Merge pull request #492 from MikaylaFischler/devel

2024.05.16 Beta Hotfix

.github/FUNDING.yml

@@ -0,0 +1 @@
+ko_fi: mikayla_f

.github/ISSUE_TEMPLATE/feature_request.md

@@ -2,7 +2,7 @@
 name: Feature request
 about: Suggest an idea for this project
 title: ''
-labels: enhancement
+labels: "enhancement,feature request"
 assignees: ''
 
 ---

.github/workflows/check.yml

@@ -5,12 +5,10 @@ on:
   push:
     branches:
       - main
-      - latest
       - devel
   pull_request:
     branches:
       - main
-      - latest
       - devel
 jobs:
   check:
@@ -28,4 +26,4 @@ jobs:
           # --no-max-line-length = Disable warnings for long line lengths
           # --exclude-files ...  = Exclude lockbox library (external) and config files
           # --globals ...        = Override all globals overridden in .vscode/settings.json AND 'os' since CraftOS 'os' differs from Lua's 'os'
-          args: . --no-max-line-length -i 121 512 542 --exclude-files ./lockbox/* ./*/config.lua --globals os _HOST bit colors fs http parallel periphemu peripheral read rs settings shell term textutils window
+          args: . --no-max-line-length -i 121 512 542 --exclude-files ./lockbox/* ./*/config.lua --globals os _HOST bit colors fs http keys parallel periphemu peripheral read rs settings shell term textutils window

.github/workflows/manifest.yml

@@ -6,7 +6,6 @@ on:
   push:
     branches:
       - main
-      - latest
       - devel
 
 # Sets permissions of the GITHUB_TOKEN to allow deployment to GitHub Pages
@@ -43,7 +42,7 @@ jobs:
       - name: Create outputs folders
         if: success() || failure()
         shell: bash
-        run: mkdir deploy; mkdir deploy/manifests; mkdir deploy/manifests/main deploy/manifests/latest deploy/manifests/devel
+        run: mkdir deploy; mkdir deploy/manifests; mkdir deploy/manifests/main deploy/manifests/devel
       - name: Generate manifest and shields for main branch
         id: manifest-main
         if: ${{ (success() || failure()) && steps.checkout-main.outcome == 'success' }}
@@ -51,21 +50,6 @@ jobs:
       - name: Save main's manifest
         if: ${{ (success() || failure()) && steps.manifest-main.outcome == 'success' }}
         run: mv install_manifest.json deploy/manifests/main
-      # Generate manifest for latest branch
-      - name: Checkout latest
-        id: checkout-latest
-        if: success() || failure()
-        uses: actions/checkout@v3
-        with:
-          ref: 'latest'
-          clean: false
-      - name: Generate manifest for latest
-        id: manifest-latest
-        if: ${{ (success() || failure()) && steps.checkout-latest.outcome == 'success' }}
-        run: python imgen.py
-      - name: Save latest's manifest
-        if: ${{ (success() || failure()) && steps.manifest-latest.outcome == 'success' }}
-        run: mv install_manifest.json deploy/manifests/latest
       # Generate manifest for devel branch
       - name: Checkout devel
         id: checkout-devel

.vscode/settings.json

@@ -5,6 +5,7 @@
         "colors",
         "fs",
         "http",
+        "keys",
         "parallel",
         "periphemu",
         "peripheral",
@@ -24,6 +25,7 @@
     },
     "Lua.hint.setType": true,
     "Lua.diagnostics.disable": [
-        "duplicate-set-field"
+        "duplicate-set-field",
+        "inject-field"
     ]
 }

LICENSE

@@ -1,6 +1,6 @@
 MIT License
 
-Copyright © 2022 - 2023 Mikayla Fischler
+Copyright © 2022 - 2024 Mikayla Fischler
 
 Permission is hereby granted, free of charge, to any person obtaining a copy
 of this software and associated documentation files (the "Software"), to deal

README.md

@@ -4,12 +4,11 @@ Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fi
 ![GitHub](https://img.shields.io/github/license/MikaylaFischler/cc-mek-scada)
 ![GitHub release (latest by date including pre-releases)](https://img.shields.io/github/v/release/MikaylaFischler/cc-mek-scada?include_prereleases)
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=main&label=main)
-![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=latest&label=latest)
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=devel&label=devel)
 
-### [Join](https://discord.gg/R9NSCkhcwt) the Discord!
+### Join [the Discord](https://discord.gg/R9NSCkhcwt)!
 
-![Discord](https://img.shields.io/discord/1129075839288496259)
+![Discord](https://img.shields.io/discord/1129075839288496259?logo=Discord&logoColor=white&label=discord)
 
 ## Released Component Versions
 
@@ -17,7 +16,10 @@ Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fi
 
 
 ![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
+![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcommon.json)
 ![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
+![Graphics](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fgraphics.json)
+![Lockbox](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Flockbox.json)
 
 
 ![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
@@ -34,14 +36,21 @@ Mod Requirements:
 
 Mod Recommendations:
 - Advanced Peripherals (adds the capability to detect environmental radiation levels)
+- Immersive Engineering (provides bundled redstone, though any mod containing bundled redstone will do)
 
-v10.1+ is required due the complete support of CC:Tweaked added in Mekanism v10.1
+v10.1+ is required due to the complete support of CC:Tweaked added in Mekanism v10.1
 
 ## Installation
 
 You can install this on a ComputerCraft computer using either:
 * `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua`
-* `pastebin get RGasyTM4 ccmsi.lua`
+* `pastebin get sqUN6VUb ccmsi.lua`
+
+## Contributing
+
+Please reach out to me via Discord or email (or GitHub in some way) if you are thinking of making any contributions at this time. I started this project as a challenge for myself and have been enjoying having something I can work on in my own way. 
+
+Once this is out of beta I will be more open to contributions, but for now I am hoping to keep them to a minimum as the remaining challenges are ones I am looking forward to solving.
 
 ## [SCADA](https://en.wikipedia.org/wiki/SCADA)
 > Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery.

ccmsi.lua

@@ -1,9 +1,7 @@
---
--- ComputerCraft Mekanism SCADA System Installer Utility
---
-
 --[[
-Copyright (c) 2023 Mikayla Fischler
+CC-MEK-SCADA Installer Utility
+
+Copyright (c) 2023 - 2024 Mikayla Fischler
 
 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and
 associated documentation files (the "Software"), to deal in the Software without restriction,
@@ -20,7 +18,7 @@ SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
 local function println(message) print(tostring(message)) end
 local function print(message) term.write(tostring(message)) end
 
-local CCMSI_VERSION = "v1.7d"
+local CCMSI_VERSION = "v1.14"
 
 local install_dir = "/.install-cache"
 local manifest_path = "https://mikaylafischler.github.io/cc-mek-scada/manifests/"
@@ -28,12 +26,13 @@ local repo_path = "http://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada
 
 local opts = { ... }
 local mode, app, target
-local install_manifest = manifest_path .. "main/install_manifest.json"
+local install_manifest = manifest_path.."main/install_manifest.json"
 
 local function red() term.setTextColor(colors.red) end
 local function orange() term.setTextColor(colors.orange) end
 local function yellow() term.setTextColor(colors.yellow) end
 local function green() term.setTextColor(colors.green) end
+local function cyan() term.setTextColor(colors.cyan) end
 local function blue() term.setTextColor(colors.blue) end
 local function white() term.setTextColor(colors.white) end
 local function lgray() term.setTextColor(colors.lightGray) end
@@ -60,19 +59,18 @@ local function ask_y_n(question, default)
 end
 
 -- print out a white + blue text message
-local function pkg_message(message, package) white();print(message .. " ");blue();println(package);white() end
+local function pkg_message(message, package) white();print(message.." ");blue();println(package);white() end
 
 -- indicate actions to be taken based on package differences for installs/updates
-local function show_pkg_change(name, v_local, v_remote)
-    if v_local ~= nil then
-        if v_local ~= v_remote then
-            print("[" .. name .. "] updating ");blue();print(v_local);white();print(" \xbb ");blue();println(v_remote);white()
+local function show_pkg_change(name, v)
+    if v.v_local ~= nil then
+        if v.v_local ~= v.v_remote then
+            print("["..name.."] updating ");blue();print(v.v_local);white();print(" \xbb ");blue();println(v.v_remote);white()
         elseif mode == "install" then
-            pkg_message("[" .. name .. "] reinstalling", v_local)
+            pkg_message("["..name.."] reinstalling", v.v_local)
         end
-    else
-        pkg_message("[" .. name .. "] new install of", v_remote)
-    end
+    else pkg_message("["..name.."] new install of", v.v_remote) end
+    return v.v_local ~= v.v_remote
 end
 
 -- read the local manifest file
@@ -91,8 +89,8 @@ end
 local function get_remote_manifest()
     local response, error = http.get(install_manifest)
     if response == nil then
-        orange();println("failed to get installation manifest from GitHub, cannot update or install")
-        red();println("HTTP error: " .. error);white()
+        orange();println("Failed to get installation manifest from GitHub, cannot update or install.")
+        red();println("HTTP error: "..error);white()
         return false, {}
     end
 
@@ -157,92 +155,92 @@ local function _clean_dir(dir, tree)
     if tree == nil then tree = {} end
     local ls = fs.list(dir)
     for _, val in pairs(ls) do
-        local path = dir .. "/" .. val
+        local path = dir.."/"..val
         if fs.isDir(path) then
             _clean_dir(path, tree[val])
-            if #fs.list(path) == 0 then fs.delete(path);println("deleted " .. path) end
-        elseif not _in_array(val, tree) then
+            if #fs.list(path) == 0 then fs.delete(path);println("deleted "..path) end
+        elseif (not _in_array(val, tree)) and (val ~= "config.lua" ) then
             fs.delete(path)
-            println("deleted " .. path)
+            println("deleted "..path)
         end
     end
 end
 
 -- go through app/common directories to delete unused files
 local function clean(manifest)
-    local root_ext = false
     local tree = gen_tree(manifest)
 
     table.insert(tree, "install_manifest.json")
     table.insert(tree, "ccmsi.lua")
-    table.insert(tree, "log.txt")
-
-    lgray()
+    table.insert(tree, "log.txt") ---@fixme fix after migration to settings files?
 
     local ls = fs.list("/")
     for _, val in pairs(ls) do
-        if fs.isDir(val) then
-            if tree[val] ~= nil then _clean_dir("/" .. val, tree[val]) end
-            if #fs.list(val) == 0 then fs.delete(val);println("deleted " .. val) end
-        elseif not _in_array(val, tree) then
-            root_ext = true
-            yellow();println(val .. " not used")
+        if fs.isDriveRoot(val) then
+            yellow();println("skipped mount '"..val.."'")
+        elseif fs.isDir(val) then
+            if tree[val] ~= nil then lgray();_clean_dir("/"..val, tree[val])
+            else white(); if ask_y_n("delete the unused directory '"..val.."'") then lgray();_clean_dir("/"..val) end end
+            if #fs.list(val) == 0 then fs.delete(val);lgray();println("deleted empty directory '"..val.."'") end
+        elseif not _in_array(val, tree) and (string.find(val, ".settings") == nil) then
+            white();if ask_y_n("delete the unused file '"..val.."'") then fs.delete(val);lgray();println("deleted "..val) end
         end
     end
 
     white()
-    if root_ext then println("Files in root directory won't be automatically deleted.") end
 end
 
 -- get and validate command line options
 
-println("-- CC Mekanism SCADA Installer " .. CCMSI_VERSION .. " --")
+println("-- CC Mekanism SCADA Installer "..CCMSI_VERSION.." --")
 
 if #opts == 0 or opts[1] == "help" then
     println("usage: ccmsi <mode> <app> <branch>")
     println("<mode>")
     lgray()
-    println(" check       - check latest versions avilable")
+    println(" check       - check latest versions available")
     yellow()
     println("               ccmsi check <branch> for target")
     lgray()
-    println(" install     - fresh install, overwrites config")
-    println(" update      - update files EXCEPT for config/logs")
-    println(" remove      - delete files EXCEPT for config/logs")
-    println(" purge       - delete files INCLUDING config/logs")
+    println(" install     - fresh install")
+    println(" update      - update files")
+    println(" uninstall   - delete files INCLUDING config/logs")
     white();println("<app>");lgray()
     println(" reactor-plc - reactor PLC firmware")
     println(" rtu         - RTU firmware")
     println(" supervisor  - supervisor server application")
     println(" coordinator - coordinator application")
     println(" pocket      - pocket application")
-    white();println("<branch>");yellow()
-    println(" second parameter when used with check")
-    lgray();println(" main (default) | latest | devel");white()
+    println(" installer   - ccmsi installer (update only)")
+    white();println("<branch>")
+    lgray();println(" main (default) | devel");white()
     return
 else
-    mode = get_opt(opts[1], { "check", "install", "update", "remove", "purge" })
+    mode = get_opt(opts[1], { "check", "install", "update", "uninstall" })
     if mode == nil then
         red();println("Unrecognized mode.");white()
         return
     end
 
-    app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket" })
+    app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket", "installer" })
     if app == nil and mode ~= "check" then
         red();println("Unrecognized application.");white()
         return
+    elseif app == "installer" and mode ~= "update" then
+        red();println("Installer app only supports 'update' option.");white()
+        return
     end
 
     -- determine target
     if mode == "check" then target = opts[2] else target = opts[3] end
-    if (target ~= "main") and (target ~= "latest") and (target ~= "devel") then
+    if (target ~= "main") and (target ~= "devel") then
         if (target and target ~= "") then yellow();println("Unknown target, defaulting to 'main'");white() end
         target = "main"
     end
 
     -- set paths
-    install_manifest = manifest_path .. target .. "/install_manifest.json"
-    repo_path = repo_path .. target .. "/"
+    install_manifest = manifest_path..target.."/install_manifest.json"
+    repo_path = repo_path..target.."/"
 end
 
 -- run selected mode
@@ -262,21 +260,24 @@ if mode == "check" then
     -- list all versions
     for key, value in pairs(manifest.versions) do
         term.setTextColor(colors.purple)
-        print(string.format("%-14s", "[" .. key .. "]"))
+        print(string.format("%-14s", "["..key.."]"))
         if key == "installer" or (local_ok and (local_manifest.versions[key] ~= nil)) then
             blue();print(local_manifest.versions[key])
             if value ~= local_manifest.versions[key] then
                 white();print(" (")
-                term.setTextColor(colors.cyan)
-                print(value);white();println(" available)")
+                cyan();print(value);white();println(" available)")
             else green();println(" (up to date)") end
         else
             lgray();print("not installed");white();print(" (latest ")
-            term.setTextColor(colors.cyan)
-            print(value);white();println(")")
+            cyan();print(value);white();println(")")
         end
     end
+
+    if manifest.versions.installer ~= local_manifest.versions.installer then
+        yellow();println("\nA different version of the installer is available, it is recommended to update (use 'ccmsi update installer').");white()
+    end
 elseif mode == "install" or mode == "update" then
+    local update_installer = app == "installer"
     local ok, manifest = get_remote_manifest()
     if not ok then return end
 
@@ -284,71 +285,75 @@ elseif mode == "install" or mode == "update" then
         app = { v_local = nil, v_remote = nil, changed = false },
         boot = { v_local = nil, v_remote = nil, changed = false },
         comms = { v_local = nil, v_remote = nil, changed = false },
+        common = { v_local = nil, v_remote = nil, changed = false },
         graphics = { v_local = nil, v_remote = nil, changed = false },
         lockbox = { v_local = nil, v_remote = nil, changed = false }
     }
 
     -- try to find local versions
-    local local_ok, local_manifest = read_local_manifest()
+    local local_ok, lmnf = read_local_manifest()
     if not local_ok then
         if mode == "update" then
-            red();println("failed to load local installation information, cannot update");white()
+            red();println("Failed to load local installation information, cannot update.");white()
             return
         end
-    else
-        ver.boot.v_local = local_manifest.versions.bootloader
-        ver.app.v_local = local_manifest.versions[app]
-        ver.comms.v_local = local_manifest.versions.comms
-        ver.graphics.v_local = local_manifest.versions.graphics
-        ver.lockbox.v_local = local_manifest.versions.lockbox
+    elseif not update_installer then
+        ver.boot.v_local = lmnf.versions.bootloader
+        ver.app.v_local = lmnf.versions[app]
+        ver.comms.v_local = lmnf.versions.comms
+        ver.common.v_local = lmnf.versions.common
+        ver.graphics.v_local = lmnf.versions.graphics
+        ver.lockbox.v_local = lmnf.versions.lockbox
 
-        if local_manifest.versions[app] == nil then
-            red();println("another application is already installed, please purge it before installing a new application");white()
+        if lmnf.versions[app] == nil then
+            red();println("Another application is already installed, please uninstall it before installing a new application.");white()
             return
         end
+    end
 
-        local_manifest.versions.installer = CCMSI_VERSION
-        if manifest.versions.installer ~= CCMSI_VERSION then
-            yellow();println("a newer version of the installer is available, it is recommended to download it");white()
+    if manifest.versions.installer ~= CCMSI_VERSION then
+        if not update_installer then yellow();println("A different version of the installer is available, it is recommended to update to it.");white() end
+        if update_installer or ask_y_n("Would you like to update now") then
+            lgray();println("GET ccmsi.lua")
+            local dl, err = http.get(repo_path.."ccmsi.lua")
+
+            if dl == nil then
+                red();println("HTTP Error "..err)
+                println("Installer download failed.");white()
+            else
+                local handle = fs.open(debug.getinfo(1, "S").source:sub(2), "w") -- this file, regardless of name or location
+                handle.write(dl.readAll())
+                handle.close()
+                green();println("Installer updated successfully.");white()
+            end
+
+            return
         end
+    elseif update_installer then
+        green();println("Installer already up-to-date.");white()
+        return
     end
 
     ver.boot.v_remote = manifest.versions.bootloader
     ver.app.v_remote = manifest.versions[app]
     ver.comms.v_remote = manifest.versions.comms
+    ver.common.v_remote = manifest.versions.common
     ver.graphics.v_remote = manifest.versions.graphics
     ver.lockbox.v_remote = manifest.versions.lockbox
 
     green()
-    if mode == "install" then
-        println("Installing " .. app .. " files...")
-    elseif mode == "update" then
-        println("Updating " .. app .. " files... (keeping old config.lua)")
-    end
-    white()
+    if mode == "install" then print("Installing ") else print("Updating ") end
+    println(app.." files...");white()
 
-    -- display bootloader version change information
-    show_pkg_change("bootldr", ver.boot.v_local, ver.boot.v_remote)
-    ver.boot.changed = ver.boot.v_local ~= ver.boot.v_remote
-
-    -- display app version change information
-    show_pkg_change(app, ver.app.v_local, ver.app.v_remote)
-    ver.app.changed = ver.app.v_local ~= ver.app.v_remote
-
-    -- display comms version change information
-    show_pkg_change("comms", ver.comms.v_local, ver.comms.v_remote)
-    ver.comms.changed = ver.comms.v_local ~= ver.comms.v_remote
+    ver.boot.changed = show_pkg_change("bootldr", ver.boot)
+    ver.common.changed = show_pkg_change("common", ver.common)
+    ver.comms.changed = show_pkg_change("comms", ver.comms)
     if ver.comms.changed and ver.comms.v_local ~= nil then
         print("[comms] ");yellow();println("other devices on the network will require an update");white()
     end
-
-    -- display graphics version change information
-    show_pkg_change("graphics", ver.graphics.v_local, ver.graphics.v_remote)
-    ver.graphics.changed = ver.graphics.v_local ~= ver.graphics.v_remote
-
-    -- display lockbox version change information
-    show_pkg_change("lockbox", ver.lockbox.v_local, ver.lockbox.v_remote)
-    ver.lockbox.changed = ver.lockbox.v_local ~= ver.lockbox.v_remote
+    ver.app.changed = show_pkg_change(app, ver.app)
+    ver.graphics.changed = show_pkg_change("graphics", ver.graphics)
+    ver.lockbox.changed = show_pkg_change("lockbox", ver.lockbox)
 
     -- ask for confirmation
     if not ask_y_n("Continue", false) then return end
@@ -364,7 +369,6 @@ elseif mode == "install" or mode == "update" then
     local file_list = manifest.files
     local size_list = manifest.sizes
     local dependencies = manifest.depends[app]
-    local config_file = app .. "/config.lua"
 
     table.insert(dependencies, app)
 
@@ -376,10 +380,11 @@ elseif mode == "install" or mode == "update" then
     -- check space constraints
     if space_available < space_required then
         single_file_mode = true
-        yellow();println("WARNING: Insufficient space available for a full download!");white()
-        println("Files can be downloaded one by one, so if you are replacing a current install this will not be a problem unless installation fails.")
-        if mode == "update" then println("If installation still fails, delete this device's log file or uninstall the app (not purge) and try again.") end
-        if not ask_y_n("Do you wish to continue?", false) then
+        yellow();println("NOTICE: Insufficient space available for a full cached download!");white()
+        lgray();println("Files can instead be downloaded one by one. If you are replacing a current install this may corrupt your install ONLY if it fails (such as a sudden network issue). If that occurs, you can still try again.")
+        if mode == "update" then println("If installation still fails, delete this device's log file and/or any unrelated files you have on this computer then try again.") end
+        white();
+        if not ask_y_n("Do you wish to continue", false) then
             println("Operation cancelled.")
             return
         end
@@ -392,16 +397,13 @@ elseif mode == "install" or mode == "update" then
         if dependency == "system" then return not ver.boot.changed
         elseif dependency == "graphics" then return not ver.graphics.changed
         elseif dependency == "lockbox" then return not ver.lockbox.changed
-        elseif dependency == "common" then return not (ver.app.changed or ver.comms.changed)
+        elseif dependency == "common" then return not (ver.common.changed or ver.comms.changed)
         elseif dependency == app then return not ver.app.changed
         else return true end
     end
 
     if not single_file_mode then
-        if fs.exists(install_dir) then
-            fs.delete(install_dir)
-            fs.makeDir(install_dir)
-        end
+        if fs.exists(install_dir) then fs.delete(install_dir);fs.makeDir(install_dir) end
 
         -- download all dependencies
         for _, dependency in pairs(dependencies) do
@@ -413,15 +415,15 @@ elseif mode == "install" or mode == "update" then
 
                 local files = file_list[dependency]
                 for _, file in pairs(files) do
-                    println("GET " .. file)
-                    local dl, err = http.get(repo_path .. file)
+                    println("GET "..file)
+                    local dl, err = http.get(repo_path..file)
 
                     if dl == nil then
-                        red();println("GET HTTP Error " .. err)
+                        red();println("HTTP Error "..err)
                         success = false
                         break
                     else
-                        local handle = fs.open(install_dir .. "/" .. file, "w")
+                        local handle = fs.open(install_dir.."/"..file, "w")
                         handle.write(dl.readAll())
                         handle.close()
                     end
@@ -440,11 +442,9 @@ elseif mode == "install" or mode == "update" then
 
                     local files = file_list[dependency]
                     for _, file in pairs(files) do
-                        if mode == "install" or file ~= config_file then
-                            local temp_file = install_dir .. "/" .. file
-                            if fs.exists(file) then fs.delete(file) end
-                            fs.move(temp_file, file)
-                        end
+                        local temp_file = install_dir.."/"..file
+                        if fs.exists(file) then fs.delete(file) end
+                        fs.move(temp_file, file)
                     end
                 end
             end
@@ -477,19 +477,17 @@ elseif mode == "install" or mode == "update" then
 
                 local files = file_list[dependency]
                 for _, file in pairs(files) do
-                    if mode == "install" or file ~= config_file then
-                        println("GET " .. file)
-                        local dl, err = http.get(repo_path .. file)
+                    println("GET "..file)
+                    local dl, err = http.get(repo_path..file)
 
-                        if dl == nil then
-                            red();println("GET HTTP Error " .. err)
-                            success = false
-                            break
-                        else
-                            local handle = fs.open("/" .. file, "w")
-                            handle.write(dl.readAll())
-                            handle.close()
-                        end
+                    if dl == nil then
+                        red();println("HTTP Error "..err)
+                        success = false
+                        break
+                    else
+                        local handle = fs.open("/"..file, "w")
+                        handle.write(dl.readAll())
+                        handle.close()
                     end
                 end
             end
@@ -511,22 +509,19 @@ elseif mode == "install" or mode == "update" then
             else println("Update failed, files may have been skipped.") end
         end
     end
-elseif mode == "remove" or mode == "purge" then
+elseif mode == "uninstall" then
     local ok, manifest = read_local_manifest()
     if not ok then
         red();println("Error parsing local installation manifest.");white()
         return
-    elseif mode == "remove" and manifest.versions[app] == nil then
-        red();println(app .. " is not installed, cannot remove.");white()
+    end
+
+    if manifest.versions[app] == nil then
+        red();println("Error: '"..app.."' is not installed.")
         return
     end
 
-    orange()
-    if mode == "remove" then
-        println("Removing all " .. app .. " files except for config and log...")
-    elseif mode == "purge" then
-        println("Purging all " .. app .. " files including config and log...")
-    end
+    orange();println("Uninstalling all "..app.." files...")
 
     -- ask for confirmation
     if not ask_y_n("Continue", false) then return end
@@ -536,76 +531,68 @@ elseif mode == "remove" or mode == "purge" then
 
     local file_list = manifest.files
     local dependencies = manifest.depends[app]
-    local config_file = app .. "/config.lua"
 
     table.insert(dependencies, app)
 
-    -- delete log file if purging
+    -- delete log file
+    local log_deleted = false
+    local settings_file = app..".settings"
+    local legacy_config_file = app.."/config.lua"
+
     lgray()
-    if mode == "purge" and fs.exists(config_file) then
-        local log_deleted = pcall(function ()
-            local config = require(app .. ".config")
+    if fs.exists(legacy_config_file) then
+        log_deleted = pcall(function ()
+            local config = require(app..".config")
             if fs.exists(config.LOG_PATH) then
                 fs.delete(config.LOG_PATH)
-                println("deleted log file " .. config.LOG_PATH)
+                println("deleted log file "..config.LOG_PATH)
             end
         end)
-
-        if not log_deleted then
-            red();println("failed to delete log file")
-            white();println("press any key to continue...")
-            any_key();lgray()
+    elseif fs.exists(settings_file) and settings.load(settings_file) then
+        local log = settings.get("LogPath")
+        if log ~= nil and fs.exists(log) then
+            log_deleted = true
+            fs.delete(log)
+            println("deleted log file "..log)
         end
     end
 
-    -- delete all files except config unless purging
+    if not log_deleted then
+        red();println("Failed to delete log file.")
+        white();println("press any key to continue...")
+        any_key();lgray()
+    end
+
+    -- delete all installed files
     for _, dependency in pairs(dependencies) do
         local files = file_list[dependency]
         for _, file in pairs(files) do
-            if mode == "purge" or file ~= config_file then
-                if fs.exists(file) then fs.delete(file);println("deleted " .. file) end
-            end
+            if fs.exists(file) then fs.delete(file);println("deleted "..file) end
         end
 
-        -- delete folders that we should be deleteing
-        if mode == "purge" or dependency ~= app then
-            local folder = files[1]
-            while true do
-                local dir = fs.getDir(folder)
-                if dir == "" or dir == ".." then break else folder = dir end
-            end
+        local folder = files[1]
+        while true do
+            local dir = fs.getDir(folder)
+            if dir == "" or dir == ".." then break else folder = dir end
+        end
 
-            if fs.isDir(folder) then
-                fs.delete(folder)
-                println("deleted directory " .. folder)
-            end
-        elseif dependency == app then
-            -- delete individual subdirectories so we can leave the config
-            for _, folder in pairs(files) do
-                while true do
-                    local dir = fs.getDir(folder)
-                    if dir == "" or dir == ".." or dir == app then break else folder = dir end
-                end
-
-                if folder ~= app and fs.isDir(folder) then
-                    fs.delete(folder);println("deleted app subdirectory " .. folder)
-                end
-            end
+        if fs.isDir(folder) then
+            fs.delete(folder)
+            println("deleted directory "..folder)
         end
     end
 
-    -- only delete manifest if purging
-    if mode == "purge" then
-        fs.delete("install_manifest.json")
-        println("deleted install_manifest.json")
-    else
-        -- remove all data from versions list to show nothing is installed
-        manifest.versions = {}
-        local imfile = fs.open("install_manifest.json", "w")
-        imfile.write(textutils.serializeJSON(manifest))
-        imfile.close()
+    if fs.exists(legacy_config_file) then
+        fs.delete(legacy_config_file);println("deleted "..legacy_config_file)
     end
 
+    if fs.exists(settings_file) then
+        fs.delete(settings_file);println("deleted "..settings_file)
+    end
+
+    fs.delete("install_manifest.json")
+    println("deleted install_manifest.json")
+
     green();println("Done!")
 end
 

configure.lua

@@ -0,0 +1,11 @@
+print("CONFIGURE> SCANNING FOR CONFIGURATOR...")
+
+if fs.exists("reactor-plc/configure.lua") then require("reactor-plc.configure").configure()
+elseif fs.exists("rtu/configure.lua") then require("rtu.configure").configure()
+elseif fs.exists("supervisor/configure.lua") then require("supervisor.configure").configure()
+elseif fs.exists("coordinator/configure.lua") then require("coordinator.configure").configure()
+elseif fs.exists("pocket/configure.lua") then require("pocket.configure").configure()
+else
+    print("CONFIGURE> NO CONFIGURATOR FOUND")
+    print("CONFIGURE> EXIT")
+end

coordinator/config.lua

@@ -1,38 +0,0 @@
-local config = {}
-
--- supervisor comms channel
-config.SVR_CHANNEL = 16240
--- coordinator comms channel
-config.CRD_CHANNEL = 16243
--- pocket comms channel
-config.PKT_CHANNEL = 16244
--- max trusted modem message distance (0 to disable check)
-config.TRUSTED_RANGE = 0
--- time in seconds (>= 2) before assuming a remote device is no longer active
-config.SV_TIMEOUT = 5
-config.API_TIMEOUT = 5
--- facility authentication key (do NOT use one of your passwords)
--- this enables verifying that messages are authentic
--- all devices on the same network must use the same key
--- config.AUTH_KEY = "SCADAfacility123"
-
--- expected number of reactor units, used only to require that number of unit monitors
-config.NUM_UNITS = 4
-
--- alarm sounder volume (0.0 to 3.0, 1.0 being standard max volume, this is the option given to to speaker.play())
--- note: alarm sine waves are at half saturation, so that multiple will be required to reach full scale
-config.SOUNDER_VOLUME = 1.0
-
--- true for 24 hour time on main view screen
-config.TIME_24_HOUR = true
-
--- log path
-config.LOG_PATH = "/log.txt"
--- log mode
---  0 = APPEND (adds to existing file on start)
---  1 = NEW (replaces existing file on start)
-config.LOG_MODE = 0
--- true to log verbose debug messages
-config.LOG_DEBUG = false
-
-return config

coordinator/coordinator.lua

@@ -4,21 +4,18 @@ local ppm         = require("scada-common.ppm")
 local util        = require("scada-common.util")
 local types       = require("scada-common.types")
 
+local themes      = require("graphics.themes")
+
 local iocontrol   = require("coordinator.iocontrol")
 local process     = require("coordinator.process")
 
 local apisessions = require("coordinator.session.apisessions")
 
-local dialog      = require("coordinator.ui.dialog")
-
-local print = util.print
-local println = util.println
-
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
 local ESTABLISH_ACK = comms.ESTABLISH_ACK
-local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
-local SCADA_CRDN_TYPE = comms.SCADA_CRDN_TYPE
+local MGMT_TYPE = comms.MGMT_TYPE
+local CRDN_TYPE = comms.CRDN_TYPE
 local UNIT_COMMAND = comms.UNIT_COMMAND
 local FAC_COMMAND = comms.FAC_COMMAND
 
@@ -26,153 +23,166 @@ local LINK_TIMEOUT = 60.0
 
 local coordinator = {}
 
--- request the user to select a monitor
----@nodiscard
----@param names table available monitors
----@return boolean|string|nil
-local function ask_monitor(names)
-    println("available monitors:")
-    for i = 1, #names do
-        print(" " .. names[i])
-    end
-    println("")
-    println("select a monitor or type c to cancel")
+---@type crd_config
+local config = {}
 
-    local iface = dialog.ask_options(names, "c")
+coordinator.config = config
 
-    if iface ~= false and iface ~= nil then
-        util.filter_table(names, function (x) return x ~= iface end)
+-- load the coordinator configuration<br>
+-- status of 0 is OK, 1 is bad config, 2 is bad monitor config
+---@return 0|1|2 status, nil|monitors_struct|string monitors (or error message)
+function coordinator.load_config()
+    if not settings.load("/coordinator.settings") then return 1 end
+
+    config.UnitCount = settings.get("UnitCount")
+    config.SpeakerVolume = settings.get("SpeakerVolume")
+    config.Time24Hour = settings.get("Time24Hour")
+    config.TempScale = settings.get("TempScale")
+
+    config.DisableFlowView = settings.get("DisableFlowView")
+    config.MainDisplay = settings.get("MainDisplay")
+    config.FlowDisplay = settings.get("FlowDisplay")
+    config.UnitDisplays = settings.get("UnitDisplays")
+
+    config.SVR_Channel = settings.get("SVR_Channel")
+    config.CRD_Channel = settings.get("CRD_Channel")
+    config.PKT_Channel = settings.get("PKT_Channel")
+    config.SVR_Timeout = settings.get("SVR_Timeout")
+    config.API_Timeout = settings.get("API_Timeout")
+    config.TrustedRange = settings.get("TrustedRange")
+    config.AuthKey = settings.get("AuthKey")
+
+    config.LogMode = settings.get("LogMode")
+    config.LogPath = settings.get("LogPath")
+    config.LogDebug = settings.get("LogDebug")
+
+    config.MainTheme = settings.get("MainTheme")
+    config.FrontPanelTheme = settings.get("FrontPanelTheme")
+    config.ColorMode = settings.get("ColorMode")
+
+    local cfv = util.new_validator()
+
+    cfv.assert_type_int(config.UnitCount)
+    cfv.assert_range(config.UnitCount, 1, 4)
+    cfv.assert_type_bool(config.Time24Hour)
+    cfv.assert_type_int(config.TempScale)
+    cfv.assert_range(config.TempScale, 1, 4)
+
+    cfv.assert_type_bool(config.DisableFlowView)
+    cfv.assert_type_table(config.UnitDisplays)
+
+    cfv.assert_type_num(config.SpeakerVolume)
+    cfv.assert_range(config.SpeakerVolume, 0, 3)
+
+    cfv.assert_channel(config.SVR_Channel)
+    cfv.assert_channel(config.CRD_Channel)
+    cfv.assert_channel(config.PKT_Channel)
+
+    cfv.assert_type_num(config.SVR_Timeout)
+    cfv.assert_min(config.SVR_Timeout, 2)
+    cfv.assert_type_num(config.API_Timeout)
+    cfv.assert_min(config.API_Timeout, 2)
+
+    cfv.assert_type_num(config.TrustedRange)
+    cfv.assert_min(config.TrustedRange, 0)
+    cfv.assert_type_str(config.AuthKey)
+
+    if type(config.AuthKey) == "string" then
+        local len = string.len(config.AuthKey)
+        cfv.assert(len == 0 or len >= 8)
     end
 
-    return iface
-end
+    cfv.assert_type_int(config.LogMode)
+    cfv.assert_range(config.LogMode, 0, 1)
+    cfv.assert_type_str(config.LogPath)
+    cfv.assert_type_bool(config.LogDebug)
+
+    cfv.assert_type_int(config.MainTheme)
+    cfv.assert_range(config.MainTheme, 1, 2)
+    cfv.assert_type_int(config.FrontPanelTheme)
+    cfv.assert_range(config.FrontPanelTheme, 1, 2)
+    cfv.assert_type_int(config.ColorMode)
+    cfv.assert_range(config.ColorMode, 1, themes.COLOR_MODE.NUM_MODES)
+
+    -- Monitor Setup
 
--- configure monitor layout
----@param num_units integer number of units expected
----@return boolean success, monitors_struct? monitors
-function coordinator.configure_monitors(num_units)
     ---@class monitors_struct
     local monitors = {
-        primary = nil,
-        primary_name = "",
+        main = nil,     ---@type table|nil
+        main_name = "",
+        flow = nil,     ---@type table|nil
+        flow_name = "",
         unit_displays = {},
         unit_name_map = {}
     }
 
-    local monitors_avail = ppm.get_monitor_list()
-    local names = {}
-    local available = {}
+    local mon_cfv = util.new_validator()
 
     -- get all interface names
-    for iface, _ in pairs(monitors_avail) do
-        table.insert(names, iface)
-        table.insert(available, iface)
-    end
+    local names = {}
+    for iface, _ in pairs(ppm.get_monitor_list()) do table.insert(names, iface) end
 
-    -- we need a certain number of monitors (1 per unit + 1 primary display)
-    local num_displays_needed = num_units + 1
-    if #names < num_displays_needed then
-        local message = "not enough monitors connected (need " .. num_displays_needed .. ")"
-        println(message)
-        log.warning(message)
-        return false
-    end
+    local function setup_monitors()
+        mon_cfv.assert_type_str(config.MainDisplay)
+        if not config.DisableFlowView then mon_cfv.assert_type_str(config.FlowDisplay) end
+        mon_cfv.assert_eq(#config.UnitDisplays, config.UnitCount)
 
-    -- attempt to load settings
-    if not settings.load("/coord.settings") then
-        log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)")
-    else
-        local _primary = settings.get("PRIMARY_DISPLAY")
-        local _unitd = settings.get("UNIT_DISPLAYS")
+        if mon_cfv.valid() then
+            local w, h, _
 
-        -- filter out already assigned monitors
-        util.filter_table(available, function (x) return x ~= _primary end)
-        if type(_unitd) == "table" then
-            util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end)
-        end
-    end
-
-    ---------------------
-    -- PRIMARY DISPLAY --
-    ---------------------
-
-    local iface_primary_display = settings.get("PRIMARY_DISPLAY")   ---@type boolean|string|nil
-
-    if not util.table_contains(names, iface_primary_display) then
-        println("primary display is not connected")
-        local response = dialog.ask_y_n("would you like to change it", true)
-        if response == false then return false end
-        iface_primary_display = nil
-    end
-
-    while iface_primary_display == nil and #available > 0 do
-        -- lets get a monitor
-        iface_primary_display = ask_monitor(available)
-    end
-
-    if type(iface_primary_display) ~= "string" then return false end
-
-    settings.set("PRIMARY_DISPLAY", iface_primary_display)
-    util.filter_table(available, function (x) return x ~= iface_primary_display end)
-
-    monitors.primary = ppm.get_periph(iface_primary_display)
-    monitors.primary_name = iface_primary_display
-
-    -------------------
-    -- UNIT DISPLAYS --
-    -------------------
-
-    local unit_displays = settings.get("UNIT_DISPLAYS")
-
-    if unit_displays == nil then
-        unit_displays = {}
-        for i = 1, num_units do
-            local display = nil
-
-            while display == nil and #available > 0 do
-                -- lets get a monitor
-                println("please select monitor for unit #" .. i)
-                display = ask_monitor(available)
+            if not util.table_contains(names, config.MainDisplay) then
+                return 2, "Main monitor is not connected."
             end
 
-            if display == false then return false end
+            monitors.main = ppm.get_periph(config.MainDisplay)
+            monitors.main_name = config.MainDisplay
 
-            unit_displays[i] = display
-        end
-    else
-        -- make sure all displays are connected
-        for i = 1, num_units do
-            local display = unit_displays[i]
-
-            if not util.table_contains(names, display) then
-                println("unit #" .. i .. " display is not connected")
-                local response = dialog.ask_y_n("would you like to change it", true)
-                if response == false then return false end
-                display = nil
+            monitors.main.setTextScale(0.5)
+            w, _ = ppm.monitor_block_size(monitors.main.getSize())
+            if w ~= 8 then
+                return 2, util.c("Main monitor width is incorrect (was ", w, ", must be 8).")
             end
 
-            while display == nil and #available > 0 do
-                -- lets get a monitor
-                display = ask_monitor(available)
+            if not config.DisableFlowView then
+                if not util.table_contains(names, config.FlowDisplay) then
+                    return 2, "Flow monitor is not connected."
+                end
+
+                monitors.flow = ppm.get_periph(config.FlowDisplay)
+                monitors.flow_name = config.FlowDisplay
+
+                monitors.flow.setTextScale(0.5)
+                w, _ = ppm.monitor_block_size(monitors.flow.getSize())
+                if w ~= 8 then
+                    return 2, util.c("Flow monitor width is incorrect (was ", w, ", must be 8).")
+                end
             end
 
-            if display == false then return false end
+            for i = 1, config.UnitCount do
+                local display = config.UnitDisplays[i]
+                if type(display) ~= "string" or not util.table_contains(names, display) then
+                    return 2, "Unit " .. i .. " monitor is not connected."
+                end
 
-            unit_displays[i] = display
-        end
+                monitors.unit_displays[i] = ppm.get_periph(display)
+                monitors.unit_name_map[i] = display
+
+                monitors.unit_displays[i].setTextScale(0.5)
+                w, h = ppm.monitor_block_size(monitors.unit_displays[i].getSize())
+                if w ~= 4 or h ~= 4 then
+                    return 2, util.c("Unit ", i, " monitor size is incorrect (was ", w, " by ", h,", must be 4 by 4).")
+                end
+            end
+        else return 2, "Monitor configuration invalid." end
     end
 
-    settings.set("UNIT_DISPLAYS", unit_displays)
-    if not settings.save("/coord.settings") then
-        log.warning("configure_monitors(): failed to save coordinator settings file")
-    end
+    if cfv.valid() then
+        local ok, result, message = pcall(setup_monitors)
+        assert(ok, util.c("fatal error while trying to verify monitors: ", result))
+        if result == 2 then return 2, message end
+    else return 1 end
 
-    for i = 1, #unit_displays do
-        monitors.unit_displays[i] = ppm.get_periph(unit_displays[i])
-        monitors.unit_name_map[i] = unit_displays[i]
-    end
-
-    return true, monitors
+    return 0, monitors
 end
 
 -- dmesg print wrapper
@@ -182,7 +192,7 @@ end
 ---@return function? update, function? done
 local function log_dmesg(message, dmesg_tag, working)
     local colors = {
-        GRAPHICS = colors.green,
+        RENDER = colors.green,
         SYSTEM = colors.cyan,
         BOOT = colors.blue,
         COMMS = colors.purple,
@@ -196,7 +206,7 @@ local function log_dmesg(message, dmesg_tag, working)
     end
 end
 
-function coordinator.log_graphics(message) log_dmesg(message, "GRAPHICS") end
+function coordinator.log_render(message) log_dmesg(message, "RENDER") end
 function coordinator.log_sys(message) log_dmesg(message, "SYSTEM") end
 function coordinator.log_boot(message) log_dmesg(message, "BOOT") end
 function coordinator.log_comms(message) log_dmesg(message, "COMMS") end
@@ -217,12 +227,8 @@ end
 ---@nodiscard
 ---@param version string coordinator version
 ---@param nic nic network interface device
----@param crd_channel integer port of configured supervisor
----@param svr_channel integer listening port for supervisor replys
----@param pkt_channel integer listening port for pocket API
----@param range integer trusted device connection range
 ---@param sv_watchdog watchdog
-function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
+function coordinator.comms(version, nic, sv_watchdog)
     local self = {
         sv_linked = false,
         sv_addr = comms.BROADCAST,
@@ -237,19 +243,19 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
         est_task_done = nil
     }
 
-    comms.set_trusted_range(range)
-
-    -- PRIVATE FUNCTIONS --
+    comms.set_trusted_range(config.TrustedRange)
 
     -- configure network channels
     nic.closeAll()
-    nic.open(crd_channel)
+    nic.open(config.CRD_Channel)
 
-    -- link nic to apisessions
-    apisessions.init(nic)
+    -- pass config to apisessions
+    apisessions.init(nic, config)
+
+    -- PRIVATE FUNCTIONS --
 
     -- send a packet to the supervisor
-    ---@param msg_type SCADA_MGMT_TYPE|SCADA_CRDN_TYPE
+    ---@param msg_type MGMT_TYPE|CRDN_TYPE
     ---@param msg table
     local function _send_sv(protocol, msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -266,33 +272,34 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
         pkt.make(msg_type, msg)
         s_pkt.make(self.sv_addr, self.sv_seq_num, protocol, pkt.raw_sendable())
 
-        nic.transmit(svr_channel, crd_channel, s_pkt)
+        nic.transmit(config.SVR_Channel, config.CRD_Channel, s_pkt)
         self.sv_seq_num = self.sv_seq_num + 1
     end
 
     -- send an API establish request response
     ---@param packet scada_packet
     ---@param ack ESTABLISH_ACK
-    local function _send_api_establish_ack(packet, ack)
+    ---@param data any?
+    local function _send_api_establish_ack(packet, ack, data)
         local s_pkt = comms.scada_packet()
         local m_pkt = comms.mgmt_packet()
 
-        m_pkt.make(SCADA_MGMT_TYPE.ESTABLISH, { ack })
+        m_pkt.make(MGMT_TYPE.ESTABLISH, { ack, data })
         s_pkt.make(packet.src_addr(), packet.seq_num() + 1, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
 
-        nic.transmit(pkt_channel, crd_channel, s_pkt)
+        nic.transmit(config.PKT_Channel, config.CRD_Channel, s_pkt)
         self.last_api_est_acks[packet.src_addr()] = ack
     end
 
     -- attempt connection establishment
     local function _send_establish()
-        _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.CRDN })
+        _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.CRD })
     end
 
     -- keep alive ack
     ---@param srv_time integer
     local function _send_keep_alive_ack(srv_time)
-        _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
+        _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
     end
 
     -- PUBLIC FUNCTIONS --
@@ -309,24 +316,24 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
 
         if not self.sv_linked then
             if self.est_tick_waiting == nil then
-                self.est_start = util.time_s()
+                self.est_start = os.clock()
                 self.est_last = self.est_start
 
                 self.est_tick_waiting, self.est_task_done =
-                    coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. svr_channel)
+                    coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. config.SVR_Channel)
 
                 _send_establish()
             else
-                self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (util.time_s() - self.est_start)))
+                self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (os.clock() - self.est_start)))
             end
 
-            if abort or (util.time_s() - self.est_start) >= LINK_TIMEOUT then
+            if abort or (os.clock() - self.est_start) >= LINK_TIMEOUT then
                 self.est_task_done(false)
 
                 if abort then
                     coordinator.log_comms("supervisor connection attempt cancelled by user")
                 elseif self.sv_config_err then
-                    coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                    coordinator.log_comms("supervisor unit count does not match coordinator unit count, check configs")
                 elseif not self.sv_linked then
                     if self.last_est_ack == ESTABLISH_ACK.DENY then
                         coordinator.log_comms("supervisor connection attempt denied")
@@ -341,11 +348,12 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
 
                 ok = false
             elseif self.sv_config_err then
-                coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                self.est_task_done(false)
+                coordinator.log_comms("supervisor unit count does not match coordinator unit count, check configs")
                 ok = false
-            elseif (util.time_s() - self.est_last) > 1.0 then
+            elseif (os.clock() - self.est_last) > 1.0 then
                 _send_establish()
-                self.est_last = util.time_s()
+                self.est_last = os.clock()
             end
         elseif self.est_tick_waiting ~= nil then
             self.est_task_done(true)
@@ -364,21 +372,21 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
         self.sv_linked = false
         self.sv_r_seq_num = nil
         iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
-        _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.CLOSE, {})
+        _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.CLOSE, {})
     end
 
     -- send a facility command
     ---@param cmd FAC_COMMAND command
     ---@param option any? optional option options for the optional options (like waste mode)
     function public.send_fac_command(cmd, option)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd, option })
+        _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_CMD, { cmd, option })
     end
 
     -- send the auto process control configuration with a start command
-    ---@param config coord_auto_config configuration
-    function public.send_auto_start(config)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, {
-            FAC_COMMAND.START, config.mode, config.burn_target, config.charge_target, config.gen_target, config.limits
+    ---@param auto_cfg coord_auto_config configuration
+    function public.send_auto_start(auto_cfg)
+        _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_CMD, {
+            FAC_COMMAND.START, auto_cfg.mode, auto_cfg.burn_target, auto_cfg.charge_target, auto_cfg.gen_target, auto_cfg.limits
         })
     end
 
@@ -387,7 +395,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     ---@param unit integer unit ID
     ---@param option any? optional option options for the optional options (like burn rate)
     function public.send_unit_command(cmd, unit, option)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
+        _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
     end
 
     -- parse a packet
@@ -396,7 +404,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     ---@param reply_to integer
     ---@param message any
     ---@param distance integer
-    ---@return mgmt_frame|crdn_frame|capi_frame|nil packet
+    ---@return mgmt_frame|crdn_frame|nil packet
     function public.parse_packet(side, sender, reply_to, message, distance)
         local s_pkt = nic.receive(side, sender, reply_to, message, distance)
         local pkt = nil
@@ -414,12 +422,6 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 if crdn_pkt.decode(s_pkt) then
                     pkt = crdn_pkt.get()
                 end
-            -- get as coordinator API packet
-            elseif s_pkt.protocol() == PROTOCOL.COORD_API then
-                local capi_pkt = comms.capi_packet()
-                if capi_pkt.decode(s_pkt) then
-                    pkt = capi_pkt.get()
-                end
             else
                 log.debug("attempted parse of illegal packet type " .. s_pkt.protocol(), true)
             end
@@ -429,7 +431,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     end
 
     -- handle a packet
-    ---@param packet mgmt_frame|crdn_frame|capi_frame|nil
+    ---@param packet mgmt_frame|crdn_frame|nil
     ---@return boolean close_ui
     function public.handle_packet(packet)
         local was_linked = self.sv_linked
@@ -440,23 +442,23 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
             local src_addr = packet.scada_frame.src_addr()
             local protocol = packet.scada_frame.protocol()
 
-            if l_chan ~= crd_channel then
+            if l_chan ~= config.CRD_Channel then
                 log.debug("received packet on unconfigured channel " .. l_chan, true)
-            elseif r_chan == pkt_channel then
+            elseif r_chan == config.PKT_Channel then
                 if not self.sv_linked then
                     log.debug("discarding pocket API packet before linked to supervisor")
-                elseif protocol == PROTOCOL.COORD_API then
-                    ---@cast packet capi_frame
+                elseif protocol == PROTOCOL.SCADA_CRDN then
+                    ---@cast packet crdn_frame
                     -- look for an associated session
                     local session = apisessions.find_session(src_addr)
 
-                    -- API packet
+                    -- coordinator packet
                     if session ~= nil then
                         -- pass the packet onto the session handler
                         session.in_queue.push_packet(packet)
                     else
                         -- any other packet should be session related, discard it
-                        log.debug("discarding COORD_API packet without a known session")
+                        log.debug("discarding SCADA_CRDN packet without a known session")
                     end
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
@@ -467,13 +469,14 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                     if session ~= nil then
                         -- pass the packet onto the session handler
                         session.in_queue.push_packet(packet)
-                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- establish a new session
                         -- validate packet and continue
-                        if packet.length == 3 and type(packet.data[1]) == "string" and type(packet.data[2]) == "string" then
-                            local comms_v = packet.data[1]
-                            local firmware_v = packet.data[2]
+                        if packet.length == 4 then
+                            local comms_v = util.strval(packet.data[1])
+                            local firmware_v = util.strval(packet.data[2])
                             local dev_type = packet.data[3]
+                            local api_v = util.strval(packet.data[4])
 
                             if comms_v ~= comms.version then
                                 if self.last_api_est_acks[src_addr] ~= ESTABLISH_ACK.BAD_VERSION then
@@ -481,12 +484,19 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                                 end
 
                                 _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.BAD_VERSION)
+                            elseif api_v ~= comms.api_version then
+                                if self.last_api_est_acks[src_addr] ~= ESTABLISH_ACK.BAD_API_VERSION then
+                                    log.info(util.c("dropping API establish packet with incorrect api version v", api_v, " (expected v", comms.api_version, ")"))
+                                end
+
+                                _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.BAD_API_VERSION)
                             elseif dev_type == DEVICE_TYPE.PKT then
                                 -- pocket linking request
                                 local id = apisessions.establish_session(src_addr, firmware_v)
                                 coordinator.log_comms(util.c("API_ESTABLISH: pocket (", firmware_v, ") [@", src_addr, "] connected with session ID ", id))
 
-                                _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW)
+                                local conf = iocontrol.get_db().facility.conf
+                                _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW, { conf.num_units, conf.cooling })
                             else
                                 log.debug(util.c("API_ESTABLISH: illegal establish packet for device ", dev_type, " on pocket channel"))
                                 _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.DENY)
@@ -502,7 +512,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 else
                     log.debug("illegal packet type " .. protocol .. " on pocket channel", true)
                 end
-            elseif r_chan == svr_channel then
+            elseif r_chan == config.SVR_Channel then
                 -- check sequence number
                 if self.sv_r_seq_num == nil then
                     self.sv_r_seq_num = packet.scada_frame.seq_num()
@@ -523,7 +533,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 if protocol == PROTOCOL.SCADA_CRDN then
                     ---@cast packet crdn_frame
                     if self.sv_linked then
-                        if packet.type == SCADA_CRDN_TYPE.INITIAL_BUILDS then
+                        if packet.type == CRDN_TYPE.INITIAL_BUILDS then
                             if packet.length == 2 then
                                 -- record builds
                                 local fac_builds = iocontrol.record_facility_builds(packet.data[1])
@@ -531,31 +541,31 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
 
                                 if fac_builds and unit_builds then
                                     -- acknowledge receipt of builds
-                                    _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.INITIAL_BUILDS, {})
+                                    _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.INITIAL_BUILDS, {})
                                 else
                                     log.debug("received invalid INITIAL_BUILDS packet")
                                 end
                             else
                                 log.debug("INITIAL_BUILDS packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.FAC_BUILDS then
+                        elseif packet.type == CRDN_TYPE.FAC_BUILDS then
                             if packet.length == 1 then
                                 -- record facility builds
                                 if iocontrol.record_facility_builds(packet.data[1]) then
                                     -- acknowledge receipt of builds
-                                    _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_BUILDS, {})
+                                    _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_BUILDS, {})
                                 else
                                     log.debug("received invalid FAC_BUILDS packet")
                                 end
                             else
                                 log.debug("FAC_BUILDS packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.FAC_STATUS then
+                        elseif packet.type == CRDN_TYPE.FAC_STATUS then
                             -- update facility status
                             if not iocontrol.update_facility_status(packet.data) then
                                 log.debug("received invalid FAC_STATUS packet")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.FAC_CMD then
+                        elseif packet.type == CRDN_TYPE.FAC_CMD then
                             -- facility command acknowledgement
                             if packet.length >= 2 then
                                 local cmd = packet.data[1]
@@ -583,24 +593,24 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                             else
                                 log.debug("SCADA_CRDN facility command ack packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.UNIT_BUILDS then
+                        elseif packet.type == CRDN_TYPE.UNIT_BUILDS then
                             -- record builds
                             if packet.length == 1 then
                                 if iocontrol.record_unit_builds(packet.data[1]) then
                                     -- acknowledge receipt of builds
-                                    _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_BUILDS, {})
+                                    _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.UNIT_BUILDS, {})
                                 else
                                     log.debug("received invalid UNIT_BUILDS packet")
                                 end
                             else
                                 log.debug("UNIT_BUILDS packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.UNIT_STATUSES then
+                        elseif packet.type == CRDN_TYPE.UNIT_STATUSES then
                             -- update statuses
                             if not iocontrol.update_unit_statuses(packet.data) then
                                 log.debug("received invalid UNIT_STATUSES packet")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.UNIT_CMD then
+                        elseif packet.type == CRDN_TYPE.UNIT_CMD then
                             -- unit command acknowledgement
                             if packet.length == 3 then
                                 local cmd = packet.data[1]
@@ -642,7 +652,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
                     if self.sv_linked then
-                        if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
+                        if packet.type == MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
                                 local timestamp = packet.data[1]
@@ -660,7 +670,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                             else
                                 log.debug("SCADA keep alive packet length mismatch")
                             end
-                        elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
+                        elseif packet.type == MGMT_TYPE.CLOSE then
                             -- handle session close
                             sv_watchdog.cancel()
                             self.sv_addr = comms.BROADCAST
@@ -671,33 +681,28 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type)
                         end
-                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- connection with supervisor established
                         if packet.length == 2 then
                             local est_ack = packet.data[1]
-                            local config = packet.data[2]
+                            local sv_config = packet.data[2]
 
                             if est_ack == ESTABLISH_ACK.ALLOW then
                                 -- reset to disconnected before validating
                                 iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
 
-                                if type(config) == "table" and #config > 1 then
+                                if type(sv_config) == "table" and #sv_config == 2 then
                                     -- get configuration
 
                                     ---@class facility_conf
                                     local conf = {
-                                        num_units = config[1],  ---@type integer
-                                        defs = {}               -- boilers and turbines
+                                        num_units = sv_config[1], ---@type integer
+                                        cooling = sv_config[2]    ---@type sv_cooling_conf
                                     }
 
-                                    if (#config - 1) == (conf.num_units * 2) then
-                                        -- record sequence of pairs of [#boilers, #turbines] per unit
-                                        for i = 2, #config do
-                                            table.insert(conf.defs, config[i])
-                                        end
-
+                                    if conf.num_units == config.UnitCount then
                                         -- init io controller
-                                        iocontrol.init(conf, public)
+                                        iocontrol.init(conf, public, config.TempScale)
 
                                         self.sv_addr = src_addr
                                         self.sv_linked = true
@@ -707,7 +712,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                                         iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED)
                                     else
                                         self.sv_config_err = true
-                                        log.warning("invalid supervisor configuration definitions received, establish failed")
+                                        log.warning("supervisor config's number of units don't match coordinator's config, establish failed")
                                     end
                                 else
                                     log.debug("invalid supervisor configuration table received, establish failed")

coordinator/iocontrol.lua

@@ -38,9 +38,7 @@ local function __generic_ack(success) end
 ---@param comms_v string comms version
 function iocontrol.init_fp(firmware_v, comms_v)
     ---@class ioctl_front_panel
-    io.fp = {
-        ps = psil.create()
-    }
+    io.fp = { ps = psil.create() }
 
     io.fp.ps.publish("version", firmware_v)
     io.fp.ps.publish("comms_version", comms_v)
@@ -49,10 +47,30 @@ end
 -- initialize the coordinator IO controller
 ---@param conf facility_conf configuration
 ---@param comms coord_comms comms reference
-function iocontrol.init(conf, comms)
+---@param temp_scale integer temperature unit (1 = K, 2 = C, 3 = F, 4 = R)
+function iocontrol.init(conf, comms, temp_scale)
+    -- temperature unit label and conversion function (from Kelvin)
+    if temp_scale == 2 then
+        io.temp_label = "\xb0C"
+        io.temp_convert = function (t) return t - 273.15 end
+    elseif temp_scale == 3 then
+        io.temp_label = "\xb0F"
+        io.temp_convert = function (t) return (1.8 * (t - 273.15)) + 32 end
+    elseif temp_scale == 4 then
+        io.temp_label = "\xb0R"
+        io.temp_convert = function (t) return 1.8 * t end
+    else
+        io.temp_label = "K"
+        io.temp_convert = function (t) return t end
+    end
+
+    -- facility data structure
     ---@class ioctl_facility
     io.facility = {
-        num_units = conf.num_units, ---@type integer
+        conf = conf,
+        num_units = conf.num_units,
+        tank_mode = conf.cooling.fac_tank_mode,
+        tank_defs = conf.cooling.fac_tank_defs,
         all_sys_ok = false,
         rtu_count = 0,
 
@@ -74,6 +92,7 @@ function iocontrol.init(conf, comms)
         ---@type WASTE_PRODUCT
         auto_current_waste_product = types.WASTE_PRODUCT.PLUTONIUM,
         auto_pu_fallback_active = false,
+        auto_sps_disabled = false,
 
         radiation = types.new_zero_radiation_reading(),
 
@@ -83,6 +102,8 @@ function iocontrol.init(conf, comms)
         scram_ack = __generic_ack,
         ack_alarms_ack = __generic_ack,
 
+        alarm_tones = { false, false, false, false, false, false, false, false },
+
         ps = psil.create(),
 
         induction_ps_tbl = {},
@@ -104,6 +125,101 @@ function iocontrol.init(conf, comms)
     table.insert(io.facility.sps_ps_tbl, psil.create())
     table.insert(io.facility.sps_data_tbl, {})
 
+    -- determine tank information
+    if io.facility.tank_mode == 0 then
+        io.facility.tank_defs = {}
+        -- on facility tank mode 0, setup tank defs to match unit tank option
+        for i = 1, conf.num_units do
+            io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TankConnection, 1, 0)
+        end
+
+        io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
+    else
+        -- decode the layout of tanks from the connections definitions
+        local tank_mode = io.facility.tank_mode
+        local tank_defs = io.facility.tank_defs
+        local tank_list = { table.unpack(tank_defs) }
+
+        local function calc_fdef(start_idx, end_idx)
+            local first = 4
+            for i = start_idx, end_idx do
+                if io.facility.tank_defs[i] == 2 then
+                    if i < first then first = i end
+                end
+            end
+            return first
+        end
+
+        if tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef = calc_fdef(1, #tank_defs)
+            for i = 1, #tank_defs do
+                if i > first_fdef and tank_defs[i] == 2 then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
+                    tank_list[b] = 0
+                end
+            end
+        elseif tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef = calc_fdef(2, #tank_defs)
+            for i = 1, #tank_defs do
+                if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef = calc_fdef(3, #tank_defs)
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        end
+
+        io.facility.tank_list = tank_list
+    end
+
+    -- create facility tank tables
+    for i = 1, #io.facility.tank_list do
+        if io.facility.tank_list[i] == 2 then
+            table.insert(io.facility.tank_ps_tbl, psil.create())
+            table.insert(io.facility.tank_data_tbl, {})
+        end
+    end
+
+    -- create unit data structures
     io.units = {}
     for i = 1, conf.num_units do
         local function ack(alarm) process.ack_alarm(i, alarm) end
@@ -112,15 +228,21 @@ function iocontrol.init(conf, comms)
         ---@class ioctl_unit
         local entry = {
             unit_id = i,
+            connected = false,
+            rtu_hw = { boilers = {}, turbines = {} },
 
             num_boilers = 0,
             num_turbines = 0,
             num_snas = 0,
+            has_tank = conf.cooling.r_cool[i].TankConnection,
 
             control_state = false,
             burn_rate_cmd = 0.0,
             radiation = types.new_zero_radiation_reading(),
-            sna_prod_rate = 0.0,
+
+            sna_peak_rate = 0.0,
+            sna_max_rate = 0.0,
+            sna_out_rate = 0.0,
 
             waste_mode = types.WASTE_MODE.MANUAL_PLUTONIUM,
             waste_product = types.WASTE_PRODUCT.PLUTONIUM,
@@ -161,18 +283,18 @@ function iocontrol.init(conf, comms)
 
             ---@type alarms
             alarms = {
-                ALARM_STATE.INACTIVE,   -- containment breach
-                ALARM_STATE.INACTIVE,   -- containment radiation
-                ALARM_STATE.INACTIVE,   -- reactor lost
-                ALARM_STATE.INACTIVE,   -- damage critical
-                ALARM_STATE.INACTIVE,   -- reactor taking damage
-                ALARM_STATE.INACTIVE,   -- reactor over temperature
-                ALARM_STATE.INACTIVE,   -- reactor high temperature
-                ALARM_STATE.INACTIVE,   -- waste leak
-                ALARM_STATE.INACTIVE,   -- waste level high
-                ALARM_STATE.INACTIVE,   -- RPS transient
-                ALARM_STATE.INACTIVE,   -- RCS transient
-                ALARM_STATE.INACTIVE    -- turbine trip
+                ALARM_STATE.INACTIVE, -- containment breach
+                ALARM_STATE.INACTIVE, -- containment radiation
+                ALARM_STATE.INACTIVE, -- reactor lost
+                ALARM_STATE.INACTIVE, -- damage critical
+                ALARM_STATE.INACTIVE, -- reactor taking damage
+                ALARM_STATE.INACTIVE, -- reactor over temperature
+                ALARM_STATE.INACTIVE, -- reactor high temperature
+                ALARM_STATE.INACTIVE, -- waste leak
+                ALARM_STATE.INACTIVE, -- waste level high
+                ALARM_STATE.INACTIVE, -- RPS transient
+                ALARM_STATE.INACTIVE, -- RCS transient
+                ALARM_STATE.INACTIVE  -- turbine trip
             },
 
             annunciator = {},   ---@type annunciator
@@ -190,18 +312,29 @@ function iocontrol.init(conf, comms)
             tank_data_tbl = {}
         }
 
