Merge pull request #317 from MikaylaFischler/devel

2023.08.22 Release

README.md

@@ -7,6 +7,29 @@ Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fi
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=latest&label=latest)
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=devel&label=devel)
 
+### [Join](https://discord.gg/R9NSCkhcwt) the Discord!
+
+![Discord](https://img.shields.io/discord/1129075839288496259)
+
+## Released Component Versions
+
+![Installer](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Finstaller.json)
+
+
+![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
+![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
+![Graphics](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fgraphics.json)
+![Lockbox](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Flockbox.json)
+
+
+![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
+![RTU](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Frtu.json)
+![Supervisor](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fsupervisor.json)
+![Coordinator](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcoordinator.json)
+![Pocket](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fpocket.json)
+
+## Requirements
+
 Mod Requirements:
 - CC: Tweaked
 - Mekanism v10.1+
@@ -16,32 +39,11 @@ Mod Recommendations:
 
 v10.1+ is required due the complete support of CC:Tweaked added in Mekanism v10.1
 
-There was also an apparent bug with boilers disconnecting and reconnecting when active in my test world on 10.0.24, so it may not even have been an option to fully implement this with support for 10.0.
-
-## Released Component Versions
-
-### Core
-
-![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
-![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
-
-### Utilities
-
-![Installer](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Finstaller.json)
-
-### Applications
-
-![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
-![RTU](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Frtu.json)
-![Supervisor](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fsupervisor.json)
-![Coordinator](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcoordinator.json)
-![Pocket](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fpocket.json)
-
 ## Installation
 
 You can install this on a ComputerCraft computer using either:
 * `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua`
-* `pastebin get eRz6cUNM ccmsi.lua`
+* `pastebin get RGasyTM4 ccmsi.lua`
 
 ## [SCADA](https://en.wikipedia.org/wiki/SCADA)
 > Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery.
@@ -86,14 +88,8 @@ A vaguely-modbus [modbus](https://en.wikipedia.org/wiki/Modbus) communication pr
 - Input Registers: Multi-Byte Read-Only (analog inputs)
 - Holding Registers: Multi-Byte Read/Write (analog I/O)
 
-### Security and Encryption
+### Security
 
-TBD, I am planning on AES symmetric encryption for security + HMAC to prevent replay attacks. This will be done utilizing this codebase: https://github.com/somesocks/lua-lockbox.
+HMAC message authentication is available as a configuration option to prevent replay attacks and generally prevent control or false data reporting within a system's network. This is done utilizing the [lua-lockbox](https://github.com/somesocks/lua-lockbox) project.
 
-This is somewhat important here as otherwise anyone can just control your setup, which is undeseriable. Unlike normal Minecraft PVP chaos, it would be very difficult to identify who is messing with your system, as with an Ender Modem they can do it from effectively anywhere and the server operators would have to check every computer's filesystem to find suspicious code. 
-
-The other security mitigation for commanding (no effect on monitoring) is to enforce a maximum authorized transmission range, which has been added as a configurable feature.
-
-## Known Issues
-
-None yet since the switch to requiring 10.1+!
+The other, simpler security feature is to enforce a maximum authorized transmission range, which is also a configurable feature on each device.

ccmsi.lua

@@ -1,8 +1,6 @@
---
--- ComputerCraft Mekanism SCADA System Installer Utility
---
-
 --[[
+CC-MEK-SCADA Installer Utility
+
 Copyright (c) 2023 Mikayla Fischler
 
 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and
@@ -20,7 +18,7 @@ SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
 local function println(message) print(tostring(message)) end
 local function print(message) term.write(tostring(message)) end
 
-local CCMSI_VERSION = "v1.5a"
+local CCMSI_VERSION = "v1.9"
 
 local install_dir = "/.install-cache"
 local manifest_path = "https://mikaylafischler.github.io/cc-mek-scada/manifests/"
@@ -44,11 +42,15 @@ local function get_opt(opt, options)
     return nil
 end
 
+-- wait for any key to be pressed
+---@diagnostic disable-next-line: undefined-field
+local function any_key() os.pullEvent("key_up") end
+
 -- ask the user yes or no
 local function ask_y_n(question, default)
     print(question)
     if default == true then print(" (Y/n)? ") else print(" (y/N)? ") end
-    local response = read()
+    local response = read();any_key()
     if response == "" then return default
     elseif response == "Y" or response == "y" then return true
     elseif response == "N" or response == "n" then return false
@@ -56,19 +58,18 @@ local function ask_y_n(question, default)
 end
 
 -- print out a white + blue text message
-local function pkg_message(message, package) white(); print(message .. " "); blue(); println(package); white() end
+local function pkg_message(message, package) white();print(message .. " ");blue();println(package);white() end
 
 -- indicate actions to be taken based on package differences for installs/updates
-local function show_pkg_change(name, v_local, v_remote)
-    if v_local ~= nil then
-        if v_local ~= v_remote then
-            print("[" .. name .. "] updating "); blue(); print(v_local); white(); print(" \xbb "); blue(); println(v_remote); white()
+local function show_pkg_change(name, v)
+    if v.v_local ~= nil then
+        if v.v_local ~= v.v_remote then
+            print("[" .. name .. "] updating ");blue();print(v.v_local);white();print(" \xbb ");blue();println(v.v_remote);white()
         elseif mode == "install" then
-            pkg_message("[" .. name .. "] reinstalling", v_local)
+            pkg_message("[" .. name .. "] reinstalling", v.v_local)
         end
-    else
-        pkg_message("[" .. name .. "] new install of", v_remote)
-    end
+    else pkg_message("[" .. name .. "] new install of", v.v_remote) end
+    return v.v_local ~= v.v_remote
 end
 
 -- read the local manifest file
@@ -87,15 +88,13 @@ end
 local function get_remote_manifest()
     local response, error = http.get(install_manifest)
     if response == nil then
-        orange(); println("failed to get installation manifest from GitHub, cannot update or install")
-        red(); println("HTTP error: " .. error); white()
+        orange();println("Failed to get installation manifest from GitHub, cannot update or install.")
+        red();println("HTTP error: " .. error);white()
         return false, {}
     end
 
     local ok, manifest = pcall(function () return textutils.unserializeJSON(response.readAll()) end)
-    if not ok then
-        red(); println("error parsing remote installation manifest"); white()
-    end
+    if not ok then red();println("error parsing remote installation manifest");white() end
 
     return ok, manifest
 end
@@ -107,7 +106,7 @@ local function write_install_manifest(manifest, dependencies)
         local is_dependency = false
         for _, dependency in pairs(dependencies) do
             if (key == "bootloader" and dependency == "system") or key == dependency then
-                is_dependency = true; break
+                is_dependency = true;break
             end
         end
         if key == app or key == "comms" or is_dependency then versions[key] = value end
@@ -120,6 +119,78 @@ local function write_install_manifest(manifest, dependencies)
     imfile.close()
 end
 
+-- recursively build a tree out of the file manifest
+local function gen_tree(manifest)
+    local function _tree_add(tree, split)
+        if #split > 1 then
+            local name = table.remove(split, 1)
+            if tree[name] == nil then tree[name] = {} end
+            table.insert(tree[name], _tree_add(tree[name], split))
+        else return split[1] end
+        return nil
+    end
+
+    local list, tree = {}, {}
+
+    -- make a list of each and every file
+    for _, files in pairs(manifest.files) do for i = 1, #files do table.insert(list, files[i]) end end
+
+    for i = 1, #list do
+        local split = {}
+        string.gsub(list[i], "([^/]+)", function(c) split[#split + 1] = c end)
+        if #split == 1 then table.insert(tree, list[i])
+        else table.insert(tree, _tree_add(tree, split)) end
+    end
+
+    return tree
+end
+
+local function _in_array(val, array)
+    for _, v in pairs(array) do if v == val then return true end end
+    return false
+end
+
+local function _clean_dir(dir, tree)
+    if tree == nil then tree = {} end
+    local ls = fs.list(dir)
+    for _, val in pairs(ls) do
+        local path = dir .. "/" .. val
+        if fs.isDir(path) then
+            _clean_dir(path, tree[val])
+            if #fs.list(path) == 0 then fs.delete(path);println("deleted " .. path) end
+        elseif not _in_array(val, tree) then
+            fs.delete(path)
+            println("deleted " .. path)
+        end
+    end
+end
+
+-- go through app/common directories to delete unused files
+local function clean(manifest)
+    local root_ext = false
+    local tree = gen_tree(manifest)
+
+    table.insert(tree, "install_manifest.json")
+    table.insert(tree, "ccmsi.lua")
+    table.insert(tree, "log.txt")
+
+    lgray()
+
+    local ls = fs.list("/")
+    for _, val in pairs(ls) do
+        if fs.isDir(val) then
+            if tree[val] ~= nil then _clean_dir("/" .. val, tree[val]) end
+            if #fs.list(val) == 0 then fs.delete(val);println("deleted " .. val) end
+        elseif not _in_array(val, tree) then
+            root_ext = true
+            yellow();println(val .. " not used")
+        end
+    end
+
+    white()
+    if root_ext then println("Files in root directory won't be automatically deleted.") end
+end
+
 -- get and validate command line options
 
 println("-- CC Mekanism SCADA Installer " .. CCMSI_VERSION .. " --")
@@ -136,33 +207,36 @@ if #opts == 0 or opts[1] == "help" then
     println(" update      - update files EXCEPT for config/logs")
     println(" remove      - delete files EXCEPT for config/logs")
     println(" purge       - delete files INCLUDING config/logs")
-    white(); println("<app>"); lgray()
+    white();println("<app>");lgray()
     println(" reactor-plc - reactor PLC firmware")
     println(" rtu         - RTU firmware")
     println(" supervisor  - supervisor server application")
     println(" coordinator - coordinator application")
     println(" pocket      - pocket application")
-    white(); println("<branch>"); yellow()
-    println(" second parameter when used with check")
-    lgray(); println(" main (default) | latest | devel"); white()
+    println(" installer   - ccmsi installer (update only)")
+    white();println("<branch>")
+    lgray();println(" main (default) | latest | devel");white()
     return
 else
     mode = get_opt(opts[1], { "check", "install", "update", "remove", "purge" })
     if mode == nil then
-        red(); println("Unrecognized mode."); white()
+        red();println("Unrecognized mode.");white()
         return
     end
 
-    app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket" })
+    app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket", "installer" })
     if app == nil and mode ~= "check" then
-        red(); println("Unrecognized application."); white()
+        red();println("Unrecognized application.");white()
+        return
+    elseif app == "installer" and mode ~= "update" then
+        red();println("Installer app only supports 'update' option.");white()
         return
     end
 
     -- determine target
     if mode == "check" then target = opts[2] else target = opts[3] end
     if (target ~= "main") and (target ~= "latest") and (target ~= "devel") then
-        if (target and target ~= "") then yellow(); println("Unknown target, defaulting to 'main'"); white() end
+        if (target and target ~= "") then yellow();println("Unknown target, defaulting to 'main'");white() end
         target = "main"
     end
 
@@ -179,7 +253,7 @@ if mode == "check" then
 
     local local_ok, local_manifest = read_local_manifest()
     if not local_ok then
-        yellow(); println("failed to load local installation information"); white()
+        yellow();println("failed to load local installation information");white()
         local_manifest = { versions = { installer = CCMSI_VERSION } }
     else
         local_manifest.versions.installer = CCMSI_VERSION
@@ -190,19 +264,24 @@ if mode == "check" then
         term.setTextColor(colors.purple)
         print(string.format("%-14s", "[" .. key .. "]"))
         if key == "installer" or (local_ok and (local_manifest.versions[key] ~= nil)) then
-            blue(); print(local_manifest.versions[key])
+            blue();print(local_manifest.versions[key])
             if value ~= local_manifest.versions[key] then
-                white(); print(" (")
+                white();print(" (")
                 term.setTextColor(colors.cyan)
-                print(value); white(); println(" available)")
-            else green(); println(" (up to date)") end
+                print(value);white();println(" available)")
+            else green();println(" (up to date)") end
         else
-            lgray(); print("not installed"); white(); print(" (latest ")
+            lgray();print("not installed");white();print(" (latest ")
             term.setTextColor(colors.cyan)
-            print(value); white(); println(")")
+            print(value);white();println(")")
         end
     end
+
+    if manifest.versions.installer ~= local_manifest.versions.installer then
+        yellow();println("\nA newer version of the installer is available, it is recommended to update (use 'ccmsi update installer').");white()
+    end
 elseif mode == "install" or mode == "update" then
+    local update_installer = app == "installer"
     local ok, manifest = get_remote_manifest()
     if not ok then return end
 
@@ -210,38 +289,60 @@ elseif mode == "install" or mode == "update" then
         app = { v_local = nil, v_remote = nil, changed = false },
         boot = { v_local = nil, v_remote = nil, changed = false },
         comms = { v_local = nil, v_remote = nil, changed = false },
+        common = { v_local = nil, v_remote = nil, changed = false },
         graphics = { v_local = nil, v_remote = nil, changed = false },
         lockbox = { v_local = nil, v_remote = nil, changed = false }
     }
 
     -- try to find local versions
-    local local_ok, local_manifest = read_local_manifest()
+    local local_ok, lmnf = read_local_manifest()
     if not local_ok then
         if mode == "update" then
-            red(); println("failed to load local installation information, cannot update"); white()
+            red();println("Failed to load local installation information, cannot update.");white()
             return
         end
-    else
-        ver.boot.v_local = local_manifest.versions.bootloader
-        ver.app.v_local = local_manifest.versions[app]
-        ver.comms.v_local = local_manifest.versions.comms
-        ver.graphics.v_local = local_manifest.versions.graphics
-        ver.lockbox.v_local = local_manifest.versions.lockbox
+    elseif not update_installer then
+        ver.boot.v_local = lmnf.versions.bootloader
+        ver.app.v_local = lmnf.versions[app]
+        ver.comms.v_local = lmnf.versions.comms
+        ver.common.v_local = lmnf.versions.common
+        ver.graphics.v_local = lmnf.versions.graphics
+        ver.lockbox.v_local = lmnf.versions.lockbox
 
-        if local_manifest.versions[app] == nil then
-            red(); println("another application is already installed, please purge it before installing a new application"); white()
+        if lmnf.versions[app] == nil then
+            red();println("Another application is already installed, please purge it before installing a new application.");white()
             return
         end
+    end
 
-        local_manifest.versions.installer = CCMSI_VERSION
-        if manifest.versions.installer ~= CCMSI_VERSION then
-            yellow(); println("a newer version of the installer is available, it is recommended to download it"); white()
+    lmnf.versions.installer = CCMSI_VERSION
+    if manifest.versions.installer ~= CCMSI_VERSION then
+        if not update_installer then yellow();println("A newer version of the installer is available, it is recommended to update to it.");white() end
+        if update_installer or ask_y_n("Would you like to update now") then
+            lgray();println("GET ccmsi.lua")
+            local dl, err = http.get(repo_path .. "ccmsi.lua")
+
+            if dl == nil then
+                red();println("HTTP Error " .. err)
+                println("Installer download failed.");white()
+            else
+                local handle = fs.open(debug.getinfo(1, "S").source:sub(2), "w") -- this file, regardless of name or location
+                handle.write(dl.readAll())
+                handle.close()
+                green();println("Installer updated successfully.");white()
+            end
+
+            return
         end
+    elseif update_installer then
+        green();println("Installer already up-to-date.");white()
+        return
     end
 
     ver.boot.v_remote = manifest.versions.bootloader
     ver.app.v_remote = manifest.versions[app]
     ver.comms.v_remote = manifest.versions.comms
+    ver.common.v_remote = manifest.versions.common
     ver.graphics.v_remote = manifest.versions.graphics
     ver.lockbox.v_remote = manifest.versions.lockbox
 
@@ -253,31 +354,18 @@ elseif mode == "install" or mode == "update" then
     end
     white()
 
-    -- display bootloader version change information
-    show_pkg_change("bootldr", ver.boot.v_local, ver.boot.v_remote)
-    ver.boot.changed = ver.boot.v_local ~= ver.boot.v_remote
-
-    -- display app version change information
-    show_pkg_change(app, ver.app.v_local, ver.app.v_remote)
-    ver.app.changed = ver.app.v_local ~= ver.app.v_remote
-
-    -- display comms version change information
-    show_pkg_change("comms", ver.comms.v_local, ver.comms.v_remote)
-    ver.comms.changed = ver.comms.v_local ~= ver.comms.v_remote
+    ver.boot.changed = show_pkg_change("bootldr", ver.boot)
+    ver.common.changed = show_pkg_change("common", ver.common)
+    ver.comms.changed = show_pkg_change("comms", ver.comms)
     if ver.comms.changed and ver.comms.v_local ~= nil then
-        print("[comms] "); yellow(); println("other devices on the network will require an update"); white()
+        print("[comms] ");yellow();println("other devices on the network will require an update");white()
     end
-
-    -- display graphics version change information
-    show_pkg_change("graphics", ver.graphics.v_local, ver.graphics.v_remote)
-    ver.graphics.changed = ver.graphics.v_local ~= ver.graphics.v_remote
-
-    -- display lockbox version change information
-    show_pkg_change("lockbox", ver.lockbox.v_local, ver.lockbox.v_remote)
-    ver.lockbox.changed = ver.lockbox.v_local ~= ver.lockbox.v_remote
+    ver.app.changed = show_pkg_change(app, ver.app)
+    ver.graphics.changed = show_pkg_change("graphics", ver.graphics)
+    ver.lockbox.changed = show_pkg_change("lockbox", ver.lockbox)
 
     -- ask for confirmation
-    if not ask_y_n("Continue?", false) then return end
+    if not ask_y_n("Continue", false) then return end
 
     --------------------------
     -- START INSTALL/UPDATE --
@@ -302,10 +390,10 @@ elseif mode == "install" or mode == "update" then
     -- check space constraints
     if space_available < space_required then
         single_file_mode = true
-        yellow(); println("WARNING: Insufficient space available for a full download!"); white()
+        yellow();println("WARNING: Insufficient space available for a full download!");white()
         println("Files can be downloaded one by one, so if you are replacing a current install this will not be a problem unless installation fails.")
         if mode == "update" then println("If installation still fails, delete this device's log file or uninstall the app (not purge) and try again.") end
-        if not ask_y_n("Do you wish to continue?", false) then
+        if not ask_y_n("Do you wish to continue", false) then
             println("Operation cancelled.")
             return
         end
@@ -318,16 +406,13 @@ elseif mode == "install" or mode == "update" then
         if dependency == "system" then return not ver.boot.changed
         elseif dependency == "graphics" then return not ver.graphics.changed
         elseif dependency == "lockbox" then return not ver.lockbox.changed
-        elseif dependency == "common" then return not (ver.app.changed or ver.comms.changed)
+        elseif dependency == "common" then return not (ver.common.changed or ver.comms.changed)
         elseif dependency == app then return not ver.app.changed
         else return true end
     end
 
     if not single_file_mode then
-        if fs.exists(install_dir) then
-            fs.delete(install_dir)
-            fs.makeDir(install_dir)
-        end
+        if fs.exists(install_dir) then fs.delete(install_dir);fs.makeDir(install_dir) end
 
         -- download all dependencies
         for _, dependency in pairs(dependencies) do
@@ -343,7 +428,7 @@ elseif mode == "install" or mode == "update" then
                     local dl, err = http.get(repo_path .. file)
 
                     if dl == nil then
-                        red(); println("GET HTTP Error " .. err)
+                        red();println("HTTP Error " .. err)
                         success = false
                         break
                     else
@@ -384,10 +469,13 @@ elseif mode == "install" or mode == "update" then
             if mode == "install" then
                 println("Installation completed successfully.")
             else println("Update completed successfully.") end
+            white();println("Ready to clean up unused files, press any key to continue...")
+            any_key();clean(manifest)
+            white();println("Done.")
         else
             if mode == "install" then
-                red(); println("Installation failed.")
-            else orange(); println("Update failed, existing files unmodified.") end
+                red();println("Installation failed.")
+            else orange();println("Update failed, existing files unmodified.") end
         end
     else
         -- go through all files and replace one by one
@@ -405,7 +493,7 @@ elseif mode == "install" or mode == "update" then
                         local dl, err = http.get(repo_path .. file)
 
                         if dl == nil then
-                            red(); println("GET HTTP Error " .. err)
+                            red();println("HTTP Error " .. err)
                             success = false
                             break
                         else
@@ -424,6 +512,9 @@ elseif mode == "install" or mode == "update" then
             if mode == "install" then
                 println("Installation completed successfully.")
             else println("Update completed successfully.") end
+            white();println("Ready to clean up unused files, press any key to continue...")
+            any_key();clean(manifest)
+            white();println("Done.")
         else
             red()
             if mode == "install" then
@@ -434,10 +525,10 @@ elseif mode == "install" or mode == "update" then
 elseif mode == "remove" or mode == "purge" then
     local ok, manifest = read_local_manifest()
     if not ok then
-        red(); println("Error parsing local installation manifest."); white()
+        red();println("Error parsing local installation manifest.");white()
         return
     elseif mode == "remove" and manifest.versions[app] == nil then
-        red(); println(app .. " is not installed, cannot remove."); white()
+        red();println(app .. " is not installed, cannot remove.");white()
         return
     end
 
@@ -449,7 +540,10 @@ elseif mode == "remove" or mode == "purge" then
     end
 
     -- ask for confirmation
-    if not ask_y_n("Continue?", false) then return end
+    if not ask_y_n("Continue", false) then return end
+
+    -- delete unused files first
+    clean(manifest)
 
     local file_list = manifest.files
     local dependencies = manifest.depends[app]
@@ -469,9 +563,9 @@ elseif mode == "remove" or mode == "purge" then
         end)
 
         if not log_deleted then
-            red(); println("failed to delete log file")
-            white(); println("press enter to continue...")
-            read(); lgray()
+            red();println("Failed to delete log file.")
+            white();println("press any key to continue...")
+            any_key();lgray()
         end
     end
 
@@ -480,10 +574,7 @@ elseif mode == "remove" or mode == "purge" then
         local files = file_list[dependency]
         for _, file in pairs(files) do
             if mode == "purge" or file ~= config_file then
-                if fs.exists(file) then
-                    fs.delete(file)
-                    println("deleted " .. file)
-                end
+                if fs.exists(file) then fs.delete(file);println("deleted " .. file) end
             end
         end
 
@@ -508,8 +599,7 @@ elseif mode == "remove" or mode == "purge" then
                 end
 
                 if folder ~= app and fs.isDir(folder) then
-                    fs.delete(folder)
-                    println("deleted app subdirectory " .. folder)
+                    fs.delete(folder);println("deleted app subdirectory " .. folder)
                 end
             end
         end
@@ -527,7 +617,7 @@ elseif mode == "remove" or mode == "purge" then
         imfile.close()
     end
 
-    green(); println("Done!")
+    green();println("Done!")
 end
 
 white()

coordinator/config.lua

@@ -26,6 +26,9 @@ config.SOUNDER_VOLUME = 1.0
 -- true for 24 hour time on main view screen
 config.TIME_24_HOUR = true
 
+-- disable flow view (for legacy layouts)
+config.DISABLE_FLOW_VIEW = false
+
 -- log path
 config.LOG_PATH = "/log.txt"
 -- log mode

coordinator/coordinator.lua

@@ -2,6 +2,7 @@ local comms       = require("scada-common.comms")
 local log         = require("scada-common.log")
 local ppm         = require("scada-common.ppm")
 local util        = require("scada-common.util")
+local types       = require("scada-common.types")
 
 local iocontrol   = require("coordinator.iocontrol")
 local process     = require("coordinator.process")
@@ -12,7 +13,6 @@ local dialog      = require("coordinator.ui.dialog")
 
 local print = util.print
 local println = util.println
-local println_ts = util.println_ts
 
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
@@ -22,6 +22,8 @@ local SCADA_CRDN_TYPE = comms.SCADA_CRDN_TYPE
 local UNIT_COMMAND = comms.UNIT_COMMAND
 local FAC_COMMAND = comms.FAC_COMMAND
 
+local LINK_TIMEOUT = 60.0
+
 local coordinator = {}
 
 -- request the user to select a monitor
@@ -47,12 +49,15 @@ end
 
 -- configure monitor layout
 ---@param num_units integer number of units expected
+---@param disable_flow_view boolean disable flow view (legacy)
 ---@return boolean success, monitors_struct? monitors
-function coordinator.configure_monitors(num_units)
+function coordinator.configure_monitors(num_units, disable_flow_view)
     ---@class monitors_struct
     local monitors = {
         primary = nil,
         primary_name = "",
+        flow = nil,
+        flow_name = "",
         unit_displays = {},
         unit_name_map = {}
     }
@@ -67,8 +72,8 @@ function coordinator.configure_monitors(num_units)
         table.insert(available, iface)
     end
 
-    -- we need a certain number of monitors (1 per unit + 1 primary display)
-    local num_displays_needed = num_units + 1
+    -- we need a certain number of monitors (1 per unit + 1 primary display + 1 flow display)
+    local num_displays_needed = num_units + util.trinary(disable_flow_view, 1, 2)
     if #names < num_displays_needed then
         local message = "not enough monitors connected (need " .. num_displays_needed .. ")"
         println(message)
@@ -81,10 +86,12 @@ function coordinator.configure_monitors(num_units)
         log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)")
     else
         local _primary = settings.get("PRIMARY_DISPLAY")
+        local _flow = settings.get("FLOW_DISPLAY")
         local _unitd = settings.get("UNIT_DISPLAYS")
 
         -- filter out already assigned monitors
         util.filter_table(available, function (x) return x ~= _primary end)
+        util.filter_table(available, function (x) return x ~= _flow end)
         if type(_unitd) == "table" then
             util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end)
         end
@@ -104,7 +111,6 @@ function coordinator.configure_monitors(num_units)
     end
 
     while iface_primary_display == nil and #available > 0 do
-        -- lets get a monitor
         iface_primary_display = ask_monitor(available)
     end
 
@@ -116,6 +122,33 @@ function coordinator.configure_monitors(num_units)
     monitors.primary = ppm.get_periph(iface_primary_display)
     monitors.primary_name = iface_primary_display
 
+    --------------------------
+    -- FLOW MONITOR DISPLAY --
+    --------------------------
+
+    if not disable_flow_view then
+        local iface_flow_display = settings.get("FLOW_DISPLAY")  ---@type boolean|string|nil
+
+        if not util.table_contains(names, iface_flow_display) then
+            println("flow monitor display is not connected")
+            local response = dialog.ask_y_n("would you like to change it", true)
+            if response == false then return false end
+            iface_flow_display = nil
+        end
+
+        while iface_flow_display == nil and #available > 0 do
+            iface_flow_display = ask_monitor(available)
+        end
+
+        if type(iface_flow_display) ~= "string" then return false end
+
+        settings.set("FLOW_DISPLAY", iface_flow_display)
+        util.filter_table(available, function (x) return x ~= iface_flow_display end)
+
+        monitors.flow = ppm.get_periph(iface_flow_display)
+        monitors.flow_name = iface_flow_display
+    end
+
     -------------------
     -- UNIT DISPLAYS --
     -------------------
@@ -128,7 +161,6 @@ function coordinator.configure_monitors(num_units)
             local display = nil
 
             while display == nil and #available > 0 do
-                -- lets get a monitor
                 println("please select monitor for unit #" .. i)
                 display = ask_monitor(available)
             end
@@ -150,7 +182,6 @@ function coordinator.configure_monitors(num_units)
             end
 
             while display == nil and #available > 0 do
-                -- lets get a monitor
                 display = ask_monitor(available)
             end
 
@@ -215,21 +246,25 @@ end
 ---@nodiscard
 ---@param version string coordinator version
 ---@param nic nic network interface device
+---@param num_units integer number of configured units for number of monitors, checked against SV
 ---@param crd_channel integer port of configured supervisor
 ---@param svr_channel integer listening port for supervisor replys
 ---@param pkt_channel integer listening port for pocket API
 ---@param range integer trusted device connection range
 ---@param sv_watchdog watchdog
-function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
+function coordinator.comms(version, nic, num_units, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
     local self = {
         sv_linked = false,
         sv_addr = comms.BROADCAST,
         sv_seq_num = 0,
         sv_r_seq_num = nil,
         sv_config_err = false,
-        connected = false,
         last_est_ack = ESTABLISH_ACK.ALLOW,
-        last_api_est_acks = {}
+        last_api_est_acks = {},
+        est_start = 0,
+        est_last = 0,
+        est_tick_waiting = nil,
+        est_task_done = nil
     }
 
     comms.set_trusted_range(range)
@@ -295,77 +330,78 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     ---@class coord_comms
     local public = {}
 
+    -- try to connect to the supervisor if not already linked
+    ---@param abort boolean? true to print out cancel info if not linked (use on program terminate)
+    ---@return boolean ok, boolean start_ui
+    function public.try_connect(abort)
+        local ok = true
+        local start_ui = false
+
+        if not self.sv_linked then
+            if self.est_tick_waiting == nil then
+                self.est_start = util.time_s()
+                self.est_last = self.est_start
+
+                self.est_tick_waiting, self.est_task_done =
+                    coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. svr_channel)
+
+                _send_establish()
+            else
+                self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (util.time_s() - self.est_start)))
+            end
+
+            if abort or (util.time_s() - self.est_start) >= LINK_TIMEOUT then
+                self.est_task_done(false)
+
+                if abort then
+                    coordinator.log_comms("supervisor connection attempt cancelled by user")
+                elseif self.sv_config_err then
+                    coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                elseif not self.sv_linked then
+                    if self.last_est_ack == ESTABLISH_ACK.DENY then
+                        coordinator.log_comms("supervisor connection attempt denied")
+                    elseif self.last_est_ack == ESTABLISH_ACK.COLLISION then
+                        coordinator.log_comms("supervisor connection failed due to collision")
+                    elseif self.last_est_ack == ESTABLISH_ACK.BAD_VERSION then
+                        coordinator.log_comms("supervisor connection failed due to version mismatch")
+                    else
+                        coordinator.log_comms("supervisor connection failed with no valid response")
+                    end
+                end
+
+                ok = false
+            elseif self.sv_config_err then
+                coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                ok = false
+            elseif (util.time_s() - self.est_last) > 1.0 then
+                _send_establish()
+                self.est_last = util.time_s()
+            end
+        elseif self.est_tick_waiting ~= nil then
+            self.est_task_done(true)
+            self.est_tick_waiting = nil
+            self.est_task_done = nil
+            start_ui = true
+        end
+
+        return ok, start_ui
+    end
+
     -- close the connection to the server
     function public.close()
         sv_watchdog.cancel()
         self.sv_addr = comms.BROADCAST
         self.sv_linked = false
         self.sv_r_seq_num = nil
+        iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
         _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.CLOSE, {})
     end
 
-    -- attempt to connect to the subervisor
-    ---@nodiscard
-    ---@param timeout_s number timeout in seconds
-    ---@param tick_dmesg_waiting function callback to tick dmesg waiting
-    ---@param task_done function callback to show done on dmesg
-    ---@return boolean sv_linked true if connected, false otherwise
-    --- EVENT_CONSUMER: this function consumes events
-    function public.sv_connect(timeout_s, tick_dmesg_waiting, task_done)
-        local clock = util.new_clock(1)
-        local start = util.time_s()
-        local terminated = false
-
-        _send_establish()
-
-        clock.start()
-
-        while (util.time_s() - start) < timeout_s and (not self.sv_linked) and (not self.sv_config_err) do
-            local event, p1, p2, p3, p4, p5 = util.pull_event()
-
-            if event == "timer" and clock.is_clock(p1) then
-                -- timed out attempt, try again
-                tick_dmesg_waiting(math.max(0, timeout_s - (util.time_s() - start)))
-                _send_establish()
-                clock.start()
-            elseif event == "timer" then
-                -- keep checking watchdog timers
-                apisessions.check_all_watchdogs(p1)
-            elseif event == "modem_message" then
-                -- handle message
-                local packet = public.parse_packet(p1, p2, p3, p4, p5)
-                public.handle_packet(packet)
-            elseif event == "terminate" then
-                terminated = true
-                break
-            end
-        end
-
-        task_done(self.sv_linked)
-
-        if terminated then
-            coordinator.log_comms("supervisor connection attempt cancelled by user")
-        elseif self.sv_config_err then
-            coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
-        elseif not self.sv_linked then
-            if self.last_est_ack == ESTABLISH_ACK.DENY then
-                coordinator.log_comms("supervisor connection attempt denied")
-            elseif self.last_est_ack == ESTABLISH_ACK.COLLISION then
-                coordinator.log_comms("supervisor connection failed due to collision")
-            elseif self.last_est_ack == ESTABLISH_ACK.BAD_VERSION then
-                coordinator.log_comms("supervisor connection failed due to version mismatch")
-            else
-                coordinator.log_comms("supervisor connection failed with no valid response")
-            end
-        end
-
-        return self.sv_linked
-    end
-
     -- send a facility command
     ---@param cmd FAC_COMMAND command
-    function public.send_fac_command(cmd)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd })
+    ---@param option any? optional option options for the optional options (like waste mode)
+    function public.send_fac_command(cmd, option)
+        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd, option })
     end
 
     -- send the auto process control configuration with a start command
@@ -379,7 +415,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     -- send a unit command
     ---@param cmd UNIT_COMMAND command
     ---@param unit integer unit ID
-    ---@param option any? optional option options for the optional options (like burn rate) (does option still look like a word?)
+    ---@param option any? optional option options for the optional options (like burn rate)
     function public.send_unit_command(cmd, unit, option)
         _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
     end
@@ -424,7 +460,10 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
 
     -- handle a packet
     ---@param packet mgmt_frame|crdn_frame|capi_frame|nil
+    ---@return boolean close_ui
     function public.handle_packet(packet)
+        local was_linked = self.sv_linked
+
         if packet ~= nil then
             local l_chan = packet.scada_frame.local_channel()
             local r_chan = packet.scada_frame.remote_channel()
@@ -434,7 +473,9 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
             if l_chan ~= crd_channel then
                 log.debug("received packet on unconfigured channel " .. l_chan, true)
             elseif r_chan == pkt_channel then
-                if protocol == PROTOCOL.COORD_API then
+                if not self.sv_linked then
+                    log.debug("discarding pocket API packet before linked to supervisor")
+                elseif protocol == PROTOCOL.COORD_API then
                     ---@cast packet capi_frame
                     -- look for an associated session
                     local session = apisessions.find_session(src_addr)
@@ -473,7 +514,6 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                             elseif dev_type == DEVICE_TYPE.PKT then
                                 -- pocket linking request
                                 local id = apisessions.establish_session(src_addr, firmware_v)
-                                println(util.c("[API] pocket (", firmware_v, ") [@", src_addr, "] \xbb connected"))
                                 coordinator.log_comms(util.c("API_ESTABLISH: pocket (", firmware_v, ") [@", src_addr, "] connected with session ID ", id))
 
                                 _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW)
@@ -496,12 +536,12 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 -- check sequence number
                 if self.sv_r_seq_num == nil then
                     self.sv_r_seq_num = packet.scada_frame.seq_num()
-                elseif self.connected and ((self.sv_r_seq_num + 1) ~= packet.scada_frame.seq_num()) then
+                elseif self.sv_linked and ((self.sv_r_seq_num + 1) ~= packet.scada_frame.seq_num()) then
                     log.warning("sequence out-of-order: last = " .. self.sv_r_seq_num .. ", new = " .. packet.scada_frame.seq_num())
-                    return
+                    return false
                 elseif self.sv_linked and src_addr ~= self.sv_addr then
                     log.debug("received packet from unknown computer " .. src_addr .. " while linked; channel in use by another system?")
-                    return
+                    return false
                 else
                     self.sv_r_seq_num = packet.scada_frame.seq_num()
                 end
@@ -563,6 +603,10 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                                     end
                                 elseif cmd == FAC_COMMAND.ACK_ALL_ALARMS then
                                     iocontrol.get_db().facility.ack_alarms_ack(ack)
+                                elseif cmd == FAC_COMMAND.SET_WASTE_MODE then
+                                    process.waste_ack_handle(packet.data[2])
+                                elseif cmd == FAC_COMMAND.SET_PU_FB then
+                                    process.pu_fb_ack_handle(packet.data[2])
                                 else
                                     log.debug(util.c("received facility command ack with unknown command ", cmd))
                                 end
@@ -627,70 +671,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                     end
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
-                        -- connection with supervisor established
-                        if packet.length == 2 then
-                            local est_ack = packet.data[1]
-                            local config = packet.data[2]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                if type(config) == "table" and #config > 1 then
-                                    -- get configuration
-
-                                    ---@class facility_conf
-                                    local conf = {
-                                        num_units = config[1],  ---@type integer
-                                        defs = {}               -- boilers and turbines
-                                    }
-
-                                    if (#config - 1) == (conf.num_units * 2) then
-                                        -- record sequence of pairs of [#boilers, #turbines] per unit
-                                        for i = 2, #config do
-                                            table.insert(conf.defs, config[i])
-                                        end
-
-                                        -- init io controller
-                                        iocontrol.init(conf, public)
-
-                                        self.sv_addr = src_addr
-                                        self.sv_linked = true
-                                        self.sv_config_err = false
-                                    else
-                                        self.sv_config_err = true
-                                        log.warning("invalid supervisor configuration definitions received, establish failed")
-                                    end
-                                else
-                                    log.debug("invalid supervisor configuration table received, establish failed")
-                                end
-                            else
-                                log.debug("SCADA_MGMT establish packet reply (len = 2) unsupported")
-                            end
-
-                            self.last_est_ack = est_ack
-                        elseif packet.length == 1 then
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.DENY then
-                                if self.last_est_ack ~= est_ack then
-                                    log.info("supervisor connection denied")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                if self.last_est_ack ~= est_ack then
-                                    log.warning("supervisor connection denied due to collision")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                if self.last_est_ack ~= est_ack then
-                                    log.warning("supervisor comms version mismatch")
-                                end
-                            else
-                                log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported")
-                            end
-
-                            self.last_est_ack = est_ack
-                        else
-                            log.debug("SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.sv_linked then
+                    if self.sv_linked then
                         if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
@@ -715,11 +696,78 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                             self.sv_addr = comms.BROADCAST
                             self.sv_linked = false
                             self.sv_r_seq_num = nil
-                            println_ts("server connection closed by remote host")
+                            iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
                             log.info("server connection closed by remote host")
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type)
                         end
+                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                        -- connection with supervisor established
+                        if packet.length == 2 then
+                            local est_ack = packet.data[1]
+                            local config = packet.data[2]
+
+                            if est_ack == ESTABLISH_ACK.ALLOW then
+                                -- reset to disconnected before validating
+                                iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
+
+                                if type(config) == "table" and #config == 2 then
+                                    -- get configuration
+
+                                    ---@class facility_conf
+                                    local conf = {
+                                        num_units = config[1],  ---@type integer
+                                        cooling = config[2]     ---@type sv_cooling_conf
+                                    }
+
+                                    if conf.num_units == num_units then
+                                        -- init io controller
+                                        iocontrol.init(conf, public)
+
+                                        self.sv_addr = src_addr
+                                        self.sv_linked = true
+                                        self.sv_r_seq_num = nil
+                                        self.sv_config_err = false
+
+                                        iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED)
+                                    else
+                                        self.sv_config_err = true
+                                        log.warning("supervisor config's number of units don't match coordinator's config, establish failed")
+                                    end
+                                else
+                                    log.debug("invalid supervisor configuration table received, establish failed")
+                                end
+                            else
+                                log.debug("SCADA_MGMT establish packet reply (len = 2) unsupported")
+                            end
+
+                            self.last_est_ack = est_ack
+                        elseif packet.length == 1 then
+                            local est_ack = packet.data[1]
+
+                            if est_ack == ESTABLISH_ACK.DENY then
+                                if self.last_est_ack ~= est_ack then
+                                    iocontrol.fp_link_state(types.PANEL_LINK_STATE.DENIED)
+                                    log.info("supervisor connection denied")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.COLLISION then
+                                if self.last_est_ack ~= est_ack then
+                                    iocontrol.fp_link_state(types.PANEL_LINK_STATE.COLLISION)
+                                    log.warning("supervisor connection denied due to collision")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
+                                if self.last_est_ack ~= est_ack then
+                                    iocontrol.fp_link_state(types.PANEL_LINK_STATE.BAD_VERSION)
+                                    log.warning("supervisor comms version mismatch")
+                                end
+                            else
+                                log.debug("SCADA_MGMT establish packet reply (len = 1) unsupported")
+                            end
+
+                            self.last_est_ack = est_ack
+                        else
+                            log.debug("SCADA_MGMT establish packet length mismatch")
+                        end
                     else
                         log.debug("discarding non-link SCADA_MGMT packet before linked")
                     end
@@ -730,6 +778,8 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 log.debug("received packet for unknown channel " .. r_chan, true)
             end
         end
+
+        return was_linked and not self.sv_linked
     end
 
     -- check if the coordinator is still linked to the supervisor

coordinator/iocontrol.lua

@@ -10,9 +10,15 @@ local util    = require("scada-common.util")
 local process = require("coordinator.process")
 local sounder = require("coordinator.sounder")
 
+local pgi     = require("coordinator.ui.pgi")
+
 local ALARM_STATE = types.ALARM_STATE
 local PROCESS = types.PROCESS
 
+-- nominal RTT is ping (0ms to 10ms usually) + 500ms for CRD main loop tick
+local WARN_RTT = 1000   -- 2x as long as expected w/ 0 ping
+local HIGH_RTT = 1500   -- 3.33x as long as expected w/ 0 ping
+
 local iocontrol = {}
 
 ---@class ioctl
@@ -27,13 +33,27 @@ local function __generic_ack(success) end
 
 -- luacheck: unused args
 
+-- initialize front panel PSIL
+---@param firmware_v string coordinator version
+---@param comms_v string comms version
+function iocontrol.init_fp(firmware_v, comms_v)
+    ---@class ioctl_front_panel
+    io.fp = { ps = psil.create() }
+
+    io.fp.ps.publish("version", firmware_v)
+    io.fp.ps.publish("comms_version", comms_v)
+end
+
 -- initialize the coordinator IO controller
 ---@param conf facility_conf configuration
 ---@param comms coord_comms comms reference
 function iocontrol.init(conf, comms)
+    -- facility data structure
     ---@class ioctl_facility
     io.facility = {
-        num_units = conf.num_units, ---@type integer
+        num_units = conf.num_units,
+        tank_mode = conf.cooling.fac_tank_mode,
+        tank_defs = conf.cooling.fac_tank_defs,
         all_sys_ok = false,
         rtu_count = 0,
 
