i);
return b0, b1, b2, b3, b4, b5, b6, b7;
end
local F = function(x, y, z) return OR(AND(x, y), AND(NOT(x), z)); end
local G = function(x, y, z) return OR(AND(x, z), AND(y, NOT(z))); end
local H = function(x, y, z) return XOR(x, XOR(y, z)); end
local I = function(x, y, z) return XOR(y, OR(x, NOT(z))); end
local MD5 = function()
local queue = Queue();
local A = 0x67452301;
local B = 0xefcdab89;
local C = 0x98badcfe;
local D = 0x10325476;
local public = {};
local processBlock = function()
local a = A;
local b = B;
local c = C;
local d = D;
local X = {};
for i = 1, 16 do
X[i] = bytes2word(queue.pop(), queue.pop(), queue.pop(), queue.pop());
end
for i = 0, 63 do
local f, g, temp;
if (0 <= i) and (i <= 15) then
f = F(b, c, d);
g = i;
elseif (16 <= i) and (i <= 31) then
f = G(b, c, d);
g = (5 * i + 1) % 16;
elseif (32 <= i) and (i <= 47) then
f = H(b, c, d);
g = (3 * i + 5) % 16;
elseif (48 <= i) and (i <= 63) then
f = I(b, c, d);
g = (7 * i) % 16;
end
temp = d;
d = c;
c = b;
b = b + LROT((a + f + CONSTANTS[i + 1] + X[g + 1]), SHIFT[i + 1]);
a = temp;
end
A = AND(A + a, 0xFFFFFFFF);
B = AND(B + b, 0xFFFFFFFF);
C = AND(C + c, 0xFFFFFFFF);
D = AND(D + d, 0xFFFFFFFF);
end
public.init = function()
queue.reset();
A = 0x67452301;
B = 0xefcdab89;
C = 0x98badcfe;
D = 0x10325476;
return public;
end
public.update = function(bytes)
for b in bytes do
queue.push(b);
if(queue.size() >= 64) then processBlock(); end
end
return public;
end
public.finish = function()
local bits = queue.getHead() * 8;
queue.push(0x80);
while ((queue.size() + 7) % 64) < 63 do
queue.push(0x00);
end
local b0, b1, b2, b3, b4, b5, b6, b7 = dword2bytes(bits);
queue.push(b0);
queue.push(b1);
queue.push(b2);
queue.push(b3);
queue.push(b4);
queue.push(b5);
queue.push(b6);
queue.push(b7);
while queue.size() > 0 do
processBlock();
end
return public;
end
public.asBytes = function()
local b0, b1, b2, b3 = word2bytes(A);
local b4, b5, b6, b7 = word2bytes(B);
local b8, b9, b10, b11 = word2bytes(C);
local b12, b13, b14, b15 = word2bytes(D);
return {b0, b1, b2, b3, b4, b5, b6, b7, b8, b9, b10, b11, b12, b13, b14, b15};
end
public.asHex = function()
local b0, b1, b2, b3 = word2bytes(A);
local b4, b5, b6, b7 = word2bytes(B);
local b8, b9, b10, b11 = word2bytes(C);
local b12, b13, b14, b15 = word2bytes(D);
return String.format("%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x",
b0, b1, b2, b3, b4, b5, b6, b7, b8, b9, b10, b11, b12, b13, b14, b15);
end
public.asString = function()
local b0, b1, b2, b3 = word2bytes(A);
local b4, b5, b6, b7 = word2bytes(B);
local b8, b9, b10, b11 = word2bytes(C);
local b12, b13, b14, b15 = word2bytes(D);
return string.pack(string.rep('B', 16),
b0, b1, b2, b3, b4, b5, b6, b7, b8,
b9, b10, b11, b12, b13, b14, b15
)
end
return public;
end
return MD5;

View File

@@ -1,5 +1,8 @@
local Lockbox = {}; local Lockbox = {};
-- cc-mek-scada lockbox version
Lockbox.version = "1.0"
--[[ --[[
package.path = "./?.lua;" package.path = "./?.lua;"
.. "./cipher/?.lua;" .. "./cipher/?.lua;"

View File

@@ -1,22 +0,0 @@
local ANSIX923Padding = function(blockSize, byteCount)
local paddingCount = blockSize - (byteCount % blockSize);
local bytesLeft = paddingCount;
local stream = function()
if bytesLeft > 1 then
bytesLeft = bytesLeft - 1;
return 0x00;
elseif bytesLeft > 0 then
bytesLeft = bytesLeft - 1;
return paddingCount;
else
return nil;
end
end
return stream;
end
return ANSIX923Padding;

View File

@@ -1,22 +0,0 @@
local ISOIEC7816Padding = function(blockSize, byteCount)
local paddingCount = blockSize - (byteCount % blockSize);
local bytesLeft = paddingCount;
local stream = function()
if bytesLeft == paddingCount then
bytesLeft = bytesLeft - 1;
return 0x80;
elseif bytesLeft > 0 then
bytesLeft = bytesLeft - 1;
return 0x00;
else
return nil;
end
end
return stream;
end
return ISOIEC7816Padding;

View File

@@ -1,18 +0,0 @@
local PKCS7Padding = function(blockSize, byteCount)
local paddingCount = blockSize - ((byteCount -1) % blockSize) + 1;
local bytesLeft = paddingCount;
local stream = function()
if bytesLeft > 0 then
bytesLeft = bytesLeft - 1;
return paddingCount;
else
return nil;
end
end
return stream;
end
return PKCS7Padding;

View File

@@ -1,19 +0,0 @@
local ZeroPadding = function(blockSize, byteCount)
local paddingCount = blockSize - ((byteCount -1) % blockSize) + 1;
local bytesLeft = paddingCount;
local stream = function()
if bytesLeft > 0 then
bytesLeft = bytesLeft - 1;
return 0x00;
else
return nil;
end
end
return stream;
end
return ZeroPadding;

View File

@@ -1,25 +1,19 @@
local ok, e -- modified (simplified) for ComputerCraft
ok = nil
if not ok then local ok, e = nil, nil
ok, e = pcall(require, "bit") -- the LuaJIT one ?
end
if not ok then if not ok then
ok, e = pcall(require, "bit32") -- Lua 5.2 ok, e = pcall(require, "bit32") -- Lua 5.2
end end
if not ok then if not ok then
ok, e = pcall(require, "bit.numberlua") -- for Lua 5.1, https://github.com/tst2005/lua-bit-numberlua/ ok, e = pcall(require, "bit")
end end
if not ok then if not ok then
error("no bitwise support found", 2) error("no bitwise support found", 2)
end end
assert(type(e) == "table", "invalid bit module") assert(type(e) == "table", "invalid bit module")
-- Workaround to support Lua 5.2 bit32 API with the LuaJIT bit one
if e.rol and not e.lrotate then
e.lrotate = e.rol
end
if e.ror and not e.rrotate then
e.rrotate = e.ror
end
return e return e

View File

@@ -10,6 +10,10 @@ config.PKT_CHANNEL = 16244
config.TRUSTED_RANGE = 0 config.TRUSTED_RANGE = 0
-- time in seconds (>= 2) before assuming a remote device is no longer active -- time in seconds (>= 2) before assuming a remote device is no longer active
config.COMMS_TIMEOUT = 5 config.COMMS_TIMEOUT = 5
-- facility authentication key (do NOT use one of your passwords)
-- this enables verifying that messages are authentic
-- all devices on the same network must use the same key
-- config.AUTH_KEY = "SCADAfacility123"
-- log path -- log path
config.LOG_PATH = "/log.txt" config.LOG_PATH = "/log.txt"

View File

@@ -1,35 +0,0 @@
--
-- Core I/O - Pocket Central I/O Management
--
local psil = require("scada-common.psil")
local coreio = {}
---@class pocket_core_io
local io = {
ps = psil.create()
}
---@enum POCKET_LINK_STATE
local LINK_STATE = {
UNLINKED = 0,
SV_LINK_ONLY = 1,
API_LINK_ONLY = 2,
LINKED = 3
}
coreio.LINK_STATE = LINK_STATE
-- get the core PSIL
function coreio.core_ps()
return io.ps
end
-- set network link state
---@param state POCKET_LINK_STATE
function coreio.report_link_state(state)
io.ps.publish("link_state", state)
end
return coreio