+        -- on other facility modes, overwrite unit TANK option with facility tank defs
+        if io.facility.tank_mode ~= 0 then
+            entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
+        end
+
         -- create boiler tables
-        for _ = 1, conf.defs[(i * 2) - 1] do
-            local data = {} ---@type boilerv_session_db
+        for _ = 1, conf.cooling.r_cool[i].BoilerCount do
             table.insert(entry.boiler_ps_tbl, psil.create())
-            table.insert(entry.boiler_data_tbl, data)
+            table.insert(entry.boiler_data_tbl, {})
+            table.insert(entry.rtu_hw.boilers, { connected = false, faulted = false })
         end
 
         -- create turbine tables
-        for _ = 1, conf.defs[i * 2] do
-            local data = {} ---@type turbinev_session_db
+        for _ = 1, conf.cooling.r_cool[i].TurbineCount do
             table.insert(entry.turbine_ps_tbl, psil.create())
-            table.insert(entry.turbine_data_tbl, data)
+            table.insert(entry.turbine_data_tbl, {})
+            table.insert(entry.rtu_hw.turbines, { connected = false, faulted = false })
+        end
+
+        -- create tank tables
+        if io.facility.tank_defs[i] == 1 then
+            table.insert(entry.tank_ps_tbl, psil.create())
+            table.insert(entry.tank_data_tbl, {})
         end
 
         entry.num_boilers = #entry.boiler_data_tbl
@@ -232,11 +365,28 @@ function iocontrol.fp_has_speaker(has_speaker) io.fp.ps.publish("has_speaker", h
 function iocontrol.fp_link_state(state) io.fp.ps.publish("link_state", state) end
 
 -- report monitor connection state
----@param id integer unit ID or 0 for main
+---@param id string|integer unit ID for unit monitor, "main" for main monitor, or "flow" for flow monitor
 function iocontrol.fp_monitor_state(id, connected)
-    local name = "main_monitor"
-    if id > 0 then name = "unit_monitor_" .. id end
-    io.fp.ps.publish(name, connected)
+    local name = nil
+
+    if id == "main" then
+        name = "main_monitor"
+    elseif id == "flow" then
+        name = "flow_monitor"
+    elseif type(id) == "number" then
+        name = "unit_monitor_" .. id
+    end
+
+    if name ~= nil then
+        io.fp.ps.publish(name, connected)
+    end
+end
+
+-- report thread (routine) statuses
+---@param thread string thread name
+---@param ok boolean thread state
+function iocontrol.fp_rt_status(thread, ok)
+    io.fp.ps.publish(util.c("routine__", thread), ok)
 end
 
 -- report PKT firmware version and PKT session connection state
@@ -266,7 +416,7 @@ function iocontrol.fp_pkt_rtt(session_id, rtt)
     elseif rtt > WARN_RTT then
         io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.yellow_hc)
     else
-        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.green)
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.green_hc)
     end
 end
 
@@ -351,7 +501,7 @@ function iocontrol.record_unit_builds(builds)
 
     -- note: if not all units and RTUs are connected, some will be nil
     for id, build in pairs(builds) do
-        local unit = io.units[id]    ---@type ioctl_unit
+        local unit = io.units[id] ---@type ioctl_unit
 
         local log_header = util.c("iocontrol.record_unit_builds[UNIT ", id, "]: ")
 
@@ -448,7 +598,7 @@ function iocontrol.update_facility_status(status)
 
         local ctl_status = status[1]
 
-        if type(ctl_status) == "table" and #ctl_status == 16 then
+        if type(ctl_status) == "table" and #ctl_status == 17 then
             fac.all_sys_ok = ctl_status[1]
             fac.auto_ready = ctl_status[2]
 
@@ -499,9 +649,11 @@ function iocontrol.update_facility_status(status)
 
             fac.auto_current_waste_product = ctl_status[15]
             fac.auto_pu_fallback_active = ctl_status[16]
+            fac.auto_sps_disabled = ctl_status[17]
 
             fac.ps.publish("current_waste_product", fac.auto_current_waste_product)
             fac.ps.publish("pu_fallback_active", fac.auto_pu_fallback_active)
+            fac.ps.publish("sps_disabled_low_power", fac.auto_sps_disabled)
         else
             log.debug(log_header .. "control status not a table or length mismatch")
             valid = false
@@ -518,10 +670,27 @@ function iocontrol.update_facility_status(status)
             fac.rtu_count = rtu_statuses.count
 
             -- power statistics
-            if type(rtu_statuses.power) == "table" then
-                fac.induction_ps_tbl[1].publish("avg_charge", rtu_statuses.power[1])
-                fac.induction_ps_tbl[1].publish("avg_inflow", rtu_statuses.power[2])
-                fac.induction_ps_tbl[1].publish("avg_outflow", rtu_statuses.power[3])
+            if type(rtu_statuses.power) == "table" and #rtu_statuses.power == 4 then
+                local data = fac.induction_data_tbl[1] ---@type imatrix_session_db
+                local ps   = fac.induction_ps_tbl[1]   ---@type psil
+
+                local chg   = tonumber(rtu_statuses.power[1])
+                local in_f  = tonumber(rtu_statuses.power[2])
+                local out_f = tonumber(rtu_statuses.power[3])
+                local eta   = tonumber(rtu_statuses.power[4])
+
+                ps.publish("avg_charge", chg)
+                ps.publish("avg_inflow", in_f)
+                ps.publish("avg_outflow", out_f)
+                ps.publish("eta_ms", eta)
+
+                ps.publish("is_charging", in_f > out_f)
+                ps.publish("is_discharging", out_f > in_f)
+
+                if data and data.build then
+                    local cap = util.joules_to_fe(data.build.transfer_cap)
+                    ps.publish("at_max_io", in_f >= cap or out_f >= cap)
+                end
             else
                 log.debug(log_header .. "power statistics list not a table")
                 valid = false
@@ -576,8 +745,8 @@ function iocontrol.update_facility_status(status)
 
                 for id, sps in pairs(rtu_statuses.sps) do
                     if type(fac.sps_data_tbl[id]) == "table" then
-                        local data = fac.sps_data_tbl[id]   ---@type sps_session_db
-                        local ps   = fac.sps_ps_tbl[id]     ---@type psil
+                        local data = fac.sps_data_tbl[id] ---@type sps_session_db
+                        local ps   = fac.sps_ps_tbl[id]   ---@type psil
 
                         local rtu_faulted = _record_multiblock_status(sps, data, ps)
 
@@ -614,8 +783,8 @@ function iocontrol.update_facility_status(status)
 
                 for id, tank in pairs(rtu_statuses.tanks) do
                     if type(fac.tank_data_tbl[id]) == "table" then
-                        local data = fac.tank_data_tbl[id]  ---@type dynamicv_session_db
-                        local ps   = fac.tank_ps_tbl[id]    ---@type psil
+                        local data = fac.tank_data_tbl[id] ---@type dynamicv_session_db
+                        local ps   = fac.tank_ps_tbl[id]   ---@type psil
 
                         local rtu_faulted = _record_multiblock_status(tank, data, ps)
 
@@ -642,20 +811,34 @@ function iocontrol.update_facility_status(status)
             end
 
             -- environment detector status
-            if type(rtu_statuses.rad_mon) == "table" then
-                if #rtu_statuses.rad_mon > 0 then
-                    local rad_mon = rtu_statuses.rad_mon[1]
-                    local rtu_faulted = rad_mon[1]  ---@type boolean
-                    fac.radiation     = rad_mon[2]  ---@type number
+            if type(rtu_statuses.envds) == "table" then
+                local max_rad, max_reading, any_conn, any_faulted = 0, types.new_zero_radiation_reading(), false, false
 
-                    fac.ps.publish("rad_computed_status", util.trinary(rtu_faulted, 2, 3))
-                    fac.ps.publish("radiation", fac.radiation)
+                for _, envd in pairs(rtu_statuses.envds) do
+                    local rtu_faulted = envd[1] ---@type boolean
+                    local radiation   = envd[2] ---@type radiation_reading
+                    local rad_raw     = envd[3] ---@type number
+
+                    any_conn = true
+                    any_faulted = any_faulted or rtu_faulted
+
+                    if rad_raw > max_rad then
+                        max_rad = rad_raw
+                        max_reading = radiation
+                    end
+                end
+
+                if any_conn then
+                    fac.radiation = max_reading
+                    fac.ps.publish("rad_computed_status", util.trinary(any_faulted, 2, 3))
                 else
                     fac.radiation = types.new_zero_radiation_reading()
                     fac.ps.publish("rad_computed_status", 1)
                 end
+
+                fac.ps.publish("radiation", fac.radiation)
             else
-                log.debug(log_header .. "radiation monitor list not a table")
+                log.debug(log_header .. "environment detector list not a table")
                 valid = false
             end
         else
@@ -664,6 +847,16 @@ function iocontrol.update_facility_status(status)
         end
 
         fac.ps.publish("rtu_count", fac.rtu_count)
+
+        -- alarm tone commands
+
+        if (type(status[3]) == "table") and (#status[3] == 8) then
+            fac.alarm_tones = status[3]
+            sounder.set(fac.alarm_tones)
+        else
+            log.debug(log_header .. "alarm tones not a table or length mismatch")
+            valid = false
+        end
     end
 
     return valid
@@ -684,8 +877,7 @@ function iocontrol.update_unit_statuses(statuses)
     else
         local burn_rate_sum = 0.0
         local sna_count_sum = 0
-        local pu_rate = 0.0
-        local po_rate = 0.0
+        local pu_rate, po_rate, po_pl_rate, po_am_rate, spent_rate = 0.0, 0.0, 0.0, 0.0, 0.0
 
         -- get all unit statuses
         for i = 1, #statuses do
@@ -696,7 +888,7 @@ function iocontrol.update_unit_statuses(statuses)
 
             local burn_rate = 0.0
 
-            if type(status) ~= "table" or #status ~= 5 then
+            if type(status) ~= "table" or #status ~= 6 then
                 log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)")
                 valid = false
             else
@@ -709,6 +901,7 @@ function iocontrol.update_unit_statuses(statuses)
                 end
 
                 if #reactor_status == 0 then
+                    unit.connected = false
                     unit.unit_ps.publish("computed_status", 1)   -- disconnected
                 elseif #reactor_status == 3 then
                     local mek_status = reactor_status[1]
@@ -768,6 +961,8 @@ function iocontrol.update_unit_statuses(statuses)
                             unit.unit_ps.publish(key, val)
                         end
                     end
+
+                    unit.connected = true
                 else
                     log.debug(log_header .. "reactor status length mismatch")
                     valid = false
@@ -779,8 +974,13 @@ function iocontrol.update_unit_statuses(statuses)
                 if type(rtu_statuses) == "table" then
                     -- boiler statuses
                     if type(rtu_statuses.boilers) == "table" then
+                        local boil_sum = 0
+
                         for id = 1, #unit.boiler_ps_tbl do
-                            if rtu_statuses.boilers[i] == nil then
+                            local connected = rtu_statuses.boilers[id] ~= nil
+                            unit.rtu_hw.boilers[id].connected = connected
+
+                            if not connected then
                                 -- disconnected
                                 unit.boiler_ps_tbl[id].publish("computed_status", 1)
                             end
@@ -788,14 +988,17 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, boiler in pairs(rtu_statuses.boilers) do
                             if type(unit.boiler_data_tbl[id]) == "table" then
-                                local data = unit.boiler_data_tbl[id]   ---@type boilerv_session_db
-                                local ps   = unit.boiler_ps_tbl[id]     ---@type psil
+                                local data = unit.boiler_data_tbl[id] ---@type boilerv_session_db
+                                local ps   = unit.boiler_ps_tbl[id]   ---@type psil
 
                                 local rtu_faulted = _record_multiblock_status(boiler, data, ps)
+                                unit.rtu_hw.boilers[id].faulted = rtu_faulted
 
                                 if rtu_faulted then
                                     ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    boil_sum = boil_sum + data.state.boil_rate
+
                                     if data.state.boil_rate > 0 then
                                         ps.publish("computed_status", 5)    -- active
                                     else
@@ -809,6 +1012,8 @@ function iocontrol.update_unit_statuses(statuses)
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("boiler_boil_sum", boil_sum)
                     else
                         log.debug(log_header .. "boiler list not a table")
                         valid = false
@@ -816,8 +1021,13 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- turbine statuses
                     if type(rtu_statuses.turbines) == "table" then
+                        local flow_sum = 0
+
                         for id = 1, #unit.turbine_ps_tbl do
-                            if rtu_statuses.turbines[i] == nil then
+                            local connected = rtu_statuses.turbines[id] ~= nil
+                            unit.rtu_hw.turbines[id].connected = connected
+
+                            if not connected then
                                 -- disconnected
                                 unit.turbine_ps_tbl[id].publish("computed_status", 1)
                             end
@@ -825,14 +1035,17 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, turbine in pairs(rtu_statuses.turbines) do
                             if type(unit.turbine_data_tbl[id]) == "table" then
-                                local data = unit.turbine_data_tbl[id]  ---@type turbinev_session_db
-                                local ps   = unit.turbine_ps_tbl[id]    ---@type psil
+                                local data = unit.turbine_data_tbl[id] ---@type turbinev_session_db
+                                local ps   = unit.turbine_ps_tbl[id]   ---@type psil
 
                                 local rtu_faulted = _record_multiblock_status(turbine, data, ps)
+                                unit.rtu_hw.turbines[id].faulted = rtu_faulted
 
                                 if rtu_faulted then
                                     ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    flow_sum = flow_sum + data.state.flow_rate
+
                                     if data.tanks.energy_fill >= 0.99 then
                                         ps.publish("computed_status", 6)    -- trip
                                     elseif data.state.flow_rate < 100 then
@@ -848,6 +1061,8 @@ function iocontrol.update_unit_statuses(statuses)
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("turbine_flow_sum", flow_sum)
                     else
                         log.debug(log_header .. "turbine list not a table")
                         valid = false
@@ -856,7 +1071,7 @@ function iocontrol.update_unit_statuses(statuses)
                     -- dynamic tank statuses
                     if type(rtu_statuses.tanks) == "table" then
                         for id = 1, #unit.tank_ps_tbl do
-                            if rtu_statuses.tanks[i] == nil then
+                            if rtu_statuses.tanks[id] == nil then
                                 -- disconnected
                                 unit.tank_ps_tbl[id].publish("computed_status", 1)
                             end
@@ -877,7 +1092,7 @@ function iocontrol.update_unit_statuses(statuses)
                                     elseif data.tanks.fill < 0.20 then
                                         ps.publish("computed_status", 5)    -- low
                                     else
-                                        ps.publish("computed_status", 5)    -- active
+                                        ps.publish("computed_status", 4)    -- on-line
                                     end
                                 else
                                     ps.publish("computed_status", 2)        -- not formed
@@ -894,10 +1109,15 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- solar neutron activator status info
                     if type(rtu_statuses.sna) == "table" then
-                        unit.num_snas      = rtu_statuses.sna[1]    ---@type integer
-                        unit.sna_prod_rate = rtu_statuses.sna[2]    ---@type number
+                        unit.num_snas      = rtu_statuses.sna[1] ---@type integer
+                        unit.sna_peak_rate = rtu_statuses.sna[2] ---@type number
+                        unit.sna_max_rate  = rtu_statuses.sna[3] ---@type number
+                        unit.sna_out_rate  = rtu_statuses.sna[4] ---@type number
 
-                        unit.unit_ps.publish("sna_prod_rate", unit.sna_prod_rate)
+                        unit.unit_ps.publish("sna_count", unit.num_snas)
+                        unit.unit_ps.publish("sna_peak_rate", unit.sna_peak_rate)
+                        unit.unit_ps.publish("sna_max_rate", unit.sna_max_rate)
+                        unit.unit_ps.publish("sna_out_rate", unit.sna_out_rate)
 
                         sna_count_sum = sna_count_sum + unit.num_snas
                     else
@@ -906,16 +1126,28 @@ function iocontrol.update_unit_statuses(statuses)
                     end
 
                     -- environment detector status
-                    if type(rtu_statuses.rad_mon) == "table" then
-                        if #rtu_statuses.rad_mon > 0 then
-                            local rad_mon = rtu_statuses.rad_mon[1]
-                            -- local rtu_faulted = rad_mon[1]  ---@type boolean
-                            unit.radiation = rad_mon[2]  ---@type number
+                    if type(rtu_statuses.envds) == "table" then
+                        local max_rad, max_reading, any_conn = 0, types.new_zero_radiation_reading(), false
 
-                            unit.unit_ps.publish("radiation", unit.radiation)
+                        for _, envd in pairs(rtu_statuses.envds) do
+                            local radiation = envd[2] ---@type radiation_reading
+                            local rad_raw   = envd[3] ---@type number
+
+                            any_conn = true
+
+                            if rad_raw > max_rad then
+                                max_rad = rad_raw
+                                max_reading = radiation
+                            end
+                        end
+
+                        if any_conn then
+                            unit.radiation = max_reading
                         else
                             unit.radiation = types.new_zero_radiation_reading()
                         end
+
+                        unit.unit_ps.publish("radiation", unit.radiation)
                     else
                         log.debug(log_header .. "radiation monitor list not a table")
                         valid = false
@@ -1002,10 +1234,64 @@ function iocontrol.update_unit_statuses(statuses)
                     valid = false
                 end
 
+                -- valve states
+                local valve_states = status[6]
+
+                if type(valve_states) == "table" then
+                    if #valve_states == 5 then
+                        unit.unit_ps.publish("V_pu_conn", valve_states[1] > 0)
+                        unit.unit_ps.publish("V_pu_state", valve_states[1] == 2)
+                        unit.unit_ps.publish("V_po_conn", valve_states[2] > 0)
+                        unit.unit_ps.publish("V_po_state", valve_states[2] == 2)
+                        unit.unit_ps.publish("V_pl_conn", valve_states[3] > 0)
+                        unit.unit_ps.publish("V_pl_state", valve_states[3] == 2)
+                        unit.unit_ps.publish("V_am_conn", valve_states[4] > 0)
+                        unit.unit_ps.publish("V_am_state", valve_states[4] == 2)
+                        unit.unit_ps.publish("V_emc_conn", valve_states[5] > 0)
+                        unit.unit_ps.publish("V_emc_state", valve_states[5] == 2)
+                    else
+                        log.debug(log_header .. "valve states length mismatch")
+                        valid = false
+                    end
+                else
+                    log.debug(log_header .. "valve states not a table")
+                    valid = false
+                end
+
                 -- determine waste production for this unit, add to statistics
+
                 local is_pu = unit.waste_product == types.WASTE_PRODUCT.PLUTONIUM
-                pu_rate = pu_rate + util.trinary(is_pu, burn_rate / 10.0, 0.0)
-                po_rate = po_rate + util.trinary(not is_pu, math.min(burn_rate / 10.0, unit.sna_prod_rate), 0.0)
+                local waste_rate = burn_rate / 10.0
+
+                local u_spent_rate = waste_rate
+                local u_pu_rate = util.trinary(is_pu, waste_rate, 0.0)
+                local u_po_rate = unit.sna_out_rate
+
+                unit.unit_ps.publish("pu_rate", u_pu_rate)
+                unit.unit_ps.publish("po_rate", u_po_rate)
+
+                unit.unit_ps.publish("sna_in", util.trinary(is_pu, 0, burn_rate))
+
+                if unit.waste_product == types.WASTE_PRODUCT.POLONIUM then
+                    u_spent_rate = u_po_rate
+                    unit.unit_ps.publish("po_pl_rate", u_po_rate)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                    po_pl_rate = po_pl_rate + u_po_rate
+                elseif unit.waste_product == types.WASTE_PRODUCT.ANTI_MATTER then
+                    u_spent_rate = 0
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", u_po_rate)
+                    po_am_rate = po_am_rate + u_po_rate
+                else
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                end
+
+                unit.unit_ps.publish("ws_rate", u_spent_rate)
+
+                pu_rate = pu_rate + u_pu_rate
+                po_rate = po_rate + u_po_rate
+                spent_rate = spent_rate + u_spent_rate
             end
         end
 
@@ -1013,9 +1299,9 @@ function iocontrol.update_unit_statuses(statuses)
         io.facility.ps.publish("sna_count", sna_count_sum)
         io.facility.ps.publish("pu_rate", pu_rate)
         io.facility.ps.publish("po_rate", po_rate)
-
-        -- update alarm sounder
-        sounder.eval(io.units)
+        io.facility.ps.publish("po_pl_rate", po_pl_rate)
+        io.facility.ps.publish("po_am_rate", po_am_rate)
+        io.facility.ps.publish("spent_waste_rate", spent_rate)
     end
 
     return valid

coordinator/process.lua

@@ -19,15 +19,21 @@ local process = {}
 local self = {
     io = nil,       ---@type ioctl
     comms = nil,    ---@type coord_comms
-    ---@class coord_auto_config
-    config = {
-        mode = PROCESS.INACTIVE,
-        burn_target = 0.0,
-        charge_target = 0.0,
-        gen_target = 0.0,
-        limits = {},
-        waste_product = PRODUCT.PLUTONIUM,
-        pu_fallback = false
+    ---@class coord_control_states
+    control_states = {
+        ---@class coord_auto_config
+        process = {
+            mode = PROCESS.INACTIVE,
+            burn_target = 0.0,
+            charge_target = 0.0,
+            gen_target = 0.0,
+            limits = {},
+            waste_product = PRODUCT.PLUTONIUM,
+            pu_fallback = false,
+            sps_low_power = false
+        },
+        waste_modes = {},
+        priority_groups = {}
     }
 }
 
@@ -42,63 +48,67 @@ function process.init(iocontrol, coord_comms)
     self.io = iocontrol
     self.comms = coord_comms
 
+    local ctl_proc = self.control_states.process
+
     for i = 1, self.io.facility.num_units do
-        self.config.limits[i] = 0.1
+        ctl_proc.limits[i] = 0.1
     end
 
-    -- load settings
-    if not settings.load("/coord.settings") then
-        log.error("process.init(): failed to load coordinator settings file")
-    end
+    local ctrl_states = settings.get("ControlStates", {})
+    local config = ctrl_states.process  ---@type coord_auto_config
 
     -- facility auto control configuration
-    local config = settings.get("PROCESS")  ---@type coord_auto_config|nil
     if type(config) == "table" then
-        self.config.mode = config.mode
-        self.config.burn_target = config.burn_target
-        self.config.charge_target = config.charge_target
-        self.config.gen_target = config.gen_target
-        self.config.limits = config.limits
-        self.config.waste_product = config.waste_product
-        self.config.pu_fallback = config.pu_fallback
+        ctl_proc.mode = config.mode
+        ctl_proc.burn_target = config.burn_target
+        ctl_proc.charge_target = config.charge_target
+        ctl_proc.gen_target = config.gen_target
+        ctl_proc.limits = config.limits
+        ctl_proc.waste_product = config.waste_product
+        ctl_proc.pu_fallback = config.pu_fallback
+        ctl_proc.sps_low_power = config.sps_low_power
 
-        self.io.facility.ps.publish("process_mode", self.config.mode)
-        self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
-        self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
-        self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
-        self.io.facility.ps.publish("process_waste_product", self.config.waste_product)
-        self.io.facility.ps.publish("process_pu_fallback", self.config.pu_fallback)
+        self.io.facility.ps.publish("process_mode", ctl_proc.mode)
+        self.io.facility.ps.publish("process_burn_target", ctl_proc.burn_target)
+        self.io.facility.ps.publish("process_charge_target", ctl_proc.charge_target)
+        self.io.facility.ps.publish("process_gen_target", ctl_proc.gen_target)
+        self.io.facility.ps.publish("process_waste_product", ctl_proc.waste_product)
+        self.io.facility.ps.publish("process_pu_fallback", ctl_proc.pu_fallback)
+        self.io.facility.ps.publish("process_sps_low_power", ctl_proc.sps_low_power)
 
-        for id = 1, math.min(#self.config.limits, self.io.facility.num_units) do
+        for id = 1, math.min(#ctl_proc.limits, self.io.facility.num_units) do
             local unit = self.io.units[id]   ---@type ioctl_unit
-            unit.unit_ps.publish("burn_limit", self.config.limits[id])
+            unit.unit_ps.publish("burn_limit", ctl_proc.limits[id])
         end
 
-        log.info("PROCESS: loaded auto control settings from coord.settings")
+        log.info("PROCESS: loaded auto control settings")
 
         -- notify supervisor of auto waste config
-        self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, self.config.waste_product)
-        self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, self.config.pu_fallback)
+        self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, ctl_proc.waste_product)
+        self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, ctl_proc.pu_fallback)
+        self.comms.send_fac_command(FAC_COMMAND.SET_SPS_LP, ctl_proc.sps_low_power)
     end
 
     -- unit waste states
-    local waste_modes = settings.get("WASTE_MODES")  ---@type table|nil
+    local waste_modes = ctrl_states.waste_modes  ---@type table|nil
     if type(waste_modes) == "table" then
         for id, mode in pairs(waste_modes) do
+            self.control_states.waste_modes[id] = mode
             self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
         end
 
-        log.info("PROCESS: loaded unit waste mode settings from coord.settings")
+        log.info("PROCESS: loaded unit waste mode settings")
     end
 
     -- unit priority groups
-    local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil
+    local prio_groups = ctrl_states.priority_groups ---@type table|nil
     if type(prio_groups) == "table" then
         for id, group in pairs(prio_groups) do
+            self.control_states.priority_groups[id] = group
             self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group)
         end
 
-        log.info("PROCESS: loaded priority groups settings from coord.settings")
+        log.info("PROCESS: loaded priority groups settings")
     end
 end
 
@@ -155,15 +165,10 @@ function process.set_unit_waste(id, mode)
     self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
     log.debug(util.c("PROCESS: UNIT[", id, "] SET WASTE ", mode))
 
-    local waste_mode = settings.get("WASTE_MODES")  ---@type table|nil
+    self.control_states.waste_modes[id] = mode
+    settings.set("ControlStates", self.control_states)
 
-    if type(waste_mode) ~= "table" then waste_mode = {} end
-
-    waste_mode[id] = mode
-
-    settings.set("WASTE_MODES", waste_mode)
-
-    if not settings.save("/coord.settings") then
+    if not settings.save("/coordinator.settings") then
         log.error("process.set_unit_waste(): failed to save coordinator settings file")
     end
 end
@@ -198,15 +203,10 @@ function process.set_group(unit_id, group_id)
     self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, unit_id, group_id)
     log.debug(util.c("PROCESS: UNIT[", unit_id, "] SET GROUP ", group_id))
 
-    local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil
+    self.control_states.priority_groups[unit_id] = group_id
+    settings.set("ControlStates", self.control_states)
 
-    if type(prio_groups) ~= "table" then prio_groups = {} end
-
-    prio_groups[unit_id] = group_id
-
-    settings.set("PRIORITY_GROUPS", prio_groups)
-
-    if not settings.save("/coord.settings") then
+    if not settings.save("/coordinator.settings") then
         log.error("process.set_group(): failed to save coordinator settings file")
     end
 end
@@ -217,20 +217,14 @@ end
 
 -- write auto process control to config file
 local function _write_auto_config()
-    -- attempt to load settings
-    if not settings.load("/coord.settings") then
-        log.warning("process._write_auto_config(): failed to load coordinator settings file")
-    end
-
     -- save config
-    settings.set("PROCESS", self.config)
-    local saved = settings.save("/coord.settings")
-
+    settings.set("ControlStates", self.control_states)
+    local saved = settings.save("/coordinator.settings")
     if not saved then
         log.warning("process._write_auto_config(): failed to save coordinator settings file")
     end
 
-    return not not saved
+    return saved
 end
 
 -- stop automatic process control
@@ -241,7 +235,7 @@ end
 
 -- start automatic process control
 function process.start_auto()
-    self.comms.send_auto_start(self.config)
+    self.comms.send_auto_start(self.control_states.process)
     log.debug("PROCESS: START AUTO CTL")
 end
 
@@ -253,7 +247,7 @@ function process.set_process_waste(product)
     log.debug(util.c("PROCESS: SET WASTE ", product))
 
     -- update config table and save
-    self.config.waste_product = product
+    self.control_states.process.waste_product = product
     _write_auto_config()
 end
 
@@ -265,7 +259,19 @@ function process.set_pu_fallback(enabled)
     log.debug(util.c("PROCESS: SET PU FALLBACK ", enabled))
 
     -- update config table and save
-    self.config.pu_fallback = enabled
+    self.control_states.process.pu_fallback = enabled
+    _write_auto_config()
+end
+
+-- set automatic process control SPS usage at low power
+---@param enabled boolean whether to enable SPS usage at low power
+function process.set_sps_low_power(enabled)
+    self.comms.send_fac_command(FAC_COMMAND.SET_SPS_LP, enabled)
+
+    log.debug(util.c("PROCESS: SET SPS LOW POWER ", enabled))
+
+    -- update config table and save
+    self.control_states.process.sps_low_power = enabled
     _write_auto_config()
 end
 
@@ -279,11 +285,12 @@ function process.save(mode, burn_target, charge_target, gen_target, limits)
     log.debug("PROCESS: SAVE")
 
     -- update config table
-    self.config.mode = mode
-    self.config.burn_target = burn_target
-    self.config.charge_target = charge_target
-    self.config.gen_target = gen_target
-    self.config.limits = limits
+    local ctl_proc = self.control_states.process
+    ctl_proc.mode = mode
+    ctl_proc.burn_target = burn_target
+    ctl_proc.charge_target = charge_target
+    ctl_proc.gen_target = gen_target
+    ctl_proc.limits = limits
 
     -- save config
     self.io.facility.save_cfg_ack(_write_auto_config())
@@ -294,22 +301,23 @@ end
 function process.start_ack_handle(response)
     local ack = response[1]
 
-    self.config.mode = response[2]
-    self.config.burn_target = response[3]
-    self.config.charge_target = response[4]
-    self.config.gen_target = response[5]
+    local ctl_proc = self.control_states.process
+    ctl_proc.mode = response[2]
+    ctl_proc.burn_target = response[3]
+    ctl_proc.charge_target = response[4]
+    ctl_proc.gen_target = response[5]
 
     for i = 1, math.min(#response[6], self.io.facility.num_units) do
-        self.config.limits[i] = response[6][i]
+        ctl_proc.limits[i] = response[6][i]
 
         local unit = self.io.units[i]   ---@type ioctl_unit
-        unit.unit_ps.publish("burn_limit", self.config.limits[i])
+        unit.unit_ps.publish("burn_limit", ctl_proc.limits[i])
     end
 
-    self.io.facility.ps.publish("process_mode", self.config.mode)
-    self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
-    self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
-    self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
+    self.io.facility.ps.publish("process_mode", ctl_proc.mode)
+    self.io.facility.ps.publish("process_burn_target", ctl_proc.burn_target)
+    self.io.facility.ps.publish("process_charge_target", ctl_proc.charge_target)
+    self.io.facility.ps.publish("process_gen_target", ctl_proc.gen_target)
 
     self.io.facility.start_ack(ack)
 end
@@ -317,14 +325,14 @@ end
 -- record waste product state after attempting to change it
 ---@param response WASTE_PRODUCT supervisor waste product state
 function process.waste_ack_handle(response)
-    self.config.waste_product = response
+    self.control_states.process.waste_product = response
     self.io.facility.ps.publish("process_waste_product", response)
 end
 
 -- record plutonium fallback state after attempting to change it
 ---@param response boolean supervisor plutonium fallback state
 function process.pu_fb_ack_handle(response)
-    self.config.pu_fallback = response
+    self.control_states.process.pu_fallback = response
     self.io.facility.ps.publish("process_pu_fallback", response)
 end
 

coordinator/renderer.lua

@@ -2,26 +2,33 @@
 -- Graphics Rendering Control
 --
 
-local log        = require("scada-common.log")
-local util       = require("scada-common.util")
+local log         = require("scada-common.log")
+local util        = require("scada-common.util")
 
-local iocontrol  = require("coordinator.iocontrol")
+local coordinator = require("coordinator.coordinator")
+local iocontrol   = require("coordinator.iocontrol")
 
-local style      = require("coordinator.ui.style")
-local pgi        = require("coordinator.ui.pgi")
+local style       = require("coordinator.ui.style")
+local pgi         = require("coordinator.ui.pgi")
 
-local panel_view = require("coordinator.ui.layout.front_panel")
-local main_view  = require("coordinator.ui.layout.main_view")
-local unit_view  = require("coordinator.ui.layout.unit_view")
+local flow_view   = require("coordinator.ui.layout.flow_view")
+local panel_view  = require("coordinator.ui.layout.front_panel")
+local main_view   = require("coordinator.ui.layout.main_view")
+local unit_view   = require("coordinator.ui.layout.unit_view")
 
-local flasher    = require("graphics.flasher")
+local core        = require("graphics.core")
+local flasher     = require("graphics.flasher")
 
-local DisplayBox = require("graphics.elements.displaybox")
+local DisplayBox  = require("graphics.elements.displaybox")
 
+local log_render = coordinator.log_render
+
+---@class coord_renderer
 local renderer = {}
 
 -- render engine
 local engine = {
+    color_mode = 1,         ---@type COLOR_MODE
     monitors = nil,         ---@type monitors_struct|nil
     dmesg_window = nil,     ---@type table|nil
     ui_ready = false,
@@ -29,8 +36,10 @@ local engine = {
     ui = {
         front_panel = nil,  ---@type graphics_element|nil
         main_display = nil, ---@type graphics_element|nil
+        flow_display = nil, ---@type graphics_element|nil
         unit_displays = {}
-    }
+    },
+    disable_flow_view = false
 }
 
 -- init a display to the "default", but set text scale to 0.5
@@ -43,9 +52,34 @@ local function _init_display(monitor)
     monitor.setCursorPos(1, 1)
 
     -- set overridden colors
-    for i = 1, #style.colors do
-        monitor.setPaletteColor(style.colors[i].c, style.colors[i].hex)
+    for i = 1, #style.theme.colors do
+        monitor.setPaletteColor(style.theme.colors[i].c, style.theme.colors[i].hex)
     end
+
+    -- apply color mode
+    local c_mode_overrides = style.theme.color_modes[engine.color_mode]
+    for i = 1, #c_mode_overrides do
+        monitor.setPaletteColor(c_mode_overrides[i].c, c_mode_overrides[i].hex)
+    end
+end
+
+-- print out that the monitor is too small
+---@param monitor table monitor
+local function _print_too_small(monitor)
+    monitor.setCursorPos(1, 1)
+    monitor.setBackgroundColor(colors.black)
+    monitor.setTextColor(colors.red)
+    monitor.clear()
+    monitor.write("monitor too small")
+end
+
+-- apply renderer configurations
+---@param config crd_config
+function renderer.configure(config)
+    style.set_themes(config.MainTheme, config.FrontPanelTheme, config.ColorMode)
+
+    engine.color_mode = config.ColorMode
+    engine.disable_flow_view = config.DisableFlowView
 end
 
 -- link to the monitor peripherals
@@ -54,14 +88,16 @@ function renderer.set_displays(monitors)
     engine.monitors = monitors
 
     -- report to front panel as connected
-    iocontrol.fp_monitor_state(0, true)
+    iocontrol.fp_monitor_state("main", engine.monitors.main ~= nil)
+    iocontrol.fp_monitor_state("flow", engine.monitors.flow ~= nil)
     for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end
 end
 
 -- init all displays in use by the renderer
 function renderer.init_displays()
-    -- init primary monitor
-    _init_display(engine.monitors.primary)
+    -- init main and flow monitors
+    _init_display(engine.monitors.main)
+    if not engine.disable_flow_view then _init_display(engine.monitors.flow) end
 
     -- init unit displays
     for _, monitor in ipairs(engine.monitors.unit_displays) do
@@ -75,56 +111,48 @@ function renderer.init_displays()
     term.setCursorPos(1, 1)
 
     -- set overridden colors
-    for i = 1, #style.fp.colors do
-        term.setPaletteColor(style.fp.colors[i].c, style.fp.colors[i].hex)
-    end
-end
-
--- check main display width
----@nodiscard
----@return boolean width_okay
-function renderer.validate_main_display_width()
-    local w, _ = engine.monitors.primary.getSize()
-    return w == 164
-end
-
--- check display sizes
----@nodiscard
----@return boolean valid all unit display dimensions OK
-function renderer.validate_unit_display_sizes()
-    local valid = true
-
-    for id, monitor in ipairs(engine.monitors.unit_displays) do
-        local w, h = monitor.getSize()
-        if w ~= 79 or h ~= 52 then
-            log.warning(util.c("RENDERER: unit ", id, " display resolution not 79 wide by 52 tall: ", w, ", ", h))
-            valid = false
-        end
+    for i = 1, #style.fp_theme.colors do
+        term.setPaletteColor(style.fp_theme.colors[i].c, style.fp_theme.colors[i].hex)
     end
 
-    return valid
+    -- apply color mode
+    local c_mode_overrides = style.fp_theme.color_modes[engine.color_mode]
+    for i = 1, #c_mode_overrides do
+        term.setPaletteColor(c_mode_overrides[i].c, c_mode_overrides[i].hex)
+    end
 end
 
 -- initialize the dmesg output window
 function renderer.init_dmesg()
-    local disp_x, disp_y = engine.monitors.primary.getSize()
-    engine.dmesg_window = window.create(engine.monitors.primary, 1, 1, disp_x, disp_y)
+    local disp_w, disp_h = engine.monitors.main.getSize()
+    engine.dmesg_window = window.create(engine.monitors.main, 1, 1, disp_w, disp_h)
     log.direct_dmesg(engine.dmesg_window)
 end
 
--- start the coordinator front panel
-function renderer.start_fp()
+-- try to start the front panel
+---@return boolean success, any error_msg
+function renderer.try_start_fp()
+    local status, msg = true, nil
+
     if not engine.fp_ready then
         -- show front panel view on terminal
-        engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
-        panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
+        status, msg = pcall(function ()
+            engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
+            panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
+        end)
 
-        -- start flasher callback task
-        flasher.run()
-
-        -- report front panel as ready
-        engine.fp_ready = true
+        if status then
+            -- start flasher callback task and report ready
+            flasher.run()
+            engine.fp_ready = true
+        else
+            -- report fail and close front panel
+            msg = core.extract_assert_msg(msg)
+            renderer.close_fp()
+        end
     end
+
+    return status, msg
 end
 
 -- close out the front panel
@@ -144,9 +172,9 @@ function renderer.close_fp()
         engine.fp_ready = false
 
         -- restore colors
-        for i = 1, #style.colors do
-            local r, g, b = term.nativePaletteColor(style.colors[i].c)
-            term.setPaletteColor(style.colors[i].c, r, g, b)
+        for i = 1, #style.fp_theme.colors do
+            local r, g, b = term.nativePaletteColor(style.fp_theme.colors[i].c)
+            term.setPaletteColor(style.fp_theme.colors[i].c, r, g, b)
         end
 
         -- reset terminal
@@ -157,30 +185,50 @@ function renderer.close_fp()
     end
 end
 
--- start the coordinator GUI
-function renderer.start_ui()
+-- try to start the main GUI
+---@return boolean success, any error_msg
+function renderer.try_start_ui()
+    local status, msg = true, nil
+
     if not engine.ui_ready then
         -- hide dmesg
         engine.dmesg_window.setVisible(false)
 
-        -- show main view on main monitor
-        if engine.monitors.primary ~= nil then
-            engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root}
-            main_view(engine.ui.main_display)
+        status, msg = pcall(function ()
+            -- show main view on main monitor
+            if engine.monitors.main ~= nil then
+                engine.ui.main_display = DisplayBox{window=engine.monitors.main,fg_bg=style.root}
+                main_view(engine.ui.main_display)
+                util.nop()
+            end
+
+            -- show flow view on flow monitor
+            if engine.monitors.flow ~= nil then
+                engine.ui.flow_display = DisplayBox{window=engine.monitors.flow,fg_bg=style.root}
+                flow_view(engine.ui.flow_display)
+                util.nop()
+            end
+
+            -- show unit views on unit displays
+            for idx, display in pairs(engine.monitors.unit_displays) do
+                engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
+                unit_view(engine.ui.unit_displays[idx], idx)
+                util.nop()
+            end
+        end)
+
+        if status then
+            -- start flasher callback task and report ready
+            flasher.run()
+            engine.ui_ready = true
+        else
+            -- report fail and close ui
+            msg = core.extract_assert_msg(msg)
+            renderer.close_ui()
         end
-
-        -- show unit views on unit displays
-        for idx, display in pairs(engine.monitors.unit_displays) do
-            engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
-            unit_view(engine.ui.unit_displays[idx], idx)
-        end
-
-        -- start flasher callback task
-        flasher.run()
-
-        -- report ui as ready
-        engine.ui_ready = true
     end
+
+    return status, msg
 end
 
 -- close out the UI
@@ -192,6 +240,7 @@ function renderer.close_ui()
 
     -- delete element trees
     if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end
+    if engine.ui.flow_display ~= nil then engine.ui.flow_display.delete() end
     for _, display in pairs(engine.ui.unit_displays) do display.delete() end
 
     -- report ui as not ready
@@ -199,11 +248,17 @@ function renderer.close_ui()
 
     -- clear root UI elements
     engine.ui.main_display = nil
+    engine.ui.flow_display = nil
     engine.ui.unit_displays = {}
 
     -- clear unit monitors
     for _, monitor in ipairs(engine.monitors.unit_displays) do monitor.clear() end
 
+    if not engine.disable_flow_view then
+        -- clear flow monitor
+        engine.monitors.flow.clear()
+    end
+
     -- re-draw dmesg
     engine.dmesg_window.setVisible(true)
     engine.dmesg_window.redraw()
@@ -225,32 +280,43 @@ function renderer.ui_ready() return engine.ui_ready end
 function renderer.handle_disconnect(device)
     local is_used = false
 
-    if engine.monitors ~= nil then
-        if engine.monitors.primary == device then
-            if engine.ui.main_display ~= nil then
-                -- delete element tree and clear root UI elements
-                engine.ui.main_display.delete()
-            end
+    if not engine.monitors then return false end
 
-            is_used = true
-            engine.monitors.primary = nil
-            engine.ui.main_display = nil
+    if engine.monitors.main == device then
+        if engine.ui.main_display ~= nil then
+            -- delete element tree and clear root UI elements
+            engine.ui.main_display.delete()
+        end
 
-            iocontrol.fp_monitor_state(0, false)
-        else
-            for idx, monitor in pairs(engine.monitors.unit_displays) do
-                if monitor == device then
-                    if engine.ui.unit_displays[idx] ~= nil then
-                        engine.ui.unit_displays[idx].delete()
-                    end
+        is_used = true
+        engine.monitors.main = nil
+        engine.ui.main_display = nil
 
-                    is_used = true
-                    engine.monitors.unit_displays[idx] = nil
-                    engine.ui.unit_displays[idx] = nil
+        iocontrol.fp_monitor_state("main", false)
+    elseif engine.monitors.flow == device then
+        if engine.ui.flow_display ~= nil then
+            -- delete element tree and clear root UI elements
+            engine.ui.flow_display.delete()
+        end
 
-                    iocontrol.fp_monitor_state(idx, false)
-                    break
+        is_used = true
+        engine.monitors.flow = nil
+        engine.ui.flow_display = nil
+
+        iocontrol.fp_monitor_state("flow", false)
+    else
+        for idx, monitor in pairs(engine.monitors.unit_displays) do
+            if monitor == device then
+                if engine.ui.unit_displays[idx] ~= nil then
+                    engine.ui.unit_displays[idx].delete()
                 end
+
+                is_used = true
+                engine.monitors.unit_displays[idx] = nil
+                engine.ui.unit_displays[idx] = nil
+
+                iocontrol.fp_monitor_state(idx, false)
+                break
             end
         end
     end
@@ -265,41 +331,29 @@ end
 function renderer.handle_reconnect(name, device)
     local is_used = false
 
-    if engine.monitors ~= nil then
-        if engine.monitors.primary_name == name then
-            is_used = true
-            _init_display(device)
-            engine.monitors.primary = device
+    if not engine.monitors then return false end
 
-            local disp_x, disp_y = engine.monitors.primary.getSize()
-            engine.dmesg_window.reposition(1, 1, disp_x, disp_y, engine.monitors.primary)
+    -- note: handle_resize is a more adaptive way of re-initializing a connected monitor
+    --       since it can handle a monitor being reconnected that isn't the right size
 
-            if engine.ui_ready and (engine.ui.main_display == nil) then
-                engine.dmesg_window.setVisible(false)
+    if engine.monitors.main_name == name then
+        is_used = true
+        engine.monitors.main = device
 
-                engine.ui.main_display = DisplayBox{window=device,fg_bg=style.root}
-                main_view(engine.ui.main_display)
-            else
-                engine.dmesg_window.setVisible(true)
-                engine.dmesg_window.redraw()
-            end
+        renderer.handle_resize(name)
+    elseif engine.monitors.flow_name == name then
+        is_used = true
+        engine.monitors.flow = device
 
-            iocontrol.fp_monitor_state(0, true)
-        else
-            for idx, monitor in ipairs(engine.monitors.unit_name_map) do
-                if monitor == name then
-                    is_used = true
-                    _init_display(device)
-                    engine.monitors.unit_displays[idx] = device
+        renderer.handle_resize(name)
+    else
+        for idx, monitor in ipairs(engine.monitors.unit_name_map) do
+            if monitor == name then
+                is_used = true
+                engine.monitors.unit_displays[idx] = device
 
-                    if engine.ui_ready and (engine.ui.unit_displays[idx] == nil) then
-                        engine.ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
-                        unit_view(engine.ui.unit_displays[idx], idx)
-                    end
-
-                    iocontrol.fp_monitor_state(idx, true)
-                    break
-                end
+                renderer.handle_resize(name)
+                break
             end
         end
     end
@@ -307,6 +361,142 @@ function renderer.handle_reconnect(name, device)
     return is_used
 end
 
+-- handle a monitor being resized<br>
+-- returns if this monitor is assigned + if the assigned screen still fits
+---@param name string monitor name
+---@return boolean is_used, boolean is_ok
+function renderer.handle_resize(name)
+    local is_used = false
+    local is_ok = true
+    local ui = engine.ui
+
+    if not engine.monitors then return false, false end
+
+    if engine.monitors.main_name == name and engine.monitors.main then
+        local device = engine.monitors.main  ---@type table
+
+        -- this is necessary if the bottom left block was broken and on reconnect
+        _init_display(device)
+
+        is_used = true
+
+        -- resize dmesg window if needed, but don't make it thinner
+        local disp_w, disp_h = engine.monitors.main.getSize()
+        local dmsg_w, _ = engine.dmesg_window.getSize()
+        engine.dmesg_window.reposition(1, 1, math.max(disp_w, dmsg_w), disp_h, engine.monitors.main)
+
+        if ui.main_display then
+            ui.main_display.delete()
+            ui.main_display = nil
+        end
+
+        iocontrol.fp_monitor_state("main", true)
+
+        engine.dmesg_window.setVisible(not engine.ui_ready)
+
+        if engine.ui_ready then
+            local draw_start = util.time_ms()
+            local ok = pcall(function ()
+                ui.main_display = DisplayBox{window=device,fg_bg=style.root}
+                main_view(ui.main_display)
+            end)
+
+            if ok then
+                log_render("main view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
+            else
+                if ui.main_display then
+                    ui.main_display.delete()
+                    ui.main_display = nil
+                end
+
+                _print_too_small(device)
+
+                iocontrol.fp_monitor_state("main", false)
+                is_ok = false
+            end
+        else engine.dmesg_window.redraw() end
+    elseif engine.monitors.flow_name == name and engine.monitors.flow then
+        local device = engine.monitors.flow ---@type table
+
+        -- this is necessary if the bottom left block was broken and on reconnect
+        _init_display(device)
+
+        is_used = true
+
+        if ui.flow_display then
+            ui.flow_display.delete()
+            ui.flow_display = nil
+        end
+
+        iocontrol.fp_monitor_state("flow", true)
+
+        if engine.ui_ready then
+            local draw_start = util.time_ms()
+            local ok = pcall(function ()
+                ui.flow_display = DisplayBox{window=device,fg_bg=style.root}
+                flow_view(ui.flow_display)
+            end)
+
+            if ok then
+                log_render("flow view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
+            else
+                if ui.flow_display then
+                    ui.flow_display.delete()
+                    ui.flow_display = nil
+                end
+
+                _print_too_small(device)
+
+                iocontrol.fp_monitor_state("flow", false)
+                is_ok = false
+            end
+        end
+    else
+        for idx, monitor in ipairs(engine.monitors.unit_name_map) do
+            local device = engine.monitors.unit_displays[idx]
+
+            if monitor == name and device then
+                -- this is necessary if the bottom left block was broken and on reconnect
+                _init_display(device)
+
+                is_used = true
+
+                if ui.unit_displays[idx] then
+                    ui.unit_displays[idx].delete()
+                    ui.unit_displays[idx] = nil
+                end
+
+                iocontrol.fp_monitor_state(idx, true)
+
+                if engine.ui_ready then
+                    local draw_start = util.time_ms()
+                    local ok = pcall(function ()
+                        ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
+                        unit_view(ui.unit_displays[idx], idx)
+                    end)
+
+                    if ok then
+                        log_render("unit " .. idx .. " view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
+                    else
+                        if ui.unit_displays[idx] then
+                            ui.unit_displays[idx].delete()
+                            ui.unit_displays[idx] = nil
+                        end
+
+                        _print_too_small(device)
+
+                        iocontrol.fp_monitor_state(idx, false)
+                        is_ok = false
+                    end
+                end
+
+                break
+            end
+        end
+    end
+
+    return is_used, is_ok
+end
 
 -- handle a touch event
 ---@param event mouse_interaction|nil
@@ -315,14 +505,15 @@ function renderer.handle_mouse(event)
         if engine.fp_ready and event.monitor == "terminal" then
             engine.ui.front_panel.handle_mouse(event)
         elseif engine.ui_ready then
-            if event.monitor == engine.monitors.primary_name then
-                engine.ui.main_display.handle_mouse(event)
+            if event.monitor == engine.monitors.main_name then
+                if engine.ui.main_display then engine.ui.main_display.handle_mouse(event) end
+            elseif event.monitor == engine.monitors.flow_name then
+                if engine.ui.flow_display then engine.ui.flow_display.handle_mouse(event) end
             else
                 for id, monitor in ipairs(engine.monitors.unit_name_map) do
-                    if event.monitor == monitor then
-                        local layout = engine.ui.unit_displays[id]  ---@type graphics_element
-                        layout.handle_mouse(event)
-                        break
+                    local display = engine.ui.unit_displays[id]
+                    if event.monitor == monitor and display then
+                        if display then display.handle_mouse(event) end
                     end
                 end
             end

coordinator/session/apisessions.lua

@@ -3,7 +3,6 @@ local log       = require("scada-common.log")
 local mqueue    = require("scada-common.mqueue")
 local util      = require("scada-common.util")
 
-local config    = require("coordinator.config")
 local iocontrol = require("coordinator.iocontrol")
 
 local pocket    = require("coordinator.session.pocket")
@@ -11,7 +10,8 @@ local pocket    = require("coordinator.session.pocket")
 local apisessions = {}
 
 local self = {
-    nic = nil,
+    nic = nil,    ---@type nic
+    config = nil, ---@type crd_config
     next_id = 0,
     sessions = {}
 }
@@ -32,7 +32,7 @@ local function _api_handle_outq(session)
         if msg ~= nil then
             if msg.qtype == mqueue.TYPE.PACKET then
                 -- handle a packet to be sent
-                self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
+                self.nic.transmit(self.config.PKT_Channel, self.config.CRD_Channel, msg.message)
             elseif msg.qtype == mqueue.TYPE.COMMAND then
                 -- handle instruction/notification
             elseif msg.qtype == mqueue.TYPE.DATA then
@@ -42,8 +42,8 @@ local function _api_handle_outq(session)
 
         -- max 100ms spent processing queue
         if util.time() - handle_start > 100 then
-            log.warning("[API] out queue handler exceeded 100ms queue process limit")
-            log.warning(util.c("[API] offending session: ", session))
+            log.warning("API: out queue handler exceeded 100ms queue process limit")
+            log.warning(util.c("API: offending session: ", session))
             break
         end
     end
@@ -59,19 +59,21 @@ local function _shutdown(session)
     while session.out_queue.ready() do
         local msg = session.out_queue.pop()
         if msg ~= nil and msg.qtype == mqueue.TYPE.PACKET then
-            self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
+            self.nic.transmit(self.config.PKT_Channel, self.config.CRD_Channel, msg.message)
         end
     end
 
-    log.debug(util.c("[API] closed session ", session))
+    log.debug(util.c("API: closed session ", session))
 end
 
 -- PUBLIC FUNCTIONS --
 
 -- initialize apisessions
----@param nic nic
-function apisessions.init(nic)
+---@param nic nic network interface
+---@param config crd_config coordinator config
+function apisessions.init(nic, config)
     self.nic = nic
+    self.config = config
 end
 
 -- find a session by remote port
@@ -103,7 +105,7 @@ function apisessions.establish_session(source_addr, version)
 
     local id = self.next_id
 
-    pkt_s.instance = pocket.new_session(id, source_addr, pkt_s.in_queue, pkt_s.out_queue, config.API_TIMEOUT)
+    pkt_s.instance = pocket.new_session(id, source_addr, pkt_s.in_queue, pkt_s.out_queue, self.config.API_Timeout)
     table.insert(self.sessions, pkt_s)
 
     local mt = {
@@ -114,7 +116,7 @@ function apisessions.establish_session(source_addr, version)
     setmetatable(pkt_s, mt)
 
     iocontrol.fp_pkt_connected(id, version, source_addr)
-    log.debug(util.c("[API] established new session: ", pkt_s))
+    log.debug(util.c("API: established new session: ", pkt_s))
 
     self.next_id = id + 1
 
@@ -130,7 +132,7 @@ function apisessions.check_all_watchdogs(timer_event)
         if session.open then
             local triggered = session.instance.check_wd(timer_event)
             if triggered then
-                log.debug(util.c("[API] watchdog closing session ", session, "..."))
+                log.debug(util.c("API: watchdog closing session ", session, "..."))
                 _shutdown(session)
             end
         end
@@ -156,7 +158,7 @@ function apisessions.free_all_closed()
 
     ---@param session pkt_session_struct
     local on_delete = function (session)
-        log.debug(util.c("[API] free'ing closed session ", session))
+        log.debug(util.c("API: free'ing closed session ", session))
     end
 
     util.filter_table(self.sessions, f, on_delete)

coordinator/session/pocket.lua

@@ -8,8 +8,8 @@ local iocontrol = require("coordinator.iocontrol")
 local pocket = {}
 
 local PROTOCOL = comms.PROTOCOL
--- local CAPI_TYPE = comms.CAPI_TYPE
-local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
+local CRDN_TYPE = comms.CRDN_TYPE
+local MGMT_TYPE = comms.MGMT_TYPE
 
 -- retry time constants in ms
 -- local INITIAL_WAIT = 1500
@@ -72,22 +72,22 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
         iocontrol.fp_pkt_disconnected(id)
     end
 
-    -- send a CAPI packet
-    -----@param msg_type CAPI_TYPE
-    -----@param msg table
-    -- local function _send(msg_type, msg)
-    --     local s_pkt = comms.scada_packet()
-    --     local c_pkt = comms.capi_packet()
+    -- send a CRDN packet
+    ---@param msg_type CRDN_TYPE
+    ---@param msg table
+    local function _send(msg_type, msg)
+        local s_pkt = comms.scada_packet()
+        local c_pkt = comms.crdn_packet()
 
-    --     c_pkt.make(msg_type, msg)
-    --     s_pkt.make(self.seq_num, PROTOCOL.COORD_API, c_pkt.raw_sendable())
+        c_pkt.make(msg_type, msg)
+        s_pkt.make(s_addr, self.seq_num, PROTOCOL.SCADA_CRDN, c_pkt.raw_sendable())
 
-    --     out_queue.push_packet(s_pkt)
-    --     self.seq_num = self.seq_num + 1
-    -- end
+        out_queue.push_packet(s_pkt)
+        self.seq_num = self.seq_num + 1
+    end
 
     -- send a SCADA management packet
-    ---@param msg_type SCADA_MGMT_TYPE
+    ---@param msg_type MGMT_TYPE
     ---@param msg table
     local function _send_mgmt(msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -101,7 +101,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     end
 
     -- handle a packet
-    ---@param pkt mgmt_frame|capi_frame
+    ---@param pkt mgmt_frame|crdn_frame
     local function _handle_packet(pkt)
         -- check sequence number
         if self.r_seq_num == nil then
@@ -117,17 +117,53 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
         self.conn_watchdog.feed()
 
         -- process packet
-        if pkt.scada_frame.protocol() == PROTOCOL.COORD_API then
-            ---@cast pkt capi_frame
+        if pkt.scada_frame.protocol() == PROTOCOL.SCADA_CRDN then
+            ---@cast pkt crdn_frame
+
+            local db = iocontrol.get_db()
 
             -- handle packet by type
-            if pkt.type == nil then
+            if pkt.type == CRDN_TYPE.API_GET_FAC then
+                local fac = db.facility
+
+                local data = {
+                    fac.all_sys_ok,
+                    fac.rtu_count,
+                    fac.radiation,
+                    { fac.auto_ready, fac.auto_active, fac.auto_ramping, fac.auto_saturated },
+                    { fac.auto_current_waste_product, fac.auto_pu_fallback_active },
+                    util.table_len(fac.tank_data_tbl),
+                    fac.induction_data_tbl[1] ~= nil,
+                    fac.sps_data_tbl[1] ~= nil,
+                }
+
+                _send(CRDN_TYPE.API_GET_FAC, data)
+            elseif pkt.type == CRDN_TYPE.API_GET_UNIT then
+                if pkt.length == 1 and type(pkt.data[1]) == "number" then
+                    local u = db.units[pkt.data[1]]   ---@type ioctl_unit
+
+                    if u then
+                        local data = {
+                            u.unit_id,
+                            u.connected,
+                            u.rtu_hw,
+                            u.alarms,
+                            u.annunciator,
+                            u.reactor_data,
+                            u.boiler_data_tbl,
+                            u.turbine_data_tbl,
+                            u.tank_data_tbl
+                        }
+
+                        _send(CRDN_TYPE.API_GET_UNIT, data)
+                    end
+                end
             else
-                log.debug(log_header .. "handler received unsupported CAPI packet type " .. pkt.type)
+                log.debug(log_header .. "handler received unsupported CRDN packet type " .. pkt.type)
             end
         elseif pkt.scada_frame.protocol() == PROTOCOL.SCADA_MGMT then
             ---@cast pkt mgmt_frame
-            if pkt.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
+            if pkt.type == MGMT_TYPE.KEEP_ALIVE then
                 -- keep alive reply
                 if pkt.length == 2 then
                     local srv_start = pkt.data[1]
@@ -146,7 +182,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
                 else
                     log.debug(log_header .. "SCADA keep alive packet length mismatch")
                 end
-            elseif pkt.type == SCADA_MGMT_TYPE.CLOSE then
+            elseif pkt.type == MGMT_TYPE.CLOSE then
                 -- close the session
                 _close()
             else
@@ -174,7 +210,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     -- close the connection
     function public.close()
         _close()
-        _send_mgmt(SCADA_MGMT_TYPE.CLOSE, {})
+        _send_mgmt(MGMT_TYPE.CLOSE, {})
         log.info(log_header .. "session closed by server")
     end
 
@@ -229,7 +265,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
 
             periodics.keep_alive = periodics.keep_alive + elapsed
             if periodics.keep_alive >= PERIODICS.KEEP_ALIVE then
-                _send_mgmt(SCADA_MGMT_TYPE.KEEP_ALIVE, { util.time() })
+                _send_mgmt(MGMT_TYPE.KEEP_ALIVE, { util.time() })
                 periodics.keep_alive = 0
             end
 

coordinator/sounder.lua

@@ -2,269 +2,25 @@
 -- Alarm Sounder
 --
 
+local audio = require("scada-common.audio")
 local log   = require("scada-common.log")
-local types = require("scada-common.types")
-local util  = require("scada-common.util")
-
-local ALARM = types.ALARM
-local ALARM_STATE = types.ALARM_STATE
 
 ---@class sounder
 local sounder = {}
 
--- note: max samples = 0x20000 (128 * 1024 samples)
-
-local _2_PI        = 2 * math.pi    -- 2 whole pies, hope you're hungry
-local _DRATE       = 48000          -- 48kHz audio
-local _MAX_VAL     = 127 / 2        -- max signed integer in this 8-bit audio
-local _05s_SAMPLES = 24000          -- half a second worth of samples
-
-local test_alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
-
 local alarm_ctl = {
     speaker = nil,
     volume = 0.5,
-    playing = false,
-    num_active = 0,
-    next_block = 1,
-    -- split audio up into 0.5s samples so specific components can be ended quicker
-    quad_buffer = { {}, {}, {}, {} }
+    stream = audio.new_stream()
 }
 