@@ -52,6 +72,10 @@ function iocontrol.init(conf, comms)
             gen_fault = false
         },
 
+        ---@type WASTE_PRODUCT
+        auto_current_waste_product = types.WASTE_PRODUCT.PLUTONIUM,
+        auto_pu_fallback_active = false,
+
         radiation = types.new_zero_radiation_reading(),
 
         save_cfg_ack = __generic_ack,
@@ -60,22 +84,124 @@ function iocontrol.init(conf, comms)
         scram_ack = __generic_ack,
         ack_alarms_ack = __generic_ack,
 
+        alarm_tones = { false, false, false, false, false, false, false, false },
+
         ps = psil.create(),
 
         induction_ps_tbl = {},
         induction_data_tbl = {},
 
+        sps_ps_tbl = {},
+        sps_data_tbl = {},
+
+        tank_ps_tbl = {},
+        tank_data_tbl = {},
+
         env_d_ps = psil.create(),
         env_d_data = {}
     }
 
-    -- create induction tables (currently only 1 is supported)
-    for _ = 1, conf.num_units do
-        local data = {} ---@type imatrix_session_db
-        table.insert(io.facility.induction_ps_tbl, psil.create())
-        table.insert(io.facility.induction_data_tbl, data)
+    -- create induction and SPS tables (currently only 1 of each is supported)
+    table.insert(io.facility.induction_ps_tbl, psil.create())
+    table.insert(io.facility.induction_data_tbl, {})
+    table.insert(io.facility.sps_ps_tbl, psil.create())
+    table.insert(io.facility.sps_data_tbl, {})
+
+    -- determine tank information
+    if io.facility.tank_mode == 0 then
+        io.facility.tank_defs = {}
+        -- on facility tank mode 0, setup tank defs to match unit TANK option
+        for i = 1, conf.num_units do
+            io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TANK, 1, 0)
+        end
+
+        io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
+    else
+        -- decode the layout of tanks from the connections definitions
+        local tank_mode = io.facility.tank_mode
+        local tank_defs = io.facility.tank_defs
+        local tank_list = { table.unpack(tank_defs) }
+
+        local function calc_fdef(start_idx, end_idx)
+            local first = 4
+            for i = start_idx, end_idx do
+                if io.facility.tank_defs[i] == 2 then
+                    if i < first then first = i end
+                end
+            end
+            return first
+        end
+
+        if tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef = calc_fdef(1, #tank_defs)
+            for i = 1, #tank_defs do
+                if i > first_fdef and tank_defs[i] == 2 then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
+                    tank_list[b] = 0
+                end
+            end
+        elseif tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef = calc_fdef(2, #tank_defs)
+            for i = 1, #tank_defs do
+                if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef = calc_fdef(3, #tank_defs)
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        end
+
+        io.facility.tank_list = tank_list
     end
 
+    -- create facility tank tables
+    for i = 1, #io.facility.tank_list do
+        if io.facility.tank_list[i] == 2 then
+            table.insert(io.facility.tank_ps_tbl, psil.create())
+            table.insert(io.facility.tank_data_tbl, {})
+        end
+    end
+
+    -- create unit data structures
     io.units = {}
     for i = 1, conf.num_units do
         local function ack(alarm) process.ack_alarm(i, alarm) end
@@ -87,11 +213,16 @@ function iocontrol.init(conf, comms)
 
             num_boilers = 0,
             num_turbines = 0,
+            num_snas = 0,
+            has_tank = conf.cooling.r_cool[i].TANK,
 
             control_state = false,
             burn_rate_cmd = 0.0,
-            waste_control = 0,
             radiation = types.new_zero_radiation_reading(),
+            sna_prod_rate = 0.0,
+
+            waste_mode = types.WASTE_MODE.MANUAL_PLUTONIUM,
+            waste_product = types.WASTE_PRODUCT.PLUTONIUM,
 
             -- auto control group
             a_group = 0,
@@ -100,10 +231,10 @@ function iocontrol.init(conf, comms)
             scram = function () process.scram(i) end,
             reset_rps = function () process.reset_rps(i) end,
             ack_alarms = function () process.ack_all_alarms(i) end,
-            set_burn = function (rate) process.set_rate(i, rate) end,   ---@param rate number burn rate
-            set_waste = function (mode) process.set_waste(i, mode) end, ---@param mode integer waste processing mode
+            set_burn = function (rate) process.set_rate(i, rate) end,        ---@param rate number burn rate
+            set_waste = function (mode) process.set_unit_waste(i, mode) end, ---@param mode WASTE_MODE waste processing mode
 
-            set_group = function (grp) process.set_group(i, grp) end,   ---@param grp integer|0 group ID or 0
+            set_group = function (grp) process.set_group(i, grp) end,        ---@param grp integer|0 group ID or 0 for manual
 
             start_ack = __generic_ack,
             scram_ack = __generic_ack,
@@ -152,21 +283,33 @@ function iocontrol.init(conf, comms)
             boiler_data_tbl = {},
 
             turbine_ps_tbl = {},
-            turbine_data_tbl = {}
+            turbine_data_tbl = {},
+
+            tank_ps_tbl = {},
+            tank_data_tbl = {}
         }
 
+        -- on other facility modes, overwrite unit TANK option with facility tank defs
+        if io.facility.tank_mode ~= 0 then
+            entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
+        end
+
         -- create boiler tables
-        for _ = 1, conf.defs[(i * 2) - 1] do
-            local data = {} ---@type boilerv_session_db
+        for _ = 1, conf.cooling.r_cool[i].BOILERS do
             table.insert(entry.boiler_ps_tbl, psil.create())
-            table.insert(entry.boiler_data_tbl, data)
+            table.insert(entry.boiler_data_tbl, {})
         end
 
         -- create turbine tables
-        for _ = 1, conf.defs[i * 2] do
-            local data = {} ---@type turbinev_session_db
+        for _ = 1, conf.cooling.r_cool[i].TURBINES do
             table.insert(entry.turbine_ps_tbl, psil.create())
-            table.insert(entry.turbine_data_tbl, data)
+            table.insert(entry.turbine_data_tbl, {})
+        end
+
+        -- create tank tables
+        if io.facility.tank_defs[i] == 1 then
+            table.insert(entry.tank_ps_tbl, psil.create())
+            table.insert(entry.tank_data_tbl, {})
         end
 
         entry.num_boilers = #entry.boiler_data_tbl
@@ -179,6 +322,102 @@ function iocontrol.init(conf, comms)
     process.init(io, comms)
 end
 
+--#region Front Panel PSIL
+
+-- toggle heartbeat indicator
+function iocontrol.heartbeat() io.fp.ps.toggle("heartbeat") end
+
+-- report presence of the wireless modem
+---@param has_modem boolean
+function iocontrol.fp_has_modem(has_modem) io.fp.ps.publish("has_modem", has_modem) end
+
+-- report presence of the speaker
+---@param has_speaker boolean
+function iocontrol.fp_has_speaker(has_speaker) io.fp.ps.publish("has_speaker", has_speaker) end
+
+-- report supervisor link state
+---@param state integer
+function iocontrol.fp_link_state(state) io.fp.ps.publish("link_state", state) end
+
+-- report monitor connection state
+---@param id string|integer unit ID for unit monitor, "main" for main monitor, or "flow" for flow monitor
+function iocontrol.fp_monitor_state(id, connected)
+    local name = nil
+
+    if id == "main" then
+        name = "main_monitor"
+    elseif id == "flow" then
+        name = "flow_monitor"
+    elseif type(id) == "number" then
+        name = "unit_monitor_" .. id
+    end
+
+    if name ~= nil then
+        io.fp.ps.publish(name, connected)
+    end
+end
+
+-- report PKT firmware version and PKT session connection state
+---@param session_id integer PKT session
+---@param fw string firmware version
+---@param s_addr integer PKT computer ID
+function iocontrol.fp_pkt_connected(session_id, fw, s_addr)
+    io.fp.ps.publish("pkt_" .. session_id .. "_fw", fw)
+    io.fp.ps.publish("pkt_" .. session_id .. "_addr", util.sprintf("@ C% 3d", s_addr))
+    pgi.create_pkt_entry(session_id)
+end
+
+-- report PKT session disconnected
+---@param session_id integer PKT session
+function iocontrol.fp_pkt_disconnected(session_id)
+    pgi.delete_pkt_entry(session_id)
+end
+
+-- transmit PKT session RTT
+---@param session_id integer PKT session
+---@param rtt integer round trip time
+function iocontrol.fp_pkt_rtt(session_id, rtt)
+    io.fp.ps.publish("pkt_" .. session_id .. "_rtt", rtt)
+
+    if rtt > HIGH_RTT then
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.red)
+    elseif rtt > WARN_RTT then
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.yellow_hc)
+    else
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.green)
+    end
+end
+
+--#endregion
+
+--#region Builds
+
+-- record and publish multiblock RTU build data
+---@param id integer
+---@param entry table
+---@param data_tbl table
+---@param ps_tbl table
+---@param create boolean? true to create an entry if non exists, false to fail on missing
+---@return boolean ok true if data saved, false if invalid ID
+local function _record_multiblock_build(id, entry, data_tbl, ps_tbl, create)
+    local exists = type(data_tbl[id]) == "table"
+    if exists or create then
+        if not exists then
+            ps_tbl[id] = psil.create()
+            data_tbl[id] = {}
+        end
+
+        data_tbl[id].formed = entry[1]  ---@type boolean
+        data_tbl[id].build  = entry[2]  ---@type table
+
+        ps_tbl[id].publish("formed", entry[1])
+
+        for key, val in pairs(data_tbl[id].build) do ps_tbl[id].publish(key, val) end
+    end
+
+    return exists or (create == true)
+end
+
 -- populate facility structure builds
 ---@param build table
 ---@return boolean valid
@@ -191,21 +430,29 @@ function iocontrol.record_facility_builds(build)
         -- induction matricies
         if type(build.induction) == "table" then
             for id, matrix in pairs(build.induction) do
-                if type(fac.induction_data_tbl[id]) == "table" then
-                    fac.induction_data_tbl[id].formed = matrix[1]  ---@type boolean
-                    fac.induction_data_tbl[id].build  = matrix[2]  ---@type table
-
-                    fac.induction_ps_tbl[id].publish("formed", matrix[1])
-
-                    for key, val in pairs(fac.induction_data_tbl[id].build) do
-                        fac.induction_ps_tbl[id].publish(key, val)
-                    end
-                else
+                if not _record_multiblock_build(id, matrix, fac.induction_data_tbl, fac.induction_ps_tbl) then
                     log.debug(util.c("iocontrol.record_facility_builds: invalid induction matrix id ", id))
                     valid = false
                 end
             end
         end
+
+        -- SPS
+        if type(build.sps) == "table" then
+            for id, sps in pairs(build.sps) do
+                if not _record_multiblock_build(id, sps, fac.sps_data_tbl, fac.sps_ps_tbl) then
+                    log.debug(util.c("iocontrol.record_facility_builds: invalid SPS id ", id))
+                    valid = false
+                end
+            end
+        end
+
+        -- dynamic tanks
+        if type(build.tanks) == "table" then
+            for id, tank in pairs(build.tanks) do
+                _record_multiblock_build(id, tank, fac.tank_data_tbl, fac.tank_ps_tbl, true)
+            end
+        end
     else
         log.debug("facility builds not a table")
         valid = false
@@ -249,16 +496,7 @@ function iocontrol.record_unit_builds(builds)
             -- boiler builds
             if type(build.boilers) == "table" then
                 for b_id, boiler in pairs(build.boilers) do
-                    if type(unit.boiler_data_tbl[b_id]) == "table" then
-                        unit.boiler_data_tbl[b_id].formed = boiler[1] ---@type boolean
-                        unit.boiler_data_tbl[b_id].build  = boiler[2] ---@type table
-
-                        unit.boiler_ps_tbl[b_id].publish("formed", boiler[1])
-
-                        for key, val in pairs(unit.boiler_data_tbl[b_id].build) do
-                            unit.boiler_ps_tbl[b_id].publish(key, val)
-                        end
-                    else
+                    if not _record_multiblock_build(b_id, boiler, unit.boiler_data_tbl, unit.boiler_ps_tbl) then
                         log.debug(util.c(log_header, "invalid boiler id ", b_id))
                         valid = false
                     end
@@ -268,27 +506,49 @@ function iocontrol.record_unit_builds(builds)
             -- turbine builds
             if type(build.turbines) == "table" then
                 for t_id, turbine in pairs(build.turbines) do
-                    if type(unit.turbine_data_tbl[t_id]) == "table" then
-                        unit.turbine_data_tbl[t_id].formed = turbine[1]   ---@type boolean
-                        unit.turbine_data_tbl[t_id].build  = turbine[2]   ---@type table
-
-                        unit.turbine_ps_tbl[t_id].publish("formed", turbine[1])
-
-                        for key, val in pairs(unit.turbine_data_tbl[t_id].build) do
-                            unit.turbine_ps_tbl[t_id].publish(key, val)
-                        end
-                    else
+                    if not _record_multiblock_build(t_id, turbine, unit.turbine_data_tbl, unit.turbine_ps_tbl) then
                         log.debug(util.c(log_header, "invalid turbine id ", t_id))
                         valid = false
                     end
                 end
             end
+
+            -- dynamic tank builds
+            if type(build.tanks) == "table" then
+                for d_id, d_tank in pairs(build.tanks) do
+                    _record_multiblock_build(d_id, d_tank, unit.tank_data_tbl, unit.tank_ps_tbl, true)
+                end
+            end
         end
     end
 
     return valid
 end
 
+--#endregion
+
+--#region Statuses
+
+-- record and publish multiblock status data
+---@param entry any
+---@param data imatrix_session_db|sps_session_db|dynamicv_session_db|turbinev_session_db|boilerv_session_db
+---@param ps psil
+---@return boolean is_faulted
+local function _record_multiblock_status(entry, data, ps)
+    local is_faulted = entry[1] ---@type boolean
+    data.formed      = entry[2] ---@type boolean
+    data.state       = entry[3] ---@type table
+    data.tanks       = entry[4] ---@type table
+
+    ps.publish("formed", data.formed)
+    ps.publish("faulted", is_faulted)
+
+    for key, val in pairs(data.state) do ps.publish(key, val) end
+    for key, val in pairs(data.tanks) do ps.publish(key, val) end
+
+    return is_faulted
+end
+
 -- update facility status
 ---@param status table
 ---@return boolean valid
@@ -306,7 +566,7 @@ function iocontrol.update_facility_status(status)
 
         local ctl_status = status[1]
 
-        if type(ctl_status) == "table" and #ctl_status == 14 then
+        if type(ctl_status) == "table" and #ctl_status == 16 then
             fac.all_sys_ok = ctl_status[1]
             fac.auto_ready = ctl_status[2]
 
@@ -354,6 +614,12 @@ function iocontrol.update_facility_status(status)
                     io.units[i].unit_ps.publish("auto_group", names[group_map[i] + 1])
                 end
             end
+
+            fac.auto_current_waste_product = ctl_status[15]
+            fac.auto_pu_fallback_active = ctl_status[16]
+
+            fac.ps.publish("current_waste_product", fac.auto_current_waste_product)
+            fac.ps.publish("pu_fallback_active", fac.auto_pu_fallback_active)
         else
             log.debug(log_header .. "control status not a table or length mismatch")
             valid = false
@@ -390,36 +656,23 @@ function iocontrol.update_facility_status(status)
 
                 for id, matrix in pairs(rtu_statuses.induction) do
                     if type(fac.induction_data_tbl[id]) == "table" then
-                        local rtu_faulted                 = matrix[1]   ---@type boolean
-                        fac.induction_data_tbl[id].formed = matrix[2]   ---@type boolean
-                        fac.induction_data_tbl[id].state  = matrix[3]   ---@type table
-                        fac.induction_data_tbl[id].tanks  = matrix[4]   ---@type table
+                        local data = fac.induction_data_tbl[id] ---@type imatrix_session_db
+                        local ps   = fac.induction_ps_tbl[id]   ---@type psil
 
-                        local data = fac.induction_data_tbl[id]         ---@type imatrix_session_db
+                        local rtu_faulted = _record_multiblock_status(matrix, data, ps)
 
-                        fac.induction_ps_tbl[id].publish("formed", data.formed)
-                        fac.induction_ps_tbl[id].publish("faulted", rtu_faulted)
-
-                        if data.formed then
-                            if rtu_faulted then
-                                fac.induction_ps_tbl[id].publish("computed_status", 3)  -- faulted
-                            elseif data.tanks.energy_fill >= 0.99 then
-                                fac.induction_ps_tbl[id].publish("computed_status", 6)  -- full
+                        if rtu_faulted then
+                            ps.publish("computed_status", 3)    -- faulted
+                        elseif data.formed then
+                            if data.tanks.energy_fill >= 0.99 then
+                                ps.publish("computed_status", 6)    -- full
                             elseif data.tanks.energy_fill <= 0.01 then
-                                fac.induction_ps_tbl[id].publish("computed_status", 5)  -- empty
+                                ps.publish("computed_status", 5)    -- empty
                             else
-                                fac.induction_ps_tbl[id].publish("computed_status", 4)  -- on-line
+                                ps.publish("computed_status", 4)    -- on-line
                             end
                         else
-                            fac.induction_ps_tbl[id].publish("computed_status", 2)      -- not formed
-                        end
-
-                        for key, val in pairs(fac.induction_data_tbl[id].state) do
-                            fac.induction_ps_tbl[id].publish(key, val)
-                        end
-
-                        for key, val in pairs(fac.induction_data_tbl[id].tanks) do
-                            fac.induction_ps_tbl[id].publish(key, val)
+                            ps.publish("computed_status", 2)        -- not formed
                         end
                     else
                         log.debug(util.c(log_header, "invalid induction matrix id ", id))
@@ -430,6 +683,82 @@ function iocontrol.update_facility_status(status)
                 valid = false
             end
 
+            -- SPS statuses
+            if type(rtu_statuses.sps) == "table" then
+                for id = 1, #fac.sps_ps_tbl do
+                    if rtu_statuses.sps[id] == nil then
+                        -- disconnected
+                        fac.sps_ps_tbl[id].publish("computed_status", 1)
+                    end
+                end
+
+                for id, sps in pairs(rtu_statuses.sps) do
+                    if type(fac.sps_data_tbl[id]) == "table" then
+                        local data = fac.sps_data_tbl[id]   ---@type sps_session_db
+                        local ps   = fac.sps_ps_tbl[id]     ---@type psil
+
+                        local rtu_faulted = _record_multiblock_status(sps, data, ps)
+
+                        if rtu_faulted then
+                            ps.publish("computed_status", 3)        -- faulted
+                        elseif data.formed then
+                            if data.state.process_rate > 0 then
+                                ps.publish("computed_status", 5)    -- active
+                            else
+                                ps.publish("computed_status", 4)    -- idle
+                            end
+                        else
+                            ps.publish("computed_status", 2)        -- not formed
+                        end
+
+                        io.facility.ps.publish("am_rate", data.state.process_rate * 1000)
+                    else
+                        log.debug(util.c(log_header, "invalid sps id ", id))
+                    end
+                end
+            else
+                log.debug(log_header .. "sps list not a table")
+                valid = false
+            end
+
+            -- dynamic tank statuses
+            if type(rtu_statuses.tanks) == "table" then
+                for id = 1, #fac.tank_ps_tbl do
+                    if rtu_statuses.tanks[id] == nil then
+                        -- disconnected
+                        fac.tank_ps_tbl[id].publish("computed_status", 1)
+                    end
+                end
+
+                for id, tank in pairs(rtu_statuses.tanks) do
+                    if type(fac.tank_data_tbl[id]) == "table" then
+                        local data = fac.tank_data_tbl[id]  ---@type dynamicv_session_db
+                        local ps   = fac.tank_ps_tbl[id]    ---@type psil
+
+                        local rtu_faulted = _record_multiblock_status(tank, data, ps)
+
+                        if rtu_faulted then
+                            ps.publish("computed_status", 3)        -- faulted
+                        elseif data.formed then
+                            if data.tanks.fill >= 0.99 then
+                                ps.publish("computed_status", 6)    -- full
+                            elseif data.tanks.fill < 0.20 then
+                                ps.publish("computed_status", 5)    -- low
+                            else
+                                ps.publish("computed_status", 4)    -- on-line
+                            end
+                        else
+                            ps.publish("computed_status", 2)        -- not formed
+                        end
+                    else
+                        log.debug(util.c(log_header, "invalid dynamic tank id ", id))
+                    end
+                end
+            else
+                log.debug(log_header .. "dyanmic tank list not a table")
+                valid = false
+            end
+
             -- environment detector status
             if type(rtu_statuses.rad_mon) == "table" then
                 if #rtu_statuses.rad_mon > 0 then
@@ -453,6 +782,16 @@ function iocontrol.update_facility_status(status)
         end
 
         fac.ps.publish("rtu_count", fac.rtu_count)
+
+        -- alarm tone commands
+
+        if (type(status[3]) == "table") and (#status[3] == 8) then
+            fac.alarm_tones = status[3]
+            sounder.set(fac.alarm_tones)
+        else
+            log.debug(log_header .. "alarm tones not a table or length mismatch")
+            valid = false
+        end
     end
 
     return valid
@@ -472,6 +811,8 @@ function iocontrol.update_unit_statuses(statuses)
         valid = false
     else
         local burn_rate_sum = 0.0
+        local sna_count_sum = 0
+        local pu_rate, po_rate, po_pl_rate, po_am_rate, spent_rate = 0.0, 0.0, 0.0, 0.0, 0.0
 
         -- get all unit statuses
         for i = 1, #statuses do
@@ -480,7 +821,9 @@ function iocontrol.update_unit_statuses(statuses)
             local unit = io.units[i]    ---@type ioctl_unit
             local status = statuses[i]
 
-            if type(status) ~= "table" or #status ~= 5 then
+            local burn_rate = 0.0
+
+            if type(status) ~= "table" or #status ~= 6 then
                 log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)")
                 valid = false
             else
@@ -515,7 +858,8 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- if status hasn't been received, mek_status = {}
                     if type(unit.reactor_data.mek_status.act_burn_rate) == "number" then
-                        burn_rate_sum = burn_rate_sum + unit.reactor_data.mek_status.act_burn_rate
+                        burn_rate = unit.reactor_data.mek_status.act_burn_rate
+                        burn_rate_sum = burn_rate_sum + burn_rate
                     end
 
                     if unit.reactor_data.mek_status.status then
@@ -562,6 +906,8 @@ function iocontrol.update_unit_statuses(statuses)
                 if type(rtu_statuses) == "table" then
                     -- boiler statuses
                     if type(rtu_statuses.boilers) == "table" then
+                        local boil_sum = 0
+
                         for id = 1, #unit.boiler_ps_tbl do
                             if rtu_statuses.boilers[i] == nil then
                                 -- disconnected
@@ -571,40 +917,31 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, boiler in pairs(rtu_statuses.boilers) do
                             if type(unit.boiler_data_tbl[id]) == "table" then
-                                local rtu_faulted               = boiler[1] ---@type boolean
-                                unit.boiler_data_tbl[id].formed = boiler[2] ---@type boolean
-                                unit.boiler_data_tbl[id].state  = boiler[3] ---@type table
-                                unit.boiler_data_tbl[id].tanks  = boiler[4] ---@type table
+                                local data = unit.boiler_data_tbl[id]   ---@type boilerv_session_db
+                                local ps   = unit.boiler_ps_tbl[id]     ---@type psil
 
-                                local data = unit.boiler_data_tbl[id]  ---@type boilerv_session_db
-
-                                unit.boiler_ps_tbl[id].publish("formed", data.formed)
-                                unit.boiler_ps_tbl[id].publish("faulted", rtu_faulted)
+                                local rtu_faulted = _record_multiblock_status(boiler, data, ps)
 
                                 if rtu_faulted then
-                                    unit.boiler_ps_tbl[id].publish("computed_status", 3)        -- faulted
+                                    ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    boil_sum = boil_sum + data.state.boil_rate
+
                                     if data.state.boil_rate > 0 then
-                                        unit.boiler_ps_tbl[id].publish("computed_status", 5)    -- active
+                                        ps.publish("computed_status", 5)    -- active
                                     else
-                                        unit.boiler_ps_tbl[id].publish("computed_status", 4)    -- idle
+                                        ps.publish("computed_status", 4)    -- idle
                                     end
                                 else
-                                    unit.boiler_ps_tbl[id].publish("computed_status", 2)        -- not formed
-                                end
-
-                                for key, val in pairs(unit.boiler_data_tbl[id].state) do
-                                    unit.boiler_ps_tbl[id].publish(key, val)
-                                end
-
-                                for key, val in pairs(unit.boiler_data_tbl[id].tanks) do
-                                    unit.boiler_ps_tbl[id].publish(key, val)
+                                    ps.publish("computed_status", 2)        -- not formed
                                 end
                             else
                                 log.debug(util.c(log_header, "invalid boiler id ", id))
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("boiler_boil_sum", boil_sum)
                     else
                         log.debug(log_header .. "boiler list not a table")
                         valid = false
@@ -612,6 +949,8 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- turbine statuses
                     if type(rtu_statuses.turbines) == "table" then
+                        local flow_sum = 0
+
                         for id = 1, #unit.turbine_ps_tbl do
                             if rtu_statuses.turbines[i] == nil then
                                 -- disconnected
@@ -621,47 +960,93 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, turbine in pairs(rtu_statuses.turbines) do
                             if type(unit.turbine_data_tbl[id]) == "table" then
-                                local rtu_faulted                = turbine[1]   ---@type boolean
-                                unit.turbine_data_tbl[id].formed = turbine[2]   ---@type boolean
-                                unit.turbine_data_tbl[id].state  = turbine[3]   ---@type table
-                                unit.turbine_data_tbl[id].tanks  = turbine[4]   ---@type table
-
                                 local data = unit.turbine_data_tbl[id]  ---@type turbinev_session_db
+                                local ps   = unit.turbine_ps_tbl[id]    ---@type psil
 
-                                unit.turbine_ps_tbl[id].publish("formed", data.formed)
-                                unit.turbine_ps_tbl[id].publish("faulted", rtu_faulted)
+                                local rtu_faulted = _record_multiblock_status(turbine, data, ps)
 
                                 if rtu_faulted then
-                                    unit.turbine_ps_tbl[id].publish("computed_status", 3)       -- faulted
+                                    ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    flow_sum = flow_sum + data.state.flow_rate
+
                                     if data.tanks.energy_fill >= 0.99 then
-                                        unit.turbine_ps_tbl[id].publish("computed_status", 6)   -- trip
+                                        ps.publish("computed_status", 6)    -- trip
                                     elseif data.state.flow_rate < 100 then
-                                        unit.turbine_ps_tbl[id].publish("computed_status", 4)   -- idle
+                                        ps.publish("computed_status", 4)    -- idle
                                     else
-                                        unit.turbine_ps_tbl[id].publish("computed_status", 5)   -- active
+                                        ps.publish("computed_status", 5)    -- active
                                     end
                                 else
-                                    unit.turbine_ps_tbl[id].publish("computed_status", 2)       -- not formed
-                                end
-
-                                for key, val in pairs(unit.turbine_data_tbl[id].state) do
-                                    unit.turbine_ps_tbl[id].publish(key, val)
-                                end
-
-                                for key, val in pairs(unit.turbine_data_tbl[id].tanks) do
-                                    unit.turbine_ps_tbl[id].publish(key, val)
+                                    ps.publish("computed_status", 2)        -- not formed
                                 end
                             else
                                 log.debug(util.c(log_header, "invalid turbine id ", id))
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("turbine_flow_sum", flow_sum)
                     else
                         log.debug(log_header .. "turbine list not a table")
                         valid = false
                     end
 
+                    -- dynamic tank statuses
+                    if type(rtu_statuses.tanks) == "table" then
+                        for id = 1, #unit.tank_ps_tbl do
+                            if rtu_statuses.tanks[i] == nil then
+                                -- disconnected
+                                unit.tank_ps_tbl[id].publish("computed_status", 1)
+                            end
+                        end
+
+                        for id, tank in pairs(rtu_statuses.tanks) do
+                            if type(unit.tank_data_tbl[id]) == "table" then
+                                local data = unit.tank_data_tbl[id] ---@type dynamicv_session_db
+                                local ps   = unit.tank_ps_tbl[id]   ---@type psil
+
+                                local rtu_faulted = _record_multiblock_status(tank, data, ps)
+
+                                if rtu_faulted then
+                                    ps.publish("computed_status", 3)        -- faulted
+                                elseif data.formed then
+                                    if data.tanks.fill >= 0.99 then
+                                        ps.publish("computed_status", 6)    -- full
+                                    elseif data.tanks.fill < 0.20 then
+                                        ps.publish("computed_status", 5)    -- low
+                                    else
+                                        ps.publish("computed_status", 4)    -- on-line
+                                    end
+                                else
+                                    ps.publish("computed_status", 2)        -- not formed
+                                end
+                            else
+                                log.debug(util.c(log_header, "invalid dynamic tank id ", id))
+                                valid = false
+                            end
+                        end
+                    else
+                        log.debug(log_header .. "dynamic tank list not a table")
+                        valid = false
+                    end
+
+                    -- solar neutron activator status info
+                    if type(rtu_statuses.sna) == "table" then
+                        unit.num_snas      = rtu_statuses.sna[1]    ---@type integer
+                        unit.sna_prod_rate = rtu_statuses.sna[2]    ---@type number
+                        unit.sna_peak_rate = rtu_statuses.sna[3]    ---@type number
+
+                        unit.unit_ps.publish("sna_count", unit.num_snas)
+                        unit.unit_ps.publish("sna_prod_rate", unit.sna_prod_rate)
+                        unit.unit_ps.publish("sna_peak_rate", unit.sna_peak_rate)
+
+                        sna_count_sum = sna_count_sum + unit.num_snas
+                    else
+                        log.debug(log_header .. "sna statistic list not a table")
+                        valid = false
+                    end
+
                     -- environment detector status
                     if type(rtu_statuses.rad_mon) == "table" then
                         if #rtu_statuses.rad_mon > 0 then
@@ -739,12 +1124,17 @@ function iocontrol.update_unit_statuses(statuses)
                 local unit_state = status[5]
 
                 if type(unit_state) == "table" then
-                    if #unit_state == 5 then
+                    if #unit_state == 6 then
+                        unit.waste_mode = unit_state[5]
+                        unit.waste_product = unit_state[6]
+
                         unit.unit_ps.publish("U_StatusLine1", unit_state[1])
                         unit.unit_ps.publish("U_StatusLine2", unit_state[2])
-                        unit.unit_ps.publish("U_WasteMode", unit_state[3])
-                        unit.unit_ps.publish("U_AutoReady", unit_state[4])
-                        unit.unit_ps.publish("U_AutoDegraded", unit_state[5])
+                        unit.unit_ps.publish("U_AutoReady", unit_state[3])
+                        unit.unit_ps.publish("U_AutoDegraded", unit_state[4])
+                        unit.unit_ps.publish("U_AutoWaste", unit.waste_mode == types.WASTE_MODE.AUTO)
+                        unit.unit_ps.publish("U_WasteMode", unit.waste_mode)
+                        unit.unit_ps.publish("U_WasteProduct", unit.waste_product)
                     else
                         log.debug(log_header .. "unit state length mismatch")
                         valid = false
@@ -753,18 +1143,81 @@ function iocontrol.update_unit_statuses(statuses)
                     log.debug(log_header .. "unit state not a table")
                     valid = false
                 end
+
+                -- valve states
+                local valve_states = status[6]
+
+                if type(valve_states) == "table" then
+                    if #valve_states == 5 then
+                        unit.unit_ps.publish("V_pu_conn", valve_states[1] > 0)
+                        unit.unit_ps.publish("V_pu_state", valve_states[1] == 2)
+                        unit.unit_ps.publish("V_po_conn", valve_states[2] > 0)
+                        unit.unit_ps.publish("V_po_state", valve_states[2] == 2)
+                        unit.unit_ps.publish("V_pl_conn", valve_states[3] > 0)
+                        unit.unit_ps.publish("V_pl_state", valve_states[3] == 2)
+                        unit.unit_ps.publish("V_am_conn", valve_states[4] > 0)
+                        unit.unit_ps.publish("V_am_state", valve_states[4] == 2)
+                        unit.unit_ps.publish("V_emc_conn", valve_states[5] > 0)
+                        unit.unit_ps.publish("V_emc_state", valve_states[5] == 2)
+                    else
+                        log.debug(log_header .. "valve states length mismatch")
+                        valid = false
+                    end
+                else
+                    log.debug(log_header .. "valve states not a table")
+                    valid = false
+                end
+
+                -- determine waste production for this unit, add to statistics
+
+                local is_pu = unit.waste_product == types.WASTE_PRODUCT.PLUTONIUM
+                local waste_rate = burn_rate / 10.0
+
+                local u_spent_rate = waste_rate
+                local u_pu_rate = util.trinary(is_pu, waste_rate, 0.0)
+                local u_po_rate = util.trinary(not is_pu, math.min(waste_rate, unit.sna_prod_rate), 0.0)
+
+                unit.unit_ps.publish("pu_rate", u_pu_rate)
+                unit.unit_ps.publish("po_rate", u_po_rate)
+
+                unit.unit_ps.publish("sna_in", util.trinary(is_pu, 0, burn_rate))
+
+                if unit.waste_product == types.WASTE_PRODUCT.POLONIUM then
+                    unit.unit_ps.publish("po_pl_rate", u_po_rate)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                    po_pl_rate = po_pl_rate + u_po_rate
+                elseif unit.waste_product == types.WASTE_PRODUCT.ANTI_MATTER then
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", u_po_rate)
+                    po_am_rate = po_am_rate + u_po_rate
+                    u_spent_rate = 0
+                else
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                end
+
+                unit.unit_ps.publish("ws_rate", u_spent_rate)
+
+                pu_rate = pu_rate + u_pu_rate
+                po_rate = po_rate + u_po_rate
+                spent_rate = spent_rate + u_spent_rate
             end
         end
 
         io.facility.ps.publish("burn_sum", burn_rate_sum)
-
-        -- update alarm sounder
-        sounder.eval(io.units)
+        io.facility.ps.publish("sna_count", sna_count_sum)
+        io.facility.ps.publish("pu_rate", pu_rate)
+        io.facility.ps.publish("po_rate", po_rate)
+        io.facility.ps.publish("po_pl_rate", po_pl_rate)
+        io.facility.ps.publish("po_am_rate", po_am_rate)
+        io.facility.ps.publish("spent_waste_rate", spent_rate)
     end
 
     return valid
 end
 
+--#endregion
+
 -- get the IO controller database
 function iocontrol.get_db() return io end
 

coordinator/process.lua

@@ -11,6 +11,7 @@ local FAC_COMMAND = comms.FAC_COMMAND
 local UNIT_COMMAND = comms.UNIT_COMMAND
 
 local PROCESS = types.PROCESS
+local PRODUCT = types.WASTE_PRODUCT
 
 ---@class process_controller
 local process = {}
@@ -24,7 +25,9 @@ local self = {
         burn_target = 0.0,
         charge_target = 0.0,
         gen_target = 0.0,
-        limits = {}
+        limits = {},
+        waste_product = PRODUCT.PLUTONIUM,
+        pu_fallback = false
     }
 }
 
@@ -48,19 +51,23 @@ function process.init(iocontrol, coord_comms)
         log.error("process.init(): failed to load coordinator settings file")
     end
 
+    -- facility auto control configuration
     local config = settings.get("PROCESS")  ---@type coord_auto_config|nil
-
     if type(config) == "table" then
         self.config.mode = config.mode
         self.config.burn_target = config.burn_target
         self.config.charge_target = config.charge_target
         self.config.gen_target = config.gen_target
         self.config.limits = config.limits
+        self.config.waste_product = config.waste_product
+        self.config.pu_fallback = config.pu_fallback
 
         self.io.facility.ps.publish("process_mode", self.config.mode)
         self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
         self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
         self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
+        self.io.facility.ps.publish("process_waste_product", self.config.waste_product)
+        self.io.facility.ps.publish("process_pu_fallback", self.config.pu_fallback)
 
         for id = 1, math.min(#self.config.limits, self.io.facility.num_units) do
             local unit = self.io.units[id]   ---@type ioctl_unit
@@ -68,20 +75,24 @@ function process.init(iocontrol, coord_comms)
         end
 
         log.info("PROCESS: loaded auto control settings from coord.settings")
+
+        -- notify supervisor of auto waste config
+        self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, self.config.waste_product)
+        self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, self.config.pu_fallback)
     end
 
-    local waste_mode = settings.get("WASTE_MODES")  ---@type table|nil
-
-    if type(waste_mode) == "table" then
-        for id, mode in pairs(waste_mode) do
+    -- unit waste states
+    local waste_modes = settings.get("WASTE_MODES")  ---@type table|nil
+    if type(waste_modes) == "table" then
+        for id, mode in pairs(waste_modes) do
             self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
         end
 
-        log.info("PROCESS: loaded waste mode settings from coord.settings")
+        log.info("PROCESS: loaded unit waste mode settings from coord.settings")
     end
 
+    -- unit priority groups
     local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil
-
     if type(prio_groups) == "table" then
         for id, group in pairs(prio_groups) do
             self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group)
@@ -137,7 +148,7 @@ end
 -- set waste mode
 ---@param id integer unit ID
 ---@param mode integer waste mode
-function process.set_waste(id, mode)
+function process.set_unit_waste(id, mode)
     -- publish so that if it fails then it gets reset
     self.io.units[id].unit_ps.publish("U_WasteMode", mode)
 
@@ -153,7 +164,7 @@ function process.set_waste(id, mode)
     settings.set("WASTE_MODES", waste_mode)
 
     if not settings.save("/coord.settings") then
-        log.error("process.set_waste(): failed to save coordinator settings file")
+        log.error("process.set_unit_waste(): failed to save coordinator settings file")
     end
 end
 
@@ -204,6 +215,24 @@ end
 -- AUTO PROCESS CONTROL --
 --------------------------
 
+-- write auto process control to config file
+local function _write_auto_config()
+    -- attempt to load settings
+    if not settings.load("/coord.settings") then
+        log.warning("process._write_auto_config(): failed to load coordinator settings file")
+    end
+
+    -- save config
+    settings.set("PROCESS", self.config)
+    local saved = settings.save("/coord.settings")
+
+    if not saved then
+        log.warning("process._write_auto_config(): failed to save coordinator settings file")
+    end
+
+    return not not saved
+end
+
 -- stop automatic process control
 function process.stop_auto()
     self.comms.send_fac_command(FAC_COMMAND.STOP)
@@ -216,6 +245,30 @@ function process.start_auto()
     log.debug("PROCESS: START AUTO CTL")
 end
 
+-- set automatic process control waste mode
+---@param product WASTE_PRODUCT waste product for auto control
+function process.set_process_waste(product)
+    self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, product)
+
+    log.debug(util.c("PROCESS: SET WASTE ", product))
+
+    -- update config table and save
+    self.config.waste_product = product
+    _write_auto_config()
+end
+
+-- set automatic process control plutonium fallback
+---@param enabled boolean whether to enable plutonium fallback
+function process.set_pu_fallback(enabled)
+    self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, enabled)
+
+    log.debug(util.c("PROCESS: SET PU FALLBACK ", enabled))
+
+    -- update config table and save
+    self.config.pu_fallback = enabled
+    _write_auto_config()
+end
+
 -- save process control settings
 ---@param mode PROCESS control mode
 ---@param burn_target number burn rate target
@@ -223,29 +276,17 @@ end
 ---@param gen_target number generation rate target
 ---@param limits table unit burn rate limits
 function process.save(mode, burn_target, charge_target, gen_target, limits)
-    -- attempt to load settings
-    if not settings.load("/coord.settings") then
-        log.warning("process.save(): failed to load coordinator settings file")
-    end
+    log.debug("PROCESS: SAVE")
 
-    -- config table
-    self.config = {
-        mode = mode,
-        burn_target = burn_target,
-        charge_target = charge_target,
-        gen_target = gen_target,
-        limits = limits
-    }
+    -- update config table
+    self.config.mode = mode
+    self.config.burn_target = burn_target
+    self.config.charge_target = charge_target
+    self.config.gen_target = gen_target
+    self.config.limits = limits
 
     -- save config
-    settings.set("PROCESS", self.config)
-    local saved = settings.save("/coord.settings")
-
-    if not saved then
-        log.warning("process.save(): failed to save coordinator settings file")
-    end
-
-    self.io.facility.save_cfg_ack(saved)
+    self.io.facility.save_cfg_ack(_write_auto_config())
 end
 
 -- handle a start command acknowledgement
@@ -258,16 +299,33 @@ function process.start_ack_handle(response)
     self.config.charge_target = response[4]
     self.config.gen_target = response[5]
 
-    for i = 1, #response[6] do
+    for i = 1, math.min(#response[6], self.io.facility.num_units) do
         self.config.limits[i] = response[6][i]
+
+        local unit = self.io.units[i]   ---@type ioctl_unit
+        unit.unit_ps.publish("burn_limit", self.config.limits[i])
     end
 
-    self.io.facility.ps.publish("auto_mode", self.config.mode)
-    self.io.facility.ps.publish("burn_target", self.config.burn_target)
-    self.io.facility.ps.publish("charge_target", self.config.charge_target)
-    self.io.facility.ps.publish("gen_target", self.config.gen_target)
+    self.io.facility.ps.publish("process_mode", self.config.mode)
+    self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
+    self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
+    self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
 
     self.io.facility.start_ack(ack)
 end
 
+-- record waste product state after attempting to change it
+---@param response WASTE_PRODUCT supervisor waste product state
+function process.waste_ack_handle(response)
+    self.config.waste_product = response
+    self.io.facility.ps.publish("process_waste_product", response)
+end
+
+-- record plutonium fallback state after attempting to change it
+---@param response boolean supervisor plutonium fallback state
+function process.pu_fb_ack_handle(response)
+    self.config.pu_fallback = response
+    self.io.facility.ps.publish("process_pu_fallback", response)
+end
+
 return process

coordinator/renderer.lua

@@ -5,8 +5,13 @@
 local log        = require("scada-common.log")
 local util       = require("scada-common.util")
 
