Merge pull request #334 from MikaylaFischler/devel

2023.08.27 Release

.github/workflows/manifest.yml

@@ -1,5 +1,5 @@
-# Simple workflow for deploying static content to GitHub Pages
+# Deploy installation manifests and shields versions
-name: Deploy Installation Manifests and Versions
+name: Deploy Installation Data
 
 on:
   workflow_dispatch:

.gitignore

@@ -1,2 +1,2 @@
 _notes/
-program.sh
+/*program.sh

README.md

@@ -7,6 +7,29 @@ Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fi
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=latest&label=latest)
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=devel&label=devel)
 
+### [Join](https://discord.gg/R9NSCkhcwt) the Discord!
+
+![Discord](https://img.shields.io/discord/1129075839288496259)
+
+## Released Component Versions
+
+![Installer](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Finstaller.json)
+
+
+![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
+![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
+![Graphics](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fgraphics.json)
+![Lockbox](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Flockbox.json)
+
+
+![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
+![RTU](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Frtu.json)
+![Supervisor](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fsupervisor.json)
+![Coordinator](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcoordinator.json)
+![Pocket](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fpocket.json)
+
+## Requirements
+
 Mod Requirements:
 - CC: Tweaked
 - Mekanism v10.1+
@@ -16,32 +39,11 @@ Mod Recommendations:
 
 v10.1+ is required due the complete support of CC:Tweaked added in Mekanism v10.1
 
-There was also an apparent bug with boilers disconnecting and reconnecting when active in my test world on 10.0.24, so it may not even have been an option to fully implement this with support for 10.0.
-
-## Released Component Versions
-
-### Core
-
-![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
-![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
-
-### Utilities
-
-![Installer](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Finstaller.json)
-
-### Applications
-
-![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
-![RTU](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Frtu.json)
-![Supervisor](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fsupervisor.json)
-![Coordinator](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcoordinator.json)
-![Pocket](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fpocket.json)
-
 ## Installation
 
 You can install this on a ComputerCraft computer using either:
 * `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua`
-* `pastebin get eRz6cUNM ccmsi.lua`
+* `pastebin get sqUN6VUb ccmsi.lua`
 
 ## [SCADA](https://en.wikipedia.org/wiki/SCADA)
 > Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery.
@@ -86,14 +88,8 @@ A vaguely-modbus [modbus](https://en.wikipedia.org/wiki/Modbus) communication pr
 - Input Registers: Multi-Byte Read-Only (analog inputs)
 - Holding Registers: Multi-Byte Read/Write (analog I/O)
 
-### Security and Encryption
+### Security
 
-TBD, I am planning on AES symmetric encryption for security + HMAC to prevent replay attacks. This will be done utilizing this codebase: https://github.com/somesocks/lua-lockbox.
+HMAC message authentication is available as a configuration option to prevent replay attacks and generally prevent control or false data reporting within a system's network. This is done utilizing the [lua-lockbox](https://github.com/somesocks/lua-lockbox) project.
 
-This is somewhat important here as otherwise anyone can just control your setup, which is undeseriable. Unlike normal Minecraft PVP chaos, it would be very difficult to identify who is messing with your system, as with an Ender Modem they can do it from effectively anywhere and the server operators would have to check every computer's filesystem to find suspicious code. 
+The other, simpler security feature is to enforce a maximum authorized transmission range, which is also a configurable feature on each device.
-
-The other security mitigation for commanding (no effect on monitoring) is to enforce a maximum authorized transmission range, which has been added as a configurable feature.
-
-## Known Issues
-
-None yet since the switch to requiring 10.1+!

ccmsi.lua

@@ -1,8 +1,6 @@
---
--- ComputerCraft Mekanism SCADA System Installer Utility
---
-
 --[[
+CC-MEK-SCADA Installer Utility
+
 Copyright (c) 2023 Mikayla Fischler
 
 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and
@@ -20,30 +18,97 @@ SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
 local function println(message) print(tostring(message)) end
 local function print(message) term.write(tostring(message)) end
 
-local CCMSI_VERSION = "v1.2"
+local CCMSI_VERSION = "v1.9a"
 
 local install_dir = "/.install-cache"
 local manifest_path = "https://mikaylafischler.github.io/cc-mek-scada/manifests/"
 local repo_path = "http://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/"
 
 local opts = { ... }
-local mode = nil
+local mode, app, target
-local app = nil
+local install_manifest = manifest_path .. "main/install_manifest.json"
+
+local function red() term.setTextColor(colors.red) end
+local function orange() term.setTextColor(colors.orange) end
+local function yellow() term.setTextColor(colors.yellow) end
+local function green() term.setTextColor(colors.green) end
+local function blue() term.setTextColor(colors.blue) end
+local function white() term.setTextColor(colors.white) end
+local function lgray() term.setTextColor(colors.lightGray) end
+
+-- get command line option in list
+local function get_opt(opt, options)
+    for _, v in pairs(options) do if opt == v then return v end end
+    return nil
+end
+
+-- wait for any key to be pressed
+---@diagnostic disable-next-line: undefined-field
+local function any_key() os.pullEvent("key_up") end
+
+-- ask the user yes or no
+local function ask_y_n(question, default)
+    print(question)
+    if default == true then print(" (Y/n)? ") else print(" (y/N)? ") end
+    local response = read();any_key()
+    if response == "" then return default
+    elseif response == "Y" or response == "y" then return true
+    elseif response == "N" or response == "n" then return false
+    else return nil end
+end
+
+-- print out a white + blue text message
+local function pkg_message(message, package) white();print(message .. " ");blue();println(package);white() end
+
+-- indicate actions to be taken based on package differences for installs/updates
+local function show_pkg_change(name, v)
+    if v.v_local ~= nil then
+        if v.v_local ~= v.v_remote then
+            print("[" .. name .. "] updating ");blue();print(v.v_local);white();print(" \xbb ");blue();println(v.v_remote);white()
+        elseif mode == "install" then
+            pkg_message("[" .. name .. "] reinstalling", v.v_local)
+        end
+    else pkg_message("[" .. name .. "] new install of", v.v_remote) end
+    return v.v_local ~= v.v_remote
+end
+
+-- read the local manifest file
+local function read_local_manifest()
+    local local_ok = false
+    local local_manifest = {}
+    local imfile = fs.open("install_manifest.json", "r")
+    if imfile ~= nil then
+        local_ok, local_manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
+        imfile.close()
+    end
+    return local_ok, local_manifest
+end
+
+-- get the manifest from GitHub
+local function get_remote_manifest()
+    local response, error = http.get(install_manifest)
+    if response == nil then
+        orange();println("Failed to get installation manifest from GitHub, cannot update or install.")
+        red();println("HTTP error: " .. error);white()
+        return false, {}
+    end
+
+    local ok, manifest = pcall(function () return textutils.unserializeJSON(response.readAll()) end)
+    if not ok then red();println("error parsing remote installation manifest");white() end
+
+    return ok, manifest
+end
 
 -- record the local installation manifest
----@param manifest table
----@param dependencies table
 local function write_install_manifest(manifest, dependencies)
     local versions = {}
     for key, value in pairs(manifest.versions) do
         local is_dependency = false
         for _, dependency in pairs(dependencies) do
-            if key == "bootloader" and dependency == "system" then
+            if (key == "bootloader" and dependency == "system") or key == dependency then
-                is_dependency = true
+                is_dependency = true;break
-                break
             end
         end
-
         if key == app or key == "comms" or is_dependency then versions[key] = value end
     end
 
@@ -54,116 +119,141 @@ local function write_install_manifest(manifest, dependencies)
     imfile.close()
 end
 
---
+-- recursively build a tree out of the file manifest
+local function gen_tree(manifest)
+    local function _tree_add(tree, split)
+        if #split > 1 then
+            local name = table.remove(split, 1)
+            if tree[name] == nil then tree[name] = {} end
+            table.insert(tree[name], _tree_add(tree[name], split))
+        else return split[1] end
+        return nil
+    end
+
+    local list, tree = {}, {}
+
+    -- make a list of each and every file
+    for _, files in pairs(manifest.files) do for i = 1, #files do table.insert(list, files[i]) end end
+
+    for i = 1, #list do
+        local split = {}
+        string.gsub(list[i], "([^/]+)", function(c) split[#split + 1] = c end)
+        if #split == 1 then table.insert(tree, list[i])
+        else table.insert(tree, _tree_add(tree, split)) end
+    end
+
+    return tree
+end
+
+local function _in_array(val, array)
+    for _, v in pairs(array) do if v == val then return true end end
+    return false
+end
+
+local function _clean_dir(dir, tree)
+    if tree == nil then tree = {} end
+    local ls = fs.list(dir)
+    for _, val in pairs(ls) do
+        local path = dir .. "/" .. val
+        if fs.isDir(path) then
+            _clean_dir(path, tree[val])
+            if #fs.list(path) == 0 then fs.delete(path);println("deleted " .. path) end
+        elseif not _in_array(val, tree) then
+            fs.delete(path)
+            println("deleted " .. path)
+        end
+    end
+end
+
+-- go through app/common directories to delete unused files
+local function clean(manifest)
+    local root_ext = false
+    local tree = gen_tree(manifest)
+
+    table.insert(tree, "install_manifest.json")
+    table.insert(tree, "ccmsi.lua")
+    table.insert(tree, "log.txt")
+
+    lgray()
+
+    local ls = fs.list("/")
+    for _, val in pairs(ls) do
+        if fs.isDir(val) then
+            if tree[val] ~= nil then _clean_dir("/" .. val, tree[val]) end
+            if #fs.list(val) == 0 then fs.delete(val);println("deleted " .. val) end
+        elseif not _in_array(val, tree) then
+            root_ext = true
+            yellow();println(val .. " not used")
+        end
+    end
+
+    white()
+    if root_ext then println("Files in root directory won't be automatically deleted.") end
+end
+
 -- get and validate command line options
---
 
 println("-- CC Mekanism SCADA Installer " .. CCMSI_VERSION .. " --")
 
 if #opts == 0 or opts[1] == "help" then
-    println("usage: ccmsi <mode> <app> <tag/branch>")
+    println("usage: ccmsi <mode> <app> <branch>")
     println("<mode>")
-    term.setTextColor(colors.lightGray)
+    lgray()
     println(" check       - check latest versions avilable")
-    term.setTextColor(colors.yellow)
+    yellow()
-    println("               ccmsi check <tag/branch> for target")
+    println("               ccmsi check <branch> for target")
-    term.setTextColor(colors.lightGray)
+    lgray()
     println(" install     - fresh install, overwrites config")
     println(" update      - update files EXCEPT for config/logs")
     println(" remove      - delete files EXCEPT for config/logs")
     println(" purge       - delete files INCLUDING config/logs")
-    term.setTextColor(colors.white)
+    white();println("<app>");lgray()
-    println("<app>")
-    term.setTextColor(colors.lightGray)
     println(" reactor-plc - reactor PLC firmware")
     println(" rtu         - RTU firmware")
     println(" supervisor  - supervisor server application")
     println(" coordinator - coordinator application")
     println(" pocket      - pocket application")
-    term.setTextColor(colors.white)
+    println(" installer   - ccmsi installer (update only)")
-    println("<tag/branch>")
+    white();println("<branch>")
-    term.setTextColor(colors.yellow)
+    lgray();println(" main (default) | latest | devel");white()
-    println(" second parameter when used with check")
-    term.setTextColor(colors.lightGray)
-    println(" note: defaults to main")
-    println(" target GitHub tag or branch name")
     return
 else
-    for _, v in pairs({ "check", "install", "update", "remove", "purge" }) do
+    mode = get_opt(opts[1], { "check", "install", "update", "remove", "purge" })
-        if opts[1] == v then
-            mode = v
-            break
-        end
-    end
-
     if mode == nil then
-        println("unrecognized mode")
+        red();println("Unrecognized mode.");white()
         return
     end
 
-    for _, v in pairs({ "reactor-plc", "rtu", "supervisor", "coordinator", "pocket" }) do
+    app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket", "installer" })
-        if opts[2] == v then
-            app = v
-            break
-        end
-    end
-
     if app == nil and mode ~= "check" then
-        println("unrecognized application")
+        red();println("Unrecognized application.");white()
+        return
+    elseif app == "installer" and mode ~= "update" then
+        red();println("Installer app only supports 'update' option.");white()
         return
     end
+
+    -- determine target
+    if mode == "check" then target = opts[2] else target = opts[3] end
+    if (target ~= "main") and (target ~= "latest") and (target ~= "devel") then
+        if (target and target ~= "") then yellow();println("Unknown target, defaulting to 'main'");white() end
+        target = "main"
+    end
+
+    -- set paths
+    install_manifest = manifest_path .. target .. "/install_manifest.json"
+    repo_path = repo_path .. target .. "/"
 end
 
---
 -- run selected mode
---
 
 if mode == "check" then
-    -------------------------
+    local ok, manifest = get_remote_manifest()
-    -- GET REMOTE MANIFEST --
+    if not ok then return end
-    -------------------------
-
-    if opts[2] then manifest_path = manifest_path .. opts[2] .. "/" else manifest_path = manifest_path .. "main/" end
-    local install_manifest = manifest_path .. "install_manifest.json"
-
-    local response, error = http.get(install_manifest)
-
-    if response == nil then
-        term.setTextColor(colors.orange)
-        println("failed to get installation manifest from GitHub, cannot update or install")
-        term.setTextColor(colors.red)
-        println("HTTP error: " .. error)
-        term.setTextColor(colors.white)
-        return
-    end
-
-    local ok, manifest = pcall(function () return textutils.unserializeJSON(response.readAll()) end)
-
-    if not ok then
-        term.setTextColor(colors.red)
-        println("error parsing remote installation manifest")
-        term.setTextColor(colors.white)
-        return
-    end
-
-    ------------------------
-    -- GET LOCAL MANIFEST --
-    ------------------------
-
-    local imfile = fs.open("install_manifest.json", "r")
-    local local_ok = false
-    local local_manifest = {}
-
-    if imfile ~= nil then
-        local_ok, local_manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
-        imfile.close()
-    end
 
+    local local_ok, local_manifest = read_local_manifest()
     if not local_ok then
-        term.setTextColor(colors.yellow)
+        yellow();println("failed to load local installation information");white()
-        println("failed to load local installation information")
-        term.setTextColor(colors.white)
-
         local_manifest = { versions = { installer = CCMSI_VERSION } }
     else
         local_manifest.versions.installer = CCMSI_VERSION
@@ -174,190 +264,107 @@ if mode == "check" then
         term.setTextColor(colors.purple)
         print(string.format("%-14s", "[" .. key .. "]"))
         if key == "installer" or (local_ok and (local_manifest.versions[key] ~= nil)) then
-            term.setTextColor(colors.blue)
+            blue();print(local_manifest.versions[key])
-            print(local_manifest.versions[key])
             if value ~= local_manifest.versions[key] then
-                term.setTextColor(colors.white)
+                white();print(" (")
-                print(" (")
                 term.setTextColor(colors.cyan)
-                print(value)
+                print(value);white();println(" available)")
-                term.setTextColor(colors.white)
+            else green();println(" (up to date)") end
-                println(" available)")
-            else
-                term.setTextColor(colors.green)
-                println(" (up to date)")
-            end
         else
-            term.setTextColor(colors.lightGray)
+            lgray();print("not installed");white();print(" (latest ")
-            print("not installed")
-            term.setTextColor(colors.white)
-            print(" (latest ")
             term.setTextColor(colors.cyan)
-            print(value)
+            print(value);white();println(")")
-            term.setTextColor(colors.white)
-            println(")")
         end
     end
+
+    if manifest.versions.installer ~= local_manifest.versions.installer then
+        yellow();println("\nA newer version of the installer is available, it is recommended to update (use 'ccmsi update installer').");white()
+    end
 elseif mode == "install" or mode == "update" then
-    -------------------------
+    local update_installer = app == "installer"
-    -- GET REMOTE MANIFEST --
+    local ok, manifest = get_remote_manifest()
-    -------------------------
+    if not ok then return end
 
-    if opts[3] then repo_path = repo_path .. opts[3] .. "/" else repo_path = repo_path .. "main/" end
+    local ver = {
-    if opts[3] then manifest_path = manifest_path .. opts[3] .. "/" else manifest_path = manifest_path .. "main/" end
+        app = { v_local = nil, v_remote = nil, changed = false },
-    local install_manifest = manifest_path .. "install_manifest.json"
+        boot = { v_local = nil, v_remote = nil, changed = false },
+        comms = { v_local = nil, v_remote = nil, changed = false },
+        common = { v_local = nil, v_remote = nil, changed = false },
+        graphics = { v_local = nil, v_remote = nil, changed = false },
+        lockbox = { v_local = nil, v_remote = nil, changed = false }
+    }
 
-    local response, error = http.get(install_manifest)
+    -- try to find local versions
+    local local_ok, lmnf = read_local_manifest()
+    if not local_ok then
+        if mode == "update" then
+            red();println("Failed to load local installation information, cannot update.");white()
+            return
+        end
+    elseif not update_installer then
+        ver.boot.v_local = lmnf.versions.bootloader
+        ver.app.v_local = lmnf.versions[app]
+        ver.comms.v_local = lmnf.versions.comms
+        ver.common.v_local = lmnf.versions.common
+        ver.graphics.v_local = lmnf.versions.graphics
+        ver.lockbox.v_local = lmnf.versions.lockbox
 
-    if response == nil then
+        if lmnf.versions[app] == nil then
-        term.setTextColor(colors.orange)
+            red();println("Another application is already installed, please purge it before installing a new application.");white()
-        println("failed to get installation manifest from GitHub, cannot update or install")
+            return
-        term.setTextColor(colors.red)
+        end
-        println("HTTP error: " .. error)
+    end
-        term.setTextColor(colors.white)
+
+    if manifest.versions.installer ~= CCMSI_VERSION then
+        if not update_installer then yellow();println("A newer version of the installer is available, it is recommended to update to it.");white() end
+        if update_installer or ask_y_n("Would you like to update now") then
+            lgray();println("GET ccmsi.lua")
+            local dl, err = http.get(repo_path .. "ccmsi.lua")
+
+            if dl == nil then
+                red();println("HTTP Error " .. err)
+                println("Installer download failed.");white()
+            else
+                local handle = fs.open(debug.getinfo(1, "S").source:sub(2), "w") -- this file, regardless of name or location
+                handle.write(dl.readAll())
+                handle.close()
+                green();println("Installer updated successfully.");white()
+            end
+
+            return
+        end
+    elseif update_installer then
+        green();println("Installer already up-to-date.");white()
         return
     end
 
-    local ok, manifest = pcall(function () return textutils.unserializeJSON(response.readAll()) end)
+    ver.boot.v_remote = manifest.versions.bootloader
+    ver.app.v_remote = manifest.versions[app]
+    ver.comms.v_remote = manifest.versions.comms
+    ver.common.v_remote = manifest.versions.common
+    ver.graphics.v_remote = manifest.versions.graphics
+    ver.lockbox.v_remote = manifest.versions.lockbox
 
-    if not ok then
+    green()
-        term.setTextColor(colors.red)
-        println("error parsing remote installation manifest")
-        term.setTextColor(colors.white)
-    end
-
-    ------------------------
-    -- GET LOCAL MANIFEST --
-    ------------------------
-
-    local imfile = fs.open("install_manifest.json", "r")
-    local local_ok = false
-    local local_manifest = {}
-
-    if imfile ~= nil then
-        local_ok, local_manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
-        imfile.close()
-    end
-
-    local local_app_version = nil
-    local local_comms_version = nil
-    local local_boot_version = nil
-
-    -- try to find local versions
-    if not local_ok then
-        if mode == "update" then
-            term.setTextColor(colors.red)
-            println("failed to load local installation information, cannot update")
-            term.setTextColor(colors.white)
-            return
-        end
-    else
-        local_app_version = local_manifest.versions[app]
-        local_comms_version = local_manifest.versions.comms
-        local_boot_version = local_manifest.versions.bootloader
-
-        if local_manifest.versions[app] == nil then
-            term.setTextColor(colors.red)
-            println("another application is already installed, please purge it before installing a new application")
-            term.setTextColor(colors.white)
-            return
-        end
-
-        local_manifest.versions.installer = CCMSI_VERSION
-        if manifest.versions.installer ~= CCMSI_VERSION then
-            term.setTextColor(colors.yellow)
-            println("a newer version of the installer is available, consider downloading it")
-            term.setTextColor(colors.white)
-        end
-    end
-
-    local remote_app_version = manifest.versions[app]
-    local remote_comms_version = manifest.versions.comms
-    local remote_boot_version = manifest.versions.bootloader
-
-    term.setTextColor(colors.green)
     if mode == "install" then
-        println("installing " .. app .. " files...")
+        println("Installing " .. app .. " files...")
     elseif mode == "update" then
-        println("updating " .. app .. " files... (keeping old config.lua)")
+        println("Updating " .. app .. " files... (keeping old config.lua)")
     end
-    term.setTextColor(colors.white)
+    white()
 
-    -- display bootloader version change information
+    ver.boot.changed = show_pkg_change("bootldr", ver.boot)
-    if local_boot_version ~= nil then
+    ver.common.changed = show_pkg_change("common", ver.common)
-        if local_boot_version ~= remote_boot_version then
+    ver.comms.changed = show_pkg_change("comms", ver.comms)
-            print("[bootldr] updating ")
+    if ver.comms.changed and ver.comms.v_local ~= nil then
-            term.setTextColor(colors.blue)
+        print("[comms] ");yellow();println("other devices on the network will require an update");white()
-            print(local_boot_version)
-            term.setTextColor(colors.white)
-            print(" \xbb ")
-            term.setTextColor(colors.blue)
-            println(remote_boot_version)
-            term.setTextColor(colors.white)
-        elseif mode == "install" then
-            print("[bootldr] reinstalling ")
-            term.setTextColor(colors.blue)
-            println(local_boot_version)
-            term.setTextColor(colors.white)
-        end
-    else
-        print("[bootldr] new install of ")
-        term.setTextColor(colors.blue)
-        println(remote_boot_version)
-        term.setTextColor(colors.white)
     end
+    ver.app.changed = show_pkg_change(app, ver.app)
+    ver.graphics.changed = show_pkg_change("graphics", ver.graphics)
+    ver.lockbox.changed = show_pkg_change("lockbox", ver.lockbox)
 
-    -- display app version change information
+    -- ask for confirmation
-    if local_app_version ~= nil then
+    if not ask_y_n("Continue", false) then return end
-        if local_app_version ~= remote_app_version then
-            print("[" .. app .. "] updating ")
-            term.setTextColor(colors.blue)
-            print(local_app_version)
-            term.setTextColor(colors.white)
-            print(" \xbb ")
-            term.setTextColor(colors.blue)
-            println(remote_app_version)
-            term.setTextColor(colors.white)
-        elseif mode == "install" then
-            print("[" .. app .. "] reinstalling ")
-            term.setTextColor(colors.blue)
-            println(local_app_version)
-            term.setTextColor(colors.white)
-        end
-    else
-        print("[" .. app .. "] new install of ")
-        term.setTextColor(colors.blue)
-        println(remote_app_version)
-        term.setTextColor(colors.white)
-    end
-
-    -- display comms version change information
-    if local_comms_version ~= nil then
-        if local_comms_version ~= remote_comms_version then
-            print("[comms] updating ")
-            term.setTextColor(colors.blue)
-            print(local_comms_version)
-            term.setTextColor(colors.white)
-            print(" \xbb ")
-            term.setTextColor(colors.blue)
-            println(remote_comms_version)
-            term.setTextColor(colors.white)
-            print("[comms] ")
-            term.setTextColor(colors.yellow)
-            println("other devices on the network will require an update")
-            term.setTextColor(colors.white)
-        elseif mode == "install" then
-            print("[comms] reinstalling ")
-            term.setTextColor(colors.blue)
-            println(local_comms_version)
-            term.setTextColor(colors.white)
-        end
-    else
-        print("[comms] new install of ")
-        term.setTextColor(colors.blue)
-        println(remote_comms_version)
-        term.setTextColor(colors.white)
-    end
 
     --------------------------
     -- START INSTALL/UPDATE --
@@ -382,54 +389,45 @@ elseif mode == "install" or mode == "update" then
     -- check space constraints
     if space_available < space_required then
         single_file_mode = true
-        term.setTextColor(colors.yellow)
+        yellow();println("WARNING: Insufficient space available for a full download!");white()
-        println("WARNING: Insufficient space available for a full download!")
-        term.setTextColor(colors.white)
         println("Files can be downloaded one by one, so if you are replacing a current install this will not be a problem unless installation fails.")
-        println("Do you wish to continue? (y/N)")
+        if mode == "update" then println("If installation still fails, delete this device's log file or uninstall the app (not purge) and try again.") end
-
+        if not ask_y_n("Do you wish to continue", false) then
-        local confirm = read()
+            println("Operation cancelled.")
-        if confirm ~= "y" and confirm ~= "Y" then
-            println("installation cancelled")
             return
         end
     end
 
----@diagnostic disable-next-line: undefined-field
-    os.sleep(2)
-
     local success = true
 
+    -- helper function to check if a dependency is unchanged
+    local function unchanged(dependency)
+        if dependency == "system" then return not ver.boot.changed
+        elseif dependency == "graphics" then return not ver.graphics.changed
+        elseif dependency == "lockbox" then return not ver.lockbox.changed
+        elseif dependency == "common" then return not (ver.common.changed or ver.comms.changed)
+        elseif dependency == app then return not ver.app.changed
+        else return true end
+    end
+
     if not single_file_mode then
-        if fs.exists(install_dir) then
+        if fs.exists(install_dir) then fs.delete(install_dir);fs.makeDir(install_dir) end
-            fs.delete(install_dir)
-            fs.makeDir(install_dir)
-        end
 
         -- download all dependencies
         for _, dependency in pairs(dependencies) do
-            if mode == "update" and ((dependency == "system" and local_boot_version == remote_boot_version) or (local_app_version == remote_app_version)) then
+            if mode == "update" and unchanged(dependency) then
-                -- skip system package if unchanged, skip app package if not changed
+                pkg_message("skipping download of unchanged package", dependency)
-                -- skip packages that have no version if app version didn't change
-                term.setTextColor(colors.white)
-                print("skipping download of unchanged package ")
-                term.setTextColor(colors.blue)
-                println(dependency)
             else
-                term.setTextColor(colors.white)
+                pkg_message("downloading package", dependency)
-                print("downloading package ")
+                lgray()
-                term.setTextColor(colors.blue)
-                println(dependency)
 
-                term.setTextColor(colors.lightGray)
                 local files = file_list[dependency]
                 for _, file in pairs(files) do
                     println("GET " .. file)
                     local dl, err = http.get(repo_path .. file)
 
                     if dl == nil then
-                        term.setTextColor(colors.red)
+                        red();println("HTTP Error " .. err)
-                        println("GET HTTP Error " .. err)
                         success = false
                         break
                     else
@@ -444,20 +442,12 @@ elseif mode == "install" or mode == "update" then
         -- copy in downloaded files (installation)
         if success then
             for _, dependency in pairs(dependencies) do
-                if mode == "update" and ((dependency == "system" and local_boot_version == remote_boot_version) or (local_app_version == remote_app_version)) then
+                if mode == "update" and unchanged(dependency) then
-                    -- skip system package if unchanged, skip app package if not changed
+                    pkg_message("skipping install of unchanged package", dependency)
-                    -- skip packages that have no version if app version didn't change
-                    term.setTextColor(colors.white)
-                    print("skipping install of unchanged package ")
-                    term.setTextColor(colors.blue)
-                    println(dependency)
                 else
-                    term.setTextColor(colors.white)
+                    pkg_message("installing package", dependency)
-                    print("installing package ")
+                    lgray()
-                    term.setTextColor(colors.blue)
-                    println(dependency)
 
-                    term.setTextColor(colors.lightGray)
                     local files = file_list[dependency]
                     for _, file in pairs(files) do
                         if mode == "install" or file ~= config_file then
@@ -473,41 +463,28 @@ elseif mode == "install" or mode == "update" then
         fs.delete(install_dir)
 
         if success then
-            -- if we made it here, then none of the file system functions threw exceptions
-            -- that means everything is OK
             write_install_manifest(manifest, dependencies)
-            term.setTextColor(colors.green)
+            green()
             if mode == "install" then
-                println("installation completed successfully")
+                println("Installation completed successfully.")
-            else
+            else println("Update completed successfully.") end
-                println("update completed successfully")
+            white();println("Ready to clean up unused files, press any key to continue...")
-            end
+            any_key();clean(manifest)
+            white();println("Done.")
         else
             if mode == "install" then
-                term.setTextColor(colors.red)
+                red();println("Installation failed.")
-                println("installation failed")
+            else orange();println("Update failed, existing files unmodified.") end
-            else
-                term.setTextColor(colors.orange)
-                println("update failed, existing files unmodified")
-            end
         end
     else
         -- go through all files and replace one by one
         for _, dependency in pairs(dependencies) do
-            if mode == "update" and ((dependency == "system" and local_boot_version == remote_boot_version) or (local_app_version == remote_app_version)) then
+            if mode == "update" and unchanged(dependency) then
-                -- skip system package if unchanged, skip app package if not changed
+                pkg_message("skipping install of unchanged package", dependency)
-                -- skip packages that have no version if app version didn't change
-                term.setTextColor(colors.white)
-                print("skipping install of unchanged package ")
-                term.setTextColor(colors.blue)
-                println(dependency)
             else
-                term.setTextColor(colors.white)
+                pkg_message("installing package", dependency)
-                print("installing package ")
+                lgray()
-                term.setTextColor(colors.blue)
-                println(dependency)
 
-                term.setTextColor(colors.lightGray)
                 local files = file_list[dependency]
                 for _, file in pairs(files) do
                     if mode == "install" or file ~= config_file then
@@ -515,7 +492,7 @@ elseif mode == "install" or mode == "update" then
                         local dl, err = http.get(repo_path .. file)
 
                         if dl == nil then
-                            println("GET HTTP Error " .. err)
+                            red();println("HTTP Error " .. err)
                             success = false
                             break
                         else
@@ -529,55 +506,43 @@ elseif mode == "install" or mode == "update" then
         end
 
         if success then
-            -- if we made it here, then none of the file system functions threw exceptions
-            -- that means everything is OK
             write_install_manifest(manifest, dependencies)
-            term.setTextColor(colors.green)
+            green()
             if mode == "install" then
-                println("installation completed successfully")
+                println("Installation completed successfully.")
-            else
+            else println("Update completed successfully.") end
-                println("update completed successfully")
+            white();println("Ready to clean up unused files, press any key to continue...")
-            end
+            any_key();clean(manifest)
+            white();println("Done.")
         else
-            term.setTextColor(colors.red)
+            red()
             if mode == "install" then
-                println("installation failed, files may have been skipped")
+                println("Installation failed, files may have been skipped.")
-            else
+            else println("Update failed, files may have been skipped.") end
-                println("update failed, files may have been skipped")
-            end
         end
     end
 elseif mode == "remove" or mode == "purge" then
-    local imfile = fs.open("install_manifest.json", "r")
+    local ok, manifest = read_local_manifest()
-    local ok = false
-    local manifest = {}
-
-    if imfile ~= nil then
-        ok, manifest = pcall(function () return textutils.unserializeJSON(imfile.readAll()) end)
-        imfile.close()
-    end
-
     if not ok then
-        term.setTextColor(colors.red)
+        red();println("Error parsing local installation manifest.");white()
-        println("error parsing local installation manifest")
-        term.setTextColor(colors.white)
         return
     elseif mode == "remove" and manifest.versions[app] == nil then
-        term.setTextColor(colors.red)
+        red();println(app .. " is not installed, cannot remove.");white()
-        println(app .. " is not installed")
-        term.setTextColor(colors.white)
         return
     end
 
-    term.setTextColor(colors.orange)
+    orange()
     if mode == "remove" then
-        println("removing all " .. app .. " files except for config.lua and log.txt...")
+        println("Removing all " .. app .. " files except for config and log...")
     elseif mode == "purge" then
-        println("purging all " .. app .. " files...")
+        println("Purging all " .. app .. " files including config and log...")
     end
 
----@diagnostic disable-next-line: undefined-field
+    -- ask for confirmation
-    os.sleep(2)
+    if not ask_y_n("Continue", false) then return end
+
+    -- delete unused files first
+    clean(manifest)
 
     local file_list = manifest.files
     local dependencies = manifest.depends[app]
@@ -585,9 +550,8 @@ elseif mode == "remove" or mode == "purge" then
 
     table.insert(dependencies, app)
 
-    term.setTextColor(colors.lightGray)
-
     -- delete log file if purging
+    lgray()
     if mode == "purge" and fs.exists(config_file) then
         local log_deleted = pcall(function ()
             local config = require(app .. ".config")
@@ -598,11 +562,9 @@ elseif mode == "remove" or mode == "purge" then
         end)
 
         if not log_deleted then
-            term.setTextColor(colors.red)
+            red();println("Failed to delete log file.")
-            println("failed to delete log file")
+            white();println("press any key to continue...")
-            term.setTextColor(colors.lightGray)
+            any_key();lgray()
----@diagnostic disable-next-line: undefined-field
-            os.sleep(1)
         end
     end
 
@@ -611,10 +573,7 @@ elseif mode == "remove" or mode == "purge" then
         local files = file_list[dependency]
         for _, file in pairs(files) do
             if mode == "purge" or file ~= config_file then
-                if fs.exists(file) then
+                if fs.exists(file) then fs.delete(file);println("deleted " .. file) end
-                    fs.delete(file)
-                    println("deleted " .. file)
-                end
             end
         end
 
@@ -623,11 +582,7 @@ elseif mode == "remove" or mode == "purge" then
             local folder = files[1]
             while true do
                 local dir = fs.getDir(folder)
-                if dir == "" or dir == ".." then
+                if dir == "" or dir == ".." then break else folder = dir end
-                    break
-                else
-                    folder = dir
-                end
             end
 
             if fs.isDir(folder) then
@@ -635,19 +590,15 @@ elseif mode == "remove" or mode == "purge" then
                 println("deleted directory " .. folder)
             end
         elseif dependency == app then
+            -- delete individual subdirectories so we can leave the config
             for _, folder in pairs(files) do
                 while true do
                     local dir = fs.getDir(folder)
-                    if dir == "" or dir == ".." or dir == app then
+                    if dir == "" or dir == ".." or dir == app then break else folder = dir end
-                        break
-                    else
-                        folder = dir
-                    end
                 end
 
                 if folder ~= app and fs.isDir(folder) then
-                    fs.delete(folder)
+                    fs.delete(folder);println("deleted app subdirectory " .. folder)
-                    println("deleted app subdirectory " .. folder)
                 end
             end
         end
@@ -660,13 +611,12 @@ elseif mode == "remove" or mode == "purge" then
     else
         -- remove all data from versions list to show nothing is installed
         manifest.versions = {}
-        imfile = fs.open("install_manifest.json", "w")
+        local imfile = fs.open("install_manifest.json", "w")
         imfile.write(textutils.serializeJSON(manifest))
         imfile.close()
     end
 
-    term.setTextColor(colors.green)
+    green();println("Done!")
-    println("done!")
 end
 
-term.setTextColor(colors.white)
+white()

coordinator/config.lua

@@ -11,6 +11,10 @@ config.TRUSTED_RANGE = 0
 -- time in seconds (>= 2) before assuming a remote device is no longer active
 config.SV_TIMEOUT = 5
 config.API_TIMEOUT = 5
+-- facility authentication key (do NOT use one of your passwords)
+-- this enables verifying that messages are authentic
+-- all devices on the same network must use the same key
+-- config.AUTH_KEY = "SCADAfacility123"
 
 -- expected number of reactor units, used only to require that number of unit monitors
 config.NUM_UNITS = 4
@@ -22,6 +26,9 @@ config.SOUNDER_VOLUME = 1.0
 -- true for 24 hour time on main view screen
 config.TIME_24_HOUR = true
 
+-- disable flow view (for legacy layouts)
+config.DISABLE_FLOW_VIEW = false
+
 -- log path
 config.LOG_PATH = "/log.txt"
 -- log mode

coordinator/coordinator.lua

@@ -2,6 +2,7 @@ local comms       = require("scada-common.comms")
 local log         = require("scada-common.log")
 local ppm         = require("scada-common.ppm")
 local util        = require("scada-common.util")
+local types       = require("scada-common.types")
 
 local iocontrol   = require("coordinator.iocontrol")
 local process     = require("coordinator.process")
@@ -12,7 +13,6 @@ local dialog      = require("coordinator.ui.dialog")
 
 local print = util.print
 local println = util.println
-local println_ts = util.println_ts
 
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
@@ -22,6 +22,8 @@ local SCADA_CRDN_TYPE = comms.SCADA_CRDN_TYPE
 local UNIT_COMMAND = comms.UNIT_COMMAND
 local FAC_COMMAND = comms.FAC_COMMAND
 
+local LINK_TIMEOUT = 60.0
+
 local coordinator = {}
 
 -- request the user to select a monitor
@@ -47,12 +49,15 @@ end
 
 -- configure monitor layout
 ---@param num_units integer number of units expected
+---@param disable_flow_view boolean disable flow view (legacy)
 ---@return boolean success, monitors_struct? monitors
-function coordinator.configure_monitors(num_units)
+function coordinator.configure_monitors(num_units, disable_flow_view)
     ---@class monitors_struct
     local monitors = {
         primary = nil,
         primary_name = "",
+        flow = nil,
+        flow_name = "",
         unit_displays = {},
         unit_name_map = {}
     }
@@ -67,8 +72,8 @@ function coordinator.configure_monitors(num_units)
         table.insert(available, iface)
     end
 
-    -- we need a certain number of monitors (1 per unit + 1 primary display)
+    -- we need a certain number of monitors (1 per unit + 1 primary display + 1 flow display)
-    local num_displays_needed = num_units + 1
+    local num_displays_needed = num_units + util.trinary(disable_flow_view, 1, 2)
     if #names < num_displays_needed then
         local message = "not enough monitors connected (need " .. num_displays_needed .. ")"
         println(message)
@@ -81,10 +86,12 @@ function coordinator.configure_monitors(num_units)
         log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)")
     else
         local _primary = settings.get("PRIMARY_DISPLAY")
+        local _flow = settings.get("FLOW_DISPLAY")
         local _unitd = settings.get("UNIT_DISPLAYS")
 
         -- filter out already assigned monitors
         util.filter_table(available, function (x) return x ~= _primary end)
+        util.filter_table(available, function (x) return x ~= _flow end)
         if type(_unitd) == "table" then
             util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end)
         end
@@ -104,7 +111,6 @@ function coordinator.configure_monitors(num_units)
     end
 
     while iface_primary_display == nil and #available > 0 do
-        -- lets get a monitor
         iface_primary_display = ask_monitor(available)
     end
 
@@ -116,6 +122,33 @@ function coordinator.configure_monitors(num_units)
     monitors.primary = ppm.get_periph(iface_primary_display)
     monitors.primary_name = iface_primary_display
 
+    --------------------------
+    -- FLOW MONITOR DISPLAY --
+    --------------------------
+
+    if not disable_flow_view then
+        local iface_flow_display = settings.get("FLOW_DISPLAY")  ---@type boolean|string|nil
+
+        if not util.table_contains(names, iface_flow_display) then
+            println("flow monitor display is not connected")
+            local response = dialog.ask_y_n("would you like to change it", true)
+            if response == false then return false end
+            iface_flow_display = nil
+        end
+
+        while iface_flow_display == nil and #available > 0 do
+            iface_flow_display = ask_monitor(available)
+        end
+
+        if type(iface_flow_display) ~= "string" then return false end
+
+        settings.set("FLOW_DISPLAY", iface_flow_display)
+        util.filter_table(available, function (x) return x ~= iface_flow_display end)
+
+        monitors.flow = ppm.get_periph(iface_flow_display)
+        monitors.flow_name = iface_flow_display
+    end
+
     -------------------
     -- UNIT DISPLAYS --
     -------------------
@@ -128,7 +161,6 @@ function coordinator.configure_monitors(num_units)
             local display = nil
 
             while display == nil and #available > 0 do
-                -- lets get a monitor
                 println("please select monitor for unit #" .. i)
                 display = ask_monitor(available)
             end
@@ -150,7 +182,6 @@ function coordinator.configure_monitors(num_units)
             end
 
             while display == nil and #available > 0 do
-                -- lets get a monitor
                 display = ask_monitor(available)
             end
 
@@ -183,7 +214,8 @@ local function log_dmesg(message, dmesg_tag, working)
         GRAPHICS = colors.green,
         SYSTEM = colors.cyan,
         BOOT = colors.blue,
-        COMMS = colors.purple
+        COMMS = colors.purple,
+        CRYPTO = colors.yellow
     }
 
     if working then
@@ -197,6 +229,7 @@ function coordinator.log_graphics(message) log_dmesg(message, "GRAPHICS") end
 function coordinator.log_sys(message) log_dmesg(message, "SYSTEM") end
 function coordinator.log_boot(message) log_dmesg(message, "BOOT") end
 function coordinator.log_comms(message) log_dmesg(message, "COMMS") end
+function coordinator.log_crypto(message) log_dmesg(message, "CRYPTO") end
 
 -- log a message for communications connecting, providing access to progress indication control functions
 ---@nodiscard
@@ -212,38 +245,38 @@ end
 -- coordinator communications
 ---@nodiscard
 ---@param version string coordinator version
----@param modem table modem device
+---@param nic nic network interface device
+---@param num_units integer number of configured units for number of monitors, checked against SV
 ---@param crd_channel integer port of configured supervisor
 ---@param svr_channel integer listening port for supervisor replys
 ---@param pkt_channel integer listening port for pocket API
 ---@param range integer trusted device connection range
 ---@param sv_watchdog watchdog
-function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
+function coordinator.comms(version, nic, num_units, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
     local self = {
         sv_linked = false,
         sv_addr = comms.BROADCAST,
         sv_seq_num = 0,
         sv_r_seq_num = nil,
         sv_config_err = false,
-        connected = false,
         last_est_ack = ESTABLISH_ACK.ALLOW,
-        last_api_est_acks = {}
+        last_api_est_acks = {},
+        est_start = 0,
+        est_last = 0,
+        est_tick_waiting = nil,
+        est_task_done = nil
     }
 
     comms.set_trusted_range(range)
 
     -- PRIVATE FUNCTIONS --
 
-    -- configure modem channels
+    -- configure network channels
-    local function _conf_channels()
+    nic.closeAll()
-        modem.closeAll()
+    nic.open(crd_channel)
-        modem.open(crd_channel)
-    end
 
-    _conf_channels()
+    -- link nic to apisessions
-
+    apisessions.init(nic)
-    -- link modem to apisessions
-    apisessions.init(modem)
 
     -- send a packet to the supervisor
     ---@param msg_type SCADA_MGMT_TYPE|SCADA_CRDN_TYPE
@@ -263,7 +296,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
         pkt.make(msg_type, msg)
         s_pkt.make(self.sv_addr, self.sv_seq_num, protocol, pkt.raw_sendable())
 