--- sounds modeled after https://www.e2s.com/references-and-guidelines/listen-and-download-alarm-tones
-
-local T_340Hz_Int_2Hz = 1
-local T_544Hz_440Hz_Alt = 2
-local T_660Hz_Int_125ms = 3
-local T_745Hz_Int_1Hz = 4
-local T_800Hz_Int = 5
-local T_800Hz_1000Hz_Alt = 6
-local T_1000Hz_Int = 7
-local T_1800Hz_Int_4Hz = 8
-
-local TONES = {
-    { active = false, component = { {}, {}, {}, {} } }, -- 340Hz @ 2Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 544Hz 100mS / 440Hz 400mS Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 660Hz @ 125ms On 125ms Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 745Hz @ 1Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 800Hz @ 0.25s On 1.75s Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 800/1000Hz @ 0.25s Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 1KHz 1s on, 1s off Intermittent
-    { active = false, component = { {}, {}, {}, {} } }  -- 1.8KHz @ 4Hz Intermittent
-}
-
--- calculate how many samples are in the given number of milliseconds
----@nodiscard
----@param ms integer milliseconds
----@return integer samples
-local function ms_to_samples(ms) return math.floor(ms * 48) end
-
---#region Tone Generation (the Maths)
-
--- 340Hz @ 2Hz Intermittent
-local function gen_tone_1()
-    local t, dt = 0, _2_PI * 340 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[1].component[1][i] = val
-        TONES[1].component[3][i] = val
-        TONES[1].component[2][i] = 0
-        TONES[1].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 544Hz 100mS / 440Hz 400mS Alternating
-local function gen_tone_2()
-    local t1, dt1 = 0, _2_PI * 544 / _DRATE
-    local t2, dt2 = 0, _2_PI * 440 / _DRATE
-    local alternate_at = ms_to_samples(100)
-
-    for i = 1, _05s_SAMPLES do
-        local value
-
-        if i <= alternate_at then
-            value = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            value = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[2].component[1][i] = value
-        TONES[2].component[2][i] = value
-        TONES[2].component[3][i] = value
-        TONES[2].component[4][i] = value
-    end
-end
-
--- 660Hz @ 125ms On 125ms Off
-local function gen_tone_3()
-    local elapsed_samples = 0
-    local alternate_after = ms_to_samples(125)
-    local alternate_at = alternate_after
-    local mode = true
-
-    local t, dt = 0, _2_PI * 660 / _DRATE
-
-    for set = 1, 4 do
-        for i = 1, _05s_SAMPLES do
-            if mode then
-                local val = math.floor(math.sin(t) * _MAX_VAL)
-                TONES[3].component[set][i] = val
-                t = (t + dt) % _2_PI
-            else
-                t = 0
-                TONES[3].component[set][i] = 0
-            end
-
-            if elapsed_samples == alternate_at then
-                mode = not mode
-                alternate_at = elapsed_samples + alternate_after
-            end
-
-            elapsed_samples = elapsed_samples + 1
-        end
-    end
-end
-
--- 745Hz @ 1Hz Intermittent
-local function gen_tone_4()
-    local t, dt = 0, _2_PI * 745 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[4].component[1][i] = val
-        TONES[4].component[3][i] = val
-        TONES[4].component[2][i] = 0
-        TONES[4].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 800Hz @ 0.25s On 1.75s Off
-local function gen_tone_5()
-    local t, dt = 0, _2_PI * 800 / _DRATE
-    local stop_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-
-        if i > stop_at then
-            TONES[5].component[1][i] = val
-        else
-            TONES[5].component[1][i] = 0
-        end
-
-        TONES[5].component[2][i] = 0
-        TONES[5].component[3][i] = 0
-        TONES[5].component[4][i] = 0
-
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1000/800Hz @ 0.25s Alternating
-local function gen_tone_6()
-    local t1, dt1 = 0, _2_PI * 1000 / _DRATE
-    local t2, dt2 = 0, _2_PI * 800 / _DRATE
-
-    local alternate_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val
-        if i <= alternate_at then
-            val = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            val = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[6].component[1][i] = val
-        TONES[6].component[2][i] = val
-        TONES[6].component[3][i] = val
-        TONES[6].component[4][i] = val
-    end
-end
-
--- 1KHz 1s on, 1s off Intermittent
-local function gen_tone_7()
-    local t, dt = 0, _2_PI * 1000 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[7].component[1][i] = val
-        TONES[7].component[2][i] = val
-        TONES[7].component[3][i] = 0
-        TONES[7].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1800Hz @ 4Hz Intermittent
-local function gen_tone_8()
-    local t, dt = 0, _2_PI * 1800 / _DRATE
-
-    local off_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = 0
-
-        if i <= off_at then
-            val = math.floor(math.sin(t) * _MAX_VAL)
-            t = (t + dt) % _2_PI
-        end
-
-        TONES[8].component[1][i] = val
-        TONES[8].component[2][i] = val
-        TONES[8].component[3][i] = val
-        TONES[8].component[4][i] = val
-    end
-end
-
---#endregion
-
--- hard audio limiter
----@nodiscard
----@param output number output level
----@return number limited -128.0 to 127.0
-local function limit(output)
-    return math.max(-128, math.min(127, output))
-end
-
--- zero the alarm audio buffer
-local function zero()
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do alarm_ctl.quad_buffer[i][s] = 0 end
-    end
-end
-
--- add an alarm to the output buffer
----@param alarm_idx integer tone ID
-local function add(alarm_idx)
-    alarm_ctl.num_active = alarm_ctl.num_active + 1
-    TONES[alarm_idx].active = true
-
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do
-            alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] + TONES[alarm_idx].component[i][s])
-        end
-    end
-end
-
 -- start audio or continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 local function play()
     if not alarm_ctl.playing then
         alarm_ctl.playing = true
-        alarm_ctl.next_block = 1
-
         return sounder.continue()
-    else
-        return true
-    end
+    else return true end
 end
 
 -- initialize the annunciator alarm system
@@ -273,23 +29,10 @@ end
 function sounder.init(speaker, volume)
     alarm_ctl.speaker = speaker
     alarm_ctl.speaker.stop()
-
     alarm_ctl.volume = volume
-    alarm_ctl.playing = false
-    alarm_ctl.num_active = 0
-    alarm_ctl.next_block = 1
+    alarm_ctl.stream.stop()
 
-    zero()
-
-    -- generate tones
-    gen_tone_1()
-    gen_tone_2()
-    gen_tone_3()
-    gen_tone_4()
-    gen_tone_5()
-    gen_tone_6()
-    gen_tone_7()
-    gen_tone_8()
+    audio.generate_tones()
 end
 
 -- reconnect the speaker peripheral
@@ -297,173 +40,40 @@ end
 function sounder.reconnect(speaker)
     alarm_ctl.speaker = speaker
     alarm_ctl.playing = false
-    alarm_ctl.next_block = 1
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
+    alarm_ctl.stream.stop()
 end
 
--- check alarm state to enable/disable alarms
----@param units table|nil unit list or nil to use test mode
-function sounder.eval(units)
-    local changed = false
-    local any_active = false
-    local new_states = { false, false, false, false, false, false, false, false }
-    local alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
+-- set alarm tones
+---@param states table alarm tone commands from supervisor
+function sounder.set(states)
+    -- set tone states
+    for id = 1, #states do alarm_ctl.stream.set_active(id, states[id]) end
 
-    if units ~= nil then
-        -- check all alarms for all units
-        for i = 1, #units do
-            local unit = units[i]   ---@type ioctl_unit
-            for id = 1, #unit.alarms do
-                alarms[id] = alarms[id] or (unit.alarms[id] == ALARM_STATE.TRIPPED)
-            end
-        end
-    else
-        alarms = test_alarms
-    end
-
-    -- containment breach is worst case CRITICAL alarm, this takes priority
-    if alarms[ALARM.ContainmentBreach] then
-        new_states[T_1800Hz_Int_4Hz] = true
-    else
-        -- critical damage is highest priority CRITICAL level alarm
-        if alarms[ALARM.CriticalDamage] then
-            new_states[T_660Hz_Int_125ms] = true
-        else
-            -- EMERGENCY level alarms + URGENT over temp
-            if alarms[ALARM.ReactorDamage] or alarms[ALARM.ReactorOverTemp] or alarms[ALARM.ReactorWasteLeak] then
-                new_states[T_544Hz_440Hz_Alt] = true
-            -- URGENT level turbine trip
-            elseif alarms[ALARM.TurbineTrip] then
-                new_states[T_745Hz_Int_1Hz] = true
-            -- URGENT level reactor lost
-            elseif alarms[ALARM.ReactorLost] then
-                new_states[T_340Hz_Int_2Hz] = true
-            -- TIMELY level alarms
-            elseif alarms[ALARM.ReactorHighTemp] or alarms[ALARM.ReactorHighWaste] or alarms[ALARM.RCSTransient] then
-                new_states[T_800Hz_Int] = true
-            end
-        end
-
-        -- check RPS transient URGENT level alarm
-        if alarms[ALARM.RPSTransient] then
-            new_states[T_1000Hz_Int] = true
-            -- disable really painful audio combination
-            new_states[T_340Hz_Int_2Hz] = false
-        end
-    end
-
-    -- radiation is a big concern, always play this CRITICAL level alarm if active
-    if alarms[ALARM.ContainmentRadiation] then
-        new_states[T_800Hz_1000Hz_Alt] = true
-        -- we are going to disable the RPS trip alarm audio due to conflict, and if it was enabled
-        -- then we can re-enable the reactor lost alarm audio since it doesn't painfully combine with this one
-        if new_states[T_1000Hz_Int] and alarms[ALARM.ReactorLost] then new_states[T_340Hz_Int_2Hz] = true end
-        -- it sounds *really* bad if this is in conjunction with these other tones, so disable them
-        new_states[T_745Hz_Int_1Hz] = false
-        new_states[T_800Hz_Int] = false
-        new_states[T_1000Hz_Int] = false
-    end
-
-    -- check if any changed, check if any active, update active flags
-    for id = 1, #TONES do
-        if new_states[id] ~= TONES[id].active then
-            TONES[id].active = new_states[id]
-            changed = true
-        end
-
-        if TONES[id].active then any_active = true end
-    end
-
-    -- zero and re-add tones if changed
-    if changed then
-        zero()
-
-        for id = 1, #TONES do
-            if TONES[id].active then add(id) end
-        end
-    end
-
-    if any_active then play() else sounder.stop() end
+    -- re-compute output if needed, then play audio if available
+    if alarm_ctl.stream.is_recompute_needed() then alarm_ctl.stream.compute_buffer() end
+    if alarm_ctl.stream.any_active() then play() else sounder.stop() end
 end
 
 -- stop all audio and clear output buffer
 function sounder.stop()
     alarm_ctl.playing = false
     alarm_ctl.speaker.stop()
-    alarm_ctl.next_block = 1
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
-    zero()
+    alarm_ctl.stream.stop()
 end
 
 -- continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 function sounder.continue()
+    local success = false
+
     if alarm_ctl.playing then
-        if alarm_ctl.speaker ~= nil and #alarm_ctl.quad_buffer[alarm_ctl.next_block] > 0 then
-            local success = alarm_ctl.speaker.playAudio(alarm_ctl.quad_buffer[alarm_ctl.next_block], alarm_ctl.volume)
-
-            alarm_ctl.next_block = alarm_ctl.next_block + 1
-            if alarm_ctl.next_block > 4 then alarm_ctl.next_block = 1 end
-
-            if not success then
-                log.debug("SOUNDER: error playing audio")
-            end
-
-            return success
-        else
-            return false
-        end
-    else
-        return false
-    end
-end
-
---#region Test Functions
-
-function sounder.test_1() add(1) play() end -- play tone T_340Hz_Int_2Hz
-function sounder.test_2() add(2) play() end -- play tone T_544Hz_440Hz_Alt
-function sounder.test_3() add(3) play() end -- play tone T_660Hz_Int_125ms
-function sounder.test_4() add(4) play() end -- play tone T_745Hz_Int_1Hz
-function sounder.test_5() add(5) play() end -- play tone T_800Hz_Int
-function sounder.test_6() add(6) play() end -- play tone T_800Hz_1000Hz_Alt
-function sounder.test_7() add(7) play() end -- play tone T_1000Hz_Int
-function sounder.test_8() add(8) play() end -- play tone T_1800Hz_Int_4Hz
-
-function sounder.test_breach(active)    test_alarms[ALARM.ContainmentBreach]    = active end    ---@param active boolean
-function sounder.test_rad(active)       test_alarms[ALARM.ContainmentRadiation] = active end    ---@param active boolean
-function sounder.test_lost(active)      test_alarms[ALARM.ReactorLost]          = active end    ---@param active boolean
-function sounder.test_crit(active)      test_alarms[ALARM.CriticalDamage]       = active end    ---@param active boolean
-function sounder.test_dmg(active)       test_alarms[ALARM.ReactorDamage]        = active end    ---@param active boolean
-function sounder.test_overtemp(active)  test_alarms[ALARM.ReactorOverTemp]      = active end    ---@param active boolean
-function sounder.test_hightemp(active)  test_alarms[ALARM.ReactorHighTemp]      = active end    ---@param active boolean
-function sounder.test_wasteleak(active) test_alarms[ALARM.ReactorWasteLeak]     = active end    ---@param active boolean
-function sounder.test_highwaste(active) test_alarms[ALARM.ReactorHighWaste]     = active end    ---@param active boolean
-function sounder.test_rps(active)       test_alarms[ALARM.RPSTransient]         = active end    ---@param active boolean
-function sounder.test_rcs(active)       test_alarms[ALARM.RCSTransient]         = active end    ---@param active boolean
-function sounder.test_turbinet(active)  test_alarms[ALARM.TurbineTrip]          = active end    ---@param active boolean
-
--- power rescaling limiter test
-function sounder.test_power_scale()
-    local start = util.time_ms()
-
-    zero()
-
-    for id = 1, #TONES do
-        if TONES[id].active then
-            for i = 1, 4 do
-                for s = 1, _05s_SAMPLES do
-                    alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] +
-                        (TONES[id].component[i][s] / math.sqrt(alarm_ctl.num_active)))
-                end
-            end
+        if alarm_ctl.speaker ~= nil and alarm_ctl.stream.has_next_block() then
+            success = alarm_ctl.speaker.playAudio(alarm_ctl.stream.get_next_block(), alarm_ctl.volume)
+            if not success then log.error("SOUNDER: error playing audio") end
         end
     end
 
-    log.debug("SOUNDER: power rescale test took " .. (util.time_ms() - start) .. "ms")
+    return success
 end
 
---#endregion
-
 return sounder

coordinator/startup.lua

@@ -7,59 +7,92 @@ require("/initenv").init_env()
 local comms       = require("scada-common.comms")
 local crash       = require("scada-common.crash")
 local log         = require("scada-common.log")
+local mqueue      = require("scada-common.mqueue")
 local network     = require("scada-common.network")
 local ppm         = require("scada-common.ppm")
-local tcd         = require("scada-common.tcd")
 local util        = require("scada-common.util")
 
-local core        = require("graphics.core")
-
-local config      = require("coordinator.config")
+local configure   = require("coordinator.configure")
 local coordinator = require("coordinator.coordinator")
 local iocontrol   = require("coordinator.iocontrol")
 local renderer    = require("coordinator.renderer")
 local sounder     = require("coordinator.sounder")
+local threads     = require("coordinator.threads")
 
-local apisessions = require("coordinator.session.apisessions")
+local COORDINATOR_VERSION = "v1.4.6"
 
-local COORDINATOR_VERSION = "v0.21.2"
+local CHUNK_LOAD_DELAY_S = 30.0
 
-local println = util.println
+local println    = util.println
 local println_ts = util.println_ts
 
-local log_graphics = coordinator.log_graphics
-local log_sys = coordinator.log_sys
-local log_boot = coordinator.log_boot
-local log_comms = coordinator.log_comms
+local log_render = coordinator.log_render
+local log_sys    = coordinator.log_sys
+local log_boot   = coordinator.log_boot
+local log_comms  = coordinator.log_comms
 local log_crypto = coordinator.log_crypto
 
 ----------------------------------------
--- config validation
+-- get configuration
 ----------------------------------------
 
-local cfv = util.new_validator()
+-- mount connected devices (required for monitor setup)
+ppm.mount_all()
 
-cfv.assert_channel(config.SVR_CHANNEL)
-cfv.assert_channel(config.CRD_CHANNEL)
-cfv.assert_channel(config.PKT_CHANNEL)
-cfv.assert_type_int(config.TRUSTED_RANGE)
-cfv.assert_type_num(config.SV_TIMEOUT)
-cfv.assert_min(config.SV_TIMEOUT, 2)
-cfv.assert_type_num(config.API_TIMEOUT)
-cfv.assert_min(config.API_TIMEOUT, 2)
-cfv.assert_type_int(config.NUM_UNITS)
-cfv.assert_type_num(config.SOUNDER_VOLUME)
-cfv.assert_type_bool(config.TIME_24_HOUR)
-cfv.assert_type_str(config.LOG_PATH)
-cfv.assert_type_int(config.LOG_MODE)
+local wait_on_load = true
+local loaded, monitors = coordinator.load_config()
 
-assert(cfv.valid(), "bad config file: missing/invalid fields")
+-- if the computer just started, its chunk may have just loaded (...or the user rebooted)
+-- if monitor config failed, maybe an adjacent chunk containing all or part of a monitor has not loaded yet, so keep trying
+while wait_on_load and loaded == 2 and os.clock() < CHUNK_LOAD_DELAY_S do
+    term.clear()
+    term.setCursorPos(1, 1)
+    println("There was a monitor configuration problem at boot.\n")
+    println("Startup will keep trying every 2s in case of chunk load delays.\n")
+    println(util.sprintf("The configurator will be started in %ds if all attempts fail.\n", math.max(0, CHUNK_LOAD_DELAY_S - os.clock())))
+    println("(click to skip to the configurator)")
+
+    local timer_id = util.start_timer(2)
+
+    while true do
+        local event, param1 = util.pull_event()
+        if event == "timer" and param1 == timer_id then
+            -- remount and re-attempt
+            ppm.mount_all()
+            loaded, monitors = coordinator.load_config()
+            break
+        elseif event == "mouse_click" or event == "terminate" then
+            wait_on_load = false
+            break
+        end
+    end
+end
+
+if loaded ~= 0 then
+    -- try to reconfigure (user action)
+    local success, error = configure.configure(loaded, monitors)
+    if success then
+        loaded, monitors = coordinator.load_config()
+        if loaded ~= 0 then
+            println(util.trinary(loaded == 2, "monitor configuration invalid", "failed to load a valid configuration") .. ", please reconfigure")
+            return
+        end
+    else
+        println("configuration error: " .. error)
+        return
+    end
+end
+
+-- passed checks, good now
+---@cast monitors monitors_struct
+
+local config = coordinator.config
 
 ----------------------------------------
 -- log init
 ----------------------------------------
 
-log.init(config.LOG_PATH, config.LOG_MODE, config.LOG_DEBUG == true)
+log.init(config.LogPath, config.LogMode, config.LogDebug)
 
 log.info("========================================")
 log.info("BOOTING coordinator.startup " .. COORDINATOR_VERSION)
@@ -67,6 +100,7 @@ log.info("========================================")
 println(">> SCADA Coordinator " .. COORDINATOR_VERSION .. " <<")
 
 crash.set_env("coordinator", COORDINATOR_VERSION)
+crash.dbg_log_env()
 
 ----------------------------------------
 -- main application
@@ -77,49 +111,73 @@ local function main()
     -- system startup
     ----------------------------------------
 
-    -- mount connected devices
-    ppm.mount_all()
+    -- log mounts now since mounting was done before logging was ready
+    ppm.log_mounts()
 
     -- report versions/init fp PSIL
     iocontrol.init_fp(COORDINATOR_VERSION, comms.version)
 
-    -- setup monitors
-    local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS)
-    if not configured or monitors == nil then
-        println("startup> monitor setup failed")
-        log.fatal("monitor configuration failed")
-        return
-    end
-
     -- init renderer
+    renderer.configure(config)
     renderer.set_displays(monitors)
     renderer.init_displays()
-
-    if not renderer.validate_main_display_width() then
-        println("startup> main display must be 8 blocks wide")
-        log.fatal("main display not wide enough")
-        return
-    elseif not renderer.validate_unit_display_sizes() then
-        println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks")
-        log.fatal("unit display dimensions incorrect")
-        return
-    end
-
     renderer.init_dmesg()
 
     -- lets get started!
     log.info("monitors ready, dmesg output incoming...")
 
-    log_graphics("displays connected and reset")
+    log_render("displays connected and reset")
     log_sys("system start on " .. os.date("%c"))
     log_boot("starting " .. COORDINATOR_VERSION)
 
+    ----------------------------------------
+    -- memory allocation
+    ----------------------------------------
+
+    -- shared memory across threads
+    ---@class crd_shared_memory
+    local __shared_memory = {
+        -- time and date format for display
+        date_format = util.trinary(config.Time24Hour, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y"),
+
+        -- coordinator system state flags
+        ---@class crd_state
+        crd_state = {
+            fp_ok = false,
+            ui_ok = true,       -- default true, used to abort on fail
+            link_fail = false,
+            shutdown = false
+        },
+
+        -- core coordinator devices
+        crd_dev = {
+            speaker = ppm.get_device("speaker"),
+            modem = ppm.get_wireless_modem()
+        },
+
+        -- system objects
+        crd_sys = {
+            nic = nil,          ---@type nic
+            coord_comms = nil,  ---@type coord_comms
+            conn_watchdog = nil ---@type watchdog
+        },
+
+        -- message queues
+        q = {
+            mq_render = mqueue.new()
+        }
+    }
+
+    local smem_dev = __shared_memory.crd_dev
+    local smem_sys = __shared_memory.crd_sys
+
+    local crd_state = __shared_memory.crd_state
+
     ----------------------------------------
     -- setup alarm sounder subsystem
     ----------------------------------------
 
-    local speaker = ppm.get_device("speaker")
-    if speaker == nil then
+    if smem_dev.speaker == nil then
         log_boot("annunciator alarm speaker not found")
         println("startup> speaker not found")
         log.fatal("no annunciator alarm speaker found")
@@ -127,7 +185,7 @@ local function main()
     else
         local sounder_start = util.time_ms()
         log_boot("annunciator alarm speaker connected")
-        sounder.init(speaker, config.SOUNDER_VOLUME)
+        sounder.init(smem_dev.speaker, config.SpeakerVolume)
         log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms")
         log_sys("annunciator alarm configured")
         iocontrol.fp_has_speaker(true)
@@ -138,14 +196,13 @@ local function main()
     ----------------------------------------
 
     -- message authentication init
-    if type(config.AUTH_KEY) == "string" then
-        local init_time = network.init_mac(config.AUTH_KEY)
+    if type(config.AuthKey) == "string" and string.len(config.AuthKey) > 0 then
+        local init_time = network.init_mac(config.AuthKey)
         log_crypto("HMAC init took " .. init_time .. "ms")
     end
 
     -- get the communications modem
-    local modem = ppm.get_wireless_modem()
-    if modem == nil then
+    if smem_dev.modem == nil then
         log_comms("wireless modem not found")
         println("startup> wireless modem not found")
         log.fatal("no wireless modem on startup")
@@ -156,238 +213,54 @@ local function main()
     end
 
     -- create connection watchdog
-    local conn_watchdog = util.new_watchdog(config.SV_TIMEOUT)
-    conn_watchdog.cancel()
+    smem_sys.conn_watchdog = util.new_watchdog(config.SVR_Timeout)
+    smem_sys.conn_watchdog.cancel()
     log.debug("startup> conn watchdog created")
 
     -- create network interface then setup comms
-    local nic = network.nic(modem)
-    local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.CRD_CHANNEL, config.SVR_CHANNEL,
-                                            config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
+    smem_sys.nic = network.nic(smem_dev.modem)
+    smem_sys.coord_comms = coordinator.comms(COORDINATOR_VERSION, smem_sys.nic, smem_sys.conn_watchdog)
     log.debug("startup> comms init")
     log_comms("comms initialized")
 
-    -- base loop clock (2Hz, 10 ticks)
-    local MAIN_CLOCK = 0.5
-    local loop_clock = util.new_clock(MAIN_CLOCK)
-
     ----------------------------------------
-    -- start front panel & UI start function
+    -- start front panel
     ----------------------------------------
 
-    log_graphics("starting front panel UI...")
+    log_render("starting front panel UI...")
 
-    local fp_ok, fp_message = pcall(renderer.start_fp)
-    if not fp_ok then
-        renderer.close_fp()
-        log_graphics(util.c("front panel UI error: ", fp_message))
+    local fp_message
+    crd_state.fp_ok, fp_message = renderer.try_start_fp()
+    if not crd_state.fp_ok then
+        log_render(util.c("front panel UI error: ", fp_message))
         println_ts("front panel UI creation failed")
         log.fatal(util.c("front panel GUI render failed with error ", fp_message))
         return
-    else log_graphics("front panel ready") end
-
-    -- start up the main UI
-    ---@return boolean ui_ok started ok
-    local function start_main_ui()
-        log_graphics("starting main UI...")
-
-        local draw_start = util.time_ms()
-
-        local ui_ok, ui_message = pcall(renderer.start_ui)
-        if not ui_ok then
-            renderer.close_ui()
-            log_graphics(util.c("main UI error: ", ui_message))
-            log.fatal(util.c("main GUI render failed with error ", ui_message))
-        else
-            log_graphics("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
-        end
-
-        return ui_ok
-    end
+    else log_render("front panel ready") end
 
     ----------------------------------------
-    -- main event loop
+    -- start system
     ----------------------------------------
 
-    local link_failed = false
-    local ui_ok = true
-    local date_format = util.trinary(config.TIME_24_HOUR, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y")
+    -- init threads
+    local main_thread   = threads.thread__main(__shared_memory)
+    local render_thread = threads.thread__render(__shared_memory)
 
-    -- start clock
-    loop_clock.start()
+    log.info("startup> completed")
 
-    log_sys("system started successfully")
-
-    -- main event loop
-    while true do
-        local event, param1, param2, param3, param4, param5 = util.pull_event()
-
-        -- handle event
-        if event == "peripheral_detach" then
-            local type, device = ppm.handle_unmount(param1)
-
-            if type ~= nil and device ~= nil then
-                if type == "modem" then
-                    -- we only really care if this is our wireless modem
-                    -- if it is another modem, handle other peripheral losses separately
-                    if nic.is_modem(device) then
-                        nic.disconnect()
-                        log_sys("comms modem disconnected")
-
-                        local other_modem = ppm.get_wireless_modem()
-                        if other_modem then
-                            log_sys("found another wireless modem, using it for comms")
-                            nic.connect(other_modem)
-                        else
-                            -- close out main UI
-                            renderer.close_ui()
-
-                            -- alert user to status
-                            log_sys("awaiting comms modem reconnect...")
-
-                            iocontrol.fp_has_modem(false)
-                        end
-                    else
-                        log_sys("non-comms modem disconnected")
-                    end
-                elseif type == "monitor" then
-                    if renderer.handle_disconnect(device) then
-                        log_sys("lost a configured monitor")
-                    else
-                        log_sys("lost an unused monitor")
-                    end
-                elseif type == "speaker" then
-                    log_sys("lost alarm sounder speaker")
-                    iocontrol.fp_has_speaker(false)
-                end
-            end
-        elseif event == "peripheral" then
-            local type, device = ppm.mount(param1)
-
-            if type ~= nil and device ~= nil then
-                if type == "modem" then
-                    if device.isWireless() and not nic.is_connected() then
-                        -- reconnected modem
-                        log_sys("comms modem reconnected")
-                        nic.connect(device)
-                        iocontrol.fp_has_modem(true)
-                    elseif device.isWireless() then
-                        log.info("unused wireless modem reconnected")
-                    else
-                        log_sys("wired modem reconnected")
-                    end
-                elseif type == "monitor" then
-                    if renderer.handle_reconnect(param1, device) then
-                        log_sys(util.c("configured monitor ", param1, " reconnected"))
-                    else
-                        log_sys(util.c("unused monitor ", param1, " connected"))
-                    end
-                elseif type == "speaker" then
-                    log_sys("alarm sounder speaker reconnected")
-                    sounder.reconnect(device)
-                    iocontrol.fp_has_speaker(true)
-                end
-            end
-        elseif event == "timer" then
-            if loop_clock.is_clock(param1) then
-                -- main loop tick
-
-                -- toggle heartbeat
-                iocontrol.heartbeat()
-
-                -- maintain connection
-                if nic.is_connected() then
-                    local ok, start_ui = coord_comms.try_connect()
-                    if not ok then
-                        link_failed = true
-                        log_sys("supervisor connection failed, shutting down...")
-                        log.fatal("failed to connect to supervisor")
-                        break
-                    elseif start_ui then
-                        log_sys("supervisor connected, proceeding to main UI start")
-                        ui_ok = start_main_ui()
-                        if not ui_ok then break end
-                    end
-                end
-
-                -- iterate sessions
-                apisessions.iterate_all()
-
-                -- free any closed sessions
-                apisessions.free_all_closed()
-
-                -- update date and time string for main display
-                if coord_comms.is_linked() then
-                    iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
-                end
-
-                loop_clock.start()
-            elseif conn_watchdog.is_timer(param1) then
-                -- supervisor watchdog timeout
-                log_comms("supervisor server timeout")
-
-                -- close connection, main UI, and stop sounder
-                coord_comms.close()
-                renderer.close_ui()
-                sounder.stop()
-            else
-                -- a non-clock/main watchdog timer event
-
-                -- check API watchdogs
-                apisessions.check_all_watchdogs(param1)
-
-                -- notify timer callback dispatcher
-                tcd.handle(param1)
-            end
-        elseif event == "modem_message" then
-            -- got a packet
-            local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
-
-            -- handle then check if it was a disconnect
-            if coord_comms.handle_packet(packet) then
-                log_comms("supervisor closed connection")
-
-                -- close connection, main UI, and stop sounder
-                coord_comms.close()
-                renderer.close_ui()
-                sounder.stop()
-            end
-        elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
-               event == "mouse_drag" or event == "mouse_scroll" then
-            -- handle a mouse event
-            renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
-        elseif event == "speaker_audio_empty" then
-            -- handle speaker buffer emptied
-            sounder.continue()
-        end
-
-        -- check for termination request
-        if event == "terminate" or ppm.should_terminate() then
-            -- handle supervisor connection
-            coord_comms.try_connect(true)
-
-            if coord_comms.is_linked() then
-                log_comms("terminate requested, closing supervisor connection...")
-            else link_failed = true end
-
-            coord_comms.close()
-            log_comms("supervisor connection closed")
-
-            -- handle API sessions
-            log_comms("closing api sessions...")
-            apisessions.close_all()
-            log_comms("api sessions closed")
-            break
-        end
-    end
+    -- run threads
+    parallel.waitForAll(main_thread.p_exec, render_thread.p_exec)
 
     renderer.close_ui()
     renderer.close_fp()
     sounder.stop()
     log_sys("system shutdown")
 
-    if link_failed then println_ts("failed to connect to supervisor") end
-    if not ui_ok then println_ts("main UI creation failed") end
+    if crd_state.link_fail then println_ts("failed to connect to supervisor") end
+    if not crd_state.ui_ok then println_ts("main UI creation failed") end
+
+    -- close on error exit (such as UI error)
+    if smem_sys.coord_comms.is_linked() then smem_sys.coord_comms.close() end
 
     println_ts("exited")
     log.info("exited")

coordinator/threads.lua

@@ -0,0 +1,363 @@
+local log         = require("scada-common.log")
+local mqueue      = require("scada-common.mqueue")
+local ppm         = require("scada-common.ppm")
+local tcd         = require("scada-common.tcd")
+local util        = require("scada-common.util")
+
+local coordinator = require("coordinator.coordinator")
+local iocontrol   = require("coordinator.iocontrol")
+local renderer    = require("coordinator.renderer")
+local sounder     = require("coordinator.sounder")
+
+local apisessions = require("coordinator.session.apisessions")
+
+local core        = require("graphics.core")
+
+local log_render = coordinator.log_render
+local log_sys    = coordinator.log_sys
+local log_comms  = coordinator.log_comms
+
+local threads = {}
+
+local MAIN_CLOCK   = 0.5 -- (2Hz,   10 ticks)
+local RENDER_SLEEP = 100 -- (100ms, 2 ticks)
+
+local MQ__RENDER_CMD = {
+    START_MAIN_UI = 1
+}
+
+local MQ__RENDER_DATA = {
+    MON_CONNECT = 1,
+    MON_DISCONNECT = 2,
+    MON_RESIZE = 3
+}
+
+-- main thread
+---@nodiscard
+---@param smem crd_shared_memory
+function threads.thread__main(smem)
+    ---@class parallel_thread
+    local public = {}
+
+    -- execute thread
+    function public.exec()
+        iocontrol.fp_rt_status("main", true)
+        log.debug("main thread start")
+
+        local loop_clock = util.new_clock(MAIN_CLOCK)
+
+        -- start clock
+        loop_clock.start()
+
+        log_sys("system started successfully")
+
+        -- load in from shared memory
+        local crd_state     = smem.crd_state
+        local nic           = smem.crd_sys.nic
+        local coord_comms   = smem.crd_sys.coord_comms
+        local conn_watchdog = smem.crd_sys.conn_watchdog
+
+        -- event loop
+        while true do
+            local event, param1, param2, param3, param4, param5 = util.pull_event()
+
+            -- handle event
+            if event == "peripheral_detach" then
+                local type, device = ppm.handle_unmount(param1)
+
+                if type ~= nil and device ~= nil then
+                    if type == "modem" then
+                        -- we only really care if this is our wireless modem
+                        -- if it is another modem, handle other peripheral losses separately
+                        if nic.is_modem(device) then
+                            nic.disconnect()
+                            log_sys("comms modem disconnected")
+
+                            local other_modem = ppm.get_wireless_modem()
+                            if other_modem then
+                                log_sys("found another wireless modem, using it for comms")
+                                nic.connect(other_modem)
+                            else
+                                -- close out main UI
+                                renderer.close_ui()
+
+                                -- alert user to status
+                                log_sys("awaiting comms modem reconnect...")
+
+                                iocontrol.fp_has_modem(false)
+                            end
+                        else
+                            log_sys("non-comms modem disconnected")
+                        end
+                    elseif type == "monitor" then
+                        smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_DISCONNECT, device)
+                    elseif type == "speaker" then
+                        log_sys("lost alarm sounder speaker")
+                        iocontrol.fp_has_speaker(false)
+                    end
+                end
+            elseif event == "peripheral" then
+                local type, device = ppm.mount(param1)
+
+                if type ~= nil and device ~= nil then
+                    if type == "modem" then
+                        if device.isWireless() and not nic.is_connected() then
+                            -- reconnected modem
+                            log_sys("comms modem reconnected")
+                            nic.connect(device)
+                            iocontrol.fp_has_modem(true)
+                        elseif device.isWireless() then
+                            log.info("unused wireless modem reconnected")
+                        else
+                            log_sys("wired modem reconnected")
+                        end
+                    elseif type == "monitor" then
+                        smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_CONNECT, { name = param1, device = device })
+                    elseif type == "speaker" then
+                        log_sys("alarm sounder speaker reconnected")
+                        sounder.reconnect(device)
+                        iocontrol.fp_has_speaker(true)
+                    end
+                end
+            elseif event == "monitor_resize" then
+                smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_RESIZE, param1)
+            elseif event == "timer" then
+                if loop_clock.is_clock(param1) then
+                    -- main loop tick
+
+                    -- toggle heartbeat
+                    iocontrol.heartbeat()
+
+                    -- maintain connection
+                    if nic.is_connected() then
+                        local ok, start_ui = coord_comms.try_connect()
+                        if not ok then
+                            crd_state.link_fail = true
+                            crd_state.shutdown = true
+                            log_sys("supervisor connection failed, shutting down...")
+                            log.fatal("failed to connect to supervisor")
+                            break
+                        elseif start_ui then
+                            log_sys("supervisor connected, dispatching main UI start")
+                            smem.q.mq_render.push_command(MQ__RENDER_CMD.START_MAIN_UI)
+                        end
+                    end
+
+                    -- iterate sessions and free any closed ones
+                    apisessions.iterate_all()
+                    apisessions.free_all_closed()
+
+                    if renderer.ui_ready() then
+                        -- update clock used on main and flow monitors
+                        iocontrol.get_db().facility.ps.publish("date_time", os.date(smem.date_format))
+                    end
+
+                    loop_clock.start()
+                elseif conn_watchdog.is_timer(param1) then
+                    -- supervisor watchdog timeout
+                    log_comms("supervisor server timeout")
+
+                    -- close connection, main UI, and stop sounder
+                    coord_comms.close()
+                    renderer.close_ui()
+                    sounder.stop()
+                else
+                    -- a non-clock/main watchdog timer event
+
+                    -- check API watchdogs
+                    apisessions.check_all_watchdogs(param1)
+
+                    -- notify timer callback dispatcher
+                    tcd.handle(param1)
+                end
+            elseif event == "modem_message" then
+                -- got a packet
+                local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
+
+                -- handle then check if it was a disconnect
+                if coord_comms.handle_packet(packet) then
+                    log_comms("supervisor closed connection")
+
+                    -- close connection, main UI, and stop sounder
+                    coord_comms.close()
+                    renderer.close_ui()
+                    sounder.stop()
+                end
+            elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
+                   event == "mouse_drag" or event == "mouse_scroll" or event == "double_click" then
+                -- handle a mouse event
+                renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
+            elseif event == "speaker_audio_empty" then
+                -- handle speaker buffer emptied
+                sounder.continue()
+            end
+
+            -- check for termination request or UI crash
+            if event == "terminate" or ppm.should_terminate() then
+                crd_state.shutdown = true
+                log.info("terminate requested, main thread exiting")
+            elseif not crd_state.ui_ok then
+                crd_state.shutdown = true
+                log.info("terminating due to fatal UI error")
+            end
+
+            if crd_state.shutdown then
+                -- handle closing supervisor connection
+                coord_comms.try_connect(true)
+
+                if coord_comms.is_linked() then
+                    log_comms("closing supervisor connection...")
+                else crd_state.link_fail = true end
+
+                coord_comms.close()
+                log_comms("supervisor connection closed")
+
+                -- handle API sessions
+                log_comms("closing api sessions...")
+                apisessions.close_all()
+                log_comms("api sessions closed")
+                break
+            end
+        end
+    end
+
+    -- execute the thread in a protected mode, retrying it on return if not shutting down
+    function public.p_exec()
+        local crd_state = smem.crd_state
+
+        while not crd_state.shutdown do
+            local status, result = pcall(public.exec)
+            if status == false then
+                log.fatal(util.strval(result))
+            end
+
+            iocontrol.fp_rt_status("main", false)
+
+            -- if status is true, then we are probably exiting, so this won't matter
+            -- this thread cannot be slept because it will miss events (namely "terminate")
+            if not crd_state.shutdown then
+                log.info("main thread restarting now...")
+            end
+        end
+    end
+
+    return public
+end
+
+-- coordinator renderer thread, tasked with long duration re-draws
+---@nodiscard
+---@param smem crd_shared_memory
+function threads.thread__render(smem)
+    ---@class parallel_thread
+    local public = {}
+
+    -- execute thread
+    function public.exec()
+        iocontrol.fp_rt_status("render", true)
+        log.debug("render thread start")
+
+        -- load in from shared memory
+        local crd_state    = smem.crd_state
+        local render_queue = smem.q.mq_render
+
+        local last_update = util.time()
+
+        -- thread loop
+        while true do
+            -- check for messages in the message queue
+            while render_queue.ready() and not crd_state.shutdown do
+                local msg = render_queue.pop()
+
+                if msg ~= nil then
+                    if msg.qtype == mqueue.TYPE.COMMAND then
+                        -- received a command
+                        if msg.message == MQ__RENDER_CMD.START_MAIN_UI then
+                            -- stop the UI if it was already started
+                            -- this may occur on a quick supervisor disconnect -> connect
+                            if renderer.ui_ready() then
+                                log_render("closing main UI before executing new request to start")
+                                renderer.close_ui()
+                            end
+
+                            -- start up the main UI
+                            log_render("starting main UI...")
+
+                            local draw_start = util.time_ms()
+
+                            local ui_message
+                            crd_state.ui_ok, ui_message = renderer.try_start_ui()
+                            if not crd_state.ui_ok then
+                                log_render(util.c("main UI error: ", ui_message))
+                                log.fatal(util.c("main GUI render failed with error ", ui_message))
+                            else
+                                log_render("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
+                            end
+                        end
+                    elseif msg.qtype == mqueue.TYPE.DATA then
+                        -- received data
+                        local cmd = msg.message ---@type queue_data
+
+                        if cmd.key == MQ__RENDER_DATA.MON_CONNECT then
+                            -- monitor connected
+                            if renderer.handle_reconnect(cmd.val.name, cmd.val.device) then
+                                log_sys(util.c("configured monitor ", cmd.val.name, " reconnected"))
+                            else
+                                log_sys(util.c("unused monitor ", cmd.val.name, " connected"))
+                            end
+                        elseif cmd.key == MQ__RENDER_DATA.MON_DISCONNECT then
+                            -- monitor disconnected
+                            if renderer.handle_disconnect(cmd.val) then
+                                log_sys("lost a configured monitor")
+                            else
+                                log_sys("lost an unused monitor")
+                            end
+                        elseif cmd.key == MQ__RENDER_DATA.MON_RESIZE then
+                            -- monitor resized
+                            local is_used, is_ok = renderer.handle_resize(cmd.val)
+                            if is_used then
+                                log_sys(util.c("configured monitor ", cmd.val, " resized, ", util.trinary(is_ok, "display fits", "display does not fit")))
+                            end
+                        end
+                    elseif msg.qtype == mqueue.TYPE.PACKET then
+                        -- received a packet
+                    end
+                end
+
+                -- quick yield
+                util.nop()
+            end
+
+            -- check for termination request
+            if crd_state.shutdown then
+                log.info("render thread exiting")
+                break
+            end
+
+            -- delay before next check
+            last_update = util.adaptive_delay(RENDER_SLEEP, last_update)
+        end
+    end
+
+    -- execute the thread in a protected mode, retrying it on return if not shutting down
+    function public.p_exec()
+        local crd_state = smem.crd_state
+
+        while not crd_state.shutdown do
+            local status, result = pcall(public.exec)
+            if status == false then
+                log.fatal(util.strval(result))
+            end
+
+            iocontrol.fp_rt_status("render", false)
+
+            if not crd_state.shutdown then
+                log.info("render thread restarting in 5 seconds...")
+                util.psleep(5)
+            end
+        end
+    end
+
+    return public
+end
+
+return threads

coordinator/ui/components/boiler.lua

@@ -1,5 +1,7 @@
 local style          = require("coordinator.ui.style")
 
+local iocontrol      = require("coordinator.iocontrol")
+
 local core           = require("graphics.core")
 
 local Rectangle      = require("graphics.elements.rectangle")
@@ -18,23 +20,25 @@ local border = core.border
 ---@param y integer top left y
 ---@param ps psil ps interface
 local function new_view(root, x, y, ps)
-    local boiler = Rectangle{parent=root,border=border(1, colors.gray, true),width=31,height=7,x=x,y=y}
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
+    local db = iocontrol.get_db()
+
+    local boiler = Rectangle{parent=root,border=border(1,colors.gray,true),width=31,height=7,x=x,y=y}
 
     local status = StateIndicator{parent=boiler,x=9,y=1,states=style.boiler.states,value=1,min_width=12}
-    local temp   = DataIndicator{parent=boiler,x=5,y=3,lu_colors=lu_col,label="Temp:",unit="K",format="%10.2f",value=0,width=22,fg_bg=text_fg_bg}
-    local boil_r = DataIndicator{parent=boiler,x=5,y=4,lu_colors=lu_col,label="Boil:",unit="mB/t",format="%10.0f",value=0,commas=true,width=22,fg_bg=text_fg_bg}
+    local temp   = DataIndicator{parent=boiler,x=5,y=3,lu_colors=lu_col,label="Temp:",unit=db.temp_label,format="%10.2f",value=0,commas=true,width=22,fg_bg=text_fg}
+    local boil_r = DataIndicator{parent=boiler,x=5,y=4,lu_colors=lu_col,label="Boil:",unit="mB/t",format="%10.0f",value=0,commas=true,width=22,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
-    temp.register(ps, "temperature", temp.update)
+    temp.register(ps, "temperature", function (t) temp.update(db.temp_convert(t)) end)
     boil_r.register(ps, "boil_rate", boil_r.update)
 
-    TextBox{parent=boiler,text="H",x=2,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=boiler,text="W",x=3,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=boiler,text="S",x=27,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=boiler,text="C",x=28,y=5,height=1,width=1,fg_bg=text_fg_bg}
+    TextBox{parent=boiler,text="H",x=2,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=boiler,text="W",x=3,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=boiler,text="S",x=27,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=boiler,text="C",x=28,y=5,height=1,width=1,fg_bg=text_fg}
 
     local hcool = VerticalBar{parent=boiler,x=2,y=1,fg_bg=cpair(colors.orange,colors.gray),height=4,width=1}
     local water = VerticalBar{parent=boiler,x=3,y=1,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1}

coordinator/ui/components/imatrix.lua

@@ -9,6 +9,7 @@ local Rectangle      = require("graphics.elements.rectangle")
 local TextBox        = require("graphics.elements.textbox")
 
 local DataIndicator  = require("graphics.elements.indicators.data")
+local IndicatorLight = require("graphics.elements.indicators.light")
 local PowerIndicator = require("graphics.elements.indicators.power")
 local StateIndicator = require("graphics.elements.indicators.state")
 local VerticalBar    = require("graphics.elements.indicators.vbar")
@@ -16,7 +17,7 @@ local VerticalBar    = require("graphics.elements.indicators.vbar")
 local cpair = core.cpair
 local border = core.border
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 -- new induction matrix view
 ---@param root graphics_element parent
@@ -26,71 +27,120 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 ---@param ps psil ps interface
 ---@param id number? matrix ID
 local function new_view(root, x, y, data, ps, id)
+    local label_fg = style.theme.label_fg
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
+
+    local ind_yel = style.ind_yel
+    local ind_wht = style.ind_wht
+
     local title = "INDUCTION MATRIX"
     if type(id) == "number" then title = title .. id end
 
     local matrix = Div{parent=root,fg_bg=style.root,width=33,height=24,x=x,y=y}
 
-    TextBox{parent=matrix,text=" ",width=33,height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
-    TextBox{parent=matrix,text=title,alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.gray)}
+    -- black has low contrast with dark gray, so if background is black use white instead
+    local cutout_fg_bg = cpair(util.trinary(style.theme.bg == colors.black, colors.white, style.theme.bg), colors.gray)
+
+    TextBox{parent=matrix,text=" ",width=33,height=1,x=1,y=1,fg_bg=cutout_fg_bg}
+    TextBox{parent=matrix,text=title,alignment=ALIGN.CENTER,width=33,height=1,x=1,y=2,fg_bg=cutout_fg_bg}
 
     local rect = Rectangle{parent=matrix,border=border(1,colors.gray,true),width=33,height=22,x=1,y=3}
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local label_fg_bg = cpair(colors.gray, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
-
-    local status   = StateIndicator{parent=rect,x=10,y=1,states=style.imatrix.states,value=1,min_width=14}
-    local energy   = PowerIndicator{parent=rect,x=7,y=3,lu_colors=lu_col,label="Energy:  ",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local capacity = PowerIndicator{parent=rect,x=7,y=4,lu_colors=lu_col,label="Capacity:",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local input    = PowerIndicator{parent=rect,x=7,y=5,lu_colors=lu_col,label="Input:   ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
-    local output   = PowerIndicator{parent=rect,x=7,y=6,lu_colors=lu_col,label="Output:  ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
-
-    local avg_chg  = PowerIndicator{parent=rect,x=7,y=8,lu_colors=lu_col,label="Avg. Chg:",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local avg_in   = PowerIndicator{parent=rect,x=7,y=9,lu_colors=lu_col,label="Avg. In: ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
-    local avg_out  = PowerIndicator{parent=rect,x=7,y=10,lu_colors=lu_col,label="Avg. Out:",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
+    local status    = StateIndicator{parent=rect,x=10,y=1,states=style.imatrix.states,value=1,min_width=14}
+    local capacity  = PowerIndicator{parent=rect,x=7,y=3,lu_colors=lu_col,label="Capacity:",format="%8.2f",value=0,width=26,fg_bg=text_fg}
+    local energy    = PowerIndicator{parent=rect,x=7,y=4,lu_colors=lu_col,label="Energy:  ",format="%8.2f",value=0,width=26,fg_bg=text_fg}
+    local avg_chg   = PowerIndicator{parent=rect,x=7,y=5,lu_colors=lu_col,label="\xb7Average:",format="%8.2f",value=0,width=26,fg_bg=text_fg}
+    local input     = PowerIndicator{parent=rect,x=7,y=6,lu_colors=lu_col,label="Input:   ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local avg_in    = PowerIndicator{parent=rect,x=7,y=7,lu_colors=lu_col,label="\xb7Average:",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local output    = PowerIndicator{parent=rect,x=7,y=8,lu_colors=lu_col,label="Output:  ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local avg_out   = PowerIndicator{parent=rect,x=7,y=9,lu_colors=lu_col,label="\xb7Average:",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local trans_cap = PowerIndicator{parent=rect,x=7,y=10,lu_colors=lu_col,label="Max I/O: ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
-    energy.register(ps, "energy", function (val) energy.update(util.joules_to_fe(val)) end)
     capacity.register(ps, "max_energy", function (val) capacity.update(util.joules_to_fe(val)) end)
-    input.register(ps, "last_input", function (val) input.update(util.joules_to_fe(val)) end)
-    output.register(ps, "last_output", function (val) output.update(util.joules_to_fe(val)) end)
-
+    energy.register(ps, "energy", function (val) energy.update(util.joules_to_fe(val)) end)
     avg_chg.register(ps, "avg_charge", avg_chg.update)
+    input.register(ps, "last_input", function (val) input.update(util.joules_to_fe(val)) end)
     avg_in.register(ps, "avg_inflow", avg_in.update)
+    output.register(ps, "last_output", function (val) output.update(util.joules_to_fe(val)) end)
     avg_out.register(ps, "avg_outflow", avg_out.update)
+    trans_cap.register(ps, "transfer_cap", function (val) trans_cap.update(util.joules_to_fe(val)) end)
 
-    local fill      = DataIndicator{parent=rect,x=11,y=12,lu_colors=lu_col,label="Fill:",unit="%",format="%8.2f",value=0,width=18,fg_bg=text_fg_bg}
-
-    local cells     = DataIndicator{parent=rect,x=11,y=14,lu_colors=lu_col,label="Cells:    ",format="%7d",value=0,width=18,fg_bg=text_fg_bg}
-    local providers = DataIndicator{parent=rect,x=11,y=15,lu_colors=lu_col,label="Providers:",format="%7d",value=0,width=18,fg_bg=text_fg_bg}
-
-    TextBox{parent=rect,text="Transfer Capacity",x=11,y=17,height=1,width=17,fg_bg=label_fg_bg}
-    local trans_cap = PowerIndicator{parent=rect,x=19,y=18,lu_colors=lu_col,label="",format="%5.2f",rate=true,value=0,width=12,fg_bg=text_fg_bg}
+    local fill      = DataIndicator{parent=rect,x=11,y=12,lu_colors=lu_col,label="Fill:     ",format="%7.2f",unit="%",value=0,width=20,fg_bg=text_fg}
+    local cells     = DataIndicator{parent=rect,x=11,y=13,lu_colors=lu_col,label="Cells:    ",format="%7d",value=0,width=18,fg_bg=text_fg}
+    local providers = DataIndicator{parent=rect,x=11,y=14,lu_colors=lu_col,label="Providers:",format="%7d",value=0,width=18,fg_bg=text_fg}
 
+    fill.register(ps, "energy_fill", function (val) fill.update(val * 100) end)
     cells.register(ps, "cells", cells.update)
     providers.register(ps, "providers", providers.update)
-    fill.register(ps, "energy_fill", function (val) fill.update(val * 100) end)
-    trans_cap.register(ps, "transfer_cap", function (val) trans_cap.update(util.joules_to_fe(val)) end)
+
+    local chging = IndicatorLight{parent=rect,x=11,y=16,label="Charging",colors=ind_wht}
+    local dischg = IndicatorLight{parent=rect,x=11,y=17,label="Discharging",colors=ind_wht}
+    local max_io = IndicatorLight{parent=rect,x=11,y=18,label="Max I/O Rate",colors=ind_yel}
+
+    chging.register(ps, "is_charging", chging.update)
+    dischg.register(ps, "is_discharging", dischg.update)
+    max_io.register(ps, "at_max_io", max_io.update)
 
     local charge  = VerticalBar{parent=rect,x=2,y=2,fg_bg=cpair(colors.green,colors.gray),height=17,width=4}
     local in_cap  = VerticalBar{parent=rect,x=7,y=12,fg_bg=cpair(colors.red,colors.gray),height=7,width=1}
     local out_cap = VerticalBar{parent=rect,x=9,y=12,fg_bg=cpair(colors.blue,colors.gray),height=7,width=1}
 
-    TextBox{parent=rect,text="FILL",x=2,y=20,height=1,width=4,fg_bg=text_fg_bg}
-    TextBox{parent=rect,text="I/O",x=7,y=20,height=1,width=3,fg_bg=text_fg_bg}
+    TextBox{parent=rect,text="FILL I/O",x=2,y=20,height=1,width=8,fg_bg=label_fg}
 
     local function calc_saturation(val)
         if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then
             return val / data.build.transfer_cap
-        else
-            return 0
-        end
+        else return 0 end
     end
 
     charge.register(ps, "energy_fill", charge.update)
     in_cap.register(ps, "last_input", function (val) in_cap.update(calc_saturation(val)) end)
     out_cap.register(ps, "last_output", function (val) out_cap.update(calc_saturation(val)) end)
+
+    local eta = TextBox{parent=rect,x=11,y=20,width=20,height=1,text="ETA Unknown",alignment=ALIGN.CENTER,fg_bg=style.theme.field_box}
+
+    eta.register(ps, "eta_ms", function (eta_ms)
+        local str, pre = "", util.trinary(eta_ms >= 0, "Full in ", "Empty in ")
+
+        local seconds = math.abs(eta_ms) / 1000
+        local minutes = seconds / 60
+        local hours   = minutes / 60
+        local days    = hours / 24
+
+        if math.abs(eta_ms) < 1000 or (eta_ms ~= eta_ms) then
+            -- really small or NaN
+            str = "No ETA"
+        elseif days < 1000 then
+            days    = math.floor(days)
+            hours   = math.floor(hours % 24)
+            minutes = math.floor(minutes % 60)
+            seconds = math.floor(seconds % 60)
+
+            if days > 0 then
+                str = days .. "d"
+            elseif hours > 0 then
+                str = hours .. "h " .. minutes .. "m"
+            elseif minutes > 0 then
+                str = minutes .. "m " .. seconds .. "s"
+            elseif seconds > 0 then
+                str = seconds .. "s"
+            end
+
+            str = pre .. str
+        else
+            local years = math.floor(days / 365.25)
+
+            if years <= 99999999 then
+                str = pre .. years .. "y"
+            else
+                str = pre .. "eras"
+            end
+        end
+
+        eta.set_value(str)
+    end)
 end
 
 return new_view

coordinator/ui/components/pkt_entry.lua

@@ -4,6 +4,8 @@
 
 local iocontrol     = require("coordinator.iocontrol")
 
+local style         = require("coordinator.ui.style")
+
 local core          = require("graphics.core")
 
 local Div           = require("graphics.elements.div")
@@ -11,7 +13,7 @@ local TextBox       = require("graphics.elements.textbox")
 
 local DataIndicator = require("graphics.elements.indicators.data")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 
@@ -19,26 +21,31 @@ local cpair = core.cpair
 ---@param parent graphics_element parent
 ---@param id integer PKT session ID
 local function init(parent, id)
+    local s_hi_box = style.fp_theme.highlight_box
+    local s_hi_bright = style.fp_theme.highlight_box_bright
+
+    local label_fg = style.fp.label_fg
+
     local ps = iocontrol.get_db().fp.ps
 
     -- root div
     local root = Div{parent=parent,x=2,y=2,height=4,width=parent.get_width()-2,hidden=true}
-    local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=cpair(colors.black,colors.white)}
+    local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=s_hi_bright}
 
     local ps_prefix = "pkt_" .. id .. "_"
 
-    TextBox{parent=entry,x=1,y=1,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
-    local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=TEXT_ALIGN.CENTER,width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray),nav_active=cpair(colors.gray,colors.black)}
-    TextBox{parent=entry,x=1,y=3,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
+    TextBox{parent=entry,x=1,y=1,text="",width=8,height=1,fg_bg=s_hi_box}
+    local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=ALIGN.CENTER,width=8,height=1,fg_bg=s_hi_box,nav_active=cpair(colors.gray,colors.black)}
+    TextBox{parent=entry,x=1,y=3,text="",width=8,height=1,fg_bg=s_hi_box}
     pkt_addr.register(ps, ps_prefix .. "addr", pkt_addr.set_value)
 
     TextBox{parent=entry,x=10,y=2,text="FW:",width=3,height=1}
-    local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,height=1,fg_bg=label_fg}
     pkt_fw_v.register(ps, ps_prefix .. "fw", pkt_fw_v.set_value)
 
     TextBox{parent=entry,x=35,y=2,text="RTT:",width=4,height=1}
-    local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=cpair(colors.lightGray,colors.white)}
-    TextBox{parent=entry,x=46,y=2,text="ms",width=4,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=label_fg}
+    TextBox{parent=entry,x=46,y=2,text="ms",width=4,height=1,fg_bg=label_fg}
     pkt_rtt.register(ps, ps_prefix .. "rtt", pkt_rtt.update)
     pkt_rtt.register(ps, ps_prefix .. "rtt_color", pkt_rtt.recolor)
 

coordinator/ui/components/process_ctl.lua

@@ -23,11 +23,13 @@ local HazardButton      = require("graphics.elements.controls.hazard_button")
 local RadioButton       = require("graphics.elements.controls.radio_button")
 local SpinboxNumeric    = require("graphics.elements.controls.spinbox_numeric")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 local border = core.border
 
+local bw_fg_bg = style.bw_fg_bg
+
 local period = core.flasher.PERIOD
 
 -- new process control view
@@ -35,16 +37,28 @@ local period = core.flasher.PERIOD
 ---@param x integer top left x
 ---@param y integer top left y
 local function new_view(root, x, y)
+    local s_hi_box = style.theme.highlight_box
+    local s_field = style.theme.field_box
+
+    local lu_cpair = style.lu_colors
+    local hzd_fg_bg  = style.hzd_fg_bg
+    local dis_colors = style.dis_colors
+    local arrow_fg_bg = cpair(style.theme.label, s_hi_box.bkg)
+
+    local ind_grn = style.ind_grn
+    local ind_yel = style.ind_yel
+    local ind_red = style.ind_red
+    local ind_wht = style.ind_wht
+
     assert(root.get_height() >= (y + 24), "main display not of sufficient vertical resolution (add an additional row of monitors)")
 
+    local black = cpair(colors.black, colors.black)
+    local blk_brn = cpair(colors.black, colors.brown)
+    local blk_pur = cpair(colors.black, colors.purple)
+
     local facility = iocontrol.get_db().facility
     local units = iocontrol.get_db().units
 
-    local bw_fg_bg   = cpair(colors.black, colors.white)
-    local hzd_fg_bg  = cpair(colors.white, colors.gray)
-    local lu_cpair   = cpair(colors.gray, colors.gray)
-    local dis_colors = cpair(colors.white, colors.lightGray)
-
     local main = Div{parent=root,width=128,height=24,x=x,y=y}
 
     local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
@@ -53,10 +67,10 @@ local function new_view(root, x, y)
     facility.scram_ack = scram.on_response
     facility.ack_alarms_ack = ack_a.on_response
 
-    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=cpair(colors.green,colors.red)}
-    local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
-    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=cpair(colors.green,colors.gray)}
-    local sps     = IndicatorLight{parent=main,label="SPS Connected",colors=cpair(colors.green,colors.gray)}
+    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=ind_grn}
+    local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=style.ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd}
+    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=ind_grn}
+    local sps     = IndicatorLight{parent=main,label="SPS Connected",colors=ind_grn}
 
     all_ok.register(facility.ps, "all_sys_ok", all_ok.update)
     rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update)
@@ -65,10 +79,10 @@ local function new_view(root, x, y)
 
     main.line_break()
 
-    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=cpair(colors.green,colors.red)}
-    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=cpair(colors.green,colors.gray)}
-    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=cpair(colors.yellow,colors.gray)}
+    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=ind_grn}
+    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=ind_grn}
+    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=ind_wht,flash=true,period=period.BLINK_250_MS}
+    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=ind_yel}
 
     auto_ready.register(facility.ps, "auto_ready", auto_ready.update)
     auto_act.register(facility.ps, "auto_active", auto_act.update)
@@ -77,12 +91,12 @@ local function new_view(root, x, y)
 
     main.line_break()
 
-    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=ind_red,flash=true,period=period.BLINK_500_MS}
+    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
 
     auto_scram.register(facility.ps, "auto_scram", auto_scram.update)
     matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update)
@@ -92,11 +106,11 @@ local function new_view(root, x, y)
     gen_fault.register(facility.ps, "as_gen_fault", gen_fault.update)
 
     TextBox{parent=main,y=23,text="Radiation",height=1,width=13,fg_bg=style.label}
-    local radiation = RadIndicator{parent=main,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local radiation = RadIndicator{parent=main,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     radiation.register(facility.ps, "radiation", radiation.update)
 
     TextBox{parent=main,x=15,y=23,text="Linked RTUs",height=1,width=11,fg_bg=style.label}
-    local rtu_count = DataIndicator{parent=main,x=15,y=24,label="",format="%11d",value=0,lu_colors=lu_cpair,width=11,fg_bg=bw_fg_bg}
+    local rtu_count = DataIndicator{parent=main,x=15,y=24,label="",format="%11d",value=0,lu_colors=lu_cpair,width=11,fg_bg=s_field}
     rtu_count.register(facility.ps, "rtu_count", rtu_count.update)
 
     ---------------------
@@ -111,35 +125,35 @@ local function new_view(root, x, y)
 
     local targets = Div{parent=proc,width=31,height=24,x=1,y=1}
 
-    local burn_tag = Div{parent=targets,x=1,y=1,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
+    local burn_tag = Div{parent=targets,x=1,y=1,width=8,height=4,fg_bg=blk_pur}
     TextBox{parent=burn_tag,x=2,y=2,text="Burn Target",width=7,height=2}
 
-    local burn_target = Div{parent=targets,x=9,y=1,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local b_target = SpinboxNumeric{parent=burn_target,x=11,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=burn_target,x=18,y=2,text="mB/t"}
-    local burn_sum = DataIndicator{parent=targets,x=9,y=4,label="",format="%18.1f",value=0,unit="mB/t",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
+    local burn_target = Div{parent=targets,x=9,y=1,width=23,height=3,fg_bg=s_hi_box}
+    local b_target = SpinboxNumeric{parent=burn_target,x=11,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=burn_target,x=18,y=2,text="mB/t",fg_bg=style.theme.label_fg}
+    local burn_sum = DataIndicator{parent=targets,x=9,y=4,label="",format="%18.1f",value=0,unit="mB/t",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
 
     b_target.register(facility.ps, "process_burn_target", b_target.set_value)
     burn_sum.register(facility.ps, "burn_sum", burn_sum.update)
 
-    local chg_tag = Div{parent=targets,x=1,y=6,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
+    local chg_tag = Div{parent=targets,x=1,y=6,width=8,height=4,fg_bg=blk_pur}
     TextBox{parent=chg_tag,x=2,y=2,text="Charge Target",width=7,height=2}
 
-    local chg_target = Div{parent=targets,x=9,y=6,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local c_target = SpinboxNumeric{parent=chg_target,x=2,y=1,whole_num_precision=15,fractional_precision=0,min=0,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=chg_target,x=18,y=2,text="MFE"}
-    local cur_charge = DataIndicator{parent=targets,x=9,y=9,label="",format="%19d",value=0,unit="MFE",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
+    local chg_target = Div{parent=targets,x=9,y=6,width=23,height=3,fg_bg=s_hi_box}
+    local c_target = SpinboxNumeric{parent=chg_target,x=2,y=1,whole_num_precision=15,fractional_precision=0,min=0,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=chg_target,x=18,y=2,text="MFE",fg_bg=style.theme.label_fg}
+    local cur_charge = DataIndicator{parent=targets,x=9,y=9,label="",format="%19d",value=0,unit="MFE",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
 
     c_target.register(facility.ps, "process_charge_target", c_target.set_value)
-    cur_charge.register(facility.induction_ps_tbl[1], "energy", function (j) cur_charge.update(util.joules_to_fe(j) / 1000000) end)
+    cur_charge.register(facility.induction_ps_tbl[1], "avg_charge", function (fe) cur_charge.update(fe / 1000000) end)
 
-    local gen_tag = Div{parent=targets,x=1,y=11,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
+    local gen_tag = Div{parent=targets,x=1,y=11,width=8,height=4,fg_bg=blk_pur}
     TextBox{parent=gen_tag,x=2,y=2,text="Gen. Target",width=7,height=2}
 
-    local gen_target = Div{parent=targets,x=9,y=11,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local g_target = SpinboxNumeric{parent=gen_target,x=8,y=1,whole_num_precision=9,fractional_precision=0,min=0,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=gen_target,x=18,y=2,text="kFE/t"}
-    local cur_gen = DataIndicator{parent=targets,x=9,y=14,label="",format="%17d",value=0,unit="kFE/t",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
+    local gen_target = Div{parent=targets,x=9,y=11,width=23,height=3,fg_bg=s_hi_box}
+    local g_target = SpinboxNumeric{parent=gen_target,x=8,y=1,whole_num_precision=9,fractional_precision=0,min=0,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=gen_target,x=18,y=2,text="kFE/t",fg_bg=style.theme.label_fg}
+    local cur_gen = DataIndicator{parent=targets,x=9,y=14,label="",format="%17d",value=0,unit="kFE/t",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
 
     g_target.register(facility.ps, "process_gen_target", g_target.set_value)
     cur_gen.register(facility.induction_ps_tbl[1], "last_input", function (j) cur_gen.update(util.round(util.joules_to_fe(j) / 1000)) end)
@@ -154,18 +168,18 @@ local function new_view(root, x, y)
 
     for i = 1, 4 do
         local unit
-        local tag_fg_bg = cpair(colors.gray,colors.white)
-        local lim_fg_bg = cpair(colors.lightGray,colors.white)
-        local ctl_fg    = colors.lightGray
-        local cur_fg_bg = cpair(colors.lightGray,colors.white)
-        local cur_lu    = colors.lightGray
+        local tag_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local lim_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local label_fg  = style.theme.disabled_fg
+        local cur_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local cur_lu    = style.theme.disabled
 
         if i <= facility.num_units then
             unit = units[i]   ---@type ioctl_unit
-            tag_fg_bg = cpair(colors.black,colors.lightBlue)
-            lim_fg_bg = bw_fg_bg
-            ctl_fg    = colors.gray
-            cur_fg_bg = cpair(colors.black,colors.brown)
+            tag_fg_bg = cpair(colors.black, colors.lightBlue)
+            lim_fg_bg = s_hi_box
+            label_fg  = style.theme.label_fg
+            cur_fg_bg = blk_brn
             cur_lu    = colors.black
         end
 