-local style      = require("coordinator.ui.style")
+local iocontrol  = require("coordinator.iocontrol")
 
+local style      = require("coordinator.ui.style")
+local pgi        = require("coordinator.ui.pgi")
+
+local flow_view  = require("coordinator.ui.layout.flow_view")
+local panel_view = require("coordinator.ui.layout.front_panel")
 local main_view  = require("coordinator.ui.layout.main_view")
 local unit_view  = require("coordinator.ui.layout.unit_view")
 
@@ -21,10 +26,14 @@ local engine = {
     monitors = nil,         ---@type monitors_struct|nil
     dmesg_window = nil,     ---@type table|nil
     ui_ready = false,
+    fp_ready = false,
     ui = {
+        front_panel = nil,  ---@type graphics_element|nil
         main_display = nil, ---@type graphics_element|nil
+        flow_display = nil, ---@type graphics_element|nil
         unit_displays = {}
-    }
+    },
+    disable_flow_view = false
 }
 
 -- init a display to the "default", but set text scale to 0.5
@@ -42,39 +51,44 @@ local function _init_display(monitor)
     end
 end
 
+-- disable the flow view
+---@param disable boolean
+function renderer.legacy_disable_flow_view(disable)
+    engine.disable_flow_view = disable
+end
+
 -- link to the monitor peripherals
 ---@param monitors monitors_struct
 function renderer.set_displays(monitors)
     engine.monitors = monitors
-end
 
--- check if the renderer is configured to use a given monitor peripheral
----@nodiscard
----@param periph table peripheral
----@return boolean is_used
-function renderer.is_monitor_used(periph)
-    if engine.monitors ~= nil then
-        if engine.monitors.primary == periph then
-            return true
-        else
-            for _, monitor in ipairs(engine.monitors.unit_displays) do
-                if monitor == periph then return true end
-            end
-        end
-    end
-
-    return false
+    -- report to front panel as connected
+    iocontrol.fp_monitor_state("main", engine.monitors.primary ~= nil)
+    iocontrol.fp_monitor_state("flow", engine.monitors.flow ~= nil)
+    for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end
 end
 
 -- init all displays in use by the renderer
 function renderer.init_displays()
-    -- init primary monitor
+    -- init primary and flow monitors
     _init_display(engine.monitors.primary)
+    if not engine.disable_flow_view then _init_display(engine.monitors.flow) end
 
     -- init unit displays
     for _, monitor in ipairs(engine.monitors.unit_displays) do
         _init_display(monitor)
     end
+
+    -- init terminal
+    term.setTextColor(colors.white)
+    term.setBackgroundColor(colors.black)
+    term.clear()
+    term.setCursorPos(1, 1)
+
+    -- set overridden colors
+    for i = 1, #style.fp.colors do
+        term.setPaletteColor(style.fp.colors[i].c, style.fp.colors[i].hex)
+    end
 end
 
 -- check main display width
@@ -85,6 +99,14 @@ function renderer.validate_main_display_width()
     return w == 164
 end
 
+-- check flow display width
+---@nodiscard
+---@return boolean width_okay
+function renderer.validate_flow_display_width()
+    local w, _ = engine.monitors.flow.getSize()
+    return w == 164
+end
+
 -- check display sizes
 ---@nodiscard
 ---@return boolean valid all unit display dimensions OK
@@ -109,6 +131,51 @@ function renderer.init_dmesg()
     log.direct_dmesg(engine.dmesg_window)
 end
 
+-- start the coordinator front panel
+function renderer.start_fp()
+    if not engine.fp_ready then
+        -- show front panel view on terminal
+        engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
+        panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
+
+        -- start flasher callback task
+        flasher.run()
+
+        -- report front panel as ready
+        engine.fp_ready = true
+    end
+end
+
+-- close out the front panel
+function renderer.close_fp()
+    if engine.fp_ready then
+        if not engine.ui_ready then
+            -- stop blinking indicators
+            flasher.clear()
+        end
+
+        -- disable PGI
+        pgi.unlink()
+
+        -- hide to stop animation callbacks and clear root UI elements
+        engine.ui.front_panel.hide()
+        engine.ui.front_panel = nil
+        engine.fp_ready = false
+
+        -- restore colors
+        for i = 1, #style.colors do
+            local r, g, b = term.nativePaletteColor(style.colors[i].c)
+            term.setPaletteColor(style.colors[i].c, r, g, b)
+        end
+
+        -- reset terminal
+        term.setTextColor(colors.white)
+        term.setBackgroundColor(colors.black)
+        term.clear()
+        term.setCursorPos(1, 1)
+    end
+end
+
 -- start the coordinator GUI
 function renderer.start_ui()
     if not engine.ui_ready then
@@ -116,13 +183,21 @@ function renderer.start_ui()
         engine.dmesg_window.setVisible(false)
 
         -- show main view on main monitor
-        engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root}
-        main_view(engine.ui.main_display)
+        if engine.monitors.primary ~= nil then
+            engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root}
+            main_view(engine.ui.main_display)
+        end
+
+        -- show flow view on flow monitor
+        if engine.monitors.flow ~= nil then
+            engine.ui.flow_display = DisplayBox{window=engine.monitors.flow,fg_bg=style.root}
+            flow_view(engine.ui.flow_display)
+        end
 
         -- show unit views on unit displays
-        for i = 1, #engine.monitors.unit_displays do
-            engine.ui.unit_displays[i] = DisplayBox{window=engine.monitors.unit_displays[i],fg_bg=style.root}
-            unit_view(engine.ui.unit_displays[i], i)
+        for idx, display in pairs(engine.monitors.unit_displays) do
+            engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
+            unit_view(engine.ui.unit_displays[idx], idx)
         end
 
         -- start flasher callback task
@@ -135,18 +210,22 @@ end
 
 -- close out the UI
 function renderer.close_ui()
-    -- stop blinking indicators
-    flasher.clear()
+    if not engine.fp_ready then
+        -- stop blinking indicators
+        flasher.clear()
+    end
 
     -- delete element trees
     if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end
-    for _, display in ipairs(engine.ui.unit_displays) do display.delete() end
+    if engine.ui.flow_display ~= nil then engine.ui.flow_display.delete() end
+    for _, display in pairs(engine.ui.unit_displays) do display.delete() end
 
     -- report ui as not ready
     engine.ui_ready = false
 
     -- clear root UI elements
     engine.ui.main_display = nil
+    engine.ui.flow_display = nil
     engine.ui.unit_displays = {}
 
     -- clear unit monitors
@@ -157,22 +236,145 @@ function renderer.close_ui()
     engine.dmesg_window.redraw()
 end
 
+-- is the front panel ready?
+---@nodiscard
+---@return boolean ready
+function renderer.fp_ready() return engine.fp_ready end
+
 -- is the UI ready?
 ---@nodiscard
 ---@return boolean ready
 function renderer.ui_ready() return engine.ui_ready end
 
+-- handle a monitor peripheral being disconnected
+---@param device table monitor
+---@return boolean is_used if the monitor is one of the configured monitors
+function renderer.handle_disconnect(device)
+    local is_used = false
+
+    if engine.monitors ~= nil then
+        if engine.monitors.primary == device then
+            if engine.ui.main_display ~= nil then
+                -- delete element tree and clear root UI elements
+                engine.ui.main_display.delete()
+            end
+
+            is_used = true
+            engine.monitors.primary = nil
+            engine.ui.main_display = nil
+
+            iocontrol.fp_monitor_state("main", false)
+        elseif engine.monitors.flow == device then
+            if engine.ui.flow_display ~= nil then
+                -- delete element tree and clear root UI elements
+                engine.ui.flow_display.delete()
+            end
+
+            is_used = true
+            engine.monitors.flow = nil
+            engine.ui.flow_display = nil
+
+            iocontrol.fp_monitor_state("flow", false)
+        else
+            for idx, monitor in pairs(engine.monitors.unit_displays) do
+                if monitor == device then
+                    if engine.ui.unit_displays[idx] ~= nil then
+                        engine.ui.unit_displays[idx].delete()
+                    end
+
+                    is_used = true
+                    engine.monitors.unit_displays[idx] = nil
+                    engine.ui.unit_displays[idx] = nil
+
+                    iocontrol.fp_monitor_state(idx, false)
+                    break
+                end
+            end
+        end
+    end
+
+    return is_used
+end
+
+-- handle a monitor peripheral being reconnected
+---@param name string monitor name
+---@param device table monitor
+---@return boolean is_used if the monitor is one of the configured monitors
+function renderer.handle_reconnect(name, device)
+    local is_used = false
+
+    if engine.monitors ~= nil then
+        if engine.monitors.primary_name == name then
+            is_used = true
+            _init_display(device)
+            engine.monitors.primary = device
+
+            local disp_x, disp_y = engine.monitors.primary.getSize()
+            engine.dmesg_window.reposition(1, 1, disp_x, disp_y, engine.monitors.primary)
+
+            if engine.ui_ready and (engine.ui.main_display == nil) then
+                engine.dmesg_window.setVisible(false)
+
+                engine.ui.main_display = DisplayBox{window=device,fg_bg=style.root}
+                main_view(engine.ui.main_display)
+            else
+                engine.dmesg_window.setVisible(true)
+                engine.dmesg_window.redraw()
+            end
+
+            iocontrol.fp_monitor_state("main", true)
+        elseif engine.monitors.flow_name == name then
+            is_used = true
+            _init_display(device)
+            engine.monitors.flow = device
+
+            if engine.ui_ready and (engine.ui.flow_display == nil) then
+                engine.ui.flow_display = DisplayBox{window=device,fg_bg=style.root}
+                flow_view(engine.ui.flow_display)
+            end
+
+            iocontrol.fp_monitor_state("flow", true)
+        else
+            for idx, monitor in ipairs(engine.monitors.unit_name_map) do
+                if monitor == name then
+                    is_used = true
+                    _init_display(device)
+                    engine.monitors.unit_displays[idx] = device
+
+                    if engine.ui_ready and (engine.ui.unit_displays[idx] == nil) then
+                        engine.ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
+                        unit_view(engine.ui.unit_displays[idx], idx)
+                    end
+
+                    iocontrol.fp_monitor_state(idx, true)
+                    break
+                end
+            end
+        end
+    end
+
+    return is_used
+end
+
+
 -- handle a touch event
 ---@param event mouse_interaction|nil
 function renderer.handle_mouse(event)
-    if engine.ui_ready and event ~= nil then
-        if event.monitor == engine.monitors.primary_name then
-            engine.ui.main_display.handle_mouse(event)
-        else
-            for id, monitor in ipairs(engine.monitors.unit_name_map) do
-                if event.monitor == monitor then
-                    local layout = engine.ui.unit_displays[id]  ---@type graphics_element
-                    layout.handle_mouse(event)
+    if event ~= nil then
+        if engine.fp_ready and event.monitor == "terminal" then
+            engine.ui.front_panel.handle_mouse(event)
+        elseif engine.ui_ready then
+            if event.monitor == engine.monitors.primary_name then
+                engine.ui.main_display.handle_mouse(event)
+            elseif event.monitor == engine.monitors.flow_name then
+                engine.ui.flow_display.handle_mouse(event)
+            else
+                for id, monitor in ipairs(engine.monitors.unit_name_map) do
+                    if event.monitor == monitor then
+                        local layout = engine.ui.unit_displays[id]  ---@type graphics_element
+                        layout.handle_mouse(event)
+                        break
+                    end
                 end
             end
         end

coordinator/session/apisessions.lua

@@ -1,11 +1,12 @@
 
-local log    = require("scada-common.log")
-local mqueue = require("scada-common.mqueue")
-local util   = require("scada-common.util")
+local log       = require("scada-common.log")
+local mqueue    = require("scada-common.mqueue")
+local util      = require("scada-common.util")
 
-local config = require("coordinator.config")
+local config    = require("coordinator.config")
+local iocontrol = require("coordinator.iocontrol")
 
-local pocket = require("coordinator.session.pocket")
+local pocket    = require("coordinator.session.pocket")
 
 local apisessions = {}
 
@@ -112,6 +113,7 @@ function apisessions.establish_session(source_addr, version)
 
     setmetatable(pkt_s, mt)
 
+    iocontrol.fp_pkt_connected(id, version, source_addr)
     log.debug(util.c("[API] established new session: ", pkt_s))
 
     self.next_id = id + 1

coordinator/session/pocket.lua

@@ -1,7 +1,9 @@
-local comms  = require("scada-common.comms")
-local log    = require("scada-common.log")
-local mqueue = require("scada-common.mqueue")
-local util   = require("scada-common.util")
+local comms     = require("scada-common.comms")
+local log       = require("scada-common.log")
+local mqueue    = require("scada-common.mqueue")
+local util      = require("scada-common.util")
+
+local iocontrol = require("coordinator.iocontrol")
 
 local pocket = {}
 
@@ -9,8 +11,6 @@ local PROTOCOL = comms.PROTOCOL
 -- local CAPI_TYPE = comms.CAPI_TYPE
 local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
 
-local println = util.println
-
 -- retry time constants in ms
 -- local INITIAL_WAIT = 1500
 -- local RETRY_PERIOD = 1000
@@ -69,6 +69,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     local function _close()
         self.conn_watchdog.cancel()
         self.connected = false
+        iocontrol.fp_pkt_disconnected(id)
     end
 
     -- send a CAPI packet
@@ -140,6 +141,8 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
 
                     -- log.debug(log_header .. "PKT RTT = " .. self.last_rtt .. "ms")
                     -- log.debug(log_header .. "PKT TT  = " .. (srv_now - api_send) .. "ms")
+
+                    iocontrol.fp_pkt_rtt(id, self.last_rtt)
                 else
                     log.debug(log_header .. "SCADA keep alive packet length mismatch")
                 end
@@ -172,7 +175,6 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     function public.close()
         _close()
         _send_mgmt(SCADA_MGMT_TYPE.CLOSE, {})
-        println("connection to pocket session " .. id .. " closed by server")
         log.info(log_header .. "session closed by server")
     end
 
@@ -211,7 +213,6 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
 
             -- exit if connection was closed
             if not self.connected then
-                println("connection to pocket session " .. id .. " closed by remote host")
                 log.info(log_header .. "session closed by remote host")
                 return self.connected
             end

coordinator/sounder.lua

@@ -2,269 +2,25 @@
 -- Alarm Sounder
 --
 
+local audio = require("scada-common.audio")
 local log   = require("scada-common.log")
-local types = require("scada-common.types")
-local util  = require("scada-common.util")
-
-local ALARM = types.ALARM
-local ALARM_STATE = types.ALARM_STATE
 
 ---@class sounder
 local sounder = {}
 
--- note: max samples = 0x20000 (128 * 1024 samples)
-
-local _2_PI        = 2 * math.pi    -- 2 whole pies, hope you're hungry
-local _DRATE       = 48000          -- 48kHz audio
-local _MAX_VAL     = 127 / 2        -- max signed integer in this 8-bit audio
-local _05s_SAMPLES = 24000          -- half a second worth of samples
-
-local test_alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
-
 local alarm_ctl = {
     speaker = nil,
     volume = 0.5,
-    playing = false,
-    num_active = 0,
-    next_block = 1,
-    -- split audio up into 0.5s samples so specific components can be ended quicker
-    quad_buffer = { {}, {}, {}, {} }
+    stream = audio.new_stream()
 }
 
--- sounds modeled after https://www.e2s.com/references-and-guidelines/listen-and-download-alarm-tones
-
-local T_340Hz_Int_2Hz = 1
-local T_544Hz_440Hz_Alt = 2
-local T_660Hz_Int_125ms = 3
-local T_745Hz_Int_1Hz = 4
-local T_800Hz_Int = 5
-local T_800Hz_1000Hz_Alt = 6
-local T_1000Hz_Int = 7
-local T_1800Hz_Int_4Hz = 8
-
-local TONES = {
-    { active = false, component = { {}, {}, {}, {} } }, -- 340Hz @ 2Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 544Hz 100mS / 440Hz 400mS Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 660Hz @ 125ms On 125ms Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 745Hz @ 1Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 800Hz @ 0.25s On 1.75s Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 800/1000Hz @ 0.25s Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 1KHz 1s on, 1s off Intermittent
-    { active = false, component = { {}, {}, {}, {} } }  -- 1.8KHz @ 4Hz Intermittent
-}
-
--- calculate how many samples are in the given number of milliseconds
----@nodiscard
----@param ms integer milliseconds
----@return integer samples
-local function ms_to_samples(ms) return math.floor(ms * 48) end
-
---#region Tone Generation (the Maths)
-
--- 340Hz @ 2Hz Intermittent
-local function gen_tone_1()
-    local t, dt = 0, _2_PI * 340 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[1].component[1][i] = val
-        TONES[1].component[3][i] = val
-        TONES[1].component[2][i] = 0
-        TONES[1].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 544Hz 100mS / 440Hz 400mS Alternating
-local function gen_tone_2()
-    local t1, dt1 = 0, _2_PI * 544 / _DRATE
-    local t2, dt2 = 0, _2_PI * 440 / _DRATE
-    local alternate_at = ms_to_samples(100)
-
-    for i = 1, _05s_SAMPLES do
-        local value
-
-        if i <= alternate_at then
-            value = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            value = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[2].component[1][i] = value
-        TONES[2].component[2][i] = value
-        TONES[2].component[3][i] = value
-        TONES[2].component[4][i] = value
-    end
-end
-
--- 660Hz @ 125ms On 125ms Off
-local function gen_tone_3()
-    local elapsed_samples = 0
-    local alternate_after = ms_to_samples(125)
-    local alternate_at = alternate_after
-    local mode = true
-
-    local t, dt = 0, _2_PI * 660 / _DRATE
-
-    for set = 1, 4 do
-        for i = 1, _05s_SAMPLES do
-            if mode then
-                local val = math.floor(math.sin(t) * _MAX_VAL)
-                TONES[3].component[set][i] = val
-                t = (t + dt) % _2_PI
-            else
-                t = 0
-                TONES[3].component[set][i] = 0
-            end
-
-            if elapsed_samples == alternate_at then
-                mode = not mode
-                alternate_at = elapsed_samples + alternate_after
-            end
-
-            elapsed_samples = elapsed_samples + 1
-        end
-    end
-end
-
--- 745Hz @ 1Hz Intermittent
-local function gen_tone_4()
-    local t, dt = 0, _2_PI * 745 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[4].component[1][i] = val
-        TONES[4].component[3][i] = val
-        TONES[4].component[2][i] = 0
-        TONES[4].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 800Hz @ 0.25s On 1.75s Off
-local function gen_tone_5()
-    local t, dt = 0, _2_PI * 800 / _DRATE
-    local stop_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-
-        if i > stop_at then
-            TONES[5].component[1][i] = val
-        else
-            TONES[5].component[1][i] = 0
-        end
-
-        TONES[5].component[2][i] = 0
-        TONES[5].component[3][i] = 0
-        TONES[5].component[4][i] = 0
-
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1000/800Hz @ 0.25s Alternating
-local function gen_tone_6()
-    local t1, dt1 = 0, _2_PI * 1000 / _DRATE
-    local t2, dt2 = 0, _2_PI * 800 / _DRATE
-
-    local alternate_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val
-        if i <= alternate_at then
-            val = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            val = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[6].component[1][i] = val
-        TONES[6].component[2][i] = val
-        TONES[6].component[3][i] = val
-        TONES[6].component[4][i] = val
-    end
-end
-
--- 1KHz 1s on, 1s off Intermittent
-local function gen_tone_7()
-    local t, dt = 0, _2_PI * 1000 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[7].component[1][i] = val
-        TONES[7].component[2][i] = val
-        TONES[7].component[3][i] = 0
-        TONES[7].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1800Hz @ 4Hz Intermittent
-local function gen_tone_8()
-    local t, dt = 0, _2_PI * 1800 / _DRATE
-
-    local off_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = 0
-
-        if i <= off_at then
-            val = math.floor(math.sin(t) * _MAX_VAL)
-            t = (t + dt) % _2_PI
-        end
-
-        TONES[8].component[1][i] = val
-        TONES[8].component[2][i] = val
-        TONES[8].component[3][i] = val
-        TONES[8].component[4][i] = val
-    end
-end
-
---#endregion
-
--- hard audio limiter
----@nodiscard
----@param output number output level
----@return number limited -128.0 to 127.0
-local function limit(output)
-    return math.max(-128, math.min(127, output))
-end
-
--- zero the alarm audio buffer
-local function zero()
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do alarm_ctl.quad_buffer[i][s] = 0 end
-    end
-end
-
--- add an alarm to the output buffer
----@param alarm_idx integer tone ID
-local function add(alarm_idx)
-    alarm_ctl.num_active = alarm_ctl.num_active + 1
-    TONES[alarm_idx].active = true
-
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do
-            alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] + TONES[alarm_idx].component[i][s])
-        end
-    end
-end
-
 -- start audio or continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 local function play()
     if not alarm_ctl.playing then
         alarm_ctl.playing = true
-        alarm_ctl.next_block = 1
-
         return sounder.continue()
-    else
-        return true
-    end
+    else return true end
 end
 
 -- initialize the annunciator alarm system
@@ -273,23 +29,10 @@ end
 function sounder.init(speaker, volume)
     alarm_ctl.speaker = speaker
     alarm_ctl.speaker.stop()
-
     alarm_ctl.volume = volume
-    alarm_ctl.playing = false
-    alarm_ctl.num_active = 0
-    alarm_ctl.next_block = 1
+    alarm_ctl.stream.stop()
 
-    zero()
-
-    -- generate tones
-    gen_tone_1()
-    gen_tone_2()
-    gen_tone_3()
-    gen_tone_4()
-    gen_tone_5()
-    gen_tone_6()
-    gen_tone_7()
-    gen_tone_8()
+    audio.generate_tones()
 end
 
 -- reconnect the speaker peripheral
@@ -297,173 +40,40 @@ end
 function sounder.reconnect(speaker)
     alarm_ctl.speaker = speaker
     alarm_ctl.playing = false
-    alarm_ctl.next_block = 1
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
+    alarm_ctl.stream.stop()
 end
 
--- check alarm state to enable/disable alarms
----@param units table|nil unit list or nil to use test mode
-function sounder.eval(units)
-    local changed = false
-    local any_active = false
-    local new_states = { false, false, false, false, false, false, false, false }
-    local alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
+-- set alarm tones
+---@param states table alarm tone commands from supervisor
+function sounder.set(states)
+    -- set tone states
+    for id = 1, #states do alarm_ctl.stream.set_active(id, states[id]) end
 
-    if units ~= nil then
-        -- check all alarms for all units
-        for i = 1, #units do
-            local unit = units[i]   ---@type ioctl_unit
-            for id = 1, #unit.alarms do
-                alarms[id] = alarms[id] or (unit.alarms[id] == ALARM_STATE.TRIPPED)
-            end
-        end
-    else
-        alarms = test_alarms
-    end
-
-    -- containment breach is worst case CRITICAL alarm, this takes priority
-    if alarms[ALARM.ContainmentBreach] then
-        new_states[T_1800Hz_Int_4Hz] = true
-    else
-        -- critical damage is highest priority CRITICAL level alarm
-        if alarms[ALARM.CriticalDamage] then
-            new_states[T_660Hz_Int_125ms] = true
-        else
-            -- EMERGENCY level alarms + URGENT over temp
-            if alarms[ALARM.ReactorDamage] or alarms[ALARM.ReactorOverTemp] or alarms[ALARM.ReactorWasteLeak] then
-                new_states[T_544Hz_440Hz_Alt] = true
-            -- URGENT level turbine trip
-            elseif alarms[ALARM.TurbineTrip] then
-                new_states[T_745Hz_Int_1Hz] = true
-            -- URGENT level reactor lost
-            elseif alarms[ALARM.ReactorLost] then
-                new_states[T_340Hz_Int_2Hz] = true
-            -- TIMELY level alarms
-            elseif alarms[ALARM.ReactorHighTemp] or alarms[ALARM.ReactorHighWaste] or alarms[ALARM.RCSTransient] then
-                new_states[T_800Hz_Int] = true
-            end
-        end
-
-        -- check RPS transient URGENT level alarm
-        if alarms[ALARM.RPSTransient] then
-            new_states[T_1000Hz_Int] = true
-            -- disable really painful audio combination
-            new_states[T_340Hz_Int_2Hz] = false
-        end
-    end
-
-    -- radiation is a big concern, always play this CRITICAL level alarm if active
-    if alarms[ALARM.ContainmentRadiation] then
-        new_states[T_800Hz_1000Hz_Alt] = true
-        -- we are going to disable the RPS trip alarm audio due to conflict, and if it was enabled
-        -- then we can re-enable the reactor lost alarm audio since it doesn't painfully combine with this one
-        if new_states[T_1000Hz_Int] and alarms[ALARM.ReactorLost] then new_states[T_340Hz_Int_2Hz] = true end
-        -- it sounds *really* bad if this is in conjunction with these other tones, so disable them
-        new_states[T_745Hz_Int_1Hz] = false
-        new_states[T_800Hz_Int] = false
-        new_states[T_1000Hz_Int] = false
-    end
-
-    -- check if any changed, check if any active, update active flags
-    for id = 1, #TONES do
-        if new_states[id] ~= TONES[id].active then
-            TONES[id].active = new_states[id]
-            changed = true
-        end
-
-        if TONES[id].active then any_active = true end
-    end
-
-    -- zero and re-add tones if changed
-    if changed then
-        zero()
-
-        for id = 1, #TONES do
-            if TONES[id].active then add(id) end
-        end
-    end
-
-    if any_active then play() else sounder.stop() end
+    -- re-compute output if needed, then play audio if available
+    if alarm_ctl.stream.is_recompute_needed() then alarm_ctl.stream.compute_buffer() end
+    if alarm_ctl.stream.has_next_block() then play() else sounder.stop() end
 end
 
 -- stop all audio and clear output buffer
 function sounder.stop()
     alarm_ctl.playing = false
     alarm_ctl.speaker.stop()
-    alarm_ctl.next_block = 1
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
-    zero()
+    alarm_ctl.stream.stop()
 end
 
 -- continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 function sounder.continue()
+    local success = false
+
     if alarm_ctl.playing then
-        if alarm_ctl.speaker ~= nil and #alarm_ctl.quad_buffer[alarm_ctl.next_block] > 0 then
-            local success = alarm_ctl.speaker.playAudio(alarm_ctl.quad_buffer[alarm_ctl.next_block], alarm_ctl.volume)
-
-            alarm_ctl.next_block = alarm_ctl.next_block + 1
-            if alarm_ctl.next_block > 4 then alarm_ctl.next_block = 1 end
-
-            if not success then
-                log.debug("SOUNDER: error playing audio")
-            end
-
-            return success
-        else
-            return false
-        end
-    else
-        return false
-    end
-end
-
---#region Test Functions
-
-function sounder.test_1() add(1) play() end -- play tone T_340Hz_Int_2Hz
-function sounder.test_2() add(2) play() end -- play tone T_544Hz_440Hz_Alt
-function sounder.test_3() add(3) play() end -- play tone T_660Hz_Int_125ms
-function sounder.test_4() add(4) play() end -- play tone T_745Hz_Int_1Hz
-function sounder.test_5() add(5) play() end -- play tone T_800Hz_Int
-function sounder.test_6() add(6) play() end -- play tone T_800Hz_1000Hz_Alt
-function sounder.test_7() add(7) play() end -- play tone T_1000Hz_Int
-function sounder.test_8() add(8) play() end -- play tone T_1800Hz_Int_4Hz
-
-function sounder.test_breach(active)    test_alarms[ALARM.ContainmentBreach]    = active end    ---@param active boolean
-function sounder.test_rad(active)       test_alarms[ALARM.ContainmentRadiation] = active end    ---@param active boolean
-function sounder.test_lost(active)      test_alarms[ALARM.ReactorLost]          = active end    ---@param active boolean
-function sounder.test_crit(active)      test_alarms[ALARM.CriticalDamage]       = active end    ---@param active boolean
-function sounder.test_dmg(active)       test_alarms[ALARM.ReactorDamage]        = active end    ---@param active boolean
-function sounder.test_overtemp(active)  test_alarms[ALARM.ReactorOverTemp]      = active end    ---@param active boolean
-function sounder.test_hightemp(active)  test_alarms[ALARM.ReactorHighTemp]      = active end    ---@param active boolean
-function sounder.test_wasteleak(active) test_alarms[ALARM.ReactorWasteLeak]     = active end    ---@param active boolean
-function sounder.test_highwaste(active) test_alarms[ALARM.ReactorHighWaste]     = active end    ---@param active boolean
-function sounder.test_rps(active)       test_alarms[ALARM.RPSTransient]         = active end    ---@param active boolean
-function sounder.test_rcs(active)       test_alarms[ALARM.RCSTransient]         = active end    ---@param active boolean
-function sounder.test_turbinet(active)  test_alarms[ALARM.TurbineTrip]          = active end    ---@param active boolean
-
--- power rescaling limiter test
-function sounder.test_power_scale()
-    local start = util.time_ms()
-
-    zero()
-
-    for id = 1, #TONES do
-        if TONES[id].active then
-            for i = 1, 4 do
-                for s = 1, _05s_SAMPLES do
-                    alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] +
-                        (TONES[id].component[i][s] / math.sqrt(alarm_ctl.num_active)))
-                end
-            end
+        if alarm_ctl.speaker ~= nil and alarm_ctl.stream.has_next_block() then
+            success = alarm_ctl.speaker.playAudio(alarm_ctl.stream.get_next_block(), alarm_ctl.volume)
+            if not success then log.error("SOUNDER: error playing audio") end
         end
     end
 
-    log.debug("SOUNDER: power rescale test took " .. (util.time_ms() - start) .. "ms")
+    return success
 end
 
---#endregion
-
 return sounder

coordinator/startup.lua

@@ -4,6 +4,7 @@
 
 require("/initenv").init_env()
 
+local comms       = require("scada-common.comms")
 local crash       = require("scada-common.crash")
 local log         = require("scada-common.log")
 local network     = require("scada-common.network")
@@ -21,7 +22,7 @@ local sounder     = require("coordinator.sounder")
 
 local apisessions = require("coordinator.session.apisessions")
 
-local COORDINATOR_VERSION = "v0.17.1"
+local COORDINATOR_VERSION = "v1.0.1"
 
 local println = util.println
 local println_ts = util.println_ts
@@ -30,7 +31,6 @@ local log_graphics = coordinator.log_graphics
 local log_sys = coordinator.log_sys
 local log_boot = coordinator.log_boot
 local log_comms = coordinator.log_comms
-local log_comms_connecting = coordinator.log_comms_connecting
 local log_crypto = coordinator.log_crypto
 
 ----------------------------------------
@@ -80,8 +80,11 @@ local function main()
     -- mount connected devices
     ppm.mount_all()
 
+    -- report versions/init fp PSIL
+    iocontrol.init_fp(COORDINATOR_VERSION, comms.version)
+
     -- setup monitors
-    local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS)
+    local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS, config.DISABLE_FLOW_VIEW == true)
     if not configured or monitors == nil then
         println("startup> monitor setup failed")
         log.fatal("monitor configuration failed")
@@ -89,6 +92,7 @@ local function main()
     end
 
     -- init renderer
+    renderer.legacy_disable_flow_view(config.DISABLE_FLOW_VIEW == true)
     renderer.set_displays(monitors)
     renderer.init_displays()
 
@@ -96,6 +100,10 @@ local function main()
         println("startup> main display must be 8 blocks wide")
         log.fatal("main display not wide enough")
         return
+    elseif (config.DISABLE_FLOW_VIEW ~= true) and not renderer.validate_flow_display_width() then
+        println("startup> flow display must be 8 blocks wide")
+        log.fatal("flow display not wide enough")
+        return
     elseif not renderer.validate_unit_display_sizes() then
         println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks")
         log.fatal("unit display dimensions incorrect")
@@ -127,6 +135,7 @@ local function main()
         sounder.init(speaker, config.SOUNDER_VOLUME)
         log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms")
         log_sys("annunciator alarm configured")
+        iocontrol.fp_has_speaker(true)
     end
 
     ----------------------------------------
@@ -148,6 +157,7 @@ local function main()
         return
     else
         log_comms("wireless modem connected")
+        iocontrol.fp_has_modem(true)
     end
 
     -- create connection watchdog
@@ -157,8 +167,8 @@ local function main()
 
     -- create network interface then setup comms
     local nic = network.nic(modem)
-    local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.CRD_CHANNEL, config.SVR_CHANNEL,
-                                            config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
+    local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.NUM_UNITS, config.CRD_CHANNEL,
+                                            config.SVR_CHANNEL, config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
     log.debug("startup> comms init")
     log_comms("comms initialized")
 
@@ -167,76 +177,54 @@ local function main()
     local loop_clock = util.new_clock(MAIN_CLOCK)
 
     ----------------------------------------
-    -- connect to the supervisor
+    -- start front panel & UI start function
     ----------------------------------------
 
-    -- attempt to connect to the supervisor or exit
-    local function init_connect_sv()
-        local tick_waiting, task_done = log_comms_connecting("attempting to connect to configured supervisor on channel " .. config.SVR_CHANNEL)
+    log_graphics("starting front panel UI...")
 
-        -- attempt to establish a connection with the supervisory computer
-        if not coord_comms.sv_connect(60, tick_waiting, task_done) then
-            log_sys("supervisor connection failed, shutting down...")
-            log.fatal("failed to connect to supervisor")
-            return false
-        end
-
-        return true
-    end
-
-    if not init_connect_sv() then
-        println("startup> failed to connect to supervisor")
-        log_sys("system shutdown")
+    local fp_ok, fp_message = pcall(renderer.start_fp)
+    if not fp_ok then
+        renderer.close_fp()
+        log_graphics(util.c("front panel UI error: ", fp_message))
+        println_ts("front panel UI creation failed")
+        log.fatal(util.c("front panel GUI render failed with error ", fp_message))
         return
-    else
-        log_sys("supervisor connected, proceeding to UI start")
-    end
+    else log_graphics("front panel ready") end
 
-    ----------------------------------------
-    -- start the UI
-    ----------------------------------------
-
-    -- start up the UI
+    -- start up the main UI
     ---@return boolean ui_ok started ok
-    local function init_start_ui()
-        log_graphics("starting UI...")
+    local function start_main_ui()
+        log_graphics("starting main UI...")
 
         local draw_start = util.time_ms()
 
-        local ui_ok, message = pcall(renderer.start_ui)
+        local ui_ok, ui_message = pcall(renderer.start_ui)
         if not ui_ok then
             renderer.close_ui()
-            log_graphics(util.c("UI crashed: ", message))
-            println_ts("UI crashed")
-            log.fatal(util.c("GUI crashed with error ", message))
+            log_graphics(util.c("main UI error: ", ui_message))
+            log.fatal(util.c("main GUI render failed with error ", ui_message))
         else
-            log_graphics("first UI draw took " .. (util.time_ms() - draw_start) .. "ms")
-
-            -- start clock
-            loop_clock.start()
+            log_graphics("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
         end
 
         return ui_ok
     end
 
-    local ui_ok = init_start_ui()
-
     ----------------------------------------
     -- main event loop
     ----------------------------------------
 
+    local link_failed = false
+    local ui_ok = true
     local date_format = util.trinary(config.TIME_24_HOUR, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y")
 
-    if ui_ok then
-        -- start connection watchdog
-        conn_watchdog.feed()
-        log.debug("startup> conn watchdog started")
+    -- start clock
+    loop_clock.start()
 
-        log_sys("system started successfully")
-    end
+    log_sys("system started successfully")
 
     -- main event loop
-    while ui_ok do
+    while true do
         local event, param1, param2, param3, param4, param5 = util.pull_event()
 
         -- handle event
@@ -250,31 +238,32 @@ local function main()
                     if nic.is_modem(device) then
                         nic.disconnect()
                         log_sys("comms modem disconnected")
-                        println_ts("wireless modem disconnected!")
 
-                        -- close out UI
-                        renderer.close_ui()
+                        local other_modem = ppm.get_wireless_modem()
+                        if other_modem then
+                            log_sys("found another wireless modem, using it for comms")
+                            nic.connect(other_modem)
+                        else
+                            -- close out main UI
+                            renderer.close_ui()
 
-                        -- alert user to status
-                        log_sys("awaiting comms modem reconnect...")
+                            -- alert user to status
+                            log_sys("awaiting comms modem reconnect...")
+
+                            iocontrol.fp_has_modem(false)
+                        end
                     else
                         log_sys("non-comms modem disconnected")
                     end
                 elseif type == "monitor" then
-                    if renderer.is_monitor_used(device) then
-                        ---@todo will be handled properly in #249
-                        -- "halt and catch fire" style handling
-                        local msg = "lost a configured monitor, system will now exit"
-                        println_ts(msg)
-                        log_sys(msg)
-                        break
+                    if renderer.handle_disconnect(device) then
+                        log_sys("lost a configured monitor")
                     else
-                        log_sys("lost unused monitor, ignoring")
+                        log_sys("lost an unused monitor")
                     end
                 elseif type == "speaker" then
-                    local msg = "lost alarm sounder speaker"
-                    println_ts(msg)
-                    log_sys(msg)
+                    log_sys("lost alarm sounder speaker")
+                    iocontrol.fp_has_speaker(false)
                 end
             end
         elseif event == "peripheral" then
@@ -282,33 +271,50 @@ local function main()
 
             if type ~= nil and device ~= nil then
                 if type == "modem" then
-                    if device.isWireless() then
+                    if device.isWireless() and not nic.is_connected() then
                         -- reconnected modem
-                        nic.connect(device)
-
                         log_sys("comms modem reconnected")
-                        println_ts("wireless modem reconnected.")
-
-                        -- re-init system
-                        if not init_connect_sv() then break end
-                        ui_ok = init_start_ui()
+                        nic.connect(device)
+                        iocontrol.fp_has_modem(true)
+                    elseif device.isWireless() then
+                        log.info("unused wireless modem reconnected")
                     else
                         log_sys("wired modem reconnected")
                     end
-                -- elseif type == "monitor" then
-                    ---@todo will be handled properly in #249
-                    -- not supported, system will exit on loss of in-use monitors
+                elseif type == "monitor" then
+                    if renderer.handle_reconnect(param1, device) then
+                        log_sys(util.c("configured monitor ", param1, " reconnected"))
+                    else
+                        log_sys(util.c("unused monitor ", param1, " connected"))
+                    end
                 elseif type == "speaker" then
-                    local msg = "alarm sounder speaker reconnected"
-                    println_ts(msg)
-                    log_sys(msg)
+                    log_sys("alarm sounder speaker reconnected")
                     sounder.reconnect(device)
+                    iocontrol.fp_has_speaker(true)
                 end
             end
         elseif event == "timer" then
             if loop_clock.is_clock(param1) then
                 -- main loop tick
 
+                -- toggle heartbeat
+                iocontrol.heartbeat()
+
+                -- maintain connection
+                if nic.is_connected() then
+                    local ok, start_ui = coord_comms.try_connect()
+                    if not ok then
+                        link_failed = true
+                        log_sys("supervisor connection failed, shutting down...")
+                        log.fatal("failed to connect to supervisor")
+                        break
+                    elseif start_ui then
+                        log_sys("supervisor connected, proceeding to main UI start")
+                        ui_ok = start_main_ui()
+                        if not ui_ok then break end
+                    end
+                end
+
                 -- iterate sessions
                 apisessions.iterate_all()
 
@@ -316,25 +322,19 @@ local function main()
                 apisessions.free_all_closed()
 
                 -- update date and time string for main display
-                iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
+                if coord_comms.is_linked() then
+                    iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
+                end
 
                 loop_clock.start()
             elseif conn_watchdog.is_timer(param1) then
                 -- supervisor watchdog timeout
-                local msg = "supervisor server timeout"
-                log_comms(msg)
-                println_ts(msg)
+                log_comms("supervisor server timeout")
 
-                -- close connection, UI, and stop sounder
+                -- close connection, main UI, and stop sounder
                 coord_comms.close()
                 renderer.close_ui()
                 sounder.stop()
-
-                if nic.connected() then
-                    -- try to re-connect to the supervisor
-                    if not init_connect_sv() then break end
-                    ui_ok = init_start_ui()
-                end
             else
                 -- a non-clock/main watchdog timer event
 
@@ -347,25 +347,19 @@ local function main()
         elseif event == "modem_message" then
             -- got a packet
             local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
-            coord_comms.handle_packet(packet)
 
-            -- check if it was a disconnect
-            if not coord_comms.is_linked() then
+            -- handle then check if it was a disconnect
+            if coord_comms.handle_packet(packet) then
                 log_comms("supervisor closed connection")
 
-                -- close connection, UI, and stop sounder
+                -- close connection, main UI, and stop sounder
                 coord_comms.close()
                 renderer.close_ui()
                 sounder.stop()
-
-                if nic.connected() then
-                    -- try to re-connect to the supervisor
-                    if not init_connect_sv() then break end
-                    ui_ok = init_start_ui()
-                end
             end
-        elseif event == "monitor_touch" then
-            -- handle a monitor touch event
+        elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
+               event == "mouse_drag" or event == "mouse_scroll" then
+            -- handle a mouse event
             renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
         elseif event == "speaker_audio_empty" then
             -- handle speaker buffer emptied
@@ -374,10 +368,17 @@ local function main()
 
         -- check for termination request
         if event == "terminate" or ppm.should_terminate() then
-            println_ts("terminate requested, closing connections...")
-            log_comms("terminate requested, closing supervisor connection...")
+            -- handle supervisor connection
+            coord_comms.try_connect(true)
+
+            if coord_comms.is_linked() then
+                log_comms("terminate requested, closing supervisor connection...")
+            else link_failed = true end
+
             coord_comms.close()
             log_comms("supervisor connection closed")
+
+            -- handle API sessions
             log_comms("closing api sessions...")
             apisessions.close_all()
             log_comms("api sessions closed")
@@ -386,15 +387,20 @@ local function main()
     end
 
     renderer.close_ui()
+    renderer.close_fp()
     sounder.stop()
     log_sys("system shutdown")
 