106
pocket/iocontrol.lua Normal file
View File

@@ -0,0 +1,106 @@
--
-- I/O Control for Pocket Integration with Supervisor & Coordinator
--
local psil = require("scada-common.psil")
local types = require("scada-common.types")
local ALARM = types.ALARM
local iocontrol = {}
---@class pocket_ioctl
local io = {
ps = psil.create()
}
---@enum POCKET_LINK_STATE
local LINK_STATE = {
UNLINKED = 0,
SV_LINK_ONLY = 1,
API_LINK_ONLY = 2,
LINKED = 3
}
---@enum NAV_PAGE
local NAV_PAGE = {
HOME = 1,
UNITS = 2,
REACTORS = 3,
BOILERS = 4,
TURBINES = 5,
DIAG = 6,
D_ALARMS = 7
}
iocontrol.LINK_STATE = LINK_STATE
iocontrol.NAV_PAGE = NAV_PAGE
-- initialize facility-independent components of pocket iocontrol
---@param comms pocket_comms
function iocontrol.init_core(comms)
---@class pocket_ioctl_diag
io.diag = {}
-- alarm testing
io.diag.tone_test = {
test_1 = function (state) comms.diag__set_alarm_tone(1, state) end,
test_2 = function (state) comms.diag__set_alarm_tone(2, state) end,
test_3 = function (state) comms.diag__set_alarm_tone(3, state) end,
test_4 = function (state) comms.diag__set_alarm_tone(4, state) end,
test_5 = function (state) comms.diag__set_alarm_tone(5, state) end,
test_6 = function (state) comms.diag__set_alarm_tone(6, state) end,
test_7 = function (state) comms.diag__set_alarm_tone(7, state) end,
test_8 = function (state) comms.diag__set_alarm_tone(8, state) end,
stop_tones = function () comms.diag__set_alarm_tone(0, false) end,
test_breach = function (state) comms.diag__set_alarm(ALARM.ContainmentBreach, state) end,
test_rad = function (state) comms.diag__set_alarm(ALARM.ContainmentRadiation, state) end,
test_lost = function (state) comms.diag__set_alarm(ALARM.ReactorLost, state) end,
test_crit = function (state) comms.diag__set_alarm(ALARM.CriticalDamage, state) end,
test_dmg = function (state) comms.diag__set_alarm(ALARM.ReactorDamage, state) end,
test_overtemp = function (state) comms.diag__set_alarm(ALARM.ReactorOverTemp, state) end,
test_hightemp = function (state) comms.diag__set_alarm(ALARM.ReactorHighTemp, state) end,
test_wasteleak = function (state) comms.diag__set_alarm(ALARM.ReactorWasteLeak, state) end,
test_highwaste = function (state) comms.diag__set_alarm(ALARM.ReactorHighWaste, state) end,
test_rps = function (state) comms.diag__set_alarm(ALARM.RPSTransient, state) end,
test_rcs = function (state) comms.diag__set_alarm(ALARM.RCSTransient, state) end,
test_turbinet = function (state) comms.diag__set_alarm(ALARM.TurbineTrip, state) end,
stop_alarms = function () comms.diag__set_alarm(0, false) end,
get_tone_states = function () comms.diag__get_alarm_tones() end,
ready_warn = nil, ---@type graphics_element
tone_buttons = {},
alarm_buttons = {},
tone_indicators = {} -- indicators to update from supervisor tone states
}
---@class pocket_nav
io.nav = {
page = NAV_PAGE.HOME, ---@type NAV_PAGE
sub_pages = { NAV_PAGE.HOME, NAV_PAGE.UNITS, NAV_PAGE.REACTORS, NAV_PAGE.BOILERS, NAV_PAGE.TURBINES, NAV_PAGE.DIAG },
tasks = {}
}
-- add a task to be performed periodically while on a given page
---@param page NAV_PAGE page to add task to
---@param task function function to execute
function io.nav.register_task(page, task)
if io.nav.tasks[page] == nil then io.nav.tasks[page] = {} end
table.insert(io.nav.tasks[page], task)
end
end
-- initialize facility-dependent components of pocket iocontrol
function iocontrol.init_fac() end
-- set network link state
---@param state POCKET_LINK_STATE
function iocontrol.report_link_state(state) io.ps.publish("link_state", state) end
-- get the IO controller database
function iocontrol.get_db() return io end
return iocontrol