-        modem.transmit(svr_channel, crd_channel, s_pkt.raw_sendable())
+        nic.transmit(svr_channel, crd_channel, s_pkt)
         self.sv_seq_num = self.sv_seq_num + 1
     end
 
@@ -277,7 +310,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
         m_pkt.make(SCADA_MGMT_TYPE.ESTABLISH, { ack })
         s_pkt.make(packet.src_addr(), packet.seq_num() + 1, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
 
-        modem.transmit(pkt_channel, crd_channel, s_pkt.raw_sendable())
+        nic.transmit(pkt_channel, crd_channel, s_pkt)
         self.last_api_est_acks[packet.src_addr()] = ack
     end
 
@@ -297,12 +330,61 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
     ---@class coord_comms
     local public = {}
 
-    -- reconnect a newly connected modem
+    -- try to connect to the supervisor if not already linked
-    ---@param new_modem table
+    ---@param abort boolean? true to print out cancel info if not linked (use on program terminate)
-    function public.reconnect_modem(new_modem)
+    ---@return boolean ok, boolean start_ui
-        modem = new_modem
+    function public.try_connect(abort)
-        apisessions.relink_modem(new_modem)
+        local ok = true
-        _conf_channels()
+        local start_ui = false
+
+        if not self.sv_linked then
+            if self.est_tick_waiting == nil then
+                self.est_start = util.time_s()
+                self.est_last = self.est_start
+
+                self.est_tick_waiting, self.est_task_done =
+                    coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. svr_channel)
+
+                _send_establish()
+            else
+                self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (util.time_s() - self.est_start)))
+            end
+
+            if abort or (util.time_s() - self.est_start) >= LINK_TIMEOUT then
+                self.est_task_done(false)
+
+                if abort then
+                    coordinator.log_comms("supervisor connection attempt cancelled by user")
+                elseif self.sv_config_err then
+                    coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                elseif not self.sv_linked then
+                    if self.last_est_ack == ESTABLISH_ACK.DENY then
+                        coordinator.log_comms("supervisor connection attempt denied")
+                    elseif self.last_est_ack == ESTABLISH_ACK.COLLISION then
+                        coordinator.log_comms("supervisor connection failed due to collision")
+                    elseif self.last_est_ack == ESTABLISH_ACK.BAD_VERSION then
+                        coordinator.log_comms("supervisor connection failed due to version mismatch")
+                    else
+                        coordinator.log_comms("supervisor connection failed with no valid response")
+                    end
+                end
+
+                ok = false
+            elseif self.sv_config_err then
+                coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                ok = false
+            elseif (util.time_s() - self.est_last) > 1.0 then
+                _send_establish()
+                self.est_last = util.time_s()
+            end
+        elseif self.est_tick_waiting ~= nil then
+            self.est_task_done(true)
+            self.est_tick_waiting = nil
+            self.est_task_done = nil
+            start_ui = true
+        end
+
+        return ok, start_ui
     end
 
     -- close the connection to the server
@@ -311,71 +393,15 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
         self.sv_addr = comms.BROADCAST
         self.sv_linked = false
         self.sv_r_seq_num = nil
+        iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
         _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.CLOSE, {})
     end
 
-    -- attempt to connect to the subervisor
-    ---@nodiscard
-    ---@param timeout_s number timeout in seconds
-    ---@param tick_dmesg_waiting function callback to tick dmesg waiting
-    ---@param task_done function callback to show done on dmesg
-    ---@return boolean sv_linked true if connected, false otherwise
-    --- EVENT_CONSUMER: this function consumes events
-    function public.sv_connect(timeout_s, tick_dmesg_waiting, task_done)
-        local clock = util.new_clock(1)
-        local start = util.time_s()
-        local terminated = false
-
-        _send_establish()
-
-        clock.start()
-
-        while (util.time_s() - start) < timeout_s and (not self.sv_linked) and (not self.sv_config_err) do
-            local event, p1, p2, p3, p4, p5 = util.pull_event()
-
-            if event == "timer" and clock.is_clock(p1) then
-                -- timed out attempt, try again
-                tick_dmesg_waiting(math.max(0, timeout_s - (util.time_s() - start)))
-                _send_establish()
-                clock.start()
-            elseif event == "timer" then
-                -- keep checking watchdog timers
-                apisessions.check_all_watchdogs(p1)
-            elseif event == "modem_message" then
-                -- handle message
-                local packet = public.parse_packet(p1, p2, p3, p4, p5)
-                public.handle_packet(packet)
-            elseif event == "terminate" then
-                terminated = true
-                break
-            end
-        end
-
-        task_done(self.sv_linked)
-
-        if terminated then
-            coordinator.log_comms("supervisor connection attempt cancelled by user")
-        elseif self.sv_config_err then
-            coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
-        elseif not self.sv_linked then
-            if self.last_est_ack == ESTABLISH_ACK.DENY then
-                coordinator.log_comms("supervisor connection attempt denied")
-            elseif self.last_est_ack == ESTABLISH_ACK.COLLISION then
-                coordinator.log_comms("supervisor connection failed due to collision")
-            elseif self.last_est_ack == ESTABLISH_ACK.BAD_VERSION then
-                coordinator.log_comms("supervisor connection failed due to version mismatch")
-            else
-                coordinator.log_comms("supervisor connection failed with no valid response")
-            end
-        end
-
-        return self.sv_linked
-    end
-
     -- send a facility command
     ---@param cmd FAC_COMMAND command
-    function public.send_fac_command(cmd)
+    ---@param option any? optional option options for the optional options (like waste mode)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd })
+    function public.send_fac_command(cmd, option)
+        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd, option })
     end
 
     -- send the auto process control configuration with a start command
@@ -389,7 +415,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
     -- send a unit command
     ---@param cmd UNIT_COMMAND command
     ---@param unit integer unit ID
-    ---@param option any? optional option options for the optional options (like burn rate) (does option still look like a word?)
+    ---@param option any? optional option options for the optional options (like burn rate)
     function public.send_unit_command(cmd, unit, option)
         _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
     end
@@ -402,13 +428,10 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
     ---@param distance integer
     ---@return mgmt_frame|crdn_frame|capi_frame|nil packet
     function public.parse_packet(side, sender, reply_to, message, distance)
+        local s_pkt = nic.receive(side, sender, reply_to, message, distance)
         local pkt = nil
-        local s_pkt = comms.scada_packet()
 
-        -- parse packet as generic SCADA packet
+        if s_pkt then
-        s_pkt.receive(side, sender, reply_to, message, distance)
-
-        if s_pkt.is_valid() then
             -- get as SCADA management packet
             if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then
                 local mgmt_pkt = comms.mgmt_packet()
@@ -437,7 +460,10 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
 
     -- handle a packet
     ---@param packet mgmt_frame|crdn_frame|capi_frame|nil
+    ---@return boolean close_ui
     function public.handle_packet(packet)
+        local was_linked = self.sv_linked
+
         if packet ~= nil then
             local l_chan = packet.scada_frame.local_channel()
             local r_chan = packet.scada_frame.remote_channel()
@@ -447,7 +473,9 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
             if l_chan ~= crd_channel then
                 log.debug("received packet on unconfigured channel " .. l_chan, true)
             elseif r_chan == pkt_channel then
-                if protocol == PROTOCOL.COORD_API then
+                if not self.sv_linked then
+                    log.debug("discarding pocket API packet before linked to supervisor")
+                elseif protocol == PROTOCOL.COORD_API then
                     ---@cast packet capi_frame
                     -- look for an associated session
                     local session = apisessions.find_session(src_addr)
@@ -486,7 +514,6 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
                             elseif dev_type == DEVICE_TYPE.PKT then
                                 -- pocket linking request
                                 local id = apisessions.establish_session(src_addr, firmware_v)
-                                println(util.c("[API] pocket (", firmware_v, ") [@", src_addr, "] \xbb connected"))
                                 coordinator.log_comms(util.c("API_ESTABLISH: pocket (", firmware_v, ") [@", src_addr, "] connected with session ID ", id))
 
                                 _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW)
@@ -509,12 +536,12 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
                 -- check sequence number
                 if self.sv_r_seq_num == nil then
                     self.sv_r_seq_num = packet.scada_frame.seq_num()
-                elseif self.connected and ((self.sv_r_seq_num + 1) ~= packet.scada_frame.seq_num()) then
+                elseif self.sv_linked and ((self.sv_r_seq_num + 1) ~= packet.scada_frame.seq_num()) then
                     log.warning("sequence out-of-order: last = " .. self.sv_r_seq_num .. ", new = " .. packet.scada_frame.seq_num())
-                    return
+                    return false
                 elseif self.sv_linked and src_addr ~= self.sv_addr then
                     log.debug("received packet from unknown computer " .. src_addr .. " while linked; channel in use by another system?")
-                    return
+                    return false
                 else
                     self.sv_r_seq_num = packet.scada_frame.seq_num()
                 end
@@ -576,6 +603,10 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
                                     end
                                 elseif cmd == FAC_COMMAND.ACK_ALL_ALARMS then
                                     iocontrol.get_db().facility.ack_alarms_ack(ack)
+                                elseif cmd == FAC_COMMAND.SET_WASTE_MODE then
+                                    process.waste_ack_handle(packet.data[2])
+                                elseif cmd == FAC_COMMAND.SET_PU_FB then
+                                    process.pu_fb_ack_handle(packet.data[2])
                                 else
                                     log.debug(util.c("received facility command ack with unknown command ", cmd))
                                 end
@@ -640,70 +671,7 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
                     end
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if self.sv_linked then
-                        -- connection with supervisor established
-                        if packet.length == 2 then
-                            local est_ack = packet.data[1]
-                            local config = packet.data[2]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                if type(config) == "table" and #config > 1 then
-                                    -- get configuration
-
-                                    ---@class facility_conf
-                                    local conf = {
-                                        num_units = config[1],  ---@type integer
-                                        defs = {}               -- boilers and turbines
-                                    }
-
-                                    if (#config - 1) == (conf.num_units * 2) then
-                                        -- record sequence of pairs of [#boilers, #turbines] per unit
-                                        for i = 2, #config do
-                                            table.insert(conf.defs, config[i])
-                                        end
-
-                                        -- init io controller
-                                        iocontrol.init(conf, public)
-
-                                        self.sv_addr = src_addr
-                                        self.sv_linked = true
-                                        self.sv_config_err = false
-                                    else
-                                        self.sv_config_err = true
-                                        log.warning("invalid supervisor configuration definitions received, establish failed")
-                                    end
-                                else
-                                    log.debug("invalid supervisor configuration table received, establish failed")
-                                end
-                            else
-                                log.debug("SCADA_MGMT establish packet reply (len = 2) unsupported")
-                            end
-
-                            self.last_est_ack = est_ack
-                        elseif packet.length == 1 then
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.DENY then
-                                if self.last_est_ack ~= est_ack then
-                                    log.info("supervisor connection denied")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                if self.last_est_ack ~= est_ack then
-                                    log.warning("supervisor connection denied due to collision")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                if self.last_est_ack ~= est_ack then
-                                    log.warning("supervisor comms version mismatch")
-                                end
-                            else
-                                log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported")
-                            end
-
-                            self.last_est_ack = est_ack
-                        else
-                            log.debug("SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.sv_linked then
                         if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
@@ -728,11 +696,78 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
                             self.sv_addr = comms.BROADCAST
                             self.sv_linked = false
                             self.sv_r_seq_num = nil
-                            println_ts("server connection closed by remote host")
+                            iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
                             log.info("server connection closed by remote host")
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type)
                         end
+                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                        -- connection with supervisor established
+                        if packet.length == 2 then
+                            local est_ack = packet.data[1]
+                            local config = packet.data[2]
+
+                            if est_ack == ESTABLISH_ACK.ALLOW then
+                                -- reset to disconnected before validating
+                                iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
+
+                                if type(config) == "table" and #config == 2 then
+                                    -- get configuration
+
+                                    ---@class facility_conf
+                                    local conf = {
+                                        num_units = config[1],  ---@type integer
+                                        cooling = config[2]     ---@type sv_cooling_conf
+                                    }
+
+                                    if conf.num_units == num_units then
+                                        -- init io controller
+                                        iocontrol.init(conf, public)
+
+                                        self.sv_addr = src_addr
+                                        self.sv_linked = true
+                                        self.sv_r_seq_num = nil
+                                        self.sv_config_err = false
+
+                                        iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED)
+                                    else
+                                        self.sv_config_err = true
+                                        log.warning("supervisor config's number of units don't match coordinator's config, establish failed")
+                                    end
+                                else
+                                    log.debug("invalid supervisor configuration table received, establish failed")
+                                end
+                            else
+                                log.debug("SCADA_MGMT establish packet reply (len = 2) unsupported")
+                            end
+
+                            self.last_est_ack = est_ack
+                        elseif packet.length == 1 then
+                            local est_ack = packet.data[1]
+
+                            if est_ack == ESTABLISH_ACK.DENY then
+                                if self.last_est_ack ~= est_ack then
+                                    iocontrol.fp_link_state(types.PANEL_LINK_STATE.DENIED)
+                                    log.info("supervisor connection denied")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.COLLISION then
+                                if self.last_est_ack ~= est_ack then
+                                    iocontrol.fp_link_state(types.PANEL_LINK_STATE.COLLISION)
+                                    log.warning("supervisor connection denied due to collision")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
+                                if self.last_est_ack ~= est_ack then
+                                    iocontrol.fp_link_state(types.PANEL_LINK_STATE.BAD_VERSION)
+                                    log.warning("supervisor comms version mismatch")
+                                end
+                            else
+                                log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported")
+                            end
+
+                            self.last_est_ack = est_ack
+                        else
+                            log.debug("SCADA_MGMT establish packet length mismatch")
+                        end
                     else
                         log.debug("discarding non-link SCADA_MGMT packet before linked")
                     end
@@ -743,6 +778,8 @@ function coordinator.comms(version, modem, crd_channel, svr_channel, pkt_channel
                 log.debug("received packet for unknown channel " .. r_chan, true)
             end
         end
+
+        return was_linked and not self.sv_linked
     end
 
     -- check if the coordinator is still linked to the supervisor

coordinator/iocontrol.lua

@@ -10,9 +10,15 @@ local util    = require("scada-common.util")
 local process = require("coordinator.process")
 local sounder = require("coordinator.sounder")
 
+local pgi     = require("coordinator.ui.pgi")
+
 local ALARM_STATE = types.ALARM_STATE
 local PROCESS = types.PROCESS
 
+-- nominal RTT is ping (0ms to 10ms usually) + 500ms for CRD main loop tick
+local WARN_RTT = 1000   -- 2x as long as expected w/ 0 ping
+local HIGH_RTT = 1500   -- 3.33x as long as expected w/ 0 ping
+
 local iocontrol = {}
 
 ---@class ioctl
@@ -27,13 +33,27 @@ local function __generic_ack(success) end
 
 -- luacheck: unused args
 
+-- initialize front panel PSIL
+---@param firmware_v string coordinator version
+---@param comms_v string comms version
+function iocontrol.init_fp(firmware_v, comms_v)
+    ---@class ioctl_front_panel
+    io.fp = { ps = psil.create() }
+
+    io.fp.ps.publish("version", firmware_v)
+    io.fp.ps.publish("comms_version", comms_v)
+end
+
 -- initialize the coordinator IO controller
 ---@param conf facility_conf configuration
 ---@param comms coord_comms comms reference
 function iocontrol.init(conf, comms)
+    -- facility data structure
     ---@class ioctl_facility
     io.facility = {
-        num_units = conf.num_units, ---@type integer
+        num_units = conf.num_units,
+        tank_mode = conf.cooling.fac_tank_mode,
+        tank_defs = conf.cooling.fac_tank_defs,
         all_sys_ok = false,
         rtu_count = 0,
 
@@ -52,6 +72,10 @@ function iocontrol.init(conf, comms)
             gen_fault = false
         },
 
+        ---@type WASTE_PRODUCT
+        auto_current_waste_product = types.WASTE_PRODUCT.PLUTONIUM,
+        auto_pu_fallback_active = false,
+
         radiation = types.new_zero_radiation_reading(),
 
         save_cfg_ack = __generic_ack,
@@ -60,22 +84,124 @@ function iocontrol.init(conf, comms)
         scram_ack = __generic_ack,
         ack_alarms_ack = __generic_ack,
 
+        alarm_tones = { false, false, false, false, false, false, false, false },
+
         ps = psil.create(),
 
         induction_ps_tbl = {},
         induction_data_tbl = {},
 
+        sps_ps_tbl = {},
+        sps_data_tbl = {},
+
+        tank_ps_tbl = {},
+        tank_data_tbl = {},
+
         env_d_ps = psil.create(),
         env_d_data = {}
     }
 
-    -- create induction tables (currently only 1 is supported)
+    -- create induction and SPS tables (currently only 1 of each is supported)
-    for _ = 1, conf.num_units do
+    table.insert(io.facility.induction_ps_tbl, psil.create())
-        local data = {} ---@type imatrix_session_db
+    table.insert(io.facility.induction_data_tbl, {})
-        table.insert(io.facility.induction_ps_tbl, psil.create())
+    table.insert(io.facility.sps_ps_tbl, psil.create())
-        table.insert(io.facility.induction_data_tbl, data)
+    table.insert(io.facility.sps_data_tbl, {})
+
+    -- determine tank information
+    if io.facility.tank_mode == 0 then
+        io.facility.tank_defs = {}
+        -- on facility tank mode 0, setup tank defs to match unit TANK option
+        for i = 1, conf.num_units do
+            io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TANK, 1, 0)
+        end
+
+        io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
+    else
+        -- decode the layout of tanks from the connections definitions
+        local tank_mode = io.facility.tank_mode
+        local tank_defs = io.facility.tank_defs
+        local tank_list = { table.unpack(tank_defs) }
+
+        local function calc_fdef(start_idx, end_idx)
+            local first = 4
+            for i = start_idx, end_idx do
+                if io.facility.tank_defs[i] == 2 then
+                    if i < first then first = i end
+                end
+            end
+            return first
+        end
+
+        if tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef = calc_fdef(1, #tank_defs)
+            for i = 1, #tank_defs do
+                if i > first_fdef and tank_defs[i] == 2 then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
+                    tank_list[b] = 0
+                end
+            end
+        elseif tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef = calc_fdef(2, #tank_defs)
+            for i = 1, #tank_defs do
+                if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef = calc_fdef(3, #tank_defs)
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        end
+
+        io.facility.tank_list = tank_list
     end
 
+    -- create facility tank tables
+    for i = 1, #io.facility.tank_list do
+        if io.facility.tank_list[i] == 2 then
+            table.insert(io.facility.tank_ps_tbl, psil.create())
+            table.insert(io.facility.tank_data_tbl, {})
+        end
+    end
+
+    -- create unit data structures
     io.units = {}
     for i = 1, conf.num_units do
         local function ack(alarm) process.ack_alarm(i, alarm) end
@@ -87,11 +213,16 @@ function iocontrol.init(conf, comms)
 
             num_boilers = 0,
             num_turbines = 0,
+            num_snas = 0,
+            has_tank = conf.cooling.r_cool[i].TANK,
 
             control_state = false,
             burn_rate_cmd = 0.0,
-            waste_control = 0,
             radiation = types.new_zero_radiation_reading(),
+            sna_prod_rate = 0.0,
+
+            waste_mode = types.WASTE_MODE.MANUAL_PLUTONIUM,
+            waste_product = types.WASTE_PRODUCT.PLUTONIUM,
 
             -- auto control group
             a_group = 0,
@@ -100,10 +231,10 @@ function iocontrol.init(conf, comms)
             scram = function () process.scram(i) end,
             reset_rps = function () process.reset_rps(i) end,
             ack_alarms = function () process.ack_all_alarms(i) end,
-            set_burn = function (rate) process.set_rate(i, rate) end,   ---@param rate number burn rate
+            set_burn = function (rate) process.set_rate(i, rate) end,        ---@param rate number burn rate
-            set_waste = function (mode) process.set_waste(i, mode) end, ---@param mode integer waste processing mode
+            set_waste = function (mode) process.set_unit_waste(i, mode) end, ---@param mode WASTE_MODE waste processing mode
 
-            set_group = function (grp) process.set_group(i, grp) end,   ---@param grp integer|0 group ID or 0
+            set_group = function (grp) process.set_group(i, grp) end,        ---@param grp integer|0 group ID or 0 for manual
 
             start_ack = __generic_ack,
             scram_ack = __generic_ack,
@@ -152,21 +283,33 @@ function iocontrol.init(conf, comms)
             boiler_data_tbl = {},
 
             turbine_ps_tbl = {},
-            turbine_data_tbl = {}
+            turbine_data_tbl = {},
+
+            tank_ps_tbl = {},
+            tank_data_tbl = {}
         }
 
+        -- on other facility modes, overwrite unit TANK option with facility tank defs
+        if io.facility.tank_mode ~= 0 then
+            entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
+        end
+
         -- create boiler tables
-        for _ = 1, conf.defs[(i * 2) - 1] do
+        for _ = 1, conf.cooling.r_cool[i].BOILERS do
-            local data = {} ---@type boilerv_session_db
             table.insert(entry.boiler_ps_tbl, psil.create())
-            table.insert(entry.boiler_data_tbl, data)
+            table.insert(entry.boiler_data_tbl, {})
         end
 
         -- create turbine tables
-        for _ = 1, conf.defs[i * 2] do
+        for _ = 1, conf.cooling.r_cool[i].TURBINES do
-            local data = {} ---@type turbinev_session_db
             table.insert(entry.turbine_ps_tbl, psil.create())
-            table.insert(entry.turbine_data_tbl, data)
+            table.insert(entry.turbine_data_tbl, {})
+        end
+
+        -- create tank tables
+        if io.facility.tank_defs[i] == 1 then
+            table.insert(entry.tank_ps_tbl, psil.create())
+            table.insert(entry.tank_data_tbl, {})
         end
 
         entry.num_boilers = #entry.boiler_data_tbl
@@ -179,6 +322,102 @@ function iocontrol.init(conf, comms)
     process.init(io, comms)
 end
 
+--#region Front Panel PSIL
+
+-- toggle heartbeat indicator
+function iocontrol.heartbeat() io.fp.ps.toggle("heartbeat") end
+
+-- report presence of the wireless modem
+---@param has_modem boolean
+function iocontrol.fp_has_modem(has_modem) io.fp.ps.publish("has_modem", has_modem) end
+
+-- report presence of the speaker
+---@param has_speaker boolean
+function iocontrol.fp_has_speaker(has_speaker) io.fp.ps.publish("has_speaker", has_speaker) end
+
+-- report supervisor link state
+---@param state integer
+function iocontrol.fp_link_state(state) io.fp.ps.publish("link_state", state) end
+
+-- report monitor connection state
+---@param id string|integer unit ID for unit monitor, "main" for main monitor, or "flow" for flow monitor
+function iocontrol.fp_monitor_state(id, connected)
+    local name = nil
+
+    if id == "main" then
+        name = "main_monitor"
+    elseif id == "flow" then
+        name = "flow_monitor"
+    elseif type(id) == "number" then
+        name = "unit_monitor_" .. id
+    end
+
+    if name ~= nil then
+        io.fp.ps.publish(name, connected)
+    end
+end
+
+-- report PKT firmware version and PKT session connection state
+---@param session_id integer PKT session
+---@param fw string firmware version
+---@param s_addr integer PKT computer ID
+function iocontrol.fp_pkt_connected(session_id, fw, s_addr)
+    io.fp.ps.publish("pkt_" .. session_id .. "_fw", fw)
+    io.fp.ps.publish("pkt_" .. session_id .. "_addr", util.sprintf("@ C% 3d", s_addr))
+    pgi.create_pkt_entry(session_id)
+end
+
+-- report PKT session disconnected
+---@param session_id integer PKT session
+function iocontrol.fp_pkt_disconnected(session_id)
+    pgi.delete_pkt_entry(session_id)
+end
+
+-- transmit PKT session RTT
+---@param session_id integer PKT session
+---@param rtt integer round trip time
+function iocontrol.fp_pkt_rtt(session_id, rtt)
+    io.fp.ps.publish("pkt_" .. session_id .. "_rtt", rtt)
+
+    if rtt > HIGH_RTT then
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.red)
+    elseif rtt > WARN_RTT then
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.yellow_hc)
+    else
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.green)
+    end
+end
+
+--#endregion
+
+--#region Builds
+
+-- record and publish multiblock RTU build data
+---@param id integer
+---@param entry table
+---@param data_tbl table
+---@param ps_tbl table
+---@param create boolean? true to create an entry if non exists, false to fail on missing
+---@return boolean ok true if data saved, false if invalid ID
+local function _record_multiblock_build(id, entry, data_tbl, ps_tbl, create)
+    local exists = type(data_tbl[id]) == "table"
+    if exists or create then
+        if not exists then
+            ps_tbl[id] = psil.create()
+            data_tbl[id] = {}
+        end
+
+        data_tbl[id].formed = entry[1]  ---@type boolean
+        data_tbl[id].build  = entry[2]  ---@type table
+
+        ps_tbl[id].publish("formed", entry[1])
+
+        for key, val in pairs(data_tbl[id].build) do ps_tbl[id].publish(key, val) end
+    end
+
+    return exists or (create == true)
+end
+
 -- populate facility structure builds
 ---@param build table
 ---@return boolean valid
@@ -191,21 +430,29 @@ function iocontrol.record_facility_builds(build)
         -- induction matricies
         if type(build.induction) == "table" then
             for id, matrix in pairs(build.induction) do
-                if type(fac.induction_data_tbl[id]) == "table" then
+                if not _record_multiblock_build(id, matrix, fac.induction_data_tbl, fac.induction_ps_tbl) then
-                    fac.induction_data_tbl[id].formed = matrix[1]  ---@type boolean
-                    fac.induction_data_tbl[id].build  = matrix[2]  ---@type table
-
-                    fac.induction_ps_tbl[id].publish("formed", matrix[1])
-
-                    for key, val in pairs(fac.induction_data_tbl[id].build) do
-                        fac.induction_ps_tbl[id].publish(key, val)
-                    end
-                else
                     log.debug(util.c("iocontrol.record_facility_builds: invalid induction matrix id ", id))
                     valid = false
                 end
             end
         end
+
+        -- SPS
+        if type(build.sps) == "table" then
+            for id, sps in pairs(build.sps) do
+                if not _record_multiblock_build(id, sps, fac.sps_data_tbl, fac.sps_ps_tbl) then
+                    log.debug(util.c("iocontrol.record_facility_builds: invalid SPS id ", id))
+                    valid = false
+                end
+            end
+        end
+
+        -- dynamic tanks
+        if type(build.tanks) == "table" then
+            for id, tank in pairs(build.tanks) do
+                _record_multiblock_build(id, tank, fac.tank_data_tbl, fac.tank_ps_tbl, true)
+            end
+        end
     else
         log.debug("facility builds not a table")
         valid = false
@@ -249,16 +496,7 @@ function iocontrol.record_unit_builds(builds)
             -- boiler builds
             if type(build.boilers) == "table" then
                 for b_id, boiler in pairs(build.boilers) do
-                    if type(unit.boiler_data_tbl[b_id]) == "table" then
+                    if not _record_multiblock_build(b_id, boiler, unit.boiler_data_tbl, unit.boiler_ps_tbl) then
-                        unit.boiler_data_tbl[b_id].formed = boiler[1] ---@type boolean
-                        unit.boiler_data_tbl[b_id].build  = boiler[2] ---@type table
-
-                        unit.boiler_ps_tbl[b_id].publish("formed", boiler[1])
-
-                        for key, val in pairs(unit.boiler_data_tbl[b_id].build) do
-                            unit.boiler_ps_tbl[b_id].publish(key, val)
-                        end
-                    else
                         log.debug(util.c(log_header, "invalid boiler id ", b_id))
                         valid = false
                     end
@@ -268,27 +506,49 @@ function iocontrol.record_unit_builds(builds)
             -- turbine builds
             if type(build.turbines) == "table" then
                 for t_id, turbine in pairs(build.turbines) do
-                    if type(unit.turbine_data_tbl[t_id]) == "table" then
+                    if not _record_multiblock_build(t_id, turbine, unit.turbine_data_tbl, unit.turbine_ps_tbl) then
-                        unit.turbine_data_tbl[t_id].formed = turbine[1]   ---@type boolean
-                        unit.turbine_data_tbl[t_id].build  = turbine[2]   ---@type table
-
-                        unit.turbine_ps_tbl[t_id].publish("formed", turbine[1])
-
-                        for key, val in pairs(unit.turbine_data_tbl[t_id].build) do
-                            unit.turbine_ps_tbl[t_id].publish(key, val)
-                        end
-                    else
                         log.debug(util.c(log_header, "invalid turbine id ", t_id))
                         valid = false
                     end
                 end
             end
+
+            -- dynamic tank builds
+            if type(build.tanks) == "table" then
+                for d_id, d_tank in pairs(build.tanks) do
+                    _record_multiblock_build(d_id, d_tank, unit.tank_data_tbl, unit.tank_ps_tbl, true)
+                end
+            end
         end
     end
 
     return valid
 end
 
+--#endregion
+
+--#region Statuses
+
+-- record and publish multiblock status data
+---@param entry any
+---@param data imatrix_session_db|sps_session_db|dynamicv_session_db|turbinev_session_db|boilerv_session_db
+---@param ps psil
+---@return boolean is_faulted
+local function _record_multiblock_status(entry, data, ps)
+    local is_faulted = entry[1] ---@type boolean
+    data.formed      = entry[2] ---@type boolean
+    data.state       = entry[3] ---@type table
+    data.tanks       = entry[4] ---@type table
+
+    ps.publish("formed", data.formed)
+    ps.publish("faulted", is_faulted)
+
+    for key, val in pairs(data.state) do ps.publish(key, val) end
+    for key, val in pairs(data.tanks) do ps.publish(key, val) end
+
+    return is_faulted
+end
+
 -- update facility status
 ---@param status table
 ---@return boolean valid
@@ -306,7 +566,7 @@ function iocontrol.update_facility_status(status)
 
         local ctl_status = status[1]
 
-        if type(ctl_status) == "table" and #ctl_status == 14 then
+        if type(ctl_status) == "table" and #ctl_status == 16 then
             fac.all_sys_ok = ctl_status[1]
             fac.auto_ready = ctl_status[2]
 
@@ -354,6 +614,12 @@ function iocontrol.update_facility_status(status)
                     io.units[i].unit_ps.publish("auto_group", names[group_map[i] + 1])
                 end
             end
+
+            fac.auto_current_waste_product = ctl_status[15]
+            fac.auto_pu_fallback_active = ctl_status[16]
+
+            fac.ps.publish("current_waste_product", fac.auto_current_waste_product)
+            fac.ps.publish("pu_fallback_active", fac.auto_pu_fallback_active)
         else
             log.debug(log_header .. "control status not a table or length mismatch")
             valid = false
@@ -390,36 +656,23 @@ function iocontrol.update_facility_status(status)
 
                 for id, matrix in pairs(rtu_statuses.induction) do
                     if type(fac.induction_data_tbl[id]) == "table" then
-                        local rtu_faulted                 = matrix[1]   ---@type boolean
+                        local data = fac.induction_data_tbl[id] ---@type imatrix_session_db
-                        fac.induction_data_tbl[id].formed = matrix[2]   ---@type boolean
+                        local ps   = fac.induction_ps_tbl[id]   ---@type psil
-                        fac.induction_data_tbl[id].state  = matrix[3]   ---@type table
-                        fac.induction_data_tbl[id].tanks  = matrix[4]   ---@type table
 
-                        local data = fac.induction_data_tbl[id]         ---@type imatrix_session_db
+                        local rtu_faulted = _record_multiblock_status(matrix, data, ps)
 
-                        fac.induction_ps_tbl[id].publish("formed", data.formed)
+                        if rtu_faulted then
-                        fac.induction_ps_tbl[id].publish("faulted", rtu_faulted)
+                            ps.publish("computed_status", 3)    -- faulted
-
+                        elseif data.formed then
-                        if data.formed then
+                            if data.tanks.energy_fill >= 0.99 then
-                            if rtu_faulted then
+                                ps.publish("computed_status", 6)    -- full
-                                fac.induction_ps_tbl[id].publish("computed_status", 3)  -- faulted
-                            elseif data.tanks.energy_fill >= 0.99 then
-                                fac.induction_ps_tbl[id].publish("computed_status", 6)  -- full
                             elseif data.tanks.energy_fill <= 0.01 then
-                                fac.induction_ps_tbl[id].publish("computed_status", 5)  -- empty
+                                ps.publish("computed_status", 5)    -- empty
                             else
-                                fac.induction_ps_tbl[id].publish("computed_status", 4)  -- on-line
+                                ps.publish("computed_status", 4)    -- on-line
                             end
                         else
-                            fac.induction_ps_tbl[id].publish("computed_status", 2)      -- not formed
+                            ps.publish("computed_status", 2)        -- not formed
-                        end
-
-                        for key, val in pairs(fac.induction_data_tbl[id].state) do
-                            fac.induction_ps_tbl[id].publish(key, val)
-                        end
-
-                        for key, val in pairs(fac.induction_data_tbl[id].tanks) do
-                            fac.induction_ps_tbl[id].publish(key, val)
                         end
                     else
                         log.debug(util.c(log_header, "invalid induction matrix id ", id))
@@ -430,6 +683,82 @@ function iocontrol.update_facility_status(status)
                 valid = false
             end
 
+            -- SPS statuses
+            if type(rtu_statuses.sps) == "table" then
+                for id = 1, #fac.sps_ps_tbl do
+                    if rtu_statuses.sps[id] == nil then
+                        -- disconnected
+                        fac.sps_ps_tbl[id].publish("computed_status", 1)
+                    end
+                end
+
+                for id, sps in pairs(rtu_statuses.sps) do
+                    if type(fac.sps_data_tbl[id]) == "table" then
+                        local data = fac.sps_data_tbl[id]   ---@type sps_session_db
+                        local ps   = fac.sps_ps_tbl[id]     ---@type psil
+
+                        local rtu_faulted = _record_multiblock_status(sps, data, ps)
+
+                        if rtu_faulted then
+                            ps.publish("computed_status", 3)        -- faulted
+                        elseif data.formed then
+                            if data.state.process_rate > 0 then
+                                ps.publish("computed_status", 5)    -- active
+                            else
+                                ps.publish("computed_status", 4)    -- idle
+                            end
+                        else
+                            ps.publish("computed_status", 2)        -- not formed
+                        end
+
+                        io.facility.ps.publish("am_rate", data.state.process_rate * 1000)
+                    else
+                        log.debug(util.c(log_header, "invalid sps id ", id))
+                    end
+                end
+            else
+                log.debug(log_header .. "sps list not a table")
+                valid = false
+            end
+
+            -- dynamic tank statuses
+            if type(rtu_statuses.tanks) == "table" then
+                for id = 1, #fac.tank_ps_tbl do
+                    if rtu_statuses.tanks[id] == nil then
+                        -- disconnected
+                        fac.tank_ps_tbl[id].publish("computed_status", 1)
+                    end
+                end
+
+                for id, tank in pairs(rtu_statuses.tanks) do
+                    if type(fac.tank_data_tbl[id]) == "table" then
+                        local data = fac.tank_data_tbl[id]  ---@type dynamicv_session_db
+                        local ps   = fac.tank_ps_tbl[id]    ---@type psil
+
+                        local rtu_faulted = _record_multiblock_status(tank, data, ps)
+
+                        if rtu_faulted then
+                            ps.publish("computed_status", 3)        -- faulted
+                        elseif data.formed then
+                            if data.tanks.fill >= 0.99 then
+                                ps.publish("computed_status", 6)    -- full
+                            elseif data.tanks.fill < 0.20 then
+                                ps.publish("computed_status", 5)    -- low
+                            else
+                                ps.publish("computed_status", 4)    -- on-line
+                            end
+                        else
+                            ps.publish("computed_status", 2)        -- not formed
+                        end
+                    else
+                        log.debug(util.c(log_header, "invalid dynamic tank id ", id))
+                    end
+                end
+            else
+                log.debug(log_header .. "dyanmic tank list not a table")
+                valid = false
+            end
+
             -- environment detector status
             if type(rtu_statuses.rad_mon) == "table" then
                 if #rtu_statuses.rad_mon > 0 then
@@ -453,6 +782,16 @@ function iocontrol.update_facility_status(status)
         end
 
         fac.ps.publish("rtu_count", fac.rtu_count)
+
+        -- alarm tone commands
+
+        if (type(status[3]) == "table") and (#status[3] == 8) then
+            fac.alarm_tones = status[3]
+            sounder.set(fac.alarm_tones)
+        else
+            log.debug(log_header .. "alarm tones not a table or length mismatch")
+            valid = false
+        end
     end
 
     return valid
@@ -472,6 +811,8 @@ function iocontrol.update_unit_statuses(statuses)
         valid = false
     else
         local burn_rate_sum = 0.0
+        local sna_count_sum = 0
+        local pu_rate, po_rate, po_pl_rate, po_am_rate, spent_rate = 0.0, 0.0, 0.0, 0.0, 0.0
 
         -- get all unit statuses
         for i = 1, #statuses do
@@ -480,7 +821,9 @@ function iocontrol.update_unit_statuses(statuses)
             local unit = io.units[i]    ---@type ioctl_unit
             local status = statuses[i]
 
-            if type(status) ~= "table" or #status ~= 5 then
+            local burn_rate = 0.0
+
+            if type(status) ~= "table" or #status ~= 6 then
                 log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)")
                 valid = false
             else
@@ -515,7 +858,8 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- if status hasn't been received, mek_status = {}
                     if type(unit.reactor_data.mek_status.act_burn_rate) == "number" then
-                        burn_rate_sum = burn_rate_sum + unit.reactor_data.mek_status.act_burn_rate
+                        burn_rate = unit.reactor_data.mek_status.act_burn_rate
+                        burn_rate_sum = burn_rate_sum + burn_rate
                     end
 
                     if unit.reactor_data.mek_status.status then
@@ -562,6 +906,8 @@ function iocontrol.update_unit_statuses(statuses)
                 if type(rtu_statuses) == "table" then
                     -- boiler statuses
                     if type(rtu_statuses.boilers) == "table" then
+                        local boil_sum = 0
+
                         for id = 1, #unit.boiler_ps_tbl do
                             if rtu_statuses.boilers[i] == nil then
                                 -- disconnected
@@ -571,40 +917,31 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, boiler in pairs(rtu_statuses.boilers) do
                             if type(unit.boiler_data_tbl[id]) == "table" then
-                                local rtu_faulted               = boiler[1] ---@type boolean
+                                local data = unit.boiler_data_tbl[id]   ---@type boilerv_session_db
-                                unit.boiler_data_tbl[id].formed = boiler[2] ---@type boolean
+                                local ps   = unit.boiler_ps_tbl[id]     ---@type psil
-                                unit.boiler_data_tbl[id].state  = boiler[3] ---@type table
-                                unit.boiler_data_tbl[id].tanks  = boiler[4] ---@type table
 
-                                local data = unit.boiler_data_tbl[id]  ---@type boilerv_session_db
+                                local rtu_faulted = _record_multiblock_status(boiler, data, ps)
-
-                                unit.boiler_ps_tbl[id].publish("formed", data.formed)
-                                unit.boiler_ps_tbl[id].publish("faulted", rtu_faulted)
 
                                 if rtu_faulted then
-                                    unit.boiler_ps_tbl[id].publish("computed_status", 3)        -- faulted
+                                    ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    boil_sum = boil_sum + data.state.boil_rate
+
                                     if data.state.boil_rate > 0 then
-                                        unit.boiler_ps_tbl[id].publish("computed_status", 5)    -- active
+                                        ps.publish("computed_status", 5)    -- active
                                     else
-                                        unit.boiler_ps_tbl[id].publish("computed_status", 4)    -- idle
+                                        ps.publish("computed_status", 4)    -- idle
                                     end
                                 else
-                                    unit.boiler_ps_tbl[id].publish("computed_status", 2)        -- not formed
+                                    ps.publish("computed_status", 2)        -- not formed
-                                end
-
-                                for key, val in pairs(unit.boiler_data_tbl[id].state) do
-                                    unit.boiler_ps_tbl[id].publish(key, val)
-                                end
-
-                                for key, val in pairs(unit.boiler_data_tbl[id].tanks) do
-                                    unit.boiler_ps_tbl[id].publish(key, val)
                                 end
                             else
                                 log.debug(util.c(log_header, "invalid boiler id ", id))
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("boiler_boil_sum", boil_sum)
                     else
                         log.debug(log_header .. "boiler list not a table")
                         valid = false
@@ -612,6 +949,8 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- turbine statuses
                     if type(rtu_statuses.turbines) == "table" then
+                        local flow_sum = 0
+
                         for id = 1, #unit.turbine_ps_tbl do
                             if rtu_statuses.turbines[i] == nil then
                                 -- disconnected
@@ -621,47 +960,93 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, turbine in pairs(rtu_statuses.turbines) do
                             if type(unit.turbine_data_tbl[id]) == "table" then
-                                local rtu_faulted                = turbine[1]   ---@type boolean
-                                unit.turbine_data_tbl[id].formed = turbine[2]   ---@type boolean
-                                unit.turbine_data_tbl[id].state  = turbine[3]   ---@type table
-                                unit.turbine_data_tbl[id].tanks  = turbine[4]   ---@type table
-
                                 local data = unit.turbine_data_tbl[id]  ---@type turbinev_session_db
+                                local ps   = unit.turbine_ps_tbl[id]    ---@type psil
 
-                                unit.turbine_ps_tbl[id].publish("formed", data.formed)
+                                local rtu_faulted = _record_multiblock_status(turbine, data, ps)
-                                unit.turbine_ps_tbl[id].publish("faulted", rtu_faulted)
 
                                 if rtu_faulted then
-                                    unit.turbine_ps_tbl[id].publish("computed_status", 3)       -- faulted
+                                    ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    flow_sum = flow_sum + data.state.flow_rate
+
                                     if data.tanks.energy_fill >= 0.99 then
-                                        unit.turbine_ps_tbl[id].publish("computed_status", 6)   -- trip
+                                        ps.publish("computed_status", 6)    -- trip
                                     elseif data.state.flow_rate < 100 then
-                                        unit.turbine_ps_tbl[id].publish("computed_status", 4)   -- idle
+                                        ps.publish("computed_status", 4)    -- idle
                                     else
-                                        unit.turbine_ps_tbl[id].publish("computed_status", 5)   -- active
+                                        ps.publish("computed_status", 5)    -- active
                                     end
                                 else
-                                    unit.turbine_ps_tbl[id].publish("computed_status", 2)       -- not formed
+                                    ps.publish("computed_status", 2)        -- not formed
-                                end
-
-                                for key, val in pairs(unit.turbine_data_tbl[id].state) do
-                                    unit.turbine_ps_tbl[id].publish(key, val)
-                                end
-
-                                for key, val in pairs(unit.turbine_data_tbl[id].tanks) do
-                                    unit.turbine_ps_tbl[id].publish(key, val)
                                 end
                             else
                                 log.debug(util.c(log_header, "invalid turbine id ", id))
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("turbine_flow_sum", flow_sum)
                     else
                         log.debug(log_header .. "turbine list not a table")
                         valid = false
                     end
 