@@ -174,9 +188,9 @@ local function new_view(root, x, y)
         local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2}
 
-        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(ctl_fg,colors.white)}
-        local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=lim_fg_bg}
-        TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1}
+        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=s_hi_box}
+        local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled,fg_bg=lim_fg_bg}
+        TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1,fg_bg=label_fg}
 
         local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(cur_lu,cur_lu),width=14,fg_bg=cur_fg_bg}
 
@@ -198,14 +212,14 @@ local function new_view(root, x, y)
     local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6}
 
     for i = 1, 4 do
-        local tag_fg_bg = cpair(colors.gray,colors.white)
-        local ind_fg_bg = cpair(colors.lightGray,colors.white)
-        local ind_off = colors.lightGray
+        local tag_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local ind_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local ind_off = style.theme.disabled
 
         if i <= facility.num_units then
-            tag_fg_bg = cpair(colors.black,colors.cyan)
-            ind_fg_bg = bw_fg_bg
-            ind_off = colors.gray
+            tag_fg_bg = cpair(colors.black, colors.cyan)
+            ind_fg_bg = cpair(style.theme.text, s_hi_box.bkg)
+            ind_off = style.ind_hi_box_bg
         end
 
         local _y = ((i - 1) * 5) + 1
@@ -214,8 +228,8 @@ local function new_view(root, x, y)
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2}
 
         local lights   = Div{parent=stat_div,x=9,y=_y,width=14,height=4,fg_bg=ind_fg_bg}
-        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,ind_off)}
-        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,ind_off),flash=true,period=period.BLINK_250_MS}
+        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(ind_grn.fgd,ind_off)}
+        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(ind_red.fgd,ind_off),flash=true,period=period.BLINK_250_MS}
 
         if i <= facility.num_units then
             local unit = units[i]   ---@type ioctl_unit
@@ -230,18 +244,18 @@ local function new_view(root, x, y)
     -------------------------
 
     local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" }
-    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.purple}
+    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.purple}
 
     mode.register(facility.ps, "process_mode", mode.set_value)
 
     local u_stat = Rectangle{parent=proc,border=border(1,colors.gray,true),thin=true,width=31,height=4,x=1,y=16,fg_bg=bw_fg_bg}
-    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=31,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=bw_fg_bg}
-    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=31,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.gray, colors.white)}
+    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=31,height=1,alignment=ALIGN.CENTER,fg_bg=bw_fg_bg}
+    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=31,height=1,alignment=ALIGN.CENTER,fg_bg=cpair(colors.gray,colors.white)}
 
     stat_line_1.register(facility.ps, "status_line_1", stat_line_1.set_value)
     stat_line_2.register(facility.ps, "status_line_2", stat_line_2.set_value)
 
-    local auto_controls = Div{parent=proc,x=1,y=20,width=31,height=5,fg_bg=cpair(colors.gray,colors.white)}
+    local auto_controls = Div{parent=proc,x=1,y=20,width=31,height=5,fg_bg=s_hi_box}
 
     -- save the automatic process control configuration without starting
     local function _save_cfg()
@@ -307,7 +321,7 @@ local function new_view(root, x, y)
         local unit = units[i]   ---@type ioctl_unit
 
         TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8,height=1}
-        local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=cpair(colors.white,colors.gray)}
+        local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=ind_wht}
         local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6}
 
         a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update)
@@ -316,40 +330,36 @@ local function new_view(root, x, y)
 
     local waste_sel = Div{parent=proc,width=21,height=24,x=81,y=1}
 
-    TextBox{parent=waste_sel,text=" ",width=21,height=1,x=1,y=1,fg_bg=cpair(colors.black,colors.brown)}
-    TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=TEXT_ALIGN.CENTER,width=21,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.brown)}
+    local cutout_fg_bg = cpair(style.theme.bg, colors.brown)
+
+    TextBox{parent=waste_sel,text=" ",width=21,height=1,x=1,y=1,fg_bg=cutout_fg_bg}
+    TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=ALIGN.CENTER,width=21,height=1,x=1,y=2,fg_bg=cutout_fg_bg}
 
     local rect   = Rectangle{parent=waste_sel,border=border(1,colors.brown,true),width=21,height=22,x=1,y=3}
     local status = StateIndicator{parent=rect,x=2,y=1,states=style.waste.states,value=1,min_width=17}
 
     status.register(facility.ps, "current_waste_product", status.update)
 
-    local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.brown}
-    local pu_fallback = Checkbox{parent=rect,x=2,y=7,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.green,colors.black)}
+    local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.brown}
 
     waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value)
-    pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
 
-    local fb_active  = IndicatorLight{parent=rect,x=2,y=9,label="Fallback Active",colors=cpair(colors.white,colors.gray)}
+    local fb_active = IndicatorLight{parent=rect,x=2,y=7,label="Fallback Active",colors=ind_wht}
+    local sps_disabled  = IndicatorLight{parent=rect,x=2,y=8,label="SPS Disabled LC",colors=ind_yel}
 
     fb_active.register(facility.ps, "pu_fallback_active", fb_active.update)
+    sps_disabled.register(facility.ps, "sps_disabled_low_power", sps_disabled.update)
 
-    TextBox{parent=rect,x=2,y=11,text="Plutonium Rate",height=1,width=17,fg_bg=style.label}
-    local pu_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+    local pu_fallback = Checkbox{parent=rect,x=2,y=10,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.brown,style.theme.checkbox_bg)}
 
-    TextBox{parent=rect,x=2,y=14,text="Polonium Rate",height=1,width=17,fg_bg=style.label}
-    local po_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+    TextBox{parent=rect,x=2,y=12,height=3,text="Switch to Pu when SNAs cannot keep up with waste.",fg_bg=style.label}
 
-    TextBox{parent=rect,x=2,y=17,text="Antimatter Rate",height=1,width=17,fg_bg=style.label}
-    local am_rate = DataIndicator{parent=rect,x=2,label="",unit="\xb5B/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+    local lc_sps = Checkbox{parent=rect,x=2,y=16,label="Low Charge SPS",callback=process.set_sps_low_power,box_fg_bg=cpair(colors.brown,style.theme.checkbox_bg)}
 
-    pu_rate.register(facility.ps, "pu_rate", pu_rate.update)
-    po_rate.register(facility.ps, "po_rate", po_rate.update)
-    am_rate.register(facility.ps, "am_rate", am_rate.update)
+    TextBox{parent=rect,x=2,y=18,height=3,text="Use SPS at low charge, otherwise switches to Po.",fg_bg=style.label}
 
-    local sna_count = DataIndicator{parent=rect,x=2,y=20,label="Linked SNAs:",format="%4d",value=0,lu_colors=lu_cpair,width=17}
-
-    sna_count.register(facility.ps, "sna_count", sna_count.update)
+    pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
+    lc_sps.register(facility.ps, "process_sps_low_power", lc_sps.set_value)
 end
 
 return new_view

coordinator/ui/components/reactor.lua

@@ -1,5 +1,7 @@
 local types          = require("scada-common.types")
 
+local iocontrol      = require("coordinator.iocontrol")
+
 local style          = require("coordinator.ui.style")
 
 local core           = require("graphics.core")
@@ -20,29 +22,31 @@ local border = core.border
 ---@param y integer top left y
 ---@param ps psil ps interface
 local function new_view(root, x, y, ps)
-    local reactor = Rectangle{parent=root,border=border(1, colors.gray, true),width=30,height=7,x=x,y=y}
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
+    local db = iocontrol.get_db()
+
+    local reactor = Rectangle{parent=root,border=border(1,colors.gray,true),width=30,height=7,x=x,y=y}
 
     local status    = StateIndicator{parent=reactor,x=6,y=1,states=style.reactor.states,value=1,min_width=16}
-    local core_temp = DataIndicator{parent=reactor,x=2,y=3,lu_colors=lu_col,label="Core Temp:",unit="K",format="%10.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local burn_r    = DataIndicator{parent=reactor,x=2,y=4,lu_colors=lu_col,label="Burn Rate:",unit="mB/t",format="%10.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local heating_r = DataIndicator{parent=reactor,x=2,y=5,lu_colors=lu_col,label="Heating:",unit="mB/t",format="%12.0f",value=0,commas=true,width=26,fg_bg=text_fg_bg}
+    local core_temp = DataIndicator{parent=reactor,x=2,y=3,lu_colors=lu_col,label="Core Temp:",unit=db.temp_label,format="%10.2f",value=0,commas=true,width=26,fg_bg=text_fg}
+    local burn_r    = DataIndicator{parent=reactor,x=2,y=4,lu_colors=lu_col,label="Burn Rate:",unit="mB/t",format="%10.2f",value=0,width=26,fg_bg=text_fg}
+    local heating_r = DataIndicator{parent=reactor,x=2,y=5,lu_colors=lu_col,label="Heating:",unit="mB/t",format="%12.0f",value=0,commas=true,width=26,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
-    core_temp.register(ps, "temp", core_temp.update)
+    core_temp.register(ps, "temp", function (t) core_temp.update(db.temp_convert(t)) end)
     burn_r.register(ps, "act_burn_rate", burn_r.update)
     heating_r.register(ps, "heating_rate", heating_r.update)
 
     local reactor_fills = Rectangle{parent=root,border=border(1, colors.gray, true),width=24,height=7,x=(x + 29),y=y}
 
-    TextBox{parent=reactor_fills,text="FUEL",x=2,y=1,height=1,fg_bg=text_fg_bg}
-    TextBox{parent=reactor_fills,text="COOL",x=2,y=2,height=1,fg_bg=text_fg_bg}
-    TextBox{parent=reactor_fills,text="HCOOL",x=2,y=4,height=1,fg_bg=text_fg_bg}
-    TextBox{parent=reactor_fills,text="WASTE",x=2,y=5,height=1,fg_bg=text_fg_bg}
+    TextBox{parent=reactor_fills,text="FUEL",x=2,y=1,height=1,fg_bg=text_fg}
+    TextBox{parent=reactor_fills,text="COOL",x=2,y=2,height=1,fg_bg=text_fg}
+    TextBox{parent=reactor_fills,text="HCOOL",x=2,y=4,height=1,fg_bg=text_fg}
+    TextBox{parent=reactor_fills,text="WASTE",x=2,y=5,height=1,fg_bg=text_fg}
 
-    local fuel  = HorizontalBar{parent=reactor_fills,x=8,y=1,show_percent=true,bar_fg_bg=cpair(colors.black,colors.gray),height=1,width=14}
+    local fuel  = HorizontalBar{parent=reactor_fills,x=8,y=1,show_percent=true,bar_fg_bg=cpair(style.theme.fuel_color,colors.gray),height=1,width=14}
     local ccool = HorizontalBar{parent=reactor_fills,x=8,y=2,show_percent=true,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=14}
     local hcool = HorizontalBar{parent=reactor_fills,x=8,y=4,show_percent=true,bar_fg_bg=cpair(colors.white,colors.gray),height=1,width=14}
     local waste = HorizontalBar{parent=reactor_fills,x=8,y=5,show_percent=true,bar_fg_bg=cpair(colors.brown,colors.gray),height=1,width=14}

coordinator/ui/components/turbine.lua

@@ -21,24 +21,24 @@ local border = core.border
 ---@param y integer top left y
 ---@param ps psil ps interface
 local function new_view(root, x, y, ps)
-    local turbine = Rectangle{parent=root,border=border(1, colors.gray, true),width=23,height=7,x=x,y=y}
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
+    local turbine = Rectangle{parent=root,border=border(1,colors.gray,true),width=23,height=7,x=x,y=y}
 
     local status    = StateIndicator{parent=turbine,x=7,y=1,states=style.turbine.states,value=1,min_width=12}
-    local prod_rate = PowerIndicator{parent=turbine,x=5,y=3,lu_colors=lu_col,label="",format="%10.2f",value=0,rate=true,width=16,fg_bg=text_fg_bg}
-    local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg}
+    local prod_rate = PowerIndicator{parent=turbine,x=5,y=3,lu_colors=lu_col,label="",format="%10.2f",value=0,rate=true,width=16,fg_bg=text_fg}
+    local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
     prod_rate.register(ps, "prod_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end)
-    flow_rate.register(ps, "flow_rate", flow_rate.update)
+    flow_rate.register(ps, "steam_input_rate", flow_rate.update)
 
     local steam  = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
     local energy = VerticalBar{parent=turbine,x=3,y=1,fg_bg=cpair(colors.green,colors.gray),height=4,width=1}
 
-    TextBox{parent=turbine,text="S",x=2,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=turbine,text="E",x=3,y=5,height=1,width=1,fg_bg=text_fg_bg}
+    TextBox{parent=turbine,text="S",x=2,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=turbine,text="E",x=3,y=5,height=1,width=1,fg_bg=text_fg}
 
     steam.register(ps, "steam_fill", steam.update)
     energy.register(ps, "energy_fill", energy.update)

coordinator/ui/components/unit_detail.lua

@@ -2,6 +2,9 @@
 -- Reactor Unit SCADA Coordinator GUI
 --
 
+local types             = require("scada-common.types")
+local util              = require("scada-common.util")
+
 local iocontrol         = require("coordinator.iocontrol")
 
 local style             = require("coordinator.ui.style")
@@ -26,19 +29,39 @@ local PushButton        = require("graphics.elements.controls.push_button")
 local RadioButton       = require("graphics.elements.controls.radio_button")
 local SpinboxNumeric    = require("graphics.elements.controls.spinbox_numeric")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 local border = core.border
 
+local bw_fg_bg = style.bw_fg_bg
+local gry_wht = style.gray_white
+
 local period = core.flasher.PERIOD
 
 -- create a unit view
 ---@param parent graphics_element parent
 ---@param id integer
 local function init(parent, id)
-    local unit = iocontrol.get_db().units[id]   ---@type ioctl_unit
-    local f_ps = iocontrol.get_db().facility.ps
+    local s_hi_box = style.theme.highlight_box
+    local s_hi_bright = style.theme.highlight_box_bright
+    local s_field = style.theme.field_box
+
+    local hc_text = style.hc_text
+    local lu_cpair = style.lu_colors
+    local hzd_fg_bg = style.hzd_fg_bg
+    local dis_colors = style.dis_colors
+    local arrow_fg_bg = cpair(style.theme.label, s_hi_box.bkg)
+
+    local ind_bkg = style.ind_bkg
+    local ind_grn = style.ind_grn
+    local ind_yel = style.ind_yel
+    local ind_red = style.ind_red
+    local ind_wht = style.ind_wht
+
+    local db = iocontrol.get_db()
+    local unit = db.units[id]   ---@type ioctl_unit
+    local f_ps = db.facility.ps
 
     local main = Div{parent=parent,x=1,y=1}
 
@@ -48,11 +71,7 @@ local function init(parent, id)
     local b_ps = unit.boiler_ps_tbl
     local t_ps = unit.turbine_ps_tbl
 
-    TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
-
-    local bw_fg_bg  = cpair(colors.black, colors.white)
-    local hzd_fg_bg = cpair(colors.white, colors.gray)
-    local lu_cpair  = cpair(colors.gray, colors.gray)
+    TextBox{parent=main,text="Reactor Unit #" .. id,alignment=ALIGN.CENTER,height=1,fg_bg=style.theme.header}
 
     -----------------------------
     -- main stats and core map --
@@ -63,11 +82,11 @@ local function init(parent, id)
     core_map.register(u_ps, "size", function (s) core_map.resize(s[1], s[2]) end)
 
     TextBox{parent=main,x=12,y=22,text="Heating Rate",height=1,width=12,fg_bg=style.label}
-    local heating_r = DataIndicator{parent=main,x=12,label="",format="%14.0f",value=0,unit="mB/t",commas=true,lu_colors=lu_cpair,width=19,fg_bg=bw_fg_bg}
+    local heating_r = DataIndicator{parent=main,x=12,label="",format="%14.0f",value=0,unit="mB/t",commas=true,lu_colors=lu_cpair,width=19,fg_bg=s_field}
     heating_r.register(u_ps, "heating_rate", heating_r.update)
 
     TextBox{parent=main,x=12,y=25,text="Commanded Burn Rate",height=1,width=19,fg_bg=style.label}
-    local burn_r = DataIndicator{parent=main,x=12,label="",format="%14.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=19,fg_bg=bw_fg_bg}
+    local burn_r = DataIndicator{parent=main,x=12,label="",format="%14.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=19,fg_bg=s_field}
     burn_r.register(u_ps, "burn_rate", burn_r.update)
 
     TextBox{parent=main,text="F",x=2,y=22,width=1,height=1,fg_bg=style.label}
@@ -77,7 +96,7 @@ local function init(parent, id)
     TextBox{parent=main,text="H",x=8,y=22,width=1,height=1,fg_bg=style.label}
     TextBox{parent=main,text="W",x=10,y=22,width=1,height=1,fg_bg=style.label}
 
-    local fuel  = VerticalBar{parent=main,x=2,y=23,fg_bg=cpair(colors.black,colors.gray),height=4,width=1}
+    local fuel  = VerticalBar{parent=main,x=2,y=23,fg_bg=cpair(style.theme.fuel_color,colors.gray),height=4,width=1}
     local ccool = VerticalBar{parent=main,x=4,y=23,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1}
     local hcool = VerticalBar{parent=main,x=8,y=23,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
     local waste = VerticalBar{parent=main,x=10,y=23,fg_bg=cpair(colors.brown,colors.gray),height=4,width=1}
@@ -88,7 +107,7 @@ local function init(parent, id)
     waste.register(u_ps, "waste_fill", waste.update)
 
     ccool.register(u_ps, "ccool_type", function (type)
-        if type == "mekanism:sodium" then
+        if type == types.FLUID.SODIUM then
             ccool.recolor(cpair(colors.lightBlue, colors.gray))
         else
             ccool.recolor(cpair(colors.blue, colors.gray))
@@ -96,7 +115,7 @@ local function init(parent, id)
     end)
 
     hcool.register(u_ps, "hcool_type", function (type)
-        if type == "mekanism:superheated_sodium" then
+        if type == types.FLUID.SUPERHEATED_SODIUM then
             hcool.recolor(cpair(colors.orange, colors.gray))
         else
             hcool.recolor(cpair(colors.white, colors.gray))
@@ -104,19 +123,20 @@ local function init(parent, id)
     end)
 
     TextBox{parent=main,x=32,y=22,text="Core Temp",height=1,width=9,fg_bg=style.label}
-    local core_temp = DataIndicator{parent=main,x=32,label="",format="%11.2f",value=0,unit="K",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
-    core_temp.register(u_ps, "temp", core_temp.update)
+    local fmt = util.trinary(string.len(db.temp_label) == 2, "%10.2f", "%11.2f")
+    local core_temp = DataIndicator{parent=main,x=32,label="",format=fmt,value=0,commas=true,unit=db.temp_label,lu_colors=lu_cpair,width=13,fg_bg=s_field}
+    core_temp.register(u_ps, "temp", function (t) core_temp.update(db.temp_convert(t)) end)
 
     TextBox{parent=main,x=32,y=25,text="Burn Rate",height=1,width=9,fg_bg=style.label}
-    local act_burn_r = DataIndicator{parent=main,x=32,label="",format="%8.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local act_burn_r = DataIndicator{parent=main,x=32,label="",format="%8.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     act_burn_r.register(u_ps, "act_burn_rate", act_burn_r.update)
 
     TextBox{parent=main,x=32,y=28,text="Damage",height=1,width=6,fg_bg=style.label}
-    local damage_p = DataIndicator{parent=main,x=32,label="",format="%11.0f",value=0,unit="%",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local damage_p = DataIndicator{parent=main,x=32,label="",format="%11.0f",value=0,unit="%",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     damage_p.register(u_ps, "damage", damage_p.update)
 
     TextBox{parent=main,x=32,y=31,text="Radiation",height=1,width=21,fg_bg=style.label}
-    local radiation = RadIndicator{parent=main,x=32,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local radiation = RadIndicator{parent=main,x=32,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     radiation.register(u_ps, "radiation", radiation.update)
 
     -------------------
@@ -124,8 +144,8 @@ local function init(parent, id)
     -------------------
 
     local u_stat = Rectangle{parent=main,border=border(1,colors.gray,true),thin=true,width=33,height=4,x=46,y=3,fg_bg=bw_fg_bg}
-    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=33,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=bw_fg_bg}
-    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=33,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.gray, colors.white)}
+    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=33,height=1,alignment=ALIGN.CENTER,fg_bg=bw_fg_bg}
+    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=33,height=1,alignment=ALIGN.CENTER,fg_bg=gry_wht}
 
     stat_line_1.register(u_ps, "U_StatusLine1", stat_line_1.set_value)
     stat_line_2.register(u_ps, "U_StatusLine2", stat_line_2.set_value)
@@ -139,9 +159,9 @@ local function init(parent, id)
     local annunciator = Div{parent=main,width=23,height=18,x=22,y=3}
 
     -- connectivity
-    local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)}
-    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=cpair(colors.white,colors.gray)}
-    local rad_mon    = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
+    local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(ind_grn.fgd,ind_red.fgd)}
+    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=ind_wht}
+    local rad_mon    = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd}
 
     plc_online.register(u_ps, "PLCOnline", plc_online.update)
     plc_hbeat.register(u_ps, "PLCHeartbeat", plc_hbeat.update)
@@ -150,25 +170,25 @@ local function init(parent, id)
     annunciator.line_break()
 
     -- operating state
-    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=cpair(colors.green,colors.gray)}
-    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=cpair(colors.white,colors.gray)}
+    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=ind_grn}
+    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=ind_wht}
 
     r_active.register(u_ps, "status", r_active.update)
     r_auto.register(u_ps, "AutoControl", r_auto.update)
 
     -- main unit transient/warning annunciator panel
-    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=cpair(colors.yellow,colors.gray)}
-    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=cpair(colors.red,colors.gray)}
-    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant  Level Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=cpair(colors.red,colors.gray)}
-    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=cpair(colors.yellow,colors.gray)}
-    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=cpair(colors.yellow,colors.gray)}
-    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=cpair(colors.yellow,colors.gray)}
+    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=ind_red}
+    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=ind_red}
+    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=ind_red}
+    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=ind_yel}
+    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=ind_red}
+    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=ind_yel}
+    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=ind_yel}
+    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=ind_red}
+    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=ind_yel}
+    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=ind_yel}
+    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=ind_yel}
+    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=ind_yel}
 
     r_scram.register(u_ps, "ReactorSCRAM", r_scram.update)
     r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update)
@@ -185,20 +205,20 @@ local function init(parent, id)
 
     -- RPS annunciator panel
 
-    TextBox{parent=main,text="REACTOR PROTECTION SYSTEM",fg_bg=cpair(colors.black,colors.cyan),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=8}
+    TextBox{parent=main,text="REACTOR PROTECTION SYSTEM",fg_bg=cpair(colors.black,colors.cyan),alignment=ALIGN.CENTER,width=33,height=1,x=46,y=8}
     local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9}
     local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1}
 
-    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=cpair(colors.yellow,colors.gray)}
-    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=cpair(colors.yellow,colors.gray)}
-    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=cpair(colors.yellow,colors.gray)}
-    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=cpair(colors.yellow,colors.gray)}
-    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=ind_yel}
+    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=ind_yel}
+    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=ind_yel}
+    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=ind_yel}
+    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=ind_red,flash=true,period=period.BLINK_500_MS}
 
     rps_trp.register(u_ps, "rps_tripped", rps_trp.update)
     rps_dmg.register(u_ps, "high_dmg", rps_dmg.update)
@@ -213,17 +233,17 @@ local function init(parent, id)
 
     -- cooling annunciator panel
 
-    TextBox{parent=main,text="REACTOR COOLANT SYSTEM",fg_bg=cpair(colors.black,colors.blue),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=22}
+    TextBox{parent=main,text="REACTOR COOLANT SYSTEM",fg_bg=cpair(colors.black,colors.blue),alignment=ALIGN.CENTER,width=33,height=1,x=46,y=22}
     local rcs = Rectangle{parent=main,border=border(1,colors.blue,true),thin=true,width=33,height=24,x=46,y=23}
     local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1}
     local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7}
 
-    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=cpair(colors.yellow,colors.gray)}
-    local c_emg  = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green}
-    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=cpair(colors.yellow,colors.gray)}
+    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=ind_yel}
+    local c_emg  = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=ind_bkg,c2=ind_wht.fgd,c3=ind_grn.fgd}
+    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=ind_yel}
+    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=ind_yel}
+    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=ind_yel}
+    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=ind_yel}
 
     c_flt.register(u_ps, "RCSFault", c_flt.update)
     c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
@@ -242,15 +262,15 @@ local function init(parent, id)
 
     -- boiler annunciator panel(s)
 
-    if available_space > 0 then _add_space() end
-
     if unit.num_boilers > 0 then
-        TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
-        b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update)
+        if available_space > 0 then _add_space() end
 
-        TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=hc_text}
+        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
+        b1_wll.register(b_ps[1], "WaterLevelLow", b1_wll.update)
+
+        TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=hc_text}
+        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update)
     end
     if unit.num_boilers > 1 then
@@ -261,12 +281,12 @@ local function init(parent, id)
             _add_space()
         end
 
-        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
-        b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update)
+        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=hc_text}
+        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
+        b2_wll.register(b_ps[2], "WaterLevelLow", b2_wll.update)
 
-        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=hc_text}
+        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update)
     end
 
@@ -274,20 +294,20 @@ local function init(parent, id)
 
     if available_space > 1 then _add_space() end
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
     t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update)
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
     t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update)
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
     t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update)
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
     t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update)
 
     if unit.num_turbines > 1 then
@@ -295,55 +315,55 @@ local function init(parent, id)
             _add_space()
         end
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
         t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update)
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update)
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update)
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update)
     end
 
     if unit.num_turbines > 2 then
         if available_space > 3 then _add_space() end
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
         t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update)
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update)
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update)
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update)
     end
 
+    util.nop()
+
     ----------------------
     -- reactor controls --
     ----------------------
 
-    local dis_colors = cpair(colors.white, colors.lightGray)
-
-    local burn_control = Div{parent=main,x=12,y=28,width=19,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local burn_rate = SpinboxNumeric{parent=burn_control,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=burn_control,x=9,y=2,text="mB/t"}
+    local burn_control = Div{parent=main,x=12,y=28,width=19,height=3,fg_bg=s_hi_box}
+    local burn_rate = SpinboxNumeric{parent=burn_control,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=burn_control,x=9,y=2,text="mB/t",fg_bg=style.theme.label_fg}
 
     local set_burn = function () unit.set_burn(burn_rate.get_value()) end
-    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=dis_colors,callback=set_burn}
+    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=dis_colors,callback=set_burn}
 
     burn_rate.register(u_ps, "burn_rate", burn_rate.set_value)
     burn_rate.register(u_ps, "max_burn", burn_rate.set_max)
@@ -374,7 +394,7 @@ local function init(parent, id)
 
     reset.register(u_ps, "rps_tripped", function (active) if active then reset.enable() else reset.disable() end end)
 
-    TextBox{parent=main,text="WASTE PROCESSING",fg_bg=cpair(colors.black,colors.brown),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=48}
+    TextBox{parent=main,text="WASTE PROCESSING",fg_bg=cpair(colors.black,colors.brown),alignment=ALIGN.CENTER,width=33,height=1,x=46,y=48}
     local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49}
     local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1}
 
@@ -386,22 +406,22 @@ local function init(parent, id)
     -- alarm management --
     ----------------------
 
-    local alarm_panel = Div{parent=main,x=2,y=36,width=29,height=16,fg_bg=bw_fg_bg}
+    local alarm_panel = Div{parent=main,x=2,y=36,width=29,height=16,fg_bg=s_hi_bright}
 
-    local a_brc = AlarmLight{parent=alarm_panel,x=6,y=2,label="Containment Breach",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rad = AlarmLight{parent=alarm_panel,x=6,label="Containment Radiation",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_dmg = AlarmLight{parent=alarm_panel,x=6,label="Critical Damage",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
+    local a_brc = AlarmLight{parent=alarm_panel,x=6,y=2,label="Containment Breach",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rad = AlarmLight{parent=alarm_panel,x=6,label="Containment Radiation",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_dmg = AlarmLight{parent=alarm_panel,x=6,label="Critical Damage",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
     alarm_panel.line_break()
-    local a_rcl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Lost",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rcd = AlarmLight{parent=alarm_panel,x=6,label="Reactor Damage",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rot = AlarmLight{parent=alarm_panel,x=6,label="Reactor Over Temp",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rht = AlarmLight{parent=alarm_panel,x=6,label="Reactor High Temp",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
-    local a_rwl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste Leak",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rwh = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste High",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
+    local a_rcl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Lost",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rcd = AlarmLight{parent=alarm_panel,x=6,label="Reactor Damage",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rot = AlarmLight{parent=alarm_panel,x=6,label="Reactor Over Temp",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rht = AlarmLight{parent=alarm_panel,x=6,label="Reactor High Temp",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
+    local a_rwl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste Leak",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rwh = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste High",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
     alarm_panel.line_break()
-    local a_rps = AlarmLight{parent=alarm_panel,x=6,label="RPS Transient",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
-    local a_clt = AlarmLight{parent=alarm_panel,x=6,label="RCS Transient",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
-    local a_tbt = AlarmLight{parent=alarm_panel,x=6,label="Turbine Trip",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
+    local a_rps = AlarmLight{parent=alarm_panel,x=6,label="RPS Transient",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
+    local a_clt = AlarmLight{parent=alarm_panel,x=6,label="RCS Transient",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
+    local a_tbt = AlarmLight{parent=alarm_panel,x=6,label="Turbine Trip",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
 
     a_brc.register(u_ps, "Alarm_1", a_brc.update)
     a_rad.register(u_ps, "Alarm_2", a_rad.update)
@@ -454,40 +474,40 @@ local function init(parent, id)
 
     -- color tags
 
-    TextBox{parent=alarm_panel,x=5,y=13,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.cyan)}
-    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.blue)}
-    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.blue)}
+    TextBox{parent=alarm_panel,x=5,y=13,text="\x95",width=1,height=1,fg_bg=cpair(s_hi_bright.bkg,colors.cyan)}
+    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(s_hi_bright.bkg,colors.blue)}
+    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(s_hi_bright.bkg,colors.blue)}
 
     --------------------------------
     -- automatic control settings --
     --------------------------------
 
-    TextBox{parent=main,text="AUTO CTRL",fg_bg=cpair(colors.black,colors.purple),alignment=TEXT_ALIGN.CENTER,width=13,height=1,x=32,y=36}
+    TextBox{parent=main,text="AUTO CTRL",fg_bg=cpair(colors.black,colors.purple),alignment=ALIGN.CENTER,width=13,height=1,x=32,y=36}
     local auto_ctl = Rectangle{parent=main,border=border(1,colors.purple,true),thin=true,width=13,height=15,x=32,y=37}
     local auto_div = Div{parent=auto_ctl,width=13,height=15,x=1,y=1}
 
     local ctl_opts = { "Manual", "Primary", "Secondary", "Tertiary", "Backup" }
 
-    local group = RadioButton{parent=auto_div,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.blue,colors.white),radio_bg=colors.gray}
+    local group = RadioButton{parent=auto_div,options=ctl_opts,callback=function()end,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.purple}
 
     group.register(u_ps, "auto_group_id", function (gid) group.set_value(gid + 1) end)
 
     auto_div.line_break()
 
     local function set_group() unit.set_group(group.get_value() - 1) end
-    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
+    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=gry_wht,callback=set_group}
 
     auto_div.line_break()
 
     TextBox{parent=auto_div,text="Prio. Group",height=1,width=11,fg_bg=style.label}
-    local auto_grp = TextBox{parent=auto_div,text="Manual",height=1,width=11,fg_bg=bw_fg_bg}
+    local auto_grp = TextBox{parent=auto_div,text="Manual",height=1,width=11,fg_bg=s_field}
 
     auto_grp.register(u_ps, "auto_group", auto_grp.set_value)
 
     auto_div.line_break()
 
-    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=cpair(colors.green,colors.gray)}
-    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_1000_MS}
+    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=ind_grn}
+    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=ind_wht,flash=true,period=period.BLINK_1000_MS}
 
     a_rdy.register(u_ps, "U_AutoReady", a_rdy.update)
 

coordinator/ui/components/unit_flow.lua

@@ -0,0 +1,229 @@
+--
+-- Basic Unit Flow Overview
+--
+
+local util              = require("scada-common.util")
+
+local style             = require("coordinator.ui.style")
+
+local core              = require("graphics.core")
+
+local Div               = require("graphics.elements.div")
+local PipeNetwork       = require("graphics.elements.pipenet")
+local TextBox           = require("graphics.elements.textbox")
+
+local Rectangle         = require("graphics.elements.rectangle")
+
+local DataIndicator     = require("graphics.elements.indicators.data")
+
+local IndicatorLight    = require("graphics.elements.indicators.light")
+local TriIndicatorLight = require("graphics.elements.indicators.trilight")
+
+local ALIGN = core.ALIGN
+
+local sprintf = util.sprintf
+
+local border = core.border
+local cpair = core.cpair
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+local lg_gray = style.lg_gray
+
+-- make a new unit flow window
+---@param parent graphics_element parent
+---@param x integer top left x
+---@param y integer top left y
+---@param wide boolean whether to render wide version
+---@param unit ioctl_unit unit database entry
+local function make(parent, x, y, wide, unit)
+    local s_field = style.theme.field_box
+
+    local text_c = style.text_colors
+    local lu_c = style.lu_colors
+    local lu_c_d = style.lu_colors_dark
+
+    local ind_grn = style.ind_grn
+    local ind_wht = style.ind_wht
+
+    local height = 16
+
+    local v_start = 1 + ((unit.unit_id - 1) * 5)
+    local prv_start = 1 + ((unit.unit_id - 1) * 3)
+    local v_fields = { "pu", "po", "pl", "am" }
+    local v_names = {
+        sprintf("PV%02d-PU", v_start),
+        sprintf("PV%02d-PO", v_start + 1),
+        sprintf("PV%02d-PL", v_start + 2),
+        sprintf("PV%02d-AM", v_start + 3),
+        sprintf("PRV%02d", prv_start),
+        sprintf("PRV%02d", prv_start + 1),
+        sprintf("PRV%02d", prv_start + 2)
+    }
+
+    assert(parent.get_height() >= (y + height), "flow display not of sufficient vertical resolution (add an additional row of monitors) " .. y .. "," .. parent.get_height())
+
+    local function _wide(a, b) return util.trinary(wide, a, b) end
+
+    -- bounding box div
+    local root = Div{parent=parent,x=x,y=y,width=_wide(136, 114),height=height}
+
+    ------------------
+    -- COOLING LOOP --
+    ------------------
+
+    local reactor = Rectangle{parent=root,x=1,y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=reactor,y=1,text="FISSION REACTOR",alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=reactor,y=3,text="UNIT #"..unit.unit_id,alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=19,y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+    TextBox{parent=root,x=3,y=5,text="\x19",width=1,height=1,fg_bg=lg_gray}
+
+    local rc_pipes = {}
+
+    local emc_x = 42    -- emergency coolant connection x point
+
+    if unit.num_boilers > 0 then
+        table.insert(rc_pipes, pipe(0, 1, _wide(28, 19), 1, colors.lightBlue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(28, 19), 3, colors.orange, true))
+        table.insert(rc_pipes, pipe(_wide(46 ,39), 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(_wide(46,39), 3, _wide(72,58), 3, colors.white, true))
+    else
+        emc_x = 3
+        table.insert(rc_pipes, pipe(0, 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(72,58), 3, colors.white, true))
+    end
+
+    if unit.has_tank then
+        table.insert(rc_pipes, pipe(emc_x, 1, emc_x, 0, colors.blue, true, true))
+    end
+
+    local prv_yo = math.max(3 - unit.num_turbines, 0)
+    for i = 1, unit.num_turbines do
+        local py = 2 * (i - 1) + prv_yo
+        table.insert(rc_pipes, pipe(_wide(92, 78), py, _wide(104, 83), py, colors.white, true))
+    end
+
+    PipeNetwork{parent=root,x=20,y=1,pipes=rc_pipes,bg=style.theme.bg}
+
+    if unit.num_boilers > 0 then
+        local cc_rate = DataIndicator{parent=root,x=_wide(25,22),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+        local hc_rate = DataIndicator{parent=root,x=_wide(25,22),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+
+        cc_rate.register(unit.unit_ps, "boiler_boil_sum", function (sum) cc_rate.update(sum * 10) end)
+        hc_rate.register(unit.unit_ps, "heating_rate", hc_rate.update)
+
+        local boiler = Rectangle{parent=root,x=_wide(47,40),y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+        TextBox{parent=boiler,y=1,text="THERMO-ELECTRIC",alignment=ALIGN.CENTER,height=1}
+        TextBox{parent=boiler,y=3,text=util.trinary(unit.num_boilers>1,"BOILERS","BOILER"),alignment=ALIGN.CENTER,height=1}
+        TextBox{parent=root,x=_wide(47,40),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+        TextBox{parent=root,x=_wide(65,58),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+        local wt_rate = DataIndicator{parent=root,x=_wide(71,61),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+        local st_rate = DataIndicator{parent=root,x=_wide(71,61),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "boiler_boil_sum", st_rate.update)
+    else
+        local wt_rate = DataIndicator{parent=root,x=28,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+        local st_rate = DataIndicator{parent=root,x=28,y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "heating_rate", st_rate.update)
+    end
+
+    local turbine = Rectangle{parent=root,x=_wide(93,79),y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=turbine,y=1,text="STEAM TURBINE",alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=turbine,y=3,text=util.trinary(unit.num_turbines>1,"GENERATORS","GENERATOR"),alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=_wide(93,79),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+    for i = 1, unit.num_turbines do
+        local ry = 1 + (2 * (i - 1)) + prv_yo
+        TextBox{parent=root,x=_wide(125,103),y=ry,text="\x10\x11\x7f",fg_bg=text_c,width=3,height=1}
+        local state = TriIndicatorLight{parent=root,x=_wide(129,107),y=ry,label=v_names[i+4],c1=style.ind_bkg,c2=style.ind_yel.fgd,c3=style.ind_red.fgd}
+        state.register(unit.turbine_ps_tbl[i], "SteamDumpOpen", state.update)
+    end
+
+    ----------------------
+    -- WASTE PROCESSING --
+    ----------------------
+
+    local waste = Div{parent=root,x=3,y=6}
+
+    local waste_c = style.theme.fuel_color
+
+    local waste_pipes = {
+        pipe(0, 0, _wide(19, 16), 1, colors.brown, true),
+        pipe(_wide(14, 13), 1, _wide(19, 17), 5, colors.brown, true),
+        pipe(_wide(22, 19), 1, _wide(49, 45), 1, colors.brown, true),
+        pipe(_wide(22, 19), 5, _wide(28, 24), 5, colors.brown, true),
+
+        pipe(_wide(64, 53), 1, _wide(95, 81), 1, colors.green, true),
+
+        pipe(_wide(48, 43), 4, _wide(71, 61), 4, colors.cyan, true),
+        pipe(_wide(66, 57), 4, _wide(71, 61), 8, colors.cyan, true),
+        pipe(_wide(74, 63), 4, _wide(95, 81), 4, colors.cyan, true),
+        pipe(_wide(74, 63), 8, _wide(133, 111), 8, colors.cyan, true),
+
+        pipe(_wide(108, 94), 1, _wide(132, 110), 6, waste_c, true, true),
+        pipe(_wide(108, 94), 4, _wide(111, 95), 1, waste_c, true, true),
+        pipe(_wide(132, 110), 6, _wide(130, 108), 6, waste_c, true, true)
+    }
+
+    PipeNetwork{parent=waste,x=1,y=1,pipes=waste_pipes,bg=style.theme.bg}
+
+    local function _valve(vx, vy, n)
+        TextBox{parent=waste,x=vx,y=vy,text="\x10\x11",fg_bg=text_c,width=2,height=1}
+        local conn = IndicatorLight{parent=waste,x=vx-3,y=vy+1,label=v_names[n],colors=ind_grn}
+        local open = IndicatorLight{parent=waste,x=vx-3,y=vy+2,label="OPEN",colors=ind_wht}
+        conn.register(unit.unit_ps, util.c("V_", v_fields[n], "_conn"), conn.update)
+        open.register(unit.unit_ps, util.c("V_", v_fields[n], "_state"), open.update)
+    end
+
+    local function _machine(mx, my, name)
+        local l = string.len(name) + 2
+        TextBox{parent=waste,x=mx,y=my,text=string.rep("\x8f",l),alignment=ALIGN.CENTER,fg_bg=cpair(style.theme.bg,style.theme.header.bkg),width=l,height=1}
+        TextBox{parent=waste,x=mx,y=my+1,text=name,alignment=ALIGN.CENTER,fg_bg=style.theme.header,width=l,height=1}
+    end
+
+    local waste_rate = DataIndicator{parent=waste,x=1,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local pu_rate = DataIndicator{parent=waste,x=_wide(82,70),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=s_field}
+    local po_rate = DataIndicator{parent=waste,x=_wide(52,45),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local popl_rate = DataIndicator{parent=waste,x=_wide(82,70),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local poam_rate = DataIndicator{parent=waste,x=_wide(82,70),y=10,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local spent_rate = DataIndicator{parent=waste,x=_wide(117,98),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%8.3f",value=0,width=13,fg_bg=s_field}
+
+    waste_rate.register(unit.unit_ps, "act_burn_rate", waste_rate.update)
+    pu_rate.register(unit.unit_ps, "pu_rate", pu_rate.update)
+    po_rate.register(unit.unit_ps, "po_rate", po_rate.update)
+    popl_rate.register(unit.unit_ps, "po_pl_rate", popl_rate.update)
+    poam_rate.register(unit.unit_ps, "po_am_rate", poam_rate.update)
+    spent_rate.register(unit.unit_ps, "ws_rate", spent_rate.update)
+
+    _valve(_wide(21, 18), 2, 1)
+    _valve(_wide(21, 18), 6, 2)
+    _valve(_wide(73, 62), 5, 3)
+    _valve(_wide(73, 62), 9, 4)
+
+    _machine(_wide(51, 45), 1, "CENTRIFUGE \x1a");
+    _machine(_wide(97, 83), 1, "PRC [Pu] \x1a");
+    _machine(_wide(97, 83), 4, "PRC [Po] \x1a");
+    _machine(_wide(116, 94), 6, "SPENT WASTE \x1b")
+
+    TextBox{parent=waste,x=_wide(30,25),y=3,text="SNAs [Po]",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sna_po  = Rectangle{parent=waste,x=_wide(30,25),y=4,border=border(1,colors.gray,true),width=19,height=7,thin=true,fg_bg=style.theme.highlight_box_bright}
+    local sna_act = IndicatorLight{parent=sna_po,label="ACTIVE",colors=ind_grn}
+    local sna_cnt = DataIndicator{parent=sna_po,x=12,y=1,lu_colors=lu_c_d,label="CNT",unit="",format="%2d",value=0,width=7}
+    local sna_pk = DataIndicator{parent=sna_po,y=3,lu_colors=lu_c_d,label="PEAK",unit="mB/t",format="%7.2f",value=0,width=17}
+    local sna_max = DataIndicator{parent=sna_po,lu_colors=lu_c_d,label="MAX",unit="mB/t",format="%8.2f",value=0,width=17}
+    local sna_in = DataIndicator{parent=sna_po,lu_colors=lu_c_d,label="IN",unit="mB/t",format="%9.2f",value=0,width=17}
+
+    sna_act.register(unit.unit_ps, "po_rate", function (r) sna_act.update(r > 0) end)
+    sna_cnt.register(unit.unit_ps, "sna_count", sna_cnt.update)
+    sna_pk.register(unit.unit_ps, "sna_peak_rate", sna_pk.update)
+    sna_max.register(unit.unit_ps, "sna_max_rate", sna_max.update)
+    sna_in.register(unit.unit_ps, "sna_in", sna_in.update)
+
+    return root
+end
+
+return make

coordinator/ui/components/unit_overview.lua

@@ -14,7 +14,7 @@ local Div          = require("graphics.elements.div")
 local PipeNetwork  = require("graphics.elements.pipenet")
 local TextBox      = require("graphics.elements.textbox")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local pipe = core.pipe
 
@@ -34,7 +34,7 @@ local function make(parent, x, y, unit)
 
     if num_boilers == 0 and num_turbines == 1 then
         height = 9
-    elseif num_boilers == 1 and num_turbines <= 2 then
+    elseif num_boilers <= 1 and num_turbines <= 2 then
         height = 17
     end
 
@@ -44,7 +44,7 @@ local function make(parent, x, y, unit)
     local root = Div{parent=parent,x=x,y=y,width=80,height=height}
 
     -- unit header message
-    TextBox{parent=root,text="Unit #"..unit.unit_id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
+    TextBox{parent=root,text="Unit #"..unit.unit_id,alignment=ALIGN.CENTER,height=1,fg_bg=style.theme.header}
 
     -------------
     -- REACTOR --
@@ -66,7 +66,7 @@ local function make(parent, x, y, unit)
             table.insert(coolant_pipes, pipe(2, 0, 11, 11, colors.orange))
         end
 
-        PipeNetwork{parent=root,x=4,y=10,pipes=coolant_pipes,bg=colors.lightGray}
+        PipeNetwork{parent=root,x=4,y=10,pipes=coolant_pipes,bg=style.theme.bg}
     end
 
     -------------
@@ -164,10 +164,10 @@ local function make(parent, x, y, unit)
             table.insert(steam_pipes_b, pipe(0, 18, 2, 18, colors.blue, false, true))       -- water boiler 2 to turbine 2 junction
         end
 
-        PipeNetwork{parent=root,x=47,y=11,pipes=steam_pipes_a,bg=colors.lightGray}
+        PipeNetwork{parent=root,x=47,y=11,pipes=steam_pipes_a,bg=style.theme.bg}
     end
 
-    PipeNetwork{parent=root,x=54,y=3,pipes=steam_pipes_b,bg=colors.lightGray}
+    PipeNetwork{parent=root,x=54,y=3,pipes=steam_pipes_b,bg=style.theme.bg}
 
     return root
 end

coordinator/ui/dialog.lua

@@ -1,52 +0,0 @@
-local completion = require("cc.completion")
-
-local util       = require("scada-common.util")
-
-local print = util.print
-
-local dialog = {}
-
--- ask the user yes or no
----@nodiscard
----@param question string
----@param default boolean
----@return boolean|nil
-function dialog.ask_y_n(question, default)
-    print(question)
-
-    if default == true then
-        print(" (Y/n)? ")
-    else
-        print(" (y/N)? ")
-    end
-
-    local response = read(nil, nil)
-
-    if response == "" then
-        return default
-    elseif response == "Y" or response == "y" then
-        return true
-    elseif response == "N" or response == "n" then
-        return false
-    else
-        return nil
-    end
-end
-
--- ask the user for an input within a set of options
----@nodiscard
----@param options table
----@param cancel string
----@return boolean|string|nil
-function dialog.ask_options(options, cancel)
-    print("> ")
-    local response = read(nil, nil, function(text) return completion.choice(text, options) end)
-
-    if response == cancel then return false end
-
-    if util.table_contains(options, response) then
-        return response
-    else return nil end
-end
-
-return dialog

coordinator/ui/layout/flow_view.lua

@@ -0,0 +1,393 @@
+--
+-- Flow Monitor GUI
+--
+
+local types          = require("scada-common.types")
+local util           = require("scada-common.util")
+
+local iocontrol      = require("coordinator.iocontrol")
+
+local style          = require("coordinator.ui.style")
+
+local unit_flow      = require("coordinator.ui.components.unit_flow")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local PipeNetwork    = require("graphics.elements.pipenet")
+local Rectangle      = require("graphics.elements.rectangle")
+local TextBox        = require("graphics.elements.textbox")
+
+local DataIndicator  = require("graphics.elements.indicators.data")
+local HorizontalBar  = require("graphics.elements.indicators.hbar")
+local IndicatorLight = require("graphics.elements.indicators.light")
+local StateIndicator = require("graphics.elements.indicators.state")
+
+local CONTAINER_MODE = types.CONTAINER_MODE
+
+local ALIGN = core.ALIGN
+
+local cpair = core.cpair
+local border = core.border
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+
+-- create new flow view
+---@param main graphics_element main displaybox
+local function init(main)
+    local s_hi_bright = style.theme.highlight_box_bright
+    local s_field = style.theme.field_box
+    local text_col = style.text_colors
+    local lu_col = style.lu_colors
+    local lu_c_d = style.lu_colors_dark
+
+    local facility = iocontrol.get_db().facility
+    local units = iocontrol.get_db().units
+
+    local tank_defs = facility.tank_defs
+    local tank_list = facility.tank_list
+
+    -- window header message
+    local header = TextBox{parent=main,y=1,text="Facility Coolant and Waste Flow Monitor",alignment=ALIGN.CENTER,height=1,fg_bg=style.theme.header}
+    -- max length example: "01:23:45 AM - Wednesday, September 28 2022"
+    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=ALIGN.RIGHT,width=42,height=1,fg_bg=style.theme.header}
+
+    datetime.register(facility.ps, "date_time", datetime.set_value)
+
+    local po_pipes = {}
+    local water_pipes = {}
+
+    -- get the y offset for this unit index
+    ---@param idx integer unit index
+    local function y_ofs(idx) return ((idx - 1) * 20) end
+
+    -- determinte facility tank start/end from the definitions list
+    ---@param start_idx integer start index of table iteration
+    ---@param end_idx integer end index of table iteration
+    local function find_fdef(start_idx, end_idx)
+        local first, last = 4, 0
+        for i = start_idx, end_idx do
+            if tank_defs[i] == 2 then
+                last = i
+                if i < first then first = i end
+            end
+        end
+        return first, last
+    end
+
+    if facility.tank_mode == 0 or facility.tank_mode == 8 then
+        -- (0) tanks belong to reactor units OR (8) 4 total facility tanks (A B C D)
+        for i = 1, facility.num_units do
+            if units[i].has_tank then
+                local y = y_ofs(i)
+                table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+    else
+        -- setup connections for units with emergency coolant, always the same
+        for i = 1, #tank_defs do
+            if tank_defs[i] > 0 then
+                local y = y_ofs(i)
+
+                if tank_defs[i] == 2 then
+                    table.insert(water_pipes, pipe(1, y, 21, y, colors.blue, true))
+                else
+                    table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                    table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+                end
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+
+        if facility.tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef, last_fdef = find_fdef(1, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef, last_fdef = find_fdef(1, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if tank_defs[a] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(a), 1, y_ofs(a) + 6, colors.blue, true))
+                    if tank_defs[b] == 2 then
+                        table.insert(water_pipes, pipe(0, y_ofs(b) - 13, 1, y_ofs(b), colors.blue, true))
+                    end
+                elseif tank_defs[b] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(b), 1, y_ofs(b) + 6, colors.blue, true))
+                end
+            end
+        elseif facility.tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef, last_fdef = find_fdef(2, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef, last_fdef = find_fdef(1, math.min(2, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 3 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef, last_fdef = find_fdef(2, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef, last_fdef = find_fdef(3, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 2 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        end
+    end
+
+    local flow_x = 3
+    if #water_pipes > 0 then
+        flow_x = 25
+        PipeNetwork{parent=main,x=2,y=3,pipes=water_pipes,bg=style.theme.bg}
+    end
+
+    for i = 1, facility.num_units do
+        local y_offset = y_ofs(i)
+        unit_flow(main, flow_x, 5 + y_offset, #water_pipes == 0, units[i])
+        table.insert(po_pipes, pipe(0, 3 + y_offset, 4, 0, colors.cyan, true, true))
+        util.nop()
+    end
+
+    PipeNetwork{parent=main,x=139,y=15,pipes=po_pipes,bg=style.theme.bg}
+
+    -----------------
+    -- tank valves --
+    -----------------
+
+    local next_f_id = 1
+
+    for i = 1, #tank_defs do
+        if tank_defs[i] > 0 then
+            local vy = 3 + y_ofs(i)
+
+            TextBox{parent=main,x=12,y=vy,text="\x10\x11",fg_bg=text_col,width=2,height=1}
+
+            local conn = IndicatorLight{parent=main,x=9,y=vy+1,label=util.sprintf("PV%02d-EMC", i * 5),colors=style.ind_grn}
+            local open = IndicatorLight{parent=main,x=9,y=vy+2,label="OPEN",colors=style.ind_wht}
+
+            conn.register(units[i].unit_ps, "V_emc_conn", conn.update)
+            open.register(units[i].unit_ps, "V_emc_state", open.update)
+        end
+    end
+
+    -------------------
+    -- dynamic tanks --
+    -------------------
+
+    for i = 1, #tank_list do
+        if tank_list[i] > 0 then
+            local id = "U-" .. i
+            local f_id = next_f_id
+            if tank_list[i] == 2 then
+                id = "F-" .. next_f_id
+                next_f_id = next_f_id + 1
+            end
+
+            local y_offset = y_ofs(i)
+
+            local tank = Div{parent=main,x=3,y=7+y_offset,width=20,height=14}
+
+            TextBox{parent=tank,text=" ",height=1,x=1,y=1,fg_bg=style.lg_gray}
+            TextBox{parent=tank,text="DYNAMIC TANK "..id,alignment=ALIGN.CENTER,height=1,fg_bg=style.wh_gray}
+
+            local tank_box = Rectangle{parent=tank,border=border(1,colors.gray,true),width=20,height=12}
+
+            local status = StateIndicator{parent=tank_box,x=3,y=1,states=style.dtank.states,value=1,min_width=14}
+
+            TextBox{parent=tank_box,x=2,y=3,text="Fill",height=1,width=10,fg_bg=style.label}
+            local tank_pcnt = DataIndicator{parent=tank_box,x=10,y=3,label="",format="%5.2f",value=100,unit="%",lu_colors=lu_col,width=8,fg_bg=text_col}
+            local tank_amnt = DataIndicator{parent=tank_box,x=2,label="",format="%13d",value=0,commas=true,unit="mB",lu_colors=lu_col,width=16,fg_bg=s_field}
+
+            TextBox{parent=tank_box,x=2,y=6,text="Water Level",height=1,width=11,fg_bg=style.label}
+            local level = HorizontalBar{parent=tank_box,x=2,y=7,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=16}
+
+            TextBox{parent=tank_box,x=2,y=9,text="In/Out Mode",height=1,width=11,fg_bg=style.label}
+            local can_fill = IndicatorLight{parent=tank_box,x=2,y=10,label="FILL",colors=style.ind_wht}
+            local can_empty = IndicatorLight{parent=tank_box,x=10,y=10,label="EMPTY",colors=style.ind_wht}
+
+            local function _can_fill(mode)
+                can_fill.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.FILL))
+            end
+
+            local function _can_empty(mode)
+                can_empty.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.EMPTY))
+            end
+
+            if tank_list[i] == 1 then
+                status.register(units[i].tank_ps_tbl[1], "computed_status", status.update)
+                tank_pcnt.register(units[i].tank_ps_tbl[1], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(units[i].tank_ps_tbl[1], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(units[i].tank_ps_tbl[1], "fill", level.update)
+                can_fill.register(units[i].tank_ps_tbl[1], "container_mode", _can_fill)
+                can_empty.register(units[i].tank_ps_tbl[1], "container_mode", _can_empty)
+            else
+                status.register(facility.tank_ps_tbl[f_id], "computed_status", status.update)
+                tank_pcnt.register(facility.tank_ps_tbl[f_id], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(facility.tank_ps_tbl[f_id], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(facility.tank_ps_tbl[f_id], "fill", level.update)
+                can_fill.register(facility.tank_ps_tbl[f_id], "container_mode", _can_fill)
+                can_empty.register(facility.tank_ps_tbl[f_id], "container_mode", _can_empty)
+            end
+        end
+    end
+
+    util.nop()
+
+    ---------
+    -- SPS --
+    ---------
+
+    local sps = Div{parent=main,x=140,y=3,height=12}
+
+    TextBox{parent=sps,text=" ",width=24,height=1,x=1,y=1,fg_bg=style.lg_gray}
+    TextBox{parent=sps,text="SPS",alignment=ALIGN.CENTER,width=24,height=1,fg_bg=wh_gray}
+
+    local sps_box = Rectangle{parent=sps,border=border(1,colors.gray,true),width=24,height=10}
+
+    local status = StateIndicator{parent=sps_box,x=5,y=1,states=style.sps.states,value=1,min_width=14}
+
+    status.register(facility.sps_ps_tbl[1], "computed_status", status.update)
+
+    TextBox{parent=sps_box,x=2,y=3,text="Input Rate",height=1,width=10,fg_bg=style.label}
+    local sps_in = DataIndicator{parent=sps_box,x=2,label="",format="%15.2f",value=0,unit="mB/t",lu_colors=lu_col,width=20,fg_bg=s_field}
+
+    sps_in.register(facility.ps, "po_am_rate", sps_in.update)
+
+    TextBox{parent=sps_box,x=2,y=6,text="Production Rate",height=1,width=15,fg_bg=style.label}
+    local sps_rate = DataIndicator{parent=sps_box,x=2,label="",format="%15d",value=0,unit="\xb5B/t",lu_colors=lu_col,width=20,fg_bg=s_field}
+
+    sps_rate.register(facility.sps_ps_tbl[1], "process_rate", function (r) sps_rate.update(r * 1000) end)
+
+    ----------------
+    -- statistics --
+    ----------------
+
+    TextBox{parent=main,x=145,y=16,text="RAW WASTE",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local raw_waste  = Rectangle{parent=main,x=145,y=17,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=s_hi_bright}
+    local sum_raw_waste = DataIndicator{parent=raw_waste,lu_colors=lu_c_d,label="SUM",unit="mB/t",format="%8.2f",value=0,width=17}
+
+    sum_raw_waste.register(facility.ps, "burn_sum", sum_raw_waste.update)
+
+    TextBox{parent=main,x=145,y=21,text="PROC. WASTE",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local pr_waste  = Rectangle{parent=main,x=145,y=22,border=border(1,colors.gray,true),width=19,height=5,thin=true,fg_bg=s_hi_bright}
+    local pu = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="Pu",unit="mB/t",format="%9.3f",value=0,width=17}
+    local po = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="Po",unit="mB/t",format="%9.2f",value=0,width=17}
+    local popl = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="PoPl",unit="mB/t",format="%7.2f",value=0,width=17}
+
+    pu.register(facility.ps, "pu_rate", pu.update)
+    po.register(facility.ps, "po_rate", po.update)
+    popl.register(facility.ps, "po_pl_rate", popl.update)
+
+    TextBox{parent=main,x=145,y=28,text="SPENT WASTE",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sp_waste  = Rectangle{parent=main,x=145,y=29,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=s_hi_bright}
+    local sum_sp_waste = DataIndicator{parent=sp_waste,lu_colors=lu_c_d,label="SUM",unit="mB/t",format="%8.3f",value=0,width=17}
+
+    sum_sp_waste.register(facility.ps, "spent_waste_rate", sum_sp_waste.update)
+end
+
+return init

coordinator/ui/layout/front_panel.lua

@@ -2,39 +2,44 @@
 -- Coordinator Front Panel GUI
 --
 
-local types         = require("scada-common.types")
-local util          = require("scada-common.util")
+local types     = require("scada-common.types")
+local util      = require("scada-common.util")
 
-local iocontrol     = require("coordinator.iocontrol")
+local iocontrol = require("coordinator.iocontrol")
 
-local pgi           = require("coordinator.ui.pgi")
-local style         = require("coordinator.ui.style")
+local pgi       = require("coordinator.ui.pgi")
+local style     = require("coordinator.ui.style")
 
-local pkt_entry     = require("coordinator.ui.components.pkt_entry")
+local pkt_entry = require("coordinator.ui.components.pkt_entry")
 
-local core          = require("graphics.core")
+local core      = require("graphics.core")
 
-local Div           = require("graphics.elements.div")
-local ListBox       = require("graphics.elements.listbox")
-local MultiPane     = require("graphics.elements.multipane")
-local TextBox       = require("graphics.elements.textbox")
+local Div       = require("graphics.elements.div")
+local ListBox   = require("graphics.elements.listbox")
+local MultiPane = require("graphics.elements.multipane")
+local TextBox   = require("graphics.elements.textbox")
 
-local TabBar        = require("graphics.elements.controls.tabbar")
+local TabBar    = require("graphics.elements.controls.tabbar")
 
-local LED           = require("graphics.elements.indicators.led")
-local RGBLED        = require("graphics.elements.indicators.ledrgb")
+local LED       = require("graphics.elements.indicators.led")
+local LEDPair   = require("graphics.elements.indicators.ledpair")
+local RGBLED    = require("graphics.elements.indicators.ledrgb")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local LINK_STATE = types.PANEL_LINK_STATE
+
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 
+local led_grn = style.led_grn
+
 -- create new front panel view
 ---@param panel graphics_element main displaybox
 ---@param num_units integer number of units (number of unit monitors)
 local function init(panel, num_units)
     local ps = iocontrol.get_db().fp.ps
 
-    TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.fp.header}
+    TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=ALIGN.CENTER,height=1,fg_bg=style.fp_theme.header}
 
     local page_div = Div{parent=panel,x=1,y=3}
 
@@ -47,36 +52,78 @@ local function init(panel, num_units)
     local system = Div{parent=main_page,width=14,height=17,x=2,y=2}
 
     local status = LED{parent=system,label="STATUS",colors=cpair(colors.green,colors.red)}
-    local heartbeat = LED{parent=system,label="HEARTBEAT",colors=cpair(colors.green,colors.green_off)}
+    local heartbeat = LED{parent=system,label="HEARTBEAT",colors=led_grn}
     status.update(true)
     system.line_break()
 
     heartbeat.register(ps, "heartbeat", heartbeat.update)
 
-    local modem = LED{parent=system,label="MODEM",colors=cpair(colors.green,colors.green_off)}
-    local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,colors.gray}}
-    network.update(types.PANEL_LINK_STATE.DISCONNECTED)
+    local modem = LED{parent=system,label="MODEM",colors=led_grn}
+
+    if not style.colorblind then
+        local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,style.fp_ind_bkg}}
+        network.update(types.PANEL_LINK_STATE.DISCONNECTED)
+        network.register(ps, "link_state", network.update)
+    else
+        local nt_lnk = LEDPair{parent=system,label="NT LINKED",off=style.fp_ind_bkg,c1=colors.red,c2=colors.green}
+        local nt_ver = LEDPair{parent=system,label="NT VERSION",off=style.fp_ind_bkg,c1=colors.red,c2=colors.green}
+
+        nt_lnk.register(ps, "link_state", function (state)
+            local value = 2
+
+            if state == LINK_STATE.DISCONNECTED then
+                value = 1
+            elseif state == LINK_STATE.LINKED then
+                value = 3
+            end
+
+            nt_lnk.update(value)
+        end)
+
+        nt_ver.register(ps, "link_state", function (state)
+            local value = 3
+
+            if state == LINK_STATE.BAD_VERSION then
+                value = 2
+            elseif state == LINK_STATE.DISCONNECTED then
+                value = 1
+            end
+
+            nt_ver.update(value)
+        end)
+    end
+
     system.line_break()
 
     modem.register(ps, "has_modem", modem.update)
-    network.register(ps, "link_state", network.update)
 
-    local speaker = LED{parent=system,label="SPEAKER",colors=cpair(colors.green,colors.green_off)}
+    local speaker = LED{parent=system,label="SPEAKER",colors=led_grn}
     speaker.register(ps, "has_speaker", speaker.update)
 