+    if link_failed then println_ts("failed to connect to supervisor") end
+    if not ui_ok then println_ts("main UI creation failed") end
+
     println_ts("exited")
     log.info("exited")
 end
 
 if not xpcall(main, crash.handler) then
     pcall(renderer.close_ui)
+    pcall(renderer.close_fp)
     pcall(sounder.stop)
     crash.exit()
 else

coordinator/ui/components/imatrix.lua

@@ -83,9 +83,7 @@ local function new_view(root, x, y, data, ps, id)
     local function calc_saturation(val)
         if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then
             return val / data.build.transfer_cap
-        else
-            return 0
-        end
+        else return 0 end
     end
 
     charge.register(ps, "energy_fill", charge.update)

coordinator/ui/components/pkt_entry.lua

@@ -0,0 +1,48 @@
+--
+-- Pocket Connection Entry
+--
+
+local iocontrol     = require("coordinator.iocontrol")
+
+local core          = require("graphics.core")
+
+local Div           = require("graphics.elements.div")
+local TextBox       = require("graphics.elements.textbox")
+
+local DataIndicator = require("graphics.elements.indicators.data")
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local cpair = core.cpair
+
+-- create a pocket list entry
+---@param parent graphics_element parent
+---@param id integer PKT session ID
+local function init(parent, id)
+    local ps = iocontrol.get_db().fp.ps
+
+    -- root div
+    local root = Div{parent=parent,x=2,y=2,height=4,width=parent.get_width()-2,hidden=true}
+    local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=cpair(colors.black,colors.white)}
+
+    local ps_prefix = "pkt_" .. id .. "_"
+
+    TextBox{parent=entry,x=1,y=1,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
+    local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=TEXT_ALIGN.CENTER,width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray),nav_active=cpair(colors.gray,colors.black)}
+    TextBox{parent=entry,x=1,y=3,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
+    pkt_addr.register(ps, ps_prefix .. "addr", pkt_addr.set_value)
+
+    TextBox{parent=entry,x=10,y=2,text="FW:",width=3,height=1}
+    local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    pkt_fw_v.register(ps, ps_prefix .. "fw", pkt_fw_v.set_value)
+
+    TextBox{parent=entry,x=35,y=2,text="RTT:",width=4,height=1}
+    local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=cpair(colors.lightGray,colors.white)}
+    TextBox{parent=entry,x=46,y=2,text="ms",width=4,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    pkt_rtt.register(ps, ps_prefix .. "rtt", pkt_rtt.update)
+    pkt_rtt.register(ps, ps_prefix .. "rtt_color", pkt_rtt.recolor)
+
+    return root
+end
+
+return init

coordinator/ui/components/process_ctl.lua

@@ -15,8 +15,10 @@ local TextBox           = require("graphics.elements.textbox")
 local DataIndicator     = require("graphics.elements.indicators.data")
 local IndicatorLight    = require("graphics.elements.indicators.light")
 local RadIndicator      = require("graphics.elements.indicators.rad")
+local StateIndicator    = require("graphics.elements.indicators.state")
 local TriIndicatorLight = require("graphics.elements.indicators.trilight")
 
+local Checkbox          = require("graphics.elements.controls.checkbox")
 local HazardButton      = require("graphics.elements.controls.hazard_button")
 local RadioButton       = require("graphics.elements.controls.radio_button")
 local SpinboxNumeric    = require("graphics.elements.controls.spinbox_numeric")
@@ -26,6 +28,16 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 local cpair = core.cpair
 local border = core.border
 
+local bw_fg_bg = style.bw_fg_bg
+local lu_cpair = style.lu_colors
+local hzd_fg_bg  = style.hzd_fg_bg
+local dis_colors = style.dis_colors
+
+local ind_grn = style.ind_grn
+local ind_yel = style.ind_yel
+local ind_red = style.ind_red
+local ind_wht = style.ind_wht
+
 local period = core.flasher.PERIOD
 
 -- new process control view
@@ -38,12 +50,7 @@ local function new_view(root, x, y)
     local facility = iocontrol.get_db().facility
     local units = iocontrol.get_db().units
 
-    local bw_fg_bg   = cpair(colors.black, colors.white)
-    local hzd_fg_bg  = cpair(colors.white, colors.gray)
-    local lu_cpair   = cpair(colors.gray, colors.gray)
-    local dis_colors = cpair(colors.white, colors.lightGray)
-
-    local main = Div{parent=root,width=104,height=24,x=x,y=y}
+    local main = Div{parent=root,width=128,height=24,x=x,y=y}
 
     local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
     local ack_a = HazardButton{parent=main,x=16,y=1,text="ACK \x13",accent=colors.orange,dis_colors=dis_colors,callback=process.fac_ack_alarms,fg_bg=hzd_fg_bg}
@@ -51,20 +58,22 @@ local function new_view(root, x, y)
     facility.scram_ack = scram.on_response
     facility.ack_alarms_ack = ack_a.on_response
 
-    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=cpair(colors.green,colors.red)}
-    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=cpair(colors.green,colors.gray)}
+    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=ind_grn}
     local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
+    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=ind_grn}
+    local sps     = IndicatorLight{parent=main,label="SPS Connected",colors=ind_grn}
 
     all_ok.register(facility.ps, "all_sys_ok", all_ok.update)
-    ind_mat.register(facility.induction_ps_tbl[1], "computed_status", function (status) ind_mat.update(status > 1) end)
     rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update)
+    ind_mat.register(facility.induction_ps_tbl[1], "computed_status", function (status) ind_mat.update(status > 1) end)
+    sps.register(facility.sps_ps_tbl[1], "computed_status", function (status) sps.update(status > 1) end)
 
     main.line_break()
 
-    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=cpair(colors.green,colors.red)}
-    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=cpair(colors.green,colors.gray)}
-    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=cpair(colors.yellow,colors.gray)}
+    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=ind_grn}
+    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=ind_grn}
+    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=ind_wht,flash=true,period=period.BLINK_250_MS}
+    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=ind_yel}
 
     auto_ready.register(facility.ps, "auto_ready", auto_ready.update)
     auto_act.register(facility.ps, "auto_active", auto_act.update)
@@ -73,12 +82,12 @@ local function new_view(root, x, y)
 
     main.line_break()
 
-    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=ind_red,flash=true,period=period.BLINK_500_MS}
+    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
 
     auto_scram.register(facility.ps, "auto_scram", auto_scram.update)
     matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update)
@@ -99,7 +108,7 @@ local function new_view(root, x, y)
     -- process control --
     ---------------------
 
-    local proc = Div{parent=main,width=78,height=24,x=27,y=1}
+    local proc = Div{parent=main,width=103,height=24,x=27,y=1}
 
     -----------------------------
     -- process control targets --
@@ -148,46 +157,77 @@ local function new_view(root, x, y)
 
     local rate_limits = {}
 
-    for i = 1, facility.num_units do
-        local unit = units[i]   ---@type ioctl_unit
+    for i = 1, 4 do
+        local unit
+        local tag_fg_bg = cpair(colors.gray,colors.white)
+        local lim_fg_bg = cpair(colors.lightGray,colors.white)
+        local ctl_fg    = colors.lightGray
+        local cur_fg_bg = cpair(colors.lightGray,colors.white)
+        local cur_lu    = colors.lightGray
+
+        if i <= facility.num_units then
+            unit = units[i]   ---@type ioctl_unit
+            tag_fg_bg = cpair(colors.black,colors.lightBlue)
+            lim_fg_bg = bw_fg_bg
+            ctl_fg    = colors.gray
+            cur_fg_bg = cpair(colors.black,colors.brown)
+            cur_lu    = colors.black
+        end
 
         local _y = ((i - 1) * 5) + 1
 
-        local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)}
+        local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2}
 
-        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(colors.gray,colors.white)}
-        rate_limits[i] = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
+        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(ctl_fg,colors.white)}
+        local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=lim_fg_bg}
         TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1}
 
-        rate_limits[i].register(unit.unit_ps, "max_burn", rate_limits[i].set_max)
-        rate_limits[i].register(unit.unit_ps, "burn_limit", rate_limits[i].set_value)
+        local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(cur_lu,cur_lu),width=14,fg_bg=cur_fg_bg}
 
-        local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(colors.black,colors.black),width=14,fg_bg=cpair(colors.black,colors.brown)}
+        if i <= facility.num_units then
+            rate_limits[i] = lim
+            rate_limits[i].register(unit.unit_ps, "max_burn", rate_limits[i].set_max)
+            rate_limits[i].register(unit.unit_ps, "burn_limit", rate_limits[i].set_value)
 
-        cur_burn.register(unit.unit_ps, "act_burn_rate", cur_burn.update)
+            cur_burn.register(unit.unit_ps, "act_burn_rate", cur_burn.update)
+        else
+            lim.disable()
+        end
     end
 
     -------------------
     -- unit statuses --
     -------------------
 
-    local stat_div = Div{parent=proc,width=38,height=19,x=57,y=6}
+    local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6}
 
-    for i = 1, facility.num_units do
-        local unit = units[i]   ---@type ioctl_unit
+    for i = 1, 4 do
+        local tag_fg_bg = cpair(colors.gray, colors.white)
+        local ind_fg_bg = cpair(colors.lightGray, colors.white)
+        local ind_off = colors.lightGray
+
+        if i <= facility.num_units then
+            tag_fg_bg = cpair(colors.black, colors.cyan)
+            ind_fg_bg = bw_fg_bg
+            ind_off = colors.gray
+        end
 
         local _y = ((i - 1) * 5) + 1
 
-        local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=cpair(colors.black,colors.lightBlue)}
+        local unit_tag = Div{parent=stat_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2}
 
-        local lights   = Div{parent=stat_div,x=9,y=_y,width=12,height=4,fg_bg=bw_fg_bg}
-        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,colors.gray)}
-        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local lights   = Div{parent=stat_div,x=9,y=_y,width=14,height=4,fg_bg=ind_fg_bg}
+        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,ind_off)}
+        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,ind_off),flash=true,period=period.BLINK_250_MS}
 
-        ready.register(unit.unit_ps, "U_AutoReady", ready.update)
-        degraded.register(unit.unit_ps, "U_AutoDegraded", degraded.update)
+        if i <= facility.num_units then
+            local unit = units[i]   ---@type ioctl_unit
+
+            ready.register(unit.unit_ps, "U_AutoReady", ready.update)
+            degraded.register(unit.unit_ps, "U_AutoDegraded", degraded.update)
+        end
     end
 
     -------------------------
@@ -195,7 +235,7 @@ local function new_view(root, x, y)
     -------------------------
 
     local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" }
-    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.purple,colors.black),radio_bg=colors.gray}
+    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.purple}
 
     mode.register(facility.ps, "process_mode", mode.set_value)
 
@@ -261,6 +301,60 @@ local function new_view(root, x, y)
             for i = 1, #rate_limits do rate_limits[i].enable() end
         end
     end)
+
+    ------------------------------
+    -- waste production control --
+    ------------------------------
+
+    local waste_status = Div{parent=proc,width=24,height=4,x=57,y=1,}
+
+    for i = 1, facility.num_units do
+        local unit = units[i]   ---@type ioctl_unit
+
+        TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8,height=1}
+        local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=ind_wht}
+        local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6}
+
+        a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update)
+        waste_m.register(unit.unit_ps, "U_WasteProduct", waste_m.update)
+    end
+
+    local waste_sel = Div{parent=proc,width=21,height=24,x=81,y=1}
+
+    TextBox{parent=waste_sel,text=" ",width=21,height=1,x=1,y=1,fg_bg=cpair(colors.black,colors.brown)}
+    TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=TEXT_ALIGN.CENTER,width=21,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.brown)}
+
+    local rect   = Rectangle{parent=waste_sel,border=border(1,colors.brown,true),width=21,height=22,x=1,y=3}
+    local status = StateIndicator{parent=rect,x=2,y=1,states=style.waste.states,value=1,min_width=17}
+
+    status.register(facility.ps, "current_waste_product", status.update)
+
+    local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.brown}
+    local pu_fallback = Checkbox{parent=rect,x=2,y=7,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.green,colors.black)}
+
+    waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value)
+    pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
+
+    local fb_active  = IndicatorLight{parent=rect,x=2,y=9,label="Fallback Active",colors=ind_wht}
+
+    fb_active.register(facility.ps, "pu_fallback_active", fb_active.update)
+
+    TextBox{parent=rect,x=2,y=11,text="Plutonium Rate",height=1,width=17,fg_bg=style.label}
+    local pu_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+
+    TextBox{parent=rect,x=2,y=14,text="Polonium Rate",height=1,width=17,fg_bg=style.label}
+    local po_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+
+    TextBox{parent=rect,x=2,y=17,text="Antimatter Rate",height=1,width=17,fg_bg=style.label}
+    local am_rate = DataIndicator{parent=rect,x=2,label="",unit="\xb5B/t",format="%12d",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+
+    pu_rate.register(facility.ps, "pu_rate", pu_rate.update)
+    po_rate.register(facility.ps, "po_rate", po_rate.update)
+    am_rate.register(facility.ps, "am_rate", am_rate.update)
+
+    local sna_count = DataIndicator{parent=rect,x=2,y=20,label="Linked SNAs:",format="%4d",value=0,lu_colors=lu_cpair,width=17}
+
+    sna_count.register(facility.ps, "sna_count", sna_count.update)
 end
 
 return new_view

coordinator/ui/components/turbine.lua

@@ -31,7 +31,7 @@ local function new_view(root, x, y, ps)
     local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg}
 
     status.register(ps, "computed_status", status.update)
-    prod_rate.register(ps, "prod_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end)
+    prod_rate.register(ps, "steam_input_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end)
     flow_rate.register(ps, "flow_rate", flow_rate.update)
 
     local steam  = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}

coordinator/ui/components/unit_detail.lua

@@ -31,30 +31,16 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 local cpair = core.cpair
 local border = core.border
 
-local period = core.flasher.PERIOD
+local bw_fg_bg = style.bw_fg_bg
+local lu_cpair = style.lu_colors
+local hzd_fg_bg = style.hzd_fg_bg
 
-local waste_opts = {
-    {
-        text = "Auto",
-        fg_bg = cpair(colors.black, colors.lightGray),
-        active_fg_bg = cpair(colors.white, colors.gray)
-    },
-    {
-        text = "Pu",
-        fg_bg = cpair(colors.black, colors.lightGray),
-        active_fg_bg = cpair(colors.black, colors.green)
-    },
-    {
-        text = "Po",
-        fg_bg = cpair(colors.black, colors.lightGray),
-        active_fg_bg = cpair(colors.black, colors.cyan)
-    },
-    {
-        text = "AM",
-        fg_bg = cpair(colors.black, colors.lightGray),
-        active_fg_bg = cpair(colors.black, colors.purple)
-    }
-}
+local ind_grn = style.ind_grn
+local ind_yel = style.ind_yel
+local ind_red = style.ind_red
+local ind_wht = style.ind_wht
+
+local period = core.flasher.PERIOD
 
 -- create a unit view
 ---@param parent graphics_element parent
@@ -62,18 +48,17 @@ local waste_opts = {
 local function init(parent, id)
     local unit = iocontrol.get_db().units[id]   ---@type ioctl_unit
     local f_ps = iocontrol.get_db().facility.ps
+
+    local main = Div{parent=parent,x=1,y=1}
+
+    if unit == nil then return main end
+
     local u_ps = unit.unit_ps
     local b_ps = unit.boiler_ps_tbl
     local t_ps = unit.turbine_ps_tbl
 
-    local main = Div{parent=parent,x=1,y=1}
-
     TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
 
-    local bw_fg_bg  = cpair(colors.black, colors.white)
-    local hzd_fg_bg = cpair(colors.white, colors.gray)
-    local lu_cpair  = cpair(colors.gray, colors.gray)
-
     -----------------------------
     -- main stats and core map --
     -----------------------------
@@ -160,7 +145,7 @@ local function init(parent, id)
 
     -- connectivity
     local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)}
-    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=cpair(colors.white,colors.gray)}
+    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=ind_wht}
     local rad_mon    = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
 
     plc_online.register(u_ps, "PLCOnline", plc_online.update)
@@ -170,25 +155,25 @@ local function init(parent, id)
     annunciator.line_break()
 
     -- operating state
-    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=cpair(colors.green,colors.gray)}
-    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=cpair(colors.white,colors.gray)}
+    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=ind_grn}
+    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=ind_wht}
 
     r_active.register(u_ps, "status", r_active.update)
     r_auto.register(u_ps, "AutoControl", r_auto.update)
 
     -- main unit transient/warning annunciator panel
-    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=cpair(colors.yellow,colors.gray)}
-    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=cpair(colors.red,colors.gray)}
-    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant  Level Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=cpair(colors.red,colors.gray)}
-    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=cpair(colors.yellow,colors.gray)}
-    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=cpair(colors.yellow,colors.gray)}
-    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=cpair(colors.yellow,colors.gray)}
+    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=ind_red}
+    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=ind_red}
+    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=ind_red}
+    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=ind_yel}
+    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=ind_red}
+    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=ind_yel}
+    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant  Level Low",colors=ind_yel}
+    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=ind_red}
+    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=ind_yel}
+    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=ind_yel}
+    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=ind_yel}
+    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=ind_yel}
 
     r_scram.register(u_ps, "ReactorSCRAM", r_scram.update)
     r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update)
@@ -209,15 +194,15 @@ local function init(parent, id)
     local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9}
     local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1}
 
-    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=cpair(colors.yellow,colors.gray)}
-    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=cpair(colors.yellow,colors.gray)}
-    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=cpair(colors.yellow,colors.gray)}
-    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=cpair(colors.yellow,colors.gray)}
-    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=ind_yel}
+    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=ind_yel}
+    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=ind_yel}
+    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=ind_yel}
+    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
     local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS}
 
     rps_trp.register(u_ps, "rps_tripped", rps_trp.update)
@@ -238,12 +223,12 @@ local function init(parent, id)
     local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1}
     local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7}
 
-    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=cpair(colors.yellow,colors.gray)}
+    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=ind_yel}
     local c_emg  = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green}
-    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=cpair(colors.yellow,colors.gray)}
+    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=ind_yel}
+    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=ind_yel}
+    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=ind_yel}
+    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=ind_yel}
 
     c_flt.register(u_ps, "RCSFault", c_flt.update)
     c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
@@ -266,11 +251,11 @@ local function init(parent, id)
 
     if unit.num_boilers > 0 then
         TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
+        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
         b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update)
 
         TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update)
     end
     if unit.num_boilers > 1 then
@@ -282,11 +267,11 @@ local function init(parent, id)
         end
 
         TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
+        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
         b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update)
 
         TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update)
     end
 
@@ -299,15 +284,15 @@ local function init(parent, id)
     t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update)
 
     TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
     t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update)
 
     TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
     t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update)
 
     TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
     t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update)
 
     if unit.num_turbines > 1 then
@@ -320,15 +305,15 @@ local function init(parent, id)
         t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update)
 
         TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update)
 
         TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update)
 
         TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update)
     end
 
@@ -340,15 +325,15 @@ local function init(parent, id)
         t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update)
 
         TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update)
 
         TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update)
 
         TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update)
     end
 
@@ -363,7 +348,7 @@ local function init(parent, id)
     TextBox{parent=burn_control,x=9,y=2,text="mB/t"}
 
     local set_burn = function () unit.set_burn(burn_rate.get_value()) end
-    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=dis_colors,callback=set_burn}
+    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=dis_colors,callback=set_burn}
 
     burn_rate.register(u_ps, "burn_rate", burn_rate.set_value)
     burn_rate.register(u_ps, "max_burn", burn_rate.set_max)
@@ -398,7 +383,7 @@ local function init(parent, id)
     local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49}
     local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1}
 
-    local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=waste_opts,callback=unit.set_waste,min_width=6}
+    local waste_mode = MultiButton{parent=waste_div,x=1,y=1,options=style.waste.unit_opts,callback=unit.set_waste,min_width=6}
 
     waste_mode.register(u_ps, "U_WasteMode", waste_mode.set_value)
 
@@ -495,7 +480,7 @@ local function init(parent, id)
     auto_div.line_break()
 
     local function set_group() unit.set_group(group.get_value() - 1) end
-    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
+    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
 
     auto_div.line_break()
 
@@ -506,8 +491,8 @@ local function init(parent, id)
 
     auto_div.line_break()
 
-    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=cpair(colors.green,colors.gray)}
-    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_1000_MS}
+    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=ind_grn}
+    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=ind_wht,flash=true,period=period.BLINK_1000_MS}
 
     a_rdy.register(u_ps, "U_AutoReady", a_rdy.update)
 

coordinator/ui/components/unit_flow.lua

@@ -0,0 +1,225 @@
+--
+-- Basic Unit Flow Overview
+--
+
+local util              = require("scada-common.util")
+
+local style             = require("coordinator.ui.style")
+
+local core              = require("graphics.core")
+
+local Div               = require("graphics.elements.div")
+local PipeNetwork       = require("graphics.elements.pipenet")
+local TextBox           = require("graphics.elements.textbox")
+
+local Rectangle         = require("graphics.elements.rectangle")
+
+local DataIndicator     = require("graphics.elements.indicators.data")
+
+local IndicatorLight    = require("graphics.elements.indicators.light")
+local TriIndicatorLight = require("graphics.elements.indicators.trilight")
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local sprintf = util.sprintf
+
+local cpair = core.cpair
+local border = core.border
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+local bw_fg_bg = style.bw_fg_bg
+local text_c = style.text_colors
+local lu_c = style.lu_colors
+
+local ind_grn = style.ind_grn
+local ind_wht = style.ind_wht
+
+-- make a new unit flow window
+---@param parent graphics_element parent
+---@param x integer top left x
+---@param y integer top left y
+---@param wide boolean whether to render wide version
+---@param unit ioctl_unit unit database entry
+local function make(parent, x, y, wide, unit)
+    local height = 16
+
+    local v_start = 1 + ((unit.unit_id - 1) * 5)
+    local prv_start = 1 + ((unit.unit_id - 1) * 3)
+    local v_fields = { "pu", "po", "pl", "am" }
+    local v_names = {
+        sprintf("PV%02d-PU", v_start),
+        sprintf("PV%02d-PO", v_start + 1),
+        sprintf("PV%02d-PL", v_start + 2),
+        sprintf("PV%02d-AM", v_start + 3),
+        sprintf("PRV%02d", prv_start),
+        sprintf("PRV%02d", prv_start + 1),
+        sprintf("PRV%02d", prv_start + 2)
+    }
+
+    assert(parent.get_height() >= (y + height), "flow display not of sufficient vertical resolution (add an additional row of monitors) " .. y .. "," .. parent.get_height())
+
+    local function _wide(a, b) return util.trinary(wide, a, b) end
+
+    -- bounding box div
+    local root = Div{parent=parent,x=x,y=y,width=_wide(136, 114),height=height}
+
+    local lg_gray = cpair(colors.lightGray, colors.gray)
+
+    ------------------
+    -- COOLING LOOP --
+    ------------------
+
+    local reactor = Rectangle{parent=root,x=1,y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=reactor,y=1,text="FISSION REACTOR",alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=reactor,y=3,text="UNIT #"..unit.unit_id,alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=19,y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+    TextBox{parent=root,x=3,y=5,text="\x19",width=1,height=1,fg_bg=lg_gray}
+
+    local rc_pipes = {}
+
+    local emc_x = 42    -- emergency coolant connection x point
+
+    if unit.num_boilers > 0 then
+        table.insert(rc_pipes, pipe(0, 1, _wide(28, 19), 1, colors.lightBlue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(28, 19), 3, colors.orange, true))
+        table.insert(rc_pipes, pipe(_wide(46 ,39), 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(_wide(46,39), 3, _wide(72,58), 3, colors.white, true))
+    else
+        emc_x = 3
+        table.insert(rc_pipes, pipe(0, 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(72,58), 3, colors.white, true))
+    end
+
+    if unit.has_tank then
+        table.insert(rc_pipes, pipe(emc_x, 1, emc_x, 0, colors.blue, true, true))
+    end
+
+    local prv_yo = math.max(3 - unit.num_turbines, 0)
+    for i = 1, unit.num_turbines do
+        local py = 2 * (i - 1) + prv_yo
+        table.insert(rc_pipes, pipe(_wide(92, 78), py, _wide(104, 83), py, colors.white, true))
+    end
+
+    PipeNetwork{parent=root,x=20,y=1,pipes=rc_pipes,bg=colors.lightGray}
+
+    if unit.num_boilers > 0 then
+        local cc_rate = DataIndicator{parent=root,x=_wide(25,22),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+        local hc_rate = DataIndicator{parent=root,x=_wide(25,22),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+
+        cc_rate.register(unit.unit_ps, "boil_sum", cc_rate.update)
+        hc_rate.register(unit.unit_ps, "heating_rate", hc_rate.update)
+
+        local boiler = Rectangle{parent=root,x=_wide(47,40),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
+        TextBox{parent=boiler,y=1,text="THERMO-ELECTRIC",alignment=TEXT_ALIGN.CENTER,height=1}
+        TextBox{parent=boiler,y=3,text="BOILERS",alignment=TEXT_ALIGN.CENTER,height=1}
+        TextBox{parent=root,x=_wide(47,40),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+        TextBox{parent=root,x=_wide(65,58),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+        local wt_rate = DataIndicator{parent=root,x=_wide(71,61),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+        local st_rate = DataIndicator{parent=root,x=_wide(71,61),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "boil_sum", st_rate.update)
+    else
+        local wt_rate = DataIndicator{parent=root,x=28,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+        local st_rate = DataIndicator{parent=root,x=28,y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=bw_fg_bg}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "heating_rate", st_rate.update)
+    end
+
+    local turbine = Rectangle{parent=root,x=_wide(93,79),y=1,border=border(1, colors.gray, true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=turbine,y=1,text="STEAM TURBINE",alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=turbine,y=3,text=util.trinary(unit.num_turbines>1,"GENERATORS","GENERATOR"),alignment=TEXT_ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=_wide(93,79),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+    for i = 1, unit.num_turbines do
+        local ry = 1 + (2 * (i - 1)) + prv_yo
+        TextBox{parent=root,x=_wide(125,103),y=ry,text="\x10\x11\x7f",fg_bg=text_c,width=3,height=1}
+        local state = TriIndicatorLight{parent=root,x=_wide(129,107),y=ry,label=v_names[i+4],c1=colors.gray,c2=colors.yellow,c3=colors.red}
+        state.register(unit.turbine_ps_tbl[i], "SteamDumpOpen", state.update)
+    end
+
+    ----------------------
+    -- WASTE PROCESSING --
+    ----------------------
+
+    local waste = Div{parent=root,x=3,y=6}
+
+    local waste_pipes = {
+        pipe(0, 0, _wide(19, 16), 1, colors.brown, true),
+        pipe(_wide(14, 13), 1, _wide(19, 17), 5, colors.brown, true),
+        pipe(_wide(22, 19), 1, _wide(49, 45), 1, colors.brown, true),
+        pipe(_wide(22, 19), 5, _wide(28, 24), 5, colors.brown, true),
+
+        pipe(_wide(64, 53), 1, _wide(95, 81), 1, colors.green, true),
+
+        pipe(_wide(48, 43), 4, _wide(71, 61), 4, colors.cyan, true),
+        pipe(_wide(66, 57), 4, _wide(71, 61), 8, colors.cyan, true),
+        pipe(_wide(74, 63), 4, _wide(95, 81), 4, colors.cyan, true),
+        pipe(_wide(74, 63), 8, _wide(133, 111), 8, colors.cyan, true),
+
+        pipe(_wide(108, 94), 1, _wide(132, 110), 6, colors.black, true, true),
+        pipe(_wide(108, 94), 4, _wide(111, 95), 1, colors.black, true, true),
+        pipe(_wide(132, 110), 6, _wide(130, 108), 6, colors.black, true, true)
+    }
+
+    PipeNetwork{parent=waste,x=1,y=1,pipes=waste_pipes,bg=colors.lightGray}
+
+    local function _valve(vx, vy, n)
+        TextBox{parent=waste,x=vx,y=vy,text="\x10\x11",fg_bg=text_c,width=2,height=1}
+        local conn = IndicatorLight{parent=waste,x=vx-3,y=vy+1,label=v_names[n],colors=ind_grn}
+        local open = IndicatorLight{parent=waste,x=vx-3,y=vy+2,label="OPEN",colors=ind_wht}
+        conn.register(unit.unit_ps, util.c("V_", v_fields[n], "_conn"), conn.update)
+        open.register(unit.unit_ps, util.c("V_", v_fields[n], "_state"), open.update)
+    end
+
+    local function _machine(mx, my, name)
+        local l = string.len(name) + 2
+        TextBox{parent=waste,x=mx,y=my,text=string.rep("\x8f",l),alignment=TEXT_ALIGN.CENTER,fg_bg=lg_gray,width=l,height=1}
+        TextBox{parent=waste,x=mx,y=my+1,text=name,alignment=TEXT_ALIGN.CENTER,fg_bg=wh_gray,width=l,height=1}
+    end
+
+    local waste_rate = DataIndicator{parent=waste,x=1,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=bw_fg_bg}
+    local pu_rate = DataIndicator{parent=waste,x=_wide(82,70),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local po_rate = DataIndicator{parent=waste,x=_wide(52,45),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local popl_rate = DataIndicator{parent=waste,x=_wide(82,70),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local poam_rate = DataIndicator{parent=waste,x=_wide(82,70),y=10,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+    local spent_rate = DataIndicator{parent=waste,x=_wide(117,99),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=bw_fg_bg}
+
+    waste_rate.register(unit.unit_ps, "act_burn_rate", waste_rate.update)
+    pu_rate.register(unit.unit_ps, "pu_rate", pu_rate.update)
+    po_rate.register(unit.unit_ps, "po_rate", po_rate.update)
+    popl_rate.register(unit.unit_ps, "po_pl_rate", popl_rate.update)
+    poam_rate.register(unit.unit_ps, "po_am_rate", poam_rate.update)
+    spent_rate.register(unit.unit_ps, "ws_rate", spent_rate.update)
+
+    _valve(_wide(21, 18), 2, 1)
+    _valve(_wide(21, 18), 6, 2)
+    _valve(_wide(73, 62), 5, 3)
+    _valve(_wide(73, 62), 9, 4)
+
+    _machine(_wide(51, 45), 1, "CENTRIFUGE \x1a");
+    _machine(_wide(97, 83), 1, "PRC [Pu] \x1a");
+    _machine(_wide(97, 83), 4, "PRC [Po] \x1a");
+    _machine(_wide(116, 94), 6, "SPENT WASTE \x1b")
+
+    TextBox{parent=waste,x=_wide(30,25),y=3,text="SNAs [Po]",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sna_po  = Rectangle{parent=waste,x=_wide(30,25),y=4,border=border(1,colors.gray,true),width=19,height=7,thin=true,fg_bg=bw_fg_bg}
+    local sna_act = IndicatorLight{parent=sna_po,label="ACTIVE",colors=ind_grn}
+    local sna_cnt = DataIndicator{parent=sna_po,x=12,y=1,lu_colors=lu_c,label="CNT",unit="",format="%2d",value=0,width=7}
+    local sna_pk = DataIndicator{parent=sna_po,y=3,lu_colors=lu_c,label="PEAK",unit="mB/t",format="%7.2f",value=0,width=17}
+    local sna_max = DataIndicator{parent=sna_po,lu_colors=lu_c,label="MAX",unit="mB/t",format="%8.2f",value=0,width=17}
+    local sna_in = DataIndicator{parent=sna_po,lu_colors=lu_c,label="IN",unit="mB/t",format="%9.2f",value=0,width=17}
+
+    sna_act.register(unit.unit_ps, "po_rate", function (r) sna_act.update(r > 0) end)
+    sna_cnt.register(unit.unit_ps, "sna_count", sna_cnt.update)
+    sna_pk.register(unit.unit_ps, "sna_peak_rate", sna_pk.update)
+    sna_max.register(unit.unit_ps, "sna_prod_rate", sna_max.update)
+    sna_in.register(unit.unit_ps, "sna_in", sna_in.update)
+
+    return root
+end
+
+return make

coordinator/ui/layout/flow_view.lua

@@ -0,0 +1,381 @@
+--
+-- Flow Monitor GUI
+--
+
+local types          = require("scada-common.types")
+local util           = require("scada-common.util")
+
+local iocontrol      = require("coordinator.iocontrol")
+
+local style          = require("coordinator.ui.style")
+
+local unit_flow      = require("coordinator.ui.components.unit_flow")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local PipeNetwork    = require("graphics.elements.pipenet")
+local Rectangle      = require("graphics.elements.rectangle")
+local TextBox        = require("graphics.elements.textbox")
+
+local DataIndicator  = require("graphics.elements.indicators.data")
+local HorizontalBar  = require("graphics.elements.indicators.hbar")
+local IndicatorLight = require("graphics.elements.indicators.light")
+local StateIndicator = require("graphics.elements.indicators.state")
+
+local CONTAINER_MODE = types.CONTAINER_MODE
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local cpair = core.cpair
+local border = core.border
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+local bw_fg_bg = style.bw_fg_bg
+local text_col = style.text_colors
+local lu_col = style.lu_colors
+
+-- create new flow view
+---@param main graphics_element main displaybox
+local function init(main)
+    local facility = iocontrol.get_db().facility
+    local units = iocontrol.get_db().units
+
+    local tank_defs = facility.tank_defs
+    local tank_list = facility.tank_list
+
+    -- window header message
+    local header = TextBox{parent=main,y=1,text="Facility Coolant and Waste Flow Monitor",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
+    -- max length example: "01:23:45 AM - Wednesday, September 28 2022"
+    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=TEXT_ALIGN.RIGHT,width=42,height=1,fg_bg=style.header}
+
+    datetime.register(facility.ps, "date_time", datetime.set_value)
+
+    local po_pipes = {}
+    local water_pipes = {}
+
+    -- get the y offset for this unit index
+    ---@param idx integer unit index
+    local function y_ofs(idx) return ((idx - 1) * 20) end
+
+    -- determinte facility tank start/end from the definitions list
+    ---@param start_idx integer start index of table iteration
+    ---@param end_idx integer end index of table iteration
+    local function find_fdef(start_idx, end_idx)
+        local first, last = 4, 0
+        for i = start_idx, end_idx do
+            if tank_defs[i] == 2 then
+                last = i
+                if i < first then first = i end
+            end
+        end
+        return first, last
+    end
+
+    if facility.tank_mode == 0 or facility.tank_mode == 8 then
+        -- (0) tanks belong to reactor units OR (8) 4 total facility tanks (A B C D)
+        for i = 1, facility.num_units do
+            if units[i].has_tank then
+                local y = y_ofs(i)
+                table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+    else
+        -- setup connections for units with emergency coolant, always the same
+        for i = 1, #tank_defs do
+            if tank_defs[i] > 0 then
+                local y = y_ofs(i)
+
+                if tank_defs[i] == 2 then
+                    table.insert(water_pipes, pipe(1, y, 21, y, colors.blue, true))
+                else
+                    table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                    table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+                end
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+
+        if facility.tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef, last_fdef = find_fdef(1, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef, last_fdef = find_fdef(1, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if tank_defs[a] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(a), 1, y_ofs(a) + 6, colors.blue, true))
+                    if tank_defs[b] == 2 then
+                        table.insert(water_pipes, pipe(0, y_ofs(b) - 13, 1, y_ofs(b), colors.blue, true))
+                    end
+                elseif tank_defs[b] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(b), 1, y_ofs(b) + 6, colors.blue, true))
+                end
+            end
+        elseif facility.tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef, last_fdef = find_fdef(2, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef, last_fdef = find_fdef(1, math.min(2, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 3 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef, last_fdef = find_fdef(2, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef, last_fdef = find_fdef(3, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 2 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        end
+    end
+
+    local flow_x = 3
+    if #water_pipes > 0 then
+        flow_x = 25
+        PipeNetwork{parent=main,x=2,y=3,pipes=water_pipes,bg=colors.lightGray}
+    end
+
+    for i = 1, facility.num_units do
+        local y_offset = y_ofs(i)
+        unit_flow(main, flow_x, 5 + y_offset, #water_pipes == 0, units[i])
+        table.insert(po_pipes, pipe(0, 3 + y_offset, 4, 0, colors.cyan, true, true))
+    end
+
+    PipeNetwork{parent=main,x=139,y=15,pipes=po_pipes,bg=colors.lightGray}
+
+    -----------------
+    -- tank valves --
+    -----------------
+
+    local next_f_id = 1
+
+    for i = 1, #tank_defs do
+        if tank_defs[i] > 0 then
+            local vy = 3 + y_ofs(i)
+
+            TextBox{parent=main,x=12,y=vy,text="\x10\x11",fg_bg=cpair(colors.black,colors.lightGray),width=2,height=1}
+
+            local conn = IndicatorLight{parent=main,x=9,y=vy+1,label=util.sprintf("PV%02d-EMC", i * 5),colors=style.ind_grn}
+            local open = IndicatorLight{parent=main,x=9,y=vy+2,label="OPEN",colors=style.ind_wht}
+
+            conn.register(units[i].unit_ps, "V_emc_conn", conn.update)
+            open.register(units[i].unit_ps, "V_emc_state", open.update)
+        end
+    end
+
+    -------------------
+    -- dynamic tanks --
+    -------------------
+
+    for i = 1, #tank_list do
+        if tank_list[i] > 0 then
+            local id = "U-" .. i
+            local f_id = next_f_id
+            if tank_list[i] == 2 then
+                id = "F-" .. next_f_id
+                next_f_id = next_f_id + 1
+            end
+
+            local y_offset = y_ofs(i)
+
+            local tank = Div{parent=main,x=3,y=7+y_offset,width=20,height=14}
+
+            TextBox{parent=tank,text=" ",height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
+            TextBox{parent=tank,text="DYNAMIC TANK "..id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.wh_gray}
+
+            local tank_box = Rectangle{parent=tank,border=border(1,colors.gray,true),width=20,height=12}
+
+            local status = StateIndicator{parent=tank_box,x=3,y=1,states=style.dtank.states,value=1,min_width=14}
+
+            TextBox{parent=tank_box,x=2,y=3,text="Fill",height=1,width=10,fg_bg=style.label}
+            local tank_pcnt = DataIndicator{parent=tank_box,x=10,y=3,label="",format="%5.2f",value=100,unit="%",lu_colors=lu_col,width=8,fg_bg=text_col}
+            local tank_amnt = DataIndicator{parent=tank_box,x=2,label="",format="%13d",value=0,unit="mB",lu_colors=lu_col,width=16,fg_bg=bw_fg_bg}
+
+            TextBox{parent=tank_box,x=2,y=6,text="Water Level",height=1,width=11,fg_bg=style.label}
+            local level = HorizontalBar{parent=tank_box,x=2,y=7,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=16}
+
+            TextBox{parent=tank_box,x=2,y=9,text="In/Out Mode",height=1,width=11,fg_bg=style.label}
+            local can_fill = IndicatorLight{parent=tank_box,x=2,y=10,label="FILL",colors=style.ind_wht}
+            local can_empty = IndicatorLight{parent=tank_box,x=10,y=10,label="EMPTY",colors=style.ind_wht}
+
+            local function _can_fill(mode)
+                can_fill.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.FILL))
+            end
+
+            local function _can_empty(mode)
+                can_empty.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.EMPTY))
+            end
+
+            if tank_list[i] == 1 then
+                status.register(units[i].tank_ps_tbl[1], "computed_status", status.update)
+                tank_pcnt.register(units[i].tank_ps_tbl[1], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(units[i].tank_ps_tbl[1], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(units[i].tank_ps_tbl[1], "fill", level.update)
+                can_fill.register(units[i].tank_ps_tbl[1], "container_mode", _can_fill)
+                can_empty.register(units[i].tank_ps_tbl[1], "container_mode", _can_empty)
+            else
+                status.register(facility.tank_ps_tbl[f_id], "computed_status", status.update)
+                tank_pcnt.register(facility.tank_ps_tbl[f_id], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(facility.tank_ps_tbl[f_id], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(facility.tank_ps_tbl[f_id], "fill", level.update)
+                can_fill.register(facility.tank_ps_tbl[f_id], "container_mode", _can_fill)
+                can_empty.register(facility.tank_ps_tbl[f_id], "container_mode", _can_empty)
+            end
+        end
+    end
+
+    ---------
+    -- SPS --
+    ---------
+
+    local sps = Div{parent=main,x=140,y=3,height=12}
+
+    TextBox{parent=sps,text=" ",width=24,height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
+    TextBox{parent=sps,text="SPS",alignment=TEXT_ALIGN.CENTER,width=24,height=1,fg_bg=wh_gray}
+
+    local sps_box = Rectangle{parent=sps,border=border(1,colors.gray,true),width=24,height=10}
+
+    local status = StateIndicator{parent=sps_box,x=5,y=1,states=style.sps.states,value=1,min_width=14}
+
+    status.register(facility.sps_ps_tbl[1], "computed_status", status.update)
+
+    TextBox{parent=sps_box,x=2,y=3,text="Input Rate",height=1,width=10,fg_bg=style.label}
+    local sps_in = DataIndicator{parent=sps_box,x=2,label="",format="%15.3f",value=0,unit="mB/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
+
+    sps_in.register(facility.ps, "po_am_rate", sps_in.update)
+
+    TextBox{parent=sps_box,x=2,y=6,text="Production Rate",height=1,width=15,fg_bg=style.label}
+    local sps_rate = DataIndicator{parent=sps_box,x=2,label="",format="%15d",value=0,unit="\xb5B/t",lu_colors=lu_col,width=20,fg_bg=bw_fg_bg}
+
+    sps_rate.register(facility.sps_ps_tbl[1], "process_rate", function (r) sps_rate.update(r * 1000) end)
+
+    ----------------
+    -- statistics --
+    ----------------
+
+    TextBox{parent=main,x=145,y=16,text="PROC. WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local pr_waste  = Rectangle{parent=main,x=145,y=17,border=border(1,colors.gray,true),width=19,height=5,thin=true,fg_bg=bw_fg_bg}
+    local pu = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Pu",unit="mB/t",format="%9.3f",value=0,width=17}
+    local po = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="Po",unit="mB/t",format="%9.3f",value=0,width=17}
+    local popl = DataIndicator{parent=pr_waste,lu_colors=lu_col,label="PoPl",unit="mB/t",format="%7.3f",value=0,width=17}
+
+    pu.register(facility.ps, "pu_rate", pu.update)
+    po.register(facility.ps, "po_rate", po.update)
+    popl.register(facility.ps, "po_pl_rate", popl.update)
+
+    TextBox{parent=main,x=145,y=23,text="SPENT WASTE",alignment=TEXT_ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sp_waste  = Rectangle{parent=main,x=145,y=24,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=bw_fg_bg}
+    local sum_sp_waste = DataIndicator{parent=sp_waste,lu_colors=lu_col,label="SUM",unit="mB/t",format="%8.3f",value=0,width=17}
+
+    sum_sp_waste.register(facility.ps, "spent_waste_rate", sum_sp_waste.update)
+end
+
+return init