+                    -- dynamic tank statuses
+                    if type(rtu_statuses.tanks) == "table" then
+                        for id = 1, #unit.tank_ps_tbl do
+                            if rtu_statuses.tanks[i] == nil then
+                                -- disconnected
+                                unit.tank_ps_tbl[id].publish("computed_status", 1)
+                            end
+                        end
+
+                        for id, tank in pairs(rtu_statuses.tanks) do
+                            if type(unit.tank_data_tbl[id]) == "table" then
+                                local data = unit.tank_data_tbl[id] ---@type dynamicv_session_db
+                                local ps   = unit.tank_ps_tbl[id]   ---@type psil
+
+                                local rtu_faulted = _record_multiblock_status(tank, data, ps)
+
+                                if rtu_faulted then
+                                    ps.publish("computed_status", 3)        -- faulted
+                                elseif data.formed then
+                                    if data.tanks.fill >= 0.99 then
+                                        ps.publish("computed_status", 6)    -- full
+                                    elseif data.tanks.fill < 0.20 then
+                                        ps.publish("computed_status", 5)    -- low
+                                    else
+                                        ps.publish("computed_status", 4)    -- on-line
+                                    end
+                                else
+                                    ps.publish("computed_status", 2)        -- not formed
+                                end
+                            else
+                                log.debug(util.c(log_header, "invalid dynamic tank id ", id))
+                                valid = false
+                            end
+                        end
+                    else
+                        log.debug(log_header .. "dynamic tank list not a table")
+                        valid = false
+                    end
+
+                    -- solar neutron activator status info
+                    if type(rtu_statuses.sna) == "table" then
+                        unit.num_snas      = rtu_statuses.sna[1]    ---@type integer
+                        unit.sna_prod_rate = rtu_statuses.sna[2]    ---@type number
+                        unit.sna_peak_rate = rtu_statuses.sna[3]    ---@type number
+
+                        unit.unit_ps.publish("sna_count", unit.num_snas)
+                        unit.unit_ps.publish("sna_prod_rate", unit.sna_prod_rate)
+                        unit.unit_ps.publish("sna_peak_rate", unit.sna_peak_rate)
+
+                        sna_count_sum = sna_count_sum + unit.num_snas
+                    else
+                        log.debug(log_header .. "sna statistic list not a table")
+                        valid = false
+                    end
+
                     -- environment detector status
                     if type(rtu_statuses.rad_mon) == "table" then
                         if #rtu_statuses.rad_mon > 0 then
@@ -739,12 +1124,17 @@ function iocontrol.update_unit_statuses(statuses)
                 local unit_state = status[5]
 
                 if type(unit_state) == "table" then
-                    if #unit_state == 5 then
+                    if #unit_state == 6 then
+                        unit.waste_mode = unit_state[5]
+                        unit.waste_product = unit_state[6]
+
                         unit.unit_ps.publish("U_StatusLine1", unit_state[1])
                         unit.unit_ps.publish("U_StatusLine2", unit_state[2])
-                        unit.unit_ps.publish("U_WasteMode", unit_state[3])
+                        unit.unit_ps.publish("U_AutoReady", unit_state[3])
-                        unit.unit_ps.publish("U_AutoReady", unit_state[4])
+                        unit.unit_ps.publish("U_AutoDegraded", unit_state[4])
-                        unit.unit_ps.publish("U_AutoDegraded", unit_state[5])
+                        unit.unit_ps.publish("U_AutoWaste", unit.waste_mode == types.WASTE_MODE.AUTO)
+                        unit.unit_ps.publish("U_WasteMode", unit.waste_mode)
+                        unit.unit_ps.publish("U_WasteProduct", unit.waste_product)
                     else
                         log.debug(log_header .. "unit state length mismatch")
                         valid = false
@@ -753,18 +1143,81 @@ function iocontrol.update_unit_statuses(statuses)
                     log.debug(log_header .. "unit state not a table")
                     valid = false
                 end
+
+                -- valve states
+                local valve_states = status[6]
+
+                if type(valve_states) == "table" then
+                    if #valve_states == 5 then
+                        unit.unit_ps.publish("V_pu_conn", valve_states[1] > 0)
+                        unit.unit_ps.publish("V_pu_state", valve_states[1] == 2)
+                        unit.unit_ps.publish("V_po_conn", valve_states[2] > 0)
+                        unit.unit_ps.publish("V_po_state", valve_states[2] == 2)
+                        unit.unit_ps.publish("V_pl_conn", valve_states[3] > 0)
+                        unit.unit_ps.publish("V_pl_state", valve_states[3] == 2)
+                        unit.unit_ps.publish("V_am_conn", valve_states[4] > 0)
+                        unit.unit_ps.publish("V_am_state", valve_states[4] == 2)
+                        unit.unit_ps.publish("V_emc_conn", valve_states[5] > 0)
+                        unit.unit_ps.publish("V_emc_state", valve_states[5] == 2)
+                    else
+                        log.debug(log_header .. "valve states length mismatch")
+                        valid = false
+                    end
+                else
+                    log.debug(log_header .. "valve states not a table")
+                    valid = false
+                end
+
+                -- determine waste production for this unit, add to statistics
+
+                local is_pu = unit.waste_product == types.WASTE_PRODUCT.PLUTONIUM
+                local waste_rate = burn_rate / 10.0
+
+                local u_spent_rate = waste_rate
+                local u_pu_rate = util.trinary(is_pu, waste_rate, 0.0)
+                local u_po_rate = util.trinary(not is_pu, math.min(waste_rate, unit.sna_prod_rate), 0.0)
+
+                unit.unit_ps.publish("pu_rate", u_pu_rate)
+                unit.unit_ps.publish("po_rate", u_po_rate)
+
+                unit.unit_ps.publish("sna_in", util.trinary(is_pu, 0, burn_rate))
+
+                if unit.waste_product == types.WASTE_PRODUCT.POLONIUM then
+                    unit.unit_ps.publish("po_pl_rate", u_po_rate)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                    po_pl_rate = po_pl_rate + u_po_rate
+                elseif unit.waste_product == types.WASTE_PRODUCT.ANTI_MATTER then
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", u_po_rate)
+                    po_am_rate = po_am_rate + u_po_rate
+                    u_spent_rate = 0
+                else
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                end
+
+                unit.unit_ps.publish("ws_rate", u_spent_rate)
+
+                pu_rate = pu_rate + u_pu_rate
+                po_rate = po_rate + u_po_rate
+                spent_rate = spent_rate + u_spent_rate
             end
         end
 
         io.facility.ps.publish("burn_sum", burn_rate_sum)
-
+        io.facility.ps.publish("sna_count", sna_count_sum)
-        -- update alarm sounder
+        io.facility.ps.publish("pu_rate", pu_rate)
-        sounder.eval(io.units)
+        io.facility.ps.publish("po_rate", po_rate)
+        io.facility.ps.publish("po_pl_rate", po_pl_rate)
+        io.facility.ps.publish("po_am_rate", po_am_rate)
+        io.facility.ps.publish("spent_waste_rate", spent_rate)
     end
 
     return valid
 end
 
+--#endregion
+
 -- get the IO controller database
 function iocontrol.get_db() return io end
 

coordinator/process.lua

@@ -11,6 +11,7 @@ local FAC_COMMAND = comms.FAC_COMMAND
 local UNIT_COMMAND = comms.UNIT_COMMAND
 
 local PROCESS = types.PROCESS
+local PRODUCT = types.WASTE_PRODUCT
 
 ---@class process_controller
 local process = {}
@@ -24,7 +25,9 @@ local self = {
         burn_target = 0.0,
         charge_target = 0.0,
         gen_target = 0.0,
-        limits = {}
+        limits = {},
+        waste_product = PRODUCT.PLUTONIUM,
+        pu_fallback = false
     }
 }
 
@@ -48,19 +51,23 @@ function process.init(iocontrol, coord_comms)
         log.error("process.init(): failed to load coordinator settings file")
     end
 
+    -- facility auto control configuration
     local config = settings.get("PROCESS")  ---@type coord_auto_config|nil
-
     if type(config) == "table" then
         self.config.mode = config.mode
         self.config.burn_target = config.burn_target
         self.config.charge_target = config.charge_target
         self.config.gen_target = config.gen_target
         self.config.limits = config.limits
+        self.config.waste_product = config.waste_product
+        self.config.pu_fallback = config.pu_fallback
 
         self.io.facility.ps.publish("process_mode", self.config.mode)
         self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
         self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
         self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
+        self.io.facility.ps.publish("process_waste_product", self.config.waste_product)
+        self.io.facility.ps.publish("process_pu_fallback", self.config.pu_fallback)
 
         for id = 1, math.min(#self.config.limits, self.io.facility.num_units) do
             local unit = self.io.units[id]   ---@type ioctl_unit
@@ -68,20 +75,24 @@ function process.init(iocontrol, coord_comms)
         end
 
         log.info("PROCESS: loaded auto control settings from coord.settings")
+
+        -- notify supervisor of auto waste config
+        self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, self.config.waste_product)
+        self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, self.config.pu_fallback)
     end
 
-    local waste_mode = settings.get("WASTE_MODES")  ---@type table|nil
+    -- unit waste states
-
+    local waste_modes = settings.get("WASTE_MODES")  ---@type table|nil
-    if type(waste_mode) == "table" then
+    if type(waste_modes) == "table" then
-        for id, mode in pairs(waste_mode) do
+        for id, mode in pairs(waste_modes) do
             self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
         end
 
-        log.info("PROCESS: loaded waste mode settings from coord.settings")
+        log.info("PROCESS: loaded unit waste mode settings from coord.settings")
     end
 
+    -- unit priority groups
     local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil
-
     if type(prio_groups) == "table" then
         for id, group in pairs(prio_groups) do
             self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group)
@@ -137,7 +148,7 @@ end
 -- set waste mode
 ---@param id integer unit ID
 ---@param mode integer waste mode
-function process.set_waste(id, mode)
+function process.set_unit_waste(id, mode)
     -- publish so that if it fails then it gets reset
     self.io.units[id].unit_ps.publish("U_WasteMode", mode)
 
@@ -153,7 +164,7 @@ function process.set_waste(id, mode)
     settings.set("WASTE_MODES", waste_mode)
 
     if not settings.save("/coord.settings") then
-        log.error("process.set_waste(): failed to save coordinator settings file")
+        log.error("process.set_unit_waste(): failed to save coordinator settings file")
     end
 end
 
@@ -204,6 +215,24 @@ end
 -- AUTO PROCESS CONTROL --
 --------------------------
 
+-- write auto process control to config file
+local function _write_auto_config()
+    -- attempt to load settings
+    if not settings.load("/coord.settings") then
+        log.warning("process._write_auto_config(): failed to load coordinator settings file")
+    end
+
+    -- save config
+    settings.set("PROCESS", self.config)
+    local saved = settings.save("/coord.settings")
+
+    if not saved then
+        log.warning("process._write_auto_config(): failed to save coordinator settings file")
+    end
+
+    return not not saved
+end
+
 -- stop automatic process control
 function process.stop_auto()
     self.comms.send_fac_command(FAC_COMMAND.STOP)
@@ -216,6 +245,30 @@ function process.start_auto()
     log.debug("PROCESS: START AUTO CTL")
 end
 
+-- set automatic process control waste mode
+---@param product WASTE_PRODUCT waste product for auto control
+function process.set_process_waste(product)
+    self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, product)
+
+    log.debug(util.c("PROCESS: SET WASTE ", product))
+
+    -- update config table and save
+    self.config.waste_product = product
+    _write_auto_config()
+end
+
+-- set automatic process control plutonium fallback
+---@param enabled boolean whether to enable plutonium fallback
+function process.set_pu_fallback(enabled)
+    self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, enabled)
+
+    log.debug(util.c("PROCESS: SET PU FALLBACK ", enabled))
+
+    -- update config table and save
+    self.config.pu_fallback = enabled
+    _write_auto_config()
+end
+
 -- save process control settings
 ---@param mode PROCESS control mode
 ---@param burn_target number burn rate target
@@ -223,29 +276,17 @@ end
 ---@param gen_target number generation rate target
 ---@param limits table unit burn rate limits
 function process.save(mode, burn_target, charge_target, gen_target, limits)
-    -- attempt to load settings
+    log.debug("PROCESS: SAVE")
-    if not settings.load("/coord.settings") then
-        log.warning("process.save(): failed to load coordinator settings file")
-    end
 
-    -- config table
+    -- update config table
-    self.config = {
+    self.config.mode = mode
-        mode = mode,
+    self.config.burn_target = burn_target
-        burn_target = burn_target,
+    self.config.charge_target = charge_target
-        charge_target = charge_target,
+    self.config.gen_target = gen_target
-        gen_target = gen_target,
+    self.config.limits = limits
-        limits = limits
-    }
 
     -- save config
-    settings.set("PROCESS", self.config)
+    self.io.facility.save_cfg_ack(_write_auto_config())
-    local saved = settings.save("/coord.settings")
-
-    if not saved then
-        log.warning("process.save(): failed to save coordinator settings file")
-    end
-
-    self.io.facility.save_cfg_ack(saved)
 end
 
 -- handle a start command acknowledgement
@@ -258,16 +299,33 @@ function process.start_ack_handle(response)
     self.config.charge_target = response[4]
     self.config.gen_target = response[5]
 
-    for i = 1, #response[6] do
+    for i = 1, math.min(#response[6], self.io.facility.num_units) do
         self.config.limits[i] = response[6][i]
+
+        local unit = self.io.units[i]   ---@type ioctl_unit
+        unit.unit_ps.publish("burn_limit", self.config.limits[i])
     end
 
-    self.io.facility.ps.publish("auto_mode", self.config.mode)
+    self.io.facility.ps.publish("process_mode", self.config.mode)
-    self.io.facility.ps.publish("burn_target", self.config.burn_target)
+    self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
-    self.io.facility.ps.publish("charge_target", self.config.charge_target)
+    self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
-    self.io.facility.ps.publish("gen_target", self.config.gen_target)
+    self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
 
     self.io.facility.start_ack(ack)
 end
 
+-- record waste product state after attempting to change it
+---@param response WASTE_PRODUCT supervisor waste product state
+function process.waste_ack_handle(response)
+    self.config.waste_product = response
+    self.io.facility.ps.publish("process_waste_product", response)
+end
+
+-- record plutonium fallback state after attempting to change it
+---@param response boolean supervisor plutonium fallback state
+function process.pu_fb_ack_handle(response)
+    self.config.pu_fallback = response
+    self.io.facility.ps.publish("process_pu_fallback", response)
+end
+
 return process

coordinator/renderer.lua

@@ -5,8 +5,13 @@
 local log        = require("scada-common.log")
 local util       = require("scada-common.util")
 
-local style      = require("coordinator.ui.style")
+local iocontrol  = require("coordinator.iocontrol")
 
+local style      = require("coordinator.ui.style")
+local pgi        = require("coordinator.ui.pgi")
+
+local flow_view  = require("coordinator.ui.layout.flow_view")
+local panel_view = require("coordinator.ui.layout.front_panel")
 local main_view  = require("coordinator.ui.layout.main_view")
 local unit_view  = require("coordinator.ui.layout.unit_view")
 
@@ -21,10 +26,14 @@ local engine = {
     monitors = nil,         ---@type monitors_struct|nil
     dmesg_window = nil,     ---@type table|nil
     ui_ready = false,
+    fp_ready = false,
     ui = {
+        front_panel = nil,  ---@type graphics_element|nil
         main_display = nil, ---@type graphics_element|nil
+        flow_display = nil, ---@type graphics_element|nil
         unit_displays = {}
-    }
+    },
+    disable_flow_view = false
 }
 
 -- init a display to the "default", but set text scale to 0.5
@@ -42,39 +51,44 @@ local function _init_display(monitor)
     end
 end
 
+-- disable the flow view
+---@param disable boolean
+function renderer.legacy_disable_flow_view(disable)
+    engine.disable_flow_view = disable
+end
+
 -- link to the monitor peripherals
 ---@param monitors monitors_struct
 function renderer.set_displays(monitors)
     engine.monitors = monitors
-end
 
--- check if the renderer is configured to use a given monitor peripheral
+    -- report to front panel as connected
----@nodiscard
+    iocontrol.fp_monitor_state("main", engine.monitors.primary ~= nil)
----@param periph table peripheral
+    iocontrol.fp_monitor_state("flow", engine.monitors.flow ~= nil)
----@return boolean is_used
+    for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end
-function renderer.is_monitor_used(periph)
-    if engine.monitors ~= nil then
-        if engine.monitors.primary == periph then
-            return true
-        else
-            for _, monitor in ipairs(engine.monitors.unit_displays) do
-                if monitor == periph then return true end
-            end
-        end
-    end
-
-    return false
 end
 
 -- init all displays in use by the renderer
 function renderer.init_displays()
-    -- init primary monitor
+    -- init primary and flow monitors
     _init_display(engine.monitors.primary)
+    if not engine.disable_flow_view then _init_display(engine.monitors.flow) end
 
     -- init unit displays
     for _, monitor in ipairs(engine.monitors.unit_displays) do
         _init_display(monitor)
     end
+
+    -- init terminal
+    term.setTextColor(colors.white)
+    term.setBackgroundColor(colors.black)
+    term.clear()
+    term.setCursorPos(1, 1)
+
+    -- set overridden colors
+    for i = 1, #style.fp.colors do
+        term.setPaletteColor(style.fp.colors[i].c, style.fp.colors[i].hex)
+    end
 end
 
 -- check main display width
@@ -85,6 +99,14 @@ function renderer.validate_main_display_width()
     return w == 164
 end
 
+-- check flow display width
+---@nodiscard
+---@return boolean width_okay
+function renderer.validate_flow_display_width()
+    local w, _ = engine.monitors.flow.getSize()
+    return w == 164
+end
+
 -- check display sizes
 ---@nodiscard
 ---@return boolean valid all unit display dimensions OK
@@ -109,6 +131,51 @@ function renderer.init_dmesg()
     log.direct_dmesg(engine.dmesg_window)
 end
 
+-- start the coordinator front panel
+function renderer.start_fp()
+    if not engine.fp_ready then
+        -- show front panel view on terminal
+        engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
+        panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
+
+        -- start flasher callback task
+        flasher.run()
+
+        -- report front panel as ready
+        engine.fp_ready = true
+    end
+end
+
+-- close out the front panel
+function renderer.close_fp()
+    if engine.fp_ready then
+        if not engine.ui_ready then
+            -- stop blinking indicators
+            flasher.clear()
+        end
+
+        -- disable PGI
+        pgi.unlink()
+
+        -- hide to stop animation callbacks and clear root UI elements
+        engine.ui.front_panel.hide()
+        engine.ui.front_panel = nil
+        engine.fp_ready = false
+
+        -- restore colors
+        for i = 1, #style.colors do
+            local r, g, b = term.nativePaletteColor(style.colors[i].c)
+            term.setPaletteColor(style.colors[i].c, r, g, b)
+        end
+
+        -- reset terminal
+        term.setTextColor(colors.white)
+        term.setBackgroundColor(colors.black)
+        term.clear()
+        term.setCursorPos(1, 1)
+    end
+end
+
 -- start the coordinator GUI
 function renderer.start_ui()
     if not engine.ui_ready then
@@ -116,13 +183,21 @@ function renderer.start_ui()
         engine.dmesg_window.setVisible(false)
 
         -- show main view on main monitor
-        engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root}
+        if engine.monitors.primary ~= nil then
-        main_view(engine.ui.main_display)
+            engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root}
+            main_view(engine.ui.main_display)
+        end
+
+        -- show flow view on flow monitor
+        if engine.monitors.flow ~= nil then
+            engine.ui.flow_display = DisplayBox{window=engine.monitors.flow,fg_bg=style.root}
+            flow_view(engine.ui.flow_display)
+        end
 
         -- show unit views on unit displays
-        for i = 1, #engine.monitors.unit_displays do
+        for idx, display in pairs(engine.monitors.unit_displays) do
-            engine.ui.unit_displays[i] = DisplayBox{window=engine.monitors.unit_displays[i],fg_bg=style.root}
+            engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
-            unit_view(engine.ui.unit_displays[i], i)
+            unit_view(engine.ui.unit_displays[idx], idx)
         end
 
         -- start flasher callback task
@@ -135,18 +210,22 @@ end
 
 -- close out the UI
 function renderer.close_ui()
-    -- stop blinking indicators
+    if not engine.fp_ready then
-    flasher.clear()
+        -- stop blinking indicators
+        flasher.clear()
+    end
 
     -- delete element trees
     if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end
-    for _, display in ipairs(engine.ui.unit_displays) do display.delete() end
+    if engine.ui.flow_display ~= nil then engine.ui.flow_display.delete() end
+    for _, display in pairs(engine.ui.unit_displays) do display.delete() end
 
     -- report ui as not ready
     engine.ui_ready = false
 
     -- clear root UI elements
     engine.ui.main_display = nil
+    engine.ui.flow_display = nil
     engine.ui.unit_displays = {}
 
     -- clear unit monitors
@@ -157,22 +236,145 @@ function renderer.close_ui()
     engine.dmesg_window.redraw()
 end
 
+-- is the front panel ready?
+---@nodiscard
+---@return boolean ready
+function renderer.fp_ready() return engine.fp_ready end
+
 -- is the UI ready?
 ---@nodiscard
 ---@return boolean ready
 function renderer.ui_ready() return engine.ui_ready end
 
+-- handle a monitor peripheral being disconnected
+---@param device table monitor
+---@return boolean is_used if the monitor is one of the configured monitors
+function renderer.handle_disconnect(device)
+    local is_used = false
+
+    if engine.monitors ~= nil then
+        if engine.monitors.primary == device then
+            if engine.ui.main_display ~= nil then
+                -- delete element tree and clear root UI elements
+                engine.ui.main_display.delete()
+            end
+
+            is_used = true
+            engine.monitors.primary = nil
+            engine.ui.main_display = nil
+
+            iocontrol.fp_monitor_state("main", false)
+        elseif engine.monitors.flow == device then
+            if engine.ui.flow_display ~= nil then
+                -- delete element tree and clear root UI elements
+                engine.ui.flow_display.delete()
+            end
+
+            is_used = true
+            engine.monitors.flow = nil
+            engine.ui.flow_display = nil
+
+            iocontrol.fp_monitor_state("flow", false)
+        else
+            for idx, monitor in pairs(engine.monitors.unit_displays) do
+                if monitor == device then
+                    if engine.ui.unit_displays[idx] ~= nil then
+                        engine.ui.unit_displays[idx].delete()
+                    end
+
+                    is_used = true
+                    engine.monitors.unit_displays[idx] = nil
+                    engine.ui.unit_displays[idx] = nil
+
+                    iocontrol.fp_monitor_state(idx, false)
+                    break
+                end
+            end
+        end
+    end
+
+    return is_used
+end
+
+-- handle a monitor peripheral being reconnected
+---@param name string monitor name
+---@param device table monitor
+---@return boolean is_used if the monitor is one of the configured monitors
+function renderer.handle_reconnect(name, device)
+    local is_used = false
+
+    if engine.monitors ~= nil then
+        if engine.monitors.primary_name == name then
+            is_used = true
+            _init_display(device)
+            engine.monitors.primary = device
+
+            local disp_x, disp_y = engine.monitors.primary.getSize()
+            engine.dmesg_window.reposition(1, 1, disp_x, disp_y, engine.monitors.primary)
+
+            if engine.ui_ready and (engine.ui.main_display == nil) then
+                engine.dmesg_window.setVisible(false)
+
+                engine.ui.main_display = DisplayBox{window=device,fg_bg=style.root}
+                main_view(engine.ui.main_display)
+            else
+                engine.dmesg_window.setVisible(true)
+                engine.dmesg_window.redraw()
+            end
+
+            iocontrol.fp_monitor_state("main", true)
+        elseif engine.monitors.flow_name == name then
+            is_used = true
+            _init_display(device)
+            engine.monitors.flow = device
+
+            if engine.ui_ready and (engine.ui.flow_display == nil) then
+                engine.ui.flow_display = DisplayBox{window=device,fg_bg=style.root}
+                flow_view(engine.ui.flow_display)
+            end
+
+            iocontrol.fp_monitor_state("flow", true)
+        else
+            for idx, monitor in ipairs(engine.monitors.unit_name_map) do
+                if monitor == name then
+                    is_used = true
+                    _init_display(device)
+                    engine.monitors.unit_displays[idx] = device
+
+                    if engine.ui_ready and (engine.ui.unit_displays[idx] == nil) then
+                        engine.ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
+                        unit_view(engine.ui.unit_displays[idx], idx)
+                    end
+
+                    iocontrol.fp_monitor_state(idx, true)
+                    break
+                end
+            end
+        end
+    end
+
+    return is_used
+end
+
+
 -- handle a touch event
 ---@param event mouse_interaction|nil
 function renderer.handle_mouse(event)
-    if engine.ui_ready and event ~= nil then
+    if event ~= nil then
-        if event.monitor == engine.monitors.primary_name then
+        if engine.fp_ready and event.monitor == "terminal" then
-            engine.ui.main_display.handle_mouse(event)
+            engine.ui.front_panel.handle_mouse(event)
-        else
+        elseif engine.ui_ready then
-            for id, monitor in ipairs(engine.monitors.unit_name_map) do
+            if event.monitor == engine.monitors.primary_name then
-                if event.monitor == monitor then
+                engine.ui.main_display.handle_mouse(event)
-                    local layout = engine.ui.unit_displays[id]  ---@type graphics_element
+            elseif event.monitor == engine.monitors.flow_name then
-                    layout.handle_mouse(event)
+                engine.ui.flow_display.handle_mouse(event)
+            else
+                for id, monitor in ipairs(engine.monitors.unit_name_map) do
+                    if event.monitor == monitor then
+                        local layout = engine.ui.unit_displays[id]  ---@type graphics_element
+                        layout.handle_mouse(event)
+                        break
+                    end
                 end
             end
         end

coordinator/session/apisessions.lua

@@ -1,16 +1,17 @@
 
-local log    = require("scada-common.log")
+local log       = require("scada-common.log")
-local mqueue = require("scada-common.mqueue")
+local mqueue    = require("scada-common.mqueue")
-local util   = require("scada-common.util")
+local util      = require("scada-common.util")
 
-local config = require("coordinator.config")
+local config    = require("coordinator.config")
+local iocontrol = require("coordinator.iocontrol")
 
-local pocket = require("coordinator.session.pocket")
+local pocket    = require("coordinator.session.pocket")
 
 local apisessions = {}
 
 local self = {
-    modem = nil,
+    nic = nil,
     next_id = 0,
     sessions = {}
 }
@@ -31,7 +32,7 @@ local function _api_handle_outq(session)
         if msg ~= nil then
             if msg.qtype == mqueue.TYPE.PACKET then
                 -- handle a packet to be sent
-                self.modem.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message.raw_sendable())
+                self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
             elseif msg.qtype == mqueue.TYPE.COMMAND then
                 -- handle instruction/notification
             elseif msg.qtype == mqueue.TYPE.DATA then
@@ -41,8 +42,8 @@ local function _api_handle_outq(session)
 
         -- max 100ms spent processing queue
         if util.time() - handle_start > 100 then
-            log.warning("[API] out queue handler exceeded 100ms queue process limit")
+            log.warning("API: out queue handler exceeded 100ms queue process limit")
-            log.warning(util.c("[API] offending session: ", session))
+            log.warning(util.c("API: offending session: ", session))
             break
         end
     end
@@ -58,25 +59,19 @@ local function _shutdown(session)
     while session.out_queue.ready() do
         local msg = session.out_queue.pop()
         if msg ~= nil and msg.qtype == mqueue.TYPE.PACKET then
-            self.modem.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message.raw_sendable())
+            self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
         end
     end
 
-    log.debug(util.c("[API] closed session ", session))
+    log.debug(util.c("API: closed session ", session))
 end
 
 -- PUBLIC FUNCTIONS --
 
 -- initialize apisessions
----@param modem table
+---@param nic nic
-function apisessions.init(modem)
+function apisessions.init(nic)
-    self.modem = modem
+    self.nic = nic
-end
-
--- re-link the modem
----@param modem table
-function apisessions.relink_modem(modem)
-    self.modem = modem
 end
 
 -- find a session by remote port
@@ -118,7 +113,8 @@ function apisessions.establish_session(source_addr, version)
 
     setmetatable(pkt_s, mt)
 
-    log.debug(util.c("[API] established new session: ", pkt_s))
+    iocontrol.fp_pkt_connected(id, version, source_addr)
+    log.debug(util.c("API: established new session: ", pkt_s))
 
     self.next_id = id + 1
 
@@ -134,7 +130,7 @@ function apisessions.check_all_watchdogs(timer_event)
         if session.open then
             local triggered = session.instance.check_wd(timer_event)
             if triggered then
-                log.debug(util.c("[API] watchdog closing session ", session, "..."))
+                log.debug(util.c("API: watchdog closing session ", session, "..."))
                 _shutdown(session)
             end
         end
@@ -160,7 +156,7 @@ function apisessions.free_all_closed()
 
     ---@param session pkt_session_struct
     local on_delete = function (session)
-        log.debug(util.c("[API] free'ing closed session ", session))
+        log.debug(util.c("API: free'ing closed session ", session))
     end
 
     util.filter_table(self.sessions, f, on_delete)

coordinator/session/pocket.lua

@@ -1,7 +1,9 @@
-local comms  = require("scada-common.comms")
+local comms     = require("scada-common.comms")
-local log    = require("scada-common.log")
+local log       = require("scada-common.log")
-local mqueue = require("scada-common.mqueue")
+local mqueue    = require("scada-common.mqueue")
-local util   = require("scada-common.util")
+local util      = require("scada-common.util")
+
+local iocontrol = require("coordinator.iocontrol")
 
 local pocket = {}
 
@@ -9,8 +11,6 @@ local PROTOCOL = comms.PROTOCOL
 -- local CAPI_TYPE = comms.CAPI_TYPE
 local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
 
-local println = util.println
-
 -- retry time constants in ms
 -- local INITIAL_WAIT = 1500
 -- local RETRY_PERIOD = 1000
@@ -69,6 +69,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     local function _close()
         self.conn_watchdog.cancel()
         self.connected = false
+        iocontrol.fp_pkt_disconnected(id)
     end
 
     -- send a CAPI packet
@@ -140,6 +141,8 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
 
                     -- log.debug(log_header .. "PKT RTT = " .. self.last_rtt .. "ms")
                     -- log.debug(log_header .. "PKT TT  = " .. (srv_now - api_send) .. "ms")
+
+                    iocontrol.fp_pkt_rtt(id, self.last_rtt)
                 else
                     log.debug(log_header .. "SCADA keep alive packet length mismatch")
                 end
@@ -172,7 +175,6 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     function public.close()
         _close()
         _send_mgmt(SCADA_MGMT_TYPE.CLOSE, {})
-        println("connection to pocket session " .. id .. " closed by server")
         log.info(log_header .. "session closed by server")
     end
 
@@ -211,7 +213,6 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
 
             -- exit if connection was closed
             if not self.connected then
-                println("connection to pocket session " .. id .. " closed by remote host")
                 log.info(log_header .. "session closed by remote host")
                 return self.connected
             end

coordinator/sounder.lua

@@ -2,269 +2,25 @@
 -- Alarm Sounder
 --
 
+local audio = require("scada-common.audio")
 local log   = require("scada-common.log")
-local types = require("scada-common.types")
-local util  = require("scada-common.util")
-
-local ALARM = types.ALARM
-local ALARM_STATE = types.ALARM_STATE
 
 ---@class sounder
 local sounder = {}
 
--- note: max samples = 0x20000 (128 * 1024 samples)
-
-local _2_PI        = 2 * math.pi    -- 2 whole pies, hope you're hungry
-local _DRATE       = 48000          -- 48kHz audio
-local _MAX_VAL     = 127 / 2        -- max signed integer in this 8-bit audio
-local _05s_SAMPLES = 24000          -- half a second worth of samples
-
-local test_alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
-
 local alarm_ctl = {
     speaker = nil,
     volume = 0.5,
-    playing = false,
+    stream = audio.new_stream()
-    num_active = 0,
-    next_block = 1,
-    -- split audio up into 0.5s samples so specific components can be ended quicker
-    quad_buffer = { {}, {}, {}, {} }
 }
 
--- sounds modeled after https://www.e2s.com/references-and-guidelines/listen-and-download-alarm-tones
-
-local T_340Hz_Int_2Hz = 1
-local T_544Hz_440Hz_Alt = 2
-local T_660Hz_Int_125ms = 3
-local T_745Hz_Int_1Hz = 4
-local T_800Hz_Int = 5
-local T_800Hz_1000Hz_Alt = 6
-local T_1000Hz_Int = 7
-local T_1800Hz_Int_4Hz = 8
-
-local TONES = {
-    { active = false, component = { {}, {}, {}, {} } }, -- 340Hz @ 2Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 544Hz 100mS / 440Hz 400mS Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 660Hz @ 125ms On 125ms Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 745Hz @ 1Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 800Hz @ 0.25s On 1.75s Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 800/1000Hz @ 0.25s Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 1KHz 1s on, 1s off Intermittent
-    { active = false, component = { {}, {}, {}, {} } }  -- 1.8KHz @ 4Hz Intermittent
-}
-
--- calculate how many samples are in the given number of milliseconds
----@nodiscard
----@param ms integer milliseconds
----@return integer samples
-local function ms_to_samples(ms) return math.floor(ms * 48) end
-
---#region Tone Generation (the Maths)
-
--- 340Hz @ 2Hz Intermittent
-local function gen_tone_1()
-    local t, dt = 0, _2_PI * 340 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[1].component[1][i] = val
-        TONES[1].component[3][i] = val
-        TONES[1].component[2][i] = 0
-        TONES[1].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 544Hz 100mS / 440Hz 400mS Alternating
-local function gen_tone_2()
-    local t1, dt1 = 0, _2_PI * 544 / _DRATE
-    local t2, dt2 = 0, _2_PI * 440 / _DRATE
-    local alternate_at = ms_to_samples(100)
-
-    for i = 1, _05s_SAMPLES do
-        local value
-
-        if i <= alternate_at then
-            value = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            value = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[2].component[1][i] = value
-        TONES[2].component[2][i] = value
-        TONES[2].component[3][i] = value
-        TONES[2].component[4][i] = value
-    end
-end
-
--- 660Hz @ 125ms On 125ms Off
-local function gen_tone_3()
-    local elapsed_samples = 0
-    local alternate_after = ms_to_samples(125)
-    local alternate_at = alternate_after
-    local mode = true
-
-    local t, dt = 0, _2_PI * 660 / _DRATE
-
-    for set = 1, 4 do
-        for i = 1, _05s_SAMPLES do
-            if mode then
-                local val = math.floor(math.sin(t) * _MAX_VAL)
-                TONES[3].component[set][i] = val
-                t = (t + dt) % _2_PI
-            else
-                t = 0
-                TONES[3].component[set][i] = 0
-            end
-
-            if elapsed_samples == alternate_at then
-                mode = not mode
-                alternate_at = elapsed_samples + alternate_after
-            end
-
-            elapsed_samples = elapsed_samples + 1
-        end
-    end
-end
-
--- 745Hz @ 1Hz Intermittent
-local function gen_tone_4()
-    local t, dt = 0, _2_PI * 745 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[4].component[1][i] = val
-        TONES[4].component[3][i] = val
-        TONES[4].component[2][i] = 0
-        TONES[4].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 800Hz @ 0.25s On 1.75s Off
-local function gen_tone_5()
-    local t, dt = 0, _2_PI * 800 / _DRATE
-    local stop_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-
-        if i > stop_at then
-            TONES[5].component[1][i] = val
-        else
-            TONES[5].component[1][i] = 0
-        end
-
-        TONES[5].component[2][i] = 0
-        TONES[5].component[3][i] = 0
-        TONES[5].component[4][i] = 0
-
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1000/800Hz @ 0.25s Alternating
-local function gen_tone_6()
-    local t1, dt1 = 0, _2_PI * 1000 / _DRATE
-    local t2, dt2 = 0, _2_PI * 800 / _DRATE
-
-    local alternate_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val
-        if i <= alternate_at then
-            val = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            val = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[6].component[1][i] = val
-        TONES[6].component[2][i] = val
-        TONES[6].component[3][i] = val
-        TONES[6].component[4][i] = val
-    end
-end
-
--- 1KHz 1s on, 1s off Intermittent
-local function gen_tone_7()
-    local t, dt = 0, _2_PI * 1000 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[7].component[1][i] = val
-        TONES[7].component[2][i] = val
-        TONES[7].component[3][i] = 0
-        TONES[7].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1800Hz @ 4Hz Intermittent
-local function gen_tone_8()
-    local t, dt = 0, _2_PI * 1800 / _DRATE
-
-    local off_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = 0
-
-        if i <= off_at then
-            val = math.floor(math.sin(t) * _MAX_VAL)
-            t = (t + dt) % _2_PI
-        end
-
-        TONES[8].component[1][i] = val
-        TONES[8].component[2][i] = val
-        TONES[8].component[3][i] = val
-        TONES[8].component[4][i] = val
-    end
-end
-
---#endregion
-
--- hard audio limiter
----@nodiscard
----@param output number output level
----@return number limited -128.0 to 127.0
-local function limit(output)
-    return math.max(-128, math.min(127, output))
-end
-
--- zero the alarm audio buffer
-local function zero()
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do alarm_ctl.quad_buffer[i][s] = 0 end
-    end
-end
-
--- add an alarm to the output buffer
----@param alarm_idx integer tone ID
-local function add(alarm_idx)
-    alarm_ctl.num_active = alarm_ctl.num_active + 1
-    TONES[alarm_idx].active = true
-
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do
-            alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] + TONES[alarm_idx].component[i][s])
-        end
-    end
-end
-
 -- start audio or continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 local function play()
     if not alarm_ctl.playing then
         alarm_ctl.playing = true
-        alarm_ctl.next_block = 1
-
         return sounder.continue()
-    else
+    else return true end
-        return true
-    end
 end
 
 -- initialize the annunciator alarm system
@@ -273,23 +29,10 @@ end
 function sounder.init(speaker, volume)
     alarm_ctl.speaker = speaker
     alarm_ctl.speaker.stop()
-
     alarm_ctl.volume = volume
-    alarm_ctl.playing = false
+    alarm_ctl.stream.stop()
-    alarm_ctl.num_active = 0
-    alarm_ctl.next_block = 1
 
-    zero()
+    audio.generate_tones()
-
-    -- generate tones
-    gen_tone_1()
-    gen_tone_2()
-    gen_tone_3()
-    gen_tone_4()
-    gen_tone_5()
-    gen_tone_6()
-    gen_tone_7()
-    gen_tone_8()
 end
 
 -- reconnect the speaker peripheral
@@ -297,173 +40,40 @@ end
 function sounder.reconnect(speaker)
     alarm_ctl.speaker = speaker
     alarm_ctl.playing = false
-    alarm_ctl.next_block = 1
+    alarm_ctl.stream.stop()
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
 end
 
--- check alarm state to enable/disable alarms
+-- set alarm tones
----@param units table|nil unit list or nil to use test mode
+---@param states table alarm tone commands from supervisor
-function sounder.eval(units)
+function sounder.set(states)
-    local changed = false
+    -- set tone states
-    local any_active = false
+    for id = 1, #states do alarm_ctl.stream.set_active(id, states[id]) end
-    local new_states = { false, false, false, false, false, false, false, false }
-    local alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
 
-    if units ~= nil then
+    -- re-compute output if needed, then play audio if available
-        -- check all alarms for all units
+    if alarm_ctl.stream.is_recompute_needed() then alarm_ctl.stream.compute_buffer() end
-        for i = 1, #units do
+    if alarm_ctl.stream.any_active() then play() else sounder.stop() end
-            local unit = units[i]   ---@type ioctl_unit
-            for id = 1, #unit.alarms do
-                alarms[id] = alarms[id] or (unit.alarms[id] == ALARM_STATE.TRIPPED)
-            end
-        end
-    else
-        alarms = test_alarms
-    end
-
-    -- containment breach is worst case CRITICAL alarm, this takes priority
-    if alarms[ALARM.ContainmentBreach] then
-        new_states[T_1800Hz_Int_4Hz] = true
-    else
-        -- critical damage is highest priority CRITICAL level alarm
-        if alarms[ALARM.CriticalDamage] then
-            new_states[T_660Hz_Int_125ms] = true
-        else
-            -- EMERGENCY level alarms + URGENT over temp
-            if alarms[ALARM.ReactorDamage] or alarms[ALARM.ReactorOverTemp] or alarms[ALARM.ReactorWasteLeak] then
-                new_states[T_544Hz_440Hz_Alt] = true
-            -- URGENT level turbine trip
-            elseif alarms[ALARM.TurbineTrip] then
-                new_states[T_745Hz_Int_1Hz] = true
-            -- URGENT level reactor lost
-            elseif alarms[ALARM.ReactorLost] then
-                new_states[T_340Hz_Int_2Hz] = true
-            -- TIMELY level alarms
-            elseif alarms[ALARM.ReactorHighTemp] or alarms[ALARM.ReactorHighWaste] or alarms[ALARM.RCSTransient] then
-                new_states[T_800Hz_Int] = true
-            end
-        end
-
-        -- check RPS transient URGENT level alarm
-        if alarms[ALARM.RPSTransient] then
-            new_states[T_1000Hz_Int] = true
-            -- disable really painful audio combination
-            new_states[T_340Hz_Int_2Hz] = false
-        end
-    end
-
-    -- radiation is a big concern, always play this CRITICAL level alarm if active
-    if alarms[ALARM.ContainmentRadiation] then
-        new_states[T_800Hz_1000Hz_Alt] = true
-        -- we are going to disable the RPS trip alarm audio due to conflict, and if it was enabled
-        -- then we can re-enable the reactor lost alarm audio since it doesn't painfully combine with this one
-        if new_states[T_1000Hz_Int] and alarms[ALARM.ReactorLost] then new_states[T_340Hz_Int_2Hz] = true end
-        -- it sounds *really* bad if this is in conjunction with these other tones, so disable them
-        new_states[T_745Hz_Int_1Hz] = false
-        new_states[T_800Hz_Int] = false
-        new_states[T_1000Hz_Int] = false
-    end
-
-    -- check if any changed, check if any active, update active flags
-    for id = 1, #TONES do
-        if new_states[id] ~= TONES[id].active then
-            TONES[id].active = new_states[id]
-            changed = true
-        end
-
-        if TONES[id].active then any_active = true end
-    end
-
-    -- zero and re-add tones if changed
-    if changed then
-        zero()
-
-        for id = 1, #TONES do
-            if TONES[id].active then add(id) end
-        end
-    end
-
-    if any_active then play() else sounder.stop() end
 end
 