+    system.line_break()
+
+    local rt_main = LED{parent=system,label="RT MAIN",colors=led_grn}
+    local rt_render = LED{parent=system,label="RT RENDER",colors=led_grn}
+
+    rt_main.register(ps, "routine__main", rt_main.update)
+    rt_render.register(ps, "routine__render", rt_render.update)
+
 ---@diagnostic disable-next-line: undefined-field
     local comp_id = util.sprintf("(%d)", os.getComputerID())
-    TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)}
+    TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=style.fp.disabled_fg}
 
     local monitors = Div{parent=main_page,width=16,height=17,x=18,y=2}
 
-    local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=cpair(colors.green,colors.green_off)}
+    local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=led_grn}
     main_monitor.register(ps, "main_monitor", main_monitor.update)
 
+    local flow_monitor = LED{parent=monitors,label="FLOW MONITOR",colors=led_grn}
+    flow_monitor.register(ps, "flow_monitor", flow_monitor.update)
+
     monitors.line_break()
 
     for i = 1, num_units do
-        local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=cpair(colors.green,colors.green_off)}
+        local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=led_grn}
         unit_monitor.register(ps, "unit_monitor_" .. i, unit_monitor.update)
     end
 
@@ -84,9 +131,9 @@ local function init(panel, num_units)
     -- about footer
     --
 
-    local about   = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=cpair(colors.lightGray,colors.ivory)}
-    local fw_v    = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
-    local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
+    local about   = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=style.fp.disabled_fg}
+    local fw_v    = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00",alignment=ALIGN.LEFT,height=1}
+    local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00",alignment=ALIGN.LEFT,height=1}
 
     fw_v.register(ps, "version", function (version) fw_v.set_value(util.c("FW: ", version)) end)
     comms_v.register(ps, "comms_version", function (version) comms_v.set_value(util.c("NT: v", version)) end)
@@ -98,7 +145,7 @@ local function init(panel, num_units)
     -- API page
 
     local api_page = Div{parent=page_div,x=1,y=1,hidden=true}
-    local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=cpair(colors.black,colors.ivory),nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
+    local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=style.fp.text_fg,nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
     local _ = Div{parent=api_list,height=1,hidden=true} -- padding
 
     -- assemble page panes
@@ -108,11 +155,11 @@ local function init(panel, num_units)
     local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
 
     local tabs = {
-        { name = "CRD", color = cpair(colors.black, colors.ivory) },
-        { name = "API", color = cpair(colors.black, colors.ivory) },
+        { name = "CRD", color = style.fp.text },
+        { name = "API", color = style.fp.text },
     }
 
-    TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=cpair(colors.black,colors.white)}
+    TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=style.fp_theme.highlight_box_bright}
 
     -- link pocket API list management to PGI
     pgi.link_elements(api_list, pkt_entry)

coordinator/ui/layout/main_view.lua

@@ -18,21 +18,21 @@ local TextBox       = require("graphics.elements.textbox")
 
 local DataIndicator = require("graphics.elements.indicators.data")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
-
-local cpair = core.cpair
+local ALIGN = core.ALIGN
 
 -- create new main view
 ---@param main graphics_element main displaybox
 local function init(main)
+    local s_header = style.theme.header
+
     local facility = iocontrol.get_db().facility
     local units = iocontrol.get_db().units
 
     -- window header message
-    local header = TextBox{parent=main,y=1,text="Nuclear Generation Facility SCADA Coordinator",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
-    local ping = DataIndicator{parent=main,x=1,y=1,label="SVTT",format="%d",value=0,unit="ms",lu_colors=cpair(colors.lightGray, colors.white),width=12,fg_bg=style.header}
+    local header = TextBox{parent=main,y=1,text="Nuclear Generation Facility SCADA Coordinator",alignment=ALIGN.CENTER,height=1,fg_bg=s_header}
+    local ping = DataIndicator{parent=main,x=1,y=1,label="SVTT",format="%d",value=0,unit="ms",lu_colors=style.lg_white,width=12,fg_bg=s_header}
     -- max length example: "01:23:45 AM - Wednesday, September 28 2022"
-    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=TEXT_ALIGN.RIGHT,width=42,height=1,fg_bg=style.header}
+    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=ALIGN.RIGHT,width=42,height=1,fg_bg=s_header}
 
     ping.register(facility.ps, "sv_ping", ping.update)
     datetime.register(facility.ps, "date_time", datetime.set_value)
@@ -55,6 +55,8 @@ local function init(main)
 
     cnc_y_start = cnc_y_start + row_1_height + 1
 
+    util.nop()
+
     if facility.num_units >= 3 then
         -- base offset 3, spacing 1, max height of units 1 and 2
         local row_2_offset = cnc_y_start
@@ -66,23 +68,25 @@ local function init(main)
             uo_4 = unit_overview(main, 84, row_2_offset, units[4])
             cnc_y_start = math.max(cnc_y_start, row_2_offset + uo_4.get_height() + 1)
         end
+
+        util.nop()
     end
 
     -- command & control
 
-    cnc_y_start = cnc_y_start
-
     -- induction matrix and process control interfaces are 24 tall + space needed for divider
     local cnc_bottom_align_start = main.get_height() - 26
 
     assert(cnc_bottom_align_start >= cnc_y_start, "main display not of sufficient vertical resolution (add an additional row of monitors)")
 
-    TextBox{parent=main,y=cnc_bottom_align_start,text=util.strrep("\x8c", header.get_width()),alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=cpair(colors.lightGray,colors.gray)}
+    TextBox{parent=main,y=cnc_bottom_align_start,text=string.rep("\x8c", header.get_width()),alignment=ALIGN.CENTER,height=1,fg_bg=style.lg_gray}
 
     cnc_bottom_align_start = cnc_bottom_align_start + 2
 
     process_ctl(main, 2, cnc_bottom_align_start)
 
+    util.nop()
+
     imatrix(main, 131, cnc_bottom_align_start, facility.induction_data_tbl[1], facility.induction_ps_tbl[1])
 end
 

coordinator/ui/style.lua

@@ -2,73 +2,149 @@
 -- Graphics Style Options
 --
 
-local core = require("graphics.core")
+local util   = require("scada-common.util")
 
+local core   = require("graphics.core")
+local themes = require("graphics.themes")
+
+---@class crd_style
 local style = {}
 
 local cpair = core.cpair
 
--- GLOBAL --
-
--- add color mappings for front panel
-colors.ivory = colors.pink
-colors.yellow_hc = colors.purple
-colors.red_off = colors.brown
-colors.yellow_off = colors.magenta
-colors.green_off = colors.lime
-
 -- front panel styling
 
-style.fp = {}
+style.fp_theme = themes.sandstone
+style.fp = themes.get_fp_style(style.fp_theme)
 
-style.fp.root = cpair(colors.black, colors.ivory)
-style.fp.header = cpair(colors.black, colors.lightGray)
-
-style.fp.colors = {
-    { c = colors.red,       hex = 0xdf4949 },   -- RED ON
-    { c = colors.orange,    hex = 0xffb659 },
-    { c = colors.yellow,    hex = 0xf9fb53 },   -- YELLOW ON
-    { c = colors.lime,      hex = 0x16665a },   -- GREEN OFF
-    { c = colors.green,     hex = 0x6be551 },   -- GREEN ON
-    { c = colors.cyan,      hex = 0x34bac8 },
-    { c = colors.lightBlue, hex = 0x6cc0f2 },
-    { c = colors.blue,      hex = 0x0096ff },
-    { c = colors.purple,    hex = 0xb156ee },   -- YELLOW HIGH CONTRAST
-    { c = colors.pink,      hex = 0xdcd9ca },   -- IVORY
-    { c = colors.magenta,   hex = 0x85862c },   -- YELLOW OFF
-    -- { c = colors.white,     hex = 0xdcd9ca },
-    { c = colors.lightGray, hex = 0xb1b8b3 },
-    { c = colors.gray,      hex = 0x575757 },
-    -- { c = colors.black,     hex = 0x191919 },
-    { c = colors.brown,     hex = 0x672223 }    -- RED OFF
-}
+style.led_grn = cpair(colors.green, colors.green_off)
 
 -- main GUI styling
 
-style.root = cpair(colors.black, colors.lightGray)
-style.header = cpair(colors.white, colors.gray)
-style.label = cpair(colors.gray, colors.lightGray)
+---@class theme
+local smooth_stone = {
+    text = colors.black,
+    text_inv = colors.white,
+    label = colors.gray,
+    label_dark = colors.gray,
+    disabled = colors.lightGray,
+    bg = colors.lightGray,
+    checkbox_bg = colors.black,
+    accent_light = colors.white,
+    accent_dark = colors.gray,
 
-style.colors = {
-    { c = colors.red,       hex = 0xdf4949 },
-    { c = colors.orange,    hex = 0xffb659 },
-    { c = colors.yellow,    hex = 0xfffc79 },
-    { c = colors.lime,      hex = 0x80ff80 },
-    { c = colors.green,     hex = 0x4aee8a },
-    { c = colors.cyan,      hex = 0x34bac8 },
-    { c = colors.lightBlue, hex = 0x6cc0f2 },
-    { c = colors.blue,      hex = 0x0096ff },
-    { c = colors.purple,    hex = 0xb156ee },
-    { c = colors.pink,      hex = 0xf26ba2 },
-    { c = colors.magenta,   hex = 0xf9488a },
-    -- { c = colors.white,     hex = 0xf0f0f0 },
-    { c = colors.lightGray, hex = 0xcacaca },
-    { c = colors.gray,      hex = 0x575757 },
-    -- { c = colors.black,     hex = 0x191919 },
-    -- { c = colors.brown,     hex = 0x7f664c }
+    fuel_color = colors.black,
+
+    header = cpair(colors.white, colors.gray),
+
+    text_fg = cpair(colors.black, colors._INHERIT),
+    label_fg = cpair(colors.gray, colors._INHERIT),
+    disabled_fg = cpair(colors.lightGray, colors._INHERIT),
+
+    highlight_box = cpair(colors.black, colors.white),
+    highlight_box_bright = cpair(colors.black, colors.white),
+    field_box = cpair(colors.black, colors.white),
+
+    colors = themes.smooth_stone.colors,
+
+    -- color re-mappings for assistive modes
+    color_modes = themes.smooth_stone.color_modes
 }
 
--- MAIN LAYOUT --
+---@type theme
+local deepslate = {
+    text = colors.white,
+    text_inv = colors.black,
+    label = colors.lightGray,
+    label_dark = colors.gray,
+    disabled = colors.gray,
+    bg = colors.black,
+    checkbox_bg = colors.gray,
+    accent_light = colors.gray,
+    accent_dark = colors.lightGray,
+
+    fuel_color = colors.lightGray,
+
+    header = cpair(colors.white, colors.gray),
+
+    text_fg = cpair(colors.white, colors._INHERIT),
+    label_fg = cpair(colors.lightGray, colors._INHERIT),
+    disabled_fg = cpair(colors.gray, colors._INHERIT),
+
+    highlight_box = cpair(colors.white, colors.gray),
+    highlight_box_bright = cpair(colors.black, colors.lightGray),
+    field_box = cpair(colors.white, colors.gray),
+
+    colors = themes.deepslate.colors,
+
+    -- color re-mappings for assistive modes
+    color_modes = themes.deepslate.color_modes
+}
+
+style.theme = smooth_stone
+
+-- set themes per configurations
+---@param main UI_THEME main UI theme
+---@param fp FP_THEME front panel theme
+---@param color_mode COLOR_MODE the color mode to use
+function style.set_themes(main, fp, color_mode)
+    local colorblind = color_mode ~= themes.COLOR_MODE.STANDARD and color_mode ~= themes.COLOR_MODE.STD_ON_BLACK
+    local gray_ind_off = color_mode == themes.COLOR_MODE.STANDARD or color_mode == themes.COLOR_MODE.BLUE_IND
+
+    style.ind_bkg = colors.gray
+    style.fp_ind_bkg = util.trinary(gray_ind_off, colors.gray, colors.black)
+    style.ind_hi_box_bg = util.trinary(gray_ind_off, colors.gray, colors.black)
+
+    if main == themes.UI_THEME.SMOOTH_STONE then
+        style.theme = smooth_stone
+        style.ind_bkg = util.trinary(gray_ind_off, colors.gray, colors.black)
+    elseif main == themes.UI_THEME.DEEPSLATE then
+        style.theme = deepslate
+        style.ind_hi_box_bg = util.trinary(gray_ind_off, colors.lightGray, colors.black)
+    end
+
+    style.colorblind = colorblind
+
+    style.root = cpair(style.theme.text, style.theme.bg)
+    style.label = cpair(style.theme.label, style.theme.bg)
+
+    -- high contrast text (also tags)
+    style.hc_text = cpair(style.theme.text, style.theme.text_inv)
+    -- text on default background
+    style.text_colors = cpair(style.theme.text, style.theme.bg)
+    -- label & unit colors
+    style.lu_colors = cpair(style.theme.label, style.theme.label)
+    -- label & unit colors (darker if set)
+    style.lu_colors_dark = cpair(style.theme.label_dark, style.theme.label_dark)
+
+    style.ind_grn = cpair(util.trinary(colorblind, colors.blue, colors.green), style.ind_bkg)
+    style.ind_yel = cpair(colors.yellow, style.ind_bkg)
+    style.ind_red = cpair(colors.red, style.ind_bkg)
+    style.ind_wht = cpair(colors.white, style.ind_bkg)
+
+    if fp == themes.FP_THEME.SANDSTONE then
+        style.fp_theme = themes.sandstone
+    elseif fp == themes.FP_THEME.BASALT then
+        style.fp_theme = themes.basalt
+    end
+
+    style.fp = themes.get_fp_style(style.fp_theme)
+end
+
+-- COMMON COLOR PAIRS --
+
+style.wh_gray = cpair(colors.white, colors.gray)
+
+style.bw_fg_bg = cpair(colors.black, colors.white)
+
+style.hzd_fg_bg  = style.wh_gray
+style.dis_colors = cpair(colors.white, colors.lightGray)
+
+style.lg_gray = cpair(colors.lightGray, colors.gray)
+style.lg_white = cpair(colors.lightGray, colors.white)
+style.gray_white = cpair(colors.gray, colors.white)
+
+-- UI COMPONENTS --
 
 style.reactor = {
     -- reactor states
@@ -206,7 +282,7 @@ style.sps = {
             text = "RTU  FAULT"
         },
         {
-            color = cpair(colors.black, colors.gray),
+            color = cpair(colors.white, colors.gray),
             text = "IDLE"
         },
         {
@@ -216,6 +292,36 @@ style.sps = {
     }
 }
 
+style.dtank = {
+    -- dynamic tank states
+    states = {
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "OFF-LINE"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "NOT FORMED"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "RTU  FAULT"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "ONLINE"
+        },
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "LOW FILL"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "FILLED"
+        },
+    }
+}
+
 style.waste = {
     -- auto waste processing states
     states = {

graphics/core.lua

@@ -7,19 +7,15 @@ local flasher = require("graphics.flasher")
 
 local core = {}
 
-core.version = "1.0.2"
+core.version = "2.2.4"
 
 core.flasher = flasher
 core.events = events
 
 -- Core Types
 
----@enum TEXT_ALIGN
-core.TEXT_ALIGN = {
-    LEFT = 1,
-    CENTER = 2,
-    RIGHT = 3
-}
+---@enum ALIGN
+core.ALIGN = { LEFT = 1, CENTER = 2, RIGHT = 3 }
 
 ---@class graphics_border
 ---@field width integer
@@ -35,11 +31,7 @@ core.TEXT_ALIGN = {
 ---@param even? boolean whether to pad width extra to account for rectangular pixels, defaults to false
 ---@return graphics_border
 function core.border(width, color, even)
-    return {
-        width = width,
-        color = color,
-        even = even or false    -- convert nil to false
-    }
+    return { width = width, color = color, even = even or false }
 end
 
 ---@class graphics_frame
@@ -56,12 +48,7 @@ end
 ---@param h integer
 ---@return graphics_frame
 function core.gframe(x, y, w, h)
-    return {
-        x = x,
-        y = y,
-        w = w,
-        h = h
-    }
+    return { x = x, y = y, w = w, h = h }
 end
 
 ---@class cpair
@@ -74,6 +61,9 @@ end
 ---@field blit_fgd string
 ---@field blit_bkg string
 
+-- add inherited flag, 3 isn't a pure color so it wouldn't be used
+colors._INHERIT = 3
+
 -- create a new color pair definition
 ---@nodiscard
 ---@param a color
@@ -82,15 +72,9 @@ end
 function core.cpair(a, b)
     return {
         -- color pairs
-        color_a = a,
-        color_b = b,
-        blit_a = colors.toBlit(a),
-        blit_b = colors.toBlit(b),
+        color_a = a, color_b = b, blit_a = colors.toBlit(a), blit_b = colors.toBlit(b),
         -- aliases
-        fgd = a,
-        bkg = b,
-        blit_fgd = colors.toBlit(a),
-        blit_bkg = colors.toBlit(b)
+        fgd = a, bkg = b, blit_fgd = colors.toBlit(a), blit_bkg = colors.toBlit(b)
     }
 end
 
@@ -130,4 +114,215 @@ function core.pipe(x1, y1, x2, y2, color, thin, align_tr)
     }
 end
 
+-- Assertion Handling
+
+-- extract the custom element assert message, dropping the path to the element file
+function core.extract_assert_msg(msg)
+    return string.sub(msg, (string.find(msg, "@") or 0) + 1)
+end
+
+-- Interactive Field Manager
+
+---@param e graphics_base
+---@param max_len any
+---@param fg_bg any
+---@param dis_fg_bg any
+function core.new_ifield(e, max_len, fg_bg, dis_fg_bg)
+    local self = {
+        frame_start = 1,
+        visible_text = e.value,
+        cursor_pos = string.len(e.value) + 1,
+        selected_all = false
+    }
+
+    -- update visible text
+    local function _update_visible()
+        self.visible_text = string.sub(e.value, self.frame_start, self.frame_start + math.min(string.len(e.value), e.frame.w) - 1)
+    end
+
+    -- try shifting frame left
+    local function _try_lshift()
+        if self.frame_start > 1 then
+            self.frame_start = self.frame_start - 1
+            return true
+        end
+    end
+
+    -- try shifting frame right
+    local function _try_rshift()
+        if (self.frame_start + e.frame.w - 1) <= string.len(e.value) then
+            self.frame_start = self.frame_start + 1
+            return true
+        end
+    end
+
+    ---@class ifield
+    local public = {}
+
+    -- censor the display (for private info, for example) with the provided character<br>
+    -- disable by passing no argument
+    ---@param censor string? character to hide data with
+    function public.censor(censor)
+        if type(censor) == "string" and string.len(censor) == 1 then
+            self.censor = censor
+        else self.censor = nil end
+        public.show()
+    end
+
+    -- show the field
+    function public.show()
+        _update_visible()
+
+        if e.enabled then
+            e.w_set_bkg(fg_bg.bkg)
+            e.w_set_fgd(fg_bg.fgd)
+        elseif dis_fg_bg ~= nil then
+            e.w_set_bkg(dis_fg_bg.bkg)
+            e.w_set_fgd(dis_fg_bg.fgd)
+        end
+
+        -- clear and print
+        e.w_set_cur(1, 1)
+        e.w_write(string.rep(" ", e.frame.w))
+        e.w_set_cur(1, 1)
+
+        local function _write()
+            if self.censor then
+                e.w_write(string.rep(self.censor, string.len(self.visible_text)))
+            else
+                e.w_write(self.visible_text)
+            end
+        end
+
+        if e.is_focused() and e.enabled then
+            -- write text with cursor
+            if self.selected_all then
+                e.w_set_bkg(fg_bg.fgd)
+                e.w_set_fgd(fg_bg.bkg)
+                _write()
+            elseif self.cursor_pos >= (string.len(self.visible_text) + 1) then
+                -- write text with cursor at the end, no need to blit
+                _write()
+                e.w_set_fgd(colors.lightGray)
+                e.w_write("_")
+            else
+                local a, b = "", ""
+
+                if self.cursor_pos <= string.len(self.visible_text) then
+                    a = fg_bg.blit_bkg
+                    b = fg_bg.blit_fgd
+                end
+
+                local b_fgd = string.rep(fg_bg.blit_fgd, self.cursor_pos - 1) .. a .. string.rep(fg_bg.blit_fgd, string.len(self.visible_text) - self.cursor_pos)
+                local b_bkg = string.rep(fg_bg.blit_bkg, self.cursor_pos - 1) .. b .. string.rep(fg_bg.blit_bkg, string.len(self.visible_text) - self.cursor_pos)
+
+                if self.censor then
+                    e.w_blit(string.rep(self.censor, string.len(self.visible_text)), b_fgd, b_bkg)
+                else
+                    e.w_blit(self.visible_text, b_fgd, b_bkg)
+                end
+            end
+        else
+            self.selected_all = false
+
+            -- write text without cursor
+            _write()
+        end
+    end
+
+    -- move cursor to x
+    ---@param x integer
+    function public.move_cursor(x)
+        self.selected_all = false
+        self.cursor_pos = math.min(x, string.len(self.visible_text) + 1)
+        public.show()
+    end
+
+    -- select all text
+    function public.select_all()
+        self.selected_all = true
+        public.show()
+    end
+
+    -- set field value
+    ---@param val string
+    function public.set_value(val)
+        e.value = string.sub(val, 1, math.min(max_len, string.len(val)))
+        public.nav_end()
+    end
+
+    -- try to insert a character if there is space
+    ---@param char string
+    function public.try_insert_char(char)
+        -- limit length
+        if string.len(e.value) >= max_len then return end
+
+        -- replace if selected all, insert otherwise
+        if self.selected_all then
+            self.selected_all = false
+            self.cursor_pos = 2
+            self.frame_start = 1
+
+            e.value = char
+            public.show()
+        else
+            e.value = string.sub(e.value, 1, self.frame_start + self.cursor_pos - 2) .. char .. string.sub(e.value, self.frame_start + self.cursor_pos - 1, string.len(e.value))
+            _update_visible()
+            public.nav_right()
+        end
+    end
+
+    -- remove charcter before cursor if there is anything to remove, or delete all if selected all
+    function public.backspace()
+        if self.selected_all then
+            self.selected_all = false
+            e.value = ""
+            self.cursor_pos = 1
+            self.frame_start = 1
+            public.show()
+        else
+            if self.frame_start + self.cursor_pos > 2 then
+                e.value = string.sub(e.value, 1, self.frame_start + self.cursor_pos - 3) .. string.sub(e.value, self.frame_start + self.cursor_pos - 1, string.len(e.value))
+                if self.cursor_pos > 1 then
+                    self.cursor_pos = self.cursor_pos - 1
+                    public.show()
+                elseif _try_lshift() then public.show() end
+            end
+        end
+    end
+
+    -- move cursor left by one
+    function public.nav_left()
+        if self.cursor_pos > 1 then
+            self.cursor_pos = self.cursor_pos - 1
+            public.show()
+        elseif _try_lshift() then public.show() end
+    end
+
+    -- move cursor right by one
+    function public.nav_right()
+        if self.cursor_pos < math.min(string.len(self.visible_text) + 1, e.frame.w) then
+            self.cursor_pos = self.cursor_pos + 1
+            public.show()
+        elseif _try_rshift() then public.show() end
+    end
+
+    -- move cursor to the start
+    function public.nav_start()
+        self.cursor_pos = 1
+        self.frame_start = 1
+        public.show()
+    end
+
+    -- move cursor to the end
+    function public.nav_end()
+        self.frame_start = math.max(1, string.len(e.value) - e.frame.w + 2)
+        _update_visible()
+        self.cursor_pos = string.len(self.visible_text) + 1
+        public.show()
+    end
+
+    return public
+end
+
 return core

graphics/element.lua

@@ -2,8 +2,12 @@
 -- Generic Graphics Element
 --
 
+local util = require("scada-common.util")
+
 local core = require("graphics.core")
 
+local events = core.events
+
 local element = {}
 
 ---@class graphics_args_generic
@@ -17,18 +21,23 @@ local element = {}
 ---@field gframe? graphics_frame frame instead of x/y/width/height
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
+---@field can_focus? boolean true if this element can be focused, false by default
 
 ---@alias graphics_args graphics_args_generic
 ---|waiting_args
+---|app_button_args
 ---|checkbox_args
 ---|hazard_button_args
 ---|multi_button_args
 ---|push_button_args
+---|radio_2d_args
 ---|radio_button_args
 ---|sidebar_args
 ---|spinbox_args
 ---|switch_button_args
 ---|tabbar_args
+---|number_field_args
+---|text_field_args
 ---|alarm_indicator_light
 ---|core_map_args
 ---|data_indicator_args
@@ -40,9 +49,11 @@ local element = {}
 ---|indicator_light_args
 ---|power_indicator_args
 ---|rad_indicator_args
+---|signal_bar_args
 ---|state_indicator_args
 ---|tristate_indicator_light_args
 ---|vbar_args
+---|app_multipane_args
 ---|colormap_args
 ---|displaybox_args
 ---|div_args
@@ -58,6 +69,16 @@ local element = {}
 ---@field key string data key
 ---@field func function callback
 
+-- more detailed assert message for element verification
+---@param condition any assert condition
+---@param msg string assert message
+---@param callstack_offset? integer shift value to change targets of debug.getinfo()
+function element.assert(condition, msg, callstack_offset)
+    callstack_offset = callstack_offset or 0
+    local caller = debug.getinfo(3 + callstack_offset)
+    assert(condition, util.c(caller.source, ":", caller.currentline, "{", debug.getinfo(2 + callstack_offset).name, "}: ", msg))
+end
+
 -- a base graphics element, should not be created on its own
 ---@nodiscard
 ---@param args graphics_args arguments
@@ -66,14 +87,19 @@ local element = {}
 function element.new(args, child_offset_x, child_offset_y)
     local self = {
         id = nil,                                       ---@type element_id|nil
+        is_root = args.parent == nil,
         elem_type = debug.getinfo(2).name,
         define_completed = false,
         p_window = nil,                                 ---@type table
-        position = { x = 1, y = 1 },                    ---@type coordinate_2d
+        position = events.new_coord_2d(1, 1),
         bounds = { x1 = 1, y1 = 1, x2 = 1, y2 = 1 },    ---@class element_bounds
+        offset_x = 0,
+        offset_y = 0,
         next_y = 1,                                     -- next child y coordinate
         next_id = 0,                                    -- next child ID
         subscriptions = {},
+        button_down = { events.new_coord_2d(-1, -1), events.new_coord_2d(-1, -1), events.new_coord_2d(-1, -1) },
+        focused = false,
         mt = {}
     }
 
@@ -83,16 +109,16 @@ function element.new(args, child_offset_x, child_offset_y)
         value = nil,            ---@type any
         window = nil,           ---@type table
         content_window = nil,   ---@type table|nil
+        mouse_window_shift = { x = 0, y = 0 },
         fg_bg = core.cpair(colors.white, colors.black),
         frame = core.gframe(1, 1, 1, 1),
-        children = {}
+        children = {},
+        child_id_map = {}
     }
 
-    local name_brief = "graphics.element{" .. self.elem_type .. "}: "
-
     -- element as string
     function self.mt.__tostring()
-        return "graphics.element{" .. self.elem_type .. "} @ " .. tostring(self)
+        return util.c("graphics.element{", self.elem_type, "} @ ", self)
     end
 
     ---@class graphics_element
@@ -100,6 +126,69 @@ function element.new(args, child_offset_x, child_offset_y)
 
     setmetatable(public, self.mt)
 
+    -----------------------
+    -- PRIVATE FUNCTIONS --
+    -----------------------
+
+    -- use tab to jump to the next focusable field
+    ---@param reverse boolean
+    local function _tab_focusable(reverse)
+        local first_f = nil ---@type graphics_element|nil
+        local prev_f = nil  ---@type graphics_element|nil
+        local cur_f = nil   ---@type graphics_element|nil
+        local done = false
+
+        ---@param elem graphics_element
+        local function handle_element(elem)
+            if elem.is_visible() and elem.is_focusable() and elem.is_enabled() then
+                if first_f == nil then first_f = elem end
+
+                if cur_f == nil then
+                    if elem.is_focused() then
+                        cur_f = elem
+                        if (not done) and (reverse and prev_f ~= nil) then
+                            cur_f.unfocus()
+                            prev_f.focus()
+                            done = true
+                        end
+                    end
+                else
+                    if elem.is_focused() then
+                        elem.unfocus()
+                    elseif not (reverse or done) then
+                        cur_f.unfocus()
+                        elem.focus()
+                        done = true
+                    end
+                end
+
+                prev_f = elem
+            end
+        end
+
+        ---@param children table
+        local function traverse(children)
+            for i = 1, #children do
+                local child = children[i]   ---@type graphics_base
+                handle_element(child.get())
+                if child.get().is_visible() then traverse(child.children) end
+            end
+        end
+
+        traverse(protected.children)
+
+        -- if no element was focused, wrap focus
+        if first_f ~= nil and not done then
+            if reverse then
+                if cur_f ~= nil then cur_f.unfocus() end
+                if prev_f ~= nil then prev_f.focus() end
+            else
+                if cur_f ~= nil then cur_f.unfocus() end
+                first_f.focus()
+            end
+        end
+    end
+
     -------------------------
     -- PROTECTED FUNCTIONS --
     -------------------------
@@ -109,6 +198,13 @@ function element.new(args, child_offset_x, child_offset_y)
     ---@param offset_y integer y offset for mouse events
     ---@param next_y integer next line if no y was provided
     function protected.prepare_template(offset_x, offset_y, next_y)
+        -- don't auto incrememnt y if inheriting height, that would cause an assertion
+        next_y = util.trinary(args.height == nil, 1, next_y)
+
+        -- record offsets in case there is a reposition
+        self.offset_x = offset_x
+        self.offset_y = offset_y
+
         -- get frame coordinates/size
         if args.gframe ~= nil then
             protected.frame.x = args.gframe.x
@@ -133,21 +229,34 @@ function element.new(args, child_offset_x, child_offset_y)
         end
 
         -- check frame
-        assert(f.x >= 1, name_brief .. "frame x not >= 1")
-        assert(f.y >= 1, name_brief .. "frame y not >= 1")
-        assert(f.w >= 1, name_brief .. "frame width not >= 1")
-        assert(f.h >= 1, name_brief .. "frame height not >= 1")
+        element.assert(f.x >= 1, "frame x not >= 1", 3)
+        element.assert(f.y >= 1, "frame y not >= 1", 3)
+        element.assert(f.w >= 1, "frame width not >= 1", 3)
+        element.assert(f.h >= 1, "frame height not >= 1", 3)
 
         -- create window
         protected.window = window.create(self.p_window, f.x, f.y, f.w, f.h, args.hidden ~= true)
 
         -- init colors
         if args.fg_bg ~= nil then
-            protected.fg_bg = args.fg_bg
-        elseif args.parent ~= nil then
-            protected.fg_bg = args.parent.get_fg_bg()
+            protected.fg_bg = core.cpair(args.fg_bg.fgd, args.fg_bg.bkg)
         end
 
+        if args.parent ~= nil then
+            local p_fg_bg = args.parent.get_fg_bg()
+
+            if args.fg_bg == nil then
+                protected.fg_bg = core.cpair(p_fg_bg.fgd, p_fg_bg.bkg)
+            else
+                if protected.fg_bg.fgd == colors._INHERIT then protected.fg_bg = core.cpair(p_fg_bg.fgd, protected.fg_bg.bkg) end
+                if protected.fg_bg.bkg == colors._INHERIT then protected.fg_bg = core.cpair(protected.fg_bg.fgd, p_fg_bg.bkg) end
+            end
+        end
+
+        -- check colors
+        element.assert(protected.fg_bg.fgd ~= colors._INHERIT, "could not determine foreground color to inherit")
+        element.assert(protected.fg_bg.bkg ~= colors._INHERIT, "could not determine background color to inherit")
+
         -- set colors
         protected.window.setBackgroundColor(protected.fg_bg.bkg)
         protected.window.setTextColor(protected.fg_bg.fgd)
@@ -165,6 +274,31 @@ function element.new(args, child_offset_x, child_offset_y)
         self.bounds.x2 = self.position.x + f.w - 1
         self.bounds.y1 = self.position.y
         self.bounds.y2 = self.position.y + f.h - 1
+
+        -- alias functions
+
+        -- window set cursor position
+        ---@param x integer
+        ---@param y integer
+        function protected.w_set_cur(x, y) protected.window.setCursorPos(x, y) end
+
+        -- set background color
+        ---@param c color
+        function protected.w_set_bkg(c) protected.window.setBackgroundColor(c) end
+
+        -- set foreground (text) color
+        ---@param c color
+        function protected.w_set_fgd(c) protected.window.setTextColor(c) end
+
+        -- write text
+        ---@param str string
+        function protected.w_write(str) protected.window.write(str) end
+
+        -- blit text
+        ---@param str string
+        ---@param fg string
+        ---@param bg string
+        function protected.w_blit(str, fg, bg) protected.window.blit(str, fg, bg) end
     end
 
     -- check if a coordinate relative to the parent is within the bounds of this element
@@ -185,85 +319,6 @@ function element.new(args, child_offset_x, child_offset_y)
         return in_x and in_y
     end
 
--- luacheck: push ignore
----@diagnostic disable: unused-local, unused-vararg
-
-    -- handle a child element having been added
-    ---@param id element_id element identifier
-    ---@param child graphics_element child element
-    function protected.on_added(id, child)
-    end
-
-    -- handle a child element having been removed
-    ---@param id element_id element identifier
-    function protected.on_removed(id)
-    end
-
-    -- handle a mouse event
-    ---@param event mouse_interaction mouse interaction event
-    function protected.handle_mouse(event)
-    end
-
-    -- handle data value changes
-    ---@vararg any value(s)
-    function protected.on_update(...)
-    end
-
-    -- callback on control press responses
-    ---@param result any
-    function protected.response_callback(result)
-    end
-
-    -- get value
-    ---@nodiscard
-    function protected.get_value()
-        return protected.value
-    end
-
-    -- set value
-    ---@param value any value to set
-    function protected.set_value(value)
-    end
-
-    -- set minimum input value
-    ---@param min integer minimum allowed value
-    function protected.set_min(min)
-    end
-
-    -- set maximum input value
-    ---@param max integer maximum allowed value
-    function protected.set_max(max)
-    end
-
-    -- enable the control
-    function protected.enable()
-    end
-
-    -- disable the control
-    function protected.disable()
-    end
-
-    -- custom recolor command, varies by element if implemented
-    ---@vararg cpair|color color(s)
-    function protected.recolor(...)
-    end
-
-    -- custom resize command, varies by element if implemented
-    ---@vararg integer sizing
-    function protected.resize(...)
-    end
-
--- luacheck: pop
----@diagnostic enable: unused-local, unused-vararg
-
-    -- start animations
-    function protected.start_anim()
-    end
-
-    -- stop animations
-    function protected.stop_anim()
-    end
-
     -- get public interface
     ---@nodiscard
     ---@return graphics_element element, element_id id
@@ -277,6 +332,111 @@ function element.new(args, child_offset_x, child_offset_y)
         return public, self.id
     end
 
+    -- protected version of public is_focused()
+    ---@nodiscard
+    ---@return boolean is_focused
+    function protected.is_focused() return self.focused end
+
+    -- defocus this element
+    function protected.defocus() public.unfocus_all() end
+
+    -- focus this element and take away focus from all other elements
+    function protected.take_focus() args.parent.__focus_child(public) end
+
+    -- action handlers --
+
+-- luacheck: push ignore
+---@diagnostic disable: unused-local, unused-vararg
+
+    -- handle a child element having been added
+    ---@param id element_id element identifier
+    ---@param child graphics_element child element
+    function protected.on_added(id, child) end
+
+    -- handle a child element having been removed
+    ---@param id element_id element identifier
+    function protected.on_removed(id) end
+
+    -- handle enabled
+    function protected.on_enabled() end
+
+    -- handle disabled
+    function protected.on_disabled() end
+
+    -- handle this element having been focused
+    function protected.on_focused() end
+
+    -- handle this element having been unfocused
+    function protected.on_unfocused() end
+
+    -- handle this element having had a child focused
+    ---@param child graphics_element
+    function protected.on_child_focused(child) end
+
+    -- handle this element having been shown
+    function protected.on_shown() end
+
+    -- handle this element having been hidden
+    function protected.on_hidden() end
+
+    -- handle a mouse event
+    ---@param event mouse_interaction mouse interaction event
+    function protected.handle_mouse(event) end
+
+    -- handle a keyboard event
+    ---@param event key_interaction key interaction event
+    function protected.handle_key(event) end
+
+    -- handle a paste event
+    ---@param text string pasted text
+    function protected.handle_paste(text) end
+
+    -- handle data value changes
+    ---@vararg any value(s)
+    function protected.on_update(...) end
+
+    -- callback on control press responses
+    ---@param result any
+    function protected.response_callback(result) end
+
+    -- accessors and control --
+
+    -- get value
+    ---@nodiscard
+    function protected.get_value() return protected.value end
+
+    -- set value
+    ---@param value any value to set
+    function protected.set_value(value) end
+
+    -- set minimum input value
+    ---@param min integer minimum allowed value
+    function protected.set_min(min) end
+
+    -- set maximum input value
+    ---@param max integer maximum allowed value
+    function protected.set_max(max) end
+
+    -- custom recolor command, varies by element if implemented
+    ---@vararg cpair|color color(s)
+    function protected.recolor(...) end
+
+    -- custom resize command, varies by element if implemented
+    ---@vararg integer sizing
+    function protected.resize(...) end
+
+-- luacheck: pop
+---@diagnostic enable: unused-local, unused-vararg
+
+    -- re-draw this element
+    function protected.redraw() end
+
+    -- start animations
+    function protected.start_anim() end
+
+    -- stop animations
+    function protected.stop_anim() end
+
     -----------
     -- SETUP --
     -----------
@@ -288,7 +448,7 @@ function element.new(args, child_offset_x, child_offset_y)
     end
 
     -- check window
-    assert(self.p_window, name_brief .. "no parent window provided")
+    element.assert(self.p_window, "no parent window provided", 1)
 
     -- prepare the template
     if args.parent == nil then
@@ -329,7 +489,7 @@ function element.new(args, child_offset_x, child_offset_y)
 
         -- delete all children
         for k, v in pairs(protected.children) do
-            v.delete()
+            v.get().delete()
             protected.children[k] = nil
         end
 
@@ -351,65 +511,94 @@ function element.new(args, child_offset_x, child_offset_y)
 
         self.next_y = child.frame.y + child.frame.h
 
-        local child_element = child.get()
-
         local id = key  ---@type string|integer|nil
         if id == nil then
             id = self.next_id
             self.next_id = self.next_id + 1
         end
 
-        protected.children[id] = child_element
+        table.insert(protected.children, child)
+
+        protected.child_id_map[id] = #protected.children
+
         return id
     end
 
     -- remove a child element
-    ---@param key element_id id
-    function public.__remove_child(key)
-        if protected.children[key] ~= nil then
-            protected.on_removed(key)
-            protected.children[key] = nil
+    ---@param id element_id id
+    function public.__remove_child(id)
+        local index = protected.child_id_map[id]
+        if protected.children[index] ~= nil then
+            protected.on_removed(id)
+            protected.children[index] = nil
+            protected.child_id_map[id] = nil
         end
     end
 
     -- actions to take upon a child element becoming ready (initial draw/construction completed)
     ---@param key element_id id
     ---@param child graphics_element
-    function public.__child_ready(key, child)
-        protected.on_added(key, child)
+    function public.__child_ready(key, child) protected.on_added(key, child) end
+
+    -- focus solely on this child
+    ---@param child graphics_element
+    function public.__focus_child(child)
+        if self.is_root then
+            public.unfocus_all()
+            child.focus()
+        else args.parent.__focus_child(child) end
+    end
+
+    -- a child was focused, used to make sure it is actually visible to the user in the content frame
+    ---@param child graphics_element
+    function public.__child_focused(child)
+        protected.on_child_focused(child)
+        if not self.is_root then args.parent.__child_focused(public) end
     end
 
     -- get a child element
     ---@nodiscard
     ---@param id element_id
     ---@return graphics_element
-    function public.get_child(id) return protected.children[id] end
+    function public.get_child(id) return protected.children[protected.child_id_map[id]].get() end
 
     -- remove a child element
     ---@param id element_id
     function public.remove(id)
-        if protected.children[id] ~= nil then
-            protected.children[id].delete()
+        local index = protected.child_id_map[id]
+        if protected.children[index] ~= nil then
+            protected.children[index].get().delete()
             protected.on_removed(id)
-            protected.children[id] = nil
+            protected.children[index] = nil
+            protected.child_id_map[id] = nil
         end
     end
 
+    -- remove all child elements and reset next y
+    function public.remove_all()
+        for i = 1, #protected.children do
+            local child = protected.children[i].get()   ---@type graphics_element
+            child.delete()
+            protected.on_removed(child.get_id())
+        end
+
+        self.next_y = 1
+        protected.children = {}
+        protected.child_id_map = {}
+    end
+
     -- attempt to get a child element by ID (does not include this element itself)
     ---@nodiscard
     ---@param id element_id
     ---@return graphics_element|nil element
     function public.get_element_by_id(id)
-        if protected.children[id] == nil then
+        local index = protected.child_id_map[id]
+        if protected.children[index] == nil then
             for _, child in pairs(protected.children) do
-                local elem = child.get_element_by_id(id)
+                local elem = child.get().get_element_by_id(id)
                 if elem ~= nil then return elem end
             end
-        else
-            return protected.children[id]
-        end
-
-        return nil
+        else return protected.children[index].get() end
     end
 
     -- AUTO-PLACEMENT --
@@ -421,89 +610,109 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- PROPERTIES --
 
-    -- get the foreground/background colors
+    -- get element id
     ---@nodiscard
-    ---@return cpair fg_bg
-    function public.get_fg_bg()
-        return protected.fg_bg
-    end
+    ---@return element_id
+    function public.get_id() return self.id end
 
     -- get element x
     ---@nodiscard
     ---@return integer x
-    function public.get_x()
-        return protected.frame.x
-    end
+    function public.get_x() return protected.frame.x end
 
     -- get element y
     ---@nodiscard
     ---@return integer y
-    function public.get_y()
-        return protected.frame.y
-    end
+    function public.get_y() return protected.frame.y end
 
     -- get element width
     ---@nodiscard
     ---@return integer width
-    function public.get_width()
-        return protected.frame.w
-    end
+    function public.get_width() return protected.frame.w end
 
     -- get element height
     ---@nodiscard
     ---@return integer height
-    function public.get_height()
-        return protected.frame.h
-    end
+    function public.get_height() return protected.frame.h end
+
+    -- get the foreground/background colors
+    ---@nodiscard
+    ---@return cpair fg_bg
+    function public.get_fg_bg() return protected.fg_bg end
 
     -- get the element value
     ---@nodiscard
     ---@return any value
-    function public.get_value()
-        return protected.get_value()
-    end
+    function public.get_value() return protected.get_value() end
 
     -- set the element value
     ---@param value any new value
-    function public.set_value(value)
-        protected.set_value(value)
-    end
+    function public.set_value(value) protected.set_value(value) end
 
     -- set minimum input value
     ---@param min integer minimum allowed value
-    function public.set_min(min)
-        protected.set_min(min)
-    end
+    function public.set_min(min) protected.set_min(min) end
 
     -- set maximum input value
     ---@param max integer maximum allowed value
-    function public.set_max(max)
-        protected.set_max(max)
-    end
+    function public.set_max(max) protected.set_max(max) end
+
+    -- check if this element is enabled
+    function public.is_enabled() return protected.enabled end
 
     -- enable the element
     function public.enable()
-        protected.enabled = true
-        protected.enable()
+        if not protected.enabled then
+            protected.enabled = true
+            protected.on_enabled()
+        end
     end
 
     -- disable the element
     function public.disable()
-        protected.enabled = false
-        protected.disable()
+        if protected.enabled then
+            protected.enabled = false
+            protected.on_disabled()
+            public.unfocus_all()
+        end
+    end
+
+    -- can this element be focused
+    function public.is_focusable() return args.can_focus end
+
+    -- is this element focused
+    function public.is_focused() return self.focused end
+
+    -- focus the element
+    function public.focus()
+        if args.can_focus and protected.enabled and not self.focused then
+            self.focused = true
+            protected.on_focused()
+            if not self.is_root then args.parent.__child_focused(public) end
+        end
+    end
+
+    -- unfocus this element
+    function public.unfocus()
+        if args.can_focus and self.focused then
+            self.focused = false
+            protected.on_unfocused()
+        end
+    end
+
+    -- unfocus this element and all its children
+    function public.unfocus_all()
+        public.unfocus()
+        for _, child in pairs(protected.children) do child.get().unfocus_all() end
     end
 
     -- custom recolor command, varies by element if implemented
     ---@vararg cpair|color color(s)
-    function public.recolor(...)
-        protected.recolor(...)
-    end
+    function public.recolor(...) protected.recolor(...) end
 
     -- resize attributes of the element value if supported
     ---@vararg number dimensions (element specific)
-    function public.resize(...)
-        protected.resize(...)
-    end
+    function public.resize(...) protected.resize(...) end
 
     -- reposition the element window<br>
     -- offsets relative to parent frame are where (1, 1) would be on top of the parent's top left corner
@@ -511,37 +720,89 @@ function element.new(args, child_offset_x, child_offset_y)
     ---@param y integer y position relative to parent frame
     function public.reposition(x, y)
         protected.window.reposition(x, y)
+
+        -- record position
+        self.position.x, self.position.y = protected.window.getPosition()
+
+        -- shift per parent child offset
+        self.position.x = self.position.x + self.offset_x
+        self.position.y = self.position.y + self.offset_y
+
+        -- calculate mouse event bounds
+        self.bounds.x1 = self.position.x
+        self.bounds.x2 = self.position.x + protected.frame.w - 1
+        self.bounds.y1 = self.position.y
+        self.bounds.y2 = self.position.y + protected.frame.h - 1
     end
 
     -- FUNCTION CALLBACKS --
 
-    -- handle a monitor touch or mouse click
+    -- handle a monitor touch or mouse click if this element is visible
     ---@param event mouse_interaction mouse interaction event
     function public.handle_mouse(event)
-        local x_ini, y_ini = event.initial.x, event.initial.y
+        if protected.window.isVisible() then
+            local x_ini, y_ini = event.initial.x, event.initial.y
 
-        local ini_in = protected.in_window_bounds(x_ini, y_ini)
+            local ini_in = protected.in_window_bounds(x_ini, y_ini)
 
-        if ini_in then
-            local event_T = core.events.mouse_transposed(event, self.position.x, self.position.y)
+            if ini_in then
+                if event.type == events.MOUSE_CLICK.UP or event.type == events.MOUSE_CLICK.DRAG then
+                    -- make sure we don't handle mouse events that started before this element was made visible
+                    if (event.initial.x ~= self.button_down[event.button].x) or (event.initial.y ~= self.button_down[event.button].y) then
+                        return
+                    end
+                elseif event.type == events.MOUSE_CLICK.DOWN then
+                    self.button_down[event.button] = event.initial
+                end
 
-            -- handle the mouse event then pass to children
-            protected.handle_mouse(event_T)
-            for _, child in pairs(protected.children) do child.handle_mouse(event_T) end
+                local event_T = events.mouse_transposed(event, self.position.x, self.position.y)
+                protected.handle_mouse(event_T)
+
+                -- shift child event if the content window has moved then pass to children
+                local c_event_T = events.mouse_transposed(event_T, protected.mouse_window_shift.x + 1, protected.mouse_window_shift.y + 1)
+                for _, child in pairs(protected.children) do child.get().handle_mouse(c_event_T) end
+            elseif event.type == events.MOUSE_CLICK.DOWN or event.type == events.MOUSE_CLICK.TAP then
+                -- clicked out, unfocus this element and children
+                public.unfocus_all()
+            end
+        else
+            -- don't track clicks while hidden
+            self.button_down[event.button] = events.new_coord_2d(-1, -1)
+        end
+    end
+
+    -- handle a keyboard click if this element is visible and focused
+    ---@param event key_interaction keyboard interaction event
+    function public.handle_key(event)
+        if protected.window.isVisible() then
+            if self.is_root and (event.type == events.KEY_CLICK.DOWN) and (event.key == keys.tab) then
+                -- try to jump to the next/previous focusable field
+                _tab_focusable(event.shift)
+            else
+                -- handle the key event then pass to children
+                if self.focused then protected.handle_key(event) end
+                for _, child in pairs(protected.children) do child.get().handle_key(event) end
+            end
+        end
+    end
+
+    -- handle text paste
+    ---@param text string pasted text
+    function public.handle_paste(text)
+        if protected.window.isVisible() then
+            -- handle the paste event then pass to children
+            if self.focused then protected.handle_paste(text) end
+            for _, child in pairs(protected.children) do child.get().handle_paste(text) end
         end
     end
 
     -- draw the element given new data
     ---@vararg any new data
-    function public.update(...)
-        protected.on_update(...)
-    end
+    function public.update(...) protected.on_update(...) end
 
     -- on a control request response
     ---@param result any
-    function public.on_response(result)
-        protected.response_callback(result)
-    end
+    function public.on_response(result) protected.response_callback(result) end
 
     -- register a callback with a PSIL, allowing for automatic unregister on delete<br>
     -- do not use graphics elements directly with PSIL subscribe()
@@ -555,6 +816,9 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- VISIBILITY & ANIMATIONS --
 
+    -- check if this element is visible
+    function public.is_visible() return protected.window.isVisible() end
+
     -- show the element and enables animations by default
     ---@param animate? boolean true (default) to automatically resume animations
     function public.show(animate)
@@ -564,47 +828,54 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- hide the element and disables animations<br>
     -- this alone does not cause an element to be fully hidden, it only prevents updates from being shown<br>
+    ---@see graphics_element.redraw
     ---@see graphics_element.content_redraw
-    function public.hide()
+    ---@param clear? boolean true to visibly hide this element (redraws the parent)
+    function public.hide(clear)
         public.freeze_all() -- stop animations for efficiency/performance
+        public.unfocus_all()
         protected.window.setVisible(false)
+        if clear and args.parent then args.parent.redraw() end
     end
 
     -- start/resume animation(s)
-    function public.animate()
-        protected.start_anim()
-    end
+    function public.animate() protected.start_anim() end
 
     -- start/resume animation(s) for this element and all its children<br>
     -- only animates if a window is visible
     function public.animate_all()
         if protected.window.isVisible() then
             public.animate()
-            for _, child in pairs(protected.children) do child.animate_all() end
+            for _, child in pairs(protected.children) do child.get().animate_all() end
         end
     end
 
     -- freeze animation(s)
-    function public.freeze()
-        protected.stop_anim()
-    end
+    function public.freeze() protected.stop_anim() end
 
     -- freeze animation(s) for this element and all its children
     function public.freeze_all()
         public.freeze()
-        for _, child in pairs(protected.children) do child.freeze_all() end
+        for _, child in pairs(protected.children) do child.get().freeze_all() end
     end
 
-    -- re-draw the element
+    -- re-draw this element and all its children
     function public.redraw()
-        protected.window.redraw()
+        local bg, fg = protected.window.getBackgroundColor(), protected.window.getTextColor()
+        protected.window.setBackgroundColor(protected.fg_bg.bkg)
+        protected.window.setTextColor(protected.fg_bg.fgd)
+        protected.window.clear()
+        protected.window.setBackgroundColor(bg)
+        protected.window.setTextColor(fg)
+        protected.redraw()
+        for _, child in pairs(protected.children) do child.get().redraw() end
     end
 
     -- if a content window is set, clears it then re-draws all children
     function public.content_redraw()
         if protected.content_window ~= nil then
             protected.content_window.clear()
-            for _, child in pairs(protected.children) do child.redraw() end
+            for _, child in pairs(protected.children) do child.get().redraw() end
         end
     end
 

graphics/elements/animations/waiting.lua

@@ -36,49 +36,49 @@ local function waiting(args)
 
         if state >= 0 and state < 7 then
             -- top
-            e.window.setCursorPos(1 + math.floor(state / 2), 1)
+            e.w_set_cur(1 + math.floor(state / 2), 1)
             if state % 2 == 0 then
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_blit("\x8f", blit_fg, blit_bg)
             else
-                e.window.blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
+                e.w_blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
             end
 
             -- bottom
-            e.window.setCursorPos(4 - math.ceil(state / 2), 3)
+            e.w_set_cur(4 - math.ceil(state / 2), 3)
             if state % 2 == 0 then
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_blit("\x8f", blit_fg, blit_bg)
             else
-                e.window.blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
+                e.w_blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
             end
         else
             local st = state - 7
 
             -- right
             if st % 3 == 0 then
-                e.window.setCursorPos(4, 1 + math.floor(st / 3))
-                e.window.blit("\x83", blit_bg, blit_fg)
+                e.w_set_cur(4, 1 + math.floor(st / 3))
+                e.w_blit("\x83", blit_bg, blit_fg)
             elseif st % 3 == 1 then
-                e.window.setCursorPos(4, 1 + math.floor(st / 3))
-                e.window.blit("\x8f", blit_bg, blit_fg)
-                e.window.setCursorPos(4, 2 + math.floor(st / 3))
-                e.window.blit("\x83", blit_fg, blit_bg)
+                e.w_set_cur(4, 1 + math.floor(st / 3))
+                e.w_blit("\x8f", blit_bg, blit_fg)
+                e.w_set_cur(4, 2 + math.floor(st / 3))
+                e.w_blit("\x83", blit_fg, blit_bg)
             else
-                e.window.setCursorPos(4, 2 + math.floor(st / 3))
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_set_cur(4, 2 + math.floor(st / 3))
+                e.w_blit("\x8f", blit_fg, blit_bg)
             end
 
             -- left
             if st % 3 == 0 then
-                e.window.setCursorPos(1, 3 - math.floor(st / 3))
-                e.window.blit("\x83", blit_fg, blit_bg)
-                e.window.setCursorPos(1, 2 - math.floor(st / 3))
-                e.window.blit("\x8f", blit_bg, blit_fg)
+                e.w_set_cur(1, 3 - math.floor(st / 3))
+                e.w_blit("\x83", blit_fg, blit_bg)
+                e.w_set_cur(1, 2 - math.floor(st / 3))
+                e.w_blit("\x8f", blit_bg, blit_fg)
             elseif st % 3 == 1 then
-                e.window.setCursorPos(1, 2 - math.floor(st / 3))
-                e.window.blit("\x83", blit_bg, blit_fg)
+                e.w_set_cur(1, 2 - math.floor(st / 3))
+                e.w_blit("\x83", blit_bg, blit_fg)
             else
-                e.window.setCursorPos(1, 2 - math.floor(st / 3))
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_set_cur(1, 2 - math.floor(st / 3))
+                e.w_blit("\x8f", blit_fg, blit_bg)
             end
         end
 

graphics/elements/appmultipane.lua

@@ -0,0 +1,109 @@
+-- App Page Multi-Pane Display Graphics Element
+
+local util    = require("scada-common.util")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+local events  = require("graphics.events")
+
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class app_multipane_args
+---@field panes table panes to swap between
+---@field nav_colors cpair on/off colors (a/b respectively) for page navigator
+---@field scroll_nav boolean? true to allow scrolling to change the active pane
+---@field drag_nav boolean? true to allow mouse dragging to change the active pane (on mouse up)
+---@field callback function? function to call when pane is changed by mouse interaction
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field width? integer parent width if omitted
+---@field height? integer parent height if omitted
+---@field gframe? graphics_frame frame instead of x/y/width/height
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new app multipane element
+---@nodiscard
+---@param args app_multipane_args
+---@return graphics_element element, element_id id
+local function multipane(args)
+    element.assert(type(args.panes) == "table", "panes is a required field")
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    e.value = 1
+
+    local nav_x_start = math.floor((e.frame.w / 2) - (#args.panes / 2)) + 1
+    local nav_x_end   = math.floor((e.frame.w / 2) - (#args.panes / 2)) + #args.panes
+
+    -- show the selected pane
+    function e.redraw()
+        for i = 1, #args.panes do args.panes[i].hide() end
+        args.panes[e.value].show()
+
+        -- draw page indicator dots
+        for i = 1, #args.panes do
+            e.w_set_cur(nav_x_start + (i - 1), e.frame.h)
+            e.w_set_fgd(util.trinary(i == e.value, args.nav_colors.color_a, args.nav_colors.color_b))
+            e.w_write("\x07")
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        local initial = e.value
+
+        if e.enabled then
+            if event.current.y == e.frame.h and event.current.x >= nav_x_start and event.current.x <= nav_x_end then
+                local id = event.current.x - nav_x_start + 1
+
+                if event.type == MOUSE_CLICK.TAP then
+                    e.set_value(id)
+                elseif event.type == MOUSE_CLICK.UP then
+                    e.set_value(id)
+                end
+            end
+        end
+
+        if args.scroll_nav then
+            if event.type == events.MOUSE_CLICK.SCROLL_DOWN then
+                e.set_value(e.value + 1)
+            elseif event.type == events.MOUSE_CLICK.SCROLL_UP then
+                e.set_value(e.value - 1)
+            end
+        end
+
+        if args.drag_nav then
+            local x1, x2 = event.initial.x, event.current.x
+            if event.type == events.MOUSE_CLICK.UP and e.in_frame_bounds(x1, event.initial.y) and e.in_frame_bounds(x1, event.current.y) then
+                if x2 > x1 then
+                    e.set_value(e.value - 1)
+                elseif x2 < x1 then
+                    e.set_value(e.value + 1)
+                end
+            end
+        end
+
+        if e.value ~= initial and type(args.callback) == "function" then args.callback(e.value) end
+    end
+
+    -- select which pane is shown
+    ---@param value integer pane to show
+    function e.set_value(value)
+        if (e.value ~= value) and (value > 0) and (value <= #args.panes) then
+            e.value = value
+            e.redraw()
+        end
+    end
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return multipane

graphics/elements/colormap.lua

@@ -1,7 +1,5 @@
 -- Color Map Graphics Element
 
-local util    = require("scada-common.util")
-
 local element = require("graphics.element")
 
 ---@class colormap_args
@@ -16,7 +14,7 @@ local element = require("graphics.element")
 ---@return graphics_element element, element_id id
 local function colormap(args)
     local bkg = "008877FFCCEE114455DD9933BBAA2266"
-    local spaces = util.spaces(32)
+    local spaces = string.rep(" ", 32)
 
     args.width = 32
     args.height = 1
@@ -25,8 +23,13 @@ local function colormap(args)
     local e = element.new(args)
 
     -- draw color map
-    e.window.setCursorPos(1, 1)
-    e.window.blit(spaces, bkg, bkg)
+    function e.redraw()
+        e.w_set_cur(1, 1)
+        e.w_blit(spaces, bkg, bkg)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/app.lua

@@ -0,0 +1,132 @@
+-- App Button Graphics Element
+
+local tcd     = require("scada-common.tcd")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class app_button_args
+---@field text string app icon text
+---@field title string app title text
+---@field callback function function to call on touch
+---@field app_fg_bg cpair app icon foreground/background colors
+---@field active_fg_bg? cpair foreground/background colors when pressed
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new app button
+---@param args app_button_args
+---@return graphics_element element, element_id id
+local function app_button(args)
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.title) == "string", "title is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.app_fg_bg) == "table", "app_fg_bg is a required field")
+
+    args.height = 4
+    args.width = 7
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- draw the app button
+    local function draw()
+        local fgd = args.app_fg_bg.fgd
+        local bkg = args.app_fg_bg.bkg
+
+        if e.value then
+            fgd = args.active_fg_bg.fgd
+            bkg = args.active_fg_bg.bkg
+        end
+
+        -- draw icon
+        e.w_set_cur(2, 1)
+        e.w_set_fgd(fgd)
+        e.w_set_bkg(bkg)
+        e.w_write("\x9f\x83\x83\x83")
+        e.w_set_fgd(bkg)
+        e.w_set_bkg(fgd)
+        e.w_write("\x90")
+        e.w_set_fgd(fgd)
+        e.w_set_bkg(bkg)
+        e.w_set_cur(2, 2)
+        e.w_write("\x95   ")
+        e.w_set_fgd(bkg)
+        e.w_set_bkg(fgd)
+        e.w_write("\x95")
+        e.w_set_cur(2, 3)
+        e.w_write("\x82\x8f\x8f\x8f\x81")
+
+        -- write the icon text
+        e.w_set_cur(4, 2)
+        e.w_set_fgd(fgd)
+        e.w_set_bkg(bkg)
+        e.w_write(args.text)
+    end
+
+    -- draw the app button as pressed (if active_fg_bg set)
+    local function show_pressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = true
+            e.w_set_fgd(args.active_fg_bg.fgd)
+            e.w_set_bkg(args.active_fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- draw the app button as unpressed (if active_fg_bg set)
+    local function show_unpressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = false
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled then
+            if event.type == MOUSE_CLICK.TAP then
+                show_pressed()
+                -- show as unpressed in 0.25 seconds
+                if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
+                args.callback()
+            elseif event.type == MOUSE_CLICK.DOWN then
+                show_pressed()
+            elseif event.type == MOUSE_CLICK.UP then
+                show_unpressed()
+                if e.in_frame_bounds(event.current.x, event.current.y) then
+                    args.callback()
+                end
+            end
+        end
+    end
+
+    -- set the value (true simulates pressing the app button)
+    ---@param val boolean new value
+    function e.set_value(val)
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
+    end
+
+    -- element redraw
+    function e.redraw()
+        e.w_set_cur(math.floor((e.frame.w - string.len(args.title)) / 2) + 1, 4)
+        e.w_write(args.title)
+        draw()
+    end
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return app_button

graphics/elements/controls/checkbox.lua

@@ -6,7 +6,8 @@ local element = require("graphics.element")
 ---@class checkbox_args
 ---@field label string checkbox text
 ---@field box_fg_bg cpair colors for checkbox
----@field callback function function to call on press
+---@field default? boolean default value
+---@field callback? function function to call on press
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -18,48 +19,75 @@ local element = require("graphics.element")
 ---@param args checkbox_args
 ---@return graphics_element element, element_id id
 local function checkbox(args)
-    assert(type(args.label) == "string", "graphics.elements.controls.checkbox: label is a required field")
-    assert(type(args.box_fg_bg) == "table", "graphics.elements.controls.checkbox: box_fg_bg is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.checkbox: callback is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.box_fg_bg) == "table", "box_fg_bg is a required field")
 
+    args.can_focus = true
     args.height = 1
-    args.width = 3 + string.len(args.label)
+    args.width = 2 + string.len(args.label)
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    e.value = false
+    e.value = args.default == true
 
     -- show the button state
     local function draw()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if e.value then
             -- show as selected
-            e.window.setTextColor(args.box_fg_bg.bkg)
-            e.window.setBackgroundColor(args.box_fg_bg.fgd)
-            e.window.write("\x88")
-            e.window.setTextColor(args.box_fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write("\x95")
+            e.w_set_fgd(args.box_fg_bg.bkg)
+            e.w_set_bkg(args.box_fg_bg.fgd)
+            e.w_write("\x88")
+            e.w_set_fgd(args.box_fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write("\x95")
         else
             -- show as unselected
-            e.window.setTextColor(e.fg_bg.bkg)
-            e.window.setBackgroundColor(args.box_fg_bg.bkg)
-            e.window.write("\x88")
-            e.window.setTextColor(args.box_fg_bg.bkg)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write("\x95")
+            e.w_set_fgd(e.fg_bg.bkg)
+            e.w_set_bkg(args.box_fg_bg.bkg)
+            e.w_write("\x88")
+            e.w_set_fgd(args.box_fg_bg.bkg)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write("\x95")
+        end
+    end
+
+    -- write label text
+    local function draw_label()
+        if e.enabled and e.is_focused() then
+            e.w_set_cur(3, 1)
+            e.w_set_fgd(e.fg_bg.bkg)
+            e.w_set_bkg(e.fg_bg.fgd)
+            e.w_write(args.label)
+        else
+            e.w_set_cur(3, 1)
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write(args.label)
         end
     end
 
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled and core.events.was_clicked(event.type) then
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
             e.value = not e.value
             draw()
-            args.callback(e.value)
+            if type(args.callback) == "function" then args.callback(e.value) end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == core.events.KEY_CLICK.DOWN then
+            if event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter then
+                e.value = not e.value
+                draw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            end
         end
     end
 