View File

@@ -2,29 +2,28 @@ local comms = require("scada-common.comms")
local log = require("scada-common.log") local log = require("scada-common.log")
local util = require("scada-common.util") local util = require("scada-common.util")
local coreio = require("pocket.coreio") local iocontrol = require("pocket.iocontrol")
local PROTOCOL = comms.PROTOCOL local PROTOCOL = comms.PROTOCOL
local DEVICE_TYPE = comms.DEVICE_TYPE local DEVICE_TYPE = comms.DEVICE_TYPE
local ESTABLISH_ACK = comms.ESTABLISH_ACK local ESTABLISH_ACK = comms.ESTABLISH_ACK
local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
-- local CAPI_TYPE = comms.CAPI_TYPE
local LINK_STATE = coreio.LINK_STATE local LINK_STATE = iocontrol.LINK_STATE
local pocket = {} local pocket = {}
-- pocket coordinator + supervisor communications -- pocket coordinator + supervisor communications
---@nodiscard ---@nodiscard
---@param version string pocket version ---@param version string pocket version
---@param modem table modem device ---@param nic nic network interface device
---@param pkt_channel integer pocket comms channel ---@param pkt_channel integer pocket comms channel
---@param svr_channel integer supervisor access channel ---@param svr_channel integer supervisor access channel
---@param crd_channel integer coordinator access channel ---@param crd_channel integer coordinator access channel
---@param range integer trusted device connection range ---@param range integer trusted device connection range
---@param sv_watchdog watchdog ---@param sv_watchdog watchdog
---@param api_watchdog watchdog ---@param api_watchdog watchdog
function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, range, sv_watchdog, api_watchdog) function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range, sv_watchdog, api_watchdog)
local self = { local self = {
sv = { sv = {
linked = false, linked = false,
@@ -47,13 +46,9 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
-- PRIVATE FUNCTIONS -- -- PRIVATE FUNCTIONS --
-- configure modem channels -- configure network channels
local function _conf_channels() nic.closeAll()
modem.closeAll() nic.open(pkt_channel)
modem.open(pkt_channel)
end
_conf_channels()
-- send a management packet to the supervisor -- send a management packet to the supervisor
---@param msg_type SCADA_MGMT_TYPE ---@param msg_type SCADA_MGMT_TYPE
@@ -65,7 +60,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
pkt.make(msg_type, msg) pkt.make(msg_type, msg)
s_pkt.make(self.sv.addr, self.sv.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable()) s_pkt.make(self.sv.addr, self.sv.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
modem.transmit(svr_channel, pkt_channel, s_pkt.raw_sendable()) nic.transmit(svr_channel, pkt_channel, s_pkt)
self.sv.seq_num = self.sv.seq_num + 1 self.sv.seq_num = self.sv.seq_num + 1
end end
@@ -79,24 +74,10 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
pkt.make(msg_type, msg) pkt.make(msg_type, msg)
s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable()) s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
modem.transmit(crd_channel, pkt_channel, s_pkt.raw_sendable()) nic.transmit(crd_channel, pkt_channel, s_pkt)
self.api.seq_num = self.api.seq_num + 1 self.api.seq_num = self.api.seq_num + 1
end end
-- send a packet to the coordinator API
-----@param msg_type CAPI_TYPE
-----@param msg table
-- local function _send_api(msg_type, msg)
-- local s_pkt = comms.scada_packet()
-- local pkt = comms.capi_packet()
-- pkt.make(msg_type, msg)
-- s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.COORD_API, pkt.raw_sendable())
-- modem.transmit(crd_channel, pkt_channel, s_pkt.raw_sendable())
-- self.api.seq_num = self.api.seq_num + 1
-- end
-- attempt supervisor connection establishment -- attempt supervisor connection establishment
local function _send_sv_establish() local function _send_sv_establish()
_send_sv(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT }) _send_sv(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
@@ -124,13 +105,6 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
---@class pocket_comms ---@class pocket_comms
local public = {} local public = {}
-- reconnect a newly connected modem
---@param new_modem table
function public.reconnect_modem(new_modem)
modem = new_modem
_conf_channels()
end
-- close connection to the supervisor -- close connection to the supervisor
function public.close_sv() function public.close_sv()
sv_watchdog.cancel() sv_watchdog.cancel()
@@ -158,7 +132,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
-- attempt to re-link if any of the dependent links aren't active -- attempt to re-link if any of the dependent links aren't active
function public.link_update() function public.link_update()
if not self.sv.linked then if not self.sv.linked then
coreio.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED)) iocontrol.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
if self.establish_delay_counter <= 0 then if self.establish_delay_counter <= 0 then
_send_sv_establish() _send_sv_establish()
@@ -167,7 +141,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
self.establish_delay_counter = self.establish_delay_counter - 1 self.establish_delay_counter = self.establish_delay_counter - 1
end end
elseif not self.api.linked then elseif not self.api.linked then
coreio.report_link_state(LINK_STATE.SV_LINK_ONLY) iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
if self.establish_delay_counter <= 0 then if self.establish_delay_counter <= 0 then
_send_api_establish() _send_api_establish()
@@ -177,10 +151,29 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
end end
else else
-- linked, all good! -- linked, all good!
coreio.report_link_state(LINK_STATE.LINKED) iocontrol.report_link_state(LINK_STATE.LINKED)
end end
end end
-- supervisor get active alarm tones
function public.diag__get_alarm_tones()
if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_TONE_GET, {}) end
end
-- supervisor test alarm tones by tone
---@param id TONE|0 tone ID, or 0 to stop all
---@param state boolean tone state
function public.diag__set_alarm_tone(id, state)
if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_TONE_SET, { id, state }) end
end
-- supervisor test alarm tones by alarm
---@param id ALARM|0 alarm ID, 0 to stop all
---@param state boolean alarm state
function public.diag__set_alarm(id, state)
if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_ALARM_SET, { id, state }) end
end
-- parse a packet -- parse a packet
---@param side string ---@param side string
---@param sender integer ---@param sender integer
@@ -189,13 +182,10 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
---@param distance integer ---@param distance integer
---@return mgmt_frame|capi_frame|nil packet ---@return mgmt_frame|capi_frame|nil packet
function public.parse_packet(side, sender, reply_to, message, distance) function public.parse_packet(side, sender, reply_to, message, distance)
local s_pkt = nic.receive(side, sender, reply_to, message, distance)
local pkt = nil local pkt = nil
local s_pkt = comms.scada_packet()
-- parse packet as generic SCADA packet if s_pkt then
s_pkt.receive(side, sender, reply_to, message, distance)
if s_pkt.is_valid() then
-- get as SCADA management packet -- get as SCADA management packet
if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then
local mgmt_pkt = comms.mgmt_packet() local mgmt_pkt = comms.mgmt_packet()
@@ -219,6 +209,8 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
-- handle a packet -- handle a packet
---@param packet mgmt_frame|capi_frame|nil ---@param packet mgmt_frame|capi_frame|nil
function public.handle_packet(packet) function public.handle_packet(packet)
local diag = iocontrol.get_db().diag
if packet ~= nil then if packet ~= nil then
local l_chan = packet.scada_frame.local_channel() local l_chan = packet.scada_frame.local_channel()
local r_chan = packet.scada_frame.remote_channel() local r_chan = packet.scada_frame.remote_channel()
@@ -245,47 +237,9 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
-- feed watchdog on valid sequence number -- feed watchdog on valid sequence number
api_watchdog.feed() api_watchdog.feed()
if protocol == PROTOCOL.COORD_API then if protocol == PROTOCOL.SCADA_MGMT then
---@cast packet capi_frame
elseif protocol == PROTOCOL.SCADA_MGMT then
---@cast packet mgmt_frame ---@cast packet mgmt_frame
if packet.type == SCADA_MGMT_TYPE.ESTABLISH then if self.api.linked then
-- connection with coordinator established
if packet.length == 1 then
local est_ack = packet.data[1]
if est_ack == ESTABLISH_ACK.ALLOW then
log.info("coordinator connection established")
self.establish_delay_counter = 0
self.api.linked = true
self.api.addr = src_addr
if self.sv.linked then
coreio.report_link_state(LINK_STATE.LINKED)
else
coreio.report_link_state(LINK_STATE.API_LINK_ONLY)
end
elseif est_ack == ESTABLISH_ACK.DENY then
if self.api.last_est_ack ~= est_ack then
log.info("coordinator connection denied")
end
elseif est_ack == ESTABLISH_ACK.COLLISION then
if self.api.last_est_ack ~= est_ack then
log.info("coordinator connection denied due to collision")
end
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
if self.api.last_est_ack ~= est_ack then
log.info("coordinator comms version mismatch")
end
else
log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
end
self.api.last_est_ack = est_ack
else
log.debug("coordinator SCADA_MGMT establish packet length mismatch")
end
elseif self.api.linked then
if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-- keep alive request received, echo back -- keep alive request received, echo back
if packet.length == 1 then if packet.length == 1 then
@@ -312,6 +266,42 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
else else
log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from coordinator") log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from coordinator")
end end
elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
-- connection with coordinator established
if packet.length == 1 then
local est_ack = packet.data[1]
if est_ack == ESTABLISH_ACK.ALLOW then
log.info("coordinator connection established")
self.establish_delay_counter = 0
self.api.linked = true
self.api.addr = src_addr
if self.sv.linked then
iocontrol.report_link_state(LINK_STATE.LINKED)
else
iocontrol.report_link_state(LINK_STATE.API_LINK_ONLY)
end
elseif est_ack == ESTABLISH_ACK.DENY then
if self.api.last_est_ack ~= est_ack then
log.info("coordinator connection denied")
end
elseif est_ack == ESTABLISH_ACK.COLLISION then
if self.api.last_est_ack ~= est_ack then
log.info("coordinator connection denied due to collision")
end
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
if self.api.last_est_ack ~= est_ack then
log.info("coordinator comms version mismatch")
end
else
log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
end
self.api.last_est_ack = est_ack
else
log.debug("coordinator SCADA_MGMT establish packet length mismatch")
end
else else
log.debug("discarding coordinator non-link SCADA_MGMT packet before linked") log.debug("discarding coordinator non-link SCADA_MGMT packet before linked")
end end
@@ -339,43 +329,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
-- handle packet -- handle packet
if protocol == PROTOCOL.SCADA_MGMT then if protocol == PROTOCOL.SCADA_MGMT then
---@cast packet mgmt_frame ---@cast packet mgmt_frame
if packet.type == SCADA_MGMT_TYPE.ESTABLISH then if self.sv.linked then
-- connection with supervisor established
if packet.length == 1 then
local est_ack = packet.data[1]
if est_ack == ESTABLISH_ACK.ALLOW then
log.info("supervisor connection established")
self.establish_delay_counter = 0
self.sv.linked = true
self.sv.addr = src_addr
if self.api.linked then
coreio.report_link_state(LINK_STATE.LINKED)
else
coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
end
elseif est_ack == ESTABLISH_ACK.DENY then
if self.sv.last_est_ack ~= est_ack then
log.info("supervisor connection denied")
end
elseif est_ack == ESTABLISH_ACK.COLLISION then
if self.sv.last_est_ack ~= est_ack then
log.info("supervisor connection denied due to collision")
end
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
if self.sv.last_est_ack ~= est_ack then
log.info("supervisor comms version mismatch")
end
else
log.debug("supervisor SCADA_MGMT establish packet reply unsupported")
end
self.sv.last_est_ack = est_ack
else
log.debug("supervisor SCADA_MGMT establish packet length mismatch")
end
elseif self.sv.linked then
if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-- keep alive request received, echo back -- keep alive request received, echo back
if packet.length == 1 then if packet.length == 1 then
@@ -399,9 +353,90 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
self.sv.r_seq_num = nil self.sv.r_seq_num = nil
self.sv.addr = comms.BROADCAST self.sv.addr = comms.BROADCAST
log.info("supervisor server connection closed by remote host") log.info("supervisor server connection closed by remote host")
elseif packet.type == SCADA_MGMT_TYPE.DIAG_TONE_GET then
if packet.length == 8 then
for i = 1, #packet.data do
diag.tone_test.tone_indicators[i].update(packet.data[i] == true)
end
else
log.debug("supervisor SCADA diag alarm states packet length mismatch")
end
elseif packet.type == SCADA_MGMT_TYPE.DIAG_TONE_SET then
if packet.length == 1 and packet.data[1] == false then
diag.tone_test.ready_warn.set_value("testing denied")
log.debug("supervisor SCADA diag tone set failed")
elseif packet.length == 2 and type(packet.data[2]) == "table" then
local ready = packet.data[1]
local states = packet.data[2]
diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
for i = 1, #states do
if diag.tone_test.tone_buttons[i] ~= nil then
diag.tone_test.tone_buttons[i].set_value(states[i] == true)
diag.tone_test.tone_indicators[i].update(states[i] == true)
end
end
else
log.debug("supervisor SCADA diag tone set packet length/type mismatch")
end
elseif packet.type == SCADA_MGMT_TYPE.DIAG_ALARM_SET then
if packet.length == 1 and packet.data[1] == false then
diag.tone_test.ready_warn.set_value("testing denied")
log.debug("supervisor SCADA diag alarm set failed")
elseif packet.length == 2 and type(packet.data[2]) == "table" then
local ready = packet.data[1]
local states = packet.data[2]
diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
for i = 1, #states do
if diag.tone_test.alarm_buttons[i] ~= nil then
diag.tone_test.alarm_buttons[i].set_value(states[i] == true)
end
end
else
log.debug("supervisor SCADA diag alarm set packet length/type mismatch")
end
else else
log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from supervisor") log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from supervisor")
end end
elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
-- connection with supervisor established
if packet.length == 1 then
local est_ack = packet.data[1]
if est_ack == ESTABLISH_ACK.ALLOW then
log.info("supervisor connection established")
self.establish_delay_counter = 0
self.sv.linked = true
self.sv.addr = src_addr
if self.api.linked then
iocontrol.report_link_state(LINK_STATE.LINKED)
else
iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
end
elseif est_ack == ESTABLISH_ACK.DENY then
if self.sv.last_est_ack ~= est_ack then
log.info("supervisor connection denied")
end
elseif est_ack == ESTABLISH_ACK.COLLISION then
if self.sv.last_est_ack ~= est_ack then
log.info("supervisor connection denied due to collision")
end
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
if self.sv.last_est_ack ~= est_ack then
log.info("supervisor comms version mismatch")
end
else
log.debug("supervisor SCADA_MGMT establish packet reply unsupported")
end
self.sv.last_est_ack = est_ack
else
log.debug("supervisor SCADA_MGMT establish packet length mismatch")
end
else else
log.debug("discarding supervisor non-link SCADA_MGMT packet before linked") log.debug("discarding supervisor non-link SCADA_MGMT packet before linked")
end end