coordinator/ui/layout/front_panel.lua

@@ -0,0 +1,124 @@
+--
+-- Coordinator Front Panel GUI
+--
+
+local types         = require("scada-common.types")
+local util          = require("scada-common.util")
+
+local iocontrol     = require("coordinator.iocontrol")
+
+local pgi           = require("coordinator.ui.pgi")
+local style         = require("coordinator.ui.style")
+
+local pkt_entry     = require("coordinator.ui.components.pkt_entry")
+
+local core          = require("graphics.core")
+
+local Div           = require("graphics.elements.div")
+local ListBox       = require("graphics.elements.listbox")
+local MultiPane     = require("graphics.elements.multipane")
+local TextBox       = require("graphics.elements.textbox")
+
+local TabBar        = require("graphics.elements.controls.tabbar")
+
+local LED           = require("graphics.elements.indicators.led")
+local RGBLED        = require("graphics.elements.indicators.ledrgb")
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+local cpair = core.cpair
+
+-- create new front panel view
+---@param panel graphics_element main displaybox
+---@param num_units integer number of units (number of unit monitors)
+local function init(panel, num_units)
+    local ps = iocontrol.get_db().fp.ps
+
+    TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.fp.header}
+
+    local page_div = Div{parent=panel,x=1,y=3}
+
+    --
+    -- system indicators
+    --
+
+    local main_page = Div{parent=page_div,x=1,y=1}
+
+    local system = Div{parent=main_page,width=14,height=17,x=2,y=2}
+
+    local status = LED{parent=system,label="STATUS",colors=cpair(colors.green,colors.red)}
+    local heartbeat = LED{parent=system,label="HEARTBEAT",colors=cpair(colors.green,colors.green_off)}
+    status.update(true)
+    system.line_break()
+
+    heartbeat.register(ps, "heartbeat", heartbeat.update)
+
+    local modem = LED{parent=system,label="MODEM",colors=cpair(colors.green,colors.green_off)}
+    local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,colors.gray}}
+    network.update(types.PANEL_LINK_STATE.DISCONNECTED)
+    system.line_break()
+
+    modem.register(ps, "has_modem", modem.update)
+    network.register(ps, "link_state", network.update)
+
+    local speaker = LED{parent=system,label="SPEAKER",colors=cpair(colors.green,colors.green_off)}
+    speaker.register(ps, "has_speaker", speaker.update)
+
+---@diagnostic disable-next-line: undefined-field
+    local comp_id = util.sprintf("(%d)", os.getComputerID())
+    TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)}
+
+    local monitors = Div{parent=main_page,width=16,height=17,x=18,y=2}
+
+    local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=cpair(colors.green,colors.green_off)}
+    main_monitor.register(ps, "main_monitor", main_monitor.update)
+
+    local flow_monitor = LED{parent=monitors,label="FLOW MONITOR",colors=cpair(colors.green,colors.green_off)}
+    flow_monitor.register(ps, "flow_monitor", flow_monitor.update)
+
+    monitors.line_break()
+
+    for i = 1, num_units do
+        local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=cpair(colors.green,colors.green_off)}
+        unit_monitor.register(ps, "unit_monitor_" .. i, unit_monitor.update)
+    end
+
+    --
+    -- about footer
+    --
+
+    local about   = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=cpair(colors.lightGray,colors.ivory)}
+    local fw_v    = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
+    local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
+
+    fw_v.register(ps, "version", function (version) fw_v.set_value(util.c("FW: ", version)) end)
+    comms_v.register(ps, "comms_version", function (version) comms_v.set_value(util.c("NT: v", version)) end)
+
+    --
+    -- page handling
+    --
+
+    -- API page
+
+    local api_page = Div{parent=page_div,x=1,y=1,hidden=true}
+    local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=cpair(colors.black,colors.ivory),nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
+    local _ = Div{parent=api_list,height=1,hidden=true} -- padding
+
+    -- assemble page panes
+
+    local panes = { main_page, api_page }
+
+    local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
+
+    local tabs = {
+        { name = "CRD", color = cpair(colors.black, colors.ivory) },
+        { name = "API", color = cpair(colors.black, colors.ivory) },
+    }
+
+    TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=cpair(colors.black,colors.white)}
+
+    -- link pocket API list management to PGI
+    pgi.link_elements(api_list, pkt_entry)
+end
+
+return init

coordinator/ui/layout/main_view.lua

@@ -9,7 +9,7 @@ local iocontrol     = require("coordinator.iocontrol")
 local style         = require("coordinator.ui.style")
 
 local imatrix       = require("coordinator.ui.components.imatrix")
-local process_ctl   = require("coordinator.ui.components.processctl")
+local process_ctl   = require("coordinator.ui.components.process_ctl")
 local unit_overview = require("coordinator.ui.components.unit_overview")
 
 local core          = require("graphics.core")

coordinator/ui/pgi.lua

@@ -0,0 +1,60 @@
+--
+-- Protected Graphics Interface
+--
+
+local log  = require("scada-common.log")
+local util = require("scada-common.util")
+
+local pgi = {}
+
+local data = {
+    pkt_list = nil,     ---@type nil|graphics_element
+    pkt_entry = nil,    ---@type function
+    -- session entries
+    s_entries = { pkt = {} }
+}
+
+-- link list boxes
+---@param pkt_list graphics_element pocket list element
+---@param pkt_entry function pocket entry constructor
+function pgi.link_elements(pkt_list, pkt_entry)
+    data.pkt_list = pkt_list
+    data.pkt_entry = pkt_entry
+end
+
+-- unlink all fields, disabling the PGI
+function pgi.unlink()
+    data.pkt_list = nil
+    data.pkt_entry = nil
+end
+
+-- add a PKT entry to the PKT list
+---@param session_id integer pocket session
+function pgi.create_pkt_entry(session_id)
+    if data.pkt_list ~= nil and data.pkt_entry ~= nil then
+        local success, result = pcall(data.pkt_entry, data.pkt_list, session_id)
+
+        if success then
+            data.s_entries.pkt[session_id] = result
+        else
+            log.error(util.c("PGI: failed to create PKT entry (", result, ")"), true)
+        end
+    end
+end
+
+-- delete a PKT entry from the PKT list
+---@param session_id integer pocket session
+function pgi.delete_pkt_entry(session_id)
+    if data.s_entries.pkt[session_id] ~= nil then
+        local success, result = pcall(data.s_entries.pkt[session_id].delete)
+        data.s_entries.pkt[session_id] = nil
+
+        if not success then
+            log.error(util.c("PGI: failed to delete PKT entry (", result, ")"), true)
+        end
+    else
+        log.debug(util.c("PGI: tried to delete unknown PKT entry ", session_id))
+    end
+end
+
+return pgi

coordinator/ui/style.lua

@@ -10,6 +10,41 @@ local cpair = core.cpair
 
 -- GLOBAL --
 
+-- add color mappings for front panel
+colors.ivory = colors.pink
+colors.yellow_hc = colors.purple
+colors.red_off = colors.brown
+colors.yellow_off = colors.magenta
+colors.green_off = colors.lime
+
+-- front panel styling
+
+style.fp = {}
+
+style.fp.root = cpair(colors.black, colors.ivory)
+style.fp.header = cpair(colors.black, colors.lightGray)
+
+style.fp.colors = {
+    { c = colors.red,       hex = 0xdf4949 },   -- RED ON
+    { c = colors.orange,    hex = 0xffb659 },
+    { c = colors.yellow,    hex = 0xf9fb53 },   -- YELLOW ON
+    { c = colors.lime,      hex = 0x16665a },   -- GREEN OFF
+    { c = colors.green,     hex = 0x6be551 },   -- GREEN ON
+    { c = colors.cyan,      hex = 0x34bac8 },
+    { c = colors.lightBlue, hex = 0x6cc0f2 },
+    { c = colors.blue,      hex = 0x0096ff },
+    { c = colors.purple,    hex = 0xb156ee },   -- YELLOW HIGH CONTRAST
+    { c = colors.pink,      hex = 0xdcd9ca },   -- IVORY
+    { c = colors.magenta,   hex = 0x85862c },   -- YELLOW OFF
+    -- { c = colors.white,     hex = 0xdcd9ca },
+    { c = colors.lightGray, hex = 0xb1b8b3 },
+    { c = colors.gray,      hex = 0x575757 },
+    -- { c = colors.black,     hex = 0x191919 },
+    { c = colors.brown,     hex = 0x672223 }    -- RED OFF
+}
+
+-- main GUI styling
+
 style.root = cpair(colors.black, colors.lightGray)
 style.header = cpair(colors.white, colors.gray)
 style.label = cpair(colors.gray, colors.lightGray)
@@ -33,7 +68,22 @@ style.colors = {
     -- { c = colors.brown,     hex = 0x7f664c }
 }
 
--- MAIN LAYOUT --
+-- COMMON COLOR PAIRS --
+
+style.wh_gray = cpair(colors.white, colors.gray)
+
+style.bw_fg_bg = cpair(colors.black, colors.white)
+style.text_colors = cpair(colors.black, colors.lightGray)
+style.lu_colors = cpair(colors.gray, colors.gray)
+style.hzd_fg_bg  = style.wh_gray
+style.dis_colors = cpair(colors.white, colors.lightGray)
+
+style.ind_grn = cpair(colors.green, colors.gray)
+style.ind_yel = cpair(colors.yellow, colors.gray)
+style.ind_red = cpair(colors.red, colors.gray)
+style.ind_wht = style.wh_gray
+
+-- UI COMPONENTS --
 
 style.reactor = {
     -- reactor states
@@ -151,8 +201,121 @@ style.imatrix = {
         {
             color = cpair(colors.black, colors.yellow),
             text = "HIGH  CHARGE"
+        }
+    }
+}
+
+style.sps = {
+    -- SPS states
+    states = {
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "OFF-LINE"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "NOT FORMED"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "RTU  FAULT"
+        },
+        {
+            color = cpair(colors.white, colors.gray),
+            text = "IDLE"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "ACTIVE"
+        }
+    }
+}
+
+style.dtank = {
+    -- dynamic tank states
+    states = {
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "OFF-LINE"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "NOT FORMED"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "RTU  FAULT"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "ONLINE"
+        },
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "LOW FILL"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "FILLED"
         },
     }
 }
 
+style.waste = {
+    -- auto waste processing states
+    states = {
+        {
+            color = cpair(colors.black, colors.green),
+            text = "PLUTONIUM"
+        },
+        {
+            color = cpair(colors.black, colors.cyan),
+            text = "POLONIUM"
+        },
+        {
+            color = cpair(colors.black, colors.purple),
+            text = "ANTI MATTER"
+        }
+    },
+    states_abbrv = {
+        {
+            color = cpair(colors.black, colors.green),
+            text = "Pu"
+        },
+        {
+            color = cpair(colors.black, colors.cyan),
+            text = "Po"
+        },
+        {
+            color = cpair(colors.black, colors.purple),
+            text = "AM"
+        }
+    },
+    -- process radio button options
+    options = { "Plutonium", "Polonium", "Antimatter" },
+    -- unit waste selection
+    unit_opts = {
+        {
+            text = "Auto",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.white, colors.gray)
+        },
+        {
+            text = "Pu",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.black, colors.green)
+        },
+        {
+            text = "Po",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.black, colors.cyan)
+        },
+        {
+            text = "AM",
+            fg_bg = cpair(colors.black, colors.lightGray),
+            active_fg_bg = cpair(colors.black, colors.purple)
+        }
+    }
+}
+
 return style

graphics/core.lua

@@ -7,7 +7,7 @@ local flasher = require("graphics.flasher")
 
 local core = {}
 
-core.version = "1.0.0"
+core.version = "1.1.1"
 
 core.flasher = flasher
 core.events = events

graphics/element.lua

@@ -20,6 +20,8 @@ local element = {}
 
 ---@alias graphics_args graphics_args_generic
 ---|waiting_args
+---|app_button_args
+---|checkbox_args
 ---|hazard_button_args
 ---|multi_button_args
 ---|push_button_args
@@ -70,7 +72,8 @@ function element.new(args, child_offset_x, child_offset_y)
         p_window = nil,                                 ---@type table
         position = { x = 1, y = 1 },                    ---@type coordinate_2d
         bounds = { x1 = 1, y1 = 1, x2 = 1, y2 = 1 },    ---@class element_bounds
-        next_y = 1,
+        next_y = 1,                                     -- next child y coordinate
+        next_id = 0,                                    -- next child ID
         subscriptions = {},
         mt = {}
     }
@@ -351,13 +354,14 @@ function element.new(args, child_offset_x, child_offset_y)
 
         local child_element = child.get()
 
-        if key == nil then
-            table.insert(protected.children, child_element)
-            return #protected.children
-        else
-            protected.children[key] = child_element
-            return key
+        local id = key  ---@type string|integer|nil
+        if id == nil then
+            id = self.next_id
+            self.next_id = self.next_id + 1
         end
+
+        protected.children[id] = child_element
+        return id
     end
 
     -- remove a child element
@@ -512,19 +516,21 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- FUNCTION CALLBACKS --
 
-    -- handle a monitor touch or mouse click
+    -- handle a monitor touch or mouse click if this element is visible
     ---@param event mouse_interaction mouse interaction event
     function public.handle_mouse(event)
-        local x_ini, y_ini = event.initial.x, event.initial.y
+        if protected.window.isVisible() then
+            local x_ini, y_ini = event.initial.x, event.initial.y
 
-        local ini_in = protected.in_window_bounds(x_ini, y_ini)
+            local ini_in = protected.in_window_bounds(x_ini, y_ini)
 
-        if ini_in then
-            local event_T = core.events.mouse_transposed(event, self.position.x, self.position.y)
+            if ini_in then
+                local event_T = core.events.mouse_transposed(event, self.position.x, self.position.y)
 
-            -- handle the mouse event then pass to children
-            protected.handle_mouse(event_T)
-            for _, child in pairs(protected.children) do child.handle_mouse(event_T) end
+                -- handle the mouse event then pass to children
+                protected.handle_mouse(event_T)
+                for _, child in pairs(protected.children) do child.handle_mouse(event_T) end
+            end
         end
     end
 

graphics/elements/animations/waiting.lua

@@ -8,7 +8,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/colormap.lua

@@ -8,7 +8,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field hidden? boolean true to hide on initial draw
 
 -- new color map

graphics/elements/controls/app.lua

@@ -0,0 +1,130 @@
+-- App Button Graphics Element
+
+local tcd     = require("scada-common.tcd")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local CLICK_TYPE = core.events.CLICK_TYPE
+
+---@class app_button_args
+---@field text string app icon text
+---@field title string app title text
+---@field callback function function to call on touch
+---@field app_fg_bg cpair app icon foreground/background colors
+---@field active_fg_bg? cpair foreground/background colors when pressed
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new app button
+---@param args app_button_args
+---@return graphics_element element, element_id id
+local function app_button(args)
+    assert(type(args.text) == "string", "graphics.elements.controls.app: text is a required field")
+    assert(type(args.title) == "string", "graphics.elements.controls.app: title is a required field")
+    assert(type(args.callback) == "function", "graphics.elements.controls.app: callback is a required field")
+    assert(type(args.app_fg_bg) == "table", "graphics.elements.controls.app: app_fg_bg is a required field")
+
+    args.height = 4
+    args.width  = 5
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- write app title, centered
+    e.window.setCursorPos(1, 4)
+    e.window.setCursorPos(math.floor((e.frame.w - string.len(args.title)) / 2) + 1, 4)
+    e.window.write(args.title)
+
+    -- draw the app button
+    local function draw()
+        local fgd = args.app_fg_bg.fgd
+        local bkg = args.app_fg_bg.bkg
+
+        if e.value then
+            fgd = args.active_fg_bg.fgd
+            bkg = args.active_fg_bg.bkg
+        end
+
+        -- draw icon
+        e.window.setCursorPos(1, 1)
+        e.window.setTextColor(fgd)
+        e.window.setBackgroundColor(bkg)
+        e.window.write("\x9f\x83\x83\x83")
+        e.window.setTextColor(bkg)
+        e.window.setBackgroundColor(fgd)
+        e.window.write("\x90")
+        e.window.setTextColor(fgd)
+        e.window.setBackgroundColor(bkg)
+        e.window.setCursorPos(1, 2)
+        e.window.write("\x95   ")
+        e.window.setTextColor(bkg)
+        e.window.setBackgroundColor(fgd)
+        e.window.write("\x95")
+        e.window.setCursorPos(1, 3)
+        e.window.write("\x82\x8f\x8f\x8f\x81")
+
+        -- write the icon text
+        e.window.setCursorPos(3, 2)
+        e.window.setTextColor(fgd)
+        e.window.setBackgroundColor(bkg)
+        e.window.write(args.text)
+    end
+
+    -- draw the app button as pressed (if active_fg_bg set)
+    local function show_pressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = true
+            e.window.setTextColor(args.active_fg_bg.fgd)
+            e.window.setBackgroundColor(args.active_fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- draw the app button as unpressed (if active_fg_bg set)
+    local function show_unpressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = false
+            e.window.setTextColor(e.fg_bg.fgd)
+            e.window.setBackgroundColor(e.fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled then
+            if event.type == CLICK_TYPE.TAP then
+                show_pressed()
+                -- show as unpressed in 0.25 seconds
+                if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
+                args.callback()
+            elseif event.type == CLICK_TYPE.DOWN then
+                show_pressed()
+            elseif event.type == CLICK_TYPE.UP then
+                show_unpressed()
+                if e.in_frame_bounds(event.current.x, event.current.y) then
+                    args.callback()
+                end
+            end
+        end
+    end
+
+    -- set the value (true simulates pressing the app button)
+    ---@param val boolean new value
+    function e.set_value(val)
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.CLICK_TYPE.UP, 1, 1)) end
+    end
+
+    -- initial draw
+    draw()
+
+    return e.complete()
+end
+
+return app_button

graphics/elements/controls/checkbox.lua

@@ -0,0 +1,85 @@
+-- Checkbox Graphics Element
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+---@class checkbox_args
+---@field label string checkbox text
+---@field box_fg_bg cpair colors for checkbox
+---@field callback function function to call on press
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new checkbox control
+---@param args checkbox_args
+---@return graphics_element element, element_id id
+local function checkbox(args)
+    assert(type(args.label) == "string", "graphics.elements.controls.checkbox: label is a required field")
+    assert(type(args.box_fg_bg) == "table", "graphics.elements.controls.checkbox: box_fg_bg is a required field")
+    assert(type(args.callback) == "function", "graphics.elements.controls.checkbox: callback is a required field")
+
+    args.height = 1
+    args.width = 3 + string.len(args.label)
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    e.value = false
+
+    -- show the button state
+    local function draw()
+        e.window.setCursorPos(1, 1)
+
+        if e.value then
+            -- show as selected
+            e.window.setTextColor(args.box_fg_bg.bkg)
+            e.window.setBackgroundColor(args.box_fg_bg.fgd)
+            e.window.write("\x88")
+            e.window.setTextColor(args.box_fg_bg.fgd)
+            e.window.setBackgroundColor(e.fg_bg.bkg)
+            e.window.write("\x95")
+        else
+            -- show as unselected
+            e.window.setTextColor(e.fg_bg.bkg)
+            e.window.setBackgroundColor(args.box_fg_bg.bkg)
+            e.window.write("\x88")
+            e.window.setTextColor(args.box_fg_bg.bkg)
+            e.window.setBackgroundColor(e.fg_bg.bkg)
+            e.window.write("\x95")
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled and core.events.was_clicked(event.type) then
+            e.value = not e.value
+            draw()
+            args.callback(e.value)
+        end
+    end
+
+    -- set the value
+    ---@param val integer new value
+    function e.set_value(val)
+        e.value = val
+        draw()
+    end
+
+    -- write label text
+    e.window.setCursorPos(3, 1)
+    e.window.setTextColor(e.fg_bg.fgd)
+    e.window.setBackgroundColor(e.fg_bg.bkg)
+    e.window.write(args.label)
+
+    -- initial draw
+    draw()
+
+    return e.complete()
+end
+
+return checkbox

graphics/elements/controls/hazard_button.lua

@@ -14,7 +14,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/controls/multi_button.lua

@@ -20,7 +20,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/push_button.lua

@@ -16,7 +16,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/radio_button.lua

@@ -13,7 +13,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/controls/sidebar.lua

@@ -17,7 +17,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/spinbox_numeric.lua

@@ -16,7 +16,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/controls/switch_button.lua

@@ -12,7 +12,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/controls/tabbar.lua

@@ -18,7 +18,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/div.lua

@@ -6,7 +6,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/indicators/alight.lua

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/coremap.lua

@@ -11,7 +11,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 
 -- new core map box
 ---@nodiscard

graphics/elements/indicators/data.lua

@@ -14,7 +14,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width integer length
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/hbar.lua

@@ -10,7 +10,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/indicators/icon.lua

@@ -16,7 +16,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/led.lua

@@ -14,7 +14,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/ledpair.lua

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/ledrgb.lua

@@ -9,7 +9,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/light.lua

@@ -14,7 +14,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/power.lua

@@ -13,7 +13,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width integer length
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/rad.lua

@@ -14,7 +14,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width integer length
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/state.lua

@@ -15,7 +15,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field height? integer 1 if omitted, must be an odd number
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw

graphics/elements/indicators/trilight.lua

@@ -16,7 +16,7 @@ local flasher = require("graphics.flasher")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 

graphics/elements/indicators/vbar.lua

@@ -8,7 +8,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/listbox.lua

@@ -15,7 +15,7 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/multipane.lua

@@ -7,7 +7,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/pipenet.lua

@@ -11,9 +11,15 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field hidden? boolean true to hide on initial draw
 
+---@class _pipe_map_entry
+---@field atr boolean align top right (or bottom left for false)
+---@field thin boolean thin pipe or not
+---@field fg string foreground blit
+---@field bg string background blit
+
 -- new pipe network
 ---@param args pipenet_args
 ---@return graphics_element element, element_id id
@@ -44,102 +50,264 @@ local function pipenet(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- draw all pipes
+    -- determine if there are any thin pipes involved
+    local any_thin = false
     for p = 1, #args.pipes do
-        local pipe = args.pipes[p]  ---@type pipe
+        any_thin = args.pipes[p].thin
+        if any_thin then break end
+    end
 
-        local x = 1 + pipe.x1
-        local y = 1 + pipe.y1
+    if not any_thin then
+        -- draw all pipes
+        for p = 1, #args.pipes do
+            local pipe = args.pipes[p]  ---@type pipe
 
-        local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
-        local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+            local x = 1 + pipe.x1
+            local y = 1 + pipe.y1
 
-        e.window.setCursorPos(x, y)
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
 
-        local c = core.cpair(pipe.color, e.fg_bg.bkg)
+            if pipe.thin then
+                x_step = util.trinary(pipe.x1 == pipe.x2, 0, x_step)
+                y_step = util.trinary(pipe.y1 == pipe.y2, 0, y_step)
+            end
 
-        if pipe.align_tr then
-            -- cross width then height
-            for i = 1, pipe.w do
-                if pipe.thin then
-                    if i == pipe.w then
-                        -- corner
-                        if y_step > 0 then
-                            e.window.blit("\x93", c.blit_bkg, c.blit_fgd)
+            e.window.setCursorPos(x, y)
+
+            local c = core.cpair(pipe.color, e.fg_bg.bkg)
+
+            if pipe.align_tr then
+                -- cross width then height
+                for i = 1, pipe.w do
+                    if pipe.thin then
+                        if i == pipe.w then
+                            -- corner
+                            if y_step > 0 then
+                                e.window.blit("\x93", c.blit_bkg, c.blit_fgd)
+                            else
+                                e.window.blit("\x8e", c.blit_fgd, c.blit_bkg)
+                            end
                         else
-                            e.window.blit("\x8e", c.blit_fgd, c.blit_bkg)
+                            e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
                         end
                     else
+                        if i == pipe.w and y_step > 0 then
+                            -- corner
+                            e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.window.blit("\x8f", c.blit_fgd, c.blit_bkg)
+                        end
+                    end
+
+                    x = x + x_step
+                    e.window.setCursorPos(x, y)
+                end
+
+                -- back up one
+                x = x - x_step
+
+                for _ = 1, pipe.h - 1 do
+                    y = y + y_step
+                    e.window.setCursorPos(x, y)
+
+                    if pipe.thin then
+                        e.window.blit("\x95", c.blit_bkg, c.blit_fgd)
+                    else
+                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+                    end
+                end
+            else
+                -- cross height then width
+                for i = 1, pipe.h do
+                    if pipe.thin then
+                        if i == pipe.h then
+                            -- corner
+                            if y_step < 0 then
+                                e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
+                            elseif y_step > 0 then
+                                e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
+                            else
+                                e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
+                            end
+                        else
+                            e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
+                        end
+                    else
+                        if i == pipe.h and y_step < 0 then
+                            -- corner
+                            e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+                        end
+                    end
+
+                    y = y + y_step
+                    e.window.setCursorPos(x, y)
+                end
+
+                -- back up one
+                y = y - y_step
+
+                for _ = 1, pipe.w - 1 do
+                    x = x + x_step
+                    e.window.setCursorPos(x, y)
+
+                    if pipe.thin then
                         e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.w and y_step > 0 then
-                        -- corner
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
                     else
-                        e.window.blit("\x8f", c.blit_fgd, c.blit_bkg)
-                    end
-                end
-
-                x = x + x_step
-                e.window.setCursorPos(x, y)
-            end
-
-            -- back up one
-            x = x - x_step
-
-            for _ = 1, pipe.h - 1 do
-                y = y + y_step
-                e.window.setCursorPos(x, y)
-
-                if pipe.thin then
-                    e.window.blit("\x95", c.blit_bkg, c.blit_fgd)
-                else
-                    e.window.blit(" ", c.blit_bkg, c.blit_fgd)
-                end
-            end
-        else
-            -- cross height then width
-            for i = 1, pipe.h do
-                if pipe.thin then
-                    if i == pipe.h then
-                        -- corner
-                        if y_step < 0 then
-                            e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
-                        else
-                            e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
-                        end
-                    else
-                        e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.h and y_step < 0 then
-                        -- corner
                         e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
-                    else
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
                     end
                 end
-
-                y = y + y_step
-                e.window.setCursorPos(x, y)
             end
+        end
+    else
+        -- build map if using thin pipes, easist way to check adjacent blocks (cannot 'cheat' like with standard width)
+        local map = {}
 
-            -- back up one
-            y = y - y_step
+        -- allocate map
+        for x = 1, args.width do
+            table.insert(map, {})
+            for _ = 1, args.height do table.insert(map[x], false) end
+        end
 
-            for _ = 1, pipe.w - 1 do
-                x = x + x_step
-                e.window.setCursorPos(x, y)
+        -- build map
+        for p = 1, #args.pipes do
+            local pipe = args.pipes[p]  ---@type pipe
 
-                if pipe.thin then
-                    e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
-                else
-                    e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
+            local x = 1 + pipe.x1
+            local y = 1 + pipe.y1
+
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+
+            local entry = { atr = pipe.align_tr, thin = pipe.thin, fg = colors.toBlit(pipe.color), bg = e.fg_bg.blit_bkg }
+
+            if pipe.align_tr then
+                -- cross width then height
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
+                end
+
+                x = x - x_step  -- back up one
+
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
+            else
+                -- cross height then width
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
+
+                y = y - y_step  -- back up one
+
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
                 end
             end
         end
 
+        -- render
+        for x = 1, args.width do
+            for y = 1, args.height do
+                local entry = map[x][y] ---@type _pipe_map_entry|false
+                local char
+                local invert = false
+
+                if entry ~= false then
+                    local function check(cx, cy)
+                        return (map[cx] ~= nil) and (map[cx][cy] ~= nil) and (map[cx][cy] ~= false) and (map[cx][cy].fg == entry.fg)
+                    end
+
+                    if entry.thin then
+                        if check(x - 1, y) then -- if left
+                            if check(x, y - 1) then -- if above
+                                if check(x + 1, y) then -- if right
+                                    if check(x, y + 1) then -- if below
+                                        char = util.trinary(entry.atr, "\x91", "\x9d")
+                                        invert = entry.atr
+                                    else -- not below
+                                        char = util.trinary(entry.atr, "\x8e", "\x8d")
+                                    end
+                                else -- not right
+                                    if check(x, y + 1) then -- if below
+                                        char = util.trinary(entry.atr, "\x91", "\x95")
+                                        invert = entry.atr
+                                    else -- not below
+                                        char = util.trinary(entry.atr, "\x8e", "\x85")
+                                    end
+                                end
+                            elseif check(x, y + 1) then-- not above, if below
+                                if check(x + 1, y) then -- if right
+                                    char = util.trinary(entry.atr, "\x93", "\x9c")
+                                    invert = entry.atr
+                                else -- not right
+                                    char = util.trinary(entry.atr, "\x93", "\x94")
+                                    invert = entry.atr
+                                end
+                            else -- not above, not below
+                                char = "\x8c"
+                            end
+                        elseif check(x + 1, y) then -- not left, if right
+                            if check(x, y - 1) then -- if above
+                                if check(x, y + 1) then -- if below
+                                    char = util.trinary(entry.atr, "\x95", "\x9d")
+                                    invert = entry.atr
+                                else -- not below
+                                    char = util.trinary(entry.atr, "\x8a", "\x8d")
+                                end
+                            else -- not above
+                                if check(x, y + 1) then -- if below
+                                    char = util.trinary(entry.atr, "\x97", "\x9c")
+                                    invert = entry.atr
+                                else -- not below
+                                    char = "\x8c"
+                                end
+                            end
+                        else -- not left, not right
+                            char = "\x95"
+                            invert = entry.atr
+                        end
+                    else
+                        if check(x, y - 1) then -- above
+                            -- not below and (if left or right)
+                            if (not check(x, y + 1)) and (check(x - 1, y) or check(x + 1, y)) then
+                                char = util.trinary(entry.atr, "\x8f", " ")
+                                invert = not entry.atr
+                            else -- not below w/ sides only
+                                char = " "
+                                invert = true
+                            end
+                        elseif check(x, y + 1) then -- not above, if below
+                            -- if left or right
+                            if (check(x - 1, y) or check(x + 1, y)) then
+                                char = "\x83"
+                                invert = true
+                            else -- not left or right
+                                char = " "
+                                invert = true
+                            end
+                        else -- not above, not below
+                            char = util.trinary(entry.atr, "\x8f", "\x83")
+                            invert = not entry.atr
+                        end
+                    end
+
+                    e.window.setCursorPos(x, y)
+
+                    if invert then
+                        e.window.blit(char, entry.bg, entry.fg)
+                    else
+                        e.window.blit(char, entry.fg, entry.bg)
+                    end
+                end
+            end
+        end
     end
 
     return e.complete()

graphics/elements/rectangle.lua

@@ -11,7 +11,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/textbox.lua

@@ -13,7 +13,7 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/elements/tiling.lua

@@ -11,7 +11,7 @@ local element = require("graphics.element")
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
----@field y? integer 1 if omitted
+---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
 ---@field height? integer parent height if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height

graphics/flasher.lua

@@ -43,8 +43,10 @@ end
 
 -- start/resume the flasher periodic
 function flasher.run()
-    active = true
-    callback_250ms()
+    if not active then
+        active = true
+        callback_250ms()
+    end
 end
 
 -- clear all blinking indicators and stop the flasher periodic

imgen.py

@@ -48,6 +48,7 @@ def make_manifest(size):
         "versions" : {
             "installer" : get_version("./ccmsi.lua"),
             "bootloader" : get_version("./startup.lua"),
+            "common" : get_version("./scada-common/util.lua", True),
             "comms" : get_version("./scada-common/comms.lua", True),
             "graphics" : get_version("./graphics/core.lua", True),
             "lockbox" : get_version("./lockbox/init.lua", True),

pocket/coreio.lua

@@ -1,35 +0,0 @@
---
--- Core I/O - Pocket Central I/O Management
---
-
-local psil = require("scada-common.psil")
-
-local coreio = {}
-
----@class pocket_core_io
-local io = {
-    ps = psil.create()
-}
-
----@enum POCKET_LINK_STATE
-local LINK_STATE = {
-    UNLINKED = 0,
-    SV_LINK_ONLY = 1,
-    API_LINK_ONLY = 2,
-    LINKED = 3
-}
-
-coreio.LINK_STATE = LINK_STATE
-
--- get the core PSIL
-function coreio.core_ps()
-    return io.ps
-end
-
--- set network link state
----@param state POCKET_LINK_STATE
-function coreio.report_link_state(state)
-    io.ps.publish("link_state", state)
-end
-
-return coreio

pocket/iocontrol.lua

@@ -0,0 +1,106 @@
+--
+-- I/O Control for Pocket Integration with Supervisor & Coordinator
+--
+
+local psil = require("scada-common.psil")
+
+local types = require("scada-common.types")
+
+local ALARM = types.ALARM
+
+local iocontrol = {}
+
+---@class pocket_ioctl
+local io = {
+    ps = psil.create()
+}
+
+---@enum POCKET_LINK_STATE
+local LINK_STATE = {
+    UNLINKED = 0,
+    SV_LINK_ONLY = 1,
+    API_LINK_ONLY = 2,
+    LINKED = 3
+}
+
+---@enum NAV_PAGE
+local NAV_PAGE = {
+    HOME = 1,
+    UNITS = 2,
+    REACTORS = 3,
+    BOILERS = 4,
+    TURBINES = 5,
+    DIAG = 6,
+    D_ALARMS = 7
+}
+
+iocontrol.LINK_STATE = LINK_STATE
+iocontrol.NAV_PAGE = NAV_PAGE
+
+-- initialize facility-independent components of pocket iocontrol
+---@param comms pocket_comms
+function iocontrol.init_core(comms)
+    ---@class pocket_ioctl_diag
+    io.diag = {}
+
+    -- alarm testing
+    io.diag.tone_test = {
+        test_1 = function (state) comms.diag__set_alarm_tone(1, state) end,
+        test_2 = function (state) comms.diag__set_alarm_tone(2, state) end,
+        test_3 = function (state) comms.diag__set_alarm_tone(3, state) end,
+        test_4 = function (state) comms.diag__set_alarm_tone(4, state) end,
+        test_5 = function (state) comms.diag__set_alarm_tone(5, state) end,
+        test_6 = function (state) comms.diag__set_alarm_tone(6, state) end,
+        test_7 = function (state) comms.diag__set_alarm_tone(7, state) end,
+        test_8 = function (state) comms.diag__set_alarm_tone(8, state) end,
+        stop_tones = function () comms.diag__set_alarm_tone(0, false) end,
+
+        test_breach = function (state) comms.diag__set_alarm(ALARM.ContainmentBreach, state) end,
+        test_rad = function (state) comms.diag__set_alarm(ALARM.ContainmentRadiation, state) end,
+        test_lost = function (state) comms.diag__set_alarm(ALARM.ReactorLost, state) end,
+        test_crit = function (state) comms.diag__set_alarm(ALARM.CriticalDamage, state) end,
+        test_dmg = function (state) comms.diag__set_alarm(ALARM.ReactorDamage, state) end,
+        test_overtemp = function (state) comms.diag__set_alarm(ALARM.ReactorOverTemp, state) end,
+        test_hightemp = function (state) comms.diag__set_alarm(ALARM.ReactorHighTemp, state) end,
+        test_wasteleak = function (state) comms.diag__set_alarm(ALARM.ReactorWasteLeak, state) end,
+        test_highwaste = function (state) comms.diag__set_alarm(ALARM.ReactorHighWaste, state) end,
+        test_rps = function (state) comms.diag__set_alarm(ALARM.RPSTransient, state) end,
+        test_rcs = function (state) comms.diag__set_alarm(ALARM.RCSTransient, state) end,
+        test_turbinet = function (state) comms.diag__set_alarm(ALARM.TurbineTrip, state) end,
+        stop_alarms = function () comms.diag__set_alarm(0, false) end,
+
+        get_tone_states = function () comms.diag__get_alarm_tones() end,
+
+        ready_warn = nil,       ---@type graphics_element
+        tone_buttons = {},
+        alarm_buttons = {},
+        tone_indicators = {}    -- indicators to update from supervisor tone states
+    }
+
+    ---@class pocket_nav
+    io.nav = {
+        page = NAV_PAGE.HOME,   ---@type NAV_PAGE
+        sub_pages = { NAV_PAGE.HOME, NAV_PAGE.UNITS, NAV_PAGE.REACTORS, NAV_PAGE.BOILERS, NAV_PAGE.TURBINES, NAV_PAGE.DIAG },
+        tasks = {}
+    }
+
+    -- add a task to be performed periodically while on a given page
+    ---@param page NAV_PAGE page to add task to
+    ---@param task function function to execute
+    function io.nav.register_task(page, task)
+        if io.nav.tasks[page] == nil then io.nav.tasks[page] = {} end
+        table.insert(io.nav.tasks[page], task)
+    end
+end
+
+-- initialize facility-dependent components of pocket iocontrol
+function iocontrol.init_fac() end
+
+-- set network link state
+---@param state POCKET_LINK_STATE
+function iocontrol.report_link_state(state) io.ps.publish("link_state", state) end
+
+-- get the IO controller database
+function iocontrol.get_db() return io end
+
+return iocontrol

pocket/pocket.lua

@@ -1,16 +1,15 @@
-local comms  = require("scada-common.comms")
-local log    = require("scada-common.log")
-local util   = require("scada-common.util")
+local comms     = require("scada-common.comms")
+local log       = require("scada-common.log")
+local util      = require("scada-common.util")
 
-local coreio = require("pocket.coreio")
+local iocontrol = require("pocket.iocontrol")
 
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
 local ESTABLISH_ACK = comms.ESTABLISH_ACK
 local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
--- local CAPI_TYPE = comms.CAPI_TYPE
 
-local LINK_STATE = coreio.LINK_STATE
+local LINK_STATE = iocontrol.LINK_STATE
 
 local pocket = {}
 
@@ -79,20 +78,6 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         self.api.seq_num = self.api.seq_num + 1
     end
 
-    -- send a packet to the coordinator API
-    -----@param msg_type CAPI_TYPE
-    -----@param msg table
-    -- local function _send_api(msg_type, msg)
-    --     local s_pkt = comms.scada_packet()
-    --     local pkt = comms.capi_packet()
-
-    --     pkt.make(msg_type, msg)
-    --     s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.COORD_API, pkt.raw_sendable())
-
-    --     nic.transmit(crd_channel, pkt_channel, s_pkt)
-    --     self.api.seq_num = self.api.seq_num + 1
-    -- end
-
     -- attempt supervisor connection establishment
     local function _send_sv_establish()
         _send_sv(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
@@ -147,7 +132,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
     -- attempt to re-link if any of the dependent links aren't active
     function public.link_update()
         if not self.sv.linked then
-            coreio.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
+            iocontrol.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
 
             if self.establish_delay_counter <= 0 then
                 _send_sv_establish()
@@ -156,7 +141,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 self.establish_delay_counter = self.establish_delay_counter - 1
             end
         elseif not self.api.linked then
-            coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
+            iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
 
             if self.establish_delay_counter <= 0 then
                 _send_api_establish()
@@ -166,10 +151,29 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
             end
         else
             -- linked, all good!
-            coreio.report_link_state(LINK_STATE.LINKED)
+            iocontrol.report_link_state(LINK_STATE.LINKED)
         end
     end
 
+    -- supervisor get active alarm tones
+    function public.diag__get_alarm_tones()
+        if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_TONE_GET, {}) end
+    end
+
+    -- supervisor test alarm tones by tone
+    ---@param id TONE|0 tone ID, or 0 to stop all
+    ---@param state boolean tone state
+    function public.diag__set_alarm_tone(id, state)
+        if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_TONE_SET, { id, state }) end
+    end
+
+    -- supervisor test alarm tones by alarm
+    ---@param id ALARM|0 alarm ID, 0 to stop all
+    ---@param state boolean alarm state
+    function public.diag__set_alarm(id, state)
+        if self.sv.linked then _send_sv(SCADA_MGMT_TYPE.DIAG_ALARM_SET, { id, state }) end
+    end
+
     -- parse a packet
     ---@param side string
     ---@param sender integer
@@ -205,6 +209,8 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
     -- handle a packet
     ---@param packet mgmt_frame|capi_frame|nil
     function public.handle_packet(packet)
+        local diag = iocontrol.get_db().diag
+
         if packet ~= nil then
             local l_chan   = packet.scada_frame.local_channel()
             local r_chan   = packet.scada_frame.remote_channel()
@@ -231,47 +237,9 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 -- feed watchdog on valid sequence number
                 api_watchdog.feed()
 