@@ -70,14 +98,22 @@ local function checkbox(args)
         draw()
     end
 
-    -- write label text
-    e.window.setCursorPos(3, 1)
-    e.window.setTextColor(e.fg_bg.fgd)
-    e.window.setBackgroundColor(e.fg_bg.bkg)
-    e.window.write(args.label)
+    -- handle focus
+    e.on_focused = draw_label
+    e.on_unfocused = draw_label
+
+    -- handle enable
+    e.on_enabled = draw_label
+    e.on_disabled = draw_label
+
+    -- element redraw
+    function e.redraw()
+        draw()
+        draw_label()
+    end
 
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/hazard_button.lua

@@ -1,7 +1,6 @@
 -- Hazard-bordered Button Graphics Element
 
 local tcd     = require("scada-common.tcd")
-local util    = require("scada-common.util")
 
 local core    = require("graphics.core")
 local element = require("graphics.element")
@@ -22,47 +21,42 @@ local element = require("graphics.element")
 ---@param args hazard_button_args
 ---@return graphics_element element, element_id id
 local function hazard_button(args)
-    assert(type(args.text) == "string", "graphics.elements.controls.hazard_button: text is a required field")
-    assert(type(args.accent) == "number", "graphics.elements.controls.hazard_button: accent is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.hazard_button: callback is a required field")
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.accent) == "number", "accent is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
 
-    -- static dimensions
     args.height = 3
     args.width = string.len(args.text) + 4
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- write the button text
-    e.window.setCursorPos(3, 2)
-    e.window.write(args.text)
-
     -- draw border
     ---@param accent color accent color
     local function draw_border(accent)
         -- top
-        e.window.setTextColor(accent)
-        e.window.setBackgroundColor(args.fg_bg.bkg)
-        e.window.setCursorPos(1, 1)
-        e.window.write("\x99" .. util.strrep("\x89", args.width - 2) .. "\x99")
+        e.w_set_fgd(accent)
+        e.w_set_bkg(args.fg_bg.bkg)
+        e.w_set_cur(1, 1)
+        e.w_write("\x99" .. string.rep("\x89", args.width - 2) .. "\x99")
 
         -- center left
-        e.window.setCursorPos(1, 2)
-        e.window.setTextColor(args.fg_bg.bkg)
-        e.window.setBackgroundColor(accent)
-        e.window.write("\x99")
+        e.w_set_cur(1, 2)
+        e.w_set_fgd(args.fg_bg.bkg)
+        e.w_set_bkg(accent)
+        e.w_write("\x99")
 
         -- center right
-        e.window.setTextColor(args.fg_bg.bkg)
-        e.window.setBackgroundColor(accent)
-        e.window.setCursorPos(args.width, 2)
-        e.window.write("\x99")
+        e.w_set_fgd(args.fg_bg.bkg)
+        e.w_set_bkg(accent)
+        e.w_set_cur(args.width, 2)
+        e.w_write("\x99")
 
         -- bottom
-        e.window.setTextColor(accent)
-        e.window.setBackgroundColor(args.fg_bg.bkg)
-        e.window.setCursorPos(1, 3)
-        e.window.write("\x99" .. util.strrep("\x98", args.width - 2) .. "\x99")
+        e.w_set_fgd(accent)
+        e.w_set_bkg(args.fg_bg.bkg)
+        e.w_set_cur(1, 3)
+        e.w_write("\x99" .. string.rep("\x98", args.width - 2) .. "\x99")
     end
 
     -- on request timeout: recursively calls itself to double flash button text
@@ -73,9 +67,9 @@ local function hazard_button(args)
 
         if n == 0 then
             -- go back off
-            e.window.setTextColor(args.fg_bg.fgd)
-            e.window.setCursorPos(3, 2)
-            e.window.write(args.text)
+            e.w_set_fgd(args.fg_bg.fgd)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
         end
 
         if n >= 4 then
@@ -83,18 +77,18 @@ local function hazard_button(args)
         elseif n % 2 == 0 then
             -- toggle text color on after 0.25 seconds
             tcd.dispatch(0.25, function ()
-                e.window.setTextColor(args.accent)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.accent)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_timeout(n + 1)
                 on_timeout(n + 1)
             end)
         elseif n % 1 then
             -- toggle text color off after 0.25 seconds
             tcd.dispatch(0.25, function ()
-                e.window.setTextColor(args.fg_bg.fgd)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.fg_bg.fgd)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_timeout(n + 1)
             end)
         end
@@ -102,9 +96,9 @@ local function hazard_button(args)
 
     -- blink routine for success indication
     local function on_success()
-        e.window.setTextColor(args.fg_bg.fgd)
-        e.window.setCursorPos(3, 2)
-        e.window.write(args.text)
+        e.w_set_fgd(args.fg_bg.fgd)
+        e.w_set_cur(3, 2)
+        e.w_write(args.text)
     end
 
     -- blink routine for failure indication
@@ -115,9 +109,9 @@ local function hazard_button(args)
 
         if n == 0 then
             -- go back off
-            e.window.setTextColor(args.fg_bg.fgd)
-            e.window.setCursorPos(3, 2)
-            e.window.write(args.text)
+            e.w_set_fgd(args.fg_bg.fgd)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
         end
 
         if n >= 2 then
@@ -125,17 +119,17 @@ local function hazard_button(args)
         elseif n % 2 == 0 then
             -- toggle text color on after 0.5 seconds
             tcd.dispatch(0.5, function ()
-                e.window.setTextColor(args.accent)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.accent)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_failure(n + 1)
             end)
         elseif n % 1 then
             -- toggle text color off after 0.25 seconds
             tcd.dispatch(0.25, function ()
-                e.window.setTextColor(args.fg_bg.fgd)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.fg_bg.fgd)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_failure(n + 1)
             end)
         end
@@ -144,24 +138,21 @@ local function hazard_button(args)
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled then
-            if core.events.was_clicked(event.type) then
-                -- change text color to indicate clicked
-                e.window.setTextColor(args.accent)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
+            -- change text color to indicate clicked
+            e.w_set_fgd(args.accent)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
 
-                -- abort any other callbacks
-                tcd.abort(on_timeout)
-                tcd.abort(on_success)
-                tcd.abort(on_failure)
+            -- abort any other callbacks
+            tcd.abort(on_timeout)
+            tcd.abort(on_success)
+            tcd.abort(on_failure)
 
-                -- 1.5 second timeout
-                tcd.dispatch(1.5, on_timeout)
+            -- 1.5 second timeout
+            tcd.dispatch(1.5, on_timeout)
 
-                -- call the touch callback
-                args.callback()
-            end
+            args.callback()
         end
     end
 
@@ -175,29 +166,37 @@ local function hazard_button(args)
     -- set the value (true simulates pressing the button)
     ---@param val boolean new value
     function e.set_value(val)
-        if val then e.handle_mouse(core.events.mouse_generic(core.events.CLICK_TYPE.UP, 1, 1)) end
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
     end
 
     -- show the button as disabled
-    function e.disable()
+    function e.on_disabled()
         if args.dis_colors then
             draw_border(args.dis_colors.color_a)
-            e.window.setTextColor(args.dis_colors.color_b)
-            e.window.setCursorPos(3, 2)
-            e.window.write(args.text)
+            e.w_set_fgd(args.dis_colors.color_b)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
         end
     end
 
     -- show the button as enabled
-    function e.enable()
+    function e.on_enabled()
         draw_border(args.accent)
-        e.window.setTextColor(args.fg_bg.fgd)
-        e.window.setCursorPos(3, 2)
-        e.window.write(args.text)
+        e.w_set_fgd(args.fg_bg.fgd)
+        e.w_set_cur(3, 2)
+        e.w_write(args.text)
     end
 
-    -- initial draw of border
-    draw_border(args.accent)
+    -- element redraw
+    function e.redraw()
+        -- write the button text and draw border
+        e.w_set_cur(3, 2)
+        e.w_write(args.text)
+        draw_border(args.accent)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/multi_button.lua

@@ -29,13 +29,11 @@ local element = require("graphics.element")
 ---@param args multi_button_args
 ---@return graphics_element element, element_id id
 local function multi_button(args)
-    assert(type(args.options) == "table", "graphics.elements.controls.multi_button: options is a required field")
-    assert(#args.options > 0, "graphics.elements.controls.multi_button: at least one option is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.multi_button: callback is a required field")
-    assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0),
-        "graphics.elements.controls.multi_button: default must be nil or a number > 0")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.multi_button: min_width must be nil or a number > 0")
+    element.assert(type(args.options) == "table", "options is a required field")
+    element.assert(#args.options > 0, "at least one option is required")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     -- single line
     args.height = 1
@@ -71,23 +69,23 @@ local function multi_button(args)
     end
 
     -- show the button state
-    local function draw()
+    function e.redraw()
         for i = 1, #args.options do
             local opt = args.options[i] ---@type button_option
 
-            e.window.setCursorPos(opt._start_x, 1)
+            e.w_set_cur(opt._start_x, 1)
 
             if e.value == i then
                 -- show as pressed
-                e.window.setTextColor(opt.active_fg_bg.fgd)
-                e.window.setBackgroundColor(opt.active_fg_bg.bkg)
+                e.w_set_fgd(opt.active_fg_bg.fgd)
+                e.w_set_bkg(opt.active_fg_bg.bkg)
             else
                 -- show as unpressed
-                e.window.setTextColor(opt.fg_bg.fgd)
-                e.window.setBackgroundColor(opt.fg_bg.bkg)
+                e.w_set_fgd(opt.fg_bg.fgd)
+                e.w_set_bkg(opt.fg_bg.bkg)
             end
 
-            e.window.write(util.pad(opt.text, button_width))
+            e.w_write(util.pad(opt.text, button_width))
         end
     end
 
@@ -115,7 +113,7 @@ local function multi_button(args)
             -- tap always has identical coordinates, so this always passes for taps
             if button_ini == button_cur and button_cur ~= nil then
                 e.value = button_cur
-                draw()
+                e.redraw()
                 args.callback(e.value)
             end
         end
@@ -125,11 +123,11 @@ local function multi_button(args)
     ---@param val integer new value
     function e.set_value(val)
         e.value = val
-        draw()
+        e.redraw()
     end
 
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/push_button.lua

@@ -5,12 +5,16 @@ local tcd     = require("scada-common.tcd")
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local CLICK_TYPE = core.events.CLICK_TYPE
+local ALIGN = core.ALIGN
+
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+local KEY_CLICK = core.events.KEY_CLICK
 
 ---@class push_button_args
 ---@field text string button text
 ---@field callback function function to call on touch
 ---@field min_width? integer text length if omitted
+---@field alignment? ALIGN text align if min width > length
 ---@field active_fg_bg? cpair foreground/background colors when pressed
 ---@field dis_fg_bg? cpair foreground/background colors when disabled
 ---@field parent graphics_element
@@ -25,14 +29,15 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@param args push_button_args
 ---@return graphics_element element, element_id id
 local function push_button(args)
-    assert(type(args.text) == "string", "graphics.elements.controls.push_button: text is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.push_button: callback is a required field")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.push_button: min_width must be nil or a number > 0")
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     local text_width = string.len(args.text)
+    local alignment = args.alignment or ALIGN.CENTER
 
-    -- single line height, calculate width
+    -- set automatic settings
+    args.can_focus = true
     args.height = 1
     args.min_width = args.min_width or 0
     args.width = math.max(text_width, args.min_width)
@@ -40,25 +45,31 @@ local function push_button(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    local h_pad = math.floor((e.frame.w - text_width) / 2) + 1
+    local h_pad = 1
     local v_pad = math.floor(e.frame.h / 2) + 1
 
+    if alignment == ALIGN.CENTER then
+        h_pad = math.floor((e.frame.w - text_width) / 2) + 1
+    elseif alignment == ALIGN.RIGHT then
+        h_pad = (e.frame.w - text_width) + 1
+    end
+
     -- draw the button
-    local function draw()
+    function e.redraw()
         e.window.clear()
 
         -- write the button text
-        e.window.setCursorPos(h_pad, v_pad)
-        e.window.write(args.text)
+        e.w_set_cur(h_pad, v_pad)
+        e.w_write(args.text)
     end
 
     -- draw the button as pressed (if active_fg_bg set)
     local function show_pressed()
         if e.enabled and args.active_fg_bg ~= nil then
             e.value = true
-            e.window.setTextColor(args.active_fg_bg.fgd)
-            e.window.setBackgroundColor(args.active_fg_bg.bkg)
-            draw()
+            e.w_set_fgd(args.active_fg_bg.fgd)
+            e.w_set_bkg(args.active_fg_bg.bkg)
+            e.redraw()
         end
     end
 
@@ -66,9 +77,9 @@ local function push_button(args)
     local function show_unpressed()
         if e.enabled and args.active_fg_bg ~= nil then
             e.value = false
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            draw()
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.redraw()
         end
     end
 
@@ -76,14 +87,14 @@ local function push_button(args)
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         if e.enabled then
-            if event.type == CLICK_TYPE.TAP then
+            if event.type == MOUSE_CLICK.TAP then
                 show_pressed()
                 -- show as unpressed in 0.25 seconds
                 if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
                 args.callback()
-            elseif event.type == CLICK_TYPE.DOWN then
+            elseif event.type == MOUSE_CLICK.DOWN then
                 show_pressed()
-            elseif event.type == CLICK_TYPE.UP then
+            elseif event.type == MOUSE_CLICK.UP then
                 show_unpressed()
                 if e.in_frame_bounds(event.current.x, event.current.y) then
                     args.callback()
@@ -92,34 +103,49 @@ local function push_button(args)
         end
     end
 
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.DOWN then
+            if event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter then
+                args.callback()
+                e.defocus()
+            end
+        end
+    end
+
     -- set the value (true simulates pressing the button)
     ---@param val boolean new value
     function e.set_value(val)
-        if val then e.handle_mouse(core.events.mouse_generic(core.events.CLICK_TYPE.UP, 1, 1)) end
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
     end
 
     -- show butten as enabled
-    function e.enable()
+    function e.on_enabled()
         if args.dis_fg_bg ~= nil then
             e.value = false
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            draw()
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.redraw()
         end
     end
 
     -- show button as disabled
-    function e.disable()
+    function e.on_disabled()
         if args.dis_fg_bg ~= nil then
             e.value = false
-            e.window.setTextColor(args.dis_fg_bg.fgd)
-            e.window.setBackgroundColor(args.dis_fg_bg.bkg)
-            draw()
+            e.w_set_fgd(args.dis_fg_bg.fgd)
+            e.w_set_bkg(args.dis_fg_bg.bkg)
+            e.redraw()
         end
     end
 
+    -- handle focus
+    e.on_focused = show_pressed
+    e.on_unfocused = show_unpressed
+
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/radio_2d.lua

@@ -0,0 +1,203 @@
+-- 2D Radio Button Graphics Element
+
+local util    = require("scada-common.util")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+---@class radio_2d_args
+---@field rows integer
+---@field columns integer
+---@field options table
+---@field radio_colors cpair radio button colors (inner & outer)
+---@field select_color? color color for radio button when selected
+---@field color_map? table colors for each radio button when selected
+---@field disable_color? color color for radio button when disabled
+---@field disable_fg_bg? cpair text colors when disabled
+---@field default? integer default state, defaults to options[1]
+---@field callback? function function to call on touch
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new 2D radio button list (latch selection, exclusively one color at a time)
+---@param args radio_2d_args
+---@return graphics_element element, element_id id
+local function radio_2d_button(args)
+    element.assert(type(args.options) == "table" and #args.options > 0, "options should be a table with length >= 1")
+    element.assert(util.is_int(args.rows) and util.is_int(args.columns), "rows/columns must be integers")
+    element.assert((args.rows * args.columns) >= #args.options, "rows x columns size insufficient for provided number of options")
+    element.assert(type(args.radio_colors) == "table", "radio_colors is a required field")
+    element.assert(type(args.select_color) == "number" or type(args.color_map) == "table", "select_color or color_map is required")
+    element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
+
+    local array = {}
+    local col_widths = {}
+
+    local next_idx = 1
+    local total_width = 0
+    local max_rows = 1
+
+    local focused_opt = 1
+    local focus_x, focus_y = 1, 1
+
+    -- build table to display
+    for col = 1, args.columns do
+        local max_width = 0
+        array[col] = {}
+
+        for row = 1, args.rows do
+            local len = string.len(args.options[next_idx])
+            if len > max_width then max_width = len end
+            if row > max_rows then max_rows = row end
+
+            table.insert(array[col], { text = args.options[next_idx], id = next_idx, x_1 = 1 + total_width, x_2 = 2 + total_width + len })
+
+            next_idx = next_idx + 1
+            if next_idx > #args.options then break end
+        end
+
+        table.insert(col_widths, max_width + 3)
+        total_width = total_width + max_width + 3
+        if next_idx > #args.options then break end
+    end
+
+    args.can_focus = true
+    args.width = total_width
+    args.height = max_rows
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- selected option (convert nil to 1 if missing)
+    e.value = args.default or 1
+
+    -- draw the element
+    function e.redraw()
+        local col_x = 1
+
+        local radio_color_b = util.trinary(type(args.disable_color) == "number" and not e.enabled, args.disable_color, args.radio_colors.color_b)
+
+        for col = 1, #array do
+            for row = 1, #array[col] do
+                local opt = array[col][row]
+                local select_color = args.select_color
+
+                if type(args.color_map) == "table" and args.color_map[opt.id] then
+                    select_color = args.color_map[opt.id]
+                end
+
+                local inner_color = util.trinary((e.value == opt.id) and e.enabled, radio_color_b, args.radio_colors.color_a)
+                local outer_color = util.trinary((e.value == opt.id) and e.enabled, select_color, radio_color_b)
+
+                e.w_set_cur(col_x, row)
+
+                e.w_set_fgd(inner_color)
+                e.w_set_bkg(outer_color)
+                e.w_write("\x88")
+
+                e.w_set_fgd(outer_color)
+                e.w_set_bkg(e.fg_bg.bkg)
+                e.w_write("\x95")
+
+                if opt.id == focused_opt then
+                    focus_x, focus_y = row, col
+                end
+
+                -- write button text
+                if opt.id == focused_opt and e.is_focused() and e.enabled then
+                    e.w_set_fgd(e.fg_bg.bkg)
+                    e.w_set_bkg(e.fg_bg.fgd)
+                elseif type(args.disable_fg_bg) == "table" and not e.enabled then
+                    e.w_set_fgd(args.disable_fg_bg.fgd)
+                    e.w_set_bkg(args.disable_fg_bg.bkg)
+                else
+                    e.w_set_fgd(e.fg_bg.fgd)
+                    e.w_set_bkg(e.fg_bg.bkg)
+                end
+
+                e.w_write(opt.text)
+            end
+
+            col_x = col_x + col_widths[col]
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled and core.events.was_clicked(event.type) and (event.initial.y == event.current.y) then
+            -- determine what was pressed
+            for _, row in ipairs(array) do
+                local elem = row[event.current.y]
+                if elem ~= nil and event.initial.x >= elem.x_1 and event.initial.x <= elem.x_2 and event.current.x >= elem.x_1 and event.current.x <= elem.x_2 then
+                    e.value = elem.id
+                    focused_opt = elem.id
+                    e.redraw()
+                    if type(args.callback) == "function" then args.callback(e.value) end
+                    break
+                end
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == core.events.KEY_CLICK.DOWN or event.type == core.events.KEY_CLICK.HELD then
+            if event.type == core.events.KEY_CLICK.DOWN and (event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter) then
+                e.value = focused_opt
+                e.redraw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            elseif event.key == keys.down then
+                if focused_opt < #args.options then
+                    focused_opt = focused_opt + 1
+                    e.redraw()
+                end
+            elseif event.key == keys.up then
+                if focused_opt > 1 then
+                    focused_opt = focused_opt - 1
+                    e.redraw()
+                end
+            elseif event.key == keys.right then
+                if array[focus_y + 1] and array[focus_y + 1][focus_x] then
+                    focused_opt = array[focus_y + 1][focus_x].id
+                else focused_opt = array[1][focus_x].id end
+                e.redraw()
+            elseif event.key == keys.left then
+                if array[focus_y - 1] and array[focus_y - 1][focus_x] then
+                    focused_opt = array[focus_y - 1][focus_x].id
+                    e.redraw()
+                elseif array[#array][focus_x] then
+                    focused_opt = array[#array][focus_x].id
+                    e.redraw()
+                end
+            end
+        end
+    end
+
+    -- set the value
+    ---@param val integer new value
+    function e.set_value(val)
+        if type(val) == "number" and val > 0 and val <= #args.options then
+            e.value = val
+            e.redraw()
+        end
+    end
+
+    -- handle focus & enable
+    e.on_focused = e.redraw
+    e.on_unfocused = e.redraw
+    e.on_enabled = e.redraw
+    e.on_disabled = e.redraw
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return radio_2d_button

graphics/elements/controls/radio_button.lua

@@ -1,15 +1,19 @@
 -- Radio Button Graphics Element
 
+local util    = require("scada-common.util")
+
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
+local KEY_CLICK = core.events.KEY_CLICK
+
 ---@class radio_button_args
 ---@field options table button options
----@field callback function function to call on touch
----@field radio_colors cpair colors for radio button center dot when active (a) or inactive (b)
----@field radio_bg color background color of radio button
+---@field radio_colors cpair radio button colors (inner & outer)
+---@field select_color color color for radio button border when selected
 ---@field default? integer default state, defaults to options[1]
 ---@field min_width? integer text length + 2 if omitted
+---@field callback? function function to call on touch
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -21,16 +25,12 @@ local element = require("graphics.element")
 ---@param args radio_button_args
 ---@return graphics_element element, element_id id
 local function radio_button(args)
-    assert(type(args.options) == "table", "graphics.elements.controls.radio_button: options is a required field")
-    assert(#args.options > 0, "graphics.elements.controls.radio_button: at least one option is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.radio_button: callback is a required field")
-    assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0),
-        "graphics.elements.controls.radio_button: default must be nil or a number > 0")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.radio_button: min_width must be nil or a number > 0")
-
-    -- one line per option
-    args.height = #args.options
+    element.assert(type(args.options) == "table", "options is a required field")
+    element.assert(#args.options > 0, "at least one option is required")
+    element.assert(type(args.radio_colors) == "table", "radio_colors is a required field")
+    element.assert(type(args.select_color) == "number", "select_color is a required field")
+    element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     -- determine widths
     local max_width = 1
@@ -43,53 +43,83 @@ local function radio_button(args)
 
     local button_text_width = math.max(max_width, args.min_width or 0)
 
+    -- set automatic args
+    args.can_focus = true
     args.width = button_text_width + 2
+    args.height = #args.options -- one line per option
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    local focused_opt = 1
+
     -- button state (convert nil to 1 if missing)
     e.value = args.default or 1
 
     -- show the button state
-    local function draw()
+    function e.redraw()
         for i = 1, #args.options do
             local opt = args.options[i] ---@type string
 
-            e.window.setCursorPos(1, i)
+            local inner_color = util.trinary(e.value == i, args.radio_colors.color_b, args.radio_colors.color_a)
+            local outer_color = util.trinary(e.value == i, args.select_color, args.radio_colors.color_b)
 
-            if e.value == i then
-                -- show as selected
-                e.window.setTextColor(args.radio_colors.color_a)
-                e.window.setBackgroundColor(args.radio_bg)
-            else
-                -- show as unselected
-                e.window.setTextColor(args.radio_colors.color_b)
-                e.window.setBackgroundColor(args.radio_bg)
-            end
+            e.w_set_cur(1, i)
 
-            e.window.write("\x88")
+            e.w_set_fgd(inner_color)
+            e.w_set_bkg(outer_color)
+            e.w_write("\x88")
 
-            e.window.setTextColor(args.radio_bg)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write("\x95")
+            e.w_set_fgd(outer_color)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write("\x95")
 
             -- write button text
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write(opt)
+            if i == focused_opt and e.is_focused() and e.enabled then
+                e.w_set_fgd(e.fg_bg.bkg)
+                e.w_set_bkg(e.fg_bg.fgd)
+            else
+                e.w_set_fgd(e.fg_bg.fgd)
+                e.w_set_bkg(e.fg_bg.bkg)
+            end
+
+            e.w_write(opt)
         end
     end
 
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled and core.events.was_clicked(event.type) and (event.initial.y == event.current.y) then
+        if e.enabled and core.events.was_clicked(event.type) and
+           (event.initial.y == event.current.y) and e.in_frame_bounds(event.current.x, event.current.y) then
             -- determine what was pressed
             if args.options[event.current.y] ~= nil then
                 e.value = event.current.y
-                draw()
-                args.callback(e.value)
+                focused_opt = e.value
+                e.redraw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if event.type == KEY_CLICK.DOWN and (event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter) then
+                e.value = focused_opt
+                e.redraw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            elseif event.key == keys.down then
+                if focused_opt < #args.options then
+                    focused_opt = focused_opt + 1
+                    e.redraw()
+                end
+            elseif event.key == keys.up then
+                if focused_opt > 1 then
+                    focused_opt = focused_opt - 1
+                    e.redraw()
+                end
             end
         end
     end
@@ -97,12 +127,20 @@ local function radio_button(args)
     -- set the value
     ---@param val integer new value
     function e.set_value(val)
-        e.value = val
-        draw()
+        if type(val) == "number" and val > 0 and val <= #args.options then
+            e.value = val
+            e.redraw()
+        end
     end
 
+    -- handle focus & enable
+    e.on_focused = e.redraw
+    e.on_unfocused = e.redraw
+    e.on_enabled = e.redraw
+    e.on_disabled = e.redraw
+
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/sidebar.lua

@@ -1,19 +1,14 @@
 -- Sidebar Graphics Element
 
 local tcd     = require("scada-common.tcd")
+local util    = require("scada-common.util")
 
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local CLICK_TYPE = core.events.CLICK_TYPE
-
----@class sidebar_tab
----@field char string character identifier
----@field color cpair tab colors (fg/bg)
+local MOUSE_CLICK = core.events.MOUSE_CLICK
 
 ---@class sidebar_args
----@field tabs table sidebar tab options
----@field callback function function to call on tab change
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -26,53 +21,71 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@param args sidebar_args
 ---@return graphics_element element, element_id id
 local function sidebar(args)
-    assert(type(args.tabs) == "table", "graphics.elements.controls.sidebar: tabs is a required field")
-    assert(#args.tabs > 0, "graphics.elements.controls.sidebar: at least one tab is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.sidebar: callback is a required field")
-
-    -- always 3 wide
     args.width = 3
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    assert(e.frame.h >= (#args.tabs * 3), "graphics.elements.controls.sidebar: height insufficent to display all tabs")
-
     -- default to 1st tab
     e.value = 1
 
+    local was_pressed = false
+    local tabs = {}
+
     -- show the button state
-    ---@param pressed boolean if the currently selected tab should appear as actively pressed
+    ---@param pressed? boolean if the currently selected tab should appear as actively pressed
     ---@param pressed_idx? integer optional index to show as held (that is not yet selected)
     local function draw(pressed, pressed_idx)
+        pressed = util.trinary(pressed == nil, was_pressed, pressed)
+        was_pressed = pressed
         pressed_idx = pressed_idx or e.value
 
-        for i = 1, #args.tabs do
-            local tab = args.tabs[i] ---@type sidebar_tab
+        -- clear
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_bkg(e.fg_bg.bkg)
+        for y = 1, e.frame.h do
+            e.w_set_cur(1, y)
+            e.w_write("   ")
+        end
 
-            local y = ((i - 1) * 3) + 1
+        -- draw tabs
+        for i = 1, #tabs do
+            local tab = tabs[i] ---@type sidebar_tab
+            local y = tab.y_start
 
-            e.window.setCursorPos(1, y)
+            e.w_set_cur(1, y)
 
             if pressed and i == pressed_idx then
-                e.window.setTextColor(e.fg_bg.fgd)
-                e.window.setBackgroundColor(e.fg_bg.bkg)
+                e.w_set_fgd(e.fg_bg.fgd)
+                e.w_set_bkg(e.fg_bg.bkg)
             else
-                e.window.setTextColor(tab.color.fgd)
-                e.window.setBackgroundColor(tab.color.bkg)
+                e.w_set_fgd(tab.color.fgd)
+                e.w_set_bkg(tab.color.bkg)
             end
 
-            e.window.write("   ")
-            e.window.setCursorPos(1, y + 1)
-            if e.value == i then
-                -- show as selected
-                e.window.write(" " .. tab.char .. "\x10")
-            else
-                -- show as unselected
-                e.window.write(" " .. tab.char .. " ")
+            if tab.tall then
+                e.w_write("   ")
+                e.w_set_cur(1, y + 1)
+            end
+
+            e.w_write(tab.label)
+
+            if tab.tall then
+                e.w_set_cur(1, y + 2)
+                e.w_write("   ")
+            end
+        end
+    end
+
+    -- determine which tab was pressed
+    ---@param y integer y coordinate
+    local function find_tab(y)
+        for i = 1, #tabs do
+            local tab = tabs[i] ---@type sidebar_tab
+
+            if y >= tab.y_start and y <= tab.y_end then
+                return i
             end
-            e.window.setCursorPos(1, y + 2)
-            e.window.write("   ")
         end
     end
 
@@ -81,26 +94,28 @@ local function sidebar(args)
     function e.handle_mouse(event)
         -- determine what was pressed
         if e.enabled then
-            local cur_idx = math.ceil(event.current.y / 3)
-            local ini_idx = math.ceil(event.initial.y / 3)
+            local cur_idx = find_tab(event.current.y)
+            local ini_idx = find_tab(event.initial.y)
+            local tab = tabs[cur_idx]
 
-            if args.tabs[cur_idx] ~= nil then
-                if event.type == CLICK_TYPE.TAP then
+            -- handle press if a callback was provided
+            if tab ~= nil and type(tab.callback) == "function" then
+                if event.type == MOUSE_CLICK.TAP then
                     e.value = cur_idx
                     draw(true)
                     -- show as unpressed in 0.25 seconds
                     tcd.dispatch(0.25, function () draw(false) end)
-                    args.callback(e.value)
-                elseif event.type == CLICK_TYPE.DOWN then
+                    tab.callback()
+                elseif event.type == MOUSE_CLICK.DOWN then
                     draw(true, cur_idx)
-                elseif event.type == CLICK_TYPE.UP then
+                elseif event.type == MOUSE_CLICK.UP then
                     if cur_idx == ini_idx and e.in_frame_bounds(event.current.x, event.current.y) then
                         e.value = cur_idx
                         draw(false)
-                        args.callback(e.value)
+                        tab.callback()
                     else draw(false) end
                 end
-            elseif event.type == CLICK_TYPE.UP then
+            elseif event.type == MOUSE_CLICK.UP then
                 draw(false)
             end
         end
@@ -113,8 +128,39 @@ local function sidebar(args)
         draw(false)
     end
 
-    -- initial draw
-    draw(false)
+    -- update the sidebar navigation options
+    ---@param items table sidebar entries
+    function e.on_update(items)
+        local next_y = 1
+
+        tabs = {}
+
+        for i = 1, #items do
+            local item = items[i]
+            local height = util.trinary(item.tall, 3, 1)
+
+            ---@class sidebar_tab
+            local entry = {
+                y_start = next_y,            ---@type integer
+                y_end = next_y + height - 1, ---@type integer
+                tall = item.tall,            ---@type boolean
+                label = item.label,          ---@type string
+                color = item.color,          ---@type cpair
+                callback = item.callback     ---@type function|nil
+            }
+
+            next_y = next_y + height
+
+            tabs[i] = entry
+        end
+
+        draw()
+    end
+
+    -- element redraw
+    e.redraw = draw
+
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/spinbox_numeric.lua

@@ -29,8 +29,8 @@ local function spinbox(args)
     local wn_prec = args.whole_num_precision
     local fr_prec = args.fractional_precision
 
-    assert(util.is_int(wn_prec), "graphics.element.controls.spinbox_numeric: whole number precision must be an integer")
-    assert(util.is_int(fr_prec), "graphics.element.controls.spinbox_numeric: fractional precision must be an integer")
+    element.assert(util.is_int(wn_prec), "whole number precision must be an integer")
+    element.assert(util.is_int(fr_prec), "fractional precision must be an integer")
 
     local fmt, fmt_init ---@type string, string
 
@@ -44,7 +44,7 @@ local function spinbox(args)
 
     local dec_point_x = args.whole_num_precision + 1
 
-    assert(type(args.arrow_fg_bg) == "table", "graphics.element.spinbox_numeric: arrow_fg_bg is a required field")
+    element.assert(type(args.arrow_fg_bg) == "table", "arrow_fg_bg is a required field")
 
     -- determine widths
     args.width = wn_prec + fr_prec + util.trinary(fr_prec > 0, 1, 0)
@@ -58,22 +58,20 @@ local function spinbox(args)
 
     -- draw the arrows
     local function draw_arrows(color)
-        e.window.setBackgroundColor(args.arrow_fg_bg.bkg)
-        e.window.setTextColor(color)
-        e.window.setCursorPos(1, 1)
-        e.window.write(util.strrep("\x1e", wn_prec))
-        e.window.setCursorPos(1, 3)
-        e.window.write(util.strrep("\x1f", wn_prec))
+        e.w_set_bkg(args.arrow_fg_bg.bkg)
+        e.w_set_fgd(color)
+        e.w_set_cur(1, 1)
+        e.w_write(string.rep("\x1e", wn_prec))
+        e.w_set_cur(1, 3)
+        e.w_write(string.rep("\x1f", wn_prec))
         if fr_prec > 0 then
-            e.window.setCursorPos(1 + wn_prec, 1)
-            e.window.write(" " .. util.strrep("\x1e", fr_prec))
-            e.window.setCursorPos(1 + wn_prec, 3)
-            e.window.write(" " .. util.strrep("\x1f", fr_prec))
+            e.w_set_cur(1 + wn_prec, 1)
+            e.w_write(" " .. string.rep("\x1e", fr_prec))
+            e.w_set_cur(1 + wn_prec, 3)
+            e.w_write(" " .. string.rep("\x1f", fr_prec))
         end
     end
 
-    draw_arrows(args.arrow_fg_bg.fgd)
-
     -- populate digits from current value
     local function set_digits()
         local initial_str = util.sprintf(fmt_init, e.value)
@@ -119,35 +117,29 @@ local function spinbox(args)
         end
 
         -- draw
-        e.window.setBackgroundColor(e.fg_bg.bkg)
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.setCursorPos(1, 2)
-        e.window.write(util.sprintf(fmt, e.value))
+        e.w_set_bkg(e.fg_bg.bkg)
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_cur(1, 2)
+        e.w_write(util.sprintf(fmt, e.value))
     end
 
-    -- init with the default value
-    show_num()
-
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         -- only handle if on an increment or decrement arrow
-        if e.enabled and core.events.was_clicked(event.type) and
-                (event.current.x ~= dec_point_x) and (event.current.y ~= 2) then
-            if event.current.x == event.initial.x and event.current.y == event.initial.y then
-                local idx = util.trinary(event.current.x > dec_point_x, event.current.x - 1, event.current.x)
-                if digits[idx] ~= nil then
-                    if event.current.y == 1 then
-                        -- increment
-                        digits[idx] = digits[idx] + 1
-                    elseif event.current.y == 3 then
-                        -- decrement
-                        digits[idx] = digits[idx] - 1
-                    end
-
-                    update_value()
-                    show_num()
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) and
+           (event.current.x ~= dec_point_x) and (event.current.y ~= 2) and
+           (event.current.x == event.initial.x) and (event.current.y == event.initial.y) then
+            local idx = util.trinary(event.current.x > dec_point_x, event.current.x - 1, event.current.x)
+            if digits[idx] ~= nil then
+                if event.current.y == 1 then
+                    digits[idx] = digits[idx] + 1
+                elseif event.current.y == 3 then
+                    digits[idx] = digits[idx] - 1
                 end
+
+                update_value()
+                show_num()
             end
         end
     end
@@ -176,18 +168,19 @@ local function spinbox(args)
     end
 
     -- enable this input
-    function e.enable()
-        draw_arrows(args.arrow_fg_bg.fgd)
-    end
+    function e.on_enabled() draw_arrows(args.arrow_fg_bg.fgd) end
 
     -- disable this input
-    function e.disable()
-        draw_arrows(args.arrow_disable or colors.lightGray)
+    function e.on_disabled() draw_arrows(args.arrow_disable or colors.lightGray) end
+
+    -- element redraw
+    function e.redraw()
+        show_num()
+        draw_arrows(util.trinary(e.enabled, args.arrow_fg_bg.fgd, args.arrow_disable or colors.lightGray))
     end
 
-    -- default to zero, init digits table
-    e.value = 0
-    set_digits()
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/switch_button.lua

@@ -21,15 +21,13 @@ local element = require("graphics.element")
 ---@param args switch_button_args
 ---@return graphics_element element, element_id id
 local function switch_button(args)
-    assert(type(args.text) == "string", "graphics.elements.controls.switch_button: text is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.switch_button: callback is a required field")
-    assert(type(args.active_fg_bg) == "table", "graphics.elements.controls.switch_button: active_fg_bg is a required field")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.switch_button: min_width must be nil or a number > 0")
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.active_fg_bg) == "table", "active_fg_bg is a required field")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     local text_width = string.len(args.text)
 
-    -- single line height, calculate width
     args.height = 1
     args.min_width = args.min_width or 0
     args.width = math.max(text_width, args.min_width)
@@ -37,56 +35,46 @@ local function switch_button(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- button state (convert nil to false if missing)
     e.value = args.default or false
 
     local h_pad = math.floor((e.frame.w - text_width) / 2) + 1
     local v_pad = math.floor(e.frame.h / 2) + 1
 
     -- show the button state
-    local function draw_state()
+    function e.redraw()
         if e.value then
-            -- show as pressed
-            e.window.setTextColor(args.active_fg_bg.fgd)
-            e.window.setBackgroundColor(args.active_fg_bg.bkg)
+            e.w_set_fgd(args.active_fg_bg.fgd)
+            e.w_set_bkg(args.active_fg_bg.bkg)
         else
-            -- show as unpressed
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
         end
 
-        -- clear to redraw background
         e.window.clear()
-
-        -- write the button text
-        e.window.setCursorPos(h_pad, v_pad)
-        e.window.write(args.text)
+        e.w_set_cur(h_pad, v_pad)
+        e.w_write(args.text)
     end
 
-    -- initial draw
-    draw_state()
-
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled and core.events.was_clicked(event.type) then
-            -- toggle state
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
             e.value = not e.value
-            draw_state()
-
-            -- call the touch callback with state
+            e.redraw()
             args.callback(e.value)
         end
     end
 
-    -- set the value
+    -- set the value (does not call the callback)
     ---@param val boolean new value
     function e.set_value(val)
-        -- set state
         e.value = val
-        draw_state()
+        e.redraw()
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/controls/tabbar.lua

@@ -27,13 +27,11 @@ local element = require("graphics.element")
 ---@param args tabbar_args
 ---@return graphics_element element, element_id id
 local function tabbar(args)
-    assert(type(args.tabs) == "table", "graphics.elements.controls.tabbar: tabs is a required field")
-    assert(#args.tabs > 0, "graphics.elements.controls.tabbar: at least one tab is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.tabbar: callback is a required field")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.tabbar: min_width must be nil or a number > 0")
+    element.assert(type(args.tabs) == "table", "tabs is a required field")
+    element.assert(#args.tabs > 0, "at least one tab is required")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
-    -- always 1 tall
     args.height = 1
 
     -- determine widths
@@ -50,7 +48,7 @@ local function tabbar(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    assert(e.frame.w >= (button_width * #args.tabs), "graphics.elements.controls.tabbar: width insufficent to display all tabs")
+    element.assert(e.frame.w >= (button_width * #args.tabs), "width insufficent to display all tabs")
 
     -- default to 1st tab
     e.value = 1
@@ -67,21 +65,21 @@ local function tabbar(args)
     end
 
     -- show the tab state
-    local function draw()
+    function e.redraw()
         for i = 1, #args.tabs do
             local tab = args.tabs[i]    ---@type tabbar_tab
 
-            e.window.setCursorPos(tab._start_x, 1)
+            e.w_set_cur(tab._start_x, 1)
 
             if e.value == i then
-                e.window.setTextColor(tab.color.fgd)
-                e.window.setBackgroundColor(tab.color.bkg)
+                e.w_set_fgd(tab.color.fgd)
+                e.w_set_bkg(tab.color.bkg)
             else
-                e.window.setTextColor(e.fg_bg.fgd)
-                e.window.setBackgroundColor(e.fg_bg.bkg)
+                e.w_set_fgd(e.fg_bg.fgd)
+                e.w_set_bkg(e.fg_bg.bkg)
             end
 
-            e.window.write(util.pad(tab.name, button_width))
+            e.w_write(util.pad(tab.name, button_width))
         end
     end
 
@@ -100,7 +98,7 @@ local function tabbar(args)
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         -- determine what was pressed
-        if e.enabled and core.events.was_clicked(event.type) then
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
             -- a button may have been pressed, which one was it?
             local tab_ini = which_tab(event.initial.x)
             local tab_cur = which_tab(event.current.x)
@@ -109,7 +107,7 @@ local function tabbar(args)
             -- tap always has identical coordinates, so this always passes for taps
             if tab_ini == tab_cur and tab_cur ~= nil then
                 e.value = tab_cur
-                draw()
+                e.redraw()
                 args.callback(e.value)
             end
         end
@@ -119,11 +117,11 @@ local function tabbar(args)
     ---@param val integer new value
     function e.set_value(val)
         e.value = val
-        draw()
+        e.redraw()
     end
 
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/form/number_field.lua

@@ -0,0 +1,197 @@
+-- Numeric Value Entry Graphics Element
+
+local util    = require("scada-common.util")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local KEY_CLICK = core.events.KEY_CLICK
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class number_field_args
+---@field default? number default value, defaults to 0
+---@field min? number minimum, enforced on unfocus
+---@field max? number maximum, enforced on unfocus
+---@field max_chars? integer maximum number of characters, defaults to width
+---@field max_int_digits? integer maximum number of integer digits, enforced on unfocus
+---@field max_frac_digits? integer maximum number of fractional digits, enforced on unfocus
+---@field allow_decimal? boolean true to allow decimals
+---@field allow_negative? boolean true to allow negative numbers
+---@field dis_fg_bg? cpair foreground/background colors when disabled
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field width? integer parent width if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new numeric entry field
+---@param args number_field_args
+---@return graphics_element element, element_id id
+local function number_field(args)
+    element.assert(args.max_int_digits == nil or (util.is_int(args.max_int_digits) and args.max_int_digits > 0), "max_int_digits must be an integer greater than zero if supplied")
+    element.assert(args.max_frac_digits == nil or (util.is_int(args.max_frac_digits) and args.max_frac_digits > 0), "max_frac_digits must be an integer greater than zero if supplied")
+
+    args.height = 1
+    args.can_focus = true
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    local has_decimal = false
+
+    args.max_chars = args.max_chars or e.frame.w
+
+    -- set initial value
+    e.value = "" .. (args.default or 0)
+
+    -- make an interactive field manager
+    local ifield = core.new_ifield(e, args.max_chars, args.fg_bg, args.dis_fg_bg)
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        -- only handle if on an increment or decrement arrow
+        if e.enabled and e.in_frame_bounds(event.current.x, event.current.y) then
+            if core.events.was_clicked(event.type) then
+                e.take_focus()
+
+                if event.type == MOUSE_CLICK.UP then
+                    ifield.move_cursor(event.current.x)
+                end
+            elseif event.type == MOUSE_CLICK.DOUBLE_CLICK then
+                ifield.select_all()
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.CHAR and string.len(e.value) < args.max_chars then
+            if tonumber(event.name) then
+                if e.value == 0 then e.value = "" end
+                ifield.try_insert_char(event.name)
+            end
+        elseif event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if (event.key == keys.backspace or event.key == keys.delete) and (string.len(e.value) > 0) then
+                ifield.backspace()
+                has_decimal = string.find(e.value, "%.") ~= nil
+            elseif (event.key == keys.period or event.key == keys.numPadDecimal) and (not has_decimal) and args.allow_decimal then
+                has_decimal = true
+                ifield.try_insert_char(".")
+            elseif (event.key == keys.minus or event.key == keys.numPadSubtract) and (string.len(e.value) == 0) and args.allow_negative then
+                ifield.set_value("-")
+            elseif event.key == keys.left then
+                ifield.nav_left()
+            elseif event.key == keys.right then
+                ifield.nav_right()
+            elseif event.key == keys.a and event.ctrl then
+                ifield.select_all()
+            elseif event.key == keys.home or event.key == keys.up then
+                ifield.nav_start()
+            elseif event.key == keys["end"] or event.key == keys.down then
+                ifield.nav_end()
+            end
+        end
+    end
+
+    -- set the value (must be a number)
+    ---@param val number number to show
+    function e.set_value(val)
+        if tonumber(val) then ifield.set_value("" .. tonumber(val)) end
+    end
+
+    -- set minimum input value
+    ---@param min integer minimum allowed value
+    function e.set_min(min)
+        args.min = min
+        e.on_unfocused()
+    end
+
+    -- set maximum input value
+    ---@param max integer maximum allowed value
+    function e.set_max(max)
+        args.max = max
+        e.on_unfocused()
+    end
+
+    -- replace text with pasted text if its a number
+    ---@param text string string pasted
+    function e.handle_paste(text)
+        if tonumber(text) then
+            ifield.set_value("" .. tonumber(text))
+        else
+            ifield.set_value("0")
+        end
+    end
+
+    -- handle unfocused
+    function e.on_unfocused()
+        local val = tonumber(e.value)
+        local max = tonumber(args.max)
+        local min = tonumber(args.min)
+
+        if type(val) == "number" then
+            if args.max_int_digits or args.max_frac_digits then
+                local str = e.value
+                local ceil = false
+
+                if string.find(str, "-") then str = string.sub(e.value, 2) end
+                local parts = util.strtok(str, ".")
+
+                if parts[1] and args.max_int_digits then
+                    if string.len(parts[1]) > args.max_int_digits then
+                        parts[1] = string.rep("9", args.max_int_digits)
+                        ceil = true
+                    end
+                end
+
+                if args.allow_decimal and args.max_frac_digits then
+                    if ceil then
+                        parts[2] = string.rep("9", args.max_frac_digits)
+                    elseif parts[2] and (string.len(parts[2]) > args.max_frac_digits) then
+                        -- add a half of the highest precision fractional value in order to round using floor
+                        local scaled = math.fmod(val, 1) * (10 ^ (args.max_frac_digits))
+                        local value = math.floor(scaled + 0.5)
+                        local unscaled = value * (10 ^ (-args.max_frac_digits))
+                        parts[2] = string.sub(tostring(unscaled), 3) -- remove starting "0."
+                    end
+                end
+
+                if parts[2] then parts[2] = "." .. parts[2] else parts[2] = "" end
+
+                val = tonumber((parts[1] or "") .. parts[2])
+            end
+
+            if type(args.max) == "number" and val > max then
+                e.value = "" .. max
+                ifield.nav_start()
+            elseif type(args.min) == "number" and val < min then
+                e.value = "" .. min
+                ifield.nav_start()
+            else
+                e.value = "" .. val
+                ifield.nav_end()
+            end
+        else
+            e.value = ""
+        end
+
+        ifield.show()
+    end
+
+    -- handle focus (not unfocus), enable, and redraw with show()
+    e.on_focused = ifield.show
+    e.on_enabled = ifield.show
+    e.on_disabled = ifield.show
+    e.redraw = ifield.show
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return number_field

graphics/elements/form/text_field.lua

@@ -0,0 +1,105 @@
+-- Text Value Entry Graphics Element
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local KEY_CLICK = core.events.KEY_CLICK
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class text_field_args
+---@field value? string initial value
+---@field max_len? integer maximum string length
+---@field censor? string character to replace text with when printing to screen
+---@field dis_fg_bg? cpair foreground/background colors when disabled
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field width? integer parent width if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new text entry field
+---@param args text_field_args
+---@return graphics_element element, element_id id, function censor_ctl
+local function text_field(args)
+    args.height = 1
+    args.can_focus = true
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- set initial value
+    e.value = args.value or ""
+
+    -- make an interactive field manager
+    local ifield = core.new_ifield(e, args.max_len or e.frame.w, args.fg_bg, args.dis_fg_bg)
+
+    ifield.censor(args.censor)
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        -- only handle if on an increment or decrement arrow
+        if e.enabled and e.in_frame_bounds(event.current.x, event.current.y) then
+            if core.events.was_clicked(event.type) then
+                e.take_focus()
+
+                if event.type == MOUSE_CLICK.UP then
+                    ifield.move_cursor(event.current.x)
+                end
+            elseif event.type == MOUSE_CLICK.DOUBLE_CLICK then
+                ifield.select_all()
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.CHAR then
+            ifield.try_insert_char(event.name)
+        elseif event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if (event.key == keys.backspace or event.key == keys.delete) then
+                ifield.backspace()
+            elseif event.key == keys.left then
+                ifield.nav_left()
+            elseif event.key == keys.right then
+                ifield.nav_right()
+            elseif event.key == keys.a and event.ctrl then
+                ifield.select_all()
+            elseif event.key == keys.home or event.key == keys.up then
+                ifield.nav_start()
+            elseif event.key == keys["end"] or event.key == keys.down then
+                ifield.nav_end()
+            end
+        end
+    end
+
+    -- set the value
+    ---@param val string string to set
+    function e.set_value(val)
+        ifield.set_value(val)
+    end
+
+    -- replace text with pasted text
+    ---@param text string string to set
+    function e.handle_paste(text)
+        ifield.set_value(text)
+    end
+
+    -- handle focus, enable, and redraw with show()
+    e.on_focused = ifield.show
+    e.on_unfocused = ifield.show
+    e.on_enabled = ifield.show
+    e.on_disabled = ifield.show
+    e.redraw = ifield.show
+
+    -- initial draw
+    e.redraw()
+
+    local elem, id = e.complete()
+    return elem, id, ifield.censor
+end
+
+return text_field

graphics/elements/indicators/alight.lua

@@ -25,13 +25,13 @@ local flasher = require("graphics.flasher")
 ---@param args alarm_indicator_light
 ---@return graphics_element element, element_id id
 local function alarm_indicator_light(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.alight: label is a required field")
-    assert(type(args.c1) == "number", "graphics.elements.indicators.alight: c1 is a required field")
-    assert(type(args.c2) == "number", "graphics.elements.indicators.alight: c2 is a required field")
-    assert(type(args.c3) == "number", "graphics.elements.indicators.alight: c3 is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.c1) == "number", "c1 is a required field")
+    element.assert(type(args.c2) == "number", "c2 is a required field")
+    element.assert(type(args.c3) == "number", "c3 is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.alight: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
     -- single line
@@ -51,19 +51,21 @@ local function alarm_indicator_light(args)
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 1
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
             if e.value == 2 then
-                e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
             end
         else
             if e.value == 3 then
-                e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
             else
-                e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
             end
         end
 
@@ -76,7 +78,7 @@ local function alarm_indicator_light(args)
         local was_off = e.value ~= 2
 
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if args.flash then
             if was_off and (new_state == 2) then
@@ -87,17 +89,17 @@ local function alarm_indicator_light(args)
                 flasher.stop(flash_callback)
 
                 if new_state == 3 then
-                    e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+                    e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
                 else
-                    e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+                    e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
                 end
             end
         elseif new_state == 2 then
-            e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
         elseif new_state == 3 then
-            e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
         else
-            e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
         end
     end
 
@@ -105,9 +107,14 @@ local function alarm_indicator_light(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        e.w_write(args.label)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/coremap.lua

@@ -18,8 +18,8 @@ local element = require("graphics.element")
 ---@param args core_map_args
 ---@return graphics_element element, element_id id
 local function core_map(args)
-    assert(util.is_int(args.reactor_l), "graphics.elements.indicators.coremap: reactor_l is a required field")
-    assert(util.is_int(args.reactor_w), "graphics.elements.indicators.coremap: reactor_w is a required field")
+    element.assert(util.is_int(args.reactor_l), "reactor_l is a required field")
+    element.assert(util.is_int(args.reactor_w), "reactor_w is a required field")
 
     -- require max dimensions
     args.width = 18
@@ -31,6 +31,8 @@ local function core_map(args)
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 0
+
     local alternator = true
 
     local core_l = args.reactor_l - 2
@@ -47,25 +49,25 @@ local function core_map(args)
 
     -- create coordinate grid and frame
     local function draw_frame()
-        e.window.setTextColor(colors.white)
+        e.w_set_fgd(colors.white)
 
         for x = 0, (inner_width - 1) do
-            e.window.setCursorPos(x + start_x, 1)
-            e.window.write(util.sprintf("%X", x))
+            e.w_set_cur(x + start_x, 1)
+            e.w_write(util.sprintf("%X", x))
         end
 
         for y = 0, (inner_height - 1) do
-            e.window.setCursorPos(1, y + start_y)
-            e.window.write(util.sprintf("%X", y))
+            e.w_set_cur(1, y + start_y)
+            e.w_write(util.sprintf("%X", y))
         end
 
         -- even out bottom edge
-        e.window.setTextColor(e.fg_bg.bkg)
-        e.window.setBackgroundColor(args.parent.get_fg_bg().bkg)
-        e.window.setCursorPos(1, e.frame.h)
-        e.window.write(util.strrep("\x8f", e.frame.w))
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.setBackgroundColor(e.fg_bg.bkg)
+        e.w_set_fgd(e.fg_bg.bkg)
+        e.w_set_bkg(args.parent.get_fg_bg().bkg)
+        e.w_set_cur(1, e.frame.h)
+        e.w_write(string.rep("\x8f", e.frame.w))
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_bkg(e.fg_bg.bkg)
     end
 
     -- draw the core
@@ -102,13 +104,13 @@ local function core_map(args)
 
         -- draw pattern
         for y = start_y, inner_height + (start_y - 1) do
-            e.window.setCursorPos(start_x, y)
+            e.w_set_cur(start_x, y)
             for _ = 1, inner_width do
                 if alternator then
                     i = i + 1
-                    e.window.blit("\x07", text_c, back_c)
+                    e.w_blit("\x07", text_c, back_c)
                 else
-                    e.window.blit("\x07", "7", "8")
+                    e.w_blit("\x07", "7", "8")
                 end
 
                 alternator = not alternator
@@ -157,11 +159,14 @@ local function core_map(args)
         e.on_update(e.value)
     end
 
-    -- initial (one-time except for resize()) frame draw
-    draw_frame()
+    -- redraw both frame and core
+    function e.redraw()
+        draw_frame()
+        draw_core(e.value)
+    end
 
     -- initial draw
-    e.on_update(0)
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/data.lua

@@ -24,25 +24,17 @@ local element = require("graphics.element")
 ---@param args data_indicator_args
 ---@return graphics_element element, element_id id
 local function data(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.data: label is a required field")
-    assert(type(args.format) == "string", "graphics.elements.indicators.data: format is a required field")
-    assert(args.value ~= nil, "graphics.elements.indicators.data: value is a required field")
-    assert(util.is_int(args.width), "graphics.elements.indicators.data: width is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.format) == "string", "format is a required field")
+    element.assert(args.value ~= nil, "value is a required field")
+    element.assert(util.is_int(args.width), "width is a required field")
 
-    -- single line
     args.height = 1
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- label color
-    if args.lu_colors ~= nil then
-        e.window.setTextColor(args.lu_colors.color_a)
-    end
-
-    -- write label
-    e.window.setCursorPos(1, 1)
-    e.window.write(args.label)
+    e.value = args.value
 
     local value_color = e.fg_bg.fgd
     local label_len   = string.len(args.label)
@@ -60,25 +52,25 @@ local function data(args)
         e.value = value
 
         -- clear old data and label
-        e.window.setCursorPos(data_start, 1)
-        e.window.write(util.spaces(clear_width))
+        e.w_set_cur(data_start, 1)
+        e.w_write(util.spaces(clear_width))
 
         -- write data
         local data_str = util.sprintf(args.format, value)
-        e.window.setCursorPos(data_start, 1)
-        e.window.setTextColor(value_color)
+        e.w_set_cur(data_start, 1)
+        e.w_set_fgd(value_color)
         if args.commas then
-            e.window.write(util.comma_format(data_str))
+            e.w_write(util.comma_format(data_str))
         else
-            e.window.write(data_str)
+            e.w_write(data_str)
         end
 
         -- write label
         if args.unit ~= nil then
             if args.lu_colors ~= nil then
-                e.window.setTextColor(args.lu_colors.color_b)
+                e.w_set_fgd(args.lu_colors.color_b)
             end
-            e.window.write(" " .. args.unit)
+            e.w_write(" " .. args.unit)
         end
     end
 
@@ -93,8 +85,17 @@ local function data(args)
         e.on_update(e.value)
     end
 
-    -- initial value draw
-    e.on_update(args.value)
+    -- element redraw
+    function e.redraw()
+        if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
+        e.w_set_cur(1, 1)
+        e.w_write(args.label)
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/hbar.lua

@@ -22,16 +22,17 @@ local element = require("graphics.element")
 ---@param args hbar_args
 ---@return graphics_element element, element_id id
 local function hbar(args)
-    -- properties/state
-    local last_num_bars = -1
-
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 0.0
+
     -- bar width is width - 5 characters for " 100%" if showing percent
     local bar_width = util.trinary(args.show_percent, e.frame.w - 5, e.frame.w)
 
-    assert(bar_width > 0, "graphics.elements.indicators.hbar: too small for bar")
+    element.assert(bar_width > 0, "too small for bar")
+
+    local last_num_bars = -1
 
     -- determine bar colors
     local bar_bkg = e.fg_bg.blit_bkg
@@ -87,16 +88,16 @@ local function hbar(args)
 
             -- draw bar
             for y = 1, e.frame.h do
-                e.window.setCursorPos(1, y)
+                e.w_set_cur(1, y)
                 -- intentionally swapped fgd/bkg since we use spaces as fill, but they are the opposite
-                e.window.blit(spaces, bkg, fgd)
+                e.w_blit(spaces, bkg, fgd)
             end
         end
 
         -- update percentage
         if args.show_percent then
-            e.window.setCursorPos(bar_width + 2, math.max(1, math.ceil(e.frame.h / 2)))
-            e.window.write(util.sprintf("%3.0f%%", fraction * 100))
+            e.w_set_cur(bar_width + 2, math.max(1, math.ceil(e.frame.h / 2)))
+            e.w_write(util.sprintf("%3.0f%%", fraction * 100))
         end
     end
 
@@ -105,20 +106,21 @@ local function hbar(args)
     function e.recolor(bar_fg_bg)
         bar_bkg = bar_fg_bg.blit_bkg
         bar_fgd = bar_fg_bg.blit_fgd
-
-        -- re-draw
-        last_num_bars = 0
-        if type(e.value) == "number" then
-            e.on_update(e.value)
-        end
+        e.redraw()
     end
 
     -- set the percentage value
     ---@param val number 0.0 to 1.0
     function e.set_value(val) e.on_update(val) end
 
-    -- initialize to 0
-    e.on_update(0)
+    -- element redraw
+    function e.redraw()
+        last_num_bars = -1
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/icon.lua

@@ -1,7 +1,5 @@
 -- Icon Indicator Graphics Element
 
-local util    = require("scada-common.util")
-
 local element = require("graphics.element")
 
 ---@class icon_sym_color
@@ -11,7 +9,7 @@ local element = require("graphics.element")
 ---@class icon_indicator_args
 ---@field label string indicator label
 ---@field states table state color and symbol table
----@field value? integer default state, defaults to 1
+---@field value? integer|boolean default state, defaults to 1 (true = 2, false = 1)
 ---@field min_label_width? integer label length if omitted
 ---@field parent graphics_element
 ---@field id? string element id
@@ -25,18 +23,18 @@ local element = require("graphics.element")
 ---@param args icon_indicator_args
 ---@return graphics_element element, element_id id
 local function icon(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.icon: label is a required field")
-    assert(type(args.states) == "table", "graphics.elements.indicators.icon: states is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.states) == "table", "states is a required field")
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 4
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = args.value or 1
+    if e.value == true then e.value = 2 end
+
     -- state blit strings
     local state_blit_cmds = {}
     for i = 1, #args.states do
@@ -44,30 +42,37 @@ local function icon(args)
 
         table.insert(state_blit_cmds, {
             text = " " .. sym_color.symbol .. " ",
-            fgd = util.strrep(sym_color.color.blit_fgd, 3),
-            bkg = util.strrep(sym_color.color.blit_bkg, 3)
+            fgd = string.rep(sym_color.color.blit_fgd, 3),
+            bkg = string.rep(sym_color.color.blit_bkg, 3)
         })
     end
 
-    -- write label and initial indicator light
-    e.window.setCursorPos(5, 1)
-    e.window.write(args.label)
-
     -- on state change
-    ---@param new_state integer indicator state
+    ---@param new_state integer|boolean indicator state
     function e.on_update(new_state)
+        new_state = new_state or 1
+        if new_state == true then new_state = 2 end
+
         local blit_cmd = state_blit_cmds[new_state]
         e.value = new_state
-        e.window.setCursorPos(1, 1)
-        e.window.blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
+        e.w_set_cur(1, 1)
+        e.w_blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
     end
 
     -- set indicator state
-    ---@param val integer indicator state
+    ---@param val integer|boolean indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- initial icon draw
-    e.on_update(args.value or 1)
+    -- element redraw
+    function e.redraw()
+        e.w_set_cur(5, 1)
+        e.w_write(args.label)
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/led.lua

@@ -23,33 +23,31 @@ local flasher = require("graphics.flasher")
 ---@param args indicator_led_args
 ---@return graphics_element element, element_id id
 local function indicator_led(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.led: label is a required field")
-    assert(type(args.colors) == "table", "graphics.elements.indicators.led: colors is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.colors) == "table", "colors is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.led: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
 
-    -- flasher state
     local flash_on = true
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = false
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
-            e.window.blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
         else
-            e.window.blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -61,8 +59,8 @@ local function indicator_led(args)
             flash_on = true
             flasher.start(flash_callback, args.period)
         else
-            e.window.setCursorPos(1, 1)
-            e.window.blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
+            e.w_set_cur(1, 1)
+            e.w_blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
         end
     end
 
@@ -73,8 +71,8 @@ local function indicator_led(args)
             flasher.stop(flash_callback)
         end
 
-        e.window.setCursorPos(1, 1)
-        e.window.blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
+        e.w_set_cur(1, 1)
+        e.w_blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
     end
 
     -- on state change
@@ -88,13 +86,18 @@ local function indicator_led(args)
     ---@param val boolean indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(false)
-    if string.len(args.label) > 0 then
-        e.window.setCursorPos(3, 1)
-        e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        if string.len(args.label) > 0 then
+            e.w_set_cur(3, 1)
+            e.w_write(args.label)
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/indicators/ledpair.lua

@@ -25,25 +25,20 @@ local flasher = require("graphics.flasher")
 ---@param args indicator_led_pair_args
 ---@return graphics_element element, element_id id
 local function indicator_led_pair(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.ledpair: label is a required field")
-    assert(type(args.off) == "number", "graphics.elements.indicators.ledpair: off is a required field")
-    assert(type(args.c1) == "number", "graphics.elements.indicators.ledpair: c1 is a required field")
-    assert(type(args.c2) == "number", "graphics.elements.indicators.ledpair: c2 is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.off) == "number", "off is a required field")
+    element.assert(type(args.c1) == "number", "c1 is a required field")
+    element.assert(type(args.c2) == "number", "c2 is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.ledpair: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
 
-    -- flasher state
     local flash_on = true
 
-    -- blit translations
     local co = colors.toBlit(args.off)
     local c1 = colors.toBlit(args.c1)
     local c2 = colors.toBlit(args.c2)
@@ -51,21 +46,20 @@ local function indicator_led_pair(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- init value for initial check in on_update
     e.value = 1
 
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
             if e.value == 2 then
-                e.window.blit("\x8c", c1, e.fg_bg.blit_bkg)
+                e.w_blit("\x8c", c1, e.fg_bg.blit_bkg)
             elseif e.value == 3 then
-                e.window.blit("\x8c", c2, e.fg_bg.blit_bkg)
+                e.w_blit("\x8c", c2, e.fg_bg.blit_bkg)
             end
         else
-            e.window.blit("\x8c", co, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -77,7 +71,7 @@ local function indicator_led_pair(args)
         local was_off = e.value <= 1
 