View File

@@ -6,6 +6,7 @@ require("/initenv").init_env()
local crash = require("scada-common.crash") local crash = require("scada-common.crash")
local log = require("scada-common.log") local log = require("scada-common.log")
local network = require("scada-common.network")
local ppm = require("scada-common.ppm") local ppm = require("scada-common.ppm")
local tcd = require("scada-common.tcd") local tcd = require("scada-common.tcd")
local util = require("scada-common.util") local util = require("scada-common.util")
@@ -13,11 +14,11 @@ local util = require("scada-common.util")
local core = require("graphics.core") local core = require("graphics.core")
local config = require("pocket.config") local config = require("pocket.config")
local coreio = require("pocket.coreio") local iocontrol = require("pocket.iocontrol")
local pocket = require("pocket.pocket") local pocket = require("pocket.pocket")
local renderer = require("pocket.renderer") local renderer = require("pocket.renderer")
local POCKET_VERSION = "alpha-v0.4.4" local POCKET_VERSION = "v0.6.0-alpha"
local println = util.println local println = util.println
local println_ts = util.println_ts local println_ts = util.println_ts
@@ -67,7 +68,12 @@ local function main()
-- setup communications & clocks -- setup communications & clocks
---------------------------------------- ----------------------------------------
coreio.report_link_state(coreio.LINK_STATE.UNLINKED) -- message authentication init
if type(config.AUTH_KEY) == "string" then
network.init_mac(config.AUTH_KEY)
end
iocontrol.report_link_state(iocontrol.LINK_STATE.UNLINKED)
-- get the communications modem -- get the communications modem
local modem = ppm.get_wireless_modem() local modem = ppm.get_wireless_modem()
@@ -88,8 +94,9 @@ local function main()
log.debug("startup> conn watchdogs created") log.debug("startup> conn watchdogs created")
-- start comms, open all channels -- create network interface then setup comms
local pocket_comms = pocket.comms(POCKET_VERSION, modem, config.PKT_CHANNEL, config.SVR_CHANNEL, local nic = network.nic(modem)
local pocket_comms = pocket.comms(POCKET_VERSION, nic, config.PKT_CHANNEL, config.SVR_CHANNEL,
config.CRD_CHANNEL, config.TRUSTED_RANGE, conn_wd.sv, conn_wd.api) config.CRD_CHANNEL, config.TRUSTED_RANGE, conn_wd.sv, conn_wd.api)
log.debug("startup> comms init") log.debug("startup> comms init")
@@ -97,6 +104,9 @@ local function main()
local MAIN_CLOCK = 0.5 local MAIN_CLOCK = 0.5
local loop_clock = util.new_clock(MAIN_CLOCK) local loop_clock = util.new_clock(MAIN_CLOCK)
-- init I/O control
iocontrol.init_core(pocket_comms)
---------------------------------------- ----------------------------------------
-- start the UI -- start the UI
---------------------------------------- ----------------------------------------
@@ -105,7 +115,7 @@ local function main()
if not ui_ok then if not ui_ok then
renderer.close_ui() renderer.close_ui()
println(util.c("UI error: ", message)) println(util.c("UI error: ", message))
log.error(util.c("startup> GUI crashed with error ", message)) log.error(util.c("startup> GUI render failed with error ", message))
else else
-- start clock -- start clock
loop_clock.start() loop_clock.start()
@@ -121,6 +131,9 @@ local function main()
conn_wd.api.feed() conn_wd.api.feed()
log.debug("startup> conn watchdog started") log.debug("startup> conn watchdog started")
local io_db = iocontrol.get_db()
local nav = io_db.nav
-- main event loop -- main event loop
while true do while true do
local event, param1, param2, param3, param4, param5 = util.pull_event() local event, param1, param2, param3, param4, param5 = util.pull_event()
@@ -133,6 +146,13 @@ local function main()
-- relink if necessary -- relink if necessary
pocket_comms.link_update() pocket_comms.link_update()
-- update any tasks for the active page
if (type(nav.tasks[nav.page]) == "table") then
for i = 1, #nav.tasks[nav.page] do
nav.tasks[nav.page][i]()
end
end
loop_clock.start() loop_clock.start()
elseif conn_wd.sv.is_timer(param1) then elseif conn_wd.sv.is_timer(param1) then
-- supervisor watchdog timeout -- supervisor watchdog timeout

View File

@@ -2,17 +2,18 @@
-- Pocket GUI Root -- Pocket GUI Root
-- --
local coreio = require("pocket.coreio") local iocontrol = require("pocket.iocontrol")
local style = require("pocket.ui.style") local style = require("pocket.ui.style")
local conn_waiting = require("pocket.ui.components.conn_waiting") local conn_waiting = require("pocket.ui.components.conn_waiting")
local home_page = require("pocket.ui.pages.home_page")
local unit_page = require("pocket.ui.pages.unit_page")
local reactor_page = require("pocket.ui.pages.reactor_page")
local boiler_page = require("pocket.ui.pages.boiler_page") local boiler_page = require("pocket.ui.pages.boiler_page")
local diag_page = require("pocket.ui.pages.diag_page")
local home_page = require("pocket.ui.pages.home_page")
local reactor_page = require("pocket.ui.pages.reactor_page")
local turbine_page = require("pocket.ui.pages.turbine_page") local turbine_page = require("pocket.ui.pages.turbine_page")
local unit_page = require("pocket.ui.pages.unit_page")
local core = require("graphics.core") local core = require("graphics.core")
@@ -22,6 +23,9 @@ local TextBox = require("graphics.elements.textbox")
local Sidebar = require("graphics.elements.controls.sidebar") local Sidebar = require("graphics.elements.controls.sidebar")
local LINK_STATE = iocontrol.LINK_STATE
local NAV_PAGE = iocontrol.NAV_PAGE
local TEXT_ALIGN = core.TEXT_ALIGN local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair local cpair = core.cpair
@@ -29,6 +33,9 @@ local cpair = core.cpair
-- create new main view -- create new main view
---@param main graphics_element main displaybox ---@param main graphics_element main displaybox
local function init(main) local function init(main)
local nav = iocontrol.get_db().nav
local ps = iocontrol.get_db().ps
-- window header message -- window header message
TextBox{parent=main,y=1,text="",alignment=TEXT_ALIGN.LEFT,height=1,fg_bg=style.header} TextBox{parent=main,y=1,text="",alignment=TEXT_ALIGN.LEFT,height=1,fg_bg=style.header}
@@ -45,10 +52,10 @@ local function init(main)
local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes=root_panes} local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes=root_panes}
root_pane.register(coreio.core_ps(), "link_state", function (state) root_pane.register(ps, "link_state", function (state)
if state == coreio.LINK_STATE.UNLINKED or state == coreio.LINK_STATE.API_LINK_ONLY then if state == LINK_STATE.UNLINKED or state == LINK_STATE.API_LINK_ONLY then
root_pane.set_value(1) root_pane.set_value(1)
elseif state == coreio.LINK_STATE.SV_LINK_ONLY then elseif state == LINK_STATE.SV_LINK_ONLY then
root_pane.set_value(2) root_pane.set_value(2)
else else
root_pane.set_value(3) root_pane.set_value(3)
@@ -81,19 +88,36 @@ local function init(main)
{ {
char = "T", char = "T",
color = cpair(colors.black,colors.white) color = cpair(colors.black,colors.white)
},
{
char = "D",
color = cpair(colors.black,colors.orange)
} }
} }
local pane_1 = home_page(page_div) local panes = { home_page(page_div), unit_page(page_div), reactor_page(page_div), boiler_page(page_div), turbine_page(page_div), diag_page(page_div) }
local pane_2 = unit_page(page_div)
local pane_3 = reactor_page(page_div)
local pane_4 = boiler_page(page_div)
local pane_5 = turbine_page(page_div)
local panes = { pane_1, pane_2, pane_3, pane_4, pane_5 }
local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes} local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=page_pane.set_value} local function navigate_sidebar(page)
if page == 1 then
nav.page = nav.sub_pages[NAV_PAGE.HOME]
elseif page == 2 then
nav.page = nav.sub_pages[NAV_PAGE.UNITS]
elseif page == 3 then
nav.page = nav.sub_pages[NAV_PAGE.REACTORS]
elseif page == 4 then
nav.page = nav.sub_pages[NAV_PAGE.BOILERS]
elseif page == 5 then
nav.page = nav.sub_pages[NAV_PAGE.TURBINES]
elseif page == 6 then
nav.page = nav.sub_pages[NAV_PAGE.DIAG]
end
page_pane.set_value(page)
end
Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=navigate_sidebar}
end end
return init return init