 -- stop all audio and clear output buffer
 function sounder.stop()
     alarm_ctl.playing = false
     alarm_ctl.speaker.stop()
-    alarm_ctl.next_block = 1
+    alarm_ctl.stream.stop()
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
-    zero()
 end
 
 -- continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 function sounder.continue()
+    local success = false
+
     if alarm_ctl.playing then
-        if alarm_ctl.speaker ~= nil and #alarm_ctl.quad_buffer[alarm_ctl.next_block] > 0 then
+        if alarm_ctl.speaker ~= nil and alarm_ctl.stream.has_next_block() then
-            local success = alarm_ctl.speaker.playAudio(alarm_ctl.quad_buffer[alarm_ctl.next_block], alarm_ctl.volume)
+            success = alarm_ctl.speaker.playAudio(alarm_ctl.stream.get_next_block(), alarm_ctl.volume)
-
+            if not success then log.error("SOUNDER: error playing audio") end
-            alarm_ctl.next_block = alarm_ctl.next_block + 1
-            if alarm_ctl.next_block > 4 then alarm_ctl.next_block = 1 end
-
-            if not success then
-                log.debug("SOUNDER: error playing audio")
-            end
-
-            return success
-        else
-            return false
-        end
-    else
-        return false
-    end
-end
-
---#region Test Functions
-
-function sounder.test_1() add(1) play() end -- play tone T_340Hz_Int_2Hz
-function sounder.test_2() add(2) play() end -- play tone T_544Hz_440Hz_Alt
-function sounder.test_3() add(3) play() end -- play tone T_660Hz_Int_125ms
-function sounder.test_4() add(4) play() end -- play tone T_745Hz_Int_1Hz
-function sounder.test_5() add(5) play() end -- play tone T_800Hz_Int
-function sounder.test_6() add(6) play() end -- play tone T_800Hz_1000Hz_Alt
-function sounder.test_7() add(7) play() end -- play tone T_1000Hz_Int
-function sounder.test_8() add(8) play() end -- play tone T_1800Hz_Int_4Hz
-
-function sounder.test_breach(active)    test_alarms[ALARM.ContainmentBreach]    = active end    ---@param active boolean
-function sounder.test_rad(active)       test_alarms[ALARM.ContainmentRadiation] = active end    ---@param active boolean
-function sounder.test_lost(active)      test_alarms[ALARM.ReactorLost]          = active end    ---@param active boolean
-function sounder.test_crit(active)      test_alarms[ALARM.CriticalDamage]       = active end    ---@param active boolean
-function sounder.test_dmg(active)       test_alarms[ALARM.ReactorDamage]        = active end    ---@param active boolean
-function sounder.test_overtemp(active)  test_alarms[ALARM.ReactorOverTemp]      = active end    ---@param active boolean
-function sounder.test_hightemp(active)  test_alarms[ALARM.ReactorHighTemp]      = active end    ---@param active boolean
-function sounder.test_wasteleak(active) test_alarms[ALARM.ReactorWasteLeak]     = active end    ---@param active boolean
-function sounder.test_highwaste(active) test_alarms[ALARM.ReactorHighWaste]     = active end    ---@param active boolean
-function sounder.test_rps(active)       test_alarms[ALARM.RPSTransient]         = active end    ---@param active boolean
-function sounder.test_rcs(active)       test_alarms[ALARM.RCSTransient]         = active end    ---@param active boolean
-function sounder.test_turbinet(active)  test_alarms[ALARM.TurbineTrip]          = active end    ---@param active boolean
-
--- power rescaling limiter test
-function sounder.test_power_scale()
-    local start = util.time_ms()
-
-    zero()
-
-    for id = 1, #TONES do
-        if TONES[id].active then
-            for i = 1, 4 do
-                for s = 1, _05s_SAMPLES do
-                    alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] +
-                        (TONES[id].component[i][s] / math.sqrt(alarm_ctl.num_active)))
-                end
-            end
         end
     end
 
-    log.debug("SOUNDER: power rescale test took " .. (util.time_ms() - start) .. "ms")
+    return success
 end
 
---#endregion
-
 return sounder

coordinator/startup.lua

@@ -4,8 +4,10 @@
 
 require("/initenv").init_env()
 
+local comms       = require("scada-common.comms")
 local crash       = require("scada-common.crash")
 local log         = require("scada-common.log")
+local network     = require("scada-common.network")
 local ppm         = require("scada-common.ppm")
 local tcd         = require("scada-common.tcd")
 local util        = require("scada-common.util")
@@ -20,7 +22,7 @@ local sounder     = require("coordinator.sounder")
 
 local apisessions = require("coordinator.session.apisessions")
 
-local COORDINATOR_VERSION = "v0.16.1"
+local COORDINATOR_VERSION = "v1.0.9"
 
 local println = util.println
 local println_ts = util.println_ts
@@ -29,7 +31,7 @@ local log_graphics = coordinator.log_graphics
 local log_sys = coordinator.log_sys
 local log_boot = coordinator.log_boot
 local log_comms = coordinator.log_comms
-local log_comms_connecting = coordinator.log_comms_connecting
+local log_crypto = coordinator.log_crypto
 
 ----------------------------------------
 -- config validation
@@ -78,8 +80,11 @@ local function main()
     -- mount connected devices
     ppm.mount_all()
 
+    -- report versions/init fp PSIL
+    iocontrol.init_fp(COORDINATOR_VERSION, comms.version)
+
     -- setup monitors
-    local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS)
+    local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS, config.DISABLE_FLOW_VIEW == true)
     if not configured or monitors == nil then
         println("startup> monitor setup failed")
         log.fatal("monitor configuration failed")
@@ -87,6 +92,7 @@ local function main()
     end
 
     -- init renderer
+    renderer.legacy_disable_flow_view(config.DISABLE_FLOW_VIEW == true)
     renderer.set_displays(monitors)
     renderer.init_displays()
 
@@ -94,6 +100,10 @@ local function main()
         println("startup> main display must be 8 blocks wide")
         log.fatal("main display not wide enough")
         return
+    elseif (config.DISABLE_FLOW_VIEW ~= true) and not renderer.validate_flow_display_width() then
+        println("startup> flow display must be 8 blocks wide")
+        log.fatal("flow display not wide enough")
+        return
     elseif not renderer.validate_unit_display_sizes() then
         println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks")
         log.fatal("unit display dimensions incorrect")
@@ -125,12 +135,19 @@ local function main()
         sounder.init(speaker, config.SOUNDER_VOLUME)
         log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms")
         log_sys("annunciator alarm configured")
+        iocontrol.fp_has_speaker(true)
     end
 
     ----------------------------------------
     -- setup communications
     ----------------------------------------
 
+    -- message authentication init
+    if type(config.AUTH_KEY) == "string" then
+        local init_time = network.init_mac(config.AUTH_KEY)
+        log_crypto("HMAC init took " .. init_time .. "ms")
+    end
+
     -- get the communications modem
     local modem = ppm.get_wireless_modem()
     if modem == nil then
@@ -140,6 +157,7 @@ local function main()
         return
     else
         log_comms("wireless modem connected")
+        iocontrol.fp_has_modem(true)
     end
 
     -- create connection watchdog
@@ -147,9 +165,10 @@ local function main()
     conn_watchdog.cancel()
     log.debug("startup> conn watchdog created")
 
-    -- start comms, open all channels
+    -- create network interface then setup comms
-    local coord_comms = coordinator.comms(COORDINATOR_VERSION, modem, config.CRD_CHANNEL, config.SVR_CHANNEL,
+    local nic = network.nic(modem)
-                                            config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
+    local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.NUM_UNITS, config.CRD_CHANNEL,
+                                            config.SVR_CHANNEL, config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
     log.debug("startup> comms init")
     log_comms("comms initialized")
 
@@ -158,78 +177,54 @@ local function main()
     local loop_clock = util.new_clock(MAIN_CLOCK)
 
     ----------------------------------------
-    -- connect to the supervisor
+    -- start front panel & UI start function
     ----------------------------------------
 
-    -- attempt to connect to the supervisor or exit
+    log_graphics("starting front panel UI...")
-    local function init_connect_sv()
-        local tick_waiting, task_done = log_comms_connecting("attempting to connect to configured supervisor on channel " .. config.SVR_CHANNEL)
 
-        -- attempt to establish a connection with the supervisory computer
+    local fp_ok, fp_message = pcall(renderer.start_fp)
-        if not coord_comms.sv_connect(60, tick_waiting, task_done) then
+    if not fp_ok then
-            log_sys("supervisor connection failed, shutting down...")
+        renderer.close_fp()
-            log.fatal("failed to connect to supervisor")
+        log_graphics(util.c("front panel UI error: ", fp_message))
-            return false
+        println_ts("front panel UI creation failed")
-        end
+        log.fatal(util.c("front panel GUI render failed with error ", fp_message))
-
-        return true
-    end
-
-    if not init_connect_sv() then
-        println("startup> failed to connect to supervisor")
-        log_sys("system shutdown")
         return
-    else
+    else log_graphics("front panel ready") end
-        log_sys("supervisor connected, proceeding to UI start")
-    end
 
-    ----------------------------------------
+    -- start up the main UI
-    -- start the UI
-    ----------------------------------------
-
-    -- start up the UI
     ---@return boolean ui_ok started ok
-    local function init_start_ui()
+    local function start_main_ui()
-        log_graphics("starting UI...")
+        log_graphics("starting main UI...")
 
         local draw_start = util.time_ms()
 
-        local ui_ok, message = pcall(renderer.start_ui)
+        local ui_ok, ui_message = pcall(renderer.start_ui)
         if not ui_ok then
             renderer.close_ui()
-            log_graphics(util.c("UI crashed: ", message))
+            log_graphics(util.c("main UI error: ", ui_message))
-            println_ts("UI crashed")
+            log.fatal(util.c("main GUI render failed with error ", ui_message))
-            log.fatal(util.c("GUI crashed with error ", message))
         else
-            log_graphics("first UI draw took " .. (util.time_ms() - draw_start) .. "ms")
+            log_graphics("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
-
-            -- start clock
-            loop_clock.start()
         end
 
         return ui_ok
     end
 
-    local ui_ok = init_start_ui()
-
     ----------------------------------------
     -- main event loop
     ----------------------------------------
 
+    local link_failed = false
+    local ui_ok = true
     local date_format = util.trinary(config.TIME_24_HOUR, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y")
 
-    local no_modem = false
+    -- start clock
+    loop_clock.start()
 
-    if ui_ok then
+    log_sys("system started successfully")
-        -- start connection watchdog
-        conn_watchdog.feed()
-        log.debug("startup> conn watchdog started")
-
-        log_sys("system started successfully")
-    end
 
     -- main event loop
-    while ui_ok do
+    while true do
         local event, param1, param2, param3, param4, param5 = util.pull_event()
 
         -- handle event
@@ -239,33 +234,36 @@ local function main()
             if type ~= nil and device ~= nil then
                 if type == "modem" then
                     -- we only really care if this is our wireless modem
-                    if device == modem then
+                    -- if it is another modem, handle other peripheral losses separately
-                        no_modem = true
+                    if nic.is_modem(device) then
+                        nic.disconnect()
                         log_sys("comms modem disconnected")
-                        println_ts("wireless modem disconnected!")
 
-                        -- close out UI
+                        local other_modem = ppm.get_wireless_modem()
-                        renderer.close_ui()
+                        if other_modem then
+                            log_sys("found another wireless modem, using it for comms")
+                            nic.connect(other_modem)
+                        else
+                            -- close out main UI
+                            renderer.close_ui()
 
-                        -- alert user to status
+                            -- alert user to status
-                        log_sys("awaiting comms modem reconnect...")
+                            log_sys("awaiting comms modem reconnect...")
+
+                            iocontrol.fp_has_modem(false)
+                        end
                     else
                         log_sys("non-comms modem disconnected")
                     end
                 elseif type == "monitor" then
-                    if renderer.is_monitor_used(device) then
+                    if renderer.handle_disconnect(device) then
-                        -- "halt and catch fire" style handling
+                        log_sys("lost a configured monitor")
-                        local msg = "lost a configured monitor, system will now exit"
-                        println_ts(msg)
-                        log_sys(msg)
-                        break
                     else
-                        log_sys("lost unused monitor, ignoring")
+                        log_sys("lost an unused monitor")
                     end
                 elseif type == "speaker" then
-                    local msg = "lost alarm sounder speaker"
+                    log_sys("lost alarm sounder speaker")
-                    println_ts(msg)
+                    iocontrol.fp_has_speaker(false)
-                    log_sys(msg)
                 end
             end
         elseif event == "peripheral" then
@@ -273,34 +271,50 @@ local function main()
 
             if type ~= nil and device ~= nil then
                 if type == "modem" then
-                    if device.isWireless() then
+                    if device.isWireless() and not nic.is_connected() then
                         -- reconnected modem
-                        no_modem = false
-                        modem = device
-                        coord_comms.reconnect_modem(modem)
-
                         log_sys("comms modem reconnected")
-                        println_ts("wireless modem reconnected.")
+                        nic.connect(device)
-
+                        iocontrol.fp_has_modem(true)
-                        -- re-init system
+                    elseif device.isWireless() then
-                        if not init_connect_sv() then break end
+                        log.info("unused wireless modem reconnected")
-                        ui_ok = init_start_ui()
                     else
                         log_sys("wired modem reconnected")
                     end
-                -- elseif type == "monitor" then
+                elseif type == "monitor" then
-                    -- not supported, system will exit on loss of in-use monitors
+                    if renderer.handle_reconnect(param1, device) then
+                        log_sys(util.c("configured monitor ", param1, " reconnected"))
+                    else
+                        log_sys(util.c("unused monitor ", param1, " connected"))
+                    end
                 elseif type == "speaker" then
-                    local msg = "alarm sounder speaker reconnected"
+                    log_sys("alarm sounder speaker reconnected")
-                    println_ts(msg)
-                    log_sys(msg)
                     sounder.reconnect(device)
+                    iocontrol.fp_has_speaker(true)
                 end
             end
         elseif event == "timer" then
             if loop_clock.is_clock(param1) then
                 -- main loop tick
 
+                -- toggle heartbeat
+                iocontrol.heartbeat()
+
+                -- maintain connection
+                if nic.is_connected() then
+                    local ok, start_ui = coord_comms.try_connect()
+                    if not ok then
+                        link_failed = true
+                        log_sys("supervisor connection failed, shutting down...")
+                        log.fatal("failed to connect to supervisor")
+                        break
+                    elseif start_ui then
+                        log_sys("supervisor connected, proceeding to main UI start")
+                        ui_ok = start_main_ui()
+                        if not ui_ok then break end
+                    end
+                end
+
                 -- iterate sessions
                 apisessions.iterate_all()
 
@@ -308,25 +322,19 @@ local function main()
                 apisessions.free_all_closed()
 
                 -- update date and time string for main display
-                iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
+                if coord_comms.is_linked() then
+                    iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
+                end
 
                 loop_clock.start()
             elseif conn_watchdog.is_timer(param1) then
                 -- supervisor watchdog timeout
-                local msg = "supervisor server timeout"
+                log_comms("supervisor server timeout")
-                log_comms(msg)
-                println_ts(msg)
 
-                -- close connection, UI, and stop sounder
+                -- close connection, main UI, and stop sounder
                 coord_comms.close()
                 renderer.close_ui()
                 sounder.stop()
-
-                if not no_modem then
-                    -- try to re-connect to the supervisor
-                    if not init_connect_sv() then break end
-                    ui_ok = init_start_ui()
-                end
             else
                 -- a non-clock/main watchdog timer event
 
@@ -339,25 +347,19 @@ local function main()
         elseif event == "modem_message" then
             -- got a packet
             local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
-            coord_comms.handle_packet(packet)
 
-            -- check if it was a disconnect
+            -- handle then check if it was a disconnect
-            if not coord_comms.is_linked() then
+            if coord_comms.handle_packet(packet) then
                 log_comms("supervisor closed connection")
 
-                -- close connection, UI, and stop sounder
+                -- close connection, main UI, and stop sounder
                 coord_comms.close()
                 renderer.close_ui()
                 sounder.stop()
-
-                if not no_modem then
-                    -- try to re-connect to the supervisor
-                    if not init_connect_sv() then break end
-                    ui_ok = init_start_ui()
-                end
             end
-        elseif event == "monitor_touch" then
+        elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
-            -- handle a monitor touch event
+               event == "mouse_drag" or event == "mouse_scroll" then
+            -- handle a mouse event
             renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
         elseif event == "speaker_audio_empty" then
             -- handle speaker buffer emptied
@@ -366,10 +368,17 @@ local function main()
 
         -- check for termination request
         if event == "terminate" or ppm.should_terminate() then
-            println_ts("terminate requested, closing connections...")
+            -- handle supervisor connection
-            log_comms("terminate requested, closing supervisor connection...")
+            coord_comms.try_connect(true)
+
+            if coord_comms.is_linked() then
+                log_comms("terminate requested, closing supervisor connection...")
+            else link_failed = true end
+
             coord_comms.close()
             log_comms("supervisor connection closed")
+
+            -- handle API sessions
             log_comms("closing api sessions...")
             apisessions.close_all()
             log_comms("api sessions closed")
@@ -378,15 +387,23 @@ local function main()
     end
 
     renderer.close_ui()
+    renderer.close_fp()
     sounder.stop()
     log_sys("system shutdown")
 
+    if link_failed then println_ts("failed to connect to supervisor") end
+    if not ui_ok then println_ts("main UI creation failed") end
+
+    -- close on error exit (such as UI error)
+    if coord_comms.is_linked() then coord_comms.close() end
+
     println_ts("exited")
     log.info("exited")
 end
 
 if not xpcall(main, crash.handler) then
     pcall(renderer.close_ui)
+    pcall(renderer.close_fp)
     pcall(sounder.stop)
     crash.exit()
 else

coordinator/ui/components/imatrix.lua

@@ -83,9 +83,7 @@ local function new_view(root, x, y, data, ps, id)
     local function calc_saturation(val)
         if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then
             return val / data.build.transfer_cap
-        else
+        else return 0 end
-            return 0
-        end
     end
 
     charge.register(ps, "energy_fill", charge.update)

coordinator/ui/components/pkt_entry.lua

@@ -0,0 +1,48 @@
+--
+-- Pocket Connection Entry
+--
+
+local iocontrol     = require("coordinator.iocontrol")
+
+local core          = require("graphics.core")
+
+local Div           = require("graphics.elements.div")
+local TextBox       = require("graphics.elements.textbox")
+
+local DataIndicator = require("graphics.elements.indicators.data")
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local cpair = core.cpair
+
+-- create a pocket list entry
+---@param parent graphics_element parent
+---@param id integer PKT session ID
+local function init(parent, id)
+    local ps = iocontrol.get_db().fp.ps
+
+    -- root div
+    local root = Div{parent=parent,x=2,y=2,height=4,width=parent.get_width()-2,hidden=true}
+    local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=cpair(colors.black,colors.white)}
+
+    local ps_prefix = "pkt_" .. id .. "_"
+
+    TextBox{parent=entry,x=1,y=1,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
+    local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=TEXT_ALIGN.CENTER,width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray),nav_active=cpair(colors.gray,colors.black)}
+    TextBox{parent=entry,x=1,y=3,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
+    pkt_addr.register(ps, ps_prefix .. "addr", pkt_addr.set_value)
+
+    TextBox{parent=entry,x=10,y=2,text="FW:",width=3,height=1}
+    local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    pkt_fw_v.register(ps, ps_prefix .. "fw", pkt_fw_v.set_value)
+
+    TextBox{parent=entry,x=35,y=2,text="RTT:",width=4,height=1}
+    local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=cpair(colors.lightGray,colors.white)}
+    TextBox{parent=entry,x=46,y=2,text="ms",width=4,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    pkt_rtt.register(ps, ps_prefix .. "rtt", pkt_rtt.update)
+    pkt_rtt.register(ps, ps_prefix .. "rtt_color", pkt_rtt.recolor)
+
+    return root
+end
+
+return init

coordinator/ui/components/process_ctl.lua

@@ -15,8 +15,10 @@ local TextBox           = require("graphics.elements.textbox")
 local DataIndicator     = require("graphics.elements.indicators.data")
 local IndicatorLight    = require("graphics.elements.indicators.light")
 local RadIndicator      = require("graphics.elements.indicators.rad")
+local StateIndicator    = require("graphics.elements.indicators.state")
 local TriIndicatorLight = require("graphics.elements.indicators.trilight")
 
+local Checkbox          = require("graphics.elements.controls.checkbox")
 local HazardButton      = require("graphics.elements.controls.hazard_button")
 local RadioButton       = require("graphics.elements.controls.radio_button")
 local SpinboxNumeric    = require("graphics.elements.controls.spinbox_numeric")
@@ -26,6 +28,16 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 local cpair = core.cpair
 local border = core.border
 
+local bw_fg_bg = style.bw_fg_bg
+local lu_cpair = style.lu_colors
+local hzd_fg_bg  = style.hzd_fg_bg
+local dis_colors = style.dis_colors
+
+local ind_grn = style.ind_grn
+local ind_yel = style.ind_yel
+local ind_red = style.ind_red
+local ind_wht = style.ind_wht
+
 local period = core.flasher.PERIOD
 
 -- new process control view
@@ -38,12 +50,7 @@ local function new_view(root, x, y)
     local facility = iocontrol.get_db().facility
     local units = iocontrol.get_db().units
 
-    local bw_fg_bg   = cpair(colors.black, colors.white)
+    local main = Div{parent=root,width=128,height=24,x=x,y=y}
-    local hzd_fg_bg  = cpair(colors.white, colors.gray)
-    local lu_cpair   = cpair(colors.gray, colors.gray)
-    local dis_colors = cpair(colors.white, colors.lightGray)
-
-    local main = Div{parent=root,width=104,height=24,x=x,y=y}
 
     local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
     local ack_a = HazardButton{parent=main,x=16,y=1,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=process.fac_ack_alarms,fg_bg=hzd_fg_bg}
@@ -51,20 +58,22 @@ local function new_view(root, x, y)
     facility.scram_ack = scram.on_response
     facility.ack_alarms_ack = ack_a.on_response
 
-    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=cpair(colors.green,colors.red)}
+    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=ind_grn}
-    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=cpair(colors.green,colors.gray)}
     local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
+    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=ind_grn}
+    local sps     = IndicatorLight{parent=main,label="SPS Connected",colors=ind_grn}
 
     all_ok.register(facility.ps, "all_sys_ok", all_ok.update)
-    ind_mat.register(facility.induction_ps_tbl[1], "computed_status", function (status) ind_mat.update(status > 1) end)
     rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update)
+    ind_mat.register(facility.induction_ps_tbl[1], "computed_status", function (status) ind_mat.update(status > 1) end)
+    sps.register(facility.sps_ps_tbl[1], "computed_status", function (status) sps.update(status > 1) end)
 
     main.line_break()
 
-    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=cpair(colors.green,colors.red)}
+    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=ind_grn}
-    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=cpair(colors.green,colors.gray)}
+    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=ind_grn}
-    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=ind_wht,flash=true,period=period.BLINK_250_MS}
-    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=cpair(colors.yellow,colors.gray)}
+    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=ind_yel}
 
     auto_ready.register(facility.ps, "auto_ready", auto_ready.update)
     auto_act.register(facility.ps, "auto_active", auto_act.update)
@@ -73,12 +82,12 @@ local function new_view(root, x, y)
 
     main.line_break()
 
-    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=ind_red,flash=true,period=period.BLINK_250_MS}
-    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
-    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=ind_red,flash=true,period=period.BLINK_500_MS}
-    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=ind_red,flash=true,period=period.BLINK_250_MS}
-    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
-    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
 
     auto_scram.register(facility.ps, "auto_scram", auto_scram.update)
     matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update)
@@ -99,7 +108,7 @@ local function new_view(root, x, y)
     -- process control --
     ---------------------
 
-    local proc = Div{parent=main,width=78,height=24,x=27,y=1}
+    local proc = Div{parent=main,width=103,height=24,x=27,y=1}
 
     -----------------------------
     -- process control targets --
@@ -148,46 +157,77 @@ local function new_view(root, x, y)
 
     local rate_limits = {}
 
-    for i = 1, facility.num_units do
+    for i = 1, 4 do
-        local unit = units[i]   ---@type ioctl_unit
+        local unit
+        local tag_fg_bg = cpair(colors.gray,colors.white)
+        local lim_fg_bg = cpair(colors.lightGray,colors.white)
+        local ctl_fg    = colors.lightGray
+        local cur_fg_bg = cpair(colors.lightGray,colors.white)
+        local cur_lu    = colors.lightGray
+
+        if i <= facility.num_units then
+            unit = units[i]   ---@type ioctl_unit
+            tag_fg_bg = cpair(colors.black,colors.lightBlue)
+            lim_fg_bg = bw_fg_bg
+            ctl_fg    = colors.gray
+            cur_fg_bg = cpair(colors.black,colors.brown)
+            cur_lu    = colors.black
+        end
 
         local _y = ((i - 1) * 5) + 1
 
-        local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)}
+        local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2}
 
-        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(colors.gray,colors.white)}
+        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(ctl_fg,colors.white)}
-        rate_limits[i] = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
+        local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=lim_fg_bg}
         TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1}
 
-        rate_limits[i].register(unit.unit_ps, "max_burn", rate_limits[i].set_max)
+        local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(cur_lu,cur_lu),width=14,fg_bg=cur_fg_bg}
-        rate_limits[i].register(unit.unit_ps, "burn_limit", rate_limits[i].set_value)
 
-        local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(colors.black,colors.black),width=14,fg_bg=cpair(colors.black,colors.brown)}
+        if i <= facility.num_units then
+            rate_limits[i] = lim
+            rate_limits[i].register(unit.unit_ps, "max_burn", rate_limits[i].set_max)
+            rate_limits[i].register(unit.unit_ps, "burn_limit", rate_limits[i].set_value)
 
-        cur_burn.register(unit.unit_ps, "act_burn_rate", cur_burn.update)
+            cur_burn.register(unit.unit_ps, "act_burn_rate", cur_burn.update)
+        else
+            lim.disable()
+        end
     end
 
     -------------------
     -- unit statuses --
     -------------------
 
-    local stat_div = Div{parent=proc,width=38,height=19,x=57,y=6}
+    local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6}
 
-    for i = 1, facility.num_units do
+    for i = 1, 4 do
-        local unit = units[i]   ---@type ioctl_unit
+        local tag_fg_bg = cpair(colors.gray, colors.white)
+        local ind_fg_bg = cpair(colors.lightGray, colors.white)
+        local ind_off = colors.lightGray
+
+        if i <= facility.num_units then
+            tag_fg_bg = cpair(colors.black, colors.cyan)
+            ind_fg_bg = bw_fg_bg
+            ind_off = colors.gray
+        end
 
         local _y = ((i - 1) * 5) + 1
 
-        local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)}
+        local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2}
 
-        local lights   = Div{parent=stat_div,x=9,y=_y,width=12,height=4,fg_bg=bw_fg_bg}
+        local lights   = Div{parent=stat_div,x=9,y=_y,width=14,height=4,fg_bg=ind_fg_bg}
-        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,colors.gray)}
+        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,ind_off)}
-        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,ind_off),flash=true,period=period.BLINK_250_MS}
 
-        ready.register(unit.unit_ps, "U_AutoReady", ready.update)
+        if i <= facility.num_units then
-        degraded.register(unit.unit_ps, "U_AutoDegraded", degraded.update)
+            local unit = units[i]   ---@type ioctl_unit
+
+            ready.register(unit.unit_ps, "U_AutoReady", ready.update)
+            degraded.register(unit.unit_ps, "U_AutoDegraded", degraded.update)
+        end
     end
 
     -------------------------
@@ -195,7 +235,7 @@ local function new_view(root, x, y)
     -------------------------
 
     local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" }
-    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.purple,colors.black),radio_bg=colors.gray}
+    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.purple}
 
     mode.register(facility.ps, "process_mode", mode.set_value)
 
@@ -261,6 +301,60 @@ local function new_view(root, x, y)
             for i = 1, #rate_limits do rate_limits[i].enable() end
         end
     end)
+
+    ------------------------------
+    -- waste production control --
+    ------------------------------
+
+    local waste_status = Div{parent=proc,width=24,height=4,x=57,y=1,}
+
+    for i = 1, facility.num_units do
+        local unit = units[i]   ---@type ioctl_unit
+
+        TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8,height=1}
+        local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=ind_wht}
+        local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6}
+
+        a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update)
+        waste_m.register(unit.unit_ps, "U_WasteProduct", waste_m.update)
+    end
+
+    local waste_sel = Div{parent=proc,width=21,height=24,x=81,y=1}
+
+    TextBox{parent=waste_sel,text=" ",width=21,height=1,x=1,y=1,fg_bg=cpair(colors.black,colors.brown)}
+    TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=TEXT_ALIGN.CENTER,width=21,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.brown)}
+
+    local rect   = Rectangle{parent=waste_sel,border=border(1,colors.brown,true),width=21,height=22,x=1,y=3}
+    local status = StateIndicator{parent=rect,x=2,y=1,states=style.waste.states,value=1,min_width=17}
+
+    status.register(facility.ps, "current_waste_product", status.update)
+
+    local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.brown}
+    local pu_fallback = Checkbox{parent=rect,x=2,y=7,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.green,colors.black)}
+
+    waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value)
+    pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
+
+    local fb_active  = IndicatorLight{parent=rect,x=2,y=9,label="Fallback Active",colors=ind_wht}
+
+    fb_active.register(facility.ps, "pu_fallback_active", fb_active.update)
+
+    TextBox{parent=rect,x=2,y=11,text="Plutonium Rate",height=1,width=17,fg_bg=style.label}
+    local pu_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+
+    TextBox{parent=rect,x=2,y=14,text="Polonium Rate",height=1,width=17,fg_bg=style.label}
+    local po_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+
+    TextBox{parent=rect,x=2,y=17,text="Antimatter Rate",height=1,width=17,fg_bg=style.label}
+    local am_rate = DataIndicator{parent=rect,x=2,label="",unit="\xb5B/t",format="%12d",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+
+    pu_rate.register(facility.ps, "pu_rate", pu_rate.update)
+    po_rate.register(facility.ps, "po_rate", po_rate.update)
+    am_rate.register(facility.ps, "am_rate", am_rate.update)
+
+    local sna_count = DataIndicator{parent=rect,x=2,y=20,label="Linked SNAs:",format="%4d",value=0,lu_colors=lu_cpair,width=17}
+
+    sna_count.register(facility.ps, "sna_count", sna_count.update)
 end
 
 return new_view

coordinator/ui/components/turbine.lua

@@ -32,7 +32,7 @@ local function new_view(root, x, y, ps)
 
     status.register(ps, "computed_status", status.update)
     prod_rate.register(ps, "prod_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end)
-    flow_rate.register(ps, "flow_rate", flow_rate.update)
+    flow_rate.register(ps, "steam_input_rate", flow_rate.update)
 
     local steam  = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
     local energy = VerticalBar{parent=turbine,x=3,y=1,fg_bg=cpair(colors.green,colors.gray),height=4,width=1}

coordinator/ui/components/unit_detail.lua

@@ -31,30 +31,16 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 local cpair = core.cpair
 local border = core.border
 
-local period = core.flasher.PERIOD
+local bw_fg_bg = style.bw_fg_bg
+local lu_cpair = style.lu_colors
+local hzd_fg_bg = style.hzd_fg_bg
 
-local waste_opts = {
+local ind_grn = style.ind_grn
-    {
+local ind_yel = style.ind_yel
-        text = "Auto",
+local ind_red = style.ind_red
-        fg_bg = cpair(colors.black, colors.lightGray),
+local ind_wht = style.ind_wht
-        active_fg_bg = cpair(colors.white, colors.gray)
+
-    },
+local period = core.flasher.PERIOD
-    {
-        text = "Pu",
-        fg_bg = cpair(colors.black, colors.lightGray),
-        active_fg_bg = cpair(colors.black, colors.green)
-    },
-    {
-        text = "Po",
-        fg_bg = cpair(colors.black, colors.lightGray),
-        active_fg_bg = cpair(colors.black, colors.cyan)
-    },
-    {
-        text = "AM",
-        fg_bg = cpair(colors.black, colors.lightGray),
-        active_fg_bg = cpair(colors.black, colors.purple)
-    }
-}
 
 -- create a unit view
 ---@param parent graphics_element parent
@@ -62,18 +48,17 @@ local waste_opts = {
 local function init(parent, id)
     local unit = iocontrol.get_db().units[id]   ---@type ioctl_unit
     local f_ps = iocontrol.get_db().facility.ps
+
+    local main = Div{parent=parent,x=1,y=1}
+
+    if unit == nil then return main end
+
     local u_ps = unit.unit_ps
     local b_ps = unit.boiler_ps_tbl
     local t_ps = unit.turbine_ps_tbl
 
-    local main = Div{parent=parent,x=1,y=1}
-
     TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
 
-    local bw_fg_bg  = cpair(colors.black, colors.white)
-    local hzd_fg_bg = cpair(colors.white, colors.gray)
-    local lu_cpair  = cpair(colors.gray, colors.gray)
-
     -----------------------------
     -- main stats and core map --
     -----------------------------
@@ -160,7 +145,7 @@ local function init(parent, id)
 
     -- connectivity
     local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)}
-    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=cpair(colors.white,colors.gray)}
+    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=ind_wht}
     local rad_mon    = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
 
     plc_online.register(u_ps, "PLCOnline", plc_online.update)
@@ -170,25 +155,25 @@ local function init(parent, id)
     annunciator.line_break()
 
     -- operating state
-    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=cpair(colors.green,colors.gray)}
+    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=ind_grn}
-    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=cpair(colors.white,colors.gray)}
+    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=ind_wht}
 
     r_active.register(u_ps, "status", r_active.update)
     r_auto.register(u_ps, "AutoControl", r_auto.update)
 
     -- main unit transient/warning annunciator panel
-    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
+    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=ind_red}
-    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
+    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=ind_red}
-    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
+    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=ind_red}
-    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=cpair(colors.yellow,colors.gray)}
+    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=ind_yel}
-    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=cpair(colors.red,colors.gray)}
+    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=ind_red}
-    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=cpair(colors.yellow,colors.gray)}
+    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=ind_yel}
-    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant  Level Low",colors=cpair(colors.yellow,colors.gray)}
+    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant  Level Low",colors=ind_yel}
-    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=cpair(colors.red,colors.gray)}
+    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=ind_red}
-    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=cpair(colors.yellow,colors.gray)}
+    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=ind_yel}
-    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=cpair(colors.yellow,colors.gray)}
+    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=ind_yel}
-    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=cpair(colors.yellow,colors.gray)}
+    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=ind_yel}
-    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=cpair(colors.yellow,colors.gray)}
+    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=ind_yel}
 
     r_scram.register(u_ps, "ReactorSCRAM", r_scram.update)
     r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update)
@@ -209,15 +194,15 @@ local function init(parent, id)
     local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9}
     local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1}
 
-    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
-    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
-    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=cpair(colors.yellow,colors.gray)}
+    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=ind_yel}
-    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=cpair(colors.yellow,colors.gray)}
+    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=ind_yel}
-    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
-    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=cpair(colors.yellow,colors.gray)}
+    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=ind_yel}
-    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=cpair(colors.yellow,colors.gray)}
+    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=ind_yel}
-    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
-    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
     local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS}
 
     rps_trp.register(u_ps, "rps_tripped", rps_trp.update)
@@ -238,12 +223,12 @@ local function init(parent, id)
     local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1}
     local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7}
 
-    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=cpair(colors.yellow,colors.gray)}
+    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=ind_yel}
     local c_emg  = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green}
-    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
+    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=ind_yel}
-    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=cpair(colors.yellow,colors.gray)}
+    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=ind_yel}
-    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
+    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=ind_yel}
-    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=cpair(colors.yellow,colors.gray)}
+    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=ind_yel}
 
     c_flt.register(u_ps, "RCSFault", c_flt.update)
     c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
@@ -266,11 +251,11 @@ local function init(parent, id)
 
     if unit.num_boilers > 0 then
         TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
+        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
         b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update)
 
         TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update)
     end
     if unit.num_boilers > 1 then
@@ -282,11 +267,11 @@ local function init(parent, id)
         end
 
         TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
+        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
         b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update)
 
         TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update)
     end
 
@@ -299,15 +284,15 @@ local function init(parent, id)
     t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update)
 
     TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
     t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update)
 
     TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
     t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update)
 
     TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
     t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update)
 
     if unit.num_turbines > 1 then
@@ -320,15 +305,15 @@ local function init(parent, id)
         t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update)
 
         TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update)
 
         TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update)
 
         TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update)
     end
 
@@ -340,15 +325,15 @@ local function init(parent, id)
         t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update)
 
         TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update)
 
         TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update)
 
         TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update)
     end
 
@@ -363,7 +348,7 @@ local function init(parent, id)
     TextBox{parent=burn_control,x=9,y=2,text="mB/t"}
 
     local set_burn = function () unit.set_burn(burn_rate.get_value()) end
-    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=dis_colors,callback=set_burn}
+    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=dis_colors,callback=set_burn}
 
     burn_rate.register(u_ps, "burn_rate", burn_rate.set_value)
     burn_rate.register(u_ps, "max_burn", burn_rate.set_max)
@@ -398,7 +383,7 @@ local function init(parent, id)
     local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49}
     local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1}
 
-    local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=waste_opts,callback=unit.set_waste,min_width=6}
+    local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=style.waste.unit_opts,callback=unit.set_waste,min_width=6}
 
     waste_mode.register(u_ps, "U_WasteMode", waste_mode.set_value)
 
@@ -495,7 +480,7 @@ local function init(parent, id)
     auto_div.line_break()
 
     local function set_group() unit.set_group(group.get_value() - 1) end
-    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
+    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
 
     auto_div.line_break()
 
@@ -506,8 +491,8 @@ local function init(parent, id)
 
     auto_div.line_break()
 