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if args.flash then
             if was_off and (new_state > 1) then
@@ -86,15 +80,14 @@ local function indicator_led_pair(args)
             elseif new_state <= 1 then
                 flash_on = false
                 flasher.stop(flash_callback)
-
-                e.window.blit("\x8c", co, e.fg_bg.blit_bkg)
+                e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
             end
         elseif new_state == 2 then
-            e.window.blit("\x8c", c1, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", c1, e.fg_bg.blit_bkg)
         elseif new_state == 3 then
-            e.window.blit("\x8c", c2, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", c2, e.fg_bg.blit_bkg)
         else
-            e.window.blit("\x8c", co, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
         end
     end
 
@@ -102,13 +95,18 @@ local function indicator_led_pair(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    if string.len(args.label) > 0 then
-        e.window.setCursorPos(3, 1)
-        e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        if string.len(args.label) > 0 then
+            e.w_set_cur(3, 1)
+            e.w_write(args.label)
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/indicators/ledrgb.lua

@@ -18,28 +18,24 @@ local element = require("graphics.element")
 ---@param args indicator_led_rgb_args
 ---@return graphics_element element, element_id id
 local function indicator_led_rgb(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.ledrgb: label is a required field")
-    assert(type(args.colors) == "table", "graphics.elements.indicators.ledrgb: colors is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.colors) == "table", "colors is a required field")
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- init value for initial check in on_update
     e.value = 1
 
     -- on state change
     ---@param new_state integer indicator state
     function e.on_update(new_state)
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
         if type(args.colors[new_state]) == "number" then
-            e.window.blit("\x8c", colors.toBlit(args.colors[new_state]), e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", colors.toBlit(args.colors[new_state]), e.fg_bg.blit_bkg)
         end
     end
 
@@ -47,13 +43,18 @@ local function indicator_led_rgb(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    if string.len(args.label) > 0 then
-        e.window.setCursorPos(3, 1)
-        e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        if string.len(args.label) > 0 then
+            e.w_set_cur(3, 1)
+            e.w_write(args.label)
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/indicators/light.lua

@@ -23,33 +23,31 @@ local flasher = require("graphics.flasher")
 ---@param args indicator_light_args
 ---@return graphics_element element, element_id id
 local function indicator_light(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.light: label is a required field")
-    assert(type(args.colors) == "table", "graphics.elements.indicators.light: colors is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.colors) == "table", "colors is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.light: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2
 
-    -- flasher state
     local flash_on = true
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = false
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
-            e.window.blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
         else
-            e.window.blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -61,8 +59,8 @@ local function indicator_light(args)
             flash_on = true
             flasher.start(flash_callback, args.period)
         else
-            e.window.setCursorPos(1, 1)
-            e.window.blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
+            e.w_set_cur(1, 1)
+            e.w_blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
         end
     end
 
@@ -73,8 +71,8 @@ local function indicator_light(args)
             flasher.stop(flash_callback)
         end
 
-        e.window.setCursorPos(1, 1)
-        e.window.blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
+        e.w_set_cur(1, 1)
+        e.w_blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
     end
 
     -- on state change
@@ -88,10 +86,15 @@ local function indicator_light(args)
     ---@param val boolean indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(false)
-    e.window.setCursorPos(3, 1)
-    e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(false)
+        e.w_set_cur(3, 1)
+        e.w_write(args.label)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/power.lua

@@ -9,7 +9,7 @@ local element = require("graphics.element")
 ---@field format string power format override (lua string format)
 ---@field rate boolean? whether to append /t to the end (power per tick)
 ---@field lu_colors? cpair label foreground color (a), unit foreground color (b)
----@field value any default value
+---@field value number default value
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -23,26 +23,17 @@ local element = require("graphics.element")
 ---@param args power_indicator_args
 ---@return graphics_element element, element_id id
 local function power(args)
-    assert(args.value ~= nil, "graphics.elements.indicators.power: value is a required field")
-    assert(util.is_int(args.width), "graphics.elements.indicators.power: width is a required field")
+    element.assert(type(args.value) == "number", "value is a required field")
+    element.assert(util.is_int(args.width), "width is a required field")
 
-    -- single line
     args.height = 1
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- label color
-    if args.lu_colors ~= nil then
-        e.window.setTextColor(args.lu_colors.color_a)
-    end
+    e.value = args.value
 
-    -- write label
-    e.window.setCursorPos(1, 1)
-    e.window.write(args.label)
-
-    local data_start = string.len(args.label) + 2
-    if string.len(args.label) == 0 then data_start = 1 end
+    local data_start = 0
 
     -- on state change
     ---@param value any new value
@@ -52,13 +43,13 @@ local function power(args)
         local data_str, unit = util.power_format(value, false, args.format)
 
         -- write data
-        e.window.setCursorPos(data_start, 1)
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.write(util.comma_format(data_str))
+        e.w_set_cur(data_start, 1)
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_write(util.comma_format(data_str))
 
         -- write unit
         if args.lu_colors ~= nil then
-            e.window.setTextColor(args.lu_colors.color_b)
+            e.w_set_fgd(args.lu_colors.color_b)
         end
 
         -- append per tick if rate is set
@@ -70,15 +61,27 @@ local function power(args)
             if unit == "FE" then unit = "FE " end
         end
 
-        e.window.write(" " .. unit)
+        e.w_write(" " .. unit)
     end
 
     -- set the value
     ---@param val any new value
     function e.set_value(val) e.on_update(val) end
 
-    -- initial value draw
-    e.on_update(args.value)
+    -- element redraw
+    function e.redraw()
+        if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
+        e.w_set_cur(1, 1)
+        e.w_write(args.label)
+
+        data_start = string.len(args.label) + 2
+        if string.len(args.label) == 0 then data_start = 1 end
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/rad.lua

@@ -10,7 +10,7 @@ local element = require("graphics.element")
 ---@field format string data format (lua string format)
 ---@field commas? boolean whether to use commas if a number is given (default to false)
 ---@field lu_colors? cpair label foreground color (a), unit foreground color (b)
----@field value any default value
+---@field value? radiation_reading default value
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -24,24 +24,16 @@ local element = require("graphics.element")
 ---@param args rad_indicator_args
 ---@return graphics_element element, element_id id
 local function rad(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.rad: label is a required field")
-    assert(type(args.format) == "string", "graphics.elements.indicators.rad: format is a required field")
-    assert(util.is_int(args.width), "graphics.elements.indicators.rad: width is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.format) == "string", "format is a required field")
+    element.assert(util.is_int(args.width), "width is a required field")
 
-    -- single line
     args.height = 1
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- label color
-    if args.lu_colors ~= nil then
-        e.window.setTextColor(args.lu_colors.color_a)
-    end
-
-    -- write label
-    e.window.setCursorPos(1, 1)
-    e.window.write(args.label)
+    e.value = args.value or types.new_zero_radiation_reading()
 
     local label_len = string.len(args.label)
     local data_start = 1
@@ -58,32 +50,41 @@ local function rad(args)
         e.value = value.radiation
 
         -- clear old data and label
-        e.window.setCursorPos(data_start, 1)
-        e.window.write(util.spaces(clear_width))
+        e.w_set_cur(data_start, 1)
+        e.w_write(util.spaces(clear_width))
 
         -- write data
         local data_str = util.sprintf(args.format, e.value)
-        e.window.setCursorPos(data_start, 1)
-        e.window.setTextColor(e.fg_bg.fgd)
+        e.w_set_cur(data_start, 1)
+        e.w_set_fgd(e.fg_bg.fgd)
         if args.commas then
-            e.window.write(util.comma_format(data_str))
+            e.w_write(util.comma_format(data_str))
         else
-            e.window.write(data_str)
+            e.w_write(data_str)
         end
 
         -- write unit
         if args.lu_colors ~= nil then
-            e.window.setTextColor(args.lu_colors.color_b)
+            e.w_set_fgd(args.lu_colors.color_b)
         end
-        e.window.write(" " .. value.unit)
+        e.w_write(" " .. value.unit)
     end
 
     -- set the value
     ---@param val any new value
     function e.set_value(val) e.on_update(val) end
 
-    -- initial value draw
-    e.on_update(types.new_zero_radiation_reading())
+    -- element redraw
+    function e.redraw()
+        if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
+        e.w_set_cur(1, 1)
+        e.w_write(args.label)
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/signal.lua

@@ -0,0 +1,85 @@
+-- Signal Bars Graphics Element
+
+local util    = require("scada-common.util")
+
+local element = require("graphics.element")
+
+---@class signal_bar_args
+---@field compact? boolean true to use a single character (works better against edges that extend out colors)
+---@field colors_low_med? cpair color a for low signal quality, color b for medium signal quality
+---@field disconnect_color? color color for the 'x' on disconnect
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors (foreground is used for high signal quality)
+---@field hidden? boolean true to hide on initial draw
+
+-- new signal bar
+---@nodiscard
+---@param args signal_bar_args
+---@return graphics_element element, element_id id
+local function signal_bar(args)
+    args.height = 1
+    args.width = util.trinary(args.compact, 1, 2)
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    e.value = 0
+
+    local blit_bkg = args.fg_bg.blit_bkg
+    local blit_0, blit_1, blit_2, blit_3 = args.fg_bg.blit_fgd, args.fg_bg.blit_fgd, args.fg_bg.blit_fgd, args.fg_bg.blit_fgd
+
+    if type(args.colors_low_med) == "table" then
+        blit_1 = args.colors_low_med.blit_a or blit_1
+        blit_2 = args.colors_low_med.blit_b or blit_2
+    end
+
+    if util.is_int(args.disconnect_color) then blit_0 = colors.toBlit(args.disconnect_color) end
+
+    -- on state change (0 = offline, 1 through 3 = low to high signal)
+    ---@param new_state integer signal state
+    function e.on_update(new_state)
+        e.value = new_state
+        e.redraw()
+    end
+
+    -- set signal state (0 = offline, 1 through 3 = low to high signal)
+    ---@param val integer signal state
+    function e.set_value(val) e.on_update(val) end
+
+    -- draw label and signal bar
+    function e.redraw()
+        e.w_set_cur(1, 1)
+
+        if args.compact then
+            if e.value == 1 then
+                e.w_blit("\x90", blit_1, blit_bkg)
+            elseif e.value == 2 then
+                e.w_blit("\x94", blit_2, blit_bkg)
+            elseif e.value == 3 then
+                e.w_blit("\x95", blit_3, blit_bkg)
+            else
+                e.w_blit("x", blit_0, blit_bkg)
+            end
+        else
+            if e.value == 1 then
+                e.w_blit("\x9f ", blit_bkg .. blit_bkg, blit_1 .. blit_bkg)
+            elseif e.value == 2 then
+                e.w_blit("\x9f\x94", blit_bkg .. blit_2, blit_2 .. blit_bkg)
+            elseif e.value == 3 then
+                e.w_blit("\x9f\x81", blit_bkg .. blit_bkg, blit_3 .. blit_3)
+            else
+                e.w_blit(" x", blit_0 .. blit_0, blit_bkg .. blit_bkg)
+            end
+        end
+    end
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return signal_bar

graphics/elements/indicators/state.lua

@@ -25,16 +25,12 @@ local element = require("graphics.element")
 ---@param args state_indicator_args
 ---@return graphics_element element, element_id id
 local function state_indicator(args)
-    assert(type(args.states) == "table", "graphics.elements.indicators.state: states is a required field")
+    element.assert(type(args.states) == "table", "states is a required field")
 
-    -- determine height
     if util.is_int(args.height) then
-        assert(args.height % 2 == 1, "graphics.elements.indicators.state: height should be an odd number")
-    else
-        args.height = 1
-    end
+        element.assert(args.height % 2 == 1, "height should be an odd number")
+    else args.height = 1 end
 
-    -- initial guess at width
     args.width = args.min_width or 1
 
     -- state blit strings
@@ -42,7 +38,6 @@ local function state_indicator(args)
     for i = 1, #args.states do
         local state_def = args.states[i]    ---@type state_text_color
 
-        -- re-determine width
         if string.len(state_def.text) > args.width then
             args.width = string.len(state_def.text)
         end
@@ -51,21 +46,28 @@ local function state_indicator(args)
 
         table.insert(state_blit_cmds, {
             text = text,
-            fgd = util.strrep(state_def.color.blit_fgd, string.len(text)),
-            bkg = util.strrep(state_def.color.blit_bkg, string.len(text))
+            fgd = string.rep(state_def.color.blit_fgd, string.len(text)),
+            bkg = string.rep(state_def.color.blit_bkg, string.len(text))
         })
     end
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = args.value or 1
+
+    -- element redraw
+    function e.redraw()
+        local blit_cmd = state_blit_cmds[e.value]
+        e.w_set_cur(1, 1)
+        e.w_blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
+    end
+
     -- on state change
     ---@param new_state integer indicator state
     function e.on_update(new_state)
-        local blit_cmd = state_blit_cmds[new_state]
         e.value = new_state
-        e.window.setCursorPos(1, 1)
-        e.window.blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
+        e.redraw()
     end
 
     -- set indicator state
@@ -73,7 +75,7 @@ local function state_indicator(args)
     function e.set_value(val) e.on_update(val) end
 
     -- initial draw
-    e.on_update(args.value or 1)
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/trilight.lua

@@ -25,47 +25,41 @@ local flasher = require("graphics.flasher")
 ---@param args tristate_indicator_light_args
 ---@return graphics_element element, element_id id
 local function tristate_indicator_light(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.trilight: label is a required field")
-    assert(type(args.c1) == "number", "graphics.elements.indicators.trilight: c1 is a required field")
-    assert(type(args.c2) == "number", "graphics.elements.indicators.trilight: c2 is a required field")
-    assert(type(args.c3) == "number", "graphics.elements.indicators.trilight: c3 is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.c1) == "number", "c1 is a required field")
+    element.assert(type(args.c2) == "number", "c2 is a required field")
+    element.assert(type(args.c3) == "number", "c3 is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.trilight: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2
 
-    -- flasher state
-    local flash_on = true
-
-    -- blit translations
-    local c1 = colors.toBlit(args.c1)
-    local c2 = colors.toBlit(args.c2)
-    local c3 = colors.toBlit(args.c3)
-
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- init value for initial check in on_update
     e.value = 1
 
+    local flash_on = true
+
+    local c1 = colors.toBlit(args.c1)
+    local c2 = colors.toBlit(args.c2)
+    local c3 = colors.toBlit(args.c3)
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
             if e.value == 2 then
-                e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
             elseif e.value == 3 then
-                e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
             end
         else
-            e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -77,7 +71,7 @@ local function tristate_indicator_light(args)
         local was_off = e.value <= 1
 
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if args.flash then
             if was_off and (new_state > 1) then
@@ -87,14 +81,14 @@ local function tristate_indicator_light(args)
                 flash_on = false
                 flasher.stop(flash_callback)
 
-                e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
             end
         elseif new_state == 2 then
-            e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
         elseif new_state == 3 then
-            e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
         else
-            e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
         end
     end
 
@@ -102,9 +96,14 @@ local function tristate_indicator_light(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    e.window.write(args.label)
+    -- draw light and label
+    function e.redraw()
+        e.on_update(1)
+        e.w_write(args.label)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/vbar.lua

@@ -20,18 +20,18 @@ local element = require("graphics.element")
 ---@param args vbar_args
 ---@return graphics_element element, element_id id
 local function vbar(args)
-    -- properties/state
-    local last_num_bars = -1
-
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- blit strings
-    local fgd = util.strrep(e.fg_bg.blit_fgd, e.frame.w)
-    local bkg = util.strrep(e.fg_bg.blit_bkg, e.frame.w)
+    e.value = 0.0
+
+    local last_num_bars = -1
+
+    local fgd = string.rep(e.fg_bg.blit_fgd, e.frame.w)
+    local bkg = string.rep(e.fg_bg.blit_bkg, e.frame.w)
     local spaces = util.spaces(e.frame.w)
-    local one_third = util.strrep("\x8f", e.frame.w)
-    local two_thirds = util.strrep("\x83", e.frame.w)
+    local one_third = string.rep("\x8f", e.frame.w)
+    local two_thirds = string.rep("\x83", e.frame.w)
 
     -- handle data changes
     ---@param fraction number 0.0 to 1.0
@@ -52,54 +52,55 @@ local function vbar(args)
         if num_bars ~= last_num_bars then
             last_num_bars = num_bars
 
-            -- start bottom up
             local y = e.frame.h
-
-            -- start at base of vertical bar
-            e.window.setCursorPos(1, y)
+            e.w_set_cur(1, y)
 
             -- fill percentage
             for _ = 1, num_bars / 3 do
-                e.window.blit(spaces, bkg, fgd)
+                e.w_blit(spaces, bkg, fgd)
                 y = y - 1
-                e.window.setCursorPos(1, y)
+                e.w_set_cur(1, y)
             end
 
             -- add fractional bar if needed
             if num_bars % 3 == 1 then
-                e.window.blit(one_third, bkg, fgd)
+                e.w_blit(one_third, bkg, fgd)
                 y = y - 1
             elseif num_bars % 3 == 2 then
-                e.window.blit(two_thirds, bkg, fgd)
+                e.w_blit(two_thirds, bkg, fgd)
                 y = y - 1
             end
 
             -- fill the rest blank
             while y > 0 do
-                e.window.setCursorPos(1, y)
-                e.window.blit(spaces, fgd, bkg)
+                e.w_set_cur(1, y)
+                e.w_blit(spaces, fgd, bkg)
                 y = y - 1
             end
         end
     end
 
-    -- change bar color
-    ---@param fg_bg cpair new bar colors
-    function e.recolor(fg_bg)
-        fgd = util.strrep(fg_bg.blit_fgd, e.frame.w)
-        bkg = util.strrep(fg_bg.blit_bkg, e.frame.w)
-
-        -- re-draw
-        last_num_bars = 0
-        if type(e.value) == "number" then
-            e.on_update(e.value)
-        end
-    end
-
     -- set the percentage value
     ---@param val number 0.0 to 1.0
     function e.set_value(val) e.on_update(val) end
 
+    -- element redraw
+    function e.redraw()
+        last_num_bars = -1
+        e.on_update(e.value)
+    end
+
+    -- change bar color
+    ---@param fg_bg cpair new bar colors
+    function e.recolor(fg_bg)
+        fgd = string.rep(fg_bg.blit_fgd, e.frame.w)
+        bkg = string.rep(fg_bg.blit_bkg, e.frame.w)
+        e.redraw()
+    end
+
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/listbox.lua

@@ -5,7 +5,8 @@ local tcd     = require("scada-common.tcd")
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local CLICK_TYPE = core.events.CLICK_TYPE
+local KEY_CLICK = core.events.KEY_CLICK
+local MOUSE_CLICK = core.events.MOUSE_CLICK
 
 ---@class listbox_args
 ---@field scroll_height integer height of internal scrolling container (must fit all elements vertically tiled)
@@ -33,6 +34,8 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@param args listbox_args
 ---@return graphics_element element, element_id id
 local function listbox(args)
+    args.can_focus = true
+
     -- create new graphics element base object
     local e = element.new(args)
 
@@ -63,34 +66,34 @@ local function listbox(args)
 
         -- draw up/down arrows
         if pressed_arrow == 1 then
-            e.window.setTextColor(active_fg_bg.fgd)
-            e.window.setBackgroundColor(active_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, 1)
-            e.window.write("\x1e")
-            e.window.setTextColor(nav_fg_bg.fgd)
-            e.window.setBackgroundColor(nav_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, e.frame.h)
-            e.window.write("\x1f")
+            e.w_set_fgd(active_fg_bg.fgd)
+            e.w_set_bkg(active_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, 1)
+            e.w_write("\x1e")
+            e.w_set_fgd(nav_fg_bg.fgd)
+            e.w_set_bkg(nav_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, e.frame.h)
+            e.w_write("\x1f")
         elseif pressed_arrow == -1 then
-            e.window.setTextColor(nav_fg_bg.fgd)
-            e.window.setBackgroundColor(nav_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, 1)
-            e.window.write("\x1e")
-            e.window.setTextColor(active_fg_bg.fgd)
-            e.window.setBackgroundColor(active_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, e.frame.h)
-            e.window.write("\x1f")
+            e.w_set_fgd(nav_fg_bg.fgd)
+            e.w_set_bkg(nav_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, 1)
+            e.w_write("\x1e")
+            e.w_set_fgd(active_fg_bg.fgd)
+            e.w_set_bkg(active_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, e.frame.h)
+            e.w_write("\x1f")
         else
-            e.window.setTextColor(nav_fg_bg.fgd)
-            e.window.setBackgroundColor(nav_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, 1)
-            e.window.write("\x1e")
-            e.window.setCursorPos(e.frame.w, e.frame.h)
-            e.window.write("\x1f")
+            e.w_set_fgd(nav_fg_bg.fgd)
+            e.w_set_bkg(nav_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, 1)
+            e.w_write("\x1e")
+            e.w_set_cur(e.frame.w, e.frame.h)
+            e.w_write("\x1f")
         end
 
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.setBackgroundColor(e.fg_bg.bkg)
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_bkg(e.fg_bg.bkg)
     end
 
     -- render the scroll bar and re-cacluate height & bounds
@@ -115,23 +118,23 @@ local function listbox(args)
         for i = 2, e.frame.h - 1 do
             if (i >= offset and i < (bar_height + offset)) and (bar_height ~= max_bar_height) then
                 if args.nav_fg_bg ~= nil then
-                    e.window.setBackgroundColor(args.nav_fg_bg.fgd)
+                    e.w_set_bkg(args.nav_fg_bg.fgd)
                 else
-                    e.window.setBackgroundColor(e.fg_bg.fgd)
+                    e.w_set_bkg(e.fg_bg.fgd)
                 end
             else
                 if args.nav_fg_bg ~= nil then
-                    e.window.setBackgroundColor(args.nav_fg_bg.bkg)
+                    e.w_set_bkg(args.nav_fg_bg.bkg)
                 else
-                    e.window.setBackgroundColor(e.fg_bg.bkg)
+                    e.w_set_bkg(e.fg_bg.bkg)
                 end
             end
 
-            e.window.setCursorPos(e.frame.w, i)
-            e.window.write(" ")
+            e.w_set_cur(e.frame.w, i)
+            if e.is_focused() then e.w_write("\x7f") else e.w_write(" ") end
         end
 
-        e.window.setBackgroundColor(e.fg_bg.bkg)
+        e.w_set_bkg(e.fg_bg.bkg)
     end
 
     -- update item y positions and move elements
@@ -158,6 +161,9 @@ local function listbox(args)
         scroll_frame.reposition(1, 1 + scroll_offset)
         scroll_frame.setVisible(true)
 
+        -- shift mouse events
+        e.mouse_window_shift.y = scroll_offset
+
         draw_bar()
     end
 
@@ -219,30 +225,60 @@ local function listbox(args)
         end
     end
 
+    -- handle focus
+    e.on_focused = draw_bar
+    e.on_unfocused = draw_bar
+
+    -- handle a child in the list being focused, make sure it is visible
+    function e.on_child_focused(child)
+        for i = 1, #list do
+            local item = list[i]    ---@type listbox_item
+            if item.e == child then
+                if (item.y + scroll_offset) <= 0 then
+                    scroll_offset = 1 - item.y
+                    update_positions()
+                    draw_bar()
+                elseif (item.y + scroll_offset) == 1 then
+                    -- do nothing, it's right at the top (if the bottom doesn't fit we can't easily fix that)
+                elseif ((item.h + item.y - 1) + scroll_offset) > e.frame.h then
+                    scroll_offset = 1 - ((item.h + item.y) - e.frame.h)
+                    update_positions()
+                    draw_bar()
+                end
+
+                return
+            end
+        end
+    end
+
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         if e.enabled then
-            if event.type == CLICK_TYPE.TAP then
+            if event.type == MOUSE_CLICK.TAP then
                 if event.current.x == e.frame.w then
                     if event.current.y == 1 or event.current.y < bar_bounds[1] then
-                        draw_arrows(1)
                         scroll_up()
-                        if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        if event.current.y == 1 then
+                            draw_arrows(1)
+                            if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        end
                     elseif event.current.y == e.frame.h or event.current.y > bar_bounds[2] then
-                        draw_arrows(-1)
                         scroll_down()
-                        if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        if event.current.y == e.frame.h then
+                            draw_arrows(-1)
+                            if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        end
                     end
                 end
-            elseif event.type == CLICK_TYPE.DOWN then
+            elseif event.type == MOUSE_CLICK.DOWN then
                 if event.current.x == e.frame.w then
                     if event.current.y == 1 or event.current.y < bar_bounds[1] then
-                        draw_arrows(1)
                         scroll_up()
+                        if event.current.y == 1 then draw_arrows(1) end
                     elseif event.current.y == e.frame.h or event.current.y > bar_bounds[2] then
-                        draw_arrows(-1)
                         scroll_down()
+                        if event.current.y == e.frame.h then draw_arrows(-1) end
                     else
                         -- clicked on bar
                         holding_bar = true
@@ -250,10 +286,10 @@ local function listbox(args)
                         mouse_last_y = event.current.y
                     end
                 end
-            elseif event.type == CLICK_TYPE.UP then
+            elseif event.type == MOUSE_CLICK.UP then
                 holding_bar = false
                 draw_arrows(0)
-            elseif event.type == CLICK_TYPE.DRAG then
+            elseif event.type == MOUSE_CLICK.DRAG then
                 if holding_bar then
                     -- if mouse is within vertical frame, including the grip point
                     if event.current.y > (1 + bar_grip_pos) and event.current.y <= ((e.frame.h - bar_height) + bar_grip_pos) then
@@ -266,16 +302,40 @@ local function listbox(args)
                         mouse_last_y = event.current.y
                     end
                 end
-            elseif event.type == CLICK_TYPE.SCROLL_DOWN then
+            elseif event.type == MOUSE_CLICK.SCROLL_DOWN then
                 scroll_down()
-            elseif event.type == CLICK_TYPE.SCROLL_UP then
+            elseif event.type == MOUSE_CLICK.SCROLL_UP then
                 scroll_up()
             end
         end
     end
 
-    draw_arrows(0)
-    draw_bar()
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if event.key == keys.up then
+                scroll_up()
+            elseif event.key == keys.down then
+                scroll_down()
+            elseif event.key == keys.home then
+                scroll_offset = 0
+                update_positions()
+            elseif event.key == keys["end"] then
+                scroll_offset = max_down_scroll
+                update_positions()
+            end
+        end
+    end
+
+    -- element redraw
+    function e.redraw()
+        draw_arrows(0)
+        draw_bar()
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/multipane.lua

@@ -19,23 +19,30 @@ local element = require("graphics.element")
 ---@param args multipane_args
 ---@return graphics_element element, element_id id
 local function multipane(args)
-    assert(type(args.panes) == "table", "graphics.elements.multipane: panes is a required field")
+    element.assert(type(args.panes) == "table", "panes is a required field")
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 1
+
+    -- show the selected pane
+    function e.redraw()
+        for i = 1, #args.panes do args.panes[i].hide() end
+        args.panes[e.value].show()
+    end
+
     -- select which pane is shown
     ---@param value integer pane to show
     function e.set_value(value)
         if (e.value ~= value) and (value > 0) and (value <= #args.panes) then
             e.value = value
-
-            for i = 1, #args.panes do args.panes[i].hide() end
-            args.panes[value].show()
+            e.redraw()
         end
     end
 
-    e.set_value(1)
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/pipenet.lua

@@ -14,16 +14,21 @@ local element = require("graphics.element")
 ---@field y? integer auto incremented if omitted
 ---@field hidden? boolean true to hide on initial draw
 
+---@class _pipe_map_entry
+---@field atr boolean align top right (or bottom left for false)
+---@field thin boolean thin pipe or not
+---@field fg string foreground blit
+---@field bg string background blit
+
 -- new pipe network
 ---@param args pipenet_args
 ---@return graphics_element element, element_id id
 local function pipenet(args)
-    assert(type(args.pipes) == "table", "graphics.elements.indicators.pipenet: pipes is a required field")
+    element.assert(type(args.pipes) == "table", "pipes is a required field")
 
     args.width = 0
     args.height = 0
 
-    -- determine width/height
     for i = 1, #args.pipes do
         local pipe = args.pipes[i]  ---@type pipe
 
@@ -44,104 +49,282 @@ local function pipenet(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- draw all pipes
+    -- determine if there are any thin pipes involved
+    local any_thin = false
     for p = 1, #args.pipes do
-        local pipe = args.pipes[p]  ---@type pipe
+        any_thin = args.pipes[p].thin
+        if any_thin then break end
+    end
 
-        local x = 1 + pipe.x1
-        local y = 1 + pipe.y1
+    -- draw all pipes by drawing out lines
+    local function vector_draw()
+        for p = 1, #args.pipes do
+            local pipe = args.pipes[p]  ---@type pipe
 
-        local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
-        local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+            local x = 1 + pipe.x1
+            local y = 1 + pipe.y1
 
-        e.window.setCursorPos(x, y)
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
 
-        local c = core.cpair(pipe.color, e.fg_bg.bkg)
-
-        if pipe.align_tr then
-            -- cross width then height
-            for i = 1, pipe.w do
-                if pipe.thin then
-                    if i == pipe.w then
-                        -- corner
-                        if y_step > 0 then
-                            e.window.blit("\x93", c.blit_bkg, c.blit_fgd)
-                        else
-                            e.window.blit("\x8e", c.blit_fgd, c.blit_bkg)
-                        end
-                    else
-                        e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.w and y_step > 0 then
-                        -- corner
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
-                    else
-                        e.window.blit("\x8f", c.blit_fgd, c.blit_bkg)
-                    end
-                end
-
-                x = x + x_step
-                e.window.setCursorPos(x, y)
+            if pipe.thin then
+                x_step = util.trinary(pipe.x1 == pipe.x2, 0, x_step)
+                y_step = util.trinary(pipe.y1 == pipe.y2, 0, y_step)
             end
 
-            -- back up one
-            x = x - x_step
+            e.w_set_cur(x, y)
 
-            for _ = 1, pipe.h - 1 do
-                y = y + y_step
-                e.window.setCursorPos(x, y)
+            local c = core.cpair(pipe.color, e.fg_bg.bkg)
 
-                if pipe.thin then
-                    e.window.blit("\x95", c.blit_bkg, c.blit_fgd)
-                else
-                    e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+            if pipe.align_tr then
+                -- cross width then height
+                for i = 1, pipe.w do
+                    if pipe.thin then
+                        if i == pipe.w then
+                            -- corner
+                            if y_step > 0 then
+                                e.w_blit("\x93", c.blit_bkg, c.blit_fgd)
+                            else
+                                e.w_blit("\x8e", c.blit_fgd, c.blit_bkg)
+                            end
+                        else
+                            e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
+                        end
+                    else
+                        if i == pipe.w and y_step > 0 then
+                            -- corner
+                            e.w_blit(" ", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.w_blit("\x8f", c.blit_fgd, c.blit_bkg)
+                        end
+                    end
+
+                    x = x + x_step
+                    e.w_set_cur(x, y)
                 end
+
+                -- back up one
+                x = x - x_step
+
+                for _ = 1, pipe.h - 1 do
+                    y = y + y_step
+                    e.w_set_cur(x, y)
+
+                    if pipe.thin then
+                        e.w_blit("\x95", c.blit_bkg, c.blit_fgd)
+                    else
+                        e.w_blit(" ", c.blit_bkg, c.blit_fgd)
+                    end
+                end
+            else
+                -- cross height then width
+                for i = 1, pipe.h do
+                    if pipe.thin then
+                        if i == pipe.h then
+                            -- corner
+                            if y_step < 0 then
+                                e.w_blit("\x97", c.blit_bkg, c.blit_fgd)
+                            elseif y_step > 0 then
+                                e.w_blit("\x8d", c.blit_fgd, c.blit_bkg)
+                            else
+                                e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
+                            end
+                        else
+                            e.w_blit("\x95", c.blit_fgd, c.blit_bkg)
+                        end
+                    else
+                        if i == pipe.h and y_step < 0 then
+                            -- corner
+                            e.w_blit("\x83", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.w_blit(" ", c.blit_bkg, c.blit_fgd)
+                        end
+                    end
+
+                    y = y + y_step
+                    e.w_set_cur(x, y)
+                end
+
+                -- back up one
+                y = y - y_step
+
+                for _ = 1, pipe.w - 1 do
+                    x = x + x_step
+                    e.w_set_cur(x, y)
+
+                    if pipe.thin then
+                        e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
+                    else
+                        e.w_blit("\x83", c.blit_bkg, c.blit_fgd)
+                    end
+                end
+            end
+        end
+    end
+
+    -- draw a particular map cell
+    ---@param map table 2D cell map
+    ---@param x integer x coord
+    ---@param y integer y coord
+    local function draw_map_cell(map, x, y)
+        local entry = map[x][y] ---@type _pipe_map_entry already confirmed not false
+        local char
+        local invert = false
+
+        local function check(cx, cy)
+            return (map[cx] ~= nil) and (map[cx][cy] ~= nil) and (map[cx][cy] ~= false) and (map[cx][cy].fg == entry.fg)
+        end
+
+        if entry.thin then
+            if check(x - 1, y) then -- if left
+                if check(x, y - 1) then -- if above
+                    if check(x + 1, y) then -- if right
+                        if check(x, y + 1) then -- if below
+                            char = util.trinary(entry.atr, "\x91", "\x9d")
+                            invert = entry.atr
+                        else -- not below
+                            char = util.trinary(entry.atr, "\x8e", "\x8d")
+                        end
+                    else -- not right
+                        if check(x, y + 1) then -- if below
+                            char = util.trinary(entry.atr, "\x91", "\x95")
+                            invert = entry.atr
+                        else -- not below
+                            char = util.trinary(entry.atr, "\x8e", "\x85")
+                        end
+                    end
+                elseif check(x, y + 1) then-- not above, if below
+                    if check(x + 1, y) then -- if right
+                        char = util.trinary(entry.atr, "\x93", "\x9c")
+                        invert = entry.atr
+                    else -- not right
+                        char = util.trinary(entry.atr, "\x93", "\x94")
+                        invert = entry.atr
+                    end
+                else -- not above, not below
+                    char = "\x8c"
+                end
+            elseif check(x + 1, y) then -- not left, if right
+                if check(x, y - 1) then -- if above
+                    if check(x, y + 1) then -- if below
+                        char = util.trinary(entry.atr, "\x95", "\x9d")
+                        invert = entry.atr
+                    else -- not below
+                        char = util.trinary(entry.atr, "\x8a", "\x8d")
+                    end
+                else -- not above
+                    if check(x, y + 1) then -- if below
+                        char = util.trinary(entry.atr, "\x97", "\x9c")
+                        invert = entry.atr
+                    else -- not below
+                        char = "\x8c"
+                    end
+                end
+            else -- not left, not right
+                char = "\x95"
+                invert = entry.atr
             end
         else
-            -- cross height then width
-            for i = 1, pipe.h do
-                if pipe.thin then
-                    if i == pipe.h then
-                        -- corner
-                        if y_step < 0 then
-                            e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
-                        else
-                            e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
-                        end
-                    else
-                        e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.h and y_step < 0 then
-                        -- corner
-                        e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
-                    else
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
-                    end
+            if check(x, y - 1) then -- above
+                -- not below and (if left or right)
+                if (not check(x, y + 1)) and (check(x - 1, y) or check(x + 1, y)) then
+                    char = util.trinary(entry.atr, "\x8f", " ")
+                    invert = not entry.atr
+                else -- not below w/ sides only
+                    char = " "
+                    invert = true
+                end
+            elseif check(x, y + 1) then -- not above, if below
+                -- if left or right
+                if (check(x - 1, y) or check(x + 1, y)) then
+                    char = "\x83"
+                    invert = true
+                else -- not left or right
+                    char = " "
+                    invert = true
+                end
+            else -- not above, not below
+                char = util.trinary(entry.atr, "\x8f", "\x83")
+                invert = not entry.atr
+            end
+        end
+
+        e.w_set_cur(x, y)
+
+        if invert then
+            e.w_blit(char, entry.bg, entry.fg)
+        else
+            e.w_blit(char, entry.fg, entry.bg)
+        end
+    end
+
+    -- draw all pipes by assembling and marking up a 2D map<br>
+    -- this is an easy way to check adjacent blocks, which is required to properly draw thin pipes
+    local function map_draw()
+        local map = {}
+
+        for x = 1, args.width do
+            table.insert(map, {})
+            for _ = 1, args.height do table.insert(map[x], false) end
+        end
+
+        -- build map
+        for p = 1, #args.pipes do
+            local pipe = args.pipes[p]  ---@type pipe
+
+            local x = 1 + pipe.x1
+            local y = 1 + pipe.y1
+
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+
+            local entry = { atr = pipe.align_tr, thin = pipe.thin, fg = colors.toBlit(pipe.color), bg = e.fg_bg.blit_bkg }
+
+            if pipe.align_tr then
+                -- cross width then height
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
                 end
 
-                y = y + y_step
-                e.window.setCursorPos(x, y)
-            end
+                x = x - x_step  -- back up one
 
-            -- back up one
-            y = y - y_step
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
+            else
+                -- cross height then width
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
 
-            for _ = 1, pipe.w - 1 do
-                x = x + x_step
-                e.window.setCursorPos(x, y)
+                y = y - y_step  -- back up one
 
-                if pipe.thin then
-                    e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
-                else
-                    e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
                 end
             end
         end
 
+        -- render
+        for x = 1, args.width do
+            for y = 1, args.height do
+                if map[x][y] ~= false then draw_map_cell(map, x, y) end
+            end
+        end
     end
 
+    -- element redraw
+    function e.redraw()
+        if any_thin then map_draw() else vector_draw() end
+    end
+
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/rectangle.lua

@@ -22,7 +22,7 @@ local element = require("graphics.element")
 ---@param args rectangle_args
 ---@return graphics_element element, element_id id
 local function rectangle(args)
-    assert(args.border ~= nil or args.thin ~= true, "graphics.elements.rectangle: thin requires border to be provided")
+    element.assert(args.border ~= nil or args.thin ~= true, "thin requires border to be provided")
 
     -- if thin, then width will always need to be 1
     if args.thin == true then
@@ -56,7 +56,7 @@ local function rectangle(args)
     -- draw bordered box if requested
     -- element constructor will have drawn basic colored rectangle regardless
     if args.border ~= nil then
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         local border_width = offset_x
         local border_height = offset_y
@@ -65,50 +65,50 @@ local function rectangle(args)
         local inner_width = e.frame.w - width_x2
 
         -- check dimensions
-        assert(width_x2 <= e.frame.w, "graphics.elements.rectangle: border too thick for width")
-        assert(width_x2 <= e.frame.h, "graphics.elements.rectangle: border too thick for height")
+        element.assert(width_x2 <= e.frame.w, "border too thick for width")
+        element.assert(width_x2 <= e.frame.h, "border too thick for height")
 
         -- form the basic line strings and top/bottom blit strings
         local spaces = util.spaces(e.frame.w)
-        local blit_fg = util.strrep(e.fg_bg.blit_fgd, e.frame.w)
+        local blit_fg = string.rep(e.fg_bg.blit_fgd, e.frame.w)
         local blit_fg_sides = blit_fg
         local blit_bg_sides = ""
-        local blit_bg_top_bot = util.strrep(border_blit, e.frame.w)
+        local blit_bg_top_bot = string.rep(border_blit, e.frame.w)
 
         -- partial bars
         local p_a, p_b, p_s
         if args.thin == true then
             if args.even_inner == true then
-                p_a = "\x9c" .. util.strrep("\x8c", inner_width) .. "\x93"
-                p_b = "\x8d" .. util.strrep("\x8c", inner_width) .. "\x8e"
+                p_a = "\x9c" .. string.rep("\x8c", inner_width) .. "\x93"
+                p_b = "\x8d" .. string.rep("\x8c", inner_width) .. "\x8e"
             else
-                p_a = "\x97" .. util.strrep("\x83", inner_width) .. "\x94"
-                p_b = "\x8a" .. util.strrep("\x8f", inner_width) .. "\x85"
+                p_a = "\x97" .. string.rep("\x83", inner_width) .. "\x94"
+                p_b = "\x8a" .. string.rep("\x8f", inner_width) .. "\x85"
             end
 
             p_s = "\x95" .. util.spaces(inner_width) .. "\x95"
         else
             if args.even_inner == true then
-                p_a = util.strrep("\x83", inner_width + width_x2)
-                p_b = util.strrep("\x8f", inner_width + width_x2)
+                p_a = string.rep("\x83", inner_width + width_x2)
+                p_b = string.rep("\x8f", inner_width + width_x2)
             else
-                p_a = util.spaces(border_width) .. util.strrep("\x8f", inner_width) .. util.spaces(border_width)
-                p_b = util.spaces(border_width) .. util.strrep("\x83", inner_width) .. util.spaces(border_width)
+                p_a = util.spaces(border_width) .. string.rep("\x8f", inner_width) .. util.spaces(border_width)
+                p_b = util.spaces(border_width) .. string.rep("\x83", inner_width) .. util.spaces(border_width)
             end
 
             p_s = spaces
         end
 
-        local p_inv_fg = util.strrep(border_blit, border_width) .. util.strrep(e.fg_bg.blit_bkg, inner_width) ..
-                            util.strrep(border_blit, border_width)
-        local p_inv_bg = util.strrep(e.fg_bg.blit_bkg, border_width) .. util.strrep(border_blit, inner_width) ..
-                            util.strrep(e.fg_bg.blit_bkg, border_width)
+        local p_inv_fg = string.rep(border_blit, border_width) .. string.rep(e.fg_bg.blit_bkg, inner_width) ..
+                            string.rep(border_blit, border_width)
+        local p_inv_bg = string.rep(e.fg_bg.blit_bkg, border_width) .. string.rep(border_blit, inner_width) ..
+                            string.rep(e.fg_bg.blit_bkg, border_width)
 
         if args.thin == true then
-            p_inv_fg = e.fg_bg.blit_bkg .. util.strrep(e.fg_bg.blit_bkg, inner_width) .. util.strrep(border_blit, border_width)
-            p_inv_bg = border_blit .. util.strrep(border_blit, inner_width) .. util.strrep(e.fg_bg.blit_bkg, border_width)
+            p_inv_fg = e.fg_bg.blit_bkg .. string.rep(e.fg_bg.blit_bkg, inner_width) .. string.rep(border_blit, border_width)
+            p_inv_bg = border_blit .. string.rep(border_blit, inner_width) .. string.rep(e.fg_bg.blit_bkg, border_width)
 
-            blit_fg_sides = border_blit .. util.strrep(e.fg_bg.blit_bkg, inner_width) .. e.fg_bg.blit_bkg
+            blit_fg_sides = border_blit .. string.rep(e.fg_bg.blit_bkg, inner_width) .. e.fg_bg.blit_bkg
         end
 
         -- form the body blit strings (sides are border, inside is normal)
@@ -126,64 +126,69 @@ local function rectangle(args)
         end
 
         -- draw rectangle with borders
-        for y = 1, e.frame.h do
-            e.window.setCursorPos(1, y)
-            -- top border
-            if y <= border_height then
-                -- partial pixel fill
-                if args.border.even and y == border_height then
-                    if args.thin == true then
-                        e.window.blit(p_a, p_inv_bg, p_inv_fg)
-                    else
-                        local _fg = util.trinary(args.even_inner == true, util.strrep(e.fg_bg.blit_bkg, e.frame.w), p_inv_bg)
-                        local _bg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
+        function e.redraw()
+            for y = 1, e.frame.h do
+                e.w_set_cur(1, y)
+                -- top border
+                if y <= border_height then
+                    -- partial pixel fill
+                    if args.border.even and y == border_height then
+                        if args.thin == true then
+                            e.w_blit(p_a, p_inv_bg, p_inv_fg)
+                        else
+                            local _fg = util.trinary(args.even_inner == true, string.rep(e.fg_bg.blit_bkg, e.frame.w), p_inv_bg)
+                            local _bg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
 
-                        if width_x2 % 3 == 1 then
-                            e.window.blit(p_b, _fg, _bg)
-                        elseif width_x2 % 3 == 2 then
-                            e.window.blit(p_a, _fg, _bg)
-                        else
-                            -- skip line
-                            e.window.blit(spaces, blit_fg, blit_bg_sides)
-                        end
-                    end
-                else
-                    e.window.blit(spaces, blit_fg, blit_bg_top_bot)
-                end
-            -- bottom border
-            elseif y > (e.frame.h - border_width) then
-                -- partial pixel fill
-                if args.border.even and y == ((e.frame.h - border_width) + 1) then
-                    if args.thin == true then
-                        if args.even_inner == true then
-                            e.window.blit(p_b, blit_bg_top_bot, util.strrep(e.fg_bg.blit_bkg, e.frame.w))
-                        else
-                            e.window.blit(p_b, util.strrep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
+                            if width_x2 % 3 == 1 then
+                                e.w_blit(p_b, _fg, _bg)
+                            elseif width_x2 % 3 == 2 then
+                                e.w_blit(p_a, _fg, _bg)
+                            else
+                                -- skip line
+                                e.w_blit(spaces, blit_fg, blit_bg_sides)
+                            end
                         end
                     else
-                        local _fg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
-                        local _bg = util.trinary(args.even_inner == true, util.strrep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
-
-                        if width_x2 % 3 == 1 then
-                            e.window.blit(p_a, _fg, _bg)
-                        elseif width_x2 % 3 == 2 then
-                            e.window.blit(p_b, _fg, _bg)
+                        e.w_blit(spaces, blit_fg, blit_bg_top_bot)
+                    end
+                -- bottom border
+                elseif y > (e.frame.h - border_width) then
+                    -- partial pixel fill
+                    if args.border.even and y == ((e.frame.h - border_width) + 1) then
+                        if args.thin == true then
+                            if args.even_inner == true then
+                                e.w_blit(p_b, blit_bg_top_bot, string.rep(e.fg_bg.blit_bkg, e.frame.w))
+                            else
+                                e.w_blit(p_b, string.rep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
+                            end
                         else
-                            -- skip line
-                            e.window.blit(spaces, blit_fg, blit_bg_sides)
+                            local _fg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
+                            local _bg = util.trinary(args.even_inner == true, string.rep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
+
+                            if width_x2 % 3 == 1 then
+                                e.w_blit(p_a, _fg, _bg)
+                            elseif width_x2 % 3 == 2 then
+                                e.w_blit(p_b, _fg, _bg)
+                            else
+                                -- skip line
+                                e.w_blit(spaces, blit_fg, blit_bg_sides)
+                            end
                         end
+                    else
+                        e.w_blit(spaces, blit_fg, blit_bg_top_bot)
                     end
                 else
-                    e.window.blit(spaces, blit_fg, blit_bg_top_bot)
-                end
-            else
-                if args.thin == true then
-                    e.window.blit(p_s, blit_fg_sides, blit_bg_sides)
-                else
-                    e.window.blit(p_s, blit_fg, blit_bg_sides)
+                    if args.thin == true then
+                        e.w_blit(p_s, blit_fg_sides, blit_bg_sides)
+                    else
+                        e.w_blit(p_s, blit_fg, blit_bg_sides)
+                    end
                 end
             end
         end
+
+        -- initial draw of border
+        e.redraw()
     end
 
     return e.complete()

graphics/elements/textbox.lua

@@ -5,11 +5,11 @@ local util    = require("scada-common.util")
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 ---@class textbox_args
 ---@field text string text to show
----@field alignment? TEXT_ALIGN text alignment, left by default
+---@field alignment? ALIGN text alignment, left by default
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -24,19 +24,20 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 ---@param args textbox_args
 ---@return graphics_element element, element_id id
 local function textbox(args)
-    assert(type(args.text) == "string", "graphics.elements.textbox: text is a required field")
+    element.assert(type(args.text) == "string", "text is a required field")
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    local alignment = args.alignment or TEXT_ALIGN.LEFT
+    e.value = args.text
+
+    local alignment = args.alignment or ALIGN.LEFT
 
     -- draw textbox
+    function e.redraw()
+        e.window.clear()
 
-    local function display_text(text)
-        e.value = text
-
-        local lines = util.strwrap(text, e.frame.w)
+        local lines = util.strwrap(e.value, e.frame.w)
 
         for i = 1, #lines do
             if i > e.frame.h then break end
@@ -44,27 +45,28 @@ local function textbox(args)
             local len = string.len(lines[i])
 
             -- use cursor position to align this line
-            if alignment == TEXT_ALIGN.CENTER then
-                e.window.setCursorPos(math.floor((e.frame.w - len) / 2) + 1, i)
-            elseif alignment == TEXT_ALIGN.RIGHT then
-                e.window.setCursorPos((e.frame.w - len) + 1, i)
+            if alignment == ALIGN.CENTER then
+                e.w_set_cur(math.floor((e.frame.w - len) / 2) + 1, i)
+            elseif alignment == ALIGN.RIGHT then
+                e.w_set_cur((e.frame.w - len) + 1, i)
             else
-                e.window.setCursorPos(1, i)
+                e.w_set_cur(1, i)
             end
 
-            e.window.write(lines[i])
+            e.w_write(lines[i])
         end
     end
 
-    display_text(args.text)
-
     -- set the string value and re-draw the text
     ---@param val string value
     function e.set_value(val)
-        e.window.clear()
-        display_text(val)
+        e.value = val
+        e.redraw()
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/tiling.lua

@@ -22,13 +22,11 @@ local element = require("graphics.element")
 ---@param args tiling_args
 ---@return graphics_element element, element_id id
 local function tiling(args)
-    assert(type(args.fill_c) == "table", "graphics.elements.tiling: fill_c is a required field")
+    element.assert(type(args.fill_c) == "table", "fill_c is a required field")
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- draw tiling box
-
     local fill_a = args.fill_c.blit_a
     local fill_b = args.fill_c.blit_b
 
@@ -38,13 +36,9 @@ local function tiling(args)
     local start_y = 1
     local inner_width = math.floor(e.frame.w / util.trinary(even, 2, 1))
     local inner_height = e.frame.h
-    local alternator = true
 
     -- border
     if args.border_c ~= nil then
-        e.window.setBackgroundColor(args.border_c)
-        e.window.clear()
-
         start_x = 1 + util.trinary(even, 2, 1)
         start_y = 2
 
@@ -53,35 +47,48 @@ local function tiling(args)
     end
 
     -- check dimensions
-    assert(inner_width > 0, "graphics.elements.tiling: inner_width <= 0")
-    assert(inner_height > 0, "graphics.elements.tiling: inner_height <= 0")
-    assert(start_x <= inner_width, "graphics.elements.tiling: start_x > inner_width")
-    assert(start_y <= inner_height, "graphics.elements.tiling: start_y > inner_height")
+    element.assert(inner_width > 0, "inner_width <= 0")
+    element.assert(inner_height > 0, "inner_height <= 0")
+    element.assert(start_x <= inner_width, "start_x > inner_width")
+    element.assert(start_y <= inner_height, "start_y > inner_height")
 
-    -- create pattern
-    for y = start_y, inner_height + (start_y - 1) do
-        e.window.setCursorPos(start_x, y)
-        for _ = 1, inner_width do
-            if alternator then
-                if even then
-                    e.window.blit("  ", "00", fill_a .. fill_a)
-                else
-                    e.window.blit(" ", "0", fill_a)
-                end
-            else
-                if even then
-                    e.window.blit("  ", "00", fill_b .. fill_b)
-                else
-                    e.window.blit(" ", "0", fill_b)
-                end
-            end
+    -- draw tiling box
+    function e.redraw()
+        local alternator = true
 
-            alternator = not alternator
+        if args.border_c ~= nil then
+            e.w_set_bkg(args.border_c)
+            e.window.clear()
         end
 
-        if inner_width % 2 == 0 then alternator = not alternator end
+        -- draw pattern
+        for y = start_y, inner_height + (start_y - 1) do
+            e.w_set_cur(start_x, y)
+            for _ = 1, inner_width do
+                if alternator then
+                    if even then
+                        e.w_blit("  ", "00", fill_a .. fill_a)
+                    else
+                        e.w_blit(" ", "0", fill_a)
+                    end
+                else
+                    if even then
+                        e.w_blit("  ", "00", fill_b .. fill_b)
+                    else
+                        e.w_blit(" ", "0", fill_b)
+                    end
+                end
+
+                alternator = not alternator
+            end
+
+            if inner_width % 2 == 0 then alternator = not alternator end
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/events.lua

@@ -4,46 +4,77 @@
 
 local util = require("scada-common.util")
 
+local DOUBLE_CLICK_MS = 500
+
 local events = {}
 
 ---@enum CLICK_BUTTON
-events.CLICK_BUTTON = {
+local CLICK_BUTTON = {
     GENERIC = 0,
     LEFT_BUTTON = 1,
     RIGHT_BUTTON = 2,
     MID_BUTTON = 3
 }
 
----@enum CLICK_TYPE
-events.CLICK_TYPE = {
+events.CLICK_BUTTON = CLICK_BUTTON
+
+---@enum MOUSE_CLICK
+local MOUSE_CLICK = {
     TAP = 1,            -- screen tap (complete click)
     DOWN = 2,           -- button down
     UP = 3,             -- button up (completed a click)
     DRAG = 4,           -- mouse dragged
     SCROLL_DOWN = 5,    -- scroll down
-    SCROLL_UP = 6       -- scroll up
+    SCROLL_UP = 6,      -- scroll up
+    DOUBLE_CLICK = 7    -- double left click
 }
 
+events.MOUSE_CLICK = MOUSE_CLICK
+
+---@enum KEY_CLICK
+local KEY_CLICK = {
+    DOWN = 1,
+    HELD = 2,
+    UP = 3,
+    CHAR = 4
+}
+
+events.KEY_CLICK = KEY_CLICK
+
 -- create a new 2D coordinate
 ---@param x integer
 ---@param y integer
 ---@return coordinate_2d
 local function _coord2d(x, y) return { x = x, y = y } end
 
+events.new_coord_2d = _coord2d
+
 ---@class mouse_interaction
 ---@field monitor string
 ---@field button CLICK_BUTTON
----@field type CLICK_TYPE
+---@field type MOUSE_CLICK
 ---@field initial coordinate_2d
 ---@field current coordinate_2d
 
+---@class key_interaction
+---@field type KEY_CLICK
+---@field key number key code
+---@field name string key character name
+---@field shift boolean shift held
+---@field ctrl boolean ctrl held
+---@field alt boolean alt held
+
 local handler = {
     -- left, right, middle button down tracking
-    button_down = {
-        _coord2d(0, 0),
-        _coord2d(0, 0),
-        _coord2d(0, 0)
-    }
+    button_down = { _coord2d(0, 0), _coord2d(0, 0), _coord2d(0, 0) },
+    -- keyboard modifiers
+    shift = false,
+    alt = false,
+    ctrl = false,
+    -- double click tracking
+    dc_start = 0,
+    dc_step = 1,
+    dc_coord = _coord2d(0, 0)
 }
 
 -- create a new monitor touch mouse interaction event
@@ -55,8 +86,8 @@ local handler = {
 local function _monitor_touch(monitor, x, y)
     return {
         monitor = monitor,
-        button = events.CLICK_BUTTON.GENERIC,
-        type = events.CLICK_TYPE.TAP,
+        button = CLICK_BUTTON.GENERIC,
+        type = MOUSE_CLICK.TAP,
         initial = _coord2d(x, y),
         current = _coord2d(x, y)
     }
@@ -65,7 +96,7 @@ end
 -- create a new mouse button mouse interaction event
 ---@nodiscard
 ---@param button CLICK_BUTTON mouse button
----@param type CLICK_TYPE click type
+---@param type MOUSE_CLICK click type
 ---@param x1 integer initial x
 ---@param y1 integer initial y
 ---@param x2 integer current x
@@ -83,14 +114,14 @@ end
 
 -- create a new generic mouse interaction event
 ---@nodiscard
----@param type CLICK_TYPE
+---@param type MOUSE_CLICK
 ---@param x integer
 ---@param y integer
 ---@return mouse_interaction
 function events.mouse_generic(type, x, y)
     return {
         monitor = "",
-        button = events.CLICK_BUTTON.GENERIC,
+        button = CLICK_BUTTON.GENERIC,
         type = type,
         initial = _coord2d(x, y),
         current = _coord2d(x, y)
@@ -115,8 +146,8 @@ end
 
 -- check if an event qualifies as a click (tap or up)
 ---@nodiscard
----@param t CLICK_TYPE
-function events.was_clicked(t) return t == events.CLICK_TYPE.TAP or t == events.CLICK_TYPE.UP end
+---@param t MOUSE_CLICK
+function events.was_clicked(t) return t == MOUSE_CLICK.TAP or t == MOUSE_CLICK.UP end
 
 -- create a new mouse event to pass onto graphics renderer<br>
 -- supports: mouse_click, mouse_up, mouse_drag, mouse_scroll, and monitor_touch
@@ -126,35 +157,97 @@ function events.was_clicked(t) return t == events.CLICK_TYPE.TAP or t == events.
 ---@param y integer y coordinate
 ---@return mouse_interaction|nil
 function events.new_mouse_event(event_type, opt, x, y)
+    local h = handler
+
     if event_type == "mouse_click" then
         ---@cast opt 1|2|3
-        handler.button_down[opt] = _coord2d(x, y)
-        return _mouse_event(opt, events.CLICK_TYPE.DOWN, x, y, x, y)
+
+        local init = true
+
+        if opt == 1 and (h.dc_step % 2) == 1 then
+            if h.dc_step ~= 1 and h.dc_coord.x == x and h.dc_coord.y == y and (util.time_ms() - h.dc_start) < DOUBLE_CLICK_MS then
+                init = false
+                h.dc_step = h.dc_step + 1
+            end
+        end
+
+        if init then
+            h.dc_start = util.time_ms()
+            h.dc_coord = _coord2d(x, y)
+            h.dc_step = 2
+        end
+
+        h.button_down[opt] = _coord2d(x, y)
+        return _mouse_event(opt, MOUSE_CLICK.DOWN, x, y, x, y)
     elseif event_type == "mouse_up" then
         ---@cast opt 1|2|3
-        local initial = handler.button_down[opt]    ---@type coordinate_2d
-        return _mouse_event(opt, events.CLICK_TYPE.UP, initial.x, initial.y, x, y)
+
+        if opt == 1 and (h.dc_step % 2) == 0 and h.dc_coord.x == x and h.dc_coord.y == y and
+                (util.time_ms() - h.dc_start) < DOUBLE_CLICK_MS then
+            if h.dc_step == 4 then
+                util.push_event("double_click", 1, x, y)
+                h.dc_step = 1
+            else h.dc_step = h.dc_step + 1 end
+        else h.dc_step = 1 end
+
+        local initial = h.button_down[opt]    ---@type coordinate_2d
+        return _mouse_event(opt, MOUSE_CLICK.UP, initial.x, initial.y, x, y)
     elseif event_type == "monitor_touch" then
         ---@cast opt string
         return _monitor_touch(opt, x, y)
     elseif event_type == "mouse_drag" then
         ---@cast opt 1|2|3
-        local initial = handler.button_down[opt]    ---@type coordinate_2d
-        return _mouse_event(opt, events.CLICK_TYPE.DRAG, initial.x, initial.y, x, y)
+        local initial = h.button_down[opt]    ---@type coordinate_2d
+        return _mouse_event(opt, MOUSE_CLICK.DRAG, initial.x, initial.y, x, y)
     elseif event_type == "mouse_scroll" then
         ---@cast opt 1|-1
-        local scroll_direction = util.trinary(opt == 1, events.CLICK_TYPE.SCROLL_DOWN, events.CLICK_TYPE.SCROLL_UP)
-        return _mouse_event(events.CLICK_BUTTON.GENERIC, scroll_direction, x, y, x, y)
+        local scroll_direction = util.trinary(opt == 1, MOUSE_CLICK.SCROLL_DOWN, MOUSE_CLICK.SCROLL_UP)
+        return _mouse_event(CLICK_BUTTON.GENERIC, scroll_direction, x, y, x, y)
+    elseif event_type == "double_click" then
+        return _mouse_event(CLICK_BUTTON.LEFT_BUTTON, MOUSE_CLICK.DOUBLE_CLICK, x, y, x, y)
     end
 end
 