View File

@@ -0,0 +1,147 @@
local iocontrol = require("pocket.iocontrol")
local core = require("graphics.core")
local Div = require("graphics.elements.div")
local MultiPane = require("graphics.elements.multipane")
local TextBox = require("graphics.elements.textbox")
local IndicatorLight = require("graphics.elements.indicators.light")
local App = require("graphics.elements.controls.app")
local Checkbox = require("graphics.elements.controls.checkbox")
local PushButton = require("graphics.elements.controls.push_button")
local SwitchButton = require("graphics.elements.controls.switch_button")
local cpair = core.cpair
local NAV_PAGE = iocontrol.NAV_PAGE
local TEXT_ALIGN = core.TEXT_ALIGN
-- new diagnostics page view
---@param root graphics_element parent
local function new_view(root)
local db = iocontrol.get_db()
local main = Div{parent=root,x=1,y=1}
local diag_home = Div{parent=main,x=1,y=1}
TextBox{parent=diag_home,text="Diagnostic Apps",x=1,y=2,height=1,alignment=TEXT_ALIGN.CENTER}
local alarm_test = Div{parent=main,x=1,y=1}
local panes = { diag_home, alarm_test }
local page_pane = MultiPane{parent=main,x=1,y=1,panes=panes}
local function navigate_diag()
page_pane.set_value(1)
db.nav.page = NAV_PAGE.DIAG
db.nav.sub_pages[NAV_PAGE.DIAG] = NAV_PAGE.DIAG
end
local function navigate_alarm()
page_pane.set_value(2)
db.nav.page = NAV_PAGE.D_ALARMS
db.nav.sub_pages[NAV_PAGE.DIAG] = NAV_PAGE.D_ALARMS
end
------------------------
-- Alarm Testing Page --
------------------------
db.nav.register_task(NAV_PAGE.D_ALARMS, db.diag.tone_test.get_tone_states)
local ttest = db.diag.tone_test
local c_wht_gray = cpair(colors.white, colors.gray)
local c_red_gray = cpair(colors.red, colors.gray)
local c_yel_gray = cpair(colors.yellow, colors.gray)
local c_blue_gray = cpair(colors.blue, colors.gray)
local audio = Div{parent=alarm_test,x=1,y=1}
TextBox{parent=audio,y=1,text="Alarm Sounder Tests",height=1,alignment=TEXT_ALIGN.CENTER}
ttest.ready_warn = TextBox{parent=audio,y=2,text="",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.yellow,colors.black)}
PushButton{parent=audio,x=13,y=18,text="\x11 BACK",min_width=8,fg_bg=cpair(colors.black,colors.lightGray),active_fg_bg=c_wht_gray,callback=navigate_diag}
local tones = Div{parent=audio,x=2,y=3,height=10,width=8,fg_bg=cpair(colors.black,colors.yellow)}
TextBox{parent=tones,text="Tones",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
local test_btns = {}
test_btns[1] = SwitchButton{parent=tones,text="TEST 1",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_1}
test_btns[2] = SwitchButton{parent=tones,text="TEST 2",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_2}
test_btns[3] = SwitchButton{parent=tones,text="TEST 3",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_3}
test_btns[4] = SwitchButton{parent=tones,text="TEST 4",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_4}
test_btns[5] = SwitchButton{parent=tones,text="TEST 5",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_5}
test_btns[6] = SwitchButton{parent=tones,text="TEST 6",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_6}
test_btns[7] = SwitchButton{parent=tones,text="TEST 7",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_7}
test_btns[8] = SwitchButton{parent=tones,text="TEST 8",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_8}
ttest.tone_buttons = test_btns
local function stop_all_tones()
for i = 1, #test_btns do test_btns[i].set_value(false) end
ttest.stop_tones()
end
PushButton{parent=tones,text="STOP",min_width=8,active_fg_bg=c_wht_gray,fg_bg=cpair(colors.black,colors.red),callback=stop_all_tones}
local alarms = Div{parent=audio,x=11,y=3,height=15,fg_bg=cpair(colors.lightGray,colors.black)}
TextBox{parent=alarms,text="Alarms (\x13)",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
local alarm_btns = {}
alarm_btns[1] = Checkbox{parent=alarms,label="BREACH",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_breach}
alarm_btns[2] = Checkbox{parent=alarms,label="RADIATION",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_rad}
alarm_btns[3] = Checkbox{parent=alarms,label="RCT LOST",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_lost}
alarm_btns[4] = Checkbox{parent=alarms,label="CRIT DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_crit}
alarm_btns[5] = Checkbox{parent=alarms,label="DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_dmg}
alarm_btns[6] = Checkbox{parent=alarms,label="OVER TEMP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_overtemp}
alarm_btns[7] = Checkbox{parent=alarms,label="HIGH TEMP",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_hightemp}
alarm_btns[8] = Checkbox{parent=alarms,label="WASTE LEAK",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_wasteleak}
alarm_btns[9] = Checkbox{parent=alarms,label="WASTE HIGH",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_highwaste}
alarm_btns[10] = Checkbox{parent=alarms,label="RPS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rps}
alarm_btns[11] = Checkbox{parent=alarms,label="RCS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rcs}
alarm_btns[12] = Checkbox{parent=alarms,label="TURBINE TRP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_turbinet}
ttest.alarm_buttons = alarm_btns
local function stop_all_alarms()
for i = 1, #alarm_btns do alarm_btns[i].set_value(false) end
ttest.stop_alarms()
end
PushButton{parent=alarms,x=3,y=15,text="STOP \x13",min_width=8,fg_bg=cpair(colors.black,colors.red),active_fg_bg=c_wht_gray,callback=stop_all_alarms}
local states = Div{parent=audio,x=2,y=14,height=5,width=8}
TextBox{parent=states,text="States",height=1,alignment=TEXT_ALIGN.CENTER}
local t_1 = IndicatorLight{parent=states,label="1",colors=c_blue_gray}
local t_2 = IndicatorLight{parent=states,label="2",colors=c_blue_gray}
local t_3 = IndicatorLight{parent=states,label="3",colors=c_blue_gray}
local t_4 = IndicatorLight{parent=states,label="4",colors=c_blue_gray}
local t_5 = IndicatorLight{parent=states,x=6,y=2,label="5",colors=c_blue_gray}
local t_6 = IndicatorLight{parent=states,x=6,label="6",colors=c_blue_gray}
local t_7 = IndicatorLight{parent=states,x=6,label="7",colors=c_blue_gray}
local t_8 = IndicatorLight{parent=states,x=6,label="8",colors=c_blue_gray}
ttest.tone_indicators = { t_1, t_2, t_3, t_4, t_5, t_6, t_7, t_8 }
--------------
-- App List --
--------------
App{parent=diag_home,x=3,y=4,text="\x0f",title="Alarm",callback=navigate_alarm,app_fg_bg=cpair(colors.black,colors.red),active_fg_bg=cpair(colors.white,colors.gray)}
App{parent=diag_home,x=10,y=4,text="\x1e",title="LoopT",callback=function()end,app_fg_bg=cpair(colors.black,colors.cyan)}
App{parent=diag_home,x=17,y=4,text="@",title="Comps",callback=function()end,app_fg_bg=cpair(colors.black,colors.orange)}
return main
end
return new_view

View File

@@ -1,20 +1,21 @@
-- local style = require("pocket.ui.style")
local core = require("graphics.core") local core = require("graphics.core")
local Div = require("graphics.elements.div") local Div = require("graphics.elements.div")
local TextBox = require("graphics.elements.textbox")
-- local cpair = core.cpair local App = require("graphics.elements.controls.app")
local TEXT_ALIGN = core.TEXT_ALIGN local cpair = core.cpair
-- new home page view -- new home page view
---@param root graphics_element parent ---@param root graphics_element parent
local function new_view(root) local function new_view(root)
local main = Div{parent=root,x=1,y=1} local main = Div{parent=root,x=1,y=1}
TextBox{parent=main,text="HOME",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER} App{parent=main,x=3,y=2,text="\x17",title="PRC",callback=function()end,app_fg_bg=cpair(colors.black,colors.purple)}
App{parent=main,x=10,y=2,text="\x15",title="CTL",callback=function()end,app_fg_bg=cpair(colors.black,colors.green)}
App{parent=main,x=17,y=2,text="\x08",title="DEV",callback=function()end,app_fg_bg=cpair(colors.black,colors.lightGray)}
App{parent=main,x=3,y=7,text="\x7f",title="Waste",callback=function()end,app_fg_bg=cpair(colors.black,colors.brown)}
App{parent=main,x=10,y=7,text="\xb6",title="Guide",callback=function()end,app_fg_bg=cpair(colors.black,colors.cyan)}
return main return main
end end

View File

@@ -17,6 +17,10 @@ config.PLC_CHANNEL = 16241
config.TRUSTED_RANGE = 0 config.TRUSTED_RANGE = 0
-- time in seconds (>= 2) before assuming a remote device is no longer active -- time in seconds (>= 2) before assuming a remote device is no longer active
config.COMMS_TIMEOUT = 5 config.COMMS_TIMEOUT = 5
-- facility authentication key (do NOT use one of your passwords)
-- this enables verifying that messages are authentic
-- all devices on the same network must use the same key
-- config.AUTH_KEY = "SCADAfacility123"
-- log path -- log path
config.LOG_PATH = "/log.txt" config.LOG_PATH = "/log.txt"

View File

@@ -1,5 +1,5 @@
-- --
-- Main SCADA Coordinator GUI -- Reactor PLC Front Panel GUI
-- --
local types = require("scada-common.types") local types = require("scada-common.types")
@@ -28,7 +28,7 @@ local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair local cpair = core.cpair
local border = core.border local border = core.border
-- create new main view -- create new front panel view
---@param panel graphics_element main displaybox ---@param panel graphics_element main displaybox
local function init(panel) local function init(panel)
local header = TextBox{parent=panel,y=1,text="REACTOR PLC - UNIT ?",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header} local header = TextBox{parent=panel,y=1,text="REACTOR PLC - UNIT ?",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}