-    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=cpair(colors.green,colors.gray)}
+    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=ind_grn}
-    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_1000_MS}
+    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=ind_wht,flash=true,period=period.BLINK_1000_MS}
 
     a_rdy.register(u_ps, "U_AutoReady", a_rdy.update)
 

coordinator/ui/components/unit_flow.lua

@@ -0,0 +1,225 @@
+--
+-- Basic Unit Flow Overview
+--
+
+local util              = require("scada-common.util")
+
+local style             = require("coordinator.ui.style")
+
+local core              = require("graphics.core")
+
+local Div               = require("graphics.elements.div")
+local PipeNetwork       = require("graphics.elements.pipenet")
+local TextBox           = require("graphics.elements.textbox")
+
+local Rectangle         = require("graphics.elements.rectangle")
+
+local DataIndicator     = require("graphics.elements.indicators.data")
+
+local IndicatorLight    = require("graphics.elements.indicators.light")
+local TriIndicatorLight = require("graphics.elements.indicators.trilight")
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local sprintf = util.sprintf
+
+local cpair = core.cpair
+local border = core.border
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+local bw_fg_bg = style.bw_fg_bg
+local text_c = style.text_colors
+local lu_c = style.lu_colors
+
+local ind_grn = style.ind_grn
+local ind_wht = style.ind_wht
+
+-- make a new unit flow window
+---@param parent graphics_element parent
+---@param x integer top left x
+---@param y integer top left y
+---@param wide boolean whether to render wide version
+---@param unit ioctl_unit unit database entry
+local function make(parent, x, y, wide, unit)
+    local height = 16
+
+    local v_start = 1 + ((unit.unit_id - 1) * 5)
+    local prv_start = 1 + ((unit.unit_id - 1) * 3)
+    local v_fields = { "pu", "po", "pl", "am" }
+    local v_names = {
+        sprintf("PV%02d-PU", v_start),
+        sprintf("PV%02d-PO", v_start + 1),
+        sprintf("PV%02d-PL", v_start + 2),
+        sprintf("PV%02d-AM", v_start + 3),
+        sprintf("PRV%02d", prv_start),
+        sprintf("PRV%02d", prv_start + 1),
+        sprintf("PRV%02d", prv_start + 2)
+    }
+
+    assert(parent.get_height() >= (y + height), "flow display not of sufficient vertical resolution (add an additional row of monitors) " .. y .. "," .. parent.get_height())
+
+    local function _wide(a, b) return util.trinary(wide, a, b) end
+
+    -- bounding box div
+    local root = Div{parent=parent,x=x,y=y,width=_wide(136, 114),height=height}
+
+    local lg_gray = cpair(colors.lightGray, colors.gray)
+
+    ------------------
+    -- COOLING LOOP --
+    ------------------
+
+    local reactor = Rectangle{parent=root,x=1,y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=reactor,y=1,text="FISSION REACTOR",alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=reactor,y=3,text="UNIT #"..unit.unit_id,alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=19,y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+    TextBox{parent=root,x=3,y=5,text="\x19",width=1,height=1,fg_bg=lg_gray}
+
+    local rc_pipes = {}
+
+    local emc_x = 42    -- emergency coolant connection x point
+
+    if unit.num_boilers > 0 then
+        table.insert(rc_pipes, pipe(0, 1, _wide(28, 19), 1, colors.lightBlue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(28, 19), 3, colors.orange, true))
+        table.insert(rc_pipes, pipe(_wide(46 ,39), 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(_wide(46,39), 3, _wide(72,58), 3, colors.white, true))
+    else
+        emc_x = 3
+        table.insert(rc_pipes, pipe(0, 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(72,58), 3, colors.white, true))
+    end
+
+    if unit.has_tank then
+        table.insert(rc_pipes, pipe(emc_x, 1, emc_x, 0, colors.blue, true, true))
+    end
+
+    local prv_yo = math.max(3 - unit.num_turbines, 0)
+    for i = 1, unit.num_turbines do
+        local py = 2 * (i - 1) + prv_yo
+        table.insert(rc_pipes, pipe(_wide(92, 78), py, _wide(104, 83), py, colors.white, true))
+    end
+
+    PipeNetwork{parent=root,x=20,y=1,pipes=rc_pipes,bg=colors.lightGray}
+
+    if unit.num_boilers > 0 then
+        local cc_rate = DataIndicator{parent=root,x=_wide(25,22),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+        local hc_rate = DataIndicator{parent=root,x=_wide(25,22),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+
+        cc_rate.register(unit.unit_ps, "boiler_boil_sum", function (sum) cc_rate.update(sum * 10) end)
+        hc_rate.register(unit.unit_ps, "heating_rate", hc_rate.update)
+
+        local boiler = Rectangle{parent=root,x=_wide(47,40),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
+        TextBox{parent=boiler,y=1,text="THERMO-ELECTRIC",alignment=TEXT_ALIGN.CENTER,height=1}
+        TextBox{parent=boiler,y=3,text=util.trinary(unit.num_boilers>1,"BOILERS","BOILER"),alignment=TEXT_ALIGN.CENTER,height=1}
+        TextBox{parent=root,x=_wide(47,40),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+        TextBox{parent=root,x=_wide(65,58),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+        local wt_rate = DataIndicator{parent=root,x=_wide(71,61),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+        local st_rate = DataIndicator{parent=root,x=_wide(71,61),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "boiler_boil_sum", st_rate.update)
+    else
+        local wt_rate = DataIndicator{parent=root,x=28,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+        local st_rate = DataIndicator{parent=root,x=28,y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "heating_rate", st_rate.update)
+    end
+
+    local turbine = Rectangle{parent=root,x=_wide(93,79),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=turbine,y=1,text="STEAM TURBINE",alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=turbine,y=3,text=util.trinary(unit.num_turbines>1,"GENERATORS","GENERATOR"),alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=_wide(93,79),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+    for i = 1, unit.num_turbines do
+        local ry = 1 + (2 * (i - 1)) + prv_yo
+        TextBox{parent=root,x=_wide(125,103),y=ry,text="\x10\x11\x7f",fg_bg=text_c,width=3,height=1}
+        local state = TriIndicatorLight{parent=root,x=_wide(129,107),y=ry,label=v_names[i+4],c1=colors.gray,c2=colors.yellow,c3=colors.red}
+        state.register(unit.turbine_ps_tbl[i], "SteamDumpOpen", state.update)
+    end
+
+    ----------------------
+    -- WASTE PROCESSING --
+    ----------------------
+
+    local waste = Div{parent=root,x=3,y=6}
+
+    local waste_pipes = {
+        pipe(0, 0, _wide(19, 16), 1, colors.brown, true),
+        pipe(_wide(14, 13), 1, _wide(19, 17), 5, colors.brown, true),
+        pipe(_wide(22, 19), 1, _wide(49, 45), 1, colors.brown, true),
+        pipe(_wide(22, 19), 5, _wide(28, 24), 5, colors.brown, true),
+
+        pipe(_wide(64, 53), 1, _wide(95, 81), 1, colors.green, true),
+
+        pipe(_wide(48, 43), 4, _wide(71, 61), 4, colors.cyan, true),
+        pipe(_wide(66, 57), 4, _wide(71, 61), 8, colors.cyan, true),
+        pipe(_wide(74, 63), 4, _wide(95, 81), 4, colors.cyan, true),
+        pipe(_wide(74, 63), 8, _wide(133, 111), 8, colors.cyan, true),
+
+        pipe(_wide(108, 94), 1, _wide(132, 110), 6, colors.black, true, true),
+        pipe(_wide(108, 94), 4, _wide(111, 95), 1, colors.black, true, true),
+        pipe(_wide(132, 110), 6, _wide(130, 108), 6, colors.black, true, true)
+    }
+
+    PipeNetwork{parent=waste,x=1,y=1,pipes=waste_pipes,bg=colors.lightGray}
+
+    local function _valve(vx, vy, n)
+        TextBox{parent=waste,x=vx,y=vy,text="\x10\x11",fg_bg=text_c,width=2,height=1}
+        local conn = IndicatorLight{parent=waste,x=vx-3,y=vy+1,label=v_names[n],colors=ind_grn}
+        local open = IndicatorLight{parent=waste,x=vx-3,y=vy+2,label="OPEN",colors=ind_wht}
+        conn.register(unit.unit_ps, util.c("V_", v_fields[n], "_conn"), conn.update)
+        open.register(unit.unit_ps, util.c("V_", v_fields[n], "_state"), open.update)
+    end
+
+    local function _machine(mx, my, name)
+        local l = string.len(name) + 2
+        TextBox{parent=waste,x=mx,y=my,text=string.rep("\x8f",l),alignment=TEXT_ALIGN.CENTER,fg_bg=lg_gray,width=l,height=1}
+        TextBox{parent=waste,x=mx,y=my+1,text=name,alignment=TEXT_ALIGN.CENTER,fg_bg=wh_gray,width=l,height=1}
+    end
+
+    local waste_rate = DataIndicator{parent=waste,x=1,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=bw_fg_bg}
+    local pu_rate = DataIndicator{parent=waste,x=_wide(82,70),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local po_rate = DataIndicator{parent=waste,x=_wide(52,45),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local popl_rate = DataIndicator{parent=waste,x=_wide(82,70),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local poam_rate = DataIndicator{parent=waste,x=_wide(82,70),y=10,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local spent_rate = DataIndicator{parent=waste,x=_wide(117,99),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+
+    waste_rate.register(unit.unit_ps, "act_burn_rate", waste_rate.update)
+    pu_rate.register(unit.unit_ps, "pu_rate", pu_rate.update)
+    po_rate.register(unit.unit_ps, "po_rate", po_rate.update)
+    popl_rate.register(unit.unit_ps, "po_pl_rate", popl_rate.update)
+    poam_rate.register(unit.unit_ps, "po_am_rate", poam_rate.update)
+    spent_rate.register(unit.unit_ps, "ws_rate", spent_rate.update)
+
+    _valve(_wide(21, 18), 2, 1)
+    _valve(_wide(21, 18), 6, 2)
+    _valve(_wide(73, 62), 5, 3)
+    _valve(_wide(73, 62), 9, 4)
+
+    _machine(_wide(51, 45), 1, "CENTRIFUGE \x1a");
+    _machine(_wide(97, 83), 1, "PRC [Pu] \x1a");
+    _machine(_wide(97, 83), 4, "PRC [Po] \x1a");
+    _machine(_wide(116, 94), 6, "SPENT WASTE \x1b")
+
+    TextBox{parent=waste,x=_wide(30,25),y=3,text="SNAs [Po]",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sna_po  = Rectangle{parent=waste,x=_wide(30,25),y=4,border=border(1,colors.gray,true),width=19,height=7,thin=true,fg_bg=bw_fg_bg}
+    local sna_act = IndicatorLight{parent=sna_po,label="ACTIVE",colors=ind_grn}
+    local sna_cnt = DataIndicator{parent=sna_po,x=12,y=1,lu_colors=lu_c,label="CNT",unit="",format="%2d",value=0,width=7}
+    local sna_pk = DataIndicator{parent=sna_po,y=3,lu_colors=lu_c,label="PEAK",unit="mB/t",format="%7.2f",value=0,width=17}
+    local sna_max = DataIndicator{parent=sna_po,lu_colors=lu_c,label="MAX",unit="mB/t",format="%8.2f",value=0,width=17}
+    local sna_in = DataIndicator{parent=sna_po,lu_colors=lu_c,label="IN",unit="mB/t",format="%9.2f",value=0,width=17}
+
+    sna_act.register(unit.unit_ps, "po_rate", function (r) sna_act.update(r > 0) end)
+    sna_cnt.register(unit.unit_ps, "sna_count", sna_cnt.update)
+    sna_pk.register(unit.unit_ps, "sna_peak_rate", sna_pk.update)
+    sna_max.register(unit.unit_ps, "sna_prod_rate", sna_max.update)
+    sna_in.register(unit.unit_ps, "sna_in", sna_in.update)
+
+    return root
+end
+
+return make

coordinator/ui/components/unit_overview.lua

@@ -34,7 +34,7 @@ local function make(parent, x, y, unit)
 
     if num_boilers == 0 and num_turbines == 1 then
         height = 9
-    elseif num_boilers == 1 and num_turbines <= 2 then
+    elseif num_boilers <= 1 and num_turbines <= 2 then
         height = 17
     end
 

coordinator/ui/layout/flow_view.lua

@@ -0,0 +1,381 @@
+--
+-- Flow Monitor GUI
+--
+
+local types          = require("scada-common.types")
+local util           = require("scada-common.util")
+
+local iocontrol      = require("coordinator.iocontrol")
+
+local style          = require("coordinator.ui.style")
+
+local unit_flow      = require("coordinator.ui.components.unit_flow")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local PipeNetwork    = require("graphics.elements.pipenet")
+local Rectangle      = require("graphics.elements.rectangle")
+local TextBox        = require("graphics.elements.textbox")
+
+local DataIndicator  = require("graphics.elements.indicators.data")
+local HorizontalBar  = require("graphics.elements.indicators.hbar")
+local IndicatorLight = require("graphics.elements.indicators.light")
+local StateIndicator = require("graphics.elements.indicators.state")
+
+local CONTAINER_MODE = types.CONTAINER_MODE
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local cpair = core.cpair
+local border = core.border
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+local bw_fg_bg = style.bw_fg_bg
+local text_col = style.text_colors
+local lu_col = style.lu_colors
+
+-- create new flow view
+---@param main graphics_element main displaybox
+local function init(main)
+    local facility = iocontrol.get_db().facility
+    local units = iocontrol.get_db().units
+
+    local tank_defs = facility.tank_defs
+    local tank_list = facility.tank_list
+
+    -- window header message
+    local header = TextBox{parent=main,y=1,text="Facility Coolant and Waste Flow Monitor",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
+    -- max length example: "01:23:45 AM - Wednesday, September 28 2022"
+    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=TEXT_ALIGN.RIGHT,width=42,height=1,fg_bg=style.header}
+
+    datetime.register(facility.ps, "date_time", datetime.set_value)
+
+    local po_pipes = {}
+    local water_pipes = {}
+
+    -- get the y offset for this unit index
+    ---@param idx integer unit index
+    local function y_ofs(idx) return ((idx - 1) * 20) end
+
+    -- determinte facility tank start/end from the definitions list
+    ---@param start_idx integer start index of table iteration
+    ---@param end_idx integer end index of table iteration
+    local function find_fdef(start_idx, end_idx)
+        local first, last = 4, 0
+        for i = start_idx, end_idx do
+            if tank_defs[i] == 2 then
+                last = i
+                if i < first then first = i end
+            end
+        end
+        return first, last
+    end
+
+    if facility.tank_mode == 0 or facility.tank_mode == 8 then
+        -- (0) tanks belong to reactor units OR (8) 4 total facility tanks (A B C D)
+        for i = 1, facility.num_units do
+            if units[i].has_tank then
+                local y = y_ofs(i)
+                table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+    else
+        -- setup connections for units with emergency coolant, always the same
+        for i = 1, #tank_defs do
+            if tank_defs[i] > 0 then
+                local y = y_ofs(i)
+
+                if tank_defs[i] == 2 then
+                    table.insert(water_pipes, pipe(1, y, 21, y, colors.blue, true))
+                else
+                    table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                    table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+                end
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+
+        if facility.tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef, last_fdef = find_fdef(1, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef, last_fdef = find_fdef(1, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if tank_defs[a] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(a), 1, y_ofs(a) + 6, colors.blue, true))
+                    if tank_defs[b] == 2 then
+                        table.insert(water_pipes, pipe(0, y_ofs(b) - 13, 1, y_ofs(b), colors.blue, true))
+                    end
+                elseif tank_defs[b] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(b), 1, y_ofs(b) + 6, colors.blue, true))
+                end
+            end
+        elseif facility.tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef, last_fdef = find_fdef(2, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef, last_fdef = find_fdef(1, math.min(2, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 3 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef, last_fdef = find_fdef(2, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef, last_fdef = find_fdef(3, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 2 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        end
+    end
+
+    local flow_x = 3
+    if #water_pipes > 0 then
+        flow_x = 25
+        PipeNetwork{parent=main,x=2,y=3,pipes=water_pipes,bg=colors.lightGray}
+    end
+
+    for i = 1, facility.num_units do
+        local y_offset = y_ofs(i)
+        unit_flow(main, flow_x, 5 + y_offset, #water_pipes == 0, units[i])
+        table.insert(po_pipes, pipe(0, 3 + y_offset, 4, 0, colors.cyan, true, true))
+    end
+
+    PipeNetwork{parent=main,x=139,y=15,pipes=po_pipes,bg=colors.lightGray}
+
+    -----------------
+    -- tank valves --
+    -----------------
+
+    local next_f_id = 1
+
+    for i = 1, #tank_defs do
+        if tank_defs[i] > 0 then
+            local vy = 3 + y_ofs(i)
+
+            TextBox{parent=main,x=12,y=vy,text="\x10\x11",fg_bg=cpair(colors.black,colors.lightGray),width=2,height=1}
+
+            local conn = IndicatorLight{parent=main,x=9,y=vy+1,label=util.sprintf("PV%02d-EMC", i * 5),colors=style.ind_grn}
+            local open = IndicatorLight{parent=main,x=9,y=vy+2,label="OPEN",colors=style.ind_wht}
+
+            conn.register(units[i].unit_ps, "V_emc_conn", conn.update)
+            open.register(units[i].unit_ps, "V_emc_state", open.update)
+        end
+    end
+
+    -------------------
+    -- dynamic tanks --
+    -------------------
+
+    for i = 1, #tank_list do
+        if tank_list[i] > 0 then
+            local id = "U-" .. i
+            local f_id = next_f_id
+            if tank_list[i] == 2 then
+                id = "F-" .. next_f_id
+                next_f_id = next_f_id + 1
+            end
+
+            local y_offset = y_ofs(i)
+
+            local tank = Div{parent=main,x=3,y=7+y_offset,width=20,height=14}
+
+            TextBox{parent=tank,text=" ",height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
+            TextBox{parent=tank,text="DYNAMIC TANK "..id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.wh_gray}
+
+            local tank_box = Rectangle{parent=tank,border=border(1,colors.gray,true),width=20,height=12}
+
+            local status = StateIndicator{parent=tank_box,x=3,y=1,states=style.dtank.states,value=1,min_width=14}
+
+            TextBox{parent=tank_box,x=2,y=3,text="Fill",height=1,width=10,fg_bg=style.label}
+            local tank_pcnt = DataIndicator{parent=tank_box,x=10,y=3,label="",format="%5.2f",value=100,unit="%",lu_colors=lu_col,width=8,fg_bg=text_col}
+            local tank_amnt = DataIndicator{parent=tank_box,x=2,label="",format="%13d",value=0,commas=true,unit="mB",lu_colors=lu_col,width=16,fg_bg=bw_fg_bg}
+
+            TextBox{parent=tank_box,x=2,y=6,text="Water Level",height=1,width=11,fg_bg=style.label}
+            local level = HorizontalBar{parent=tank_box,x=2,y=7,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=16}
+
+            TextBox{parent=tank_box,x=2,y=9,text="In/Out Mode",height=1,width=11,fg_bg=style.label}
+            local can_fill = IndicatorLight{parent=tank_box,x=2,y=10,label="FILL",colors=style.ind_wht}
+            local can_empty = IndicatorLight{parent=tank_box,x=10,y=10,label="EMPTY",colors=style.ind_wht}
+
+            local function _can_fill(mode)
+                can_fill.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.FILL))
+            end
+
+            local function _can_empty(mode)
+                can_empty.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.EMPTY))
+            end
+
+            if tank_list[i] == 1 then
+                status.register(units[i].tank_ps_tbl[1], "computed_status", status.update)
+                tank_pcnt.register(units[i].tank_ps_tbl[1], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(units[i].tank_ps_tbl[1], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(units[i].tank_ps_tbl[1], "fill", level.update)
+                can_fill.register(units[i].tank_ps_tbl[1], "container_mode", _can_fill)
+                can_empty.register(units[i].tank_ps_tbl[1], "container_mode", _can_empty)
+            else
+                status.register(facility.tank_ps_tbl[f_id], "computed_status", status.update)
+                tank_pcnt.register(facility.tank_ps_tbl[f_id], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(facility.tank_ps_tbl[f_id], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(facility.tank_ps_tbl[f_id], "fill", level.update)
+                can_fill.register(facility.tank_ps_tbl[f_id], "container_mode", _can_fill)
+                can_empty.register(facility.tank_ps_tbl[f_id], "container_mode", _can_empty)
+            end
+        end
+    end
+
+    ---------
+    -- SPS --
+    ---------
+
+    local sps = Div{parent=main,x=140,y=3,height=12}
+
+    TextBox{parent=sps,text=" ",width=24,height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
+    TextBox{parent=sps,text="SPS",alignment=TEXT_ALIGN.CENTER,width=24,height=1,fg_bg=wh_gray}
+
+    local sps_box = Rectangle{parent=sps,border=border(1,colors.gray,true),width=24,height=10}
+
+    local status = StateIndicator{parent=sps_box,x=5,y=1,states=style.sps.states,value=1,min_width=14}
+
+    status.register(facility.sps_ps_tbl[1], "computed_status", status.update)
+
+    TextBox{parent=sps_box,x=2,y=3,text="Input Rate",height=1,width=10,fg_bg=style.label}
+    local sps_in = DataIndicator{parent=sps_box,x=2,label="",format="%15.3f",value=0,unit="mB/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
+
+    sps_in.register(facility.ps, "po_am_rate", sps_in.update)
+
+    TextBox{parent=sps_box,x=2,y=6,text="Production Rate",height=1,width=15,fg_bg=style.label}
+    local sps_rate = DataIndicator{parent=sps_box,x=2,label="",format="%15d",value=0,unit="\xb5B/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
+
+    sps_rate.register(facility.sps_ps_tbl[1], "process_rate", function (r) sps_rate.update(r * 1000) end)
+
+    ----------------
+    -- statistics --
+    ----------------
+
+    TextBox{parent=main,x=145,y=16,text="PROC. WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local pr_waste  = Rectangle{parent=main,x=145,y=17,border=border(1,colors.gray,true),width=19,height=5,thin=true,fg_bg=bw_fg_bg}
+    local pu = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Pu",unit="mB/t",format="%9.3f",value=0,width=17}
+    local po = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Po",unit="mB/t",format="%9.3f",value=0,width=17}
+    local popl = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="PoPl",unit="mB/t",format="%7.3f",value=0,width=17}
+
+    pu.register(facility.ps, "pu_rate", pu.update)
+    po.register(facility.ps, "po_rate", po.update)
+    popl.register(facility.ps, "po_pl_rate", popl.update)
+
+    TextBox{parent=main,x=145,y=23,text="SPENT WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sp_waste  = Rectangle{parent=main,x=145,y=24,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=bw_fg_bg}
+    local sum_sp_waste = DataIndicator{parent=sp_waste,lu_colors=lu_col,label="SUM",unit="mB/t",format="%8.3f",value=0,width=17}
+
+    sum_sp_waste.register(facility.ps, "spent_waste_rate", sum_sp_waste.update)
+end
+
+return init

coordinator/ui/layout/front_panel.lua

@@ -0,0 +1,124 @@
+--
+-- Coordinator Front Panel GUI
+--
+
+local types         = require("scada-common.types")
+local util          = require("scada-common.util")
+
+local iocontrol     = require("coordinator.iocontrol")
+
+local pgi           = require("coordinator.ui.pgi")
+local style         = require("coordinator.ui.style")
+
+local pkt_entry     = require("coordinator.ui.components.pkt_entry")
+
+local core          = require("graphics.core")
+
+local Div           = require("graphics.elements.div")
+local ListBox       = require("graphics.elements.listbox")
+local MultiPane     = require("graphics.elements.multipane")
+local TextBox       = require("graphics.elements.textbox")
+
+local TabBar        = require("graphics.elements.controls.tabbar")
+
+local LED           = require("graphics.elements.indicators.led")
+local RGBLED        = require("graphics.elements.indicators.ledrgb")
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local cpair = core.cpair
+
+-- create new front panel view
+---@param panel graphics_element main displaybox
+---@param num_units integer number of units (number of unit monitors)
+local function init(panel, num_units)
+    local ps = iocontrol.get_db().fp.ps
+
+    TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.fp.header}
+
+    local page_div = Div{parent=panel,x=1,y=3}
+
+    --
+    -- system indicators
+    --
+
+    local main_page = Div{parent=page_div,x=1,y=1}
+
+    local system = Div{parent=main_page,width=14,height=17,x=2,y=2}
+
+    local status = LED{parent=system,label="STATUS",colors=cpair(colors.green,colors.red)}
+    local heartbeat = LED{parent=system,label="HEARTBEAT",colors=cpair(colors.green,colors.green_off)}
+    status.update(true)
+    system.line_break()
+
+    heartbeat.register(ps, "heartbeat", heartbeat.update)
+
+    local modem = LED{parent=system,label="MODEM",colors=cpair(colors.green,colors.green_off)}
+    local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,colors.gray}}
+    network.update(types.PANEL_LINK_STATE.DISCONNECTED)
+    system.line_break()
+
+    modem.register(ps, "has_modem", modem.update)
+    network.register(ps, "link_state", network.update)
+
+    local speaker = LED{parent=system,label="SPEAKER",colors=cpair(colors.green,colors.green_off)}
+    speaker.register(ps, "has_speaker", speaker.update)
+
+---@diagnostic disable-next-line: undefined-field
+    local comp_id = util.sprintf("(%d)", os.getComputerID())
+    TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)}
+
+    local monitors = Div{parent=main_page,width=16,height=17,x=18,y=2}
+
+    local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=cpair(colors.green,colors.green_off)}
+    main_monitor.register(ps, "main_monitor", main_monitor.update)
+
+    local flow_monitor = LED{parent=monitors,label="FLOW MONITOR",colors=cpair(colors.green,colors.green_off)}
+    flow_monitor.register(ps, "flow_monitor", flow_monitor.update)
+
+    monitors.line_break()
+
+    for i = 1, num_units do
+        local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=cpair(colors.green,colors.green_off)}
+        unit_monitor.register(ps, "unit_monitor_" .. i, unit_monitor.update)
+    end
+
+    --
+    -- about footer
+    --
+
+    local about   = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=cpair(colors.lightGray,colors.ivory)}
+    local fw_v    = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
+    local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
+
+    fw_v.register(ps, "version", function (version) fw_v.set_value(util.c("FW: ", version)) end)
+    comms_v.register(ps, "comms_version", function (version) comms_v.set_value(util.c("NT: v", version)) end)
+
+    --
+    -- page handling
+    --
+
+    -- API page
+
+    local api_page = Div{parent=page_div,x=1,y=1,hidden=true}
+    local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=cpair(colors.black,colors.ivory),nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
+    local _ = Div{parent=api_list,height=1,hidden=true} -- padding
+
+    -- assemble page panes
+
+    local panes = { main_page, api_page }
+
+    local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
+
+    local tabs = {
+        { name = "CRD", color = cpair(colors.black, colors.ivory) },
+        { name = "API", color = cpair(colors.black, colors.ivory) },
+    }
+
+    TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=cpair(colors.black,colors.white)}
+
+    -- link pocket API list management to PGI
+    pgi.link_elements(api_list, pkt_entry)
+end
+
+return init

coordinator/ui/layout/main_view.lua

@@ -9,7 +9,7 @@ local iocontrol     = require("coordinator.iocontrol")
 local style         = require("coordinator.ui.style")
 
 local imatrix       = require("coordinator.ui.components.imatrix")
-local process_ctl   = require("coordinator.ui.components.processctl")
+local process_ctl   = require("coordinator.ui.components.process_ctl")
 local unit_overview = require("coordinator.ui.components.unit_overview")
 
 local core          = require("graphics.core")

coordinator/ui/pgi.lua

@@ -0,0 +1,60 @@
+--
+-- Protected Graphics Interface
+--
+
+local log  = require("scada-common.log")
+local util = require("scada-common.util")
+
+local pgi = {}
+
+local data = {
+    pkt_list = nil,     ---@type nil|graphics_element
+    pkt_entry = nil,    ---@type function
+    -- session entries
+    s_entries = { pkt = {} }
+}
+
+-- link list boxes
+---@param pkt_list graphics_element pocket list element
+---@param pkt_entry function pocket entry constructor
+function pgi.link_elements(pkt_list, pkt_entry)
+    data.pkt_list = pkt_list
+    data.pkt_entry = pkt_entry
+end
+
+-- unlink all fields, disabling the PGI
+function pgi.unlink()
+    data.pkt_list = nil
+    data.pkt_entry = nil
+end
+
+-- add a PKT entry to the PKT list
+---@param session_id integer pocket session
+function pgi.create_pkt_entry(session_id)
+    if data.pkt_list ~= nil and data.pkt_entry ~= nil then
+        local success, result = pcall(data.pkt_entry, data.pkt_list, session_id)
+
+        if success then
+            data.s_entries.pkt[session_id] = result
+        else
+            log.error(util.c("PGI: failed to create PKT entry (", result, ")"), true)
+        end
+    end
+end
+
+-- delete a PKT entry from the PKT list
+---@param session_id integer pocket session
+function pgi.delete_pkt_entry(session_id)
+    if data.s_entries.pkt[session_id] ~= nil then
+        local success, result = pcall(data.s_entries.pkt[session_id].delete)
+        data.s_entries.pkt[session_id] = nil
+
+        if not success then
+            log.error(util.c("PGI: failed to delete PKT entry (", result, ")"), true)
+        end
+    else
+        log.debug(util.c("PGI: tried to delete unknown PKT entry ", session_id))
+    end
+end
+
+return pgi

coordinator/ui/style.lua

@@ -10,6 +10,41 @@ local cpair = core.cpair
 
 -- GLOBAL --
 
+-- add color mappings for front panel
+colors.ivory = colors.pink
+colors.yellow_hc = colors.purple
+colors.red_off = colors.brown
+colors.yellow_off = colors.magenta
+colors.green_off = colors.lime
+
+-- front panel styling
+
+style.fp = {}
+
+style.fp.root = cpair(colors.black, colors.ivory)
+style.fp.header = cpair(colors.black, colors.lightGray)
+
+style.fp.colors = {
+    { c = colors.red,       hex = 0xdf4949 },   -- RED ON
+    { c = colors.orange,    hex = 0xffb659 },
+    { c = colors.yellow,    hex = 0xf9fb53 },   -- YELLOW ON
+    { c = colors.lime,      hex = 0x16665a },   -- GREEN OFF
+    { c = colors.green,     hex = 0x6be551 },   -- GREEN ON
+    { c = colors.cyan,      hex = 0x34bac8 },
+    { c = colors.lightBlue, hex = 0x6cc0f2 },
+    { c = colors.blue,      hex = 0x0096ff },
+    { c = colors.purple,    hex = 0xb156ee },   -- YELLOW HIGH CONTRAST
+    { c = colors.pink,      hex = 0xdcd9ca },   -- IVORY
+    { c = colors.magenta,   hex = 0x85862c },   -- YELLOW OFF
+    -- { c = colors.white,     hex = 0xdcd9ca },
+    { c = colors.lightGray, hex = 0xb1b8b3 },
+    { c = colors.gray,      hex = 0x575757 },
+    -- { c = colors.black,     hex = 0x191919 },
+    { c = colors.brown,     hex = 0x672223 }    -- RED OFF
+}
+
+-- main GUI styling
+
 style.root = cpair(colors.black, colors.lightGray)
 style.header = cpair(colors.white, colors.gray)
 style.label = cpair(colors.gray, colors.lightGray)
@@ -33,7 +68,22 @@ style.colors = {
     -- { c = colors.brown,     hex = 0x7f664c }
 }
 
--- MAIN LAYOUT --
+-- COMMON COLOR PAIRS --
+
+style.wh_gray = cpair(colors.white, colors.gray)
+
+style.bw_fg_bg = cpair(colors.black, colors.white)
+style.text_colors = cpair(colors.black, colors.lightGray)
+style.lu_colors = cpair(colors.gray, colors.gray)
+style.hzd_fg_bg  = style.wh_gray
+style.dis_colors = cpair(colors.white, colors.lightGray)
+
+style.ind_grn = cpair(colors.green, colors.gray)
+style.ind_yel = cpair(colors.yellow, colors.gray)
+style.ind_red = cpair(colors.red, colors.gray)
+style.ind_wht = style.wh_gray
+
+-- UI COMPONENTS --
 
 style.reactor = {
     -- reactor states
@@ -151,8 +201,121 @@ style.imatrix = {
         {
             color = cpair(colors.black, colors.yellow),
             text = "HIGH  CHARGE"
+        }
+    }
+}
+
+style.sps = {
+    -- SPS states
+    states = {
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "OFF-LINE"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "NOT FORMED"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "RTU  FAULT"
+        },
+        {
+            color = cpair(colors.white, colors.gray),
+            text = "IDLE"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "ACTIVE"
+        }
+    }
+}
+
+style.dtank = {
+    -- dynamic tank states
+    states = {
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "OFF-LINE"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "NOT FORMED"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "RTU  FAULT"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "ONLINE"
+        },
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "LOW FILL"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "FILLED"
         },
     }
 }
 
+style.waste = {
+    -- auto waste processing states
+    states = {
+        {
+            color = cpair(colors.black, colors.green),
+            text = "PLUTONIUM"
+        },
+        {
+            color = cpair(colors.black, colors.cyan),
+            text = "POLONIUM"
+        },
+        {
+            color = cpair(colors.black, colors.purple),
+            text = "ANTI MATTER"
+        }
+    },
+    states_abbrv = {
+        {
+            color = cpair(colors.black, colors.green),
+            text = "Pu"
+        },
+        {
+            color = cpair(colors.black, colors.cyan),
+            text = "Po"
+        },
+        {
+            color = cpair(colors.black, colors.purple),
+            text = "AM"
+        }
+    },
+    -- process radio button options
+    options = { "Plutonium", "Polonium", "Antimatter" },
+    -- unit waste selection
+    unit_opts = {
+        {
+            text = "Auto",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.white, colors.gray)
+        },
+        {
+            text = "Pu",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.black, colors.green)
+        },
+        {
+            text = "Po",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.black, colors.cyan)
+        },
+        {
+            text = "AM",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.black, colors.purple)
+        }
+    }
+}
+
 return style

graphics/core.lua

@@ -7,6 +7,8 @@ local flasher = require("graphics.flasher")
 
 local core = {}
 
+core.version = "1.1.1"
+
 core.flasher = flasher
 core.events = events
 

graphics/element.lua

@@ -20,6 +20,8 @@ local element = {}
 
 ---@alias graphics_args graphics_args_generic
 ---|waiting_args
+---|app_button_args
+---|checkbox_args
 ---|hazard_button_args
 ---|multi_button_args
 ---|push_button_args
@@ -70,7 +72,8 @@ function element.new(args, child_offset_x, child_offset_y)
         p_window = nil,                                 ---@type table
         position = { x = 1, y = 1 },                    ---@type coordinate_2d
         bounds = { x1 = 1, y1 = 1, x2 = 1, y2 = 1 },    ---@class element_bounds
-        next_y = 1,
+        next_y = 1,                                     -- next child y coordinate
+        next_id = 0,                                    -- next child ID
         subscriptions = {},
         mt = {}
     }
@@ -351,13 +354,14 @@ function element.new(args, child_offset_x, child_offset_y)
 
         local child_element = child.get()
 
-        if key == nil then
+        local id = key  ---@type string|integer|nil
-            table.insert(protected.children, child_element)
+        if id == nil then
-            return #protected.children
+            id = self.next_id
-        else
+            self.next_id = self.next_id + 1
-            protected.children[key] = child_element
-            return key
         end
+
+        protected.children[id] = child_element
+        return id
     end
 
     -- remove a child element
@@ -512,19 +516,21 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- FUNCTION CALLBACKS --
 
-    -- handle a monitor touch or mouse click
+    -- handle a monitor touch or mouse click if this element is visible
     ---@param event mouse_interaction mouse interaction event
     function public.handle_mouse(event)
-        local x_ini, y_ini = event.initial.x, event.initial.y
+        if protected.window.isVisible() then
+            local x_ini, y_ini = event.initial.x, event.initial.y
 
-        local ini_in = protected.in_window_bounds(x_ini, y_ini)
+            local ini_in = protected.in_window_bounds(x_ini, y_ini)
 
-        if ini_in then
+            if ini_in then
-            local event_T = core.events.mouse_transposed(event, self.position.x, self.position.y)
+                local event_T = core.events.mouse_transposed(event, self.position.x, self.position.y)
 
-            -- handle the mouse event then pass to children
+                -- handle the mouse event then pass to children
-            protected.handle_mouse(event_T)
+                protected.handle_mouse(event_T)
-            for _, child in pairs(protected.children) do child.handle_mouse(event_T) end
+                for _, child in pairs(protected.children) do child.handle_mouse(event_T) end
+            end
         end
     end
 

graphics/elements/animations/waiting.lua

@@ -8,7 +8,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/colormap.lua

@@ -8,7 +8,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field hidden? boolean true to hide on initial draw
 
 -- new color map

graphics/elements/controls/app.lua

@@ -0,0 +1,130 @@
+-- App Button Graphics Element
+
+local tcd     = require("scada-common.tcd")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local CLICK_TYPE = core.events.CLICK_TYPE
+
+---@class app_button_args
+---@field text string app icon text
+---@field title string app title text
+---@field callback function function to call on touch
+---@field app_fg_bg cpair app icon foreground/background colors
+---@field active_fg_bg? cpair foreground/background colors when pressed
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new app button
+---@param args app_button_args
+---@return graphics_element element, element_id id
+local function app_button(args)
+    assert(type(args.text) == "string", "graphics.elements.controls.app: text is a required field")
+    assert(type(args.title) == "string", "graphics.elements.controls.app: title is a required field")
+    assert(type(args.callback) == "function", "graphics.elements.controls.app: callback is a required field")
+    assert(type(args.app_fg_bg) == "table", "graphics.elements.controls.app: app_fg_bg is a required field")
+
+    args.height = 4
+    args.width  = 5
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- write app title, centered
+    e.window.setCursorPos(1, 4)
+    e.window.setCursorPos(math.floor((e.frame.w - string.len(args.title)) / 2) + 1, 4)
+    e.window.write(args.title)
+
+    -- draw the app button
+    local function draw()
+        local fgd = args.app_fg_bg.fgd
+        local bkg = args.app_fg_bg.bkg
+
+        if e.value then
+            fgd = args.active_fg_bg.fgd
+            bkg = args.active_fg_bg.bkg
+        end
+
+        -- draw icon
+        e.window.setCursorPos(1, 1)
+        e.window.setTextColor(fgd)
+        e.window.setBackgroundColor(bkg)
+        e.window.write("\x9f\x83\x83\x83")
+        e.window.setTextColor(bkg)
+        e.window.setBackgroundColor(fgd)
+        e.window.write("\x90")
+        e.window.setTextColor(fgd)
+        e.window.setBackgroundColor(bkg)
+        e.window.setCursorPos(1, 2)
+        e.window.write("\x95   ")
+        e.window.setTextColor(bkg)
+        e.window.setBackgroundColor(fgd)
+        e.window.write("\x95")
+        e.window.setCursorPos(1, 3)
+        e.window.write("\x82\x8f\x8f\x8f\x81")
+
+        -- write the icon text
+        e.window.setCursorPos(3, 2)
+        e.window.setTextColor(fgd)
+        e.window.setBackgroundColor(bkg)
+        e.window.write(args.text)
+    end
+
+    -- draw the app button as pressed (if active_fg_bg set)
+    local function show_pressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = true
+            e.window.setTextColor(args.active_fg_bg.fgd)
+            e.window.setBackgroundColor(args.active_fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- draw the app button as unpressed (if active_fg_bg set)
+    local function show_unpressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = false
+            e.window.setTextColor(e.fg_bg.fgd)
+            e.window.setBackgroundColor(e.fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled then
+            if event.type == CLICK_TYPE.TAP then
+                show_pressed()
+                -- show as unpressed in 0.25 seconds
+                if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
+                args.callback()
+            elseif event.type == CLICK_TYPE.DOWN then
+                show_pressed()
+            elseif event.type == CLICK_TYPE.UP then
+                show_unpressed()
+                if e.in_frame_bounds(event.current.x, event.current.y) then
+                    args.callback()
+                end
+            end
+        end
+    end
+
+    -- set the value (true simulates pressing the app button)
+    ---@param val boolean new value
+    function e.set_value(val)
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.CLICK_TYPE.UP, 1, 1)) end
+    end
+
+    -- initial draw
+    draw()
+
+    return e.complete()
+end
+
+return app_button

graphics/elements/controls/checkbox.lua

@@ -0,0 +1,85 @@
+-- Checkbox Graphics Element
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+---@class checkbox_args
+---@field label string checkbox text
+---@field box_fg_bg cpair colors for checkbox
+---@field callback function function to call on press
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new checkbox control
+---@param args checkbox_args
+---@return graphics_element element, element_id id
+local function checkbox(args)
+    assert(type(args.label) == "string", "graphics.elements.controls.checkbox: label is a required field")
+    assert(type(args.box_fg_bg) == "table", "graphics.elements.controls.checkbox: box_fg_bg is a required field")
+    assert(type(args.callback) == "function", "graphics.elements.controls.checkbox: callback is a required field")
+
+    args.height = 1
+    args.width = 3 + string.len(args.label)
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    e.value = false
+
+    -- show the button state
+    local function draw()
+        e.window.setCursorPos(1, 1)
+
+        if e.value then
+            -- show as selected
+            e.window.setTextColor(args.box_fg_bg.bkg)
+            e.window.setBackgroundColor(args.box_fg_bg.fgd)
+            e.window.write("\x88")
+            e.window.setTextColor(args.box_fg_bg.fgd)
+            e.window.setBackgroundColor(e.fg_bg.bkg)
+            e.window.write("\x95")
+        else
+            -- show as unselected
+            e.window.setTextColor(e.fg_bg.bkg)
+            e.window.setBackgroundColor(args.box_fg_bg.bkg)
+            e.window.write("\x88")
+            e.window.setTextColor(args.box_fg_bg.bkg)
+            e.window.setBackgroundColor(e.fg_bg.bkg)
+            e.window.write("\x95")
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled and core.events.was_clicked(event.type) then
+            e.value = not e.value
+            draw()
+            args.callback(e.value)
+        end
+    end
+
+    -- set the value
+    ---@param val integer new value
+    function e.set_value(val)
+        e.value = val
+        draw()
+    end
+
+    -- write label text
+    e.window.setCursorPos(3, 1)
+    e.window.setTextColor(e.fg_bg.fgd)
+    e.window.setBackgroundColor(e.fg_bg.bkg)
+    e.window.write(args.label)
+
+    -- initial draw
+    draw()
+
+    return e.complete()
+end
+
+return checkbox

graphics/elements/controls/hazard_button.lua

@@ -14,7 +14,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/controls/multi_button.lua

@@ -20,7 +20,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/push_button.lua

@@ -16,7 +16,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/radio_button.lua

@@ -13,7 +13,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/controls/sidebar.lua

@@ -17,7 +17,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/spinbox_numeric.lua

@@ -16,7 +16,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/controls/switch_button.lua

@@ -12,7 +12,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/tabbar.lua

@@ -18,7 +18,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/div.lua

@@ -6,7 +6,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/indicators/alight.lua

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/coremap.lua

@@ -11,7 +11,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 
 -- new core map box
 ---@nodiscard

graphics/elements/indicators/data.lua

@@ -14,7 +14,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width integer length
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/hbar.lua

@@ -10,7 +10,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/indicators/icon.lua

@@ -16,7 +16,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/led.lua

@@ -14,7 +14,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/ledpair.lua

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/ledrgb.lua

@@ -9,7 +9,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/light.lua

@@ -14,7 +14,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/power.lua

@@ -13,7 +13,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width integer length
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/rad.lua

@@ -14,7 +14,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width integer length
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/state.lua

@@ -15,7 +15,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer 1 if omitted, must be an odd number
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/trilight.lua

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/vbar.lua

@@ -8,7 +8,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/listbox.lua

@@ -15,7 +15,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/multipane.lua

@@ -7,7 +7,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/pipenet.lua

@@ -11,9 +11,15 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field hidden? boolean true to hide on initial draw
 
+---@class _pipe_map_entry
+---@field atr boolean align top right (or bottom left for false)
+---@field thin boolean thin pipe or not
+---@field fg string foreground blit
+---@field bg string background blit
+
 -- new pipe network
 ---@param args pipenet_args
 ---@return graphics_element element, element_id id
@@ -44,102 +50,264 @@ local function pipenet(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- draw all pipes
+    -- determine if there are any thin pipes involved
+    local any_thin = false
     for p = 1, #args.pipes do
-        local pipe = args.pipes[p]  ---@type pipe
+        any_thin = args.pipes[p].thin
+        if any_thin then break end
+    end
 
-        local x = 1 + pipe.x1
+    if not any_thin then
-        local y = 1 + pipe.y1
+        -- draw all pipes
+        for p = 1, #args.pipes do
+            local pipe = args.pipes[p]  ---@type pipe
 
-        local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local x = 1 + pipe.x1
-        local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+            local y = 1 + pipe.y1
 
-        e.window.setCursorPos(x, y)
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
 
-        local c = core.cpair(pipe.color, e.fg_bg.bkg)
+            if pipe.thin then
+                x_step = util.trinary(pipe.x1 == pipe.x2, 0, x_step)
+                y_step = util.trinary(pipe.y1 == pipe.y2, 0, y_step)
+            end
 
-        if pipe.align_tr then
+            e.window.setCursorPos(x, y)
-            -- cross width then height
+
-            for i = 1, pipe.w do
+            local c = core.cpair(pipe.color, e.fg_bg.bkg)
-                if pipe.thin then
+
-                    if i == pipe.w then
+            if pipe.align_tr then
-                        -- corner
+                -- cross width then height
-                        if y_step > 0 then
+                for i = 1, pipe.w do
-                            e.window.blit("\x93", c.blit_bkg, c.blit_fgd)
+                    if pipe.thin then
+                        if i == pipe.w then
+                            -- corner
+                            if y_step > 0 then
+                                e.window.blit("\x93", c.blit_bkg, c.blit_fgd)
+                            else
+                                e.window.blit("\x8e", c.blit_fgd, c.blit_bkg)
+                            end
                         else
-                            e.window.blit("\x8e", c.blit_fgd, c.blit_bkg)
+                            e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
                         end
                     else
+                        if i == pipe.w and y_step > 0 then
+                            -- corner
+                            e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.window.blit("\x8f", c.blit_fgd, c.blit_bkg)
+                        end
+                    end
+
+                    x = x + x_step
+                    e.window.setCursorPos(x, y)
+                end
+
+                -- back up one
+                x = x - x_step
+
+                for _ = 1, pipe.h - 1 do
+                    y = y + y_step
+                    e.window.setCursorPos(x, y)
+
+                    if pipe.thin then
+                        e.window.blit("\x95", c.blit_bkg, c.blit_fgd)
+                    else
+                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+                    end
+                end
+            else
+                -- cross height then width
+                for i = 1, pipe.h do
+                    if pipe.thin then
+                        if i == pipe.h then
+                            -- corner
+                            if y_step < 0 then
+                                e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
+                            elseif y_step > 0 then
+                                e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
+                            else
+                                e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
+                            end
+                        else
+                            e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
+                        end
+                    else
+                        if i == pipe.h and y_step < 0 then
+                            -- corner
+                            e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+                        end
+                    end
+
+                    y = y + y_step
+                    e.window.setCursorPos(x, y)
+                end
+
+                -- back up one
+                y = y - y_step
+
+                for _ = 1, pipe.w - 1 do
+                    x = x + x_step
+                    e.window.setCursorPos(x, y)
+
+                    if pipe.thin then
                         e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.w and y_step > 0 then
-                        -- corner
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
                     else
-                        e.window.blit("\x8f", c.blit_fgd, c.blit_bkg)
-                    end
-                end
-
-                x = x + x_step
-                e.window.setCursorPos(x, y)
-            end
-
-            -- back up one
-            x = x - x_step
-
-            for _ = 1, pipe.h - 1 do
-                y = y + y_step
-                e.window.setCursorPos(x, y)
-
-                if pipe.thin then
-                    e.window.blit("\x95", c.blit_bkg, c.blit_fgd)
-                else
-                    e.window.blit(" ", c.blit_bkg, c.blit_fgd)
-                end
-            end
-        else
-            -- cross height then width
-            for i = 1, pipe.h do
-                if pipe.thin then
-                    if i == pipe.h then
-                        -- corner
-                        if y_step < 0 then
-                            e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
-                        else
-                            e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
-                        end
-                    else
-                        e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.h and y_step < 0 then
-                        -- corner
                         e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
-                    else
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
                     end
                 end
-
-                y = y + y_step
-                e.window.setCursorPos(x, y)
             end
+        end
+    else
+        -- build map if using thin pipes, easist way to check adjacent blocks (cannot 'cheat' like with standard width)
+        local map = {}
 