--- create a new key event to pass onto graphics renderer<br>
+-- create a new keyboard interaction event
+---@nodiscard
+---@param click_type KEY_CLICK key click type
+---@param key integer|string keyboard key code or character for 'char' event
+---@return key_interaction
+local function _key_event(click_type, key)
+    local name = key
+    if type(key) == "number" then name = keys.getName(key) end
+    return { type = click_type, key = key, name = name, shift = handler.shift, ctrl = handler.ctrl, alt = handler.alt }
+end
+
+-- create a new keyboard event to pass onto graphics renderer<br>
 -- supports: char, key, and key_up
----@param event_type os_event
-function events.new_key_event(event_type)
+---@param event_type os_event OS event to handle
+---@param key integer keyboard key code
+---@param held boolean? if the key is being held (for 'key' event)
+---@return key_interaction|nil
+function events.new_key_event(event_type, key, held)
     if event_type == "char" then
+        return _key_event(KEY_CLICK.CHAR, key)
     elseif event_type == "key" then
+        if key == keys.leftShift or key == keys.rightShift then
+            handler.shift = true
+        elseif key == keys.leftCtrl or key == keys.rightCtrl then
+            handler.ctrl = true
+        elseif key == keys.leftAlt or key == keys.rightAlt then
+            handler.alt = true
+        else
+            return _key_event(util.trinary(held, KEY_CLICK.HELD, KEY_CLICK.DOWN), key)
+        end
     elseif event_type == "key_up" then
+        if key == keys.leftShift or key == keys.rightShift then
+            handler.shift = false
+        elseif key == keys.leftCtrl or key == keys.rightCtrl then
+            handler.ctrl = false
+        elseif key == keys.leftAlt or key == keys.rightAlt then
+            handler.alt = false
+        else
+            return _key_event(KEY_CLICK.UP, key)
+        end
     end
 end
 

graphics/themes.lua

@@ -0,0 +1,418 @@
+--
+-- Graphics Themes
+--
+
+local core = require("graphics.core")
+
+local cpair = core.cpair
+
+---@class graphics_themes
+local themes = {}
+
+-- add color mappings for front panels
+colors.ivory      = colors.pink
+colors.green_hc   = colors.cyan
+colors.yellow_hc  = colors.purple
+colors.red_off    = colors.brown
+colors.yellow_off = colors.magenta
+colors.green_off  = colors.lime
+
+--#region Types
+
+---@enum UI_THEME
+themes.UI_THEME = { SMOOTH_STONE = 1, DEEPSLATE = 2 }
+themes.UI_THEME_NAMES = { "Smooth Stone", "Deepslate" }
+
+-- attempts to get the string name of a main ui theme
+---@nodiscard
+---@param id any
+---@return string|nil
+function themes.ui_theme_name(id)
+    if id == themes.UI_THEME.SMOOTH_STONE or
+       id == themes.UI_THEME.DEEPSLATE then
+        return themes.UI_THEME_NAMES[id]
+    else return nil end
+end
+
+---@enum FP_THEME
+themes.FP_THEME = { SANDSTONE = 1, BASALT = 2 }
+themes.FP_THEME_NAMES = { "Sandstone", "Basalt" }
+
+-- attempts to get the string name of a front panel theme
+---@nodiscard
+---@param id any
+---@return string|nil
+function themes.fp_theme_name(id)
+    if id == themes.FP_THEME.SANDSTONE or
+       id == themes.FP_THEME.BASALT then
+        return themes.FP_THEME_NAMES[id]
+    else return nil end
+end
+
+---@enum COLOR_MODE
+themes.COLOR_MODE = {
+    STANDARD = 1,
+    DEUTERANOPIA = 2,
+    PROTANOPIA = 3,
+    TRITANOPIA = 4,
+    BLUE_IND = 5,
+    STD_ON_BLACK = 6,
+    BLUE_ON_BLACK = 7,
+    NUM_MODES = 8
+}
+
+themes.COLOR_MODE_NAMES = {
+    "Standard",
+    "Deuteranopia",
+    "Protanopia",
+    "Tritanopia",
+    "Blue for 'Good'",
+    "Standard + Black",
+    "Blue + Black"
+}
+
+-- attempts to get the string name of a color mode
+---@nodiscard
+---@param id any
+---@return string|nil
+function themes.color_mode_name(id)
+    if id == themes.COLOR_MODE.STANDARD or
+       id == themes.COLOR_MODE.DEUTERANOPIA or
+       id == themes.COLOR_MODE.PROTANOPIA or
+       id == themes.COLOR_MODE.TRITANOPIA or
+       id == themes.COLOR_MODE.BLUE_IND or
+       id == themes.COLOR_MODE.STD_ON_BLACK or
+       id == themes.COLOR_MODE.BLUE_ON_BLACK then
+        return themes.COLOR_MODE_NAMES[id]
+    else return nil end
+end
+
+--#endregion
+
+--#region Front Panel Themes
+
+---@class fp_theme
+themes.sandstone = {
+    text = colors.black,
+    label = colors.lightGray,
+    label_dark = colors.gray,
+    disabled = colors.lightGray,
+    bg = colors.ivory,
+
+    header = cpair(colors.black, colors.lightGray),
+
+    highlight_box = cpair(colors.black, colors.lightGray),
+    highlight_box_bright = cpair(colors.black, colors.white),
+    field_box = cpair(colors.gray, colors.white),
+
+    colors = {
+        { c = colors.red,        hex = 0xdf4949 },
+        { c = colors.orange,     hex = 0xffb659 },
+        { c = colors.yellow,     hex = 0xf9fb53 },
+        { c = colors.green_off,  hex = 0x16665a },
+        { c = colors.green,      hex = 0x6be551 },
+        { c = colors.green_hc,   hex = 0x6be551 },
+        { c = colors.lightBlue,  hex = 0x6cc0f2 },
+        { c = colors.blue,       hex = 0x0096ff },
+        { c = colors.yellow_hc,  hex = 0xe3bc2a },
+        { c = colors.ivory,      hex = 0xdcd9ca },
+        { c = colors.yellow_off, hex = 0x85862c },
+        { c = colors.white,      hex = 0xf0f0f0 },
+        { c = colors.lightGray,  hex = 0xb1b8b3 },
+        { c = colors.gray,       hex = 0x575757 },
+        { c = colors.black,      hex = 0x191919 },
+        { c = colors.red_off,    hex = 0x672223 }
+    },
+
+    -- color re-mappings for assistive modes
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow,     hex = 0xf7c311 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red,        hex = 0xfb5615 },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- protanopia
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow,     hex = 0xf5e633 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red,        hex = 0xff521a },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- tritanopia
+        {
+            { c = colors.green,      hex = 0x40cbd7 },
+            { c = colors.green_hc,   hex = 0x40cbd7 },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow,     hex = 0xffbc00 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red,        hex = 0xff0000 },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- blue indicators
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x053466 },
+        },
+        -- standard, black backgrounds
+        {
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red_off,    hex = 0x141414 }
+        }
+    }
+}
+
+---@type fp_theme
+themes.basalt = {
+    text = colors.white,
+    label = colors.gray,
+    label_dark = colors.ivory,
+    disabled = colors.lightGray,
+    bg = colors.ivory,
+
+    header = cpair(colors.white, colors.gray),
+
+    highlight_box = cpair(colors.white, colors.gray),
+    highlight_box_bright = cpair(colors.black, colors.lightGray),
+    field_box = cpair(colors.white, colors.gray),
+
+    colors = {
+        { c = colors.red,        hex = 0xf18486 },
+        { c = colors.orange,     hex = 0xffb659 },
+        { c = colors.yellow,     hex = 0xefe37c },
+        { c = colors.green_off,  hex = 0x436b41 },
+        { c = colors.green,      hex = 0x7ae175 },
+        { c = colors.green_hc,   hex = 0x7ae175 },
+        { c = colors.lightBlue,  hex = 0x7dc6f2 },
+        { c = colors.blue,       hex = 0x56aae6 },
+        { c = colors.yellow_hc,  hex = 0xe9cd68 },
+        { c = colors.ivory,      hex = 0x4d4e52 },
+        { c = colors.yellow_off, hex = 0x757040 },
+        { c = colors.white,      hex = 0xbfbfbf },
+        { c = colors.lightGray,  hex = 0x848794 },
+        { c = colors.gray,       hex = 0x5c5f68 },
+        { c = colors.black,      hex = 0x333333 },
+        { c = colors.red_off,    hex = 0x512d2d }
+    },
+
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow,     hex = 0xf7c311 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red,        hex = 0xf18486 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- protanopia
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow,     hex = 0xf5e633 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red,        hex = 0xff8058 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- tritanopia
+        {
+            { c = colors.green,      hex = 0x00ecff },
+            { c = colors.green_hc,   hex = 0x00ecff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow,     hex = 0xffbc00 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red,        hex = 0xdf4949 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- blue indicators
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x365e8a },
+        },
+        -- standard, black backgrounds
+        {
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red_off,    hex = 0x333333 }
+        }
+    }
+}
+
+-- get style fields for a front panel based on the provided theme
+---@param theme fp_theme
+function themes.get_fp_style(theme)
+    ---@class fp_style
+    local style =  {
+        root = cpair(theme.text, theme.bg),
+
+        text = cpair(theme.text, theme.bg),
+        text_fg = cpair(theme.text, colors._INHERIT),
+
+        label_fg = cpair(theme.label, colors._INHERIT),
+        label_d_fg = cpair(theme.label_dark, colors._INHERIT),
+
+        disabled_fg = cpair(theme.disabled, colors._INHERIT)
+    }
+
+    return style
+end
+
+--#endregion
+
+--#region Main UI Color Palettes
+
+---@class ui_palette
+themes.smooth_stone = {
+    colors = {
+        { c = colors.red,       hex = 0xdf4949 },
+        { c = colors.orange,    hex = 0xffb659 },
+        { c = colors.yellow,    hex = 0xfffc79 },
+        { c = colors.lime,      hex = 0x80ff80 },
+        { c = colors.green,     hex = 0x4aee8a },
+        { c = colors.cyan,      hex = 0x34bac8 },
+        { c = colors.lightBlue, hex = 0x6cc0f2 },
+        { c = colors.blue,      hex = 0x0096ff },
+        { c = colors.purple,    hex = 0xb156ee },
+        { c = colors.pink,      hex = 0xf26ba2 },
+        { c = colors.magenta,   hex = 0xf9488a },
+        { c = colors.white,     hex = 0xf0f0f0 },
+        { c = colors.lightGray, hex = 0xcacaca },
+        { c = colors.gray,      hex = 0x575757 },
+        { c = colors.black,     hex = 0x191919 },
+        { c = colors.brown,     hex = 0x7f664c }
+    },
+
+    -- color re-mappings for assistive modes
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xf7c311 },
+            { c = colors.red,    hex = 0xfb5615 }
+        },
+        -- protanopia
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xf5e633 },
+            { c = colors.red,    hex = 0xff521a }
+        },
+        -- tritanopia
+        {
+            { c = colors.blue,   hex = 0x40cbd7 },
+            { c = colors.yellow, hex = 0xffbc00 },
+            { c = colors.red,    hex = 0xff0000 }
+        },
+        -- blue indicators
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xfffc79 },
+            { c = colors.red,    hex = 0xdf4949 }
+        },
+        -- standard, black backgrounds
+        {},
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xfffc79 },
+            { c = colors.red,    hex = 0xdf4949 }
+        }
+    }
+}
+
+---@type ui_palette
+themes.deepslate = {
+    colors = {
+        { c = colors.red,       hex = 0xeb6a6c },
+        { c = colors.orange,    hex = 0xf2b86c },
+        { c = colors.yellow,    hex = 0xd9cf81 },
+        { c = colors.lime,      hex = 0x80ff80 },
+        { c = colors.green,     hex = 0x70e19b },
+        { c = colors.cyan,      hex = 0x7ccdd0 },
+        { c = colors.lightBlue, hex = 0x99ceef },
+        { c = colors.blue,      hex = 0x60bcff },
+        { c = colors.purple,    hex = 0xc38aea },
+        { c = colors.pink,      hex = 0xff7fb8 },
+        { c = colors.magenta,   hex = 0xf980dd },
+        { c = colors.white,     hex = 0xd9d9d9 },
+        { c = colors.lightGray, hex = 0x949494 },
+        { c = colors.gray,      hex = 0x575757 },
+        { c = colors.black,     hex = 0x262626 },
+        { c = colors.brown,     hex = 0xb18f6a }
+    },
+
+    -- color re-mappings for assistive modes
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xf7c311 },
+            { c = colors.red,    hex = 0xfb5615 }
+        },
+        -- protanopia
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xf5e633 },
+            { c = colors.red,    hex = 0xff8058 }
+        },
+        -- tritanopia
+        {
+            { c = colors.blue,   hex = 0x00ecff },
+            { c = colors.yellow, hex = 0xffbc00 },
+            { c = colors.red,    hex = 0xdf4949 }
+        },
+        -- blue indicators
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xd9cf81 },
+            { c = colors.red,    hex = 0xeb6a6c }
+        },
+        -- standard, black backgrounds
+        {},
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xd9cf81 },
+            { c = colors.red,    hex = 0xeb6a6c }
+        }
+    }
+}
+
+--#endregion
+
+return themes

imgen.py

@@ -48,6 +48,7 @@ def make_manifest(size):
         "versions" : {
             "installer" : get_version("./ccmsi.lua"),
             "bootloader" : get_version("./startup.lua"),
+            "common" : get_version("./scada-common/util.lua", True),
             "comms" : get_version("./scada-common/comms.lua", True),
             "graphics" : get_version("./graphics/core.lua", True),
             "lockbox" : get_version("./lockbox/init.lua", True),
@@ -59,7 +60,7 @@ def make_manifest(size):
         },
         "files" : {
             # common files
-            "system" : [ "initenv.lua", "startup.lua" ],
+            "system" : [ "initenv.lua", "startup.lua", "configure.lua", "LICENSE" ],
             "common" : list_files("./scada-common"),
             "graphics" : list_files("./graphics"),
             "lockbox" : list_files("./lockbox"),
@@ -81,7 +82,7 @@ def make_manifest(size):
             # manifest file estimate
             "manifest" : size,
             # common files
-            "system" : os.path.getsize("initenv.lua") + os.path.getsize("startup.lua"),
+            "system" : os.path.getsize("initenv.lua") + os.path.getsize("startup.lua") + os.path.getsize("configure.lua"),
             "common" : dir_size("./scada-common"),
             "graphics" : dir_size("./graphics"),
             "lockbox" : dir_size("./lockbox"),

initenv.lua

@@ -1,18 +1,8 @@
---
--- Initialize the Post-Boot Module Environment
---
-
 return {
-    -- initialize booted environment
-    init_env = function ()
-        local _require = require("cc.require")
-        local _env = setmetatable({}, { __index = _ENV })
-
-        -- overwrite require/package globals
-        require, package = _require.make(_env, "/")
-
-        -- reset terminal
-        term.clear()
-        term.setCursorPos(1, 1)
-    end
+-- initialize booted environment
+init_env = function ()
+    local _require, _env = require("cc.require"), setmetatable({}, { __index = _ENV })
+    require, package = _require.make(_env, "/")
+    term.clear(); term.setCursorPos(1, 1)
+end
 }

lockbox/digest/md5.lua

@@ -1,5 +1,3 @@
-require("lockbox").insecure();
-
 local Bit = require("lockbox.util.bit");
 local String = require("string");
 local Math = require("math");

lockbox/digest/sha1.lua

@@ -1,5 +1,3 @@
-require("lockbox").insecure();
-
 local Bit = require("lockbox.util.bit");
 local String = require("string");
 local Math = require("math");

lockbox/init.lua

@@ -1,25 +1,6 @@
-local Lockbox = {};
+local Lockbox = {}
 
 -- cc-mek-scada lockbox version
-Lockbox.version = "1.0"
+Lockbox.version = "1.1"
 
---[[
-package.path =  "./?.lua;"
-                .. "./cipher/?.lua;"
-                .. "./digest/?.lua;"
-                .. "./kdf/?.lua;"
-                .. "./mac/?.lua;"
-                .. "./padding/?.lua;"
-                .. "./test/?.lua;"
-                .. "./util/?.lua;"
-                .. package.path;
---]]
-Lockbox.ALLOW_INSECURE = true;
-
-Lockbox.insecure = function()
-    assert(Lockbox.ALLOW_INSECURE,
-            "This module is insecure!  It should not be used in production." ..
-            "If you really want to use it, set Lockbox.ALLOW_INSECURE to true before importing it");
-end
-
-return Lockbox;
+return Lockbox

lockbox/mac/hmac.lua

@@ -8,7 +8,7 @@ local HMAC = function()
 
     local public = {};
     local blockSize = 64;
-    local Digest = nil;
+    local Digest;
     local outerPadding = {};
     local innerPadding = {}
     local digest;

lockbox/util/array.lua

@@ -1,4 +1,3 @@
-
 local String = require("string");
 local Bit = require("lockbox.util.bit");
 local Queue = require("lockbox.util.queue");

pocket/config.lua

@@ -1,27 +0,0 @@
-local config = {}
-
--- supervisor comms channel
-config.SVR_CHANNEL = 16240
--- coordinator comms channel
-config.CRD_CHANNEL = 16243
--- pocket comms channel
-config.PKT_CHANNEL = 16244
--- max trusted modem message distance (0 to disable check)
-config.TRUSTED_RANGE = 0
--- time in seconds (>= 2) before assuming a remote device is no longer active
-config.COMMS_TIMEOUT = 5
--- facility authentication key (do NOT use one of your passwords)
--- this enables verifying that messages are authentic
--- all devices on the same network must use the same key
--- config.AUTH_KEY = "SCADAfacility123"
-
--- log path
-config.LOG_PATH = "/log.txt"
--- log mode
---  0 = APPEND (adds to existing file on start)
---  1 = NEW (replaces existing file on start)
-config.LOG_MODE = 0
--- true to log verbose debug messages
-config.LOG_DEBUG = false
-
-return config

pocket/configure.lua

@@ -0,0 +1,565 @@
+--
+-- Configuration GUI
+--
+
+local log         = require("scada-common.log")
+local tcd         = require("scada-common.tcd")
+local util        = require("scada-common.util")
+
+local core        = require("graphics.core")
+local themes      = require("graphics.themes")
+
+local DisplayBox  = require("graphics.elements.displaybox")
+local Div         = require("graphics.elements.div")
+local ListBox     = require("graphics.elements.listbox")
+local MultiPane   = require("graphics.elements.multipane")
+local TextBox     = require("graphics.elements.textbox")
+
+local CheckBox    = require("graphics.elements.controls.checkbox")
+local PushButton  = require("graphics.elements.controls.push_button")
+local RadioButton = require("graphics.elements.controls.radio_button")
+
+local NumberField = require("graphics.elements.form.number_field")
+local TextField   = require("graphics.elements.form.text_field")
+
+local println = util.println
+local tri = util.trinary
+
+local cpair = core.cpair
+
+local LEFT = core.ALIGN.LEFT
+local CENTER = core.ALIGN.CENTER
+local RIGHT = core.ALIGN.RIGHT
+
+-- changes to the config data/format to let the user know
+local changes = {}
+
+---@class pkt_configurator
+local configurator = {}
+
+local style = {}
+
+style.root = cpair(colors.black, colors.lightGray)
+style.header = cpair(colors.white, colors.gray)
+
+style.colors = themes.smooth_stone.colors
+
+local bw_fg_bg = cpair(colors.black, colors.white)
+local g_lg_fg_bg = cpair(colors.gray, colors.lightGray)
+local nav_fg_bg = bw_fg_bg
+local btn_act_fg_bg = cpair(colors.white, colors.gray)
+local dis_fg_bg = cpair(colors.lightGray,colors.white)
+
+local tool_ctl = {
+    ask_config = false,
+    has_config = false,
+    viewing_config = false,
+    importing_legacy = false,
+
+    view_cfg = nil,         ---@type graphics_element
+    settings_apply = nil,   ---@type graphics_element
+
+    set_networked = nil,    ---@type function
+    bundled_emcool = nil,   ---@type function
+    gen_summary = nil,      ---@type function
+    show_current_cfg = nil, ---@type function
+    load_legacy = nil,      ---@type function
+
+    show_auth_key = nil,    ---@type function
+    show_key_btn = nil,     ---@type graphics_element
+    auth_key_textbox = nil, ---@type graphics_element
+    auth_key_value = ""
+}
+
+---@class pkt_config
+local tmp_cfg = {
+    SVR_Channel = nil,  ---@type integer
+    CRD_Channel = nil,  ---@type integer
+    PKT_Channel = nil,  ---@type integer
+    ConnTimeout = nil,  ---@type number
+    TrustedRange = nil, ---@type number
+    AuthKey = nil,      ---@type string|nil
+    LogMode = 0,
+    LogPath = "",
+    LogDebug = false,
+}
+
+---@class pkt_config
+local ini_cfg = {}
+---@class pkt_config
+local settings_cfg = {}
+
+-- all settings fields, their nice names, and their default values
+local fields = {
+    { "SVR_Channel", "SVR Channel", 16240 },
+    { "CRD_Channel", "CRD Channel", 16243 },
+    { "PKT_Channel", "PKT Channel", 16244 },
+    { "ConnTimeout", "Connection Timeout", 5 },
+    { "TrustedRange", "Trusted Range", 0 },
+    { "AuthKey", "Facility Auth Key" , ""},
+    { "LogMode", "Log Mode", log.MODE.APPEND },
+    { "LogPath", "Log Path", "/log.txt" },
+    { "LogDebug", "Log Debug Messages", false }
+}
+
+-- load data from the settings file
+---@param target pkt_config
+---@param raw boolean? true to not use default values
+local function load_settings(target, raw)
+    for _, v in pairs(fields) do settings.unset(v[1]) end
+
+    local loaded = settings.load("/pocket.settings")
+
+    for _, v in pairs(fields) do target[v[1]] = settings.get(v[1], tri(raw, nil, v[3])) end
+
+    return loaded
+end
+
+-- create the config view
+---@param display graphics_element
+local function config_view(display)
+---@diagnostic disable-next-line: undefined-field
+    local function exit() os.queueEvent("terminate") end
+
+    TextBox{parent=display,y=1,text="Pocket Configurator",alignment=CENTER,height=1,fg_bg=style.header}
+
+    local root_pane_div = Div{parent=display,x=1,y=2}
+
+    local main_page = Div{parent=root_pane_div,x=1,y=1}
+    local net_cfg = Div{parent=root_pane_div,x=1,y=1}
+    local log_cfg = Div{parent=root_pane_div,x=1,y=1}
+    local summary = Div{parent=root_pane_div,x=1,y=1}
+    local changelog = Div{parent=root_pane_div,x=1,y=1}
+
+    local main_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes={main_page,net_cfg,log_cfg,summary,changelog}}
+
+    -- Main Page
+
+    local y_start = 7
+
+    TextBox{parent=main_page,x=2,y=2,height=4,text="Welcome to the Pocket configurator! Please select one of the following options."}
+
+    if tool_ctl.ask_config then
+        TextBox{parent=main_page,x=2,y=y_start,height=4,width=49,text="Please configure before starting up.",fg_bg=cpair(colors.red,colors.lightGray)}
+        y_start = y_start + 3
+    end
+
+    local function view_config()
+        tool_ctl.viewing_config = true
+        tool_ctl.gen_summary(settings_cfg)
+        tool_ctl.settings_apply.hide(true)
+        main_pane.set_value(4)
+    end
+
+    if fs.exists("/pocket/config.lua") then
+        PushButton{parent=main_page,x=2,y=y_start,min_width=22,text="Import Legacy Config",callback=function()tool_ctl.load_legacy()end,fg_bg=cpair(colors.black,colors.cyan),active_fg_bg=btn_act_fg_bg}
+        y_start = y_start + 2
+    end
+
+    PushButton{parent=main_page,x=2,y=y_start,min_width=18,text="Configure Device",callback=function()main_pane.set_value(2)end,fg_bg=cpair(colors.black,colors.blue),active_fg_bg=btn_act_fg_bg}
+    tool_ctl.view_cfg = PushButton{parent=main_page,x=2,y=y_start+2,min_width=20,text="View Configuration",callback=view_config,fg_bg=cpair(colors.black,colors.blue),active_fg_bg=btn_act_fg_bg,dis_fg_bg=dis_fg_bg}
+
+    if not tool_ctl.has_config then tool_ctl.view_cfg.disable() end
+
+    PushButton{parent=main_page,x=2,y=18,min_width=6,text="Exit",callback=exit,fg_bg=cpair(colors.black,colors.red),active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=main_page,x=14,y=18,min_width=12,text="Change Log",callback=function()main_pane.set_value(5)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    --#region Network
+
+    local net_c_1 = Div{parent=net_cfg,x=2,y=4,width=24}
+    local net_c_2 = Div{parent=net_cfg,x=2,y=4,width=24}
+    local net_c_3 = Div{parent=net_cfg,x=2,y=4,width=24}
+    local net_c_4 = Div{parent=net_cfg,x=2,y=4,width=24}
+
+    local net_pane = MultiPane{parent=net_cfg,x=1,y=4,panes={net_c_1,net_c_2,net_c_3,net_c_4}}
+
+    TextBox{parent=net_cfg,x=1,y=2,height=1,text=" Network Configuration",fg_bg=cpair(colors.black,colors.lightBlue)}
+
+    TextBox{parent=net_c_1,x=1,y=1,height=1,text="Set network channels."}
+    TextBox{parent=net_c_1,x=1,y=3,height=4,text="Each of the named channels must be the same within a particular SCADA network.",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_1,x=1,y=8,height=1,width=18,text="Supervisor Channel"}
+    local svr_chan = NumberField{parent=net_c_1,x=1,y=9,width=7,default=ini_cfg.SVR_Channel,min=1,max=65535,fg_bg=bw_fg_bg}
+    TextBox{parent=net_c_1,x=9,y=9,height=4,text="[SVR_CHANNEL]",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_1,x=1,y=10,height=1,width=19,text="Coordinator Channel"}
+    local crd_chan = NumberField{parent=net_c_1,x=1,y=11,width=7,default=ini_cfg.CRD_Channel,min=1,max=65535,fg_bg=bw_fg_bg}
+    TextBox{parent=net_c_1,x=9,y=11,height=4,text="[CRD_CHANNEL]",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_1,x=1,y=12,height=1,width=14,text="Pocket Channel"}
+    local pkt_chan = NumberField{parent=net_c_1,x=1,y=13,width=7,default=ini_cfg.PKT_Channel,min=1,max=65535,fg_bg=bw_fg_bg}
+    TextBox{parent=net_c_1,x=9,y=13,height=4,text="[PKT_CHANNEL]",fg_bg=g_lg_fg_bg}
+
+    local chan_err = TextBox{parent=net_c_1,x=1,y=14,height=1,width=24,text="Please set all channels.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_channels()
+        local svr_c, crd_c, pkt_c = tonumber(svr_chan.get_value()), tonumber(crd_chan.get_value()), tonumber(pkt_chan.get_value())
+        if svr_c ~= nil and crd_c ~= nil and pkt_c ~= nil then
+            tmp_cfg.SVR_Channel, tmp_cfg.CRD_Channel, tmp_cfg.PKT_Channel = svr_c, crd_c, pkt_c
+            net_pane.set_value(2)
+            chan_err.hide(true)
+        else chan_err.show() end
+    end
+
+    PushButton{parent=net_c_1,x=1,y=15,text="\x1b Back",callback=function()main_pane.set_value(1)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=net_c_1,x=19,y=15,text="Next \x1a",callback=submit_channels,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=net_c_2,x=1,y=1,height=1,text="Set connection timeout."}
+    TextBox{parent=net_c_2,x=1,y=3,height=7,text="You generally should not need to modify this. On slow servers, you can try to increase this to make the system wait longer before assuming a disconnection.",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_2,x=1,y=11,height=1,width=19,text="Connection Timeout"}
+    local timeout = NumberField{parent=net_c_2,x=1,y=12,width=7,default=ini_cfg.ConnTimeout,min=2,max=25,max_chars=6,max_frac_digits=2,allow_decimal=true,fg_bg=bw_fg_bg}
+
+    TextBox{parent=net_c_2,x=9,y=12,height=2,text="seconds\n(default 5)",fg_bg=g_lg_fg_bg}
+
+    local ct_err = TextBox{parent=net_c_2,x=1,y=14,height=1,width=24,text="Please set timeout.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_timeouts()
+        local timeout_val = tonumber(timeout.get_value())
+        if timeout_val ~= nil then
+            tmp_cfg.ConnTimeout = timeout_val
+            net_pane.set_value(3)
+            ct_err.hide(true)
+        else ct_err.show() end
+    end
+
+    PushButton{parent=net_c_2,x=1,y=15,text="\x1b Back",callback=function()net_pane.set_value(1)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=net_c_2,x=19,y=15,text="Next \x1a",callback=submit_timeouts,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=net_c_3,x=1,y=1,height=1,text="Set the trusted range."}
+    TextBox{parent=net_c_3,x=1,y=3,height=4,text="Setting this to a value larger than 0 prevents connections with devices that many blocks away.",fg_bg=g_lg_fg_bg}
+    TextBox{parent=net_c_3,x=1,y=8,height=4,text="This is optional. You can disable this functionality by setting the value to 0.",fg_bg=g_lg_fg_bg}
+
+    local range = NumberField{parent=net_c_3,x=1,y=13,width=10,default=ini_cfg.TrustedRange,min=0,max_chars=20,allow_decimal=true,fg_bg=bw_fg_bg}
+
+    local tr_err = TextBox{parent=net_c_3,x=1,y=14,height=1,width=24,text="Set the trusted range.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_tr()
+        local range_val = tonumber(range.get_value())
+        if range_val ~= nil then
+            tmp_cfg.TrustedRange = range_val
+            net_pane.set_value(4)
+            tr_err.hide(true)
+        else tr_err.show() end
+    end
+
+    PushButton{parent=net_c_3,x=1,y=15,text="\x1b Back",callback=function()net_pane.set_value(2)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=net_c_3,x=19,y=15,text="Next \x1a",callback=submit_tr,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=net_c_4,x=1,y=1,height=4,text="Optionally, set the facility authentication key. Do NOT use one of your passwords."}
+    TextBox{parent=net_c_4,x=1,y=6,height=6,text="This enables verifying that messages are authentic, so it is intended for security on multiplayer servers.",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_4,x=1,y=12,height=1,text="Facility Auth Key"}
+    local key, _, censor = TextField{parent=net_c_4,x=1,y=13,max_len=64,value=ini_cfg.AuthKey,width=24,height=1,fg_bg=bw_fg_bg}
+
+    local function censor_key(enable) censor(util.trinary(enable, "*", nil)) end
+
+    -- declare back first so tabbing makes sense visually
+    PushButton{parent=net_c_4,x=1,y=15,text="\x1b Back",callback=function()net_pane.set_value(3)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    local hide_key = CheckBox{parent=net_c_4,x=8,y=15,label="Hide Key",box_fg_bg=cpair(colors.lightBlue,colors.black),callback=censor_key}
+
+    hide_key.set_value(true)
+    censor_key(true)
+
+    local key_err = TextBox{parent=net_c_4,x=1,y=14,height=1,width=24,text="Length must be > 7.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_auth()
+        local v = key.get_value()
+        if string.len(v) == 0 or string.len(v) >= 8 then
+            tmp_cfg.AuthKey = key.get_value()
+            main_pane.set_value(3)
+            key_err.hide(true)
+        else key_err.show() end
+    end
+
+    PushButton{parent=net_c_4,x=19,y=15,text="Next \x1a",callback=submit_auth,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    --#endregion
+
+    --#region Logging
+
+    local log_c_1 = Div{parent=log_cfg,x=2,y=4,width=24}
+
+    TextBox{parent=log_cfg,x=1,y=2,height=1,text=" Logging Configuration",fg_bg=cpair(colors.black,colors.pink)}
+
+    TextBox{parent=log_c_1,x=1,y=1,height=1,text="Configure logging below."}
+
+    TextBox{parent=log_c_1,x=1,y=3,height=1,text="Log File Mode"}
+    local mode = RadioButton{parent=log_c_1,x=1,y=4,default=ini_cfg.LogMode+1,options={"Append on Startup","Replace on Startup"},callback=function()end,radio_colors=cpair(colors.lightGray,colors.black),select_color=colors.pink}
+
+    TextBox{parent=log_c_1,x=1,y=7,height=1,text="Log File Path"}
+    local path = TextField{parent=log_c_1,x=1,y=8,width=24,height=1,value=ini_cfg.LogPath,max_len=128,fg_bg=bw_fg_bg}
+
+    local en_dbg = CheckBox{parent=log_c_1,x=1,y=10,default=ini_cfg.LogDebug,label="Enable Debug Messages",box_fg_bg=cpair(colors.pink,colors.black)}
+    TextBox{parent=log_c_1,x=3,y=11,height=4,text="This results in much larger log files. Use only as needed.",fg_bg=g_lg_fg_bg}
+
+    local path_err = TextBox{parent=log_c_1,x=1,y=14,height=1,width=24,text="Provide a log file path.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_log()
+        if path.get_value() ~= "" then
+            path_err.hide(true)
+            tmp_cfg.LogMode = mode.get_value() - 1
+            tmp_cfg.LogPath = path.get_value()
+            tmp_cfg.LogDebug = en_dbg.get_value()
+            tool_ctl.gen_summary(tmp_cfg)
+            tool_ctl.viewing_config = false
+            tool_ctl.importing_legacy = false
+            tool_ctl.settings_apply.show()
+            main_pane.set_value(4)
+        else path_err.show() end
+    end
+
+    PushButton{parent=log_c_1,x=1,y=15,text="\x1b Back",callback=function()main_pane.set_value(2)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=log_c_1,x=19,y=15,text="Next \x1a",callback=submit_log,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    --#endregion
+
+    --#region Summary and Saving
+
+    local sum_c_1 = Div{parent=summary,x=2,y=4,width=24}
+    local sum_c_2 = Div{parent=summary,x=2,y=4,width=24}
+    local sum_c_3 = Div{parent=summary,x=2,y=4,width=24}
+    local sum_c_4 = Div{parent=summary,x=2,y=4,width=24}
+
+    local sum_pane = MultiPane{parent=summary,x=1,y=4,panes={sum_c_1,sum_c_2,sum_c_3,sum_c_4}}
+
+    TextBox{parent=summary,x=1,y=2,height=1,text=" Summary",fg_bg=cpair(colors.black,colors.green)}
+
+    local setting_list = ListBox{parent=sum_c_1,x=1,y=1,height=11,width=24,scroll_height=100,fg_bg=bw_fg_bg,nav_fg_bg=g_lg_fg_bg,nav_active=cpair(colors.black,colors.gray)}
+
+    local function back_from_summary()
+        if tool_ctl.viewing_config or tool_ctl.importing_legacy then
+            main_pane.set_value(1)
+            tool_ctl.viewing_config = false
+            tool_ctl.importing_legacy = false
+            tool_ctl.settings_apply.show()
+        else
+            main_pane.set_value(3)
+        end
+    end
+
+    ---@param element graphics_element
+    ---@param data any
+    local function try_set(element, data)
+        if data ~= nil then element.set_value(data) end
+    end
+
+    local function save_and_continue()
+        for k, v in pairs(tmp_cfg) do settings.set(k, v) end
+
+        if settings.save("/pocket.settings") then
+            load_settings(settings_cfg, true)
+            load_settings(ini_cfg)
+
+            try_set(svr_chan, ini_cfg.SVR_Channel)
+            try_set(crd_chan, ini_cfg.CRD_Channel)
+            try_set(pkt_chan, ini_cfg.PKT_Channel)
+            try_set(timeout, ini_cfg.ConnTimeout)
+            try_set(range, ini_cfg.TrustedRange)
+            try_set(key, ini_cfg.AuthKey)
+            try_set(mode, ini_cfg.LogMode)
+            try_set(path, ini_cfg.LogPath)
+            try_set(en_dbg, ini_cfg.LogDebug)
+
+            tool_ctl.view_cfg.enable()
+
+            if tool_ctl.importing_legacy then
+                tool_ctl.importing_legacy = false
+                sum_pane.set_value(3)
+            else
+                sum_pane.set_value(2)
+            end
+        else
+            sum_pane.set_value(4)
+        end
+    end
+
+    PushButton{parent=sum_c_1,x=1,y=15,text="\x1b Back",callback=back_from_summary,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    tool_ctl.show_key_btn = PushButton{parent=sum_c_1,x=1,y=13,min_width=17,text="Unhide Auth Key",callback=function()tool_ctl.show_auth_key()end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg,dis_fg_bg=dis_fg_bg}
+    tool_ctl.settings_apply = PushButton{parent=sum_c_1,x=18,y=15,min_width=7,text="Apply",callback=save_and_continue,fg_bg=cpair(colors.black,colors.green),active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=sum_c_2,x=1,y=1,height=1,text="Settings saved!"}
+
+    local function go_home()
+        main_pane.set_value(1)
+        net_pane.set_value(1)
+        sum_pane.set_value(1)
+    end
+
+    PushButton{parent=sum_c_2,x=1,y=15,min_width=6,text="Home",callback=go_home,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=sum_c_2,x=19,y=15,min_width=6,text="Exit",callback=exit,fg_bg=cpair(colors.black,colors.red),active_fg_bg=cpair(colors.white,colors.gray)}
+
+    TextBox{parent=sum_c_3,x=1,y=1,height=4,text="The old config.lua file will now be deleted, then the configurator will exit."}
+
+    local function delete_legacy()
+        fs.delete("/pocket/config.lua")
+        exit()
+    end
+
+    PushButton{parent=sum_c_3,x=1,y=15,min_width=8,text="Cancel",callback=go_home,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=sum_c_3,x=19,y=15,min_width=6,text="OK",callback=delete_legacy,fg_bg=cpair(colors.black,colors.green),active_fg_bg=cpair(colors.white,colors.gray)}
+
+    TextBox{parent=sum_c_4,x=1,y=1,height=8,text="Failed to save the settings file.\n\nThere may not be enough space for the modification or server file permissions may be denying writes."}
+    PushButton{parent=sum_c_4,x=1,y=15,min_width=6,text="Home",callback=go_home,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=sum_c_4,x=19,y=15,min_width=6,text="Exit",callback=exit,fg_bg=cpair(colors.black,colors.red),active_fg_bg=cpair(colors.white,colors.gray)}
+
+    --#endregion
+
+    -- Config Change Log
+
+    local cl = Div{parent=changelog,x=2,y=4,width=24}
+
+    TextBox{parent=changelog,x=1,y=2,height=1,text=" Config Change Log",fg_bg=bw_fg_bg}
+
+    local c_log = ListBox{parent=cl,x=1,y=1,height=13,width=24,scroll_height=100,fg_bg=bw_fg_bg,nav_fg_bg=g_lg_fg_bg,nav_active=cpair(colors.black,colors.gray)}
+
+    for _, change in ipairs(changes) do
+        TextBox{parent=c_log,text=change[1],height=1,fg_bg=bw_fg_bg}
+        for _, v in ipairs(change[2]) do
+            local e = Div{parent=c_log,height=#util.strwrap(v,21)}
+            TextBox{parent=e,y=1,x=1,text="- ",height=1,fg_bg=cpair(colors.gray,colors.white)}
+            TextBox{parent=e,y=1,x=3,text=v,height=e.get_height(),fg_bg=cpair(colors.gray,colors.white)}
+        end
+    end
+
+    PushButton{parent=cl,x=1,y=15,text="\x1b Back",callback=function()main_pane.set_value(1)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    -- set tool functions now that we have the elements
+
+    -- load a legacy config file
+    function tool_ctl.load_legacy()
+        local config = require("pocket.config")
+
+        tmp_cfg.SVR_Channel = config.SVR_CHANNEL
+        tmp_cfg.CRD_Channel = config.CRD_CHANNEL
+        tmp_cfg.PKT_Channel = config.PKT_CHANNEL
+        tmp_cfg.ConnTimeout = config.COMMS_TIMEOUT
+        tmp_cfg.TrustedRange = config.TRUSTED_RANGE
+        tmp_cfg.AuthKey = config.AUTH_KEY or ""
+
+        tmp_cfg.LogMode = config.LOG_MODE
+        tmp_cfg.LogPath = config.LOG_PATH
+        tmp_cfg.LogDebug = config.LOG_DEBUG or false
+
+        tool_ctl.gen_summary(tmp_cfg)
+        sum_pane.set_value(1)
+        main_pane.set_value(4)
+        tool_ctl.importing_legacy = true
+    end
+
+    -- expose the auth key on the summary page
+    function tool_ctl.show_auth_key()
+        tool_ctl.show_key_btn.disable()
+        tool_ctl.auth_key_textbox.set_value(tool_ctl.auth_key_value)
+    end
+
+    -- generate the summary list
+    ---@param cfg pkt_config
+    function tool_ctl.gen_summary(cfg)
+        setting_list.remove_all()
+
+        local alternate = false
+        local inner_width = setting_list.get_width() - 1
+
+        tool_ctl.show_key_btn.enable()
+        tool_ctl.auth_key_value = cfg.AuthKey or "" -- to show auth key
+
+        for i = 1, #fields do
+            local f = fields[i]
+            local height = 1
+            local label_w = string.len(f[2])
+            local val_max_w = (inner_width - label_w) - 1
+            local raw = cfg[f[1]]
+            local val = util.strval(raw)
+
+            if f[1] == "AuthKey" then val = string.rep("*", string.len(val))
+            elseif f[1] == "LogMode" then val = util.trinary(raw == log.MODE.APPEND, "append", "replace") end
+
+            if val == "nil" then val = "<not set>" end
+
+            local c = util.trinary(alternate, g_lg_fg_bg, cpair(colors.gray,colors.white))
+            alternate = not alternate
+
+            if string.len(val) > val_max_w then
+                local lines = util.strwrap(val, inner_width)
+                height = #lines + 1
+            end
+
+            local line = Div{parent=setting_list,height=height,fg_bg=c}
+            TextBox{parent=line,text=f[2],width=string.len(f[2]),fg_bg=cpair(colors.black,line.get_fg_bg().bkg)}
+
+            local textbox
+            if height > 1 then
+                textbox = TextBox{parent=line,x=1,y=2,text=val,height=height-1,alignment=LEFT}
+            else
+                textbox = TextBox{parent=line,x=label_w+1,y=1,text=val,alignment=RIGHT}
+            end
+
+            if f[1] == "AuthKey" then tool_ctl.auth_key_textbox = textbox end
+        end
+    end
+end
+
+-- reset terminal screen
+local function reset_term()
+    term.setTextColor(colors.white)
+    term.setBackgroundColor(colors.black)
+    term.clear()
+    term.setCursorPos(1, 1)
+end
+
+-- run the pcoket configurator
+---@param ask_config? boolean indicate if this is being called by the startup app due to an invalid configuration
+function configurator.configure(ask_config)
+    tool_ctl.ask_config = ask_config == true
+
+    load_settings(settings_cfg, true)
+    tool_ctl.has_config = load_settings(ini_cfg)
+
+    reset_term()
+
+    -- set overridden colors
+    for i = 1, #style.colors do
+        term.setPaletteColor(style.colors[i].c, style.colors[i].hex)
+    end
+
+    local status, error = pcall(function ()
+        local display = DisplayBox{window=term.current(),fg_bg=style.root}
+        config_view(display)
+
+        while true do
+            local event, param1, param2, param3 = util.pull_event()
+
+            -- handle event
+            if event == "timer" then
+                tcd.handle(param1)
+            elseif event == "mouse_click" or event == "mouse_up" or event == "mouse_drag" or event == "mouse_scroll" or event == "double_click" then
+                local m_e = core.events.new_mouse_event(event, param1, param2, param3)
+                if m_e then display.handle_mouse(m_e) end
+            elseif event == "char" or event == "key" or event == "key_up" then
+                local k_e = core.events.new_key_event(event, param1, param2)
+                if k_e then display.handle_key(k_e) end
+            elseif event == "paste" then
+                display.handle_paste(param1)
+            end
+
+            if event == "terminate" then return end
+        end
+    end)
+
+    -- restore colors
+    for i = 1, #style.colors do
+        local r, g, b = term.nativePaletteColor(style.colors[i].c)
+        term.setPaletteColor(style.colors[i].c, r, g, b)
+    end
+
+    reset_term()
+    if not status then
+        println("configurator error: " .. error)
+    end
+
+    return status, error
+end
+
+return configurator

pocket/coreio.lua

@@ -1,35 +0,0 @@
---
--- Core I/O - Pocket Central I/O Management
---
-
-local psil = require("scada-common.psil")
-
-local coreio = {}
-
----@class pocket_core_io
-local io = {
-    ps = psil.create()
-}
-
----@enum POCKET_LINK_STATE
-local LINK_STATE = {
-    UNLINKED = 0,
-    SV_LINK_ONLY = 1,
-    API_LINK_ONLY = 2,
-    LINKED = 3
-}
-
-coreio.LINK_STATE = LINK_STATE
-
--- get the core PSIL
-function coreio.core_ps()
-    return io.ps
-end
-
--- set network link state
----@param state POCKET_LINK_STATE
-function coreio.report_link_state(state)
-    io.ps.publish("link_state", state)
-end
-
-return coreio

pocket/iocontrol.lua

@@ -0,0 +1,779 @@
+--
+-- I/O Control for Pocket Integration with Supervisor & Coordinator
+--
+
+local log   = require("scada-common.log")
+local psil  = require("scada-common.psil")
+local types = require("scada-common.types")
+local util  = require("scada-common.util")
+
+local ALARM = types.ALARM
+local ALARM_STATE = types.ALARM_STATE
+
+---@todo nominal trip time is ping (0ms to 10ms usually)
+local WARN_TT = 40
+local HIGH_TT = 80
+
+local iocontrol = {}
+
+---@enum POCKET_LINK_STATE
+local LINK_STATE = {
+    UNLINKED = 0,
+    SV_LINK_ONLY = 1,
+    API_LINK_ONLY = 2,
+    LINKED = 3
+}
+
+iocontrol.LINK_STATE = LINK_STATE
+
+---@enum POCKET_APP_ID
+local APP_ID = {
+    ROOT = 1,
+    -- main app page
+    UNITS = 2,
+    ABOUT = 3,
+    -- diag app page
+    ALARMS = 4,
+    -- other
+    DUMMY = 5,
+    NUM_APPS = 5
+}
+
+iocontrol.APP_ID = APP_ID
+
+---@class pocket_ioctl
+local io = {
+    version = "unknown",
+    ps = psil.create()
+}
+
+---@class nav_tree_page
+---@field _p nav_tree_page|nil page's parent
+---@field _c table page's children
+---@field nav_to function function to navigate to this page
+---@field switcher function|nil function to switch between children
+---@field tasks table tasks to run while viewing this page
+
+-- allocate the page navigation system
+function iocontrol.alloc_nav()
+    local self = {
+        pane = nil, ---@type graphics_element
+        apps = {},
+        containers = {},
+        cur_app = APP_ID.ROOT
+    }
+
+    self.cur_page = self.root
+
+    ---@class pocket_nav
+    io.nav = {}
+
+    -- set the root pane element to switch between apps with
+    ---@param root_pane graphics_element
+    function io.nav.set_pane(root_pane)
+        self.pane = root_pane
+    end
+
+    function io.nav.set_sidebar(sidebar)
+        self.sidebar = sidebar
+    end
+
+    -- register an app
+    ---@param app_id POCKET_APP_ID app ID
+    ---@param container graphics_element element that contains this app (usually a Div)
+    ---@param pane graphics_element? multipane if this is a simple paned app, then nav_to must be a number
+    function io.nav.register_app(app_id, container, pane)
+        ---@class pocket_app
+        local app = {
+            loaded = false,
+            load = nil,
+            cur_page = nil, ---@type nav_tree_page
+            pane = pane,
+            paned_pages = {},
+            sidebar_items = {}
+        }
+
+        app.load = function () app.loaded = true end
+
+        -- delayed set of the pane if it wasn't ready at the start
+        ---@param root_pane graphics_element multipane
+        function app.set_root_pane(root_pane)
+            app.pane = root_pane
+        end
+
+        function app.set_sidebar(items)
+            app.sidebar_items = items
+            if self.sidebar then self.sidebar.update(items) end
+        end
+
+        -- function to run on initial load into memory
+        ---@param on_load function callback
+        function app.set_on_load(on_load)
+            app.load = function ()
+                on_load()
+                app.loaded = true
+            end
+        end
+
+        -- if a pane was provided, this will switch between numbered pages
+        ---@param idx integer page index
+        function app.switcher(idx)
+            if app.paned_pages[idx] then
+                app.paned_pages[idx].nav_to()
+            end
+        end
+
+        -- create a new page entry in the app's page navigation tree
+        ---@param parent nav_tree_page? a parent page or nil to set this as the root
+        ---@param nav_to function|integer function to navigate to this page or pane index
+        ---@return nav_tree_page new_page this new page
+        function app.new_page(parent, nav_to)
+            ---@type nav_tree_page
+            local page = { _p = parent, _c = {}, nav_to = function () end, switcher = function () end, tasks = {} }
+
+            if parent == nil and app.cur_page == nil then
+                app.cur_page = page
+            end
+
+            if type(nav_to) == "number" then
+                app.paned_pages[nav_to] = page
+
+                function page.nav_to()
+                    app.cur_page = page
+                    if app.pane then app.pane.set_value(nav_to) end
+                end
+            else
+                function page.nav_to()
+                    app.cur_page = page
+                    nav_to()
+                end
+            end
+
+            -- switch between children
+            ---@param id integer child ID
+            function page.switcher(id) if page._c[id] then page._c[id].nav_to() end end
+
+            if parent ~= nil then
+                table.insert(page._p._c, page)
+            end
+
+            return page
+        end
+
+        -- get the currently active page
+        function app.get_current_page() return app.cur_page end
+
+        -- attempt to navigate up the tree
+        ---@return boolean success true if successfully navigated up
+        function app.nav_up()
+            local parent = app.cur_page._p
+            if parent then parent.nav_to() end
+            return parent ~= nil
+        end
+
+        self.apps[app_id] = app
+        self.containers[app_id] = container
+
+        return app
+    end
+
+    -- get a list of the app containers (usually Div elements)
+    function io.nav.get_containers() return self.containers end
+
+    -- open a given app
+    ---@param app_id POCKET_APP_ID
+    function io.nav.open_app(app_id)
+        local app = self.apps[app_id]   ---@type pocket_app
+        if app then
+            if not app.loaded then app.load() end
+
+            self.cur_app = app_id
+            self.pane.set_value(app_id)
+
+            if #app.sidebar_items > 0 then
+                self.sidebar.update(app.sidebar_items)
+            end
+        else
+            log.debug("tried to open unknown app")
+        end
+    end
+
+    -- get the currently active page
+    ---@return nav_tree_page
+    function io.nav.get_current_page()
+        return self.apps[self.cur_app].get_current_page()
+    end
+
+    -- attempt to navigate up
+    function io.nav.nav_up()
+        local app = self.apps[self.cur_app] ---@type pocket_app
+        log.debug("attempting app nav up for app " .. self.cur_app)
+
+        if not app.nav_up() then
+            log.debug("internal app nav up failed, going to home screen")
+            io.nav.open_app(APP_ID.ROOT)
+        end
+    end
+end
+
+-- initialize facility-independent components of pocket iocontrol
+---@param comms pocket_comms
+function iocontrol.init_core(comms)
+    iocontrol.alloc_nav()
+
+    ---@class pocket_ioctl_diag
+    io.diag = {}
+
+    -- alarm testing
+    io.diag.tone_test = {
+        test_1 = function (state) comms.diag__set_alarm_tone(1, state) end,
+        test_2 = function (state) comms.diag__set_alarm_tone(2, state) end,
+        test_3 = function (state) comms.diag__set_alarm_tone(3, state) end,
+        test_4 = function (state) comms.diag__set_alarm_tone(4, state) end,
+        test_5 = function (state) comms.diag__set_alarm_tone(5, state) end,
+        test_6 = function (state) comms.diag__set_alarm_tone(6, state) end,
+        test_7 = function (state) comms.diag__set_alarm_tone(7, state) end,
+        test_8 = function (state) comms.diag__set_alarm_tone(8, state) end,
+        stop_tones = function () comms.diag__set_alarm_tone(0, false) end,
+
+        test_breach = function (state) comms.diag__set_alarm(ALARM.ContainmentBreach, state) end,
+        test_rad = function (state) comms.diag__set_alarm(ALARM.ContainmentRadiation, state) end,
+        test_lost = function (state) comms.diag__set_alarm(ALARM.ReactorLost, state) end,
+        test_crit = function (state) comms.diag__set_alarm(ALARM.CriticalDamage, state) end,
+        test_dmg = function (state) comms.diag__set_alarm(ALARM.ReactorDamage, state) end,
+        test_overtemp = function (state) comms.diag__set_alarm(ALARM.ReactorOverTemp, state) end,
+        test_hightemp = function (state) comms.diag__set_alarm(ALARM.ReactorHighTemp, state) end,
+        test_wasteleak = function (state) comms.diag__set_alarm(ALARM.ReactorWasteLeak, state) end,
+        test_highwaste = function (state) comms.diag__set_alarm(ALARM.ReactorHighWaste, state) end,
+        test_rps = function (state) comms.diag__set_alarm(ALARM.RPSTransient, state) end,
+        test_rcs = function (state) comms.diag__set_alarm(ALARM.RCSTransient, state) end,
+        test_turbinet = function (state) comms.diag__set_alarm(ALARM.TurbineTrip, state) end,
+        stop_alarms = function () comms.diag__set_alarm(0, false) end,
+
+        get_tone_states = function () comms.diag__get_alarm_tones() end,
+
+        ready_warn = nil,       ---@type graphics_element
+        tone_buttons = {},
+        alarm_buttons = {},
+        tone_indicators = {}    -- indicators to update from supervisor tone states
+    }
+
+    -- API access
+    ---@class pocket_ioctl_api
+    io.api = {
+        get_unit = function (unit) comms.api__get_unit(unit) end
+    }
+end
+
+-- initialize facility-dependent components of pocket iocontrol
+---@param conf facility_conf configuration
+---@param temp_scale 1|2|3|4 temperature unit (1 = K, 2 = C, 3 = F, 4 = R)
+function iocontrol.init_fac(conf, temp_scale)
+    -- temperature unit label and conversion function (from Kelvin)
+    if temp_scale == 2 then
+        io.temp_label = "\xb0C"
+        io.temp_convert = function (t) return t - 273.15 end
+    elseif temp_scale == 3 then
+        io.temp_label = "\xb0F"
+        io.temp_convert = function (t) return (1.8 * (t - 273.15)) + 32 end
+    elseif temp_scale == 4 then
+        io.temp_label = "\xb0R"
+        io.temp_convert = function (t) return 1.8 * t end
+    else
+        io.temp_label = "K"
+        io.temp_convert = function (t) return t end
+    end
+
+    -- facility data structure
+    ---@class pioctl_facility
+    io.facility = {
+        num_units = conf.num_units,
+        tank_mode = conf.cooling.fac_tank_mode,
+        tank_defs = conf.cooling.fac_tank_defs,
+        all_sys_ok = false,
+        rtu_count = 0,
+
+        auto_ready = false,
+        auto_active = false,
+        auto_ramping = false,
+        auto_saturated = false,
+
+        auto_scram = false,
+        ---@type ascram_status
+        ascram_status = {
+            matrix_dc = false,
+            matrix_fill = false,
+            crit_alarm = false,
+            radiation = false,
+            gen_fault = false
+        },
+
+        ---@type WASTE_PRODUCT
+        auto_current_waste_product = types.WASTE_PRODUCT.PLUTONIUM,
+        auto_pu_fallback_active = false,
+
+        radiation = types.new_zero_radiation_reading(),
+
+        ps = psil.create(),
+
+        induction_ps_tbl = {},
+        induction_data_tbl = {},
+
+        sps_ps_tbl = {},
+        sps_data_tbl = {},
+
+        tank_ps_tbl = {},
+        tank_data_tbl = {},
+
+        env_d_ps = psil.create(),
+        env_d_data = {}
+    }
+
+    -- create induction and SPS tables (currently only 1 of each is supported)
+    table.insert(io.facility.induction_ps_tbl, psil.create())
+    table.insert(io.facility.induction_data_tbl, {})
+    table.insert(io.facility.sps_ps_tbl, psil.create())
+    table.insert(io.facility.sps_data_tbl, {})
+
+    -- determine tank information
+    if io.facility.tank_mode == 0 then
+        io.facility.tank_defs = {}
+        -- on facility tank mode 0, setup tank defs to match unit tank option
+        for i = 1, conf.num_units do
+            io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TankConnection, 1, 0)
+        end
+
+        io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
+    else
+        -- decode the layout of tanks from the connections definitions
+        local tank_mode = io.facility.tank_mode
+        local tank_defs = io.facility.tank_defs
+        local tank_list = { table.unpack(tank_defs) }
+
+        local function calc_fdef(start_idx, end_idx)
+            local first = 4
+            for i = start_idx, end_idx do
+                if io.facility.tank_defs[i] == 2 then
+                    if i < first then first = i end
+                end
+            end
+            return first
+        end
+
+        if tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef = calc_fdef(1, #tank_defs)
+            for i = 1, #tank_defs do
+                if i > first_fdef and tank_defs[i] == 2 then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
+                    tank_list[b] = 0
+                end
+            end
+        elseif tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef = calc_fdef(2, #tank_defs)
+            for i = 1, #tank_defs do
+                if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef = calc_fdef(3, #tank_defs)
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        end
+
+        io.facility.tank_list = tank_list
+    end
+
+    -- create facility tank tables
+    for i = 1, #io.facility.tank_list do
+        if io.facility.tank_list[i] == 2 then
+            table.insert(io.facility.tank_ps_tbl, psil.create())
+            table.insert(io.facility.tank_data_tbl, {})
+        end
+    end
+
+    -- create unit data structures
+    io.units = {}
+    for i = 1, conf.num_units do
+        ---@class pioctl_unit
+        local entry = {
+            unit_id = i,
+            connected = false,
+            rtu_hw = {},
+
+            num_boilers = 0,
+            num_turbines = 0,
+            num_snas = 0,
+            has_tank = conf.cooling.r_cool[i].TankConnection,
+
+            control_state = false,
+            burn_rate_cmd = 0.0,
+            radiation = types.new_zero_radiation_reading(),
+
+            sna_peak_rate = 0.0,
+            sna_max_rate = 0.0,
+            sna_out_rate = 0.0,
+
+            waste_mode = types.WASTE_MODE.MANUAL_PLUTONIUM,
+            waste_product = types.WASTE_PRODUCT.PLUTONIUM,
+
+            -- auto control group
+            a_group = 0,
+
+            ---@type alarms
+            alarms = { ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE },
+
+            annunciator = {},   ---@type annunciator
+
+            unit_ps = psil.create(),
+            reactor_data = {},  ---@type reactor_db
+
+            boiler_ps_tbl = {},
+            boiler_data_tbl = {},
+
+            turbine_ps_tbl = {},
+            turbine_data_tbl = {},
+
+            tank_ps_tbl = {},
+            tank_data_tbl = {}
+        }
+
+        -- on other facility modes, overwrite unit TANK option with facility tank defs
+        if io.facility.tank_mode ~= 0 then
+            entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
+        end
+
+        -- create boiler tables
+        for _ = 1, conf.cooling.r_cool[i].BoilerCount do
+            table.insert(entry.boiler_ps_tbl, psil.create())
+            table.insert(entry.boiler_data_tbl, {})
+        end
+
+        -- create turbine tables
+        for _ = 1, conf.cooling.r_cool[i].TurbineCount do
+            table.insert(entry.turbine_ps_tbl, psil.create())
+            table.insert(entry.turbine_data_tbl, {})
+        end
+
+        -- create tank tables
+        if io.facility.tank_defs[i] == 1 then
+            table.insert(entry.tank_ps_tbl, psil.create())
+            table.insert(entry.tank_data_tbl, {})
+        end
+
+        entry.num_boilers = #entry.boiler_data_tbl
+        entry.num_turbines = #entry.turbine_data_tbl
+
+        table.insert(io.units, entry)
+    end
+end
+
+-- set network link state
+---@param state POCKET_LINK_STATE
+---@param sv_addr integer? supervisor address if linked
+---@param api_addr integer? coordinator address if linked
+function iocontrol.report_link_state(state, sv_addr, api_addr)
+    io.ps.publish("link_state", state)
+
+    if state == LINK_STATE.API_LINK_ONLY or state == LINK_STATE.UNLINKED then
+        io.ps.publish("svr_conn_quality", 0)
+    end
+
+    if state == LINK_STATE.SV_LINK_ONLY or state == LINK_STATE.UNLINKED then
+        io.ps.publish("crd_conn_quality", 0)
+    end
+
+    if state == LINK_STATE.LINKED then
+        io.ps.publish("sv_addr", sv_addr)
+        io.ps.publish("api_addr", api_addr)
+    end
+end
+
+-- determine supervisor connection quality (trip time)
+---@param trip_time integer
+function iocontrol.report_svr_tt(trip_time)
+    local state = 3
+    if trip_time > HIGH_TT then
+        state = 1
+    elseif trip_time > WARN_TT then
+        state = 2
+    end
+
+    io.ps.publish("svr_conn_quality", state)
+end
+
+-- determine coordinator connection quality (trip time)
+---@param trip_time integer
+function iocontrol.report_crd_tt(trip_time)
+    local state = 3
+    if trip_time > HIGH_TT then
+        state = 1
+    elseif trip_time > WARN_TT then
+        state = 2
+    end
+
+    io.ps.publish("crd_conn_quality", state)
+end
+
+-- populate facility data from API_GET_FAC
+---@param data table
+---@return boolean valid
+function iocontrol.record_facility_data(data)
+    local valid = true
+
+    local fac = io.facility
+
+    fac.all_sys_ok = data[1]
+    fac.rtu_count = data[2]
+    fac.radiation = data[3]
+
+    -- auto control
+    if type(data[4]) == "table" and #data[4] == 4 then
+        fac.auto_ready = data[4][1]
+        fac.auto_active = data[4][2]
+        fac.auto_ramping = data[4][3]
+        fac.auto_saturated = data[4][4]
+    end
+
+    -- waste
+    if type(data[5]) == "table" and #data[5] == 2 then
+        fac.auto_current_waste_product = data[5][1]
+        fac.auto_pu_fallback_active = data[5][2]
+    end
+
+    fac.num_tanks = data[6]
+    fac.has_imatrix = data[7]
+    fac.has_sps = data[8]
+
+    return valid
+end
+
+-- update unit status data from API_GET_UNIT
+---@param data table
+function iocontrol.record_unit_data(data)
+    if type(data[1]) == "number" and io.units[data[1]] then
+        local unit = io.units[data[1]]  ---@type pioctl_unit
+
+        unit.connected = data[2]
+        unit.rtu_hw = data[3]
+        unit.alarms = data[4]
+
+        --#region Annunciator
+
+        unit.annunciator = data[5]
+
+        local rcs_disconn, rcs_warn, rcs_hazard = false, false, false
+
+        for key, val in pairs(unit.annunciator) do
+            if key == "BoilerOnline" or key == "TurbineOnline" then
+                local every = true
+
+                -- split up online arrays
+                for id = 1, #val do
+                    every = every and val[id]
+
+                    if key == "BoilerOnline" then
+                        unit.boiler_ps_tbl[id].publish(key, val[id])
+                    else
+                        unit.turbine_ps_tbl[id].publish(key, val[id])
+                    end
+                end
+
+                if not every then rcs_disconn = true end
+
+                unit.unit_ps.publish("U_" .. key, every)
+            elseif key == "HeatingRateLow" or key == "WaterLevelLow" then
+                -- split up array for all boilers
+                local any = false
+                for id = 1, #val do
+                    any = any or val[id]
+                    unit.boiler_ps_tbl[id].publish(key, val[id])
+                end
+
+                if key == "HeatingRateLow" and any then
+                    rcs_warn = true
+                elseif key == "WaterLevelLow" and any then
+                    rcs_hazard = true
+                end
+
+                unit.unit_ps.publish("U_" .. key, any)
+            elseif key == "SteamDumpOpen" or key == "TurbineOverSpeed" or key == "GeneratorTrip" or key == "TurbineTrip" then
+                -- split up array for all turbines
+                local any = false
+                for id = 1, #val do
+                    any = any or val[id]
+                    unit.turbine_ps_tbl[id].publish(key, val[id])
+                end
+
+                if key == "GeneratorTrip" and any then
+                    rcs_warn = true
+                elseif (key == "TurbineOverSpeed" or key == "TurbineTrip") and any then
+                    rcs_hazard = true
+                end
+
+                unit.unit_ps.publish("U_" .. key, any)
+            else
+                -- non-table fields
+                unit.unit_ps.publish(key, val)
+            end
+        end
+
+        local anc = unit.annunciator
+        rcs_hazard = rcs_hazard or anc.RCPTrip
+        rcs_warn = rcs_warn or anc.RCSFlowLow or anc.CoolantLevelLow or anc.RCSFault or anc.MaxWaterReturnFeed or
+                   anc.CoolantFeedMismatch or anc.BoilRateMismatch or anc.SteamFeedMismatch or anc.MaxWaterReturnFeed
+
+        local rcs_status = 4
+        if rcs_hazard then
+            rcs_status = 2
+        elseif rcs_warn then
+            rcs_status = 3
+        elseif rcs_disconn then
+            rcs_status = 1
+        end
+
+        unit.unit_ps.publish("U_RCS", rcs_status)
+
+        --#endregion
+
+        --#region Reactor Data
+
+        unit.reactor_data = data[6]
+
+        local control_status = 1
+        local reactor_status = 1
+        local rps_status = 1
+
+        if unit.connected then
+            -- update RPS status
+            if unit.reactor_data.rps_tripped then
+                control_status = 2
+                rps_status = util.trinary(unit.reactor_data.rps_trip_cause == "manual", 3, 2)
+            else rps_status = 4 end
+
+            -- update reactor/control status
+            if unit.reactor_data.mek_status.status then
+                reactor_status = 4
+                control_status = util.trinary(unit.annunciator.AutoControl, 4, 3)
+            else
+                if unit.reactor_data.no_reactor then
+                    reactor_status = 2
+                elseif not unit.reactor_data.formed or unit.reactor_data.rps_status.force_dis then
+                    reactor_status = 3
+                else
+                    reactor_status = 4
+                end
+            end
+
+            for key, val in pairs(unit.reactor_data) do
+                if key ~= "rps_status" and key ~= "mek_struct" and key ~= "mek_status" then
+                    unit.unit_ps.publish(key, val)
+                end
+            end
+
+            if type(unit.reactor_data.rps_status) == "table" then
+                for key, val in pairs(unit.reactor_data.rps_status) do
+                    unit.unit_ps.publish(key, val)
+                end
+            end
+
+            if type(unit.reactor_data.mek_status) == "table" then
+                for key, val in pairs(unit.reactor_data.mek_status) do
+                    unit.unit_ps.publish(key, val)
+                end
+            end
+        end
+
+        unit.unit_ps.publish("U_ControlStatus", control_status)
+        unit.unit_ps.publish("U_ReactorStatus", reactor_status)
+        unit.unit_ps.publish("U_RPS", rps_status)
+
+        --#endregion
+
+        unit.boiler_data_tbl = data[7]
+
+        for id = 1, #unit.boiler_data_tbl do
+            local boiler = unit.boiler_data_tbl[id] ---@type boilerv_session_db
+            local ps     = unit.boiler_ps_tbl[id]   ---@type psil
+
+            local boiler_status = 1
+
+            if unit.rtu_hw.boilers[id].connected then
+                if unit.rtu_hw.boilers[id].faulted then
+                    boiler_status = 3
+                elseif boiler.formed then
+                    boiler_status = 4
+                else
+                    boiler_status = 2
+                end
+            end
+
+            ps.publish("BoilerStatus", boiler_status)
+        end
+
+        unit.turbine_data_tbl = data[8]
+
+        for id = 1, #unit.turbine_data_tbl do
+            local turbine = unit.turbine_data_tbl[id] ---@type turbinev_session_db
+            local ps      = unit.turbine_ps_tbl[id]   ---@type psil
+
+            local turbine_status = 1
+
+            if unit.rtu_hw.turbines[id].connected then
+                if unit.rtu_hw.turbines[id].faulted then
+                    turbine_status = 3
+                elseif turbine.formed then
+                    turbine_status = 4
+                else
+                    turbine_status = 2
+                end
+            end
+
+            ps.publish("TurbineStatus", turbine_status)
+        end
+
+        unit.tank_data_tbl = data