View File

@@ -12,6 +12,7 @@ local cpair = core.cpair
-- remap global colors -- remap global colors
colors.ivory = colors.pink colors.ivory = colors.pink
colors.yellow_hc = colors.purple
colors.red_off = colors.brown colors.red_off = colors.brown
colors.yellow_off = colors.magenta colors.yellow_off = colors.magenta
colors.green_off = colors.lime colors.green_off = colors.lime
@@ -28,7 +29,7 @@ style.colors = {
{ c = colors.cyan, hex = 0x34bac8 }, { c = colors.cyan, hex = 0x34bac8 },
{ c = colors.lightBlue, hex = 0x6cc0f2 }, { c = colors.lightBlue, hex = 0x6cc0f2 },
{ c = colors.blue, hex = 0x0096ff }, { c = colors.blue, hex = 0x0096ff },
{ c = colors.purple, hex = 0xb156ee }, { c = colors.purple, hex = 0xb156ee }, -- YELLOW HIGH CONTRAST
{ c = colors.pink, hex = 0xdcd9ca }, -- IVORY { c = colors.pink, hex = 0xdcd9ca }, -- IVORY
{ c = colors.magenta, hex = 0x85862c }, -- YELLOW OFF { c = colors.magenta, hex = 0x85862c }, -- YELLOW OFF
-- { c = colors.white, hex = 0xdcd9ca }, -- { c = colors.white, hex = 0xdcd9ca },

View File

@@ -445,14 +445,14 @@ end
---@nodiscard ---@nodiscard
---@param id integer reactor ID ---@param id integer reactor ID
---@param version string PLC version ---@param version string PLC version
---@param modem table modem device ---@param nic nic network interface device
---@param plc_channel integer PLC comms channel ---@param plc_channel integer PLC comms channel
---@param svr_channel integer supervisor server channel ---@param svr_channel integer supervisor server channel
---@param range integer trusted device connection range ---@param range integer trusted device connection range
---@param reactor table reactor device ---@param reactor table reactor device
---@param rps rps RPS reference ---@param rps rps RPS reference
---@param conn_watchdog watchdog watchdog reference ---@param conn_watchdog watchdog watchdog reference
function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor, rps, conn_watchdog) function plc.comms(id, version, nic, plc_channel, svr_channel, range, reactor, rps, conn_watchdog)
local self = { local self = {
sv_addr = comms.BROADCAST, sv_addr = comms.BROADCAST,
seq_num = 0, seq_num = 0,
@@ -470,13 +470,9 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
-- PRIVATE FUNCTIONS -- -- PRIVATE FUNCTIONS --
-- configure modem channels -- configure network channels
local function _conf_channels() nic.closeAll()
modem.closeAll() nic.open(plc_channel)
modem.open(plc_channel)
end
_conf_channels()
-- send an RPLC packet -- send an RPLC packet
---@param msg_type RPLC_TYPE ---@param msg_type RPLC_TYPE
@@ -488,7 +484,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
r_pkt.make(id, msg_type, msg) r_pkt.make(id, msg_type, msg)
s_pkt.make(self.sv_addr, self.seq_num, PROTOCOL.RPLC, r_pkt.raw_sendable()) s_pkt.make(self.sv_addr, self.seq_num, PROTOCOL.RPLC, r_pkt.raw_sendable())
modem.transmit(svr_channel, plc_channel, s_pkt.raw_sendable()) nic.transmit(svr_channel, plc_channel, s_pkt)
self.seq_num = self.seq_num + 1 self.seq_num = self.seq_num + 1
end end
@@ -502,7 +498,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
m_pkt.make(msg_type, msg) m_pkt.make(msg_type, msg)
s_pkt.make(self.sv_addr, self.seq_num, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable()) s_pkt.make(self.sv_addr, self.seq_num, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
modem.transmit(svr_channel, plc_channel, s_pkt.raw_sendable()) nic.transmit(svr_channel, plc_channel, s_pkt)
self.seq_num = self.seq_num + 1 self.seq_num = self.seq_num + 1
end end
@@ -639,7 +635,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
parallel.waitForAll(table.unpack(tasks)) parallel.waitForAll(table.unpack(tasks))
if not reactor.__p_is_faulted() then if reactor.__p_is_ok() then
_send(RPLC_TYPE.MEK_STRUCT, mek_data) _send(RPLC_TYPE.MEK_STRUCT, mek_data)
self.resend_build = false self.resend_build = false
end end
@@ -650,13 +646,6 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
---@class plc_comms ---@class plc_comms
local public = {} local public = {}
-- reconnect a newly connected modem
---@param new_modem table
function public.reconnect_modem(new_modem)
modem = new_modem
_conf_channels()
end
-- reconnect a newly connected reactor -- reconnect a newly connected reactor
---@param new_reactor table ---@param new_reactor table
function public.reconnect_reactor(new_reactor) function public.reconnect_reactor(new_reactor)
@@ -743,13 +732,10 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
---@param distance integer ---@param distance integer
---@return rplc_frame|mgmt_frame|nil packet ---@return rplc_frame|mgmt_frame|nil packet
function public.parse_packet(side, sender, reply_to, message, distance) function public.parse_packet(side, sender, reply_to, message, distance)
local s_pkt = nic.receive(side, sender, reply_to, message, distance)
local pkt = nil local pkt = nil
local s_pkt = comms.scada_packet()
-- parse packet as generic SCADA packet if s_pkt then
s_pkt.receive(side, sender, reply_to, message, distance)
if s_pkt.is_valid() then
-- get as RPLC packet -- get as RPLC packet
if s_pkt.protocol() == PROTOCOL.RPLC then if s_pkt.protocol() == PROTOCOL.RPLC then
local rplc_pkt = comms.rplc_packet() local rplc_pkt = comms.rplc_packet()
@@ -836,7 +822,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
success = true success = true
else else
reactor.setBurnRate(burn_rate) reactor.setBurnRate(burn_rate)
success = not reactor.__p_is_faulted() success = reactor.__p_is_ok()
end end
else else
log.debug(burn_rate .. " rate outside of 0 < x <= " .. self.max_burn_rate) log.debug(burn_rate .. " rate outside of 0 < x <= " .. self.max_burn_rate)
@@ -943,47 +929,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
---@cast packet mgmt_frame ---@cast packet mgmt_frame
-- if linked, only accept packets from configured supervisor -- if linked, only accept packets from configured supervisor
if self.linked then if self.linked then
if packet.type == SCADA_MGMT_TYPE.ESTABLISH then if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-- link request confirmation
if packet.length == 1 then
log.debug("received unsolicited establish response")
local est_ack = packet.data[1]
if est_ack == ESTABLISH_ACK.ALLOW then
self.status_cache = nil
_send_struct()
public.send_status(plc_state.no_reactor, plc_state.reactor_formed)
log.debug("re-sent initial status data due to re-establish")
else
if est_ack == ESTABLISH_ACK.DENY then
println_ts("received unsolicited link denial, unlinking")
log.warning("unsolicited establish request denied")
elseif est_ack == ESTABLISH_ACK.COLLISION then
println_ts("received unsolicited link collision, unlinking")
log.warning("unsolicited establish request collision")
elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
println_ts("received unsolicited link version mismatch, unlinking")
log.warning("unsolicited establish request version mismatch")
else
println_ts("invalid unsolicited link response")
log.debug("unsolicited unknown establish request response")
end
-- unlink
self.sv_addr = comms.BROADCAST
self.linked = false
end
-- clear this since this is for something that was unsolicited
self.last_est_ack = ESTABLISH_ACK.ALLOW
-- report link state
databus.tx_link_state(est_ack + 1)
else
log.debug("SCADA_MGMT establish packet length mismatch")
end
elseif packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-- keep alive request received, echo back -- keep alive request received, echo back
if packet.length == 1 and type(packet.data[1]) == "number" then if packet.length == 1 and type(packet.data[1]) == "number" then
local timestamp = packet.data[1] local timestamp = packet.data[1]