-            -- back up one
+        -- allocate map
-            y = y - y_step
+        for x = 1, args.width do
+            table.insert(map, {})
+            for _ = 1, args.height do table.insert(map[x], false) end
+        end
 
-            for _ = 1, pipe.w - 1 do
+        -- build map
-                x = x + x_step
+        for p = 1, #args.pipes do
-                e.window.setCursorPos(x, y)
+            local pipe = args.pipes[p]  ---@type pipe
 
-                if pipe.thin then
+            local x = 1 + pipe.x1
-                    e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
+            local y = 1 + pipe.y1
-                else
+
-                    e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+
+            local entry = { atr = pipe.align_tr, thin = pipe.thin, fg = colors.toBlit(pipe.color), bg = e.fg_bg.blit_bkg }
+
+            if pipe.align_tr then
+                -- cross width then height
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
+                end
+
+                x = x - x_step  -- back up one
+
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
+            else
+                -- cross height then width
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
+
+                y = y - y_step  -- back up one
+
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
                 end
             end
         end
 
+        -- render
+        for x = 1, args.width do
+            for y = 1, args.height do
+                local entry = map[x][y] ---@type _pipe_map_entry|false
+                local char
+                local invert = false
+
+                if entry ~= false then
+                    local function check(cx, cy)
+                        return (map[cx] ~= nil) and (map[cx][cy] ~= nil) and (map[cx][cy] ~= false) and (map[cx][cy].fg == entry.fg)
+                    end
+
+                    if entry.thin then
+                        if check(x - 1, y) then -- if left
+                            if check(x, y - 1) then -- if above
+                                if check(x + 1, y) then -- if right
+                                    if check(x, y + 1) then -- if below
+                                        char = util.trinary(entry.atr, "\x91", "\x9d")
+                                        invert = entry.atr
+                                    else -- not below
+                                        char = util.trinary(entry.atr, "\x8e", "\x8d")
+                                    end
+                                else -- not right
+                                    if check(x, y + 1) then -- if below
+                                        char = util.trinary(entry.atr, "\x91", "\x95")
+                                        invert = entry.atr
+                                    else -- not below
+                                        char = util.trinary(entry.atr, "\x8e", "\x85")
+                                    end
+                                end
+                            elseif check(x, y + 1) then-- not above, if below
+                                if check(x + 1, y) then -- if right
+                                    char = util.trinary(entry.atr, "\x93", "\x9c")
+                                    invert = entry.atr
+                                else -- not right
+                                    char = util.trinary(entry.atr, "\x93", "\x94")
+                                    invert = entry.atr
+                                end
+                            else -- not above, not below
+                                char = "\x8c"
+                            end
+                        elseif check(x + 1, y) then -- not left, if right
+                            if check(x, y - 1) then -- if above
+                                if check(x, y + 1) then -- if below
+                                    char = util.trinary(entry.atr, "\x95", "\x9d")
+                                    invert = entry.atr
+                                else -- not below
+                                    char = util.trinary(entry.atr, "\x8a", "\x8d")
+                                end
+                            else -- not above
+                                if check(x, y + 1) then -- if below
+                                    char = util.trinary(entry.atr, "\x97", "\x9c")
+                                    invert = entry.atr
+                                else -- not below
+                                    char = "\x8c"
+                                end
+                            end
+                        else -- not left, not right
+                            char = "\x95"
+                            invert = entry.atr
+                        end
+                    else
+                        if check(x, y - 1) then -- above
+                            -- not below and (if left or right)
+                            if (not check(x, y + 1)) and (check(x - 1, y) or check(x + 1, y)) then
+                                char = util.trinary(entry.atr, "\x8f", " ")
+                                invert = not entry.atr
+                            else -- not below w/ sides only
+                                char = " "
+                                invert = true
+                            end
+                        elseif check(x, y + 1) then -- not above, if below
+                            -- if left or right
+                            if (check(x - 1, y) or check(x + 1, y)) then
+                                char = "\x83"
+                                invert = true
+                            else -- not left or right
+                                char = " "
+                                invert = true
+                            end
+                        else -- not above, not below
+                            char = util.trinary(entry.atr, "\x8f", "\x83")
+                            invert = not entry.atr
+                        end
+                    end
+
+                    e.window.setCursorPos(x, y)
+
+                    if invert then
+                        e.window.blit(char, entry.bg, entry.fg)
+                    else
+                        e.window.blit(char, entry.fg, entry.bg)
+                    end
+                end
+            end
+        end
     end
 
     return e.complete()

graphics/elements/rectangle.lua

@@ -11,7 +11,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/textbox.lua

@@ -13,7 +13,7 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/tiling.lua

@@ -11,7 +11,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/flasher.lua

@@ -43,8 +43,10 @@ end
 
 -- start/resume the flasher periodic
 function flasher.run()
-    active = true
+    if not active then
-    callback_250ms()
+        active = true
+        callback_250ms()
+    end
 end
 
 -- clear all blinking indicators and stop the flasher periodic

imgen.py

@@ -23,11 +23,11 @@ def dir_size(path):
     return total
 
 # get the version of an application at the provided path
-def get_version(path, is_comms = False):
+def get_version(path, is_lib = False):
     ver = ""
-    string = "comms.version = \""
+    string = ".version = \""
 
-    if not is_comms:
+    if not is_lib:
         string = "_VERSION = \""
 
     f = open(path, "r")
@@ -48,7 +48,10 @@ def make_manifest(size):
         "versions" : {
             "installer" : get_version("./ccmsi.lua"),
             "bootloader" : get_version("./startup.lua"),
+            "common" : get_version("./scada-common/util.lua", True),
             "comms" : get_version("./scada-common/comms.lua", True),
+            "graphics" : get_version("./graphics/core.lua", True),
+            "lockbox" : get_version("./lockbox/init.lua", True),
             "reactor-plc" : get_version("./reactor-plc/startup.lua"),
             "rtu" : get_version("./rtu/startup.lua"),
             "supervisor" : get_version("./supervisor/startup.lua"),
@@ -69,11 +72,11 @@ def make_manifest(size):
             "pocket" : list_files("./pocket"),
         },
         "depends" : {
-            "reactor-plc" : [ "system", "common", "graphics" ],
+            "reactor-plc" : [ "system", "common", "graphics", "lockbox" ],
-            "rtu" : [ "system", "common", "graphics" ],
+            "rtu" : [ "system", "common", "graphics", "lockbox" ],
-            "supervisor" : [ "system", "common", "graphics" ],
+            "supervisor" : [ "system", "common", "graphics", "lockbox" ],
-            "coordinator" : [ "system", "common", "graphics" ],
+            "coordinator" : [ "system", "common", "graphics", "lockbox" ],
-            "pocket" : [ "system", "common", "graphics" ]
+            "pocket" : [ "system", "common", "graphics", "lockbox" ]
         },
         "sizes" : {
             # manifest file estimate

lockbox/cipher/aes128.lua

@@ -1,415 +0,0 @@
-local Array = require("lockbox.util.array");
-local Bit = require("lockbox.util.bit");
-
-local XOR = Bit.bxor;
-
-local SBOX = {
- [0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
- 0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
- 0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
- 0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
- 0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
- 0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
- 0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
- 0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
- 0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
- 0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
- 0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
- 0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
- 0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
- 0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
- 0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
- 0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
-
-local ISBOX = {
- [0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
- 0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
- 0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
- 0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
- 0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
- 0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
- 0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
- 0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
- 0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
- 0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
- 0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
- 0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
- 0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
- 0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
- 0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
- 0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
-
-local ROW_SHIFT =  {  1,  6, 11, 16,  5, 10, 15,  4,  9, 14,  3,  8, 13,  2,  7, 12, };
-local IROW_SHIFT = {  1, 14, 11,  8,  5,  2, 15, 12,  9,  6,  3, 16, 13, 10,  7,  4, };
-
-local ETABLE = {
- [0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
- 0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
- 0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
- 0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
- 0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
- 0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
- 0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
- 0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
- 0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
- 0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
- 0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
- 0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
- 0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
- 0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
- 0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
- 0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
-
-local LTABLE = {
- [0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
- 0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
- 0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
- 0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
- 0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
- 0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
- 0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
- 0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
- 0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
- 0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
- 0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
- 0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
- 0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
- 0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
- 0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
- 0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
-
-local MIXTABLE = {
- 0x02, 0x03, 0x01, 0x01,
- 0x01, 0x02, 0x03, 0x01,
- 0x01, 0x01, 0x02, 0x03,
- 0x03, 0x01, 0x01, 0x02};
-
-local IMIXTABLE = {
- 0x0E, 0x0B, 0x0D, 0x09,
- 0x09, 0x0E, 0x0B, 0x0D,
- 0x0D, 0x09, 0x0E, 0x0B,
- 0x0B, 0x0D, 0x09, 0x0E};
-
-local RCON = {
-[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
-0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
-0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
-0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
-0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
-0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
-0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
-0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
-0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
-0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
-0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
-0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
-0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
-0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
-0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
-0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
-
-
-local GMUL = function(A, B)
-    if(A == 0x01) then return B; end
-    if(B == 0x01) then return A; end
-    if(A == 0x00) then return 0; end
-    if(B == 0x00) then return 0; end
-
-    local LA = LTABLE[A];
-    local LB = LTABLE[B];
-
-    local sum = LA + LB;
-    if (sum > 0xFF) then sum = sum - 0xFF; end
-
-    return ETABLE[sum];
-end
-
-local byteSub = Array.substitute;
-
-local shiftRow = Array.permute;
-
-local mixCol = function(i, mix)
-    local out = {};
-
-    local a, b, c, d;
-
-    a = GMUL(i[ 1], mix[ 1]);
-    b = GMUL(i[ 2], mix[ 2]);
-    c = GMUL(i[ 3], mix[ 3]);
-    d = GMUL(i[ 4], mix[ 4]);
-    out[ 1] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[ 5]);
-    b = GMUL(i[ 2], mix[ 6]);
-    c = GMUL(i[ 3], mix[ 7]);
-    d = GMUL(i[ 4], mix[ 8]);
-    out[ 2] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[ 9]);
-    b = GMUL(i[ 2], mix[10]);
-    c = GMUL(i[ 3], mix[11]);
-    d = GMUL(i[ 4], mix[12]);
-    out[ 3] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[13]);
-    b = GMUL(i[ 2], mix[14]);
-    c = GMUL(i[ 3], mix[15]);
-    d = GMUL(i[ 4], mix[16]);
-    out[ 4] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[ 5], mix[ 1]);
-    b = GMUL(i[ 6], mix[ 2]);
-    c = GMUL(i[ 7], mix[ 3]);
-    d = GMUL(i[ 8], mix[ 4]);
-    out[ 5] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[ 5]);
-    b = GMUL(i[ 6], mix[ 6]);
-    c = GMUL(i[ 7], mix[ 7]);
-    d = GMUL(i[ 8], mix[ 8]);
-    out[ 6] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[ 9]);
-    b = GMUL(i[ 6], mix[10]);
-    c = GMUL(i[ 7], mix[11]);
-    d = GMUL(i[ 8], mix[12]);
-    out[ 7] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[13]);
-    b = GMUL(i[ 6], mix[14]);
-    c = GMUL(i[ 7], mix[15]);
-    d = GMUL(i[ 8], mix[16]);
-    out[ 8] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[ 9], mix[ 1]);
-    b = GMUL(i[10], mix[ 2]);
-    c = GMUL(i[11], mix[ 3]);
-    d = GMUL(i[12], mix[ 4]);
-    out[ 9] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[ 5]);
-    b = GMUL(i[10], mix[ 6]);
-    c = GMUL(i[11], mix[ 7]);
-    d = GMUL(i[12], mix[ 8]);
-    out[10] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[ 9]);
-    b = GMUL(i[10], mix[10]);
-    c = GMUL(i[11], mix[11]);
-    d = GMUL(i[12], mix[12]);
-    out[11] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[13]);
-    b = GMUL(i[10], mix[14]);
-    c = GMUL(i[11], mix[15]);
-    d = GMUL(i[12], mix[16]);
-    out[12] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[13], mix[ 1]);
-    b = GMUL(i[14], mix[ 2]);
-    c = GMUL(i[15], mix[ 3]);
-    d = GMUL(i[16], mix[ 4]);
-    out[13] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[ 5]);
-    b = GMUL(i[14], mix[ 6]);
-    c = GMUL(i[15], mix[ 7]);
-    d = GMUL(i[16], mix[ 8]);
-    out[14] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[ 9]);
-    b = GMUL(i[14], mix[10]);
-    c = GMUL(i[15], mix[11]);
-    d = GMUL(i[16], mix[12]);
-    out[15] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[13]);
-    b = GMUL(i[14], mix[14]);
-    c = GMUL(i[15], mix[15]);
-    d = GMUL(i[16], mix[16]);
-    out[16] = XOR(XOR(a, b), XOR(c, d));
-
-    return out;
-end
-
-local keyRound = function(key, round)
-    local out = {};
-
-    out[ 1] = XOR(key[ 1], XOR(SBOX[key[14]], RCON[round]));
-    out[ 2] = XOR(key[ 2], SBOX[key[15]]);
-    out[ 3] = XOR(key[ 3], SBOX[key[16]]);
-    out[ 4] = XOR(key[ 4], SBOX[key[13]]);
-
-    out[ 5] = XOR(out[ 1], key[ 5]);
-    out[ 6] = XOR(out[ 2], key[ 6]);
-    out[ 7] = XOR(out[ 3], key[ 7]);
-    out[ 8] = XOR(out[ 4], key[ 8]);
-
-    out[ 9] = XOR(out[ 5], key[ 9]);
-    out[10] = XOR(out[ 6], key[10]);
-    out[11] = XOR(out[ 7], key[11]);
-    out[12] = XOR(out[ 8], key[12]);
-
-    out[13] = XOR(out[ 9], key[13]);
-    out[14] = XOR(out[10], key[14]);
-    out[15] = XOR(out[11], key[15]);
-    out[16] = XOR(out[12], key[16]);
-
-    return out;
-end
-
-local keyExpand = function(key)
-    local keys = {};
-
-    local temp = key;
-
-    keys[1] = temp;
-
-    for i = 1, 10 do
-        temp = keyRound(temp, i);
-        keys[i + 1] = temp;
-    end
-
-    return keys;
-
-end
-
-local addKey = Array.XOR;
-
-
-
-local AES = {};
-
-AES.blockSize = 16;
-
-AES.encrypt = function(_key, block)
-
-    local key = keyExpand(_key);
-
-    --round 0
-    block = addKey(block, key[1]);
-
-    --round 1
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[2]);
-
-    --round 2
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[3]);
-
-    --round 3
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[4]);
-
-    --round 4
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[5]);
-
-    --round 5
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[6]);
-
-    --round 6
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[7]);
-
-    --round 7
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[8]);
-
-    --round 8
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[9]);
-
-    --round 9
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[10]);
-
-    --round 10
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = addKey(block, key[11]);
-
-    return block;
-
-end
-
-AES.decrypt = function(_key, block)
-
-    local key = keyExpand(_key);
-
-    --round 0
-    block = addKey(block, key[11]);
-
-    --round 1
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[10]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 2
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[9]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 3
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[8]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 4
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[7]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 5
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[6]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 6
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[5]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 7
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[4]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 8
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[3]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 9
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[2]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 10
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[1]);
-
-    return block;
-end
-
-return AES;

lockbox/cipher/aes192.lua

@@ -1,462 +0,0 @@
-
-local Array = require("lockbox.util.array");
-local Bit = require("lockbox.util.bit");
-
-local XOR = Bit.bxor;
-
-local SBOX = {
- [0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
- 0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
- 0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
- 0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
- 0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
- 0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
- 0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
- 0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
- 0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
- 0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
- 0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
- 0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
- 0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
- 0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
- 0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
- 0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
-
-local ISBOX = {
- [0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
- 0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
- 0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
- 0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
- 0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
- 0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
- 0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
- 0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
- 0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
- 0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
- 0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
- 0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
- 0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
- 0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
- 0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
- 0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
-
-local ROW_SHIFT =  {  1,  6, 11, 16,  5, 10, 15,  4,  9, 14,  3,  8, 13,  2,  7, 12, };
-local IROW_SHIFT = {  1, 14, 11,  8,  5,  2, 15, 12,  9,  6,  3, 16, 13, 10,  7,  4, };
-
-local ETABLE = {
- [0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
- 0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
- 0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
- 0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
- 0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
- 0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
- 0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
- 0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
- 0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
- 0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
- 0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
- 0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
- 0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
- 0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
- 0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
- 0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
-
-local LTABLE = {
- [0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
- 0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
- 0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
- 0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
- 0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
- 0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
- 0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
- 0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
- 0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
- 0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
- 0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
- 0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
- 0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
- 0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
- 0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
- 0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
-
-local MIXTABLE = {
- 0x02, 0x03, 0x01, 0x01,
- 0x01, 0x02, 0x03, 0x01,
- 0x01, 0x01, 0x02, 0x03,
- 0x03, 0x01, 0x01, 0x02};
-
-local IMIXTABLE = {
- 0x0E, 0x0B, 0x0D, 0x09,
- 0x09, 0x0E, 0x0B, 0x0D,
- 0x0D, 0x09, 0x0E, 0x0B,
- 0x0B, 0x0D, 0x09, 0x0E};
-
-local RCON = {
-[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
-0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
-0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
-0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
-0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
-0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
-0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
-0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
-0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
-0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
-0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
-0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
-0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
-0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
-0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
-0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
-
-
-local GMUL = function(A, B)
-    if(A == 0x01) then return B; end
-    if(B == 0x01) then return A; end
-    if(A == 0x00) then return 0; end
-    if(B == 0x00) then return 0; end
-
-    local LA = LTABLE[A];
-    local LB = LTABLE[B];
-
-    local sum = LA + LB;
-    if (sum > 0xFF) then sum = sum - 0xFF; end
-
-    return ETABLE[sum];
-end
-
-local byteSub = Array.substitute;
-
-local shiftRow = Array.permute;
-
-local mixCol = function(i, mix)
-    local out = {};
-
-    local a, b, c, d;
-
-    a = GMUL(i[ 1], mix[ 1]);
-    b = GMUL(i[ 2], mix[ 2]);
-    c = GMUL(i[ 3], mix[ 3]);
-    d = GMUL(i[ 4], mix[ 4]);
-    out[ 1] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[ 5]);
-    b = GMUL(i[ 2], mix[ 6]);
-    c = GMUL(i[ 3], mix[ 7]);
-    d = GMUL(i[ 4], mix[ 8]);
-    out[ 2] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[ 9]);
-    b = GMUL(i[ 2], mix[10]);
-    c = GMUL(i[ 3], mix[11]);
-    d = GMUL(i[ 4], mix[12]);
-    out[ 3] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[13]);
-    b = GMUL(i[ 2], mix[14]);
-    c = GMUL(i[ 3], mix[15]);
-    d = GMUL(i[ 4], mix[16]);
-    out[ 4] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[ 5], mix[ 1]);
-    b = GMUL(i[ 6], mix[ 2]);
-    c = GMUL(i[ 7], mix[ 3]);
-    d = GMUL(i[ 8], mix[ 4]);
-    out[ 5] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[ 5]);
-    b = GMUL(i[ 6], mix[ 6]);
-    c = GMUL(i[ 7], mix[ 7]);
-    d = GMUL(i[ 8], mix[ 8]);
-    out[ 6] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[ 9]);
-    b = GMUL(i[ 6], mix[10]);
-    c = GMUL(i[ 7], mix[11]);
-    d = GMUL(i[ 8], mix[12]);
-    out[ 7] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[13]);
-    b = GMUL(i[ 6], mix[14]);
-    c = GMUL(i[ 7], mix[15]);
-    d = GMUL(i[ 8], mix[16]);
-    out[ 8] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[ 9], mix[ 1]);
-    b = GMUL(i[10], mix[ 2]);
-    c = GMUL(i[11], mix[ 3]);
-    d = GMUL(i[12], mix[ 4]);
-    out[ 9] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[ 5]);
-    b = GMUL(i[10], mix[ 6]);
-    c = GMUL(i[11], mix[ 7]);
-    d = GMUL(i[12], mix[ 8]);
-    out[10] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[ 9]);
-    b = GMUL(i[10], mix[10]);
-    c = GMUL(i[11], mix[11]);
-    d = GMUL(i[12], mix[12]);
-    out[11] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[13]);
-    b = GMUL(i[10], mix[14]);
-    c = GMUL(i[11], mix[15]);
-    d = GMUL(i[12], mix[16]);
-    out[12] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[13], mix[ 1]);
-    b = GMUL(i[14], mix[ 2]);
-    c = GMUL(i[15], mix[ 3]);
-    d = GMUL(i[16], mix[ 4]);
-    out[13] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[ 5]);
-    b = GMUL(i[14], mix[ 6]);
-    c = GMUL(i[15], mix[ 7]);
-    d = GMUL(i[16], mix[ 8]);
-    out[14] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[ 9]);
-    b = GMUL(i[14], mix[10]);
-    c = GMUL(i[15], mix[11]);
-    d = GMUL(i[16], mix[12]);
-    out[15] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[13]);
-    b = GMUL(i[14], mix[14]);
-    c = GMUL(i[15], mix[15]);
-    d = GMUL(i[16], mix[16]);
-    out[16] = XOR(XOR(a, b), XOR(c, d));
-
-    return out;
-end
-
-local keyRound = function(key, round)
-    local i = (round - 1) * 24;
-    local out = key;
-
-    out[25 + i] = XOR(key[ 1 + i], XOR(SBOX[key[22 + i]], RCON[round]));
-    out[26 + i] = XOR(key[ 2 + i], SBOX[key[23 + i]]);
-    out[27 + i] = XOR(key[ 3 + i], SBOX[key[24 + i]]);
-    out[28 + i] = XOR(key[ 4 + i], SBOX[key[21 + i]]);
-
-    out[29 + i] = XOR(out[25 + i], key[ 5 + i]);
-    out[30 + i] = XOR(out[26 + i], key[ 6 + i]);
-    out[31 + i] = XOR(out[27 + i], key[ 7 + i]);
-    out[32 + i] = XOR(out[28 + i], key[ 8 + i]);
-
-    out[33 + i] = XOR(out[29 + i], key[ 9 + i]);
-    out[34 + i] = XOR(out[30 + i], key[10 + i]);
-    out[35 + i] = XOR(out[31 + i], key[11 + i]);
-    out[36 + i] = XOR(out[32 + i], key[12 + i]);
-
-    out[37 + i] = XOR(out[33 + i], key[13 + i]);
-    out[38 + i] = XOR(out[34 + i], key[14 + i]);
-    out[39 + i] = XOR(out[35 + i], key[15 + i]);
-    out[40 + i] = XOR(out[36 + i], key[16 + i]);
-
-    out[41 + i] = XOR(out[37 + i], key[17 + i]);
-    out[42 + i] = XOR(out[38 + i], key[18 + i]);
-    out[43 + i] = XOR(out[39 + i], key[19 + i]);
-    out[44 + i] = XOR(out[40 + i], key[20 + i]);
-
-    out[45 + i] = XOR(out[41 + i], key[21 + i]);
-    out[46 + i] = XOR(out[42 + i], key[22 + i]);
-    out[47 + i] = XOR(out[43 + i], key[23 + i]);
-    out[48 + i] = XOR(out[44 + i], key[24 + i]);
-
-    return out;
-end
-
-local keyExpand = function(key)
-    local bytes = Array.copy(key);
-
-    for i = 1, 8 do
-        keyRound(bytes, i);
-    end
-
-    local keys = {};
-
-    keys[ 1] = Array.slice(bytes, 1, 16);
-    keys[ 2] = Array.slice(bytes, 17, 32);
-    keys[ 3] = Array.slice(bytes, 33, 48);
-    keys[ 4] = Array.slice(bytes, 49, 64);
-    keys[ 5] = Array.slice(bytes, 65, 80);
-    keys[ 6] = Array.slice(bytes, 81, 96);
-    keys[ 7] = Array.slice(bytes, 97, 112);
-    keys[ 8] = Array.slice(bytes, 113, 128);
-    keys[ 9] = Array.slice(bytes, 129, 144);
-    keys[10] = Array.slice(bytes, 145, 160);
-    keys[11] = Array.slice(bytes, 161, 176);
-    keys[12] = Array.slice(bytes, 177, 192);
-    keys[13] = Array.slice(bytes, 193, 208);
-
-    return keys;
-
-end
-
-local addKey = Array.XOR;
-
-
-
-local AES = {};
-
-AES.blockSize = 16;
-
-AES.encrypt = function(_key, block)
-
-    local key = keyExpand(_key);
-
-    --round 0
-    block = addKey(block, key[1]);
-
-    --round 1
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[2]);
-
-    --round 2
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[3]);
-
-    --round 3
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[4]);
-
-    --round 4
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[5]);
-
-    --round 5
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[6]);
-
-    --round 6
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[7]);
-
-    --round 7
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[8]);
-
-    --round 8
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[9]);
-
-    --round 9
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[10]);
-
-    --round 10
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[11]);
-
-    --round 11
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[12]);
-
-    --round 12
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = addKey(block, key[13]);
-
-    return block;
-
-end
-
-AES.decrypt = function(_key, block)
-
-    local key = keyExpand(_key);
-
-    --round 0
-    block = addKey(block, key[13]);
-
-    --round 1
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[12]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 2
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[11]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 3
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[10]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 4
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[9]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 5
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[8]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 6
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[7]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 7
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[6]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 8
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[5]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 9
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[4]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 10
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[3]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 11
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[2]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 12
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[1]);
-
-    return block;
-end
-
-return AES;

lockbox/cipher/aes256.lua

@@ -1,498 +0,0 @@
-local Array = require("lockbox.util.array");
-local Bit = require("lockbox.util.bit");
-
-local XOR = Bit.bxor;
-
-local SBOX = {
- [0] = 0x63, 0x7C, 0x77, 0x7B, 0xF2, 0x6B, 0x6F, 0xC5, 0x30, 0x01, 0x67, 0x2B, 0xFE, 0xD7, 0xAB, 0x76,
- 0xCA, 0x82, 0xC9, 0x7D, 0xFA, 0x59, 0x47, 0xF0, 0xAD, 0xD4, 0xA2, 0xAF, 0x9C, 0xA4, 0x72, 0xC0,
- 0xB7, 0xFD, 0x93, 0x26, 0x36, 0x3F, 0xF7, 0xCC, 0x34, 0xA5, 0xE5, 0xF1, 0x71, 0xD8, 0x31, 0x15,
- 0x04, 0xC7, 0x23, 0xC3, 0x18, 0x96, 0x05, 0x9A, 0x07, 0x12, 0x80, 0xE2, 0xEB, 0x27, 0xB2, 0x75,
- 0x09, 0x83, 0x2C, 0x1A, 0x1B, 0x6E, 0x5A, 0xA0, 0x52, 0x3B, 0xD6, 0xB3, 0x29, 0xE3, 0x2F, 0x84,
- 0x53, 0xD1, 0x00, 0xED, 0x20, 0xFC, 0xB1, 0x5B, 0x6A, 0xCB, 0xBE, 0x39, 0x4A, 0x4C, 0x58, 0xCF,
- 0xD0, 0xEF, 0xAA, 0xFB, 0x43, 0x4D, 0x33, 0x85, 0x45, 0xF9, 0x02, 0x7F, 0x50, 0x3C, 0x9F, 0xA8,
- 0x51, 0xA3, 0x40, 0x8F, 0x92, 0x9D, 0x38, 0xF5, 0xBC, 0xB6, 0xDA, 0x21, 0x10, 0xFF, 0xF3, 0xD2,
- 0xCD, 0x0C, 0x13, 0xEC, 0x5F, 0x97, 0x44, 0x17, 0xC4, 0xA7, 0x7E, 0x3D, 0x64, 0x5D, 0x19, 0x73,
- 0x60, 0x81, 0x4F, 0xDC, 0x22, 0x2A, 0x90, 0x88, 0x46, 0xEE, 0xB8, 0x14, 0xDE, 0x5E, 0x0B, 0xDB,
- 0xE0, 0x32, 0x3A, 0x0A, 0x49, 0x06, 0x24, 0x5C, 0xC2, 0xD3, 0xAC, 0x62, 0x91, 0x95, 0xE4, 0x79,
- 0xE7, 0xC8, 0x37, 0x6D, 0x8D, 0xD5, 0x4E, 0xA9, 0x6C, 0x56, 0xF4, 0xEA, 0x65, 0x7A, 0xAE, 0x08,
- 0xBA, 0x78, 0x25, 0x2E, 0x1C, 0xA6, 0xB4, 0xC6, 0xE8, 0xDD, 0x74, 0x1F, 0x4B, 0xBD, 0x8B, 0x8A,
- 0x70, 0x3E, 0xB5, 0x66, 0x48, 0x03, 0xF6, 0x0E, 0x61, 0x35, 0x57, 0xB9, 0x86, 0xC1, 0x1D, 0x9E,
- 0xE1, 0xF8, 0x98, 0x11, 0x69, 0xD9, 0x8E, 0x94, 0x9B, 0x1E, 0x87, 0xE9, 0xCE, 0x55, 0x28, 0xDF,
- 0x8C, 0xA1, 0x89, 0x0D, 0xBF, 0xE6, 0x42, 0x68, 0x41, 0x99, 0x2D, 0x0F, 0xB0, 0x54, 0xBB, 0x16};
-
-local ISBOX = {
- [0] = 0x52, 0x09, 0x6A, 0xD5, 0x30, 0x36, 0xA5, 0x38, 0xBF, 0x40, 0xA3, 0x9E, 0x81, 0xF3, 0xD7, 0xFB,
- 0x7C, 0xE3, 0x39, 0x82, 0x9B, 0x2F, 0xFF, 0x87, 0x34, 0x8E, 0x43, 0x44, 0xC4, 0xDE, 0xE9, 0xCB,
- 0x54, 0x7B, 0x94, 0x32, 0xA6, 0xC2, 0x23, 0x3D, 0xEE, 0x4C, 0x95, 0x0B, 0x42, 0xFA, 0xC3, 0x4E,
- 0x08, 0x2E, 0xA1, 0x66, 0x28, 0xD9, 0x24, 0xB2, 0x76, 0x5B, 0xA2, 0x49, 0x6D, 0x8B, 0xD1, 0x25,
- 0x72, 0xF8, 0xF6, 0x64, 0x86, 0x68, 0x98, 0x16, 0xD4, 0xA4, 0x5C, 0xCC, 0x5D, 0x65, 0xB6, 0x92,
- 0x6C, 0x70, 0x48, 0x50, 0xFD, 0xED, 0xB9, 0xDA, 0x5E, 0x15, 0x46, 0x57, 0xA7, 0x8D, 0x9D, 0x84,
- 0x90, 0xD8, 0xAB, 0x00, 0x8C, 0xBC, 0xD3, 0x0A, 0xF7, 0xE4, 0x58, 0x05, 0xB8, 0xB3, 0x45, 0x06,
- 0xD0, 0x2C, 0x1E, 0x8F, 0xCA, 0x3F, 0x0F, 0x02, 0xC1, 0xAF, 0xBD, 0x03, 0x01, 0x13, 0x8A, 0x6B,
- 0x3A, 0x91, 0x11, 0x41, 0x4F, 0x67, 0xDC, 0xEA, 0x97, 0xF2, 0xCF, 0xCE, 0xF0, 0xB4, 0xE6, 0x73,
- 0x96, 0xAC, 0x74, 0x22, 0xE7, 0xAD, 0x35, 0x85, 0xE2, 0xF9, 0x37, 0xE8, 0x1C, 0x75, 0xDF, 0x6E,
- 0x47, 0xF1, 0x1A, 0x71, 0x1D, 0x29, 0xC5, 0x89, 0x6F, 0xB7, 0x62, 0x0E, 0xAA, 0x18, 0xBE, 0x1B,
- 0xFC, 0x56, 0x3E, 0x4B, 0xC6, 0xD2, 0x79, 0x20, 0x9A, 0xDB, 0xC0, 0xFE, 0x78, 0xCD, 0x5A, 0xF4,
- 0x1F, 0xDD, 0xA8, 0x33, 0x88, 0x07, 0xC7, 0x31, 0xB1, 0x12, 0x10, 0x59, 0x27, 0x80, 0xEC, 0x5F,
- 0x60, 0x51, 0x7F, 0xA9, 0x19, 0xB5, 0x4A, 0x0D, 0x2D, 0xE5, 0x7A, 0x9F, 0x93, 0xC9, 0x9C, 0xEF,
- 0xA0, 0xE0, 0x3B, 0x4D, 0xAE, 0x2A, 0xF5, 0xB0, 0xC8, 0xEB, 0xBB, 0x3C, 0x83, 0x53, 0x99, 0x61,
- 0x17, 0x2B, 0x04, 0x7E, 0xBA, 0x77, 0xD6, 0x26, 0xE1, 0x69, 0x14, 0x63, 0x55, 0x21, 0x0C, 0x7D};
-
-local ROW_SHIFT =  {  1,  6, 11, 16,  5, 10, 15,  4,  9, 14,  3,  8, 13,  2,  7, 12, };
-local IROW_SHIFT = {  1, 14, 11,  8,  5,  2, 15, 12,  9,  6,  3, 16, 13, 10,  7,  4, };
-
-local ETABLE = {
- [0] = 0x01, 0x03, 0x05, 0x0F, 0x11, 0x33, 0x55, 0xFF, 0x1A, 0x2E, 0x72, 0x96, 0xA1, 0xF8, 0x13, 0x35,
- 0x5F, 0xE1, 0x38, 0x48, 0xD8, 0x73, 0x95, 0xA4, 0xF7, 0x02, 0x06, 0x0A, 0x1E, 0x22, 0x66, 0xAA,
- 0xE5, 0x34, 0x5C, 0xE4, 0x37, 0x59, 0xEB, 0x26, 0x6A, 0xBE, 0xD9, 0x70, 0x90, 0xAB, 0xE6, 0x31,
- 0x53, 0xF5, 0x04, 0x0C, 0x14, 0x3C, 0x44, 0xCC, 0x4F, 0xD1, 0x68, 0xB8, 0xD3, 0x6E, 0xB2, 0xCD,
- 0x4C, 0xD4, 0x67, 0xA9, 0xE0, 0x3B, 0x4D, 0xD7, 0x62, 0xA6, 0xF1, 0x08, 0x18, 0x28, 0x78, 0x88,
- 0x83, 0x9E, 0xB9, 0xD0, 0x6B, 0xBD, 0xDC, 0x7F, 0x81, 0x98, 0xB3, 0xCE, 0x49, 0xDB, 0x76, 0x9A,
- 0xB5, 0xC4, 0x57, 0xF9, 0x10, 0x30, 0x50, 0xF0, 0x0B, 0x1D, 0x27, 0x69, 0xBB, 0xD6, 0x61, 0xA3,
- 0xFE, 0x19, 0x2B, 0x7D, 0x87, 0x92, 0xAD, 0xEC, 0x2F, 0x71, 0x93, 0xAE, 0xE9, 0x20, 0x60, 0xA0,
- 0xFB, 0x16, 0x3A, 0x4E, 0xD2, 0x6D, 0xB7, 0xC2, 0x5D, 0xE7, 0x32, 0x56, 0xFA, 0x15, 0x3F, 0x41,
- 0xC3, 0x5E, 0xE2, 0x3D, 0x47, 0xC9, 0x40, 0xC0, 0x5B, 0xED, 0x2C, 0x74, 0x9C, 0xBF, 0xDA, 0x75,
- 0x9F, 0xBA, 0xD5, 0x64, 0xAC, 0xEF, 0x2A, 0x7E, 0x82, 0x9D, 0xBC, 0xDF, 0x7A, 0x8E, 0x89, 0x80,
- 0x9B, 0xB6, 0xC1, 0x58, 0xE8, 0x23, 0x65, 0xAF, 0xEA, 0x25, 0x6F, 0xB1, 0xC8, 0x43, 0xC5, 0x54,
- 0xFC, 0x1F, 0x21, 0x63, 0xA5, 0xF4, 0x07, 0x09, 0x1B, 0x2D, 0x77, 0x99, 0xB0, 0xCB, 0x46, 0xCA,
- 0x45, 0xCF, 0x4A, 0xDE, 0x79, 0x8B, 0x86, 0x91, 0xA8, 0xE3, 0x3E, 0x42, 0xC6, 0x51, 0xF3, 0x0E,
- 0x12, 0x36, 0x5A, 0xEE, 0x29, 0x7B, 0x8D, 0x8C, 0x8F, 0x8A, 0x85, 0x94, 0xA7, 0xF2, 0x0D, 0x17,
- 0x39, 0x4B, 0xDD, 0x7C, 0x84, 0x97, 0xA2, 0xFD, 0x1C, 0x24, 0x6C, 0xB4, 0xC7, 0x52, 0xF6, 0x01};
-
-local LTABLE = {
- [0] = 0x00, 0x00, 0x19, 0x01, 0x32, 0x02, 0x1A, 0xC6, 0x4B, 0xC7, 0x1B, 0x68, 0x33, 0xEE, 0xDF, 0x03,
- 0x64, 0x04, 0xE0, 0x0E, 0x34, 0x8D, 0x81, 0xEF, 0x4C, 0x71, 0x08, 0xC8, 0xF8, 0x69, 0x1C, 0xC1,
- 0x7D, 0xC2, 0x1D, 0xB5, 0xF9, 0xB9, 0x27, 0x6A, 0x4D, 0xE4, 0xA6, 0x72, 0x9A, 0xC9, 0x09, 0x78,
- 0x65, 0x2F, 0x8A, 0x05, 0x21, 0x0F, 0xE1, 0x24, 0x12, 0xF0, 0x82, 0x45, 0x35, 0x93, 0xDA, 0x8E,
- 0x96, 0x8F, 0xDB, 0xBD, 0x36, 0xD0, 0xCE, 0x94, 0x13, 0x5C, 0xD2, 0xF1, 0x40, 0x46, 0x83, 0x38,
- 0x66, 0xDD, 0xFD, 0x30, 0xBF, 0x06, 0x8B, 0x62, 0xB3, 0x25, 0xE2, 0x98, 0x22, 0x88, 0x91, 0x10,
- 0x7E, 0x6E, 0x48, 0xC3, 0xA3, 0xB6, 0x1E, 0x42, 0x3A, 0x6B, 0x28, 0x54, 0xFA, 0x85, 0x3D, 0xBA,
- 0x2B, 0x79, 0x0A, 0x15, 0x9B, 0x9F, 0x5E, 0xCA, 0x4E, 0xD4, 0xAC, 0xE5, 0xF3, 0x73, 0xA7, 0x57,
- 0xAF, 0x58, 0xA8, 0x50, 0xF4, 0xEA, 0xD6, 0x74, 0x4F, 0xAE, 0xE9, 0xD5, 0xE7, 0xE6, 0xAD, 0xE8,
- 0x2C, 0xD7, 0x75, 0x7A, 0xEB, 0x16, 0x0B, 0xF5, 0x59, 0xCB, 0x5F, 0xB0, 0x9C, 0xA9, 0x51, 0xA0,
- 0x7F, 0x0C, 0xF6, 0x6F, 0x17, 0xC4, 0x49, 0xEC, 0xD8, 0x43, 0x1F, 0x2D, 0xA4, 0x76, 0x7B, 0xB7,
- 0xCC, 0xBB, 0x3E, 0x5A, 0xFB, 0x60, 0xB1, 0x86, 0x3B, 0x52, 0xA1, 0x6C, 0xAA, 0x55, 0x29, 0x9D,
- 0x97, 0xB2, 0x87, 0x90, 0x61, 0xBE, 0xDC, 0xFC, 0xBC, 0x95, 0xCF, 0xCD, 0x37, 0x3F, 0x5B, 0xD1,
- 0x53, 0x39, 0x84, 0x3C, 0x41, 0xA2, 0x6D, 0x47, 0x14, 0x2A, 0x9E, 0x5D, 0x56, 0xF2, 0xD3, 0xAB,
- 0x44, 0x11, 0x92, 0xD9, 0x23, 0x20, 0x2E, 0x89, 0xB4, 0x7C, 0xB8, 0x26, 0x77, 0x99, 0xE3, 0xA5,
- 0x67, 0x4A, 0xED, 0xDE, 0xC5, 0x31, 0xFE, 0x18, 0x0D, 0x63, 0x8C, 0x80, 0xC0, 0xF7, 0x70, 0x07};
-
-local MIXTABLE = {
- 0x02, 0x03, 0x01, 0x01,
- 0x01, 0x02, 0x03, 0x01,
- 0x01, 0x01, 0x02, 0x03,
- 0x03, 0x01, 0x01, 0x02};
-
-local IMIXTABLE = {
- 0x0E, 0x0B, 0x0D, 0x09,
- 0x09, 0x0E, 0x0B, 0x0D,
- 0x0D, 0x09, 0x0E, 0x0B,
- 0x0B, 0x0D, 0x09, 0x0E};
-
-local RCON = {
-[0] = 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a,
-0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39,
-0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a,
-0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8,
-0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef,
-0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc,
-0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20, 0x40, 0x80, 0x1b,
-0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3,
-0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94,
-0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04, 0x08, 0x10, 0x20,
-0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63, 0xc6, 0x97, 0x35,
-0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd, 0x61, 0xc2, 0x9f,
-0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d, 0x01, 0x02, 0x04,
-0x08, 0x10, 0x20, 0x40, 0x80, 0x1b, 0x36, 0x6c, 0xd8, 0xab, 0x4d, 0x9a, 0x2f, 0x5e, 0xbc, 0x63,
-0xc6, 0x97, 0x35, 0x6a, 0xd4, 0xb3, 0x7d, 0xfa, 0xef, 0xc5, 0x91, 0x39, 0x72, 0xe4, 0xd3, 0xbd,
-0x61, 0xc2, 0x9f, 0x25, 0x4a, 0x94, 0x33, 0x66, 0xcc, 0x83, 0x1d, 0x3a, 0x74, 0xe8, 0xcb, 0x8d};
-
-
-local GMUL = function(A, B)
-    if(A == 0x01) then return B; end
-    if(B == 0x01) then return A; end
-    if(A == 0x00) then return 0; end
-    if(B == 0x00) then return 0; end
-
-    local LA = LTABLE[A];
-    local LB = LTABLE[B];
-
-    local sum = LA + LB;
-    if (sum > 0xFF) then sum = sum - 0xFF; end
-
-    return ETABLE[sum];
-end
-
-local byteSub = Array.substitute;
-
-local shiftRow = Array.permute;
-
-local mixCol = function(i, mix)
-    local out = {};
-
-    local a, b, c, d;
-
-    a = GMUL(i[ 1], mix[ 1]);
-    b = GMUL(i[ 2], mix[ 2]);
-    c = GMUL(i[ 3], mix[ 3]);
-    d = GMUL(i[ 4], mix[ 4]);
-    out[ 1] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[ 5]);
-    b = GMUL(i[ 2], mix[ 6]);
-    c = GMUL(i[ 3], mix[ 7]);
-    d = GMUL(i[ 4], mix[ 8]);
-    out[ 2] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[ 9]);
-    b = GMUL(i[ 2], mix[10]);
-    c = GMUL(i[ 3], mix[11]);
-    d = GMUL(i[ 4], mix[12]);
-    out[ 3] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 1], mix[13]);
-    b = GMUL(i[ 2], mix[14]);
-    c = GMUL(i[ 3], mix[15]);
-    d = GMUL(i[ 4], mix[16]);
-    out[ 4] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[ 5], mix[ 1]);
-    b = GMUL(i[ 6], mix[ 2]);
-    c = GMUL(i[ 7], mix[ 3]);
-    d = GMUL(i[ 8], mix[ 4]);
-    out[ 5] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[ 5]);
-    b = GMUL(i[ 6], mix[ 6]);
-    c = GMUL(i[ 7], mix[ 7]);
-    d = GMUL(i[ 8], mix[ 8]);
-    out[ 6] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[ 9]);
-    b = GMUL(i[ 6], mix[10]);
-    c = GMUL(i[ 7], mix[11]);
-    d = GMUL(i[ 8], mix[12]);
-    out[ 7] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 5], mix[13]);
-    b = GMUL(i[ 6], mix[14]);
-    c = GMUL(i[ 7], mix[15]);
-    d = GMUL(i[ 8], mix[16]);
-    out[ 8] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[ 9], mix[ 1]);
-    b = GMUL(i[10], mix[ 2]);
-    c = GMUL(i[11], mix[ 3]);
-    d = GMUL(i[12], mix[ 4]);
-    out[ 9] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[ 5]);
-    b = GMUL(i[10], mix[ 6]);
-    c = GMUL(i[11], mix[ 7]);
-    d = GMUL(i[12], mix[ 8]);
-    out[10] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[ 9]);
-    b = GMUL(i[10], mix[10]);
-    c = GMUL(i[11], mix[11]);
-    d = GMUL(i[12], mix[12]);
-    out[11] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[ 9], mix[13]);
-    b = GMUL(i[10], mix[14]);
-    c = GMUL(i[11], mix[15]);
-    d = GMUL(i[12], mix[16]);
-    out[12] = XOR(XOR(a, b), XOR(c, d));
-
-
-    a = GMUL(i[13], mix[ 1]);
-    b = GMUL(i[14], mix[ 2]);
-    c = GMUL(i[15], mix[ 3]);
-    d = GMUL(i[16], mix[ 4]);
-    out[13] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[ 5]);
-    b = GMUL(i[14], mix[ 6]);
-    c = GMUL(i[15], mix[ 7]);
-    d = GMUL(i[16], mix[ 8]);
-    out[14] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[ 9]);
-    b = GMUL(i[14], mix[10]);
-    c = GMUL(i[15], mix[11]);
-    d = GMUL(i[16], mix[12]);
-    out[15] = XOR(XOR(a, b), XOR(c, d));
-    a = GMUL(i[13], mix[13]);
-    b = GMUL(i[14], mix[14]);
-    c = GMUL(i[15], mix[15]);
-    d = GMUL(i[16], mix[16]);
-    out[16] = XOR(XOR(a, b), XOR(c, d));
-
-    return out;
-end
-
-local keyRound = function(key, round)
-    local i = (round - 1) * 32;
-    local out = key;
-
-    out[33 + i] = XOR(key[ 1 + i], XOR(SBOX[key[30 + i]], RCON[round]));
-    out[34 + i] = XOR(key[ 2 + i], SBOX[key[31 + i]]);
-    out[35 + i] = XOR(key[ 3 + i], SBOX[key[32 + i]]);
-    out[36 + i] = XOR(key[ 4 + i], SBOX[key[29 + i]]);
-
-    out[37 + i] = XOR(out[33 + i], key[ 5 + i]);
-    out[38 + i] = XOR(out[34 + i], key[ 6 + i]);
-    out[39 + i] = XOR(out[35 + i], key[ 7 + i]);
-    out[40 + i] = XOR(out[36 + i], key[ 8 + i]);
-
-    out[41 + i] = XOR(out[37 + i], key[ 9 + i]);
-    out[42 + i] = XOR(out[38 + i], key[10 + i]);
-    out[43 + i] = XOR(out[39 + i], key[11 + i]);
-    out[44 + i] = XOR(out[40 + i], key[12 + i]);
-
-    out[45 + i] = XOR(out[41 + i], key[13 + i]);
-    out[46 + i] = XOR(out[42 + i], key[14 + i]);
-    out[47 + i] = XOR(out[43 + i], key[15 + i]);
-    out[48 + i] = XOR(out[44 + i], key[16 + i]);
-
-
-    out[49 + i] = XOR(SBOX[out[45 + i]], key[17 + i]);
-    out[50 + i] = XOR(SBOX[out[46 + i]], key[18 + i]);
-    out[51 + i] = XOR(SBOX[out[47 + i]], key[19 + i]);
-    out[52 + i] = XOR(SBOX[out[48 + i]], key[20 + i]);
-
-    out[53 + i] = XOR(out[49 + i], key[21 + i]);
-    out[54 + i] = XOR(out[50 + i], key[22 + i]);
-    out[55 + i] = XOR(out[51 + i], key[23 + i]);
-    out[56 + i] = XOR(out[52 + i], key[24 + i]);
-
-    out[57 + i] = XOR(out[53 + i], key[25 + i]);
-    out[58 + i] = XOR(out[54 + i], key[26 + i]);
-    out[59 + i] = XOR(out[55 + i], key[27 + i]);
-    out[60 + i] = XOR(out[56 + i], key[28 + i]);
-
-    out[61 + i] = XOR(out[57 + i], key[29 + i]);
-    out[62 + i] = XOR(out[58 + i], key[30 + i]);
-    out[63 + i] = XOR(out[59 + i], key[31 + i]);
-    out[64 + i] = XOR(out[60 + i], key[32 + i]);
-
-    return out;
-end
-
-local keyExpand = function(key)
-    local bytes = Array.copy(key);
-
-    for i = 1, 7 do
-        keyRound(bytes, i);
-    end
-
-    local keys = {};
-
-    keys[ 1] = Array.slice(bytes, 1, 16);
-    keys[ 2] = Array.slice(bytes, 17, 32);
-    keys[ 3] = Array.slice(bytes, 33, 48);
-    keys[ 4] = Array.slice(bytes, 49, 64);
-    keys[ 5] = Array.slice(bytes, 65, 80);
-    keys[ 6] = Array.slice(bytes, 81, 96);
-    keys[ 7] = Array.slice(bytes, 97, 112);
-    keys[ 8] = Array.slice(bytes, 113, 128);
-    keys[ 9] = Array.slice(bytes, 129, 144);
-    keys[10] = Array.slice(bytes, 145, 160);
-    keys[11] = Array.slice(bytes, 161, 176);
-    keys[12] = Array.slice(bytes, 177, 192);
-    keys[13] = Array.slice(bytes, 193, 208);
-    keys[14] = Array.slice(bytes, 209, 224);
-    keys[15] = Array.slice(bytes, 225, 240);
-
-    return keys;
-
-end
-
-local addKey = Array.XOR;
-
-
-
-local AES = {};
-
-AES.blockSize = 16;
-
-AES.encrypt = function(_key, block)
-
-    local key = keyExpand(_key);
-
-    --round 0
-    block = addKey(block, key[1]);
-
-    --round 1
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[2]);
-
-    --round 2
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[3]);
-
-    --round 3
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[4]);
-
-    --round 4
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[5]);
-
-    --round 5
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[6]);
-
-    --round 6
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[7]);
-
-    --round 7
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[8]);
-
-    --round 8
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[9]);
-
-    --round 9
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[10]);
-
-    --round 10
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[11]);
-
-    --round 11
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[12]);
-
-    --round 12
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[13]);
-
-    --round 13
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = mixCol(block, MIXTABLE);
-    block = addKey(block, key[14]);
-
-    --round 14
-    block = byteSub(block, SBOX);
-    block = shiftRow(block, ROW_SHIFT);
-    block = addKey(block, key[15]);
-
-    return block;
-
-end
-
-AES.decrypt = function(_key, block)
-
-    local key = keyExpand(_key);
-
-    --round 0
-    block = addKey(block, key[15]);
-
-    --round 1
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[14]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 2
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[13]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 3
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[12]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 4
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[11]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 5
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[10]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 6
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[9]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 7
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[8]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 8
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[7]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 9
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[6]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 10
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[5]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 11
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[4]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 12
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[3]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 13
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[2]);
-    block = mixCol(block, IMIXTABLE);
-
-    --round 14
-    block = shiftRow(block, IROW_SHIFT);
-    block = byteSub(block, ISBOX);
-    block = addKey(block, key[1]);
-
-    return block;
-end
-
-return AES;