-                if protocol == PROTOCOL.COORD_API then
-                    ---@cast packet capi_frame
-                elseif protocol == PROTOCOL.SCADA_MGMT then
+                if protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
-                        -- connection with coordinator established
-                        if packet.length == 1 then
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                log.info("coordinator connection established")
-                                self.establish_delay_counter = 0
-                                self.api.linked = true
-                                self.api.addr = src_addr
-
-                                if self.sv.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
-                                else
-                                    coreio.report_link_state(LINK_STATE.API_LINK_ONLY)
-                                end
-                            elseif est_ack == ESTABLISH_ACK.DENY then
-                                if self.api.last_est_ack ~= est_ack then
-                                    log.info("coordinator connection denied")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                if self.api.last_est_ack ~= est_ack then
-                                    log.info("coordinator connection denied due to collision")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                if self.api.last_est_ack ~= est_ack then
-                                    log.info("coordinator comms version mismatch")
-                                end
-                            else
-                                log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
-                            end
-
-                            self.api.last_est_ack = est_ack
-                        else
-                            log.debug("coordinator SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.api.linked then
+                    if self.api.linked then
                         if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
@@ -298,6 +266,42 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from coordinator")
                         end
+                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                        -- connection with coordinator established
+                        if packet.length == 1 then
+                            local est_ack = packet.data[1]
+
+                            if est_ack == ESTABLISH_ACK.ALLOW then
+                                log.info("coordinator connection established")
+                                self.establish_delay_counter = 0
+                                self.api.linked = true
+                                self.api.addr = src_addr
+
+                                if self.sv.linked then
+                                    iocontrol.report_link_state(LINK_STATE.LINKED)
+                                else
+                                    iocontrol.report_link_state(LINK_STATE.API_LINK_ONLY)
+                                end
+                            elseif est_ack == ESTABLISH_ACK.DENY then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator connection denied")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.COLLISION then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator connection denied due to collision")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator comms version mismatch")
+                                end
+                            else
+                                log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
+                            end
+
+                            self.api.last_est_ack = est_ack
+                        else
+                            log.debug("coordinator SCADA_MGMT establish packet length mismatch")
+                        end
                     else
                         log.debug("discarding coordinator non-link SCADA_MGMT packet before linked")
                     end
@@ -325,43 +329,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 -- handle packet
                 if protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
-                        -- connection with supervisor established
-                        if packet.length == 1 then
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                log.info("supervisor connection established")
-                                self.establish_delay_counter = 0
-                                self.sv.linked = true
-                                self.sv.addr = src_addr
-
-                                if self.api.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
-                                else
-                                    coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
-                                end
-                            elseif est_ack == ESTABLISH_ACK.DENY then
-                                if self.sv.last_est_ack ~= est_ack then
-                                    log.info("supervisor connection denied")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                if self.sv.last_est_ack ~= est_ack then
-                                    log.info("supervisor connection denied due to collision")
-                                end
-                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                if self.sv.last_est_ack ~= est_ack then
-                                    log.info("supervisor comms version mismatch")
-                                end
-                            else
-                                log.debug("supervisor SCADA_MGMT establish packet reply unsupported")
-                            end
-
-                            self.sv.last_est_ack = est_ack
-                        else
-                            log.debug("supervisor SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.sv.linked then
+                    if self.sv.linked then
                         if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
@@ -385,9 +353,90 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                             self.sv.r_seq_num = nil
                             self.sv.addr = comms.BROADCAST
                             log.info("supervisor server connection closed by remote host")
+                        elseif packet.type == SCADA_MGMT_TYPE.DIAG_TONE_GET then
+                            if packet.length == 8 then
+                                for i = 1, #packet.data do
+                                    diag.tone_test.tone_indicators[i].update(packet.data[i] == true)
+                                end
+                            else
+                                log.debug("supervisor SCADA diag alarm states packet length mismatch")
+                            end
+                        elseif packet.type == SCADA_MGMT_TYPE.DIAG_TONE_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag tone set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.tone_buttons[i] ~= nil then
+                                        diag.tone_test.tone_buttons[i].set_value(states[i] == true)
+                                        diag.tone_test.tone_indicators[i].update(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag tone set packet length/type mismatch")
+                            end
+                        elseif packet.type == SCADA_MGMT_TYPE.DIAG_ALARM_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag alarm set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.alarm_buttons[i] ~= nil then
+                                        diag.tone_test.alarm_buttons[i].set_value(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag alarm set packet length/type mismatch")
+                            end
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from supervisor")
                         end
+                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                        -- connection with supervisor established
+                        if packet.length == 1 then
+                            local est_ack = packet.data[1]
+
+                            if est_ack == ESTABLISH_ACK.ALLOW then
+                                log.info("supervisor connection established")
+                                self.establish_delay_counter = 0
+                                self.sv.linked = true
+                                self.sv.addr = src_addr
+
+                                if self.api.linked then
+                                    iocontrol.report_link_state(LINK_STATE.LINKED)
+                                else
+                                    iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
+                                end
+                            elseif est_ack == ESTABLISH_ACK.DENY then
+                                if self.sv.last_est_ack ~= est_ack then
+                                    log.info("supervisor connection denied")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.COLLISION then
+                                if self.sv.last_est_ack ~= est_ack then
+                                    log.info("supervisor connection denied due to collision")
+                                end
+                            elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
+                                if self.sv.last_est_ack ~= est_ack then
+                                    log.info("supervisor comms version mismatch")
+                                end
+                            else
+                                log.debug("supervisor SCADA_MGMT establish packet reply unsupported")
+                            end
+
+                            self.sv.last_est_ack = est_ack
+                        else
+                            log.debug("supervisor SCADA_MGMT establish packet length mismatch")
+                        end
                     else
                         log.debug("discarding supervisor non-link SCADA_MGMT packet before linked")
                     end

pocket/startup.lua

@@ -4,21 +4,21 @@
 
 require("/initenv").init_env()
 
-local crash    = require("scada-common.crash")
-local log      = require("scada-common.log")
-local network  = require("scada-common.network")
-local ppm      = require("scada-common.ppm")
-local tcd      = require("scada-common.tcd")
-local util     = require("scada-common.util")
+local crash     = require("scada-common.crash")
+local log       = require("scada-common.log")
+local network   = require("scada-common.network")
+local ppm       = require("scada-common.ppm")
+local tcd       = require("scada-common.tcd")
+local util      = require("scada-common.util")
 
-local core     = require("graphics.core")
+local core      = require("graphics.core")
 
-local config   = require("pocket.config")
-local coreio   = require("pocket.coreio")
-local pocket   = require("pocket.pocket")
-local renderer = require("pocket.renderer")
+local config    = require("pocket.config")
+local iocontrol = require("pocket.iocontrol")
+local pocket    = require("pocket.pocket")
+local renderer  = require("pocket.renderer")
 
-local POCKET_VERSION = "alpha-v0.5.1"
+local POCKET_VERSION = "v0.6.0-alpha"
 
 local println = util.println
 local println_ts = util.println_ts
@@ -73,7 +73,7 @@ local function main()
         network.init_mac(config.AUTH_KEY)
     end
 
-    coreio.report_link_state(coreio.LINK_STATE.UNLINKED)
+    iocontrol.report_link_state(iocontrol.LINK_STATE.UNLINKED)
 
     -- get the communications modem
     local modem = ppm.get_wireless_modem()
@@ -104,6 +104,9 @@ local function main()
     local MAIN_CLOCK = 0.5
     local loop_clock = util.new_clock(MAIN_CLOCK)
 
+    -- init I/O control
+    iocontrol.init_core(pocket_comms)
+
     ----------------------------------------
     -- start the UI
     ----------------------------------------
@@ -112,7 +115,7 @@ local function main()
     if not ui_ok then
         renderer.close_ui()
         println(util.c("UI error: ", message))
-        log.error(util.c("startup> GUI crashed with error ", message))
+        log.error(util.c("startup> GUI render failed with error ", message))
     else
         -- start clock
         loop_clock.start()
@@ -128,6 +131,9 @@ local function main()
         conn_wd.api.feed()
         log.debug("startup> conn watchdog started")
 
+        local io_db = iocontrol.get_db()
+        local nav   = io_db.nav
+
         -- main event loop
         while true do
             local event, param1, param2, param3, param4, param5 = util.pull_event()
@@ -140,6 +146,13 @@ local function main()
                     -- relink if necessary
                     pocket_comms.link_update()
 
+                    -- update any tasks for the active page
+                    if (type(nav.tasks[nav.page]) == "table") then
+                        for i = 1, #nav.tasks[nav.page] do
+                            nav.tasks[nav.page][i]()
+                        end
+                    end
+
                     loop_clock.start()
                 elseif conn_wd.sv.is_timer(param1) then
                     -- supervisor watchdog timeout

pocket/ui/main.lua

@@ -2,17 +2,18 @@
 -- Pocket GUI Root
 --
 
-local coreio        = require("pocket.coreio")
+local iocontrol    = require("pocket.iocontrol")
 
 local style        = require("pocket.ui.style")
 
 local conn_waiting = require("pocket.ui.components.conn_waiting")
 
-local home_page    = require("pocket.ui.pages.home_page")
-local unit_page    = require("pocket.ui.pages.unit_page")
-local reactor_page = require("pocket.ui.pages.reactor_page")
 local boiler_page  = require("pocket.ui.pages.boiler_page")
+local diag_page    = require("pocket.ui.pages.diag_page")
+local home_page    = require("pocket.ui.pages.home_page")
+local reactor_page = require("pocket.ui.pages.reactor_page")
 local turbine_page = require("pocket.ui.pages.turbine_page")
+local unit_page    = require("pocket.ui.pages.unit_page")
 
 local core         = require("graphics.core")
 
@@ -22,6 +23,9 @@ local TextBox      = require("graphics.elements.textbox")
 
 local Sidebar      = require("graphics.elements.controls.sidebar")
 
+local LINK_STATE = iocontrol.LINK_STATE
+local NAV_PAGE   = iocontrol.NAV_PAGE
+
 local TEXT_ALIGN = core.TEXT_ALIGN
 
 local cpair = core.cpair
@@ -29,6 +33,9 @@ local cpair = core.cpair
 -- create new main view
 ---@param main graphics_element main displaybox
 local function init(main)
+    local nav = iocontrol.get_db().nav
+    local ps  = iocontrol.get_db().ps
+
     -- window header message
     TextBox{parent=main,y=1,text="",alignment=TEXT_ALIGN.LEFT,height=1,fg_bg=style.header}
 
@@ -45,10 +52,10 @@ local function init(main)
 
     local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes=root_panes}
 
-    root_pane.register(coreio.core_ps(), "link_state", function (state)
-        if state == coreio.LINK_STATE.UNLINKED or state == coreio.LINK_STATE.API_LINK_ONLY then
+    root_pane.register(ps, "link_state", function (state)
+        if state == LINK_STATE.UNLINKED or state == LINK_STATE.API_LINK_ONLY then
             root_pane.set_value(1)
-        elseif state == coreio.LINK_STATE.SV_LINK_ONLY then
+        elseif state == LINK_STATE.SV_LINK_ONLY then
             root_pane.set_value(2)
         else
             root_pane.set_value(3)
@@ -81,19 +88,36 @@ local function init(main)
         {
             char = "T",
             color = cpair(colors.black,colors.white)
+        },
+        {
+            char = "D",
+            color = cpair(colors.black,colors.orange)
         }
     }
 
-    local pane_1 = home_page(page_div)
-    local pane_2 = unit_page(page_div)
-    local pane_3 = reactor_page(page_div)
-    local pane_4 = boiler_page(page_div)
-    local pane_5 = turbine_page(page_div)
-    local panes = { pane_1, pane_2, pane_3, pane_4, pane_5 }
+    local panes = { home_page(page_div), unit_page(page_div), reactor_page(page_div),  boiler_page(page_div), turbine_page(page_div), diag_page(page_div) }
 
     local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
 
-    Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=page_pane.set_value}
+    local function navigate_sidebar(page)
+        if page == 1 then
+            nav.page = nav.sub_pages[NAV_PAGE.HOME]
+        elseif page == 2 then
+            nav.page = nav.sub_pages[NAV_PAGE.UNITS]
+        elseif page == 3 then
+            nav.page = nav.sub_pages[NAV_PAGE.REACTORS]
+        elseif page == 4 then
+            nav.page = nav.sub_pages[NAV_PAGE.BOILERS]
+        elseif page == 5 then
+            nav.page = nav.sub_pages[NAV_PAGE.TURBINES]
+        elseif page == 6 then
+            nav.page = nav.sub_pages[NAV_PAGE.DIAG]
+        end
+
+        page_pane.set_value(page)
+    end
+
+    Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=navigate_sidebar}
 end
 
 return init

pocket/ui/pages/diag_page.lua

@@ -0,0 +1,147 @@
+local iocontrol      = require("pocket.iocontrol")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local MultiPane      = require("graphics.elements.multipane")
+local TextBox        = require("graphics.elements.textbox")
+
+local IndicatorLight = require("graphics.elements.indicators.light")
+
+local App            = require("graphics.elements.controls.app")
+local Checkbox       = require("graphics.elements.controls.checkbox")
+local PushButton     = require("graphics.elements.controls.push_button")
+local SwitchButton   = require("graphics.elements.controls.switch_button")
+
+local cpair = core.cpair
+
+local NAV_PAGE = iocontrol.NAV_PAGE
+
+local TEXT_ALIGN = core.TEXT_ALIGN
+
+-- new diagnostics page view
+---@param root graphics_element parent
+local function new_view(root)
+    local db = iocontrol.get_db()
+
+    local main = Div{parent=root,x=1,y=1}
+
+    local diag_home = Div{parent=main,x=1,y=1}
+
+    TextBox{parent=diag_home,text="Diagnostic Apps",x=1,y=2,height=1,alignment=TEXT_ALIGN.CENTER}
+
+    local alarm_test = Div{parent=main,x=1,y=1}
+
+    local panes = { diag_home, alarm_test }
+
+    local page_pane = MultiPane{parent=main,x=1,y=1,panes=panes}
+
+    local function navigate_diag()
+        page_pane.set_value(1)
+        db.nav.page = NAV_PAGE.DIAG
+        db.nav.sub_pages[NAV_PAGE.DIAG] = NAV_PAGE.DIAG
+    end
+
+    local function navigate_alarm()
+        page_pane.set_value(2)
+        db.nav.page = NAV_PAGE.D_ALARMS
+        db.nav.sub_pages[NAV_PAGE.DIAG] = NAV_PAGE.D_ALARMS
+    end
+
+    ------------------------
+    -- Alarm Testing Page --
+    ------------------------
+
+    db.nav.register_task(NAV_PAGE.D_ALARMS, db.diag.tone_test.get_tone_states)
+
+    local ttest = db.diag.tone_test
+
+    local c_wht_gray = cpair(colors.white, colors.gray)
+    local c_red_gray = cpair(colors.red, colors.gray)
+    local c_yel_gray = cpair(colors.yellow, colors.gray)
+    local c_blue_gray = cpair(colors.blue, colors.gray)
+
+    local audio = Div{parent=alarm_test,x=1,y=1}
+
+    TextBox{parent=audio,y=1,text="Alarm Sounder Tests",height=1,alignment=TEXT_ALIGN.CENTER}
+
+    ttest.ready_warn = TextBox{parent=audio,y=2,text="",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.yellow,colors.black)}
+
+    PushButton{parent=audio,x=13,y=18,text="\x11 BACK",min_width=8,fg_bg=cpair(colors.black,colors.lightGray),active_fg_bg=c_wht_gray,callback=navigate_diag}
+
+    local tones = Div{parent=audio,x=2,y=3,height=10,width=8,fg_bg=cpair(colors.black,colors.yellow)}
+
+    TextBox{parent=tones,text="Tones",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local test_btns = {}
+    test_btns[1] = SwitchButton{parent=tones,text="TEST 1",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_1}
+    test_btns[2] = SwitchButton{parent=tones,text="TEST 2",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_2}
+    test_btns[3] = SwitchButton{parent=tones,text="TEST 3",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_3}
+    test_btns[4] = SwitchButton{parent=tones,text="TEST 4",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_4}
+    test_btns[5] = SwitchButton{parent=tones,text="TEST 5",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_5}
+    test_btns[6] = SwitchButton{parent=tones,text="TEST 6",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_6}
+    test_btns[7] = SwitchButton{parent=tones,text="TEST 7",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_7}
+    test_btns[8] = SwitchButton{parent=tones,text="TEST 8",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_8}
+
+    ttest.tone_buttons = test_btns
+
+    local function stop_all_tones()
+        for i = 1, #test_btns do test_btns[i].set_value(false) end
+        ttest.stop_tones()
+    end
+
+    PushButton{parent=tones,text="STOP",min_width=8,active_fg_bg=c_wht_gray,fg_bg=cpair(colors.black,colors.red),callback=stop_all_tones}
+
+    local alarms = Div{parent=audio,x=11,y=3,height=15,fg_bg=cpair(colors.lightGray,colors.black)}
+
+    TextBox{parent=alarms,text="Alarms (\x13)",height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local alarm_btns = {}
+    alarm_btns[1] = Checkbox{parent=alarms,label="BREACH",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_breach}
+    alarm_btns[2] = Checkbox{parent=alarms,label="RADIATION",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_rad}
+    alarm_btns[3] = Checkbox{parent=alarms,label="RCT LOST",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_lost}
+    alarm_btns[4] = Checkbox{parent=alarms,label="CRIT DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_crit}
+    alarm_btns[5] = Checkbox{parent=alarms,label="DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_dmg}
+    alarm_btns[6] = Checkbox{parent=alarms,label="OVER TEMP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_overtemp}
+    alarm_btns[7] = Checkbox{parent=alarms,label="HIGH TEMP",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_hightemp}
+    alarm_btns[8] = Checkbox{parent=alarms,label="WASTE LEAK",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_wasteleak}
+    alarm_btns[9] = Checkbox{parent=alarms,label="WASTE HIGH",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_highwaste}
+    alarm_btns[10] = Checkbox{parent=alarms,label="RPS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rps}
+    alarm_btns[11] = Checkbox{parent=alarms,label="RCS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rcs}
+    alarm_btns[12] = Checkbox{parent=alarms,label="TURBINE TRP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_turbinet}
+
+    ttest.alarm_buttons = alarm_btns
+
+    local function stop_all_alarms()
+        for i = 1, #alarm_btns do alarm_btns[i].set_value(false) end
+        ttest.stop_alarms()
+    end
+
+    PushButton{parent=alarms,x=3,y=15,text="STOP \x13",min_width=8,fg_bg=cpair(colors.black,colors.red),active_fg_bg=c_wht_gray,callback=stop_all_alarms}
+
+    local states = Div{parent=audio,x=2,y=14,height=5,width=8}
+
+    TextBox{parent=states,text="States",height=1,alignment=TEXT_ALIGN.CENTER}
+    local t_1 = IndicatorLight{parent=states,label="1",colors=c_blue_gray}
+    local t_2 = IndicatorLight{parent=states,label="2",colors=c_blue_gray}
+    local t_3 = IndicatorLight{parent=states,label="3",colors=c_blue_gray}
+    local t_4 = IndicatorLight{parent=states,label="4",colors=c_blue_gray}
+    local t_5 = IndicatorLight{parent=states,x=6,y=2,label="5",colors=c_blue_gray}
+    local t_6 = IndicatorLight{parent=states,x=6,label="6",colors=c_blue_gray}
+    local t_7 = IndicatorLight{parent=states,x=6,label="7",colors=c_blue_gray}
+    local t_8 = IndicatorLight{parent=states,x=6,label="8",colors=c_blue_gray}
+
+    ttest.tone_indicators = { t_1, t_2, t_3, t_4, t_5, t_6, t_7, t_8 }
+
+    --------------
+    -- App List --
+    --------------
+
+    App{parent=diag_home,x=3,y=4,text="\x0f",title="Alarm",callback=navigate_alarm,app_fg_bg=cpair(colors.black,colors.red),active_fg_bg=cpair(colors.white,colors.gray)}
+    App{parent=diag_home,x=10,y=4,text="\x1e",title="LoopT",callback=function()end,app_fg_bg=cpair(colors.black,colors.cyan)}
+    App{parent=diag_home,x=17,y=4,text="@",title="Comps",callback=function()end,app_fg_bg=cpair(colors.black,colors.orange)}
+
+    return main
+end
+
+return new_view

pocket/ui/pages/home_page.lua

@@ -1,20 +1,21 @@
--- local style   = require("pocket.ui.style")
+local core  = require("graphics.core")
 
-local core    = require("graphics.core")
+local Div   = require("graphics.elements.div")
 
-local Div     = require("graphics.elements.div")
-local TextBox = require("graphics.elements.textbox")
+local App   = require("graphics.elements.controls.app")
 
--- local cpair = core.cpair
-
-local TEXT_ALIGN = core.TEXT_ALIGN
+local cpair = core.cpair
 
 -- new home page view
 ---@param root graphics_element parent
 local function new_view(root)
     local main = Div{parent=root,x=1,y=1}
 
-    TextBox{parent=main,text="HOME",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
+    App{parent=main,x=3,y=2,text="\x17",title="PRC",callback=function()end,app_fg_bg=cpair(colors.black,colors.purple)}
+    App{parent=main,x=10,y=2,text="\x15",title="CTL",callback=function()end,app_fg_bg=cpair(colors.black,colors.green)}
+    App{parent=main,x=17,y=2,text="\x08",title="DEV",callback=function()end,app_fg_bg=cpair(colors.black,colors.lightGray)}
+    App{parent=main,x=3,y=7,text="\x7f",title="Waste",callback=function()end,app_fg_bg=cpair(colors.black,colors.brown)}
+    App{parent=main,x=10,y=7,text="\xb6",title="Guide",callback=function()end,app_fg_bg=cpair(colors.black,colors.cyan)}
 
     return main
 end

reactor-plc/panel/front_panel.lua

@@ -1,5 +1,5 @@
 --
--- Main SCADA Coordinator GUI
+-- Reactor PLC Front Panel GUI
 --
 
 local types      = require("scada-common.types")
@@ -28,7 +28,7 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 local cpair = core.cpair
 local border = core.border
 
--- create new main view
+-- create new front panel view
 ---@param panel graphics_element main displaybox
 local function init(panel)
     local header = TextBox{parent=panel,y=1,text="REACTOR PLC - UNIT ?",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}

reactor-plc/panel/style.lua

@@ -12,6 +12,7 @@ local cpair = core.cpair
 
 -- remap global colors
 colors.ivory = colors.pink
+colors.yellow_hc = colors.purple
 colors.red_off = colors.brown
 colors.yellow_off = colors.magenta
 colors.green_off = colors.lime
@@ -28,7 +29,7 @@ style.colors = {
     { c = colors.cyan,      hex = 0x34bac8 },
     { c = colors.lightBlue, hex = 0x6cc0f2 },
     { c = colors.blue,      hex = 0x0096ff },
-    { c = colors.purple,    hex = 0xb156ee },
+    { c = colors.purple,    hex = 0xb156ee },   -- YELLOW HIGH CONTRAST
     { c = colors.pink,      hex = 0xdcd9ca },   -- IVORY
     { c = colors.magenta,   hex = 0x85862c },   -- YELLOW OFF
     -- { c = colors.white,     hex = 0xdcd9ca },

reactor-plc/plc.lua

@@ -929,47 +929,7 @@ function plc.comms(id, version, nic, plc_channel, svr_channel, range, reactor, r
                 ---@cast packet mgmt_frame
                 -- if linked, only accept packets from configured supervisor
                 if self.linked then
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
-                        -- link request confirmation
-                        if packet.length == 1 then
-                            log.debug("received unsolicited establish response")
-
-                            local est_ack = packet.data[1]
-
-                            if est_ack == ESTABLISH_ACK.ALLOW then
-                                self.status_cache = nil
-                                _send_struct()
-                                public.send_status(plc_state.no_reactor, plc_state.reactor_formed)
-                                log.debug("re-sent initial status data due to re-establish")
-                            else
-                                if est_ack == ESTABLISH_ACK.DENY then
-                                    println_ts("received unsolicited link denial, unlinking")
-                                    log.warning("unsolicited establish request denied")
-                                elseif est_ack == ESTABLISH_ACK.COLLISION then
-                                    println_ts("received unsolicited link collision, unlinking")
-                                    log.warning("unsolicited establish request collision")
-                                elseif est_ack == ESTABLISH_ACK.BAD_VERSION then
-                                    println_ts("received unsolicited link version mismatch, unlinking")
-                                    log.warning("unsolicited establish request version mismatch")
-                                else
-                                    println_ts("invalid unsolicited link response")
-                                    log.debug("unsolicited unknown establish request response")
-                                end
-
-                                -- unlink
-                                self.sv_addr = comms.BROADCAST
-                                self.linked = false
-                            end
-
-                            -- clear this since this is for something that was unsolicited
-                            self.last_est_ack = ESTABLISH_ACK.ALLOW
-
-                            -- report link state
-                            databus.tx_link_state(est_ack + 1)
-                        else
-                            log.debug("SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
+                    if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
                         -- keep alive request received, echo back
                         if packet.length == 1 and type(packet.data[1]) == "number" then
                             local timestamp = packet.data[1]

reactor-plc/startup.lua

@@ -19,7 +19,7 @@ local plc      = require("reactor-plc.plc")
 local renderer = require("reactor-plc.renderer")
 local threads  = require("reactor-plc.threads")
 
-local R_PLC_VERSION = "v1.5.0"
+local R_PLC_VERSION = "v1.5.6"
 
 local println = util.println
 local println_ts = util.println_ts
@@ -190,7 +190,7 @@ local function main()
                 renderer.close_ui()
                 println_ts(util.c("UI error: ", message))
                 println("init> running without front panel")
-                log.error(util.c("GUI crashed with error ", message))
+                log.error(util.c("front panel GUI render failed with error ", message))
                 log.info("init> running in headless mode without front panel")
             end
         end

reactor-plc/threads.lua

@@ -77,7 +77,7 @@ function threads.thread__main(smem, init)
                     loop_clock.start()
 
                     -- send updated data
-                    if nic.connected() then
+                    if nic.is_connected() then
                         if plc_comms.is_linked() then
                             smem.q.mq_comms_tx.push_command(MQ__COMM_CMD.SEND_STATUS)
                         else
@@ -116,7 +116,7 @@ function threads.thread__main(smem, init)
                             smem.q.mq_rps.push_command(MQ__RPS_CMD.SCRAM)
 
                             -- determine if we are still in a degraded state
-                            if (not networked) or nic.connected() then
+                            if (not networked) or nic.is_connected() then
                                 plc_state.degraded = false
                             end
 
@@ -146,7 +146,7 @@ function threads.thread__main(smem, init)
 
                 -- update indicators
                 databus.tx_hw_status(plc_state)
-            elseif event == "modem_message" and networked and plc_state.init_ok and nic.connected() then
+            elseif event == "modem_message" and networked and plc_state.init_ok and nic.is_connected() then
                 -- got a packet
                 local packet = plc_comms.parse_packet(param1, param2, param3, param4, param5)
                 if packet ~= nil then
@@ -165,7 +165,7 @@ function threads.thread__main(smem, init)
                 local type, device = ppm.handle_unmount(param1)
 
                 if type ~= nil and device ~= nil then
-                    if type == "fissionReactorLogicAdapter" then
+                    if device == plc_dev.reactor then
                         println_ts("reactor disconnected!")
                         log.error("reactor logic adapter disconnected")
 
@@ -177,16 +177,21 @@ function threads.thread__main(smem, init)
                             nic.disconnect()
 
                             println_ts("comms modem disconnected!")
-                            log.error("comms modem disconnected")
+                            log.warning("comms modem disconnected")
 
-                            plc_state.no_modem = true
+                            local other_modem = ppm.get_wireless_modem()
+                            if other_modem then
+                                log.info("found another wireless modem, using it for comms")
+                                nic.connect(other_modem)
+                            else
+                                plc_state.no_modem = true
+                                plc_state.degraded = true
 
-                            if plc_state.init_ok then
-                                -- try to scram reactor if it is still connected
-                                smem.q.mq_rps.push_command(MQ__RPS_CMD.DEGRADED_SCRAM)
+                                if plc_state.init_ok then
+                                    -- try to scram reactor if it is still connected
+                                    smem.q.mq_rps.push_command(MQ__RPS_CMD.DEGRADED_SCRAM)
+                                end
                             end
-
-                            plc_state.degraded = true
                         else
                             log.warning("non-comms modem disconnected")
                         end
@@ -200,7 +205,7 @@ function threads.thread__main(smem, init)
                 local type, device = ppm.mount(param1)
 
                 if type ~= nil and device ~= nil then
-                    if type == "fissionReactorLogicAdapter" then
+                    if plc_state.no_reactor and (type == "fissionReactorLogicAdapter") then
                         -- reconnected reactor
                         plc_dev.reactor = device
                         plc_state.no_reactor = false
@@ -230,7 +235,7 @@ function threads.thread__main(smem, init)
                             rps.reset()
                         end
                     elseif networked and type == "modem" then
-                        if device.isWireless() then
+                        if device.isWireless() and not nic.is_connected() then
                             -- reconnected modem
                             plc_dev.modem = device
                             plc_state.no_modem = false
@@ -244,6 +249,8 @@ function threads.thread__main(smem, init)
                             if not plc_state.no_reactor then
                                 plc_state.degraded = false
                             end
+                        elseif device.isWireless() then
+                            log.info("unused wireless modem reconnected")
                         else
                             log.info("wired modem reconnected")
                         end

rtu/config.lua

@@ -15,6 +15,10 @@ config.COMMS_TIMEOUT = 5
 -- all devices on the same network must use the same key
 -- config.AUTH_KEY = "SCADAfacility123"
 
+-- alarm sounder volume (0.0 to 3.0, 1.0 being standard max volume, this is the option given to to speaker.play())
+-- note: alarm sine waves are at half saturation, so that multiple will be required to reach full scale
+config.SOUNDER_VOLUME = 1.0
+
 -- log path
 config.LOG_PATH = "/log.txt"
 -- log mode

rtu/databus.lua

@@ -37,6 +37,12 @@ function databus.tx_hw_modem(has_modem)
     databus.ps.publish("has_modem", has_modem)
 end
 
+-- transmit the number of speakers connected
+---@param count integer
+function databus.tx_hw_spkr_count(count)
+    databus.ps.publish("speaker_count", count)
+end
+
 -- transmit unit hardware type across the bus
 ---@param uid integer unit ID
 ---@param type RTU_UNIT_TYPE

rtu/dev/boilerv_rtu.lua

@@ -2,7 +2,7 @@ local rtu = require("rtu.rtu")
 
 local boilerv_rtu = {}
 
--- create new boiler (mek 10.1+) device
+-- create new boiler device
 ---@nodiscard
 ---@param boiler table
 ---@return rtu_device interface, boolean faulted

rtu/dev/dynamicv_rtu.lua

@@ -0,0 +1,48 @@
+local rtu = require("rtu.rtu")
+
+local dynamicv_rtu = {}
+
+-- create new dynamic tank device
+---@nodiscard
+---@param dynamic_tank table
+---@return rtu_device interface, boolean faulted
+function dynamicv_rtu.new(dynamic_tank)
+    local unit = rtu.init_unit()
+
+    -- disable auto fault clearing
+    dynamic_tank.__p_clear_fault()
+    dynamic_tank.__p_disable_afc()
+
+    -- discrete inputs --
+    unit.connect_di(dynamic_tank.isFormed)
+
+    -- coils --
+    unit.connect_coil(function () dynamic_tank.incrementContainerEditMode() end, function () end)
+    unit.connect_coil(function () dynamic_tank.decrementContainerEditMode() end, function () end)
+
+    -- input registers --
+    -- multiblock properties
+    unit.connect_input_reg(dynamic_tank.getLength)
+    unit.connect_input_reg(dynamic_tank.getWidth)
+    unit.connect_input_reg(dynamic_tank.getHeight)
+    unit.connect_input_reg(dynamic_tank.getMinPos)
+    unit.connect_input_reg(dynamic_tank.getMaxPos)
+    -- build properties
+    unit.connect_input_reg(dynamic_tank.getTankCapacity)
+    unit.connect_input_reg(dynamic_tank.getChemicalTankCapacity)
+    -- tanks/containers
+    unit.connect_input_reg(dynamic_tank.getStored)
+    unit.connect_input_reg(dynamic_tank.getFilledPercentage)
+
+    -- holding registers --
+    unit.connect_holding_reg(dynamic_tank.getContainerEditMode, dynamic_tank.setContainerEditMode)
+
+    -- check if any calls faulted
+    local faulted = dynamic_tank.__p_is_faulted()
+    dynamic_tank.__p_clear_fault()
+    dynamic_tank.__p_enable_afc()
+
+    return unit.interface(), faulted
+end
+
+return dynamicv_rtu

rtu/dev/turbinev_rtu.lua

@@ -2,7 +2,7 @@ local rtu = require("rtu.rtu")
 
 local turbinev_rtu = {}
 
--- create new turbine (mek 10.1+) device
+-- create new turbine device
 ---@nodiscard
 ---@param turbine table
 ---@return rtu_device interface, boolean faulted

rtu/panel/front_panel.lua

@@ -1,39 +1,31 @@
 --
--- Main SCADA Coordinator GUI
+-- RTU Front Panel GUI
 --
 
-local types      = require("scada-common.types")
-local util       = require("scada-common.util")
+local types         = require("scada-common.types")
+local util          = require("scada-common.util")
 
-local databus    = require("rtu.databus")
+local databus       = require("rtu.databus")
 
-local style      = require("rtu.panel.style")
+local style         = require("rtu.panel.style")
 
-local core       = require("graphics.core")
+local core          = require("graphics.core")
 
-local Div        = require("graphics.elements.div")
-local TextBox    = require("graphics.elements.textbox")
+local Div           = require("graphics.elements.div")
+local TextBox       = require("graphics.elements.textbox")
 
-local LED        = require("graphics.elements.indicators.led")
-local RGBLED     = require("graphics.elements.indicators.ledrgb")
+local DataIndicator = require("graphics.elements.indicators.data")
+local LED           = require("graphics.elements.indicators.led")
+local RGBLED        = require("graphics.elements.indicators.ledrgb")
 
 local TEXT_ALIGN = core.TEXT_ALIGN
 
 local cpair = core.cpair
 
-local UNIT_TYPE_LABELS = {
-    "UNKNOWN",
-    "REDSTONE",
-    "BOILER",
-    "TURBINE",
-    "IND MATRIX",
-    "SPS",
-    "SNA",
-    "ENV DETECTOR"
-}
+local UNIT_TYPE_LABELS = { "UNKNOWN", "REDSTONE", "BOILER", "TURBINE", "DYNAMIC TANK", "IND MATRIX", "SPS", "SNA", "ENV DETECTOR" }
 
 
--- create new main view
+-- create new front panel view
 ---@param panel graphics_element main displaybox
 ---@param units table unit list
 local function init(panel, units)
@@ -71,6 +63,10 @@ local function init(panel, units)
     local comp_id = util.sprintf("(%d)", os.getComputerID())
     TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)}
 
+    TextBox{parent=system,x=1,y=14,text="SPEAKERS",height=1,width=8,fg_bg=style.label}
+    local speaker_count = DataIndicator{parent=system,x=10,y=14,label="",format="%3d",value=0,width=3,fg_bg=cpair(colors.gray,colors.white)}
+    speaker_count.register(databus.ps, "speaker_count", speaker_count.update)
+
     --
     -- about label
     --

rtu/panel/style.lua

@@ -12,6 +12,7 @@ local cpair = core.cpair
 
 -- remap global colors
 colors.ivory = colors.pink
+colors.yellow_hc = colors.purple
 colors.red_off = colors.brown
 colors.yellow_off = colors.magenta
 colors.green_off = colors.lime
@@ -28,7 +29,7 @@ style.colors = {
     { c = colors.cyan,      hex = 0x34bac8 },
     { c = colors.lightBlue, hex = 0x6cc0f2 },
     { c = colors.blue,      hex = 0x0096ff },
-    { c = colors.purple,    hex = 0xb156ee },
+    { c = colors.purple,    hex = 0xb156ee },   -- YELLOW HIGH CONTRAST
     { c = colors.pink,      hex = 0xdcd9ca },   -- IVORY
     { c = colors.magenta,   hex = 0x85862c },   -- YELLOW OFF
     -- { c = colors.white,     hex = 0xdcd9ca },

rtu/rtu.lua

@@ -1,9 +1,11 @@
+local audio   = require("scada-common.audio")
 local comms   = require("scada-common.comms")
 local ppm     = require("scada-common.ppm")
 local log     = require("scada-common.log")
 local types   = require("scada-common.types")
 local util    = require("scada-common.util")
 
+local config  = require("rtu.config")
 local databus = require("rtu.databus")
 local modbus  = require("rtu.modbus")
 
@@ -155,6 +157,48 @@ function rtu.init_unit()
     return protected
 end
 
+-- create an alarm speaker sounder
+---@param speaker table device peripheral
+function rtu.init_sounder(speaker)
+    ---@class rtu_speaker_sounder
+    local spkr_ctl = {
+        speaker = speaker,
+        name = ppm.get_iface(speaker),
+        playing = false,
+        stream = audio.new_stream(),
+        play = function () end,
+        stop = function () end,
+        continue = function () end
+    }
+
+    -- continue audio stream if playing
+    function spkr_ctl.continue()
+        if spkr_ctl.playing then
+            if spkr_ctl.speaker ~= nil and spkr_ctl.stream.has_next_block() then
+                local success = spkr_ctl.speaker.playAudio(spkr_ctl.stream.get_next_block(), config.SOUNDER_VOLUME)
+                if not success then log.error(util.c("rtu_sounder(", spkr_ctl.name, "): error playing audio")) end
+            end
+        end
+    end
+
+    -- start audio stream playback
+    function spkr_ctl.play()
+        if not spkr_ctl.playing then
+            spkr_ctl.playing = true
+            return spkr_ctl.continue()
+        end
+    end
+
+    -- stop audio stream playback
+    function spkr_ctl.stop()
+        spkr_ctl.playing = false
+        spkr_ctl.speaker.stop()
+        spkr_ctl.stream.stop()
+    end
+
+    return spkr_ctl
+end
+
 -- RTU Communications
 ---@nodiscard
 ---@param version string RTU version
@@ -312,7 +356,8 @@ function rtu.comms(version, nic, rtu_channel, svr_channel, range, conn_watchdog)
     ---@param packet modbus_frame|mgmt_frame
     ---@param units table RTU units
     ---@param rtu_state rtu_state
-    function public.handle_packet(packet, units, rtu_state)
+    ---@param sounders table speaker alarm sounders
+    function public.handle_packet(packet, units, rtu_state, sounders)
         -- print a log message to the terminal as long as the UI isn't running
         local function println_ts(message) if not rtu_state.fp_ok then util.println_ts(message) end end
 
@@ -387,7 +432,49 @@ function rtu.comms(version, nic, rtu_channel, svr_channel, range, conn_watchdog)
             elseif protocol == PROTOCOL.SCADA_MGMT then
                 ---@cast packet mgmt_frame
                 -- SCADA management packet
-                if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                if rtu_state.linked then
+                    if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
+                        -- keep alive request received, echo back
+                        if packet.length == 1 and type(packet.data[1]) == "number" then
+                            local timestamp = packet.data[1]
+                            local trip_time = util.time() - timestamp
+
+                            if trip_time > 750 then
+                                log.warning("RTU KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
+                            end
+
+                            -- log.debug("RTU RTT = " .. trip_time .. "ms")
+
+                            _send_keep_alive_ack(timestamp)
+                        else
+                            log.debug("SCADA_MGMT keep alive packet length/type mismatch")
+                        end
+                    elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
+                        -- close connection
+                        conn_watchdog.cancel()
+                        public.unlink(rtu_state)
+                        println_ts("server connection closed by remote host")
+                        log.warning("server connection closed by remote host")
+                    elseif packet.type == SCADA_MGMT_TYPE.RTU_ADVERT then
+                        -- request for capabilities again
+                        public.send_advertisement(units)
+                    elseif packet.type == SCADA_MGMT_TYPE.RTU_TONE_ALARM then
+                        -- alarm tone update from supervisor
+                        if (packet.length == 1) and type(packet.data[1] == "table") and (#packet.data[1] == 8) then
+                            local states = packet.data[1]
+
+                            for i = 1, #sounders do
+                                local s = sounders[i]   ---@type rtu_speaker_sounder
+
+                                -- set tone states
+                                for id = 1, #states do s.stream.set_active(id, states[id] == true) end
+                            end
+                        end
+                    else
+                        -- not supported
+                        log.debug("received unsupported SCADA_MGMT message type " .. packet.type)
+                    end
+                elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
                     if packet.length == 1 then
                         local est_ack = packet.data[1]
 
@@ -421,36 +508,6 @@ function rtu.comms(version, nic, rtu_channel, svr_channel, range, conn_watchdog)
                     else
                         log.debug("SCADA_MGMT establish packet length mismatch")
                     end
-                elseif rtu_state.linked then
-                    if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-                        -- keep alive request received, echo back
-                        if packet.length == 1 and type(packet.data[1]) == "number" then
-                            local timestamp = packet.data[1]
-                            local trip_time = util.time() - timestamp
-
-                            if trip_time > 750 then
-                                log.warning("RTU KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
-                            end
-
-                            -- log.debug("RTU RTT = " .. trip_time .. "ms")
-
-                            _send_keep_alive_ack(timestamp)
-                        else
-                            log.debug("SCADA_MGMT keep alive packet length/type mismatch")
-                        end
-                    elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
-                        -- close connection
-                        conn_watchdog.cancel()
-                        public.unlink(rtu_state)
-                        println_ts("server connection closed by remote host")
-                        log.warning("server connection closed by remote host")
-                    elseif packet.type == SCADA_MGMT_TYPE.RTU_ADVERT then
-                        -- request for capabilities again
-                        public.send_advertisement(units)
-                    else
-                        -- not supported
-                        log.debug("received unsupported SCADA_MGMT message type " .. packet.type)
-                    end
                 else
                     log.debug("discarding non-link SCADA_MGMT packet before linked")
                 end

rtu/startup.lua

@@ -4,6 +4,7 @@
 
 require("/initenv").init_env()
 
+local audio        = require("scada-common.audio")
 local comms        = require("scada-common.comms")
 local crash        = require("scada-common.crash")
 local log          = require("scada-common.log")
@@ -22,6 +23,7 @@ local rtu          = require("rtu.rtu")
 local threads      = require("rtu.threads")
 
 local boilerv_rtu  = require("rtu.dev.boilerv_rtu")
+local dynamicv_rtu = require("rtu.dev.dynamicv_rtu")
 local envd_rtu     = require("rtu.dev.envd_rtu")
 local imatrix_rtu  = require("rtu.dev.imatrix_rtu")
 local redstone_rtu = require("rtu.dev.redstone_rtu")
@@ -29,7 +31,7 @@ local sna_rtu      = require("rtu.dev.sna_rtu")
 local sps_rtu      = require("rtu.dev.sps_rtu")
 local turbinev_rtu = require("rtu.dev.turbinev_rtu")
 
-local RTU_VERSION = "v1.4.0"
+local RTU_VERSION = "v1.6.0"
 
 local RTU_UNIT_TYPE = types.RTU_UNIT_TYPE
 local RTU_UNIT_HW_STATE = databus.RTU_UNIT_HW_STATE
@@ -95,6 +97,9 @@ local function main()
         return
     end
 
+    -- generate alarm tones
+    audio.generate_tones()
+
     ---@class rtu_shared_memory
     local __shared_memory = {
         -- RTU system state flags
@@ -105,6 +110,11 @@ local function main()
             shutdown = false
         },
 