View File

@@ -8,6 +8,7 @@ local comms = require("scada-common.comms")
local crash = require("scada-common.crash") local crash = require("scada-common.crash")
local log = require("scada-common.log") local log = require("scada-common.log")
local mqueue = require("scada-common.mqueue") local mqueue = require("scada-common.mqueue")
local network = require("scada-common.network")
local ppm = require("scada-common.ppm") local ppm = require("scada-common.ppm")
local rsio = require("scada-common.rsio") local rsio = require("scada-common.rsio")
local util = require("scada-common.util") local util = require("scada-common.util")
@@ -18,7 +19,7 @@ local plc = require("reactor-plc.plc")
local renderer = require("reactor-plc.renderer") local renderer = require("reactor-plc.renderer")
local threads = require("reactor-plc.threads") local threads = require("reactor-plc.threads")
local R_PLC_VERSION = "v1.4.5" local R_PLC_VERSION = "v1.5.6"
local println = util.println local println = util.println
local println_ts = util.println_ts local println_ts = util.println_ts
@@ -79,6 +80,11 @@ local function main()
-- mount connected devices -- mount connected devices
ppm.mount_all() ppm.mount_all()
-- message authentication init
if type(config.AUTH_KEY) == "string" then
network.init_mac(config.AUTH_KEY)
end
-- shared memory across threads -- shared memory across threads
---@class plc_shared_memory ---@class plc_shared_memory
local __shared_memory = { local __shared_memory = {
@@ -91,10 +97,10 @@ local function main()
init_ok = true, init_ok = true,
fp_ok = false, fp_ok = false,
shutdown = false, shutdown = false,
degraded = false, degraded = true,
reactor_formed = true, reactor_formed = true,
no_reactor = false, no_reactor = true,
no_modem = false no_modem = true
}, },
-- control setpoints -- control setpoints
@@ -113,6 +119,7 @@ local function main()
-- system objects -- system objects
plc_sys = { plc_sys = {
rps = nil, ---@type rps rps = nil, ---@type rps
nic = nil, ---@type nic
plc_comms = nil, ---@type plc_comms plc_comms = nil, ---@type plc_comms
conn_watchdog = nil ---@type watchdog conn_watchdog = nil ---@type watchdog
}, },
@@ -130,14 +137,17 @@ local function main()
local plc_state = __shared_memory.plc_state local plc_state = __shared_memory.plc_state
-- initial state evaluation
plc_state.no_reactor = smem_dev.reactor == nil
plc_state.no_modem = smem_dev.modem == nil
-- we need a reactor, can at least do some things even if it isn't formed though -- we need a reactor, can at least do some things even if it isn't formed though
if smem_dev.reactor == nil then if plc_state.no_reactor then
println("init> fission reactor not found"); println("init> fission reactor not found");
log.warning("init> no reactor on startup") log.warning("init> no reactor on startup")
plc_state.init_ok = false plc_state.init_ok = false
plc_state.degraded = true plc_state.degraded = true
plc_state.no_reactor = true
elseif not smem_dev.reactor.isFormed() then elseif not smem_dev.reactor.isFormed() then
println("init> fission reactor not formed"); println("init> fission reactor not formed");
log.warning("init> reactor logic adapter present, but reactor is not formed") log.warning("init> reactor logic adapter present, but reactor is not formed")
@@ -147,7 +157,7 @@ local function main()
end end
-- modem is required if networked -- modem is required if networked
if __shared_memory.networked and smem_dev.modem == nil then if __shared_memory.networked and plc_state.no_modem then
println("init> wireless modem not found") println("init> wireless modem not found")
log.warning("init> no wireless modem on startup") log.warning("init> no wireless modem on startup")
@@ -158,7 +168,6 @@ local function main()
plc_state.init_ok = false plc_state.init_ok = false
plc_state.degraded = true plc_state.degraded = true
plc_state.no_modem = true
end end
-- print a log message to the terminal as long as the UI isn't running -- print a log message to the terminal as long as the UI isn't running
@@ -181,7 +190,7 @@ local function main()
renderer.close_ui() renderer.close_ui()
println_ts(util.c("UI error: ", message)) println_ts(util.c("UI error: ", message))
println("init> running without front panel") println("init> running without front panel")
log.error(util.c("GUI crashed with error ", message)) log.error(util.c("front panel GUI render failed with error ", message))
log.info("init> running in headless mode without front panel") log.info("init> running in headless mode without front panel")
end end
end end
@@ -196,8 +205,9 @@ local function main()
smem_sys.conn_watchdog = util.new_watchdog(config.COMMS_TIMEOUT) smem_sys.conn_watchdog = util.new_watchdog(config.COMMS_TIMEOUT)
log.debug("init> conn watchdog started") log.debug("init> conn watchdog started")
-- start comms -- create network interface then setup comms
smem_sys.plc_comms = plc.comms(config.REACTOR_ID, R_PLC_VERSION, smem_dev.modem, config.PLC_CHANNEL, config.SVR_CHANNEL, smem_sys.nic = network.nic(smem_dev.modem)
smem_sys.plc_comms = plc.comms(config.REACTOR_ID, R_PLC_VERSION, smem_sys.nic, config.PLC_CHANNEL, config.SVR_CHANNEL,
config.TRUSTED_RANGE, smem_dev.reactor, smem_sys.rps, smem_sys.conn_watchdog) config.TRUSTED_RANGE, smem_dev.reactor, smem_sys.rps, smem_sys.conn_watchdog)
log.debug("init> comms init") log.debug("init> comms init")
else else

View File

@@ -59,6 +59,7 @@ function threads.thread__main(smem, init)
while true do while true do
-- get plc_sys fields (may have been set late due to degraded boot) -- get plc_sys fields (may have been set late due to degraded boot)
local rps = smem.plc_sys.rps local rps = smem.plc_sys.rps
local nic = smem.plc_sys.nic
local plc_comms = smem.plc_sys.plc_comms local plc_comms = smem.plc_sys.plc_comms
local conn_watchdog = smem.plc_sys.conn_watchdog local conn_watchdog = smem.plc_sys.conn_watchdog
@@ -66,6 +67,7 @@ function threads.thread__main(smem, init)
-- handle event -- handle event
if event == "timer" and loop_clock.is_clock(param1) then if event == "timer" and loop_clock.is_clock(param1) then
-- note: loop clock is only running if init_ok = true
-- blink heartbeat indicator -- blink heartbeat indicator
databus.heartbeat() databus.heartbeat()
@@ -75,7 +77,7 @@ function threads.thread__main(smem, init)
loop_clock.start() loop_clock.start()
-- send updated data -- send updated data
if not plc_state.no_modem then if nic.is_connected() then
if plc_comms.is_linked() then if plc_comms.is_linked() then
smem.q.mq_comms_tx.push_command(MQ__COMM_CMD.SEND_STATUS) smem.q.mq_comms_tx.push_command(MQ__COMM_CMD.SEND_STATUS)
else else
@@ -114,7 +116,7 @@ function threads.thread__main(smem, init)
smem.q.mq_rps.push_command(MQ__RPS_CMD.SCRAM) smem.q.mq_rps.push_command(MQ__RPS_CMD.SCRAM)
-- determine if we are still in a degraded state -- determine if we are still in a degraded state
if not networked or not plc_state.no_modem then if (not networked) or nic.is_connected() then
plc_state.degraded = false plc_state.degraded = false
end end
@@ -144,7 +146,7 @@ function threads.thread__main(smem, init)
-- update indicators -- update indicators
databus.tx_hw_status(plc_state) databus.tx_hw_status(plc_state)
elseif event == "modem_message" and networked and plc_state.init_ok and not plc_state.no_modem then elseif event == "modem_message" and networked and plc_state.init_ok and nic.is_connected() then
-- got a packet -- got a packet
local packet = plc_comms.parse_packet(param1, param2, param3, param4, param5) local packet = plc_comms.parse_packet(param1, param2, param3, param4, param5)
if packet ~= nil then if packet ~= nil then
@@ -163,7 +165,7 @@ function threads.thread__main(smem, init)
local type, device = ppm.handle_unmount(param1) local type, device = ppm.handle_unmount(param1)
if type ~= nil and device ~= nil then if type ~= nil and device ~= nil then
if type == "fissionReactorLogicAdapter" then if device == plc_dev.reactor then
println_ts("reactor disconnected!") println_ts("reactor disconnected!")
log.error("reactor logic adapter disconnected") log.error("reactor logic adapter disconnected")
@@ -171,18 +173,25 @@ function threads.thread__main(smem, init)
plc_state.degraded = true plc_state.degraded = true
elseif networked and type == "modem" then elseif networked and type == "modem" then
-- we only care if this is our wireless modem -- we only care if this is our wireless modem
if device == plc_dev.modem then if nic.is_modem(device) then
println_ts("comms modem disconnected!") nic.disconnect()
log.error("comms modem disconnected")
println_ts("comms modem disconnected!")
log.warning("comms modem disconnected")
local other_modem = ppm.get_wireless_modem()
if other_modem then
log.info("found another wireless modem, using it for comms")
nic.connect(other_modem)
else
plc_state.no_modem = true plc_state.no_modem = true
plc_state.degraded = true
if plc_state.init_ok then if plc_state.init_ok then
-- try to scram reactor if it is still connected -- try to scram reactor if it is still connected
smem.q.mq_rps.push_command(MQ__RPS_CMD.DEGRADED_SCRAM) smem.q.mq_rps.push_command(MQ__RPS_CMD.DEGRADED_SCRAM)
end end
end
plc_state.degraded = true
else else
log.warning("non-comms modem disconnected") log.warning("non-comms modem disconnected")
end end
@@ -196,15 +205,14 @@ function threads.thread__main(smem, init)
local type, device = ppm.mount(param1) local type, device = ppm.mount(param1)
if type ~= nil and device ~= nil then if type ~= nil and device ~= nil then
if type == "fissionReactorLogicAdapter" then if plc_state.no_reactor and (type == "fissionReactorLogicAdapter") then
-- reconnected reactor -- reconnected reactor
plc_dev.reactor = device plc_dev.reactor = device
plc_state.no_reactor = false
println_ts("reactor reconnected.") println_ts("reactor reconnected.")
log.info("reactor reconnected") log.info("reactor reconnected")
plc_state.no_reactor = false
-- we need to assume formed here as we cannot check in this main loop -- we need to assume formed here as we cannot check in this main loop
-- RPS will identify if it isn't and this will get set false later -- RPS will identify if it isn't and this will get set false later
plc_state.reactor_formed = true plc_state.reactor_formed = true
@@ -227,22 +235,22 @@ function threads.thread__main(smem, init)
rps.reset() rps.reset()
end end
elseif networked and type == "modem" then elseif networked and type == "modem" then
if device.isWireless() then if device.isWireless() and not nic.is_connected() then
-- reconnected modem -- reconnected modem
plc_dev.modem = device plc_dev.modem = device
plc_state.no_modem = false
if plc_state.init_ok then if plc_state.init_ok then nic.connect(device) end
plc_comms.reconnect_modem(plc_dev.modem)
end
println_ts("wireless modem reconnected.") println_ts("wireless modem reconnected.")
log.info("comms modem reconnected") log.info("comms modem reconnected")
plc_state.no_modem = false
-- determine if we are still in a degraded state -- determine if we are still in a degraded state
if not plc_state.no_reactor then if not plc_state.no_reactor then
plc_state.degraded = false plc_state.degraded = false
end end
elseif device.isWireless() then
log.info("unused wireless modem reconnected")
else else
log.info("wired modem reconnected") log.info("wired modem reconnected")
end end
@@ -709,9 +717,7 @@ function threads.thread__setpoint_control(smem)
end end
-- if ramping completed or was aborted, reset last burn setpoint so that if it is requested again it will be re-attempted -- if ramping completed or was aborted, reset last burn setpoint so that if it is requested again it will be re-attempted
if not setpoints.burn_rate_en then if not setpoints.burn_rate_en then last_burn_sp = 0 end
last_burn_sp = 0
end
end end
-- check for termination request -- check for termination request