lockbox/cipher/mode/cbc.lua

@@ -1,164 +0,0 @@
-local Array = require("lockbox.util.array");
-local Stream = require("lockbox.util.stream");
-local Queue = require("lockbox.util.queue");
-
-local CBC = {};
-
-CBC.Cipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = Array.XOR(iv, block);
-                    out = blockCipher.encrypt(key, out);
-                    Array.writeToQueue(outputQueue, out);
-                    iv = out;
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-
-CBC.Decipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = block;
-                    out = blockCipher.decrypt(key, out);
-                    out = Array.XOR(iv, out);
-                    Array.writeToQueue(outputQueue, out);
-                    iv = block;
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-return CBC;
-

lockbox/cipher/mode/cfb.lua

@@ -1,163 +0,0 @@
-local Array = require("lockbox.util.array");
-local Stream = require("lockbox.util.stream");
-local Queue = require("lockbox.util.queue");
-
-local CFB = {};
-
-CFB.Cipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = iv;
-                    out = blockCipher.encrypt(key, out);
-                    out = Array.XOR(out, block);
-                    Array.writeToQueue(outputQueue, out);
-                    iv = out;
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-CFB.Decipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = iv;
-                    out = blockCipher.encrypt(key, out);
-                    out = Array.XOR(out, block);
-                    Array.writeToQueue(outputQueue, out);
-                    iv = block;
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-return CFB;

lockbox/cipher/mode/ctr.lua

@@ -1,248 +0,0 @@
-local Array = require("lockbox.util.array");
-local Stream = require("lockbox.util.stream");
-local Queue = require("lockbox.util.queue");
-
-local Bit = require("lockbox.util.bit");
-
-local AND = Bit.band;
-
-local CTR = {};
-
-CTR.Cipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    local updateIV = function()
-        iv[16] = iv[16] + 1;
-        if iv[16] <= 0xFF then return; end
-        iv[16] = AND(iv[16], 0xFF);
-
-        iv[15] = iv[15] + 1;
-        if iv[15] <= 0xFF then return; end
-        iv[15] = AND(iv[15], 0xFF);
-
-        iv[14] = iv[14] + 1;
-        if iv[14] <= 0xFF then return; end
-        iv[14] = AND(iv[14], 0xFF);
-
-        iv[13] = iv[13] + 1;
-        if iv[13] <= 0xFF then return; end
-        iv[13] = AND(iv[13], 0xFF);
-
-        iv[12] = iv[12] + 1;
-        if iv[12] <= 0xFF then return; end
-        iv[12] = AND(iv[12], 0xFF);
-
-        iv[11] = iv[11] + 1;
-        if iv[11] <= 0xFF then return; end
-        iv[11] = AND(iv[11], 0xFF);
-
-        iv[10] = iv[10] + 1;
-        if iv[10] <= 0xFF then return; end
-        iv[10] = AND(iv[10], 0xFF);
-
-        iv[9] = iv[9] + 1;
-        if iv[9] <= 0xFF then return; end
-        iv[9] = AND(iv[9], 0xFF);
-
-        return;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = iv;
-                    out = blockCipher.encrypt(key, out);
-
-                    out = Array.XOR(out, block);
-                    Array.writeToQueue(outputQueue, out);
-                    updateIV();
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-
-CTR.Decipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    local updateIV = function()
-        iv[16] = iv[16] + 1;
-        if iv[16] <= 0xFF then return; end
-        iv[16] = AND(iv[16], 0xFF);
-
-        iv[15] = iv[15] + 1;
-        if iv[15] <= 0xFF then return; end
-        iv[15] = AND(iv[15], 0xFF);
-
-        iv[14] = iv[14] + 1;
-        if iv[14] <= 0xFF then return; end
-        iv[14] = AND(iv[14], 0xFF);
-
-        iv[13] = iv[13] + 1;
-        if iv[13] <= 0xFF then return; end
-        iv[13] = AND(iv[13], 0xFF);
-
-        iv[12] = iv[12] + 1;
-        if iv[12] <= 0xFF then return; end
-        iv[12] = AND(iv[12], 0xFF);
-
-        iv[11] = iv[11] + 1;
-        if iv[11] <= 0xFF then return; end
-        iv[11] = AND(iv[11], 0xFF);
-
-        iv[10] = iv[10] + 1;
-        if iv[10] <= 0xFF then return; end
-        iv[10] = AND(iv[10], 0xFF);
-
-        iv[9] = iv[9] + 1;
-        if iv[9] <= 0xFF then return; end
-        iv[9] = AND(iv[9], 0xFF);
-
-        return;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = iv;
-                    out = blockCipher.encrypt(key, out);
-
-                    out = Array.XOR(out, block);
-                    Array.writeToQueue(outputQueue, out);
-                    updateIV();
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-
-
-
-return CTR;
-

lockbox/cipher/mode/ofb.lua

@@ -1,164 +0,0 @@
-local Array = require("lockbox.util.array");
-local Stream = require("lockbox.util.stream");
-local Queue = require("lockbox.util.queue");
-
-local OFB = {};
-
-OFB.Cipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = iv;
-                    out = blockCipher.encrypt(key, out);
-                    iv = out;
-                    out = Array.XOR(out, block);
-                    Array.writeToQueue(outputQueue, out);
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-OFB.Decipher = function()
-
-    local public = {};
-
-    local key;
-    local blockCipher;
-    local padding;
-    local inputQueue;
-    local outputQueue;
-    local iv;
-
-    public.setKey = function(keyBytes)
-        key = keyBytes;
-        return public;
-    end
-
-    public.setBlockCipher = function(cipher)
-        blockCipher = cipher;
-        return public;
-    end
-
-    public.setPadding = function(paddingMode)
-        padding = paddingMode;
-        return public;
-    end
-
-    public.init = function()
-        inputQueue = Queue();
-        outputQueue = Queue();
-        iv = nil;
-        return public;
-    end
-
-    public.update = function(messageStream)
-        local byte = messageStream();
-        while (byte ~= nil) do
-            inputQueue.push(byte);
-            if(inputQueue.size() >= blockCipher.blockSize) then
-                local block = Array.readFromQueue(inputQueue, blockCipher.blockSize);
-
-                if(iv == nil) then
-                    iv = block;
-                else
-                    local out = iv;
-                    out = blockCipher.encrypt(key, out);
-                    iv = out;
-                    out = Array.XOR(out, block);
-                    Array.writeToQueue(outputQueue, out);
-                end
-            end
-            byte = messageStream();
-        end
-        return public;
-    end
-
-    public.finish = function()
-        local paddingStream = padding(blockCipher.blockSize, inputQueue.getHead());
-        public.update(paddingStream);
-
-        return public;
-    end
-
-    public.getOutputQueue = function()
-        return outputQueue;
-    end
-
-    public.asHex = function()
-        return Stream.toHex(outputQueue.pop);
-    end
-
-    public.asBytes = function()
-        return Stream.toArray(outputQueue.pop);
-    end
-
-    return public;
-
-end
-
-
-return OFB;

lockbox/digest/md5.lua

@@ -0,0 +1,201 @@
+require("lockbox").insecure();
+
+local Bit = require("lockbox.util.bit");
+local String = require("string");
+local Math = require("math");
+local Queue = require("lockbox.util.queue");
+
+local SHIFT = {
+    7, 12, 17, 22,  7, 12, 17, 22,  7, 12, 17, 22,  7, 12, 17, 22,
+    5,  9, 14, 20,  5,  9, 14, 20,  5,  9, 14, 20,  5,  9, 14, 20,
+    4, 11, 16, 23,  4, 11, 16, 23,  4, 11, 16, 23,  4, 11, 16, 23,
+    6, 10, 15, 21,  6, 10, 15, 21,  6, 10, 15, 21,  6, 10, 15, 21};
+
+local CONSTANTS = {
+    0xd76aa478, 0xe8c7b756, 0x242070db, 0xc1bdceee,
+    0xf57c0faf, 0x4787c62a, 0xa8304613, 0xfd469501,
+    0x698098d8, 0x8b44f7af, 0xffff5bb1, 0x895cd7be,
+    0x6b901122, 0xfd987193, 0xa679438e, 0x49b40821,
+    0xf61e2562, 0xc040b340, 0x265e5a51, 0xe9b6c7aa,
+    0xd62f105d, 0x02441453, 0xd8a1e681, 0xe7d3fbc8,
+    0x21e1cde6, 0xc33707d6, 0xf4d50d87, 0x455a14ed,
+    0xa9e3e905, 0xfcefa3f8, 0x676f02d9, 0x8d2a4c8a,
+    0xfffa3942, 0x8771f681, 0x6d9d6122, 0xfde5380c,
+    0xa4beea44, 0x4bdecfa9, 0xf6bb4b60, 0xbebfbc70,
+    0x289b7ec6, 0xeaa127fa, 0xd4ef3085, 0x04881d05,
+    0xd9d4d039, 0xe6db99e5, 0x1fa27cf8, 0xc4ac5665,
+    0xf4292244, 0x432aff97, 0xab9423a7, 0xfc93a039,
+    0x655b59c3, 0x8f0ccc92, 0xffeff47d, 0x85845dd1,
+    0x6fa87e4f, 0xfe2ce6e0, 0xa3014314, 0x4e0811a1,
+    0xf7537e82, 0xbd3af235, 0x2ad7d2bb, 0xeb86d391};
+
+local AND = Bit.band;
+local OR  = Bit.bor;
+local NOT = Bit.bnot;
+local XOR = Bit.bxor;
+local LROT = Bit.lrotate;
+local LSHIFT = Bit.lshift;
+local RSHIFT = Bit.rshift;
+
+--MD5 is little-endian
+local bytes2word = function(b0, b1, b2, b3)
+    local i = b3; i = LSHIFT(i, 8);
+    i = OR(i, b2); i = LSHIFT(i, 8);
+    i = OR(i, b1); i = LSHIFT(i, 8);
+    i = OR(i, b0);
+    return i;
+end
+
+local word2bytes = function(word)
+    local b0, b1, b2, b3;
+    b0 = AND(word, 0xFF); word = RSHIFT(word, 8);
+    b1 = AND(word, 0xFF); word = RSHIFT(word, 8);
+    b2 = AND(word, 0xFF); word = RSHIFT(word, 8);
+    b3 = AND(word, 0xFF);
+    return b0, b1, b2, b3;
+end
+
+local dword2bytes = function(i)
+    local b4, b5, b6, b7 = word2bytes(Math.floor(i / 0x100000000));
+    local b0, b1, b2, b3 = word2bytes(i);
+    return b0, b1, b2, b3, b4, b5, b6, b7;
+end
+
+local F = function(x, y, z) return OR(AND(x, y), AND(NOT(x), z)); end
+local G = function(x, y, z) return OR(AND(x, z), AND(y, NOT(z))); end
+local H = function(x, y, z) return XOR(x, XOR(y, z)); end
+local I = function(x, y, z) return XOR(y, OR(x, NOT(z))); end
+
+local MD5 = function()
+
+    local queue = Queue();
+
+    local A = 0x67452301;
+    local B = 0xefcdab89;
+    local C = 0x98badcfe;
+    local D = 0x10325476;
+    local public = {};
+
+    local processBlock = function()
+        local a = A;
+        local b = B;
+        local c = C;
+        local d = D;
+
+        local X = {};
+
+        for i = 1, 16 do
+            X[i] = bytes2word(queue.pop(), queue.pop(), queue.pop(), queue.pop());
+        end
+
+        for i = 0, 63 do
+            local f, g, temp;
+
+            if (0 <= i) and (i <= 15) then
+                f = F(b, c, d);
+                g = i;
+            elseif (16 <= i) and (i <= 31) then
+                f = G(b, c, d);
+                g = (5 * i + 1) % 16;
+            elseif (32 <= i) and (i <= 47) then
+                f = H(b, c, d);
+                g = (3 * i + 5) % 16;
+            elseif (48 <= i) and (i <= 63) then
+                f = I(b, c, d);
+                g = (7 * i) % 16;
+            end
+            temp = d;
+            d = c;
+            c = b;
+            b = b + LROT((a + f + CONSTANTS[i + 1] + X[g + 1]), SHIFT[i + 1]);
+            a = temp;
+        end
+
+        A = AND(A + a, 0xFFFFFFFF);
+        B = AND(B + b, 0xFFFFFFFF);
+        C = AND(C + c, 0xFFFFFFFF);
+        D = AND(D + d, 0xFFFFFFFF);
+    end
+
+    public.init = function()
+        queue.reset();
+
+        A = 0x67452301;
+        B = 0xefcdab89;
+        C = 0x98badcfe;
+        D = 0x10325476;
+
+        return public;
+    end
+
+    public.update = function(bytes)
+        for b in bytes do
+            queue.push(b);
+            if(queue.size() >= 64) then processBlock(); end
+        end
+
+        return public;
+    end
+
+    public.finish = function()
+        local bits = queue.getHead() * 8;
+
+        queue.push(0x80);
+        while ((queue.size() + 7) % 64) < 63 do
+            queue.push(0x00);
+        end
+
+        local b0, b1, b2, b3, b4, b5, b6, b7 = dword2bytes(bits);
+
+        queue.push(b0);
+        queue.push(b1);
+        queue.push(b2);
+        queue.push(b3);
+        queue.push(b4);
+        queue.push(b5);
+        queue.push(b6);
+        queue.push(b7);
+
+        while queue.size() > 0 do
+            processBlock();
+        end
+
+        return public;
+    end
+
+    public.asBytes = function()
+        local  b0, b1, b2, b3 = word2bytes(A);
+        local  b4, b5, b6, b7 = word2bytes(B);
+        local  b8, b9, b10, b11 = word2bytes(C);
+        local b12, b13, b14, b15 = word2bytes(D);
+
+        return {b0, b1, b2, b3, b4, b5, b6, b7, b8, b9, b10, b11, b12, b13, b14, b15};
+    end
+
+    public.asHex = function()
+        local  b0, b1, b2, b3 = word2bytes(A);
+        local  b4, b5, b6, b7 = word2bytes(B);
+        local  b8, b9, b10, b11 = word2bytes(C);
+        local b12, b13, b14, b15 = word2bytes(D);
+
+        return String.format("%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x%02x",
+                b0, b1, b2, b3, b4, b5, b6, b7, b8, b9, b10, b11, b12, b13, b14, b15);
+    end
+
+    public.asString = function()
+        local b0, b1, b2, b3 = word2bytes(A);
+        local b4, b5, b6, b7 = word2bytes(B);
+        local b8, b9, b10, b11 = word2bytes(C);
+        local b12, b13, b14, b15 = word2bytes(D);
+
+        return string.pack(string.rep('B', 16),
+            b0, b1, b2, b3, b4, b5, b6, b7, b8,
+            b9, b10, b11, b12, b13, b14, b15
+        )
+    end
+
+    return public;
+
+end
+
+return MD5;

lockbox/init.lua

@@ -1,5 +1,8 @@
 local Lockbox = {};
 
+-- cc-mek-scada lockbox version
+Lockbox.version = "1.0"
+
 --[[
 package.path =  "./?.lua;"
                 .. "./cipher/?.lua;"

lockbox/padding/ansix923.lua

@@ -1,22 +0,0 @@
-local ANSIX923Padding = function(blockSize, byteCount)
-
-    local paddingCount = blockSize - (byteCount % blockSize);
-    local bytesLeft = paddingCount;
-
-    local stream = function()
-        if bytesLeft > 1 then
-            bytesLeft = bytesLeft - 1;
-            return 0x00;
-        elseif bytesLeft > 0 then
-            bytesLeft = bytesLeft - 1;
-            return paddingCount;
-        else
-            return nil;
-        end
-    end
-
-    return stream;
-
-end
-
-return ANSIX923Padding;

lockbox/padding/isoiec7816.lua

@@ -1,22 +0,0 @@
-local ISOIEC7816Padding = function(blockSize, byteCount)
-
-    local paddingCount = blockSize - (byteCount % blockSize);
-    local bytesLeft = paddingCount;
-
-    local stream = function()
-        if bytesLeft == paddingCount then
-            bytesLeft = bytesLeft - 1;
-            return 0x80;
-        elseif bytesLeft > 0 then
-            bytesLeft = bytesLeft - 1;
-            return 0x00;
-        else
-            return nil;
-        end
-    end
-
-    return stream;
-
-end
-
-return ISOIEC7816Padding;

lockbox/padding/pkcs7.lua

@@ -1,18 +0,0 @@
-local PKCS7Padding = function(blockSize, byteCount)
-
-    local paddingCount = blockSize - ((byteCount -1) % blockSize) + 1;
-    local bytesLeft = paddingCount;
-
-    local stream = function()
-        if bytesLeft > 0 then
-            bytesLeft = bytesLeft - 1;
-            return paddingCount;
-        else
-            return nil;
-        end
-    end
-
-    return stream;
-end
-
-return PKCS7Padding;

lockbox/padding/zero.lua

@@ -1,19 +0,0 @@
-local ZeroPadding = function(blockSize, byteCount)
-
-    local paddingCount = blockSize - ((byteCount -1) % blockSize) + 1;
-    local bytesLeft = paddingCount;
-
-    local stream = function()
-        if bytesLeft > 0 then
-            bytesLeft = bytesLeft - 1;
-            return 0x00;
-        else
-            return nil;
-        end
-    end
-
-    return stream;
-
-end
-
-return ZeroPadding;

lockbox/util/bit.lua

@@ -1,25 +1,19 @@
-local ok, e
+-- modified (simplified) for ComputerCraft
-ok = nil
+
-if not ok then
+local ok, e = nil, nil
-    ok, e = pcall(require, "bit") -- the LuaJIT one ?
+
-end
 if not ok then
     ok, e = pcall(require, "bit32") -- Lua 5.2
 end
+
 if not ok then
-    ok, e = pcall(require, "bit.numberlua") -- for Lua 5.1, https://github.com/tst2005/lua-bit-numberlua/
+    ok, e = pcall(require, "bit")
 end
+
 if not ok then
     error("no bitwise support found", 2)
 end
+
 assert(type(e) == "table", "invalid bit module")
 
--- Workaround to support Lua 5.2 bit32 API with the LuaJIT bit one
-if e.rol and not e.lrotate then
-    e.lrotate = e.rol
-end
-if e.ror and not e.rrotate then
-    e.rrotate = e.ror
-end
-
 return e

pocket/config.lua

@@ -10,6 +10,10 @@ config.PKT_CHANNEL = 16244
 config.TRUSTED_RANGE = 0
 -- time in seconds (>= 2) before assuming a remote device is no longer active
 config.COMMS_TIMEOUT = 5
+-- facility authentication key (do NOT use one of your passwords)
+-- this enables verifying that messages are authentic
+-- all devices on the same network must use the same key
+-- config.AUTH_KEY = "SCADAfacility123"
 
 -- log path
 config.LOG_PATH = "/log.txt"

pocket/coreio.lua

@@ -1,35 +0,0 @@
---
--- Core I/O - Pocket Central I/O Management
---
-
-local psil = require("scada-common.psil")
-
-local coreio = {}
-
----@class pocket_core_io
-local io = {
-    ps = psil.create()
-}
-
----@enum POCKET_LINK_STATE
-local LINK_STATE = {
-    UNLINKED = 0,
-    SV_LINK_ONLY = 1,
-    API_LINK_ONLY = 2,
-    LINKED = 3
-}
-
-coreio.LINK_STATE = LINK_STATE
-
--- get the core PSIL
-function coreio.core_ps()
-    return io.ps
-end
-
--- set network link state
----@param state POCKET_LINK_STATE
-function coreio.report_link_state(state)
-    io.ps.publish("link_state", state)
-end
-
-return coreio

pocket/iocontrol.lua

@@ -0,0 +1,106 @@
+--
+-- I/O Control for Pocket Integration with Supervisor & Coordinator
+--
+
+local psil = require("scada-common.psil")
+
+local types = require("scada-common.types")
+
+local ALARM = types.ALARM
+
+local iocontrol = {}
+
+---@class pocket_ioctl
+local io = {
+    ps = psil.create()
+}
+
+---@enum POCKET_LINK_STATE
+local LINK_STATE = {
+    UNLINKED = 0,
+    SV_LINK_ONLY = 1,
+    API_LINK_ONLY = 2,
+    LINKED = 3
+}
+
+---@enum NAV_PAGE
+local NAV_PAGE = {
+    HOME = 1,
+    UNITS = 2,
+    REACTORS = 3,
+    BOILERS = 4,
+    TURBINES = 5,
+    DIAG = 6,
+    D_ALARMS = 7
+}
+
+iocontrol.LINK_STATE = LINK_STATE
+iocontrol.NAV_PAGE = NAV_PAGE
+
+-- initialize facility-independent components of pocket iocontrol
+---@param comms pocket_comms
+function iocontrol.init_core(comms)
+    ---@class pocket_ioctl_diag
+    io.diag = {}
+
+    -- alarm testing
+    io.diag.tone_test = {
+        test_1 = function (state) comms.diag__set_alarm_tone(1, state) end,
+        test_2 = function (state) comms.diag__set_alarm_tone(2, state) end,
+        test_3 = function (state) comms.diag__set_alarm_tone(3, state) end,
+        test_4 = function (state) comms.diag__set_alarm_tone(4, state) end,
+        test_5 = function (state) comms.diag__set_alarm_tone(5, state) end,
+        test_6 = function (state) comms.diag__set_alarm_tone(6, state) end,
+        test_7 = function (state) comms.diag__set_alarm_tone(7, state) end,
+        test_8 = function (state) comms.diag__set_alarm_tone(8, state) end,
+        stop_tones = function () comms.diag__set_alarm_tone(0, false) end,
+
+        test_breach = function (state) comms.diag__set_alarm(ALARM.ContainmentBreach, state) end,
+        test_rad = function (state) comms.diag__set_alarm(ALARM.ContainmentRadiation, state) end,
+        test_lost = function (state) comms.diag__set_alarm(ALARM.ReactorLost, state) end,
+        test_crit = function (state) comms.diag__set_alarm(ALARM.CriticalDamage, state) end,
+        test_dmg = function (state) comms.diag__set_alarm(ALARM.ReactorDamage, state) end,
+        test_overtemp = function (state) comms.diag__set_alarm(ALARM.ReactorOverTemp, state) end,
+        test_hightemp = function (state) comms.diag__set_alarm(ALARM.ReactorHighTemp, state) end,
+        test_wasteleak = function (state) comms.diag__set_alarm(ALARM.ReactorWasteLeak, state) end,
+        test_highwaste = function (state) comms.diag__set_alarm(ALARM.ReactorHighWaste, state) end,
+        test_rps = function (state) comms.diag__set_alarm(ALARM.RPSTransient, state) end,
+        test_rcs = function (state) comms.diag__set_alarm(ALARM.RCSTransient, state) end,
+        test_turbinet = function (state) comms.diag__set_alarm(ALARM.TurbineTrip, state) end,
+        stop_alarms = function () comms.diag__set_alarm(0, false) end,
+
+        get_tone_states = function () comms.diag__get_alarm_tones() end,
+
+        ready_warn = nil,       ---@type graphics_element
+        tone_buttons = {},
+        alarm_buttons = {},
+        tone_indicators = {}    -- indicators to update from supervisor tone states
+    }
+
+    ---@class pocket_nav
+    io.nav = {
+        page = NAV_PAGE.HOME,   ---@type NAV_PAGE
+        sub_pages = { NAV_PAGE.HOME, NAV_PAGE.UNITS, NAV_PAGE.REACTORS, NAV_PAGE.BOILERS, NAV_PAGE.TURBINES, NAV_PAGE.DIAG },
+        tasks = {}
+    }
+
+    -- add a task to be performed periodically while on a given page
+    ---@param page NAV_PAGE page to add task to
+    ---@param task function function to execute
+    function io.nav.register_task(page, task)
+        if io.nav.tasks[page] == nil then io.nav.tasks[page] = {} end
+        table.insert(io.nav.tasks[page], task)
+    end
+end
+
+-- initialize facility-dependent components of pocket iocontrol
+function iocontrol.init_fac() end
+
+-- set network link state
+---@param state POCKET_LINK_STATE
+function iocontrol.report_link_state(state) io.ps.publish("link_state", state) end
+
+-- get the IO controller database
+function iocontrol.get_db() return io end
+
+return iocontrol

pocket/pocket.lua

@@ -1,30 +1,29 @@
-local comms  = require("scada-common.comms")
+local comms     = require("scada-common.comms")
-local log    = require("scada-common.log")
+local log       = require("scada-common.log")
-local util   = require("scada-common.util")
+local util      = require("scada-common.util")
 
-local coreio = require("pocket.coreio")
+local iocontrol = require("pocket.iocontrol")
 
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
 local ESTABLISH_ACK = comms.ESTABLISH_ACK
 local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
--- local CAPI_TYPE = comms.CAPI_TYPE
 
-local LINK_STATE = coreio.LINK_STATE
+local LINK_STATE = iocontrol.LINK_STATE
 
 local pocket = {}
 
 -- pocket coordinator + supervisor communications
 ---@nodiscard
 ---@param version string pocket version
----@param modem table modem device
+---@param nic nic network interface device
 ---@param pkt_channel integer pocket comms channel
 ---@param svr_channel integer supervisor access channel
 ---@param crd_channel integer coordinator access channel
 ---@param range integer trusted device connection range
 ---@param sv_watchdog watchdog
 ---@param api_watchdog watchdog
-function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, range, sv_watchdog, api_watchdog)
+function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range, sv_watchdog, api_watchdog)
     local self = {
         sv = {
             linked = false,
@@ -47,13 +46,9 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
 
     -- PRIVATE FUNCTIONS --
 
-    -- configure modem channels
+    -- configure network channels
-    local function _conf_channels()
+    nic.closeAll()
-        modem.closeAll()
+    nic.open(pkt_channel)
-        modem.open(pkt_channel)
-    end
-
-    _conf_channels()
 
     -- send a management packet to the supervisor
     ---@param msg_type SCADA_MGMT_TYPE
@@ -65,7 +60,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
         pkt.make(msg_type, msg)
         s_pkt.make(self.sv.addr, self.sv.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
 
-        modem.transmit(svr_channel, pkt_channel, s_pkt.raw_sendable())
+        nic.transmit(svr_channel, pkt_channel, s_pkt)
         self.sv.seq_num = self.sv.seq_num + 1
     end
 
@@ -79,24 +74,10 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
         pkt.make(msg_type, msg)
         s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
 
-        modem.transmit(crd_channel, pkt_channel, s_pkt.raw_sendable())
+        nic.transmit(crd_channel, pkt_channel, s_pkt)
         self.api.seq_num = self.api.seq_num + 1
     end
 
-    -- send a packet to the coordinator API
-    -----@param msg_type CAPI_TYPE
-    -----@param msg table
-    -- local function _send_api(msg_type, msg)
-    --     local s_pkt = comms.scada_packet()
-    --     local pkt = comms.capi_packet()
-
-    --     pkt.make(msg_type, msg)
-    --     s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.COORD_API, pkt.raw_sendable())
-
-    --     modem.transmit(crd_channel, pkt_channel, s_pkt.raw_sendable())
-    --     self.api.seq_num = self.api.seq_num + 1
-    -- end
-
     -- attempt supervisor connection establishment
     local function _send_sv_establish()
         _send_sv(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
@@ -124,13 +105,6 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
     ---@class pocket_comms
     local public = {}
 
-    -- reconnect a newly connected modem
-    ---@param new_modem table
-    function public.reconnect_modem(new_modem)
-        modem = new_modem
-        _conf_channels()
-    end
-
     -- close connection to the supervisor
     function public.close_sv()
         sv_watchdog.cancel()
@@ -158,7 +132,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
     -- attempt to re-link if any of the dependent links aren't active
     function public.link_update()
         if not self.sv.linked then
-            coreio.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
+            iocontrol.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
 
             if self.establish_delay_counter <= 0 then
                 _send_sv_establish()
@@ -167,7 +141,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
                 self.establish_delay_counter = self.establish_delay_counter - 1
             end
         elseif not self.api.linked then
-            coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
+            iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
 
             if self.establish_delay_counter <= 0 then
                 _send_api_establish()
@@ -177,10 +151,29 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
             end
         else
             -- linked, all good!
-            coreio.report_link_state(LINK_STATE.LINKED)
+            iocontrol.report_link_state(LINK_STATE.LINKED)
         end
     end
 
+    -- supervisor get active alarm tones
+    function public.diag__get_alarm_tones()
+        if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_TONE_GET, {}) end
+    end
+
+    -- supervisor test alarm tones by tone
+    ---@param id TONE|0 tone ID, or 0 to stop all
+    ---@param state boolean tone state
+    function public.diag__set_alarm_tone(id, state)
+        if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_TONE_SET, { id, state }) end
+    end
+
+    -- supervisor test alarm tones by alarm
+    ---@param id ALARM|0 alarm ID, 0 to stop all
+    ---@param state boolean alarm state
+    function public.diag__set_alarm(id, state)
+        if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_ALARM_SET, { id, state }) end
+    end
+
     -- parse a packet
     ---@param side string
     ---@param sender integer
@@ -189,13 +182,10 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
     ---@param distance integer
     ---@return mgmt_frame|capi_frame|nil packet
     function public.parse_packet(side, sender, reply_to, message, distance)
+        local s_pkt = nic.receive(side, sender, reply_to, message, distance)
         local pkt = nil
-        local s_pkt = comms.scada_packet()
 
-        -- parse packet as generic SCADA packet
+        if s_pkt then
-        s_pkt.receive(side, sender, reply_to, message, distance)
-
-        if s_pkt.is_valid() then
             -- get as SCADA management packet
             if s_pkt.protocol() == PROTOCOL.SCADA_MGMT then
                 local mgmt_pkt = comms.mgmt_packet()
@@ -219,6 +209,8 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
     -- handle a packet
     ---@param packet mgmt_frame|capi_frame|nil
     function public.handle_packet(packet)
+        local diag = iocontrol.get_db().diag
+
         if packet ~= nil then
             local l_chan   = packet.scada_frame.local_channel()
             local r_chan   = packet.scada_frame.remote_channel()
@@ -245,47 +237,9 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
                 -- feed watchdog on valid sequence number
                 api_watchdog.feed()
 
-                if protocol == PROTOCOL.COORD_API then
+                if protocol == PROTOCOL.SCADA_MGMT then
-                    ---@cast packet capi_frame
-                elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if self.api.linked then
-                        -- connection with coordinator established
-                        if packet.length == 1 then
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                log.info("coordinator connection established")
-                                self.establish_delay_counter = 0
-                                self.api.linked = true
-                                self.api.addr = src_addr
-
-                                if self.sv.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
-                                else
-                                    coreio.report_link_state(LINK_STATE.API_LINK_ONLY)
-                                end
-                            elseif est_ack == ESTABLISH_ACK.DENY then
-                                if self.api.last_est_ack ~= est_ack then
-                                    log.info("coordinator connection denied")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                if self.api.last_est_ack ~= est_ack then
-                                    log.info("coordinator connection denied due to collision")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                if self.api.last_est_ack ~= est_ack then
-                                    log.info("coordinator comms version mismatch")
-                                end
-                            else
-                                log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
-                            end
-
-                            self.api.last_est_ack = est_ack
-                        else
-                            log.debug("coordinator SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.api.linked then
                         if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
@@ -312,6 +266,42 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from coordinator")
                         end
+                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                        -- connection with coordinator established
+                        if packet.length == 1 then
+                            local est_ack = packet.data[1]
+
+                            if est_ack == ESTABLISH_ACK.ALLOW then
+                                log.info("coordinator connection established")
+                                self.establish_delay_counter = 0
+                                self.api.linked = true
+                                self.api.addr = src_addr
+
+                                if self.sv.linked then
+                                    iocontrol.report_link_state(LINK_STATE.LINKED)
+                                else
+                                    iocontrol.report_link_state(LINK_STATE.API_LINK_ONLY)
+                                end
+                            elseif est_ack == ESTABLISH_ACK.DENY then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator connection denied")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.COLLISION then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator connection denied due to collision")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator comms version mismatch")
+                                end
+                            else
+                                log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
+                            end
+
+                            self.api.last_est_ack = est_ack
+                        else
+                            log.debug("coordinator SCADA_MGMT establish packet length mismatch")
+                        end
                     else
                         log.debug("discarding coordinator non-link SCADA_MGMT packet before linked")
                     end
@@ -339,43 +329,7 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
                 -- handle packet
                 if protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if self.sv.linked then
-                        -- connection with supervisor established
-                        if packet.length == 1 then
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                log.info("supervisor connection established")
-                                self.establish_delay_counter = 0
-                                self.sv.linked = true
-                                self.sv.addr = src_addr
-
-                                if self.api.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
-                                else
-                                    coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
-                                end
-                            elseif est_ack == ESTABLISH_ACK.DENY then
-                                if self.sv.last_est_ack ~= est_ack then
-                                    log.info("supervisor connection denied")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                if self.sv.last_est_ack ~= est_ack then
-                                    log.info("supervisor connection denied due to collision")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                if self.sv.last_est_ack ~= est_ack then
-                                    log.info("supervisor comms version mismatch")
-                                end
-                            else
-                                log.debug("supervisor SCADA_MGMT establish packet reply unsupported")
-                            end
-
-                            self.sv.last_est_ack = est_ack
-                        else
-                            log.debug("supervisor SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.sv.linked then
                         if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
@@ -399,9 +353,90 @@ function pocket.comms(version, modem, pkt_channel, svr_channel, crd_channel, ran
                             self.sv.r_seq_num = nil
                             self.sv.addr = comms.BROADCAST
                             log.info("supervisor server connection closed by remote host")
+                        elseif packet.type == SCADA_MGMT_TYPE.DIAG_TONE_GET then
+                            if packet.length == 8 then
+                                for i = 1, #packet.data do
+                                    diag.tone_test.tone_indicators[i].update(packet.data[i] == true)
+                                end
+                            else
+                                log.debug("supervisor SCADA diag alarm states packet length mismatch")
+                            end
+                        elseif packet.type == SCADA_MGMT_TYPE.DIAG_TONE_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag tone set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.tone_buttons[i] ~= nil then
+                                        diag.tone_test.tone_buttons[i].set_value(states[i] == true)
+                                        diag.tone_test.tone_indicators[i].update(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag tone set packet length/type mismatch")
+                            end
+                        elseif packet.type == SCADA_MGMT_TYPE.DIAG_ALARM_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag alarm set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.alarm_buttons[i] ~= nil then
+                                        diag.tone_test.alarm_buttons[i].set_value(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag alarm set packet length/type mismatch")
+                            end
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from supervisor")
                         end
+                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                        -- connection with supervisor established
+                        if packet.length == 1 then
+                            local est_ack = packet.data[1]
+
+                            if est_ack == ESTABLISH_ACK.ALLOW then
+                                log.info("supervisor connection established")
+                                self.establish_delay_counter = 0
+                                self.sv.linked = true
+                                self.sv.addr = src_addr
+
+                                if self.api.linked then
+                                    iocontrol.report_link_state(LINK_STATE.LINKED)
+                                else
+                                    iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
+                                end
+                            elseif est_ack == ESTABLISH_ACK.DENY then
+                                if self.sv.last_est_ack ~= est_ack then
+                                    log.info("supervisor connection denied")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.COLLISION then
+                                if self.sv.last_est_ack ~= est_ack then
+                                    log.info("supervisor connection denied due to collision")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
+                                if self.sv.last_est_ack ~= est_ack then
+                                    log.info("supervisor comms version mismatch")
+                                end
+                            else
+                                log.debug("supervisor SCADA_MGMT establish packet reply unsupported")
+                            end
+
+                            self.sv.last_est_ack = est_ack
+                        else
+                            log.debug("supervisor SCADA_MGMT establish packet length mismatch")
+                        end
                     else
                         log.debug("discarding supervisor non-link SCADA_MGMT packet before linked")
                     end

pocket/startup.lua

@@ -4,20 +4,21 @@
 
 require("/initenv").init_env()
 
-local crash    = require("scada-common.crash")
+local crash     = require("scada-common.crash")
-local log      = require("scada-common.log")
+local log       = require("scada-common.log")
-local ppm      = require("scada-common.ppm")
+local network   = require("scada-common.network")
-local tcd      = require("scada-common.tcd")
+local ppm       = require("scada-common.ppm")
-local util     = require("scada-common.util")
+local tcd       = require("scada-common.tcd")
+local util      = require("scada-common.util")
 
-local core     = require("graphics.core")
+local core      = require("graphics.core")
 
-local config   = require("pocket.config")
+local config    = require("pocket.config")
-local coreio   = require("pocket.coreio")
+local iocontrol = require("pocket.iocontrol")
-local pocket   = require("pocket.pocket")
+local pocket    = require("pocket.pocket")
-local renderer = require("pocket.renderer")
+local renderer  = require("pocket.renderer")
 
-local POCKET_VERSION = "alpha-v0.4.5"
+local POCKET_VERSION = "v0.6.0-alpha"
 
 local println = util.println
 local println_ts = util.println_ts
@@ -67,7 +68,12 @@ local function main()
     -- setup communications & clocks
     ----------------------------------------
 
-    coreio.report_link_state(coreio.LINK_STATE.UNLINKED)
+    -- message authentication init
+    if type(config.AUTH_KEY) == "string" then
+        network.init_mac(config.AUTH_KEY)
+    end
+
+    iocontrol.report_link_state(iocontrol.LINK_STATE.UNLINKED)
 
     -- get the communications modem
     local modem = ppm.get_wireless_modem()
@@ -88,8 +94,9 @@ local function main()
 
     log.debug("startup> conn watchdogs created")
 
-    -- start comms, open all channels
+    -- create network interface then setup comms
-    local pocket_comms = pocket.comms(POCKET_VERSION, modem, config.PKT_CHANNEL, config.SVR_CHANNEL,
+    local nic = network.nic(modem)
+    local pocket_comms = pocket.comms(POCKET_VERSION, nic, config.PKT_CHANNEL, config.SVR_CHANNEL,
                                         config.CRD_CHANNEL, config.TRUSTED_RANGE, conn_wd.sv, conn_wd.api)
     log.debug("startup> comms init")
 
@@ -97,6 +104,9 @@ local function main()
     local MAIN_CLOCK = 0.5
     local loop_clock = util.new_clock(MAIN_CLOCK)
 
+    -- init I/O control
+    iocontrol.init_core(pocket_comms)
+
     ----------------------------------------
     -- start the UI
     ----------------------------------------
@@ -105,7 +115,7 @@ local function main()
     if not ui_ok then
         renderer.close_ui()
         println(util.c("UI error: ", message))
-        log.error(util.c("startup> GUI crashed with error ", message))
+        log.error(util.c("startup> GUI render failed with error ", message))
     else
         -- start clock
         loop_clock.start()
@@ -121,6 +131,9 @@ local function main()
         conn_wd.api.feed()
         log.debug("startup> conn watchdog started")
 
+        local io_db = iocontrol.get_db()
+        local nav   = io_db.nav
+
         -- main event loop
         while true do
             local event, param1, param2, param3, param4, param5 = util.pull_event()
@@ -133,6 +146,13 @@ local function main()
                     -- relink if necessary
                     pocket_comms.link_update()
 
+                    -- update any tasks for the active page
+                    if (type(nav.tasks[nav.page]) == "table") then
+                        for i = 1, #nav.tasks[nav.page] do
+                            nav.tasks[nav.page][i]()
+                        end
+                    end
+
                     loop_clock.start()
                 elseif conn_wd.sv.is_timer(param1) then
                     -- supervisor watchdog timeout

pocket/ui/main.lua

@@ -2,17 +2,18 @@
 -- Pocket GUI Root
 --
 
-local coreio        = require("pocket.coreio")
+local iocontrol    = require("pocket.iocontrol")
 
 local style        = require("pocket.ui.style")
 
 local conn_waiting = require("pocket.ui.components.conn_waiting")
 
-local home_page    = require("pocket.ui.pages.home_page")
-local unit_page    = require("pocket.ui.pages.unit_page")
-local reactor_page = require("pocket.ui.pages.reactor_page")
 local boiler_page  = require("pocket.ui.pages.boiler_page")
+local diag_page    = require("pocket.ui.pages.diag_page")
+local home_page    = require("pocket.ui.pages.home_page")
+local reactor_page = require("pocket.ui.pages.reactor_page")
 local turbine_page = require("pocket.ui.pages.turbine_page")
+local unit_page    = require("pocket.ui.pages.unit_page")
 
 local core         = require("graphics.core")
 
@@ -22,6 +23,9 @@ local TextBox      = require("graphics.elements.textbox")
 
 local Sidebar      = require("graphics.elements.controls.sidebar")
 
+local LINK_STATE = iocontrol.LINK_STATE
+local NAV_PAGE   = iocontrol.NAV_PAGE
+
 local TEXT_ALIGN = core.TEXT_ALIGN
 
 local cpair = core.cpair
@@ -29,6 +33,9 @@ local cpair = core.cpair
 -- create new main view
 ---@param main graphics_element main displaybox
 local function init(main)
+    local nav = iocontrol.get_db().nav
+    local ps  = iocontrol.get_db().ps
+
     -- window header message
     TextBox{parent=main,y=1,text="",alignment=TEXT_ALIGN.LEFT,height=1,fg_bg=style.header}
 
@@ -45,10 +52,10 @@ local function init(main)
 
     local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes=root_panes}
 
-    root_pane.register(coreio.core_ps(), "link_state", function (state)
+    root_pane.register(ps, "link_state", function (state)
-        if state == coreio.LINK_STATE.UNLINKED or state == coreio.LINK_STATE.API_LINK_ONLY then
+        if state == LINK_STATE.UNLINKED or state == LINK_STATE.API_LINK_ONLY then
             root_pane.set_value(1)
-        elseif state == coreio.LINK_STATE.SV_LINK_ONLY then
+        elseif state == LINK_STATE.SV_LINK_ONLY then
             root_pane.set_value(2)
         else
             root_pane.set_value(3)
@@ -81,19 +88,36 @@ local function init(main)
         {
             char = "T",
             color = cpair(colors.black,colors.white)
+        },
+        {
+            char = "D",
+            color = cpair(colors.black,colors.orange)
         }
     }
 
-    local pane_1 = home_page(page_div)
+    local panes = { home_page(page_div), unit_page(page_div), reactor_page(page_div),  boiler_page(page_div), turbine_page(page_div), diag_page(page_div) }
-    local pane_2 = unit_page(page_div)
-    local pane_3 = reactor_page(page_div)
-    local pane_4 = boiler_page(page_div)
-    local pane_5 = turbine_page(page_div)
-    local panes = { pane_1, pane_2, pane_3, pane_4, pane_5 }
 
     local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
 
-    Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=page_pane.set_value}
+    local function navigate_sidebar(page)
+        if page == 1 then
+            nav.page = nav.sub_pages[NAV_PAGE.HOME]
+        elseif page == 2 then
+            nav.page = nav.sub_pages[NAV_PAGE.UNITS]
+        elseif page == 3 then
+            nav.page = nav.sub_pages[NAV_PAGE.REACTORS]
+        elseif page == 4 then
+            nav.page = nav.sub_pages[NAV_PAGE.BOILERS]
+        elseif page == 5 then
+            nav.page = nav.sub_pages[NAV_PAGE.TURBINES]
+        elseif page == 6 then
+            nav.page = nav.sub_pages[NAV_PAGE.DIAG]
+        end
+
+        page_pane.set_value(page)
+    end
+
+    Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=navigate_sidebar}
 end
 
 return init

pocket/ui/pages/diag_page.lua

@@ -0,0 +1,147 @@
+local iocontrol      = require("pocket.iocontrol")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local MultiPane      = require("graphics.elements.multipane")
+local TextBox        = require("graphics.elements.textbox")
+
+local IndicatorLight = require("graphics.elements.indicators.light")
+
+local App            = require("graphics.elements.controls.app")
+local Checkbox       = require("graphics.elements.controls.checkbox")
+local PushButton     = require("graphics.elements.controls.push_button")
+local SwitchButton   = require("graphics.elements.controls.switch_button")
+
+local cpair = core.cpair
+
+local NAV_PAGE = iocontrol.NAV_PAGE
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+-- new diagnostics page view
+---@param root graphics_element parent
+local function new_view(root)
+    local db = iocontrol.get_db()
+
+    local main = Div{parent=root,x=1,y=1}
+
+    local diag_home = Div{parent=main,x=1,y=1}
+
+    TextBox{parent=diag_home,text="Diagnostic Apps",x=1,y=2,height=1,alignment=TEXT_ALIGN.CENTER}
+
+    local alarm_test = Div{parent=main,x=1,y=1}
+
+    local panes = { diag_home, alarm_test }
+
+    local page_pane = MultiPane{parent=main,x=1,y=1,panes=panes}
+
+    local function navigate_diag()
+        page_pane.set_value(1)
+        db.nav.page = NAV_PAGE.DIAG
+        db.nav.sub_pages[NAV_PAGE.DIAG] = NAV_PAGE.DIAG
+    end
+
+    local function navigate_alarm()
+        page_pane.set_value(2)
+        db.nav.page = NAV_PAGE.D_ALARMS
+        db.nav.sub_pages[NAV_PAGE.DIAG] = NAV_PAGE.D_ALARMS
+    end
+
+    ------------------------
+    -- Alarm Testing Page --
+    ------------------------
+
+    db.nav.register_task(NAV_PAGE.D_ALARMS, db.diag.tone_test.get_tone_states)
+
+    local ttest = db.diag.tone_test
+
+    local c_wht_gray = cpair(colors.white, colors.gray)
+    local c_red_gray = cpair(colors.red, colors.gray)
+    local c_yel_gray = cpair(colors.yellow, colors.gray)
+    local c_blue_gray = cpair(colors.blue, colors.gray)
+
+    local audio = Div{parent=alarm_test,x=1,y=1}
+
+    TextBox{parent=audio,y=1,text="Alarm Sounder Tests",height=1,alignment=TEXT_ALIGN.CENTER}
+
+    ttest.ready_warn = TextBox{parent=audio,y=2,text="",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.yellow,colors.black)}
+
+    PushButton{parent=audio,x=13,y=18,text="\x11 BACK",min_width=8,fg_bg=cpair(colors.black,colors.lightGray),active_fg_bg=c_wht_gray,callback=navigate_diag}
+
+    local tones = Div{parent=audio,x=2,y=3,height=10,width=8,fg_bg=cpair(colors.black,colors.yellow)}
+
+    TextBox{parent=tones,text="Tones",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local test_btns = {}
+    test_btns[1] = SwitchButton{parent=tones,text="TEST 1",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_1}
+    test_btns[2] = SwitchButton{parent=tones,text="TEST 2",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_2}
+    test_btns[3] = SwitchButton{parent=tones,text="TEST 3",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_3}
+    test_btns[4] = SwitchButton{parent=tones,text="TEST 4",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_4}
+    test_btns[5] = SwitchButton{parent=tones,text="TEST 5",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_5}
+    test_btns[6] = SwitchButton{parent=tones,text="TEST 6",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_6}
+    test_btns[7] = SwitchButton{parent=tones,text="TEST 7",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_7}
+    test_btns[8] = SwitchButton{parent=tones,text="TEST 8",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_8}
+
+    ttest.tone_buttons = test_btns
+
+    local function stop_all_tones()
+        for i = 1, #test_btns do test_btns[i].set_value(false) end
+        ttest.stop_tones()
+    end
+
+    PushButton{parent=tones,text="STOP",min_width=8,active_fg_bg=c_wht_gray,fg_bg=cpair(colors.black,colors.red),callback=stop_all_tones}
+
+    local alarms = Div{parent=audio,x=11,y=3,height=15,fg_bg=cpair(colors.lightGray,colors.black)}
+
+    TextBox{parent=alarms,text="Alarms (\x13)",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local alarm_btns = {}
+    alarm_btns[1] = Checkbox{parent=alarms,label="BREACH",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_breach}
+    alarm_btns[2] = Checkbox{parent=alarms,label="RADIATION",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_rad}
+    alarm_btns[3] = Checkbox{parent=alarms,label="RCT LOST",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_lost}
+    alarm_btns[4] = Checkbox{parent=alarms,label="CRIT DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_crit}
+    alarm_btns[5] = Checkbox{parent=alarms,label="DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_dmg}
+    alarm_btns[6] = Checkbox{parent=alarms,label="OVER TEMP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_overtemp}
+    alarm_btns[7] = Checkbox{parent=alarms,label="HIGH TEMP",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_hightemp}
+    alarm_btns[8] = Checkbox{parent=alarms,label="WASTE LEAK",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_wasteleak}
+    alarm_btns[9] = Checkbox{parent=alarms,label="WASTE HIGH",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_highwaste}
+    alarm_btns[10] = Checkbox{parent=alarms,label="RPS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rps}
+    alarm_btns[11] = Checkbox{parent=alarms,label="RCS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rcs}
+    alarm_btns[12] = Checkbox{parent=alarms,label="TURBINE TRP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_turbinet}
+
+    ttest.alarm_buttons = alarm_btns
+
+    local function stop_all_alarms()
+        for i = 1, #alarm_btns do alarm_btns[i].set_value(false) end
+        ttest.stop_alarms()
+    end
+
+    PushButton{parent=alarms,x=3,y=15,text="STOP \x13",min_width=8,fg_bg=cpair(colors.black,colors.red),active_fg_bg=c_wht_gray,callback=stop_all_alarms}
+
+    local states = Div{parent=audio,x=2,y=14,height=5,width=8}
+
+    TextBox{parent=states,text="States",height=1,alignment=TEXT_ALIGN.CENTER}
+    local t_1 = IndicatorLight{parent=states,label="1",colors=c_blue_gray}
+    local t_2 = IndicatorLight{parent=states,label="2",colors=c_blue_gray}
+    local t_3 = IndicatorLight{parent=states,label="3",colors=c_blue_gray}
+    local t_4 = IndicatorLight{parent=states,label="4",colors=c_blue_gray}
+    local t_5 = IndicatorLight{parent=states,x=6,y=2,label="5",colors=c_blue_gray}
+    local t_6 = IndicatorLight{parent=states,x=6,label="6",colors=c_blue_gray}
+    local t_7 = IndicatorLight{parent=states,x=6,label="7",colors=c_blue_gray}
+    local t_8 = IndicatorLight{parent=states,x=6,label="8",colors=c_blue_gray}
+
+    ttest.tone_indicators = { t_1, t_2, t_3, t_4, t_5, t_6, t_7, t_8 }
+
+    --------------
+    -- App List --
+    --------------
+
+    App{parent=diag_home,x=3,y=4,text="\x0f",title="Alarm",callback=navigate_alarm,app_fg_bg=cpair(colors.black,colors.red),active_fg_bg=cpair(colors.white,colors.gray)}
+    App{parent=diag_home,x=10,y=4,text="\x1e",title="LoopT",callback=function()end,app_fg_bg=cpair(colors.black,colors.cyan)}
+    App{parent=diag_home,x=17,y=4,text="@",title="Comps",callback=function()end,app_fg_bg=cpair(colors.black,colors.orange)}
+
+    return main
+end
+
+return new_view

pocket/ui/pages/home_page.lua

@@ -1,20 +1,21 @@
--- local style   = require("pocket.ui.style")
+local core  = require("graphics.core")
 
-local core    = require("graphics.core")
+local Div   = require("graphics.elements.div")
 
-local Div     = require("graphics.elements.div")
+local App   = require("graphics.elements.controls.app")
-local TextBox = require("graphics.elements.textbox")
 
--- local cpair = core.cpair
+local cpair = core.cpair
-
-local TEXT_ALIGN = core.TEXT_ALIGN
 
 -- new home page view
 ---@param root graphics_element parent
 local function new_view(root)
     local main = Div{parent=root,x=1,y=1}
 
-    TextBox{parent=main,text="HOME",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
+    App{parent=main,x=3,y=2,text="\x17",title="PRC",callback=function()end,app_fg_bg=cpair(colors.black,colors.purple)}
+    App{parent=main,x=10,y=2,text="\x15",title="CTL",callback=function()end,app_fg_bg=cpair(colors.black,colors.green)}
+    App{parent=main,x=17,y=2,text="\x08",title="DEV",callback=function()end,app_fg_bg=cpair(colors.black,colors.lightGray)}
+    App{parent=main,x=3,y=7,text="\x7f",title="Waste",callback=function()end,app_fg_bg=cpair(colors.black,colors.brown)}
+    App{parent=main,x=10,y=7,text="\xb6",title="Guide",callback=function()end,app_fg_bg=cpair(colors.black,colors.cyan)}
 
     return main
 end

reactor-plc/config.lua

@@ -17,6 +17,10 @@ config.PLC_CHANNEL = 16241
 config.TRUSTED_RANGE = 0
 -- time in seconds (>= 2) before assuming a remote device is no longer active
 config.COMMS_TIMEOUT = 5
+-- facility authentication key (do NOT use one of your passwords)
+-- this enables verifying that messages are authentic
+-- all devices on the same network must use the same key
+-- config.AUTH_KEY = "SCADAfacility123"
 
 -- log path
 config.LOG_PATH = "/log.txt"

reactor-plc/panel/front_panel.lua

@@ -1,5 +1,5 @@
 --
--- Main SCADA Coordinator GUI
+-- Reactor PLC Front Panel GUI
 --
 
 local types      = require("scada-common.types")
@@ -28,7 +28,7 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 local cpair = core.cpair
 local border = core.border
 
--- create new main view
+-- create new front panel view
 ---@param panel graphics_element main displaybox
 local function init(panel)
     local header = TextBox{parent=panel,y=1,text="REACTOR PLC - UNIT ?",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}

reactor-plc/panel/style.lua

@@ -12,6 +12,7 @@ local cpair = core.cpair
 
 -- remap global colors
 colors.ivory = colors.pink
+colors.yellow_hc = colors.purple
 colors.red_off = colors.brown
 colors.yellow_off = colors.magenta
 colors.green_off = colors.lime
@@ -28,7 +29,7 @@ style.colors = {
     { c = colors.cyan,      hex = 0x34bac8 },
     { c = colors.lightBlue, hex = 0x6cc0f2 },
     { c = colors.blue,      hex = 0x0096ff },
-    { c = colors.purple,    hex = 0xb156ee },
+    { c = colors.purple,    hex = 0xb156ee },   -- YELLOW HIGH CONTRAST
     { c = colors.pink,      hex = 0xdcd9ca },   -- IVORY
     { c = colors.magenta,   hex = 0x85862c },   -- YELLOW OFF
     -- { c = colors.white,     hex = 0xdcd9ca },

reactor-plc/plc.lua

@@ -445,14 +445,14 @@ end
 ---@nodiscard
 ---@param id integer reactor ID
 ---@param version string PLC version
----@param modem table modem device
+---@param nic nic network interface device
 ---@param plc_channel integer PLC comms channel
 ---@param svr_channel integer supervisor server channel
 ---@param range integer trusted device connection range
 ---@param reactor table reactor device
 ---@param rps rps RPS reference
 ---@param conn_watchdog watchdog watchdog reference
-function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor, rps, conn_watchdog)
+function plc.comms(id, version, nic, plc_channel, svr_channel, range, reactor, rps, conn_watchdog)
     local self = {
         sv_addr = comms.BROADCAST,
         seq_num = 0,
@@ -470,13 +470,9 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
 
     -- PRIVATE FUNCTIONS --
 
-    -- configure modem channels
+    -- configure network channels
-    local function _conf_channels()
+    nic.closeAll()
-        modem.closeAll()
+    nic.open(plc_channel)
-        modem.open(plc_channel)
-    end
-
-    _conf_channels()
 
     -- send an RPLC packet
     ---@param msg_type RPLC_TYPE
@@ -488,7 +484,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
         r_pkt.make(id, msg_type, msg)
         s_pkt.make(self.sv_addr, self.seq_num, PROTOCOL.RPLC, r_pkt.raw_sendable())
 
-        modem.transmit(svr_channel, plc_channel, s_pkt.raw_sendable())
+        nic.transmit(svr_channel, plc_channel, s_pkt)
         self.seq_num = self.seq_num + 1
     end
 
@@ -502,7 +498,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
         m_pkt.make(msg_type, msg)
         s_pkt.make(self.sv_addr, self.seq_num, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
 
-        modem.transmit(svr_channel, plc_channel, s_pkt.raw_sendable())
+        nic.transmit(svr_channel, plc_channel, s_pkt)
         self.seq_num = self.seq_num + 1
     end
 
@@ -639,7 +635,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
 
         parallel.waitForAll(table.unpack(tasks))
 
-        if not reactor.__p_is_faulted() then
+        if reactor.__p_is_ok() then
             _send(RPLC_TYPE.MEK_STRUCT, mek_data)
             self.resend_build = false
         end
@@ -650,13 +646,6 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
     ---@class plc_comms
     local public = {}
 
-    -- reconnect a newly connected modem
-    ---@param new_modem table
-    function public.reconnect_modem(new_modem)
-        modem = new_modem
-        _conf_channels()
-    end
-
     -- reconnect a newly connected reactor
     ---@param new_reactor table
     function public.reconnect_reactor(new_reactor)
@@ -743,13 +732,10 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
     ---@param distance integer
     ---@return rplc_frame|mgmt_frame|nil packet
     function public.parse_packet(side, sender, reply_to, message, distance)
+        local s_pkt = nic.receive(side, sender, reply_to, message, distance)
         local pkt = nil
-        local s_pkt = comms.scada_packet()
 
-        -- parse packet as generic SCADA packet
+        if s_pkt then
-        s_pkt.receive(side, sender, reply_to, message, distance)
-
-        if s_pkt.is_valid() then
             -- get as RPLC packet
             if s_pkt.protocol() == PROTOCOL.RPLC then
                 local rplc_pkt = comms.rplc_packet()
@@ -836,7 +822,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
                                         success = true
                                     else
                                         reactor.setBurnRate(burn_rate)
-                                        success = not reactor.__p_is_faulted()
+                                        success = reactor.__p_is_ok()
                                     end
                                 else
                                     log.debug(burn_rate .. " rate outside of 0 < x <= " .. self.max_burn_rate)
@@ -943,47 +929,7 @@ function plc.comms(id, version, modem, plc_channel, svr_channel, range, reactor,
                 ---@cast packet mgmt_frame
                 -- if linked, only accept packets from configured supervisor
                 if self.linked then
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-                        -- link request confirmation
-                        if packet.length == 1 then
-                            log.debug("received unsolicited establish response")
-
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                self.status_cache = nil
-                                _send_struct()
-                                public.send_status(plc_state.no_reactor, plc_state.reactor_formed)
-                                log.debug("re-sent initial status data due to re-establish")
-                            else
-                                if est_ack == ESTABLISH_ACK.DENY then
-                                    println_ts("received unsolicited link denial, unlinking")
-                                    log.warning("unsolicited establish request denied")
-                                elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                    println_ts("received unsolicited link collision, unlinking")
-                                    log.warning("unsolicited establish request collision")
-                                elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                    println_ts("received unsolicited link version mismatch, unlinking")
-                                    log.warning("unsolicited establish request version mismatch")
-                                else
-                                    println_ts("invalid unsolicited link response")
-                                    log.debug("unsolicited unknown establish request response")
-                                end
-
-                                -- unlink
-                                self.sv_addr = comms.BROADCAST
-                                self.linked = false
-                            end
-
-                            -- clear this since this is for something that was unsolicited
-                            self.last_est_ack = ESTABLISH_ACK.ALLOW
-
-                            -- report link state
-                            databus.tx_link_state(est_ack + 1)
-                        else
-                            log.debug("SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                         -- keep alive request received, echo back
                         if packet.length == 1 and type(packet.data[1]) == "number" then
                             local timestamp = packet.data[1]

reactor-plc/startup.lua

@@ -8,6 +8,7 @@ local comms    = require("scada-common.comms")
 local crash    = require("scada-common.crash")
 local log      = require("scada-common.log")
 local mqueue   = require("scada-common.mqueue")
+local network  = require("scada-common.network")
 local ppm      = require("scada-common.ppm")
 local rsio     = require("scada-common.rsio")
 local util     = require("scada-common.util")
@@ -18,7 +19,7 @@ local plc      = require("reactor-plc.plc")
 local renderer = require("reactor-plc.renderer")
 local threads  = require("reactor-plc.threads")
 
-local R_PLC_VERSION = "v1.4.6"
+local R_PLC_VERSION = "v1.5.7"
 
 local println = util.println
 local println_ts = util.println_ts
@@ -79,6 +80,11 @@ local function main()
     -- mount connected devices
     ppm.mount_all()
 
+    -- message authentication init
+    if type(config.AUTH_KEY) == "string" then
+        network.init_mac(config.AUTH_KEY)
+    end
+
     -- shared memory across threads
     ---@class plc_shared_memory
     local __shared_memory = {
@@ -88,13 +94,13 @@ local function main()
         -- PLC system state flags
         ---@class plc_state
         plc_state = {
-            init_ok = true,
+            init_ok        = true,
-            fp_ok = false,
+            fp_ok          = false,
-            shutdown = false,
+            shutdown       = false,
-            degraded = false,
+            degraded       = true,
             reactor_formed = true,
-            no_reactor = false,
+            no_reactor     = true,
-            no_modem = false
+            no_modem       = true
         },
 
         -- control setpoints
@@ -113,6 +119,7 @@ local function main()
         -- system objects
         plc_sys = {
             rps = nil,              ---@type rps
+            nic = nil,              ---@type nic
             plc_comms = nil,        ---@type plc_comms
             conn_watchdog = nil     ---@type watchdog
         },
@@ -130,14 +137,17 @@ local function main()
 
     local plc_state = __shared_memory.plc_state
 
+    -- initial state evaluation
+    plc_state.no_reactor = smem_dev.reactor == nil
+    plc_state.no_modem = smem_dev.modem == nil
+
     -- we need a reactor, can at least do some things even if it isn't formed though
-    if smem_dev.reactor == nil then
+    if plc_state.no_reactor then
         println("init> fission reactor not found");
         log.warning("init> no reactor on startup")
 
         plc_state.init_ok = false
         plc_state.degraded = true
-        plc_state.no_reactor = true
     elseif not smem_dev.reactor.isFormed() then
         println("init> fission reactor not formed");
         log.warning("init> reactor logic adapter present, but reactor is not formed")
@@ -147,7 +157,7 @@ local function main()
     end
 
     -- modem is required if networked
-    if __shared_memory.networked and smem_dev.modem == nil then
+    if __shared_memory.networked and plc_state.no_modem then
         println("init> wireless modem not found")
         log.warning("init> no wireless modem on startup")
 
@@ -158,7 +168,6 @@ local function main()
 
         plc_state.init_ok = false
         plc_state.degraded = true
-        plc_state.no_modem = true
     end
 
     -- print a log message to the terminal as long as the UI isn't running
@@ -181,7 +190,7 @@ local function main()
                 renderer.close_ui()
                 println_ts(util.c("UI error: ", message))
                 println("init> running without front panel")
-                log.error(util.c("GUI crashed with error ", message))
+                log.error(util.c("front panel GUI render failed with error ", message))
                 log.info("init> running in headless mode without front panel")
             end
         end
@@ -196,8 +205,9 @@ local function main()
                 smem_sys.conn_watchdog = util.new_watchdog(config.COMMS_TIMEOUT)
                 log.debug("init> conn watchdog started")
 
-                -- start comms
+                -- create network interface then setup comms
-                smem_sys.plc_comms = plc.comms(config.REACTOR_ID, R_PLC_VERSION, smem_dev.modem, config.PLC_CHANNEL, config.SVR_CHANNEL,
+                smem_sys.nic = network.nic(smem_dev.modem)
+                smem_sys.plc_comms = plc.comms(config.REACTOR_ID, R_PLC_VERSION, smem_sys.nic, config.PLC_CHANNEL, config.SVR_CHANNEL,
                                                 config.TRUSTED_RANGE, smem_dev.reactor, smem_sys.rps, smem_sys.conn_watchdog)
                 log.debug("init> comms init")
             else

reactor-plc/threads.lua

@@ -59,6 +59,7 @@ function threads.thread__main(smem, init)
         while true do
             -- get plc_sys fields (may have been set late due to degraded boot)
             local rps           = smem.plc_sys.rps
+            local nic           = smem.plc_sys.nic
             local plc_comms     = smem.plc_sys.plc_comms
             local conn_watchdog = smem.plc_sys.conn_watchdog
 
@@ -66,6 +67,7 @@ function threads.thread__main(smem, init)
 
             -- handle event
             if event == "timer" and loop_clock.is_clock(param1) then
+                -- note: loop clock is only running if init_ok = true
                 -- blink heartbeat indicator
                 databus.heartbeat()
 
@@ -75,7 +77,7 @@ function threads.thread__main(smem, init)
                     loop_clock.start()
 
                     -- send updated data
-                    if not plc_state.no_modem then
+                    if nic.is_connected() then
                         if plc_comms.is_linked() then
                             smem.q.mq_comms_tx.push_command(MQ__COMM_CMD.SEND_STATUS)
                         else
@@ -114,7 +116,7 @@ function threads.thread__main(smem, init)
                             smem.q.mq_rps.push_command(MQ__RPS_CMD.SCRAM)
 
                             -- determine if we are still in a degraded state
-                            if not networked or not plc_state.no_modem then
+                            if (not networked) or nic.is_connected() then
                                 plc_state.degraded = false
                             end
 
@@ -144,7 +146,7 @@ function threads.thread__main(smem, init)
 
                 -- update indicators
                 databus.tx_hw_status(plc_state)
-            elseif event == "modem_message" and networked and plc_state.init_ok and not plc_state.no_modem then
+            elseif event == "modem_message" and networked and plc_state.init_ok and nic.is_connected() then
                 -- got a packet
                 local packet = plc_comms.parse_packet(param1, param2, param3, param4, param5)
                 if packet ~= nil then
@@ -152,8 +154,8 @@ function threads.thread__main(smem, init)
                     smem.q.mq_comms_rx.push_packet(packet)
                 end
             elseif event == "timer" and networked and plc_state.init_ok and conn_watchdog.is_timer(param1) then
-                -- haven't heard from server recently? shutdown reactor
+                -- haven't heard from server recently? close connection and shutdown reactor
-                plc_comms.unlink()
+                plc_comms.close()
                 smem.q.mq_rps.push_command(MQ__RPS_CMD.TRIP_TIMEOUT)
             elseif event == "timer" then
                 -- notify timer callback dispatcher if no other timer case claimed this event
@@ -163,7 +165,7 @@ function threads.thread__main(smem, init)
                 local type, device = ppm.handle_unmount(param1)
 
                 if type ~= nil and device ~= nil then
-                    if type == "fissionReactorLogicAdapter" then
+                    if device == plc_dev.reactor then
                         println_ts("reactor disconnected!")
                         log.error("reactor logic adapter disconnected")
 
@@ -171,18 +173,25 @@ function threads.thread__main(smem, init)
                         plc_state.degraded = true
                     elseif networked and type == "modem" then
                         -- we only care if this is our wireless modem
-                        if device == plc_dev.modem then
+                        if nic.is_modem(device) then
+                            nic.disconnect()
+
                             println_ts("comms modem disconnected!")
-                            log.error("comms modem disconnected")
+                            log.warning("comms modem disconnected")
 
-                            plc_state.no_modem = true
+                            local other_modem = ppm.get_wireless_modem()
+                            if other_modem then
+                                log.info("found another wireless modem, using it for comms")
+                                nic.connect(other_modem)
+                            else
+                                plc_state.no_modem = true
+                                plc_state.degraded = true
 
-                            if plc_state.init_ok then
+                                if plc_state.init_ok then
-                                -- try to scram reactor if it is still connected
+                                    -- try to scram reactor if it is still connected
-                                smem.q.mq_rps.push_command(MQ__RPS_CMD.DEGRADED_SCRAM)
+                                    smem.q.mq_rps.push_command(MQ__RPS_CMD.DEGRADED_SCRAM)
+                                end
                             end
-
-                            plc_state.degraded = true
                         else
                             log.warning("non-comms modem disconnected")
                         end
@@ -196,15 +205,14 @@ function threads.thread__main(smem, init)
                 local type, device = ppm.mount(param1)
 
                 if type ~= nil and device ~= nil then
-                    if type == "fissionReactorLogicAdapter" then
+                    if plc_state.no_reactor and (type == "fissionReactorLogicAdapter") then
                         -- reconnected reactor
                         plc_dev.reactor = device
+                        plc_state.no_reactor = false
 
                         println_ts("reactor reconnected.")
                         log.info("reactor reconnected")
 
-                        plc_state.no_reactor = false
-
                         -- we need to assume formed here as we cannot check in this main loop
                         -- RPS will identify if it isn't and this will get set false later
                         plc_state.reactor_formed = true
@@ -227,22 +235,22 @@ function threads.thread__main(smem, init)
                             rps.reset()
                         end
                     elseif networked and type == "modem" then
-                        if device.isWireless() then
+                        if device.isWireless() and not nic.is_connected() then
                             -- reconnected modem
                             plc_dev.modem = device
+                            plc_state.no_modem = false
 
-                            if plc_state.init_ok then
+                            if plc_state.init_ok then nic.connect(device) end
-                                plc_comms.reconnect_modem(plc_dev.modem)
-                            end
 
                             println_ts("wireless modem reconnected.")
                             log.info("comms modem reconnected")
-                            plc_state.no_modem = false
 
                             -- determine if we are still in a degraded state
                             if not plc_state.no_reactor then
                                 plc_state.degraded = false
                             end
+                        elseif device.isWireless() then
+                            log.info("unused wireless modem reconnected")
                         else
                             log.info("wired modem reconnected")
                         end
@@ -709,9 +717,7 @@ function threads.thread__setpoint_control(smem)
                 end
 
                 -- if ramping completed or was aborted, reset last burn setpoint so that if it is requested again it will be re-attempted
-                if not setpoints.burn_rate_en then
+                if not setpoints.burn_rate_en then last_burn_sp = 0 end
-                    last_burn_sp = 0
-                end
             end
 
             -- check for termination request

rtu/config.lua

@@ -10,6 +10,14 @@ config.RTU_CHANNEL = 16242
 config.TRUSTED_RANGE = 0
 -- time in seconds (>= 2) before assuming a remote device is no longer active
 config.COMMS_TIMEOUT = 5
+-- facility authentication key (do NOT use one of your passwords)
+-- this enables verifying that messages are authentic
+-- all devices on the same network must use the same key
+-- config.AUTH_KEY = "SCADAfacility123"
+
+-- alarm sounder volume (0.0 to 3.0, 1.0 being standard max volume, this is the option given to to speaker.play())
+-- note: alarm sine waves are at half saturation, so that multiple will be required to reach full scale
+config.SOUNDER_VOLUME = 1.0
 
 -- log path
 config.LOG_PATH = "/log.txt"

rtu/databus.lua

@@ -37,6 +37,12 @@ function databus.tx_hw_modem(has_modem)
     databus.ps.publish("has_modem", has_modem)
 end
 
+-- transmit the number of speakers connected
+---@param count integer
+function databus.tx_hw_spkr_count(count)
+    databus.ps.publish("speaker_count", count)
+end
+
 -- transmit unit hardware type across the bus
 ---@param uid integer unit ID
 ---@param type RTU_UNIT_TYPE

rtu/dev/boilerv_rtu.lua

@@ -2,7 +2,7 @@ local rtu = require("rtu.rtu")
 
 local boilerv_rtu = {}
 
--- create new boiler (mek 10.1+) device
+-- create new boiler device
 ---@nodiscard
 ---@param boiler table
 ---@return rtu_device interface, boolean faulted
@@ -10,6 +10,7 @@ function boilerv_rtu.new(boiler)
     local unit = rtu.init_unit()
 
     -- disable auto fault clearing
+    boiler.__p_clear_fault()
     boiler.__p_disable_afc()
 
     -- discrete inputs --

rtu/dev/dynamicv_rtu.lua

@@ -0,0 +1,48 @@
+local rtu = require("rtu.rtu")
+
+local dynamicv_rtu = {}
+
+-- create new dynamic tank device
+---@nodiscard
+---@param dynamic_tank table
+---@return rtu_device interface, boolean faulted
+function dynamicv_rtu.new(dynamic_tank)
+    local unit = rtu.init_unit()
+
+    -- disable auto fault clearing
+    dynamic_tank.__p_clear_fault()
+    dynamic_tank.__p_disable_afc()
+
+    -- discrete inputs --
+    unit.connect_di(dynamic_tank.isFormed)
+
+    -- coils --
+    unit.connect_coil(function () dynamic_tank.incrementContainerEditMode() end, function () end)
+    unit.connect_coil(function () dynamic_tank.decrementContainerEditMode() end, function () end)
+
+    -- input registers --
+    -- multiblock properties
+    unit.connect_input_reg(dynamic_tank.getLength)
+    unit.connect_input_reg(dynamic_tank.getWidth)
+    unit.connect_input_reg(dynamic_tank.getHeight)
+    unit.connect_input_reg(dynamic_tank.getMinPos)
+    unit.connect_input_reg(dynamic_tank.getMaxPos)
+    -- build properties
+    unit.connect_input_reg(dynamic_tank.getTankCapacity)
+    unit.connect_input_reg(dynamic_tank.getChemicalTankCapacity)
+    -- tanks/containers
+    unit.connect_input_reg(dynamic_tank.getStored)
+    unit.connect_input_reg(dynamic_tank.getFilledPercentage)
+
+    -- holding registers --
+    unit.connect_holding_reg(dynamic_tank.getContainerEditMode, dynamic_tank.setContainerEditMode)
+
+    -- check if any calls faulted
+    local faulted = dynamic_tank.__p_is_faulted()
+    dynamic_tank.__p_clear_fault()
+    dynamic_tank.__p_enable_afc()
+
+    return unit.interface(), faulted
+end
+
+return dynamicv_rtu

rtu/dev/envd_rtu.lua

@@ -10,6 +10,7 @@ function envd_rtu.new(envd)
     local unit = rtu.init_unit()
 
     -- disable auto fault clearing
+    envd.__p_clear_fault()
     envd.__p_disable_afc()
 
     -- discrete inputs --

rtu/dev/imatrix_rtu.lua

@@ -10,6 +10,7 @@ function imatrix_rtu.new(imatrix)
     local unit = rtu.init_unit()
 
     -- disable auto fault clearing
+    imatrix.__p_clear_fault()
     imatrix.__p_disable_afc()
 
     -- discrete inputs --

rtu/dev/sna_rtu.lua

@@ -10,6 +10,7 @@ function sna_rtu.new(sna)
     local unit = rtu.init_unit()
 
     -- disable auto fault clearing
+    sna.__p_clear_fault()
     sna.__p_disable_afc()
 
     -- discrete inputs --

rtu/dev/sps_rtu.lua

@@ -10,6 +10,7 @@ function sps_rtu.new(sps)
     local unit = rtu.init_unit()
 
     -- disable auto fault clearing
+    sps.__p_clear_fault()
     sps.__p_disable_afc()
 
     -- discrete inputs --

rtu/dev/turbinev_rtu.lua

@@ -2,7 +2,7 @@ local rtu = require("rtu.rtu")
 
 local turbinev_rtu = {}
 
--- create new turbine (mek 10.1+) device
+-- create new turbine device
 ---@nodiscard
 ---@param turbine table
 ---@return rtu_device interface, boolean faulted
@@ -10,6 +10,7 @@ function turbinev_rtu.new(turbine)
     local unit = rtu.init_unit()
 
     -- disable auto fault clearing
+    turbine.__p_clear_fault()
     turbine.__p_disable_afc()
 
     -- discrete inputs --