+        -- RTU gateway devices (not RTU units)
+        rtu_dev = {
+            sounders = {}
+        },
+
         -- system objects
         rtu_sys = {
             nic = network.nic(modem),
@@ -342,6 +352,18 @@ local function main()
                     log.fatal(util.c("configure> failed to check if  '", name, "' is a formed turbine multiblock"))
                     return false
                 end
+            elseif type == "dynamicValve" then
+                -- dynamic tank multiblock
+                rtu_type = RTU_UNIT_TYPE.DYNAMIC_VALVE
+                rtu_iface, faulted = dynamicv_rtu.new(device)
+                is_multiblock = true
+                formed = device.isFormed()
+
+                if formed == ppm.UNDEFINED_FIELD or formed == ppm.ACCESS_FAULT then
+                    println_ts(util.c("configure> failed to check if  '", name, "' is formed"))
+                    log.fatal(util.c("configure> failed to check if  '", name, "' is a formed dynamic tank multiblock"))
+                    return false
+                end
             elseif type == "inductionPort" then
                 -- induction matrix multiblock
                 rtu_type = RTU_UNIT_TYPE.IMATRIX
@@ -464,10 +486,22 @@ local function main()
             renderer.close_ui()
             println_ts(util.c("UI error: ", message))
             println("startup> running without front panel")
-            log.error(util.c("GUI crashed with error ", message))
+            log.error(util.c("front panel GUI render failed with error ", message))
             log.info("startup> running in headless mode without front panel")
         end
 
+        -- find and setup all speakers
+        local speakers = ppm.get_all_devices("speaker")
+        for _, s in pairs(speakers) do
+            local sounder = rtu.init_sounder(s)
+
+            table.insert(__shared_memory.rtu_dev.sounders, sounder)
+
+            log.debug(util.c("startup> added speaker, attached as ", sounder.name))
+        end
+
+        databus.tx_hw_spkr_count(#__shared_memory.rtu_dev.sounders)
+
         -- start connection watchdog
         smem_sys.conn_watchdog = util.new_watchdog(config.COMMS_TIMEOUT)
         log.debug("startup> conn watchdog started")

rtu/threads.lua

@@ -8,8 +8,10 @@ local util         = require("scada-common.util")
 local databus      = require("rtu.databus")
 local modbus       = require("rtu.modbus")
 local renderer     = require("rtu.renderer")
+local rtu          = require("rtu.rtu")
 
 local boilerv_rtu  = require("rtu.dev.boilerv_rtu")
+local dynamicv_rtu = require("rtu.dev.dynamicv_rtu")
 local envd_rtu     = require("rtu.dev.envd_rtu")
 local imatrix_rtu  = require("rtu.dev.imatrix_rtu")
 local sna_rtu      = require("rtu.dev.sna_rtu")
@@ -23,7 +25,7 @@ local threads = {}
 local RTU_UNIT_TYPE = types.RTU_UNIT_TYPE
 local UNIT_HW_STATE = databus.RTU_UNIT_HW_STATE
 
-local MAIN_CLOCK  = 2   -- (2Hz, 40 ticks)
+local MAIN_CLOCK  = 0.5 -- (2Hz,  10 ticks)
 local COMMS_SLEEP = 100 -- (100ms, 2 ticks)
 
 -- main thread
@@ -46,6 +48,7 @@ function threads.thread__main(smem)
 
         -- load in from shared memory
         local rtu_state     = smem.rtu_state
+        local sounders      = smem.rtu_dev.sounders
         local nic           = smem.rtu_sys.nic
         local rtu_comms     = smem.rtu_sys.rtu_comms
         local conn_watchdog = smem.rtu_sys.conn_watchdog
@@ -65,6 +68,15 @@ function threads.thread__main(smem)
                 -- blink heartbeat indicator
                 databus.heartbeat()
 
+                -- update speaker states
+                for _, sounder in pairs(sounders) do
+                    -- re-compute output if needed, then play audio if available
+                    if sounder.stream.is_recompute_needed() then
+                        sounder.stream.compute_buffer()
+                        if sounder.stream.has_next_block() then sounder.play() else sounder.stop() end
+                    end
+                end
+
                 -- start next clock timer
                 loop_clock.start()
 
@@ -97,12 +109,30 @@ function threads.thread__main(smem)
                             nic.disconnect()
 
                             println_ts("wireless modem disconnected!")
-                            log.warning("comms modem disconnected!")
+                            log.warning("comms modem disconnected")
 
-                            databus.tx_hw_modem(false)
+                            local other_modem = ppm.get_wireless_modem()
+                            if other_modem then
+                                log.info("found another wireless modem, using it for comms")
+                                nic.connect(other_modem)
+                            else
+                                databus.tx_hw_modem(false)
+                            end
                         else
                             log.warning("non-comms modem disconnected")
                         end
+                    elseif type == "speaker" then
+                        for i = 1, #sounders do
+                            if sounders[i].speaker == device then
+                                table.remove(sounders, i)
+
+                                log.warning(util.c("speaker ", param1, " disconnected"))
+                                println_ts("speaker disconnected")
+
+                                databus.tx_hw_spkr_count(#sounders)
+                                break
+                            end
+                        end
                     else
                         for i = 1, #units do
                             -- find disconnected device
@@ -127,7 +157,7 @@ function threads.thread__main(smem)
 
                 if type ~= nil and device ~= nil then
                     if type == "modem" then
-                        if device.isWireless() then
+                        if device.isWireless() and not nic.is_connected() then
                             -- reconnected modem
                             nic.connect(device)
 
@@ -135,9 +165,18 @@ function threads.thread__main(smem)
                             log.info("comms modem reconnected")
 
                             databus.tx_hw_modem(true)
+                        elseif device.isWireless() then
+                            log.info("unused wireless modem reconnected")
                         else
                             log.info("wired modem reconnected")
                         end
+                    elseif type == "speaker" then
+                        table.insert(sounders, rtu.init_sounder(device))
+
+                        println_ts("speaker connected")
+                        log.info(util.c("connected speaker ", param1))
+
+                        databus.tx_hw_spkr_count(#sounders)
                     else
                         -- relink lost peripheral to correct unit entry
                         for i = 1, #units do
@@ -181,21 +220,22 @@ function threads.thread__main(smem)
                                     databus.tx_unit_hw_type(unit.uid, unit.type)
                                 end
 
+                                -- note for multiblock structures: if not formed, indexing the multiblock functions results in a PPM fault
+
                                 if unit.type == RTU_UNIT_TYPE.BOILER_VALVE then
                                     unit.rtu, faulted = boilerv_rtu.new(device)
-                                     -- if not formed, indexing the multiblock functions would have resulted in a PPM fault
                                     unit.formed = util.trinary(faulted, false, nil)
                                 elseif unit.type == RTU_UNIT_TYPE.TURBINE_VALVE then
                                     unit.rtu, faulted = turbinev_rtu.new(device)
-                                     -- if not formed, indexing the multiblock functions would have resulted in a PPM fault
+                                    unit.formed = util.trinary(faulted, false, nil)
+                                elseif unit.type == RTU_UNIT_TYPE.DYNAMIC_VALVE then
+                                    unit.rtu, faulted = dynamicv_rtu.new(device)
                                     unit.formed = util.trinary(faulted, false, nil)
                                 elseif unit.type == RTU_UNIT_TYPE.IMATRIX then
                                     unit.rtu, faulted = imatrix_rtu.new(device)
-                                     -- if not formed, indexing the multiblock functions would have resulted in a PPM fault
                                     unit.formed = util.trinary(faulted, false, nil)
                                 elseif unit.type == RTU_UNIT_TYPE.SPS then
                                     unit.rtu, faulted = sps_rtu.new(device)
-                                     -- if not formed, indexing the multiblock functions would have resulted in a PPM fault
                                     unit.formed = util.trinary(faulted, false, nil)
                                 elseif unit.type == RTU_UNIT_TYPE.SNA then
                                     unit.rtu, faulted = sna_rtu.new(device)
@@ -242,6 +282,15 @@ function threads.thread__main(smem)
             elseif event == "mouse_click" or event == "mouse_up" or event == "mouse_drag" or event == "mouse_scroll" then
                 -- handle a mouse event
                 renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
+            elseif event == "speaker_audio_empty" then
+                -- handle empty speaker audio buffer
+                for i = 1, #sounders do
+                    local sounder = sounders[i] ---@type rtu_speaker_sounder
+                    if sounder.name == param1 then
+                        sounder.continue()
+                        break
+                    end
+                end
             end
 
             -- check for termination request
@@ -289,6 +338,7 @@ function threads.thread__comms(smem)
 
         -- load in from shared memory
         local rtu_state   = smem.rtu_state
+        local sounders    = smem.rtu_dev.sounders
         local rtu_comms   = smem.rtu_sys.rtu_comms
         local units       = smem.rtu_sys.units
 
@@ -298,7 +348,9 @@ function threads.thread__comms(smem)
 
         -- thread loop
         while true do
-            -- check for messages in the message queue
+            local handle_start = util.time()
+
+            -- check for messages in the message queue while not shut down
             while comms_queue.ready() and not rtu_state.shutdown do
                 local msg = comms_queue.pop()
 
@@ -309,15 +361,21 @@ function threads.thread__comms(smem)
                         -- received data
                     elseif msg.qtype == mqueue.TYPE.PACKET then
                         -- received a packet
-                        -- handle the packet (rtu_state passed to allow setting link flag)
-                        rtu_comms.handle_packet(msg.message, units, rtu_state)
+                        -- handle the packet (rtu_state passed to allow setting link flag, sounders passed to manage alarm audio)
+                        rtu_comms.handle_packet(msg.message, units, rtu_state, sounders)
                     end
                 end
 
-                -- quick yield
-                util.nop()
+                -- max 100ms spent processing queue
+                if util.time() - handle_start > 100 then
+                    log.warning("comms thread exceeded 100ms queue process limit")
+                    break
+                end
             end
 
+            -- quick yield
+            util.nop()
+
             -- check for termination request
             if rtu_state.shutdown then
                 rtu_comms.close(rtu_state)
@@ -404,6 +462,12 @@ function threads.thread__unit_comms(smem, unit)
                 util.nop()
             end
 
+            -- check for termination request
+            if rtu_state.shutdown then
+                log.info("rtu unit thread exiting -> " .. short_name)
+                break
+            end
+
             -- check if multiblock is still formed if this is a multiblock
             if unit.is_multiblock and (util.time_ms() - last_f_check > 250) then
                 local is_formed = unit.device.isFormed()
@@ -441,6 +505,12 @@ function threads.thread__unit_comms(smem, unit)
                                 unit.rtu, faulted = turbinev_rtu.new(device)
                                 unit.formed = device.isFormed()
                                 unit.modbus_io = modbus.new(unit.rtu, true)
+                            elseif type == "dynamicValve" and unit.type == RTU_UNIT_TYPE.DYNAMIC_VALVE then
+                                -- dynamic tank multiblock
+                                unit.device = device
+                                unit.rtu, faulted = dynamicv_rtu.new(device)
+                                unit.formed = device.isFormed()
+                                unit.modbus_io = modbus.new(unit.rtu, true)
                             elseif type == "inductionPort" and unit.type == RTU_UNIT_TYPE.IMATRIX then
                                 -- induction matrix multiblock
                                 unit.device = device
@@ -491,12 +561,6 @@ function threads.thread__unit_comms(smem, unit)
             -- update hw status
             databus.tx_unit_hw_status(unit.uid, unit.hw_state)
 
-            -- check for termination request
-            if rtu_state.shutdown then
-                log.info("rtu unit thread exiting -> " .. short_name)
-                break
-            end
-
             -- delay before next check
             last_update = util.adaptive_delay(COMMS_SLEEP, last_update)
         end

scada-common/audio.lua

@@ -0,0 +1,313 @@
+--
+-- Audio & Tone Control for Alarms
+--
+
+-- sounds modeled after https://www.e2s.com/references-and-guidelines/listen-and-download-alarm-tones
+
+-- note: max samples = 0x20000 (128 * 1024 samples)
+
+local _2_PI        = 2 * math.pi    -- 2 whole pies, hope you're hungry
+local _DRATE       = 48000          -- 48kHz audio
+local _MAX_VAL     = 127 / 2        -- max signed integer in this 8-bit audio
+local _05s_SAMPLES = 24000          -- half a second worth of samples
+
+---@class audio
+local audio = {}
+
+---@enum TONE
+local TONE = {
+    T_340Hz_Int_2Hz = 1,
+    T_544Hz_440Hz_Alt = 2,
+    T_660Hz_Int_125ms = 3,
+    T_745Hz_Int_1Hz = 4,
+    T_800Hz_Int = 5,
+    T_800Hz_1000Hz_Alt = 6,
+    T_1000Hz_Int = 7,
+    T_1800Hz_Int_4Hz = 8
+}
+
+audio.TONE = TONE
+
+local tone_data = {
+    { {}, {}, {}, {} }, -- 340Hz @ 2Hz Intermittent
+    { {}, {}, {}, {} }, -- 544Hz 100mS / 440Hz 400mS Alternating
+    { {}, {}, {}, {} }, -- 660Hz @ 125ms On 125ms Off
+    { {}, {}, {}, {} }, -- 745Hz @ 1Hz Intermittent
+    { {}, {}, {}, {} }, -- 800Hz @ 0.25s On 1.75s Off
+    { {}, {}, {}, {} }, -- 800/1000Hz @ 0.25s Alternating
+    { {}, {}, {}, {} }, -- 1KHz 1s on, 1s off Intermittent
+    { {}, {}, {}, {} }  -- 1.8KHz @ 4Hz Intermittent
+}
+
+-- calculate how many samples are in the given number of milliseconds
+---@nodiscard
+---@param ms integer milliseconds
+---@return integer samples
+local function ms_to_samples(ms) return math.floor(ms * 48) end
+
+--#region Tone Generation (the Maths)
+
+-- 340Hz @ 2Hz Intermittent
+local function gen_tone_1()
+    local t, dt = 0, _2_PI * 340 / _DRATE
+
+    for i = 1, _05s_SAMPLES do
+        local val = math.floor(math.sin(t) * _MAX_VAL)
+        tone_data[1][1][i] = val
+        tone_data[1][3][i] = val
+        tone_data[1][2][i] = 0
+        tone_data[1][4][i] = 0
+        t = (t + dt) % _2_PI
+    end
+end
+
+-- 544Hz 100mS / 440Hz 400mS Alternating
+local function gen_tone_2()
+    local t1, dt1 = 0, _2_PI * 544 / _DRATE
+    local t2, dt2 = 0, _2_PI * 440 / _DRATE
+    local alternate_at = ms_to_samples(100)
+
+    for i = 1, _05s_SAMPLES do
+        local value
+
+        if i <= alternate_at then
+            value = math.floor(math.sin(t1) * _MAX_VAL)
+            t1 = (t1 + dt1) % _2_PI
+        else
+            value = math.floor(math.sin(t2) * _MAX_VAL)
+            t2 = (t2 + dt2) % _2_PI
+        end
+
+        tone_data[2][1][i] = value
+        tone_data[2][2][i] = value
+        tone_data[2][3][i] = value
+        tone_data[2][4][i] = value
+    end
+end
+
+-- 660Hz @ 125ms On 125ms Off
+local function gen_tone_3()
+    local elapsed_samples = 0
+    local alternate_after = ms_to_samples(125)
+    local alternate_at = alternate_after
+    local mode = true
+
+    local t, dt = 0, _2_PI * 660 / _DRATE
+
+    for set = 1, 4 do
+        for i = 1, _05s_SAMPLES do
+            if mode then
+                local val = math.floor(math.sin(t) * _MAX_VAL)
+                tone_data[3][set][i] = val
+                t = (t + dt) % _2_PI
+            else
+                t = 0
+                tone_data[3][set][i] = 0
+            end
+
+            if elapsed_samples == alternate_at then
+                mode = not mode
+                alternate_at = elapsed_samples + alternate_after
+            end
+
+            elapsed_samples = elapsed_samples + 1
+        end
+    end
+end
+
+-- 745Hz @ 1Hz Intermittent
+local function gen_tone_4()
+    local t, dt = 0, _2_PI * 745 / _DRATE
+
+    for i = 1, _05s_SAMPLES do
+        local val = math.floor(math.sin(t) * _MAX_VAL)
+        tone_data[4][1][i] = val
+        tone_data[4][3][i] = val
+        tone_data[4][2][i] = 0
+        tone_data[4][4][i] = 0
+        t = (t + dt) % _2_PI
+    end
+end
+
+-- 800Hz @ 0.25s On 1.75s Off
+local function gen_tone_5()
+    local t, dt = 0, _2_PI * 800 / _DRATE
+    local stop_at = ms_to_samples(250)
+
+    for i = 1, _05s_SAMPLES do
+        local val = math.floor(math.sin(t) * _MAX_VAL)
+
+        if i > stop_at then
+            tone_data[5][1][i] = val
+        else
+            tone_data[5][1][i] = 0
+        end
+
+        tone_data[5][2][i] = 0
+        tone_data[5][3][i] = 0
+        tone_data[5][4][i] = 0
+
+        t = (t + dt) % _2_PI
+    end
+end
+
+-- 1000/800Hz @ 0.25s Alternating
+local function gen_tone_6()
+    local t1, dt1 = 0, _2_PI * 1000 / _DRATE
+    local t2, dt2 = 0, _2_PI * 800 / _DRATE
+
+    local alternate_at = ms_to_samples(250)
+
+    for i = 1, _05s_SAMPLES do
+        local val
+        if i <= alternate_at then
+            val = math.floor(math.sin(t1) * _MAX_VAL)
+            t1 = (t1 + dt1) % _2_PI
+        else
+            val = math.floor(math.sin(t2) * _MAX_VAL)
+            t2 = (t2 + dt2) % _2_PI
+        end
+
+        tone_data[6][1][i] = val
+        tone_data[6][2][i] = val
+        tone_data[6][3][i] = val
+        tone_data[6][4][i] = val
+    end
+end
+
+-- 1KHz 1s on, 1s off Intermittent
+local function gen_tone_7()
+    local t, dt = 0, _2_PI * 1000 / _DRATE
+
+    for i = 1, _05s_SAMPLES do
+        local val = math.floor(math.sin(t) * _MAX_VAL)
+        tone_data[7][1][i] = val
+        tone_data[7][2][i] = val
+        tone_data[7][3][i] = 0
+        tone_data[7][4][i] = 0
+        t = (t + dt) % _2_PI
+    end
+end
+
+-- 1800Hz @ 4Hz Intermittent
+local function gen_tone_8()
+    local t, dt = 0, _2_PI * 1800 / _DRATE
+
+    local off_at = ms_to_samples(250)
+
+    for i = 1, _05s_SAMPLES do
+        local val = 0
+
+        if i <= off_at then
+            val = math.floor(math.sin(t) * _MAX_VAL)
+            t = (t + dt) % _2_PI
+        end
+
+        tone_data[8][1][i] = val
+        tone_data[8][2][i] = val
+        tone_data[8][3][i] = val
+        tone_data[8][4][i] = val
+    end
+end
+
+--#endregion
+
+-- generate all 8 tone sequences
+function audio.generate_tones()
+    gen_tone_1(); gen_tone_2(); gen_tone_3(); gen_tone_4(); gen_tone_5(); gen_tone_6(); gen_tone_7(); gen_tone_8()
+end
+
+-- hard audio limiter
+---@nodiscard
+---@param output number output level
+---@return number limited -128.0 to 127.0
+local function limit(output)
+    return math.max(-128, math.min(127, output))
+end
+
+-- clear output buffer
+---@param buffer table quad buffer
+local function clear(buffer)
+    for i = 1, 4 do
+        for s = 1, _05s_SAMPLES do buffer[i][s] = 0 end
+    end
+end
+
+-- create a new audio tone stream controller
+function audio.new_stream()
+    local self = {
+        any_active = false,
+        need_recompute = false,
+        next_block = 1,
+        -- split audio up into 0.5s samples, so specific components can be ended quicker
+        quad_buffer = { {}, {}, {}, {} },
+        -- all tone enable states
+        tone_active = { false, false, false, false, false, false, false, false }
+    }
+
+    clear(self.quad_buffer)
+
+    ---@class tone_stream
+    local public = {}
+
+    -- add a tone to the output buffer
+    ---@param index TONE tone ID
+    ---@param active boolean active state
+    function public.set_active(index, active)
+        if self.tone_active[index] ~= nil then
+            if self.tone_active[index] ~= active then self.need_recompute = true end
+            self.tone_active[index] = active
+        end
+    end
+
+    -- check if a tone is active
+    ---@param index TONE tone index
+    function public.is_active(index)
+        if self.tone_active[index] then return self.tone_active[index] end
+        return false
+    end
+
+    -- set all tones inactive, reset next block, and clear output buffer
+    function public.stop()
+        for i = 1, #self.tone_active do self.tone_active[i] = false end
+        self.next_block = 1
+        clear(self.quad_buffer)
+    end
+
+    -- check if the output buffer needs to be recomputed due to changes
+    function public.is_recompute_needed() return self.need_recompute end
+
+    -- re-compute the output buffer
+    function public.compute_buffer()
+        clear(self.quad_buffer)
+
+        self.need_recompute = false
+        self.any_active = false
+
+        for id = 1, #tone_data do
+            if self.tone_active[id] then
+                self.any_active = true
+                for i = 1, 4 do
+                    local buffer = self.quad_buffer[i]
+                    local values = tone_data[id][i]
+                    for s = 1, _05s_SAMPLES do self.quad_buffer[i][s] = limit(buffer[s] + values[s]) end
+                end
+            end
+        end
+    end
+
+    -- check if the next audio block has data
+    function public.has_next_block() return #self.quad_buffer[self.next_block] > 0 end
+
+    -- get the next audio block
+    function public.get_next_block()
+        local block = self.quad_buffer[self.next_block]
+        self.next_block = self.next_block + 1
+        if self.next_block > 4 then self.next_block = 1 end
+        return block
+    end
+
+    return public
+end
+
+return audio

scada-common/comms.lua

@@ -14,50 +14,54 @@ local max_distance = nil                ---@type number|nil maximum acceptable t
 ---@class comms
 local comms = {}
 
-comms.version = "2.1.0"
+comms.version = "2.2.1"
 
 ---@enum PROTOCOL
 local PROTOCOL = {
-    MODBUS_TCP = 0,     -- our "MODBUS TCP"-esque protocol
-    RPLC = 1,           -- reactor PLC protocol
-    SCADA_MGMT = 2,     -- SCADA supervisor management, device advertisements, etc
-    SCADA_CRDN = 3,     -- data/control packets for coordinators to/from supervisory controllers
-    COORD_API = 4       -- data/control packets for pocket computers to/from coordinators
+    MODBUS_TCP = 0,      -- our "MODBUS TCP"-esque protocol
+    RPLC = 1,            -- reactor PLC protocol
+    SCADA_MGMT = 2,      -- SCADA supervisor management, device advertisements, etc
+    SCADA_CRDN = 3,      -- data/control packets for coordinators to/from supervisory controllers
+    COORD_API = 4        -- data/control packets for pocket computers to/from coordinators
 }
 
 ---@enum RPLC_TYPE
 local RPLC_TYPE = {
-    STATUS = 0,         -- reactor/system status
-    MEK_STRUCT = 1,     -- mekanism build structure
-    MEK_BURN_RATE = 2,  -- set burn rate
-    RPS_ENABLE = 3,     -- enable reactor
-    RPS_SCRAM = 4,      -- SCRAM reactor (manual request)
-    RPS_ASCRAM = 5,     -- SCRAM reactor (automatic request)
-    RPS_STATUS = 6,     -- RPS status
-    RPS_ALARM = 7,      -- RPS alarm broadcast
-    RPS_RESET = 8,      -- clear RPS trip (if in bad state, will trip immediately)
-    RPS_AUTO_RESET = 9, -- clear RPS trip if it is just a timeout or auto scram
-    AUTO_BURN_RATE = 10 -- set an automatic burn rate, PLC will respond with status, enable toggle speed limited
+    STATUS = 0,          -- reactor/system status
+    MEK_STRUCT = 1,      -- mekanism build structure
+    MEK_BURN_RATE = 2,   -- set burn rate
+    RPS_ENABLE = 3,      -- enable reactor
+    RPS_SCRAM = 4,       -- SCRAM reactor (manual request)
+    RPS_ASCRAM = 5,      -- SCRAM reactor (automatic request)
+    RPS_STATUS = 6,      -- RPS status
+    RPS_ALARM = 7,       -- RPS alarm broadcast
+    RPS_RESET = 8,       -- clear RPS trip (if in bad state, will trip immediately)
+    RPS_AUTO_RESET = 9,  -- clear RPS trip if it is just a timeout or auto scram
+    AUTO_BURN_RATE = 10  -- set an automatic burn rate, PLC will respond with status, enable toggle speed limited
 }
 
 ---@enum SCADA_MGMT_TYPE
 local SCADA_MGMT_TYPE = {
-    ESTABLISH = 0,      -- establish new connection
-    KEEP_ALIVE = 1,     -- keep alive packet w/ RTT
-    CLOSE = 2,          -- close a connection
-    RTU_ADVERT = 3,     -- RTU capability advertisement
-    RTU_DEV_REMOUNT = 4 -- RTU multiblock possbily changed (formed, unformed) due to PPM remount
+    ESTABLISH = 0,       -- establish new connection
+    KEEP_ALIVE = 1,      -- keep alive packet w/ RTT
+    CLOSE = 2,           -- close a connection
+    RTU_ADVERT = 3,      -- RTU capability advertisement
+    RTU_DEV_REMOUNT = 4, -- RTU multiblock possbily changed (formed, unformed) due to PPM remount
+    RTU_TONE_ALARM = 5,  -- instruct RTUs to play specified alarm tones
+    DIAG_TONE_GET = 6,   -- diagnostic: get alarm tones
+    DIAG_TONE_SET = 7,   -- diagnostic: set alarm tones
+    DIAG_ALARM_SET = 8   -- diagnostic: set alarm to simulate audio for
 }
 
 ---@enum SCADA_CRDN_TYPE
 local SCADA_CRDN_TYPE = {
-    INITIAL_BUILDS = 0, -- initial, complete builds packet to the coordinator
-    FAC_BUILDS = 1,     -- facility RTU builds
-    FAC_STATUS = 2,     -- state of facility and facility devices
-    FAC_CMD = 3,        -- faility command
-    UNIT_BUILDS = 4,    -- build of each reactor unit (reactor + RTUs)
-    UNIT_STATUSES = 5,  -- state of each of the reactor units
-    UNIT_CMD = 6        -- command a reactor unit
+    INITIAL_BUILDS = 0,  -- initial, complete builds packet to the coordinator
+    FAC_BUILDS = 1,      -- facility RTU builds
+    FAC_STATUS = 2,      -- state of facility and facility devices
+    FAC_CMD = 3,         -- faility command
+    UNIT_BUILDS = 4,     -- build of each reactor unit (reactor + RTUs)
+    UNIT_STATUSES = 5,   -- state of each of the reactor units
+    UNIT_CMD = 6         -- command a reactor unit
 }
 
 ---@enum CAPI_TYPE
@@ -66,48 +70,50 @@ local CAPI_TYPE = {
 
 ---@enum ESTABLISH_ACK
 local ESTABLISH_ACK = {
-    ALLOW = 0,          -- link approved
-    DENY = 1,           -- link denied
-    COLLISION = 2,      -- link denied due to existing active link
-    BAD_VERSION = 3     -- link denied due to comms version mismatch
+    ALLOW = 0,           -- link approved
+    DENY = 1,            -- link denied
+    COLLISION = 2,       -- link denied due to existing active link
+    BAD_VERSION = 3      -- link denied due to comms version mismatch
 }
 
 ---@enum DEVICE_TYPE
 local DEVICE_TYPE = {
-    PLC = 0,            -- PLC device type for establish
-    RTU = 1,            -- RTU device type for establish
-    SV = 2,             -- supervisor device type for establish
-    CRDN = 3,           -- coordinator device type for establish
-    PKT = 4             -- pocket device type for establish
+    PLC = 0,             -- PLC device type for establish
+    RTU = 1,             -- RTU device type for establish
+    SV = 2,              -- supervisor device type for establish
+    CRDN = 3,            -- coordinator device type for establish
+    PKT = 4              -- pocket device type for establish
 }
 
 ---@enum PLC_AUTO_ACK
 local PLC_AUTO_ACK = {
-    FAIL = 0,           -- failed to set burn rate/burn rate invalid
-    DIRECT_SET_OK = 1,  -- successfully set burn rate
-    RAMP_SET_OK = 2,    -- successfully started burn rate ramping
-    ZERO_DIS_OK = 3     -- successfully disabled reactor with < 0.01 burn rate
+    FAIL = 0,            -- failed to set burn rate/burn rate invalid
+    DIRECT_SET_OK = 1,   -- successfully set burn rate
+    RAMP_SET_OK = 2,     -- successfully started burn rate ramping
+    ZERO_DIS_OK = 3      -- successfully disabled reactor with < 0.01 burn rate
 }
 
 ---@enum FAC_COMMAND
 local FAC_COMMAND = {
-    SCRAM_ALL = 0,      -- SCRAM all reactors
-    STOP = 1,           -- stop automatic control
-    START = 2,          -- start automatic control
-    ACK_ALL_ALARMS = 3  -- acknowledge all alarms on all units
+    SCRAM_ALL = 0,       -- SCRAM all reactors
+    STOP = 1,            -- stop automatic process control
+    START = 2,           -- start automatic process control
+    ACK_ALL_ALARMS = 3,  -- acknowledge all alarms on all units
+    SET_WASTE_MODE = 4,  -- set automatic waste processing mode
+    SET_PU_FB = 5        -- set plutonium fallback mode
 }
 
 ---@enum UNIT_COMMAND
 local UNIT_COMMAND = {
-    SCRAM = 0,          -- SCRAM the reactor
-    START = 1,          -- start the reactor
-    RESET_RPS = 2,      -- reset the RPS
-    SET_BURN = 3,       -- set the burn rate
-    SET_WASTE = 4,      -- set the waste processing mode
-    ACK_ALL_ALARMS = 5, -- ack all active alarms
-    ACK_ALARM = 6,      -- ack a particular alarm
-    RESET_ALARM = 7,    -- reset a particular alarm
-    SET_GROUP = 8       -- assign this unit to a group
+    SCRAM = 0,           -- SCRAM the reactor
+    START = 1,           -- start the reactor
+    RESET_RPS = 2,       -- reset the RPS
+    SET_BURN = 3,        -- set the burn rate
+    SET_WASTE = 4,       -- set the waste processing mode
+    ACK_ALL_ALARMS = 5,  -- ack all active alarms
+    ACK_ALARM = 6,       -- ack a particular alarm
+    RESET_ALARM = 7,     -- reset a particular alarm
+    SET_GROUP = 8        -- assign this unit to a group
 }
 
 comms.PROTOCOL = PROTOCOL
@@ -144,6 +150,7 @@ function comms.scada_packet()
     local self = {
         modem_msg_in = nil, ---@type modem_message|nil
         valid = false,
+        authenticated = false,
         raw = {},
         src_addr = comms.BROADCAST,
         dest_addr = comms.BROADCAST,
@@ -232,6 +239,9 @@ function comms.scada_packet()
         return self.valid
     end
 
+    -- report that this packet has been authenticated (was received with a valid HMAC)
+    function public.stamp_authenticated() self.authenticated = true end
+
     -- public accessors --
 
     ---@nodiscard
@@ -246,6 +256,8 @@ function comms.scada_packet()
 
     ---@nodiscard
     function public.is_valid() return self.valid end
+    ---@nodiscard
+    function public.is_authenticated() return self.authenticated end
 
     ---@nodiscard
     function public.src_addr() return self.src_addr end
@@ -311,7 +323,7 @@ function comms.authd_packet()
         self.valid = false
         self.raw = self.modem_msg_in.msg
 
-        if (type(max_distance) == "number") and (distance > max_distance) then
+        if (type(max_distance) == "number") and (type(distance) == "number") and (distance > max_distance) then
             -- outside of maximum allowable transmission distance
             -- log.debug("comms.authd_packet.receive(): discarding packet with distance " .. distance .. " outside of trusted range")
         else
@@ -586,7 +598,11 @@ function comms.mgmt_packet()
                 self.type == SCADA_MGMT_TYPE.CLOSE or
                 self.type == SCADA_MGMT_TYPE.REMOTE_LINKED or
                 self.type == SCADA_MGMT_TYPE.RTU_ADVERT or
-                self.type == SCADA_MGMT_TYPE.RTU_DEV_REMOUNT
+                self.type == SCADA_MGMT_TYPE.RTU_DEV_REMOUNT or
+                self.type == SCADA_MGMT_TYPE.RTU_TONE_ALARM or
+                self.type == SCADA_MGMT_TYPE.DIAG_TONE_GET or
+                self.type == SCADA_MGMT_TYPE.DIAG_TONE_SET or
+                self.type == SCADA_MGMT_TYPE.DIAG_ALARM_SET
     end
 
     -- make a SCADA management packet

scada-common/constants.lua

@@ -2,10 +2,12 @@
 -- System and Safety Constants
 --
 
+---@class scada_constants
 local constants = {}
 
 --#region Reactor Protection System (on the PLC) Limits
 
+---@class _rps_constants
 local rps = {}
 
 rps.MAX_DAMAGE_PERCENT      = 90    -- damage >= 90%
@@ -21,6 +23,7 @@ constants.RPS_LIMITS = rps
 
 --#region Annunciator Limits
 
+---@class _annunciator_constants
 local annunc = {}
 
 annunc.RCSFlowLow_H2O     = -3.2    -- flow < -3.2 mB/s
@@ -44,6 +47,7 @@ constants.ANNUNCIATOR_LIMITS = annunc
 
 --#region Supervisor Alarm Limits
 
+---@class _alarm_constants
 local alarms = {}
 
 -- unit alarms

scada-common/crash.lua

@@ -6,8 +6,10 @@ local comms = require("scada-common.comms")
 local log   = require("scada-common.log")
 local util  = require("scada-common.util")
 
-local core  = require("graphics.core")
+local has_graphics, core   = pcall(require, "graphics.core")
+local has_lockbox, lockbox = pcall(require, "lockbox")
 
+---@class crash_handler
 local crash = {}
 
 local app = "unknown"
@@ -34,7 +36,8 @@ function crash.handler(error)
     log.info(util.c("APPLICATION:      ", app))
     log.info(util.c("FIRMWARE VERSION: ", ver))
     log.info(util.c("COMMS VERSION:    ", comms.version))
-    log.info(util.c("GRAPHICS VERSION: ", core.version))
+    if has_graphics then log.info(util.c("GRAPHICS VERSION: ", core.version))    end
+    if has_lockbox  then log.info(util.c("LOCKBOX VERSION:  ", lockbox.version)) end
     log.info("----------------------------------")
     log.info(debug.traceback("--- begin debug trace ---", 1))
     log.info("--- end debug trace ---")

scada-common/log.lua

@@ -4,14 +4,11 @@
 
 local util = require("scada-common.util")
 
----@class log
+---@class logger
 local log = {}
 
 ---@alias MODE integer
-local MODE = {
-    APPEND = 0,
-    NEW = 1
-}
+local MODE = { APPEND = 0, NEW = 1 }
 
 log.MODE = MODE
 
@@ -20,7 +17,9 @@ local logger = {
     mode = MODE.APPEND,
     debug = false,
     file = nil,
-    dmesg_out = nil
+    dmesg_out = nil,
+    dmesg_restore_coord = { 1, 1 },
+    dmesg_scroll_count = 0
 }
 
 ---@type function
@@ -158,6 +157,7 @@ function log.dmesg(msg, tag, tag_color)
             if cur_y == out_h then
                 out.scroll(1)
                 out.setCursorPos(1, cur_y)
+                logger.dmesg_scroll_count = logger.dmesg_scroll_count + 1
             else
                 out.setCursorPos(1, cur_y + 1)
             end
@@ -193,6 +193,7 @@ function log.dmesg(msg, tag, tag_color)
                 if cur_y == out_h then
                     out.scroll(1)
                     out.setCursorPos(1, cur_y)
+                    logger.dmesg_scroll_count = logger.dmesg_scroll_count + 1
                 else
                     out.setCursorPos(1, cur_y + 1)
                 end
@@ -201,6 +202,8 @@ function log.dmesg(msg, tag, tag_color)
             out.write(lines[i])
         end
 
+        logger.dmesg_restore_coord = { out.getCursorPos() }
+
         _log(util.c("[", t_stamp, "] [", tag, "] ", msg))
     end
 
@@ -215,6 +218,7 @@ end
 ---@return function update, function done
 function log.dmesg_working(msg, tag, tag_color)
     local ts_coord = log.dmesg(msg, tag, tag_color)
+    local initial_scroll = logger.dmesg_scroll_count
 
     local out = logger.dmesg_out
     local width = (ts_coord.x2 - ts_coord.x1) + 1
@@ -225,11 +229,14 @@ function log.dmesg_working(msg, tag, tag_color)
         local counter = 0
 
         local function update(sec_remaining)
+            local new_y = ts_coord.y - (logger.dmesg_scroll_count - initial_scroll)
+            if new_y < 1 then return end
+
             local time = util.sprintf("%ds", sec_remaining)
             local available = width - (string.len(time) + 2)
             local progress = ""
 
-            out.setCursorPos(ts_coord.x1, ts_coord.y)
+            out.setCursorPos(ts_coord.x1, new_y)
             out.write(" ")
 
             if counter % 4 == 0 then
@@ -249,10 +256,15 @@ function log.dmesg_working(msg, tag, tag_color)
             out.setTextColor(initial_color)
 
             counter = counter + 1
+
+            out.setCursorPos(table.unpack(logger.dmesg_restore_coord))
         end
 
         local function done(ok)
-            out.setCursorPos(ts_coord.x1, ts_coord.y)
+            local new_y = ts_coord.y - (logger.dmesg_scroll_count - initial_scroll)
+            if new_y < 1 then return end
+
+            out.setCursorPos(ts_coord.x1, new_y)
 
             if ok or ok == nil then
                 out.setTextColor(colors.green)
@@ -263,6 +275,8 @@ function log.dmesg_working(msg, tag, tag_color)
             end
 
             out.setTextColor(initial_color)
+
+            out.setCursorPos(table.unpack(logger.dmesg_restore_coord))
         end
 
         return update, done

scada-common/mqueue.lua

@@ -4,6 +4,14 @@
 
 local mqueue = {}
 
+---@class queue_item
+---@field qtype MQ_TYPE
+---@field message any
+
+---@class queue_data
+---@field key any
+---@field val any
+
 ---@enum MQ_TYPE
 local TYPE = {
     COMMAND = 0,
@@ -13,22 +21,14 @@ local TYPE = {
 
 mqueue.TYPE = TYPE
 
+local insert = table.insert
+local remove = table.remove
+
 -- create a new message queue
 ---@nodiscard
 function mqueue.new()
     local queue = {}
 
-    local insert = table.insert
-    local remove = table.remove
-
-    ---@class queue_item
-    ---@field qtype MQ_TYPE
-    ---@field message any
-
-    ---@class queue_data
-    ---@field key any
-    ---@field val any
-
     ---@class mqueue
     local public = {}
 
@@ -48,28 +48,20 @@ function mqueue.new()
     -- push a new item onto the queue
     ---@param qtype MQ_TYPE
     ---@param message any
-    local function _push(qtype, message)
-        insert(queue, { qtype = qtype, message = message })
-    end
+    local function _push(qtype, message) insert(queue, { qtype = qtype, message = message }) end
 
     -- push a command onto the queue
     ---@param message any
-    function public.push_command(message)
-        _push(TYPE.COMMAND, message)
-    end
+    function public.push_command(message) _push(TYPE.COMMAND, message) end
 
     -- push data onto the queue
     ---@param key any
     ---@param value any
-    function public.push_data(key, value)
-        _push(TYPE.DATA, { key = key, val = value })
-    end
+    function public.push_data(key, value) _push(TYPE.DATA, { key = key, val = value }) end
 
     -- push a packet onto the queue
     ---@param packet packet|frame
-    function public.push_packet(packet)
-        _push(TYPE.PACKET, packet)
-    end
+    function public.push_packet(packet) _push(TYPE.PACKET, packet) end
 
     -- get an item off the queue
     ---@nodiscard
@@ -77,9 +69,7 @@ function mqueue.new()
     function public.pop()
         if #queue > 0 then
             return remove(queue, 1)
-        else
-            return nil
-        end
+        else return nil end
     end
 
     return public

scada-common/network.lua

@@ -2,19 +2,21 @@
 -- Network Communications
 --
 
+local comms  = require("scada-common.comms")
+local log    = require("scada-common.log")
+local util   = require("scada-common.util")
+
 local md5    = require("lockbox.digest.md5")
 local sha256 = require("lockbox.digest.sha2_256")
 local pbkdf2 = require("lockbox.kdf.pbkdf2")
 local hmac   = require("lockbox.mac.hmac")
 local stream = require("lockbox.util.stream")
 local array  = require("lockbox.util.array")
-local comms  = require("scada-common.comms")
-
-local log    = require("scada-common.log")
-local util   = require("scada-common.util")
 
+---@class scada_net_interface
 local network = {}
 
+-- cryptography engine
 local c_eng = {
     key = nil,
     hmac = nil
@@ -94,7 +96,7 @@ function network.nic(modem)
 
     -- check if this NIC has a connected modem
     ---@nodiscard
-    function public.connected() return self.connected end
+    function public.is_connected() return self.connected end
 
     -- connect to a modem peripheral
     ---@param reconnected_modem table
@@ -212,6 +214,7 @@ function network.nic(modem)
                     if packet_hmac == computed_hmac then
                         -- log.debug("crypto.modem.receive: HMAC verified in " .. (util.time_ms() - start) .. "ms")
                         s_packet.receive(side, sender, reply_to, textutils.unserialize(msg), distance)
+                        s_packet.stamp_authenticated()
                     else
                         -- log.debug("crypto.modem.receive: HMAC failed verification in " .. (util.time_ms() - start) .. "ms")
                     end

scada-common/ppm.lua

@@ -8,15 +8,13 @@ local util = require("scada-common.util")
 ---@class ppm
 local ppm = {}
 
-local ACCESS_FAULT = nil    ---@type nil
-
-local UNDEFINED_FIELD = "undefined field"
-
+local ACCESS_FAULT        = nil                 ---@type nil
+local UNDEFINED_FIELD     = "undefined field"
 local VIRTUAL_DEVICE_TYPE = "ppm_vdev"
 