View File

@@ -10,6 +10,14 @@ config.RTU_CHANNEL = 16242
config.TRUSTED_RANGE = 0 config.TRUSTED_RANGE = 0
-- time in seconds (>= 2) before assuming a remote device is no longer active -- time in seconds (>= 2) before assuming a remote device is no longer active
config.COMMS_TIMEOUT = 5 config.COMMS_TIMEOUT = 5
-- facility authentication key (do NOT use one of your passwords)
-- this enables verifying that messages are authentic
-- all devices on the same network must use the same key
-- config.AUTH_KEY = "SCADAfacility123"
-- alarm sounder volume (0.0 to 3.0, 1.0 being standard max volume, this is the option given to to speaker.play())
-- note: alarm sine waves are at half saturation, so that multiple will be required to reach full scale
config.SOUNDER_VOLUME = 1.0
-- log path -- log path
config.LOG_PATH = "/log.txt" config.LOG_PATH = "/log.txt"

View File

@@ -37,6 +37,12 @@ function databus.tx_hw_modem(has_modem)
databus.ps.publish("has_modem", has_modem) databus.ps.publish("has_modem", has_modem)
end end
-- transmit the number of speakers connected
---@param count integer
function databus.tx_hw_spkr_count(count)
databus.ps.publish("speaker_count", count)
end
-- transmit unit hardware type across the bus -- transmit unit hardware type across the bus
---@param uid integer unit ID ---@param uid integer unit ID
---@param type RTU_UNIT_TYPE ---@param type RTU_UNIT_TYPE

View File

@@ -2,7 +2,7 @@ local rtu = require("rtu.rtu")
local boilerv_rtu = {} local boilerv_rtu = {}
-- create new boiler (mek 10.1+) device -- create new boiler device
---@nodiscard ---@nodiscard
---@param boiler table ---@param boiler table
---@return rtu_device interface, boolean faulted ---@return rtu_device interface, boolean faulted
@@ -10,6 +10,7 @@ function boilerv_rtu.new(boiler)
local unit = rtu.init_unit() local unit = rtu.init_unit()
-- disable auto fault clearing -- disable auto fault clearing
boiler.__p_clear_fault()
boiler.__p_disable_afc() boiler.__p_disable_afc()
-- discrete inputs -- -- discrete inputs --

48
rtu/dev/dynamicv_rtu.lua Normal file
View File

@@ -0,0 +1,48 @@
local rtu = require("rtu.rtu")
local dynamicv_rtu = {}
-- create new dynamic tank device
---@nodiscard
---@param dynamic_tank table
---@return rtu_device interface, boolean faulted
function dynamicv_rtu.new(dynamic_tank)
local unit = rtu.init_unit()
-- disable auto fault clearing
dynamic_tank.__p_clear_fault()
dynamic_tank.__p_disable_afc()
-- discrete inputs --
unit.connect_di(dynamic_tank.isFormed)
-- coils --
unit.connect_coil(function () dynamic_tank.incrementContainerEditMode() end, function () end)
unit.connect_coil(function () dynamic_tank.decrementContainerEditMode() end, function () end)
-- input registers --
-- multiblock properties
unit.connect_input_reg(dynamic_tank.getLength)
unit.connect_input_reg(dynamic_tank.getWidth)
unit.connect_input_reg(dynamic_tank.getHeight)
unit.connect_input_reg(dynamic_tank.getMinPos)
unit.connect_input_reg(dynamic_tank.getMaxPos)
-- build properties
unit.connect_input_reg(dynamic_tank.getTankCapacity)
unit.connect_input_reg(dynamic_tank.getChemicalTankCapacity)
-- tanks/containers
unit.connect_input_reg(dynamic_tank.getStored)
unit.connect_input_reg(dynamic_tank.getFilledPercentage)
-- holding registers --
unit.connect_holding_reg(dynamic_tank.getContainerEditMode, dynamic_tank.setContainerEditMode)
-- check if any calls faulted
local faulted = dynamic_tank.__p_is_faulted()
dynamic_tank.__p_clear_fault()
dynamic_tank.__p_enable_afc()
return unit.interface(), faulted
end
return dynamicv_rtu

View File

@@ -10,6 +10,7 @@ function envd_rtu.new(envd)
local unit = rtu.init_unit() local unit = rtu.init_unit()
-- disable auto fault clearing -- disable auto fault clearing
envd.__p_clear_fault()
envd.__p_disable_afc() envd.__p_disable_afc()
-- discrete inputs -- -- discrete inputs --

View File

@@ -10,6 +10,7 @@ function imatrix_rtu.new(imatrix)
local unit = rtu.init_unit() local unit = rtu.init_unit()
-- disable auto fault clearing -- disable auto fault clearing
imatrix.__p_clear_fault()
imatrix.__p_disable_afc() imatrix.__p_disable_afc()
-- discrete inputs -- -- discrete inputs --

View File

@@ -10,6 +10,7 @@ function sna_rtu.new(sna)
local unit = rtu.init_unit() local unit = rtu.init_unit()
-- disable auto fault clearing -- disable auto fault clearing
sna.__p_clear_fault()
sna.__p_disable_afc() sna.__p_disable_afc()
-- discrete inputs -- -- discrete inputs --

View File

@@ -10,6 +10,7 @@ function sps_rtu.new(sps)
local unit = rtu.init_unit() local unit = rtu.init_unit()
-- disable auto fault clearing -- disable auto fault clearing
sps.__p_clear_fault()
sps.__p_disable_afc() sps.__p_disable_afc()
-- discrete inputs -- -- discrete inputs --

View File

@@ -2,7 +2,7 @@ local rtu = require("rtu.rtu")
local turbinev_rtu = {} local turbinev_rtu = {}
-- create new turbine (mek 10.1+) device -- create new turbine device
---@nodiscard ---@nodiscard
---@param turbine table ---@param turbine table
---@return rtu_device interface, boolean faulted ---@return rtu_device interface, boolean faulted
@@ -10,6 +10,7 @@ function turbinev_rtu.new(turbine)
local unit = rtu.init_unit() local unit = rtu.init_unit()
-- disable auto fault clearing -- disable auto fault clearing
turbine.__p_clear_fault()
turbine.__p_disable_afc() turbine.__p_disable_afc()
-- discrete inputs -- -- discrete inputs --

View File

@@ -1,5 +1,5 @@
-- --
-- Main SCADA Coordinator GUI -- RTU Front Panel GUI
-- --
local types = require("scada-common.types") local types = require("scada-common.types")
@@ -14,6 +14,7 @@ local core = require("graphics.core")
local Div = require("graphics.elements.div") local Div = require("graphics.elements.div")
local TextBox = require("graphics.elements.textbox") local TextBox = require("graphics.elements.textbox")
local DataIndicator = require("graphics.elements.indicators.data")
local LED = require("graphics.elements.indicators.led") local LED = require("graphics.elements.indicators.led")
local RGBLED = require("graphics.elements.indicators.ledrgb") local RGBLED = require("graphics.elements.indicators.ledrgb")
@@ -21,19 +22,10 @@ local TEXT_ALIGN = core.TEXT_ALIGN
local cpair = core.cpair local cpair = core.cpair
local UNIT_TYPE_LABELS = { local UNIT_TYPE_LABELS = { "UNKNOWN", "REDSTONE", "BOILER", "TURBINE", "DYNAMIC TANK", "IND MATRIX", "SPS", "SNA", "ENV DETECTOR" }
"UNKNOWN",
"REDSTONE",
"BOILER",
"TURBINE",
"IND MATRIX",
"SPS",
"SNA",
"ENV DETECTOR"
}
-- create new main view -- create new front panel view
---@param panel graphics_element main displaybox ---@param panel graphics_element main displaybox
---@param units table unit list ---@param units table unit list
local function init(panel, units) local function init(panel, units)
@@ -71,6 +63,10 @@ local function init(panel, units)
local comp_id = util.sprintf("(%d)", os.getComputerID()) local comp_id = util.sprintf("(%d)", os.getComputerID())
TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)} TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)}
TextBox{parent=system,x=1,y=14,text="SPEAKERS",height=1,width=8,fg_bg=style.label}
local speaker_count = DataIndicator{parent=system,x=10,y=14,label="",format="%3d",value=0,width=3,fg_bg=cpair(colors.gray,colors.white)}
speaker_count.register(databus.ps, "speaker_count", speaker_count.update)
-- --
-- about label -- about label
-- --

Some files were not shown because too many files have changed in this diff Show More