-ppm.ACCESS_FAULT = ACCESS_FAULT
-ppm.UNDEFINED_FIELD = UNDEFINED_FIELD
-ppm.VIRTUAL_DEVICE_TYPE = VIRTUAL_DEVICE_TYPE
+ppm.ACCESS_FAULT          = ACCESS_FAULT
+ppm.UNDEFINED_FIELD       = UNDEFINED_FIELD
+ppm.VIRTUAL_DEVICE_TYPE   = VIRTUAL_DEVICE_TYPE
 
 ----------------------------
 -- PRIVATE DATA/FUNCTIONS --
@@ -34,9 +32,9 @@ local ppm_sys = {
     mute = false
 }
 
--- wrap peripheral calls with lua protected call as we don't want a disconnect to crash a program<br>
--- also provides peripheral-specific fault checks (auto-clear fault defaults to true)<br>
--- assumes iface is a valid peripheral
+-- Wrap peripheral calls with lua protected call as we don't want a disconnect to crash a program.
+-- Additionally provides peripheral-specific fault checks (auto-clear fault defaults to true).<br>
+-- Note: assumes iface is a valid peripheral.
 ---@param iface string CC peripheral interface
 local function peri_init(iface)
     local self = {
@@ -307,16 +305,12 @@ end
 -- list all available peripherals
 ---@nodiscard
 ---@return table names
-function ppm.list_avail()
-    return peripheral.getNames()
-end
+function ppm.list_avail() return peripheral.getNames() end
 
 -- list mounted peripherals
 ---@nodiscard
 ---@return table mounts
-function ppm.list_mounts()
-    return ppm_sys.mounts
-end
+function ppm.list_mounts() return ppm_sys.mounts end
 
 -- get a mounted peripheral side/interface by device table
 ---@nodiscard
@@ -390,9 +384,7 @@ end
 -- get the fission reactor (if multiple, returns the first)
 ---@nodiscard
 ---@return table|nil reactor function table
-function ppm.get_fission_reactor()
-    return ppm.get_device("fissionReactorLogicAdapter")
-end
+function ppm.get_fission_reactor() return ppm.get_device("fissionReactorLogicAdapter") end
 
 -- get the wireless modem (if multiple, returns the first)<br>
 -- if this is in a CraftOS emulated environment, wired modems will be used instead
@@ -419,9 +411,7 @@ function ppm.get_monitor_list()
     local list = {}
 
     for iface, device in pairs(ppm_sys.mounts) do
-        if device.type == "monitor" then
-            list[iface] = device
-        end
+        if device.type == "monitor" then list[iface] = device end
     end
 
     return list

scada-common/psil.lua

@@ -9,14 +9,12 @@ local psil = {}
 -- instantiate a new PSI layer
 ---@nodiscard
 function psil.create()
-    local self = {
-        ic = {}
-    }
+    local ic = {}
 
     -- allocate a new interconnect field
     ---@key string data key
     local function alloc(key)
-        self.ic[key] = { subscribers = {}, value = nil }
+        ic[key] = { subscribers = {}, value = nil }
     end
 
     ---@class psil
@@ -28,22 +26,22 @@ function psil.create()
     ---@param func function function to call on change
     function public.subscribe(key, func)
         -- allocate new key if not found or notify if value is found
-        if self.ic[key] == nil then
+        if ic[key] == nil then
             alloc(key)
-        elseif self.ic[key].value ~= nil then
-            func(self.ic[key].value)
+        elseif ic[key].value ~= nil then
+            func(ic[key].value)
         end
 
         -- subscribe to key
-        table.insert(self.ic[key].subscribers, { notify = func })
+        table.insert(ic[key].subscribers, { notify = func })
     end
 
     -- unsubscribe a function from a given key
     ---@param key string data key
     ---@param func function function to unsubscribe
     function public.unsubscribe(key, func)
-        if self.ic[key] ~= nil then
-            util.filter_table(self.ic[key].subscribers, function (s) return s.notify ~= func end)
+        if ic[key] ~= nil then
+            util.filter_table(ic[key].subscribers, function (s) return s.notify ~= func end)
         end
     end
 
@@ -51,32 +49,32 @@ function psil.create()
     ---@param key string data key
     ---@param value any data value
     function public.publish(key, value)
-        if self.ic[key] == nil then alloc(key) end
+        if ic[key] == nil then alloc(key) end
 
-        if self.ic[key].value ~= value then
-            for i = 1, #self.ic[key].subscribers do
-                self.ic[key].subscribers[i].notify(value)
+        if ic[key].value ~= value then
+            for i = 1, #ic[key].subscribers do
+                ic[key].subscribers[i].notify(value)
             end
         end
 
-        self.ic[key].value = value
+        ic[key].value = value
     end
 
     -- publish a toggled boolean value to a given key, passing it to all subscribers if it has changed<br>
     -- this is intended to be used to toggle boolean indicators such as heartbeats without extra state variables
     ---@param key string data key
     function public.toggle(key)
-        if self.ic[key] == nil then alloc(key) end
+        if ic[key] == nil then alloc(key) end
 
-        self.ic[key].value = self.ic[key].value == false
+        ic[key].value = ic[key].value == false
 
-        for i = 1, #self.ic[key].subscribers do
-            self.ic[key].subscribers[i].notify(self.ic[key].value)
+        for i = 1, #ic[key].subscribers do
+            ic[key].subscribers[i].notify(ic[key].value)
         end
     end
 
     -- clear the contents of the interconnect
-    function public.purge() self.ic = nil end
+    function public.purge() ic = {} end
 
     return public
 end

scada-common/rsio.lua

@@ -123,7 +123,7 @@ function rsio.to_string(port)
     if util.is_int(port) and port > 0 and port <= #names then
         return names[port]
     else
-        return ""
+        return "UNKNOWN"
     end
 end
 

scada-common/tcd.lua

@@ -68,7 +68,7 @@ function tcd.handle(event)
     end
 end
 
--- identify any overdo callbacks<br>
+-- identify any overdue callbacks<br>
 -- prints to log debug output
 function tcd.diagnostics()
     for timer, entry in pairs(registry) do

scada-common/types.lua

@@ -89,16 +89,18 @@ types.RTU_UNIT_TYPE = {
     REDSTONE = 1,       -- redstone I/O
     BOILER_VALVE = 2,   -- boiler mekanism 10.1+
     TURBINE_VALVE = 3,  -- turbine, mekanism 10.1+
-    IMATRIX = 4,        -- induction matrix
-    SPS = 5,            -- SPS
-    SNA = 6,            -- SNA
-    ENV_DETECTOR = 7    -- environment detector
+    DYNAMIC_VALVE = 4,  -- dynamic tank, mekanism 10.1+
+    IMATRIX = 5,        -- induction matrix
+    SPS = 6,            -- SPS
+    SNA = 7,            -- SNA
+    ENV_DETECTOR = 8    -- environment detector
 }
 
 types.RTU_UNIT_NAMES = {
     "redstone",
     "boiler_valve",
     "turbine_valve",
+    "dynamic_valve",
     "induction_matrix",
     "sps",
     "sna",
@@ -115,6 +117,7 @@ function types.rtu_type_to_string(utype)
     elseif utype == types.RTU_UNIT_TYPE.REDSTONE or
        utype == types.RTU_UNIT_TYPE.BOILER_VALVE or
        utype == types.RTU_UNIT_TYPE.TURBINE_VALVE or
+       utype == types.RTU_UNIT_TYPE.DYNAMIC_VALVE or
        utype == types.RTU_UNIT_TYPE.IMATRIX or
        utype == types.RTU_UNIT_TYPE.SPS or
        utype == types.RTU_UNIT_TYPE.SNA or
@@ -158,13 +161,26 @@ types.PROCESS_NAMES = {
 ---@enum WASTE_MODE
 types.WASTE_MODE = {
     AUTO = 1,
-    PLUTONIUM = 2,
-    POLONIUM = 3,
-    ANTI_MATTER = 4
+    MANUAL_PLUTONIUM = 2,
+    MANUAL_POLONIUM = 3,
+    MANUAL_ANTI_MATTER = 4
 }
 
 types.WASTE_MODE_NAMES = {
     "AUTO",
+    "MANUAL_PLUTONIUM",
+    "MANUAL_POLONIUM",
+    "MANUAL_ANTI_MATTER"
+}
+
+---@enum WASTE_PRODUCT
+types.WASTE_PRODUCT = {
+    PLUTONIUM = 1,
+    POLONIUM = 2,
+    ANTI_MATTER = 3
+}
+
+types.WASTE_PRODUCT_NAMES = {
     "PLUTONIUM",
     "POLONIUM",
     "ANTI_MATTER"
@@ -315,6 +331,17 @@ types.RPS_TRIP_CAUSE = {
     FORCE_DISABLED = "force_disabled"
 }
 
+---@alias container_mode
+---| "BOTH"
+---| "FILL"
+---| "EMPTY"
+
+types.CONTAINER_MODE = {
+    BOTH = "BOTH",
+    FILL = "FILL",
+    EMPTY = "EMPTY"
+}
+
 ---@alias dumping_mode
 ---| "IDLE"
 ---| "DUMPING"

scada-common/util.lua

@@ -7,6 +7,9 @@ local cc_strings = require("cc.strings")
 ---@class util
 local util = {}
 
+-- scada-common version
+util.version = "1.0.1"
+
 -- ENVIRONMENT CONSTANTS --
 
 util.TICK_TIME_S = 0.05
@@ -80,9 +83,9 @@ end
 ---@return string
 function util.strrep(str, n)
     local repeated = ""
-    for _ = 1, n do
-        repeated = repeated .. str
-    end
+
+    for _ = 1, n do repeated = repeated .. str end
+
     return repeated
 end
 
@@ -123,7 +126,9 @@ function util.strwrap(str, limit) return cc_strings.wrap(str, limit) end
 ---@diagnostic disable-next-line: unused-vararg
 function util.concat(...)
     local str = ""
+
     for _, v in ipairs(arg) do str = str .. util.strval(v) end
+
     return str
 end
 
@@ -322,7 +327,8 @@ end
 --- EVENT_CONSUMER: this function consumes events
 function util.nop() util.psleep(0.05) end
 
--- attempt to maintain a minimum loop timing (duration of execution)
+-- attempt to maintain a minimum loop timing (duration of execution)<br>
+-- note: will not yield for time periods less than 50ms
 ---@nodiscard
 ---@param target_timing integer minimum amount of milliseconds to wait for
 ---@param last_update integer millisecond time of last update
@@ -399,7 +405,7 @@ local function GFE(fe) return fe / 1000000000.0 end
 local function TFE(fe) return fe / 1000000000000.0 end
 local function PFE(fe) return fe / 1000000000000000.0 end
 local function EFE(fe) return fe / 1000000000000000000.0 end    -- if you accomplish this please touch grass
-local function ZFE(fe) return fe / 1000000000000000000000.0 end -- please stop
+local function ZFE(fe) return fe / 1000000000000000000000.0 end -- how & why did you do this?
 
 -- format a power value into XXX.XX UNIT format (FE, kFE, MFE, GFE, TFE, PFE, EFE, ZFE)
 ---@nodiscard

supervisor/config.lua

@@ -10,27 +10,39 @@ config.RTU_CHANNEL = 16242
 config.CRD_CHANNEL = 16243
 -- pocket comms channel
 config.PKT_CHANNEL = 16244
--- max trusted modem message distance (0 to disable check)
+-- max trusted modem message distance 
+-- (0 to disable check)
 config.TRUSTED_RANGE = 0
--- time in seconds (>= 2) before assuming a remote device is no longer active
+-- time in seconds (>= 2) before assuming a remote
+-- device is no longer active
 config.PLC_TIMEOUT = 5
 config.RTU_TIMEOUT = 5
 config.CRD_TIMEOUT = 5
 config.PKT_TIMEOUT = 5
--- facility authentication key (do NOT use one of your passwords)
+-- facility authentication key 
+-- (do NOT use one of your passwords)
 -- this enables verifying that messages are authentic
--- all devices on the same network must use the same key
+-- all devices on this network must use this key
 -- config.AUTH_KEY = "SCADAfacility123"
 
 -- expected number of reactors
 config.NUM_REACTORS = 4
--- expected number of boilers/turbines for each reactor
+-- expected number of devices for each unit
 config.REACTOR_COOLING = {
-    { BOILERS = 1, TURBINES = 1 },  -- reactor unit 1
-    { BOILERS = 1, TURBINES = 1 },  -- reactor unit 2
-    { BOILERS = 1, TURBINES = 1 },  -- reactor unit 3
-    { BOILERS = 1, TURBINES = 1 }   -- reactor unit 4
+-- reactor unit 1
+{ BOILERS = 1, TURBINES = 1, TANK = false },
+-- reactor unit 2
+{ BOILERS = 1, TURBINES = 1, TANK = false },
+-- reactor unit 3
+{ BOILERS = 1, TURBINES = 1, TANK = false },
+-- reactor unit 4
+{ BOILERS = 1, TURBINES = 1, TANK = false }
 }
+-- advanced facility dynamic tank configuration
+-- (see wiki for details)
+-- by default, dynamic tanks are for each unit
+config.FAC_TANK_MODE = 0
+config.FAC_TANK_DEFS = { 0, 0, 0, 0 }
 
 -- log path
 config.LOG_PATH = "/log.txt"

supervisor/facility.lua

@@ -1,19 +1,32 @@
-local const = require("scada-common.constants")
-local log   = require("scada-common.log")
-local rsio  = require("scada-common.rsio")
-local types = require("scada-common.types")
-local util  = require("scada-common.util")
+local audio  = require("scada-common.audio")
+local const  = require("scada-common.constants")
+local log    = require("scada-common.log")
+local rsio   = require("scada-common.rsio")
+local types  = require("scada-common.types")
+local util   = require("scada-common.util")
 
-local unit  = require("supervisor.unit")
+local unit   = require("supervisor.unit")
 
-local rsctl = require("supervisor.session.rsctl")
+local qtypes = require("supervisor.session.rtu.qtypes")
 
-local PROCESS = types.PROCESS
-local PROCESS_NAMES = types.PROCESS_NAMES
-local PRIO = types.ALARM_PRIORITY
+local rsctl  = require("supervisor.session.rsctl")
+
+local TONE           = audio.TONE
+
+local ALARM          = types.ALARM
+local PRIO           = types.ALARM_PRIORITY
+local ALARM_STATE    = types.ALARM_STATE
+local CONTAINER_MODE = types.CONTAINER_MODE
+local PROCESS        = types.PROCESS
+local PROCESS_NAMES  = types.PROCESS_NAMES
+local RTU_UNIT_TYPE  = types.RTU_UNIT_TYPE
+local WASTE_MODE     = types.WASTE_MODE
+local WASTE          = types.WASTE_PRODUCT
 
 local IO = rsio.IO
 
+local DTV_RTU_S_DATA = qtypes.DTV_RTU_S_DATA
+
 -- 7.14 kJ per blade for 1 mB of fissile fuel<br>
 -- 2856 FE per blade per 1 mB, 285.6 FE per blade per 0.1 mB (minimum)
 local POWER_PER_BLADE = util.joules_to_fe(7140)
@@ -51,16 +64,20 @@ local facility = {}
 -- create a new facility management object
 ---@nodiscard
 ---@param num_reactors integer number of reactor units
----@param cooling_conf table cooling configurations of reactor units
+---@param cooling_conf sv_cooling_conf cooling configurations of reactor units
 function facility.new(num_reactors, cooling_conf)
     local self = {
         units = {},
         status_text = { "START UP", "initializing..." },
         all_sys_ok = false,
+        allow_testing = false,
         -- rtus
         rtu_conn_count = 0,
+        rtu_list = {},
         redstone = {},
         induction = {},
+        sps = {},
+        tanks = {},
         envd = {},
         -- redstone I/O control
         io_ctl = nil,   ---@type rs_controller
@@ -99,6 +116,16 @@ function facility.new(num_reactors, cooling_conf)
         last_update = 0,
         last_error = 0.0,
         last_time = 0.0,
+        -- waste processing
+        waste_product = WASTE.PLUTONIUM,
+        current_waste_product = WASTE.PLUTONIUM,
+        pu_fallback = false,
+        -- alarm tones
+        tone_states = {},
+        test_tone_set = false,
+        test_tone_reset = false,
+        test_tone_states = {},
+        test_alarm_states = {},
         -- statistics
         im_stat_init = false,
         avg_charge = util.mov_avg(3, 0.0),
@@ -108,17 +135,21 @@ function facility.new(num_reactors, cooling_conf)
 
     -- create units
     for i = 1, num_reactors do
-        table.insert(self.units, unit.new(i, cooling_conf[i].BOILERS, cooling_conf[i].TURBINES))
+        table.insert(self.units, unit.new(i, cooling_conf.r_cool[i].BOILERS, cooling_conf.r_cool[i].TURBINES))
         table.insert(self.group_map, 0)
     end
 
+    -- list for RTU session management
+    self.rtu_list = { self.redstone, self.induction, self.sps, self.tanks, self.envd }
+
     -- init redstone RTU I/O controller
     self.io_ctl = rsctl.new(self.redstone)
 
-    -- unlink disconnected units
-    ---@param sessions table
-    local function _unlink_disconnected_units(sessions)
-        util.filter_table(sessions, function (u) return u.is_connected() end)
+    -- fill blank alarm/tone states
+    for _ = 1, 12 do table.insert(self.test_alarm_states, false) end
+    for _ = 1, 8 do
+        table.insert(self.tone_states, false)
+        table.insert(self.test_tone_states, false)
     end
 
     -- check if all auto-controlled units completed ramping
@@ -205,40 +236,69 @@ function facility.new(num_reactors, cooling_conf)
         table.insert(self.redstone, rs_unit)
     end
 
-    -- link an imatrix RTU session
+    -- link an induction matrix RTU session
     ---@param imatrix unit_session
+    ---@return boolean linked induction matrix accepted (max 1)
     function public.add_imatrix(imatrix)
-        table.insert(self.induction, imatrix)
+        if #self.induction == 0 then
+            table.insert(self.induction, imatrix)
+            return true
+        else return false end
+    end
+
+    -- link an SPS RTU session
+    ---@param sps unit_session
+    ---@return boolean linked SPS accepted (max 1)
+    function public.add_sps(sps)
+        if #self.sps == 0 then
+            table.insert(self.sps, sps)
+            return true
+        else return false end
+    end
+
+    -- link a dynamic tank RTU session
+    ---@param dynamic_tank unit_session
+    ---@return boolean linked dynamic tank accepted (max 1)
+    function public.add_tank(dynamic_tank)
+        if #self.tanks == 0 then
+            table.insert(self.tanks, dynamic_tank)
+            return true
+        else return false end
     end
 
     -- link an environment detector RTU session
     ---@param envd unit_session
+    ---@return boolean linked environment detector accepted (max 1)
     function public.add_envd(envd)
-        table.insert(self.envd, envd)
+        if #self.envd == 0 then
+            table.insert(self.envd, envd)
+            return true
+        else return false end
     end
 
     -- purge devices associated with the given RTU session ID
     ---@param session integer RTU session ID
     function public.purge_rtu_devices(session)
-        util.filter_table(self.redstone,  function (s) return s.get_session_id() ~= session end)
-        util.filter_table(self.induction, function (s) return s.get_session_id() ~= session end)
-        util.filter_table(self.envd,      function (s) return s.get_session_id() ~= session end)
+        for _, v in pairs(self.rtu_list) do util.filter_table(v, function (s) return s.get_session_id() ~= session end) end
     end
 
     -- UPDATE --
 
     -- supervisor sessions reporting the list of active RTU sessions
     ---@param rtu_sessions table session list of all connected RTUs
-    function public.report_rtus(rtu_sessions)
-        self.rtu_conn_count = #rtu_sessions
-    end
+    function public.report_rtus(rtu_sessions) self.rtu_conn_count = #rtu_sessions end
 
     -- update (iterate) the facility management
     function public.update()
         -- unlink RTU unit sessions if they are closed
-        _unlink_disconnected_units(self.redstone)
-        _unlink_disconnected_units(self.induction)
-        _unlink_disconnected_units(self.envd)
+        for _, v in pairs(self.rtu_list) do util.filter_table(v, function (u) return u.is_connected() end) end
+
+        -- check if test routines are allowed right now
+        self.allow_testing = true
+        for i = 1, #self.units do
+            local u = self.units[i] ---@type reactor_unit
+            self.allow_testing = self.allow_testing and u.is_safe_idle()
+        end
 
         -- current state for process control
         local charge_update = 0
@@ -277,6 +337,8 @@ function facility.new(num_reactors, cooling_conf)
         -- Run Process Control --
         -------------------------
 
+        --#region Process Control
+
         local avg_charge = self.avg_charge.compute()
         local avg_inflow = self.avg_inflow.compute()
 
@@ -542,10 +604,14 @@ function facility.new(num_reactors, cooling_conf)
             next_mode = PROCESS.INACTIVE
         end
 
+        --#endregion
+
         ------------------------------
         -- Evaluate Automatic SCRAM --
         ------------------------------
 
+        --#region Automatic SCRAM
+
         local astatus = self.ascram_status
 
         if self.induction[1] ~= nil then
@@ -659,6 +725,8 @@ function facility.new(num_reactors, cooling_conf)
             end
         end
 
+        --#endregion
+
         -- update last mode and set next mode
         self.last_mode = self.mode
         self.mode = next_mode
@@ -692,12 +760,147 @@ function facility.new(num_reactors, cooling_conf)
 
             self.io_ctl.digital_write(IO.F_ALARM, has_alarm)
         end
+
+        ----------------
+        -- Unit Tasks --
+        ----------------
+
+        local insufficent_po_rate = false
+        local need_emcool = false
+
+        for i = 1, #self.units do
+            local u = self.units[i] ---@type reactor_unit
+
+            -- update auto waste processing
+            if u.get_control_inf().waste_mode == WASTE_MODE.AUTO then
+                if (u.get_sna_rate() * 10.0) < u.get_burn_rate() then
+                    insufficent_po_rate = true
+                end
+            end
+
+            -- check if unit activated emergency coolant & uses facility tanks
+            if (cooling_conf.fac_tank_mode > 0) and u.is_emer_cool_tripped() and (cooling_conf.fac_tank_defs[i] == 2) then
+                need_emcool = true
+            end
+        end
+
+        -- update waste product
+        if self.waste_product == WASTE.PLUTONIUM or (self.pu_fallback and insufficent_po_rate) then
+            self.current_waste_product = WASTE.PLUTONIUM
+        else self.current_waste_product = self.waste_product end
+
+        -- make sure dynamic tanks are allowing outflow if required
+        -- set all, rather than trying to determine which is for which (simpler & safer)
+        -- there should be no need for any to be in fill only mode
+        if need_emcool then
+            for i = 1, #self.tanks do
+                local session = self.tanks[i]   ---@type unit_session
+                local tank = session.get_db()   ---@type dynamicv_session_db
+
+                if tank.state.container_mode == CONTAINER_MODE.FILL then
+                    session.get_cmd_queue().push_data(DTV_RTU_S_DATA.SET_CONT_MODE, CONTAINER_MODE.BOTH)
+                end
+            end
+        end
+
+        ------------------------
+        -- Update Alarm Tones --
+        ------------------------
+
+        local allow_test = self.allow_testing and self.test_tone_set
+
+        local alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
+
+        -- reset tone states before re-evaluting
+        for i = 1, #self.tone_states do self.tone_states[i] = false end
+
+        if allow_test then
+            alarms = self.test_alarm_states
+        else
+            -- check all alarms for all units
+            for i = 1, #self.units do
+                local u = self.units[i] ---@type reactor_unit
+                for id, alarm in pairs(u.get_alarms()) do
+                    alarms[id] = alarms[id] or (alarm == ALARM_STATE.TRIPPED)
+                end
+            end
+
+            if not self.test_tone_reset then
+                -- clear testing alarms if we aren't using them
+                for i = 1, #self.test_alarm_states do self.test_alarm_states[i] = false end
+            end
+        end
+
+        -- Evaluate Alarms --
+
+        -- containment breach is worst case CRITICAL alarm, this takes priority
+        if alarms[ALARM.ContainmentBreach] then
+            self.tone_states[TONE.T_1800Hz_Int_4Hz] = true
+        else
+            -- critical damage is highest priority CRITICAL level alarm
+            if alarms[ALARM.CriticalDamage] then
+                self.tone_states[TONE.T_660Hz_Int_125ms] = true
+            else
+                -- EMERGENCY level alarms + URGENT over temp
+                if alarms[ALARM.ReactorDamage] or alarms[ALARM.ReactorOverTemp] or alarms[ALARM.ReactorWasteLeak] then
+                    self.tone_states[TONE.T_544Hz_440Hz_Alt] = true
+                -- URGENT level turbine trip
+                elseif alarms[ALARM.TurbineTrip] then
+                    self.tone_states[TONE.T_745Hz_Int_1Hz] = true
+                -- URGENT level reactor lost
+                elseif alarms[ALARM.ReactorLost] then
+                    self.tone_states[TONE.T_340Hz_Int_2Hz] = true
+                -- TIMELY level alarms
+                elseif alarms[ALARM.ReactorHighTemp] or alarms[ALARM.ReactorHighWaste] or alarms[ALARM.RCSTransient] then
+                    self.tone_states[TONE.T_800Hz_Int] = true
+                end
+            end
+
+            -- check RPS transient URGENT level alarm
+            if alarms[ALARM.RPSTransient] then
+                self.tone_states[TONE.T_1000Hz_Int] = true
+                -- disable really painful audio combination
+                self.tone_states[TONE.T_340Hz_Int_2Hz] = false
+            end
+        end
+
+        -- radiation is a big concern, always play this CRITICAL level alarm if active
+        if alarms[ALARM.ContainmentRadiation] then
+            self.tone_states[TONE.T_800Hz_1000Hz_Alt] = true
+            -- we are going to disable the RPS trip alarm audio due to conflict, and if it was enabled
+            -- then we can re-enable the reactor lost alarm audio since it doesn't painfully combine with this one
+            if self.tone_states[TONE.T_1000Hz_Int] and alarms[ALARM.ReactorLost] then self.tone_states[TONE.T_340Hz_Int_2Hz] = true end
+            -- it sounds *really* bad if this is in conjunction with these other tones, so disable them
+            self.tone_states[TONE.T_745Hz_Int_1Hz] = false
+            self.tone_states[TONE.T_800Hz_Int] = false
+            self.tone_states[TONE.T_1000Hz_Int] = false
+        end
+
+        -- add to tone states if testing is active
+        if allow_test then
+            for i = 1, #self.tone_states do
+                self.tone_states[i] = self.tone_states[i] or self.test_tone_states[i]
+            end
+
+            self.test_tone_reset = false
+        else
+            if not self.test_tone_reset then
+                -- clear testing tones if we aren't using them
+                for i = 1, #self.test_tone_states do self.test_tone_states[i] = false end
+            end
+
+            -- flag that tones were reset
+            self.test_tone_set = false
+            self.test_tone_reset = true
+        end
     end
 
-    -- call the update function of all units in the facility
+    -- call the update function of all units in the facility<br>
+    -- additionally sets the requested auto waste mode if applicable
     function public.update_units()
         for i = 1, #self.units do
             local u = self.units[i] ---@type reactor_unit
+            u.auto_set_waste(self.current_waste_product)
             u.update()
         end
     end
@@ -721,15 +924,15 @@ function facility.new(num_reactors, cooling_conf)
     end
 
     -- stop auto control
-    function public.auto_stop()
-        self.mode = PROCESS.INACTIVE
-    end
+    function public.auto_stop() self.mode = PROCESS.INACTIVE end
 
     -- set automatic control configuration and start the process
     ---@param config coord_auto_config configuration
     ---@return table response ready state (successfully started) and current configuration (after updating)
     function public.auto_start(config)
-        local ready = false
+        local charge_scaler = 1000000   -- convert MFE to FE
+        local gen_scaler    = 1000      -- convert kFE to FE
+        local ready         = false
 
         -- load up current limits
         local limits = {}
@@ -749,11 +952,11 @@ function facility.new(num_reactors, cooling_conf)
             end
 
             if (type(config.charge_target) == "number") and config.charge_target >= 0 then
-                self.charge_setpoint = config.charge_target * 1000000  -- convert MFE to FE
+                self.charge_setpoint = config.charge_target * charge_scaler
             end
 
             if (type(config.gen_target) == "number") and config.gen_target >= 0 then
-                self.gen_rate_setpoint = config.gen_target * 1000   -- convert kFE to FE
+                self.gen_rate_setpoint = config.gen_target * gen_scaler
             end
 
             if (type(config.limits) == "table") and (#config.limits == num_reactors) then
@@ -769,11 +972,9 @@ function facility.new(num_reactors, cooling_conf)
 
             ready = self.mode_set > 0
 
-            if (self.mode_set == PROCESS.CHARGE) and (self.charge_setpoint <= 0) then
-                ready = false
-            elseif (self.mode_set == PROCESS.GEN_RATE) and (self.gen_rate_setpoint <= 0) then
-                ready = false
-            elseif (self.mode_set == PROCESS.BURN_RATE) and (self.burn_target < 0.1) then
+            if (self.mode_set == PROCESS.CHARGE) and (self.charge_setpoint <= 0) or
+               (self.mode_set == PROCESS.GEN_RATE) and (self.gen_rate_setpoint <= 0) or
+               (self.mode_set == PROCESS.BURN_RATE) and (self.burn_target < 0.1) then
                 ready = false
             end
 
@@ -782,7 +983,14 @@ function facility.new(num_reactors, cooling_conf)
             if ready then self.mode = self.mode_set end
         end
 
-        return { ready, self.mode_set, self.burn_target, self.charge_setpoint, self.gen_rate_setpoint, limits }
+        return {
+            ready,
+            self.mode_set,
+            self.burn_target,
+            self.charge_setpoint / charge_scaler,
+            self.gen_rate_setpoint / gen_scaler,
+            limits
+        }
     end
 
     -- SETTINGS --
@@ -807,15 +1015,79 @@ function facility.new(num_reactors, cooling_conf)
         end
     end
 
+    -- set waste production
+    ---@param product WASTE_PRODUCT target product
+    ---@return WASTE_PRODUCT product newly set value, if valid
+    function public.set_waste_product(product)
+        if product == WASTE.PLUTONIUM or product == WASTE.POLONIUM or product == WASTE.ANTI_MATTER then
+            self.waste_product = product
+        end
+
+        return self.waste_product
+    end
+
+    -- enable/disable plutonium fallback
+    ---@param enabled boolean requested state
+    ---@return boolean enabled newly set value
+    function public.set_pu_fallback(enabled)
+        self.pu_fallback = enabled == true
+        return self.pu_fallback
+    end
+
+    -- DIAGNOSTIC TESTING --
+
+    -- attempt to set a test tone state
+    ---@param id TONE|0 tone ID or 0 to disable all
+    ---@param state boolean state
+    ---@return boolean allow_testing, table test_tone_states
+    function public.diag_set_test_tone(id, state)
+        if self.allow_testing then
+            self.test_tone_set = true
+            self.test_tone_reset = false
+
+            if id == 0 then
+                for i = 1, #self.test_tone_states do self.test_tone_states[i] = false end
+            else
+                self.test_tone_states[id] = state
+            end
+        end
+
+        return self.allow_testing, self.test_tone_states
+    end
+
+    -- attempt to set a test alarm state
+    ---@param id ALARM|0 alarm ID or 0 to disable all
+    ---@param state boolean state
+    ---@return boolean allow_testing, table test_alarm_states
+    function public.diag_set_test_alarm(id, state)
+        if self.allow_testing then
+            self.test_tone_set = true
+            self.test_tone_reset = false
+
+            if id == 0 then
+                for i = 1, #self.test_alarm_states do self.test_alarm_states[i] = false end
+            else
+                self.test_alarm_states[id] = state
+            end
+        end
+
+        return self.allow_testing, self.test_alarm_states
+    end
+
     -- READ STATES/PROPERTIES --
 
-    -- get build properties of all machines
+    -- get current alarm tone on/off states
     ---@nodiscard
-    ---@param inc_imatrix boolean? true/nil to include induction matrix build, false to exclude
-    function public.get_build(inc_imatrix)
+    function public.get_alarm_tones() return self.tone_states end
+
+    -- get build properties of all facility devices
+    ---@nodiscard
+    ---@param type RTU_UNIT_TYPE? type or nil to include only a particular unit type, or to include all if nil
+    function public.get_build(type)
+        local all = type == nil
         local build = {}
 
-        if inc_imatrix ~= false then
+        if all or type == RTU_UNIT_TYPE.IMATRIX then
             build.induction = {}
             for i = 1, #self.induction do
                 local matrix = self.induction[i]    ---@type unit_session
@@ -823,6 +1095,22 @@ function facility.new(num_reactors, cooling_conf)
             end
         end
 
+        if all or type == RTU_UNIT_TYPE.SPS then
+            build.sps = {}
+            for i = 1, #self.sps do
+                local sps = self.sps[i]             ---@type unit_session
+                build.sps[sps.get_device_idx()] = { sps.get_db().formed, sps.get_db().build }
+            end
+        end
+
+        if all or type == RTU_UNIT_TYPE.DYNAMIC_VALVE then
+            build.tanks = {}
+            for i = 1, #self.tanks do
+                local tank = self.tanks[i]          ---@type unit_session
+                build.tanks[tank.get_device_idx()] = { tank.get_db().formed, tank.get_db().build }
+            end
+        end
+
         return build
     end
 
@@ -844,7 +1132,9 @@ function facility.new(num_reactors, cooling_conf)
             astat.gen_fault or self.mode == PROCESS.GEN_RATE_FAULT_IDLE,
             self.status_text[1],
             self.status_text[2],
-            self.group_map
+            self.group_map,
+            self.current_waste_product,
+            (self.current_waste_product == WASTE.PLUTONIUM) and (self.waste_product ~= WASTE.PLUTONIUM)
         }
     end
 
@@ -866,23 +1156,32 @@ function facility.new(num_reactors, cooling_conf)
         -- status of induction matricies (including tanks)
         status.induction = {}
         for i = 1, #self.induction do
-            local matrix = self.induction[i]  ---@type unit_session
-            status.induction[matrix.get_device_idx()] = {
-                matrix.is_faulted(),
-                matrix.get_db().formed,
-                matrix.get_db().state,
-                matrix.get_db().tanks
-            }
+            local matrix = self.induction[i]    ---@type unit_session
+            local db     = matrix.get_db()      ---@type imatrix_session_db
+            status.induction[matrix.get_device_idx()] = { matrix.is_faulted(), db.formed, db.state, db.tanks }
+        end
+
+        -- status of sps
+        status.sps = {}
+        for i = 1, #self.sps do
+            local sps = self.sps[i]     ---@type unit_session
+            local db  = sps.get_db()    ---@type sps_session_db
+            status.sps[sps.get_device_idx()] = { sps.is_faulted(), db.formed, db.state, db.tanks }
+        end
+
+        -- status of dynamic tanks
+        status.tanks = {}
+        for i = 1, #self.tanks do
+            local tank = self.tanks[i]  ---@type unit_session
+            local db   = tank.get_db()  ---@type dynamicv_session_db
+            status.tanks[tank.get_device_idx()] = { tank.is_faulted(), db.formed, db.state, db.tanks }
         end
 
         -- radiation monitors (environment detectors)
         status.rad_mon = {}
         for i = 1, #self.envd do
             local envd = self.envd[i]   ---@type unit_session
-            status.rad_mon[envd.get_device_idx()] = {
-                envd.is_faulted(),
-                envd.get_db().radiation
-            }
+            status.rad_mon[envd.get_device_idx()] = { envd.is_faulted(), envd.get_db().radiation }
         end
 
         return status

supervisor/panel/front_panel.lua

@@ -1,5 +1,5 @@
 --
--- Main SCADA Coordinator GUI
+-- Supervisor Front Panel GUI
 --
 
 local util          = require("scada-common.util")
@@ -29,7 +29,7 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 
 local cpair = core.cpair
 
--- create new main view
+-- create new front panel view
 ---@param panel graphics_element main displaybox
 local function init(panel)
     TextBox{parent=panel,y=1,text="SCADA SUPERVISOR",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}

supervisor/panel/pgi.lua

@@ -60,6 +60,8 @@ function pgi.delete_rtu_entry(session_id)
         if not success then
             log.error(util.c("PGI: failed to delete RTU entry (", result, ")"), true)
         end
+    else
+        log.debug(util.c("PGI: tried to delete unknown RTU entry ", session_id))
     end
 end
 
@@ -87,6 +89,8 @@ function pgi.delete_pdg_entry(session_id)
         if not success then
             log.error(util.c("PGI: failed to delete PDG entry (", result, ")"), true)
         end
+    else
+        log.debug(util.c("PGI: tried to delete unknown PDG entry ", session_id))
     end
 end
 

supervisor/session/coordinator.lua

@@ -1,7 +1,6 @@
 local comms    = require("scada-common.comms")
 local log      = require("scada-common.log")
 local mqueue   = require("scada-common.mqueue")
-local types    = require("scada-common.types")
 local util     = require("scada-common.util")
 
 local databus  = require("supervisor.databus")
@@ -16,10 +15,11 @@ local SCADA_CRDN_TYPE = comms.SCADA_CRDN_TYPE
 local UNIT_COMMAND = comms.UNIT_COMMAND
 local FAC_COMMAND = comms.FAC_COMMAND
 
-local RTU_UNIT_TYPE = types.RTU_UNIT_TYPE
-
 local SV_Q_DATA = svqtypes.SV_Q_DATA
 
+-- grace period in seconds for coordinator to finish UI draw to prevent timeout
+local WATCHDOG_GRACE = 20.0
+
 -- retry time constants in ms
 -- local INITIAL_WAIT = 1500
 local RETRY_PERIOD = 1000
@@ -64,6 +64,7 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
         r_seq_num = nil,
         connected = true,
         conn_watchdog = util.new_watchdog(timeout),
+        establish_time = util.time_s(),
         last_rtt = 0,
         -- periodic messages
         periodics = {
@@ -153,7 +154,8 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
     local function _send_fac_status()
         local status = {
             facility.get_control_status(),
-            facility.get_rtu_statuses()
+            facility.get_rtu_statuses(),
+            facility.get_alarm_tones()
         }
 
         _send(SCADA_CRDN_TYPE.FAC_STATUS, status)
@@ -171,7 +173,8 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
                 unit.get_rtu_statuses(),
                 unit.get_annunciator(),
                 unit.get_alarms(),
-                unit.get_state()
+                unit.get_state(),
+                unit.get_valves()
             }
         end
 
@@ -258,6 +261,18 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
                     elseif cmd == FAC_COMMAND.ACK_ALL_ALARMS then
                         facility.ack_all()
                         _send(SCADA_CRDN_TYPE.FAC_CMD, { cmd, true })
+                    elseif cmd == FAC_COMMAND.SET_WASTE_MODE then
+                        if pkt.length == 2 then
+                            _send(SCADA_CRDN_TYPE.FAC_CMD, { cmd, facility.set_waste_product(pkt.data[2]) })
+                        else
+                            log.debug(log_header .. "CRDN set waste mode packet length mismatch")
+                        end
+                    elseif cmd == FAC_COMMAND.SET_PU_FB then
+                        if pkt.length == 2 then
+                            _send(SCADA_CRDN_TYPE.FAC_CMD, { cmd, facility.set_pu_fallback(pkt.data[2]) })
+                        else
+                            log.debug(log_header .. "CRDN set pu fallback packet length mismatch")
+                        end
                     else
                         log.debug(log_header .. "CRDN facility command unknown")
                     end
@@ -294,9 +309,9 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
                             end
                         elseif cmd == UNIT_COMMAND.SET_WASTE then
                             if (pkt.length == 3) and (type(pkt.data[3]) == "number") and (pkt.data[3] > 0) and (pkt.data[3] <= 4) then
-                                unit.set_waste(pkt.data[3])
+                                unit.set_waste_mode(pkt.data[3])
                             else
-                                log.debug(log_header .. "CRDN unit command set waste missing option")
+                                log.debug(log_header .. "CRDN unit command set waste missing/invalid option")
                             end
                         elseif cmd == UNIT_COMMAND.ACK_ALL_ALARMS then
                             unit.ack_all()
@@ -345,7 +360,15 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
     -- check if a timer matches this session's watchdog
     ---@nodiscard
     function public.check_wd(timer)
-        return self.conn_watchdog.is_timer(timer) and self.connected
+        local is_wd = self.conn_watchdog.is_timer(timer) and self.connected
+
+        -- if we are waiting for initial coordinator UI draw, don't close yet
+        if is_wd and (util.time_s() - self.establish_time) <= WATCHDOG_GRACE then
+            self.conn_watchdog.feed()
+            is_wd = false
+        end
+
+        return is_wd
     end
 
     -- close the connection
@@ -394,7 +417,7 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
                             local builds = {}
 
                             local unit = self.units[unit_id]    ---@type reactor_unit
-                            builds[unit_id] = unit.get_build(true, false, false)
+                            builds[unit_id] = unit.get_build(-1)
 
                             _send(SCADA_CRDN_TYPE.UNIT_BUILDS, { builds })
                         elseif cmd.key == CRD_S_DATA.RESEND_RTU_BUILD then
@@ -408,7 +431,7 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
                                 local builds = {}
 
                                 local unit = self.units[unit_id]    ---@type reactor_unit
-                                builds[unit_id] = unit.get_build(false, cmd.val.type == RTU_UNIT_TYPE.BOILER_VALVE, cmd.val.type == RTU_UNIT_TYPE.TURBINE_VALVE)
+                                builds[unit_id] = unit.get_build(cmd.val.type)
 
                                 _send(SCADA_CRDN_TYPE.UNIT_BUILDS, { builds })
                             else
@@ -417,7 +440,7 @@ function coordinator.new_session(id, s_addr, in_queue, out_queue, timeout, facil
                                 self.retry_times.f_builds_packet = util.time() + PARTIAL_RETRY_PERIOD
                                 self.acks.fac_builds = false
 
-                                _send(SCADA_CRDN_TYPE.FAC_BUILDS, { facility.get_build(cmd.val.type == RTU_UNIT_TYPE.IMATRIX) })
+                                _send(SCADA_CRDN_TYPE.FAC_BUILDS, { facility.get_build(cmd.val.type) })
                             end
                         else
                             log.error(log_header .. "unsupported data command received in in_queue (this is a bug)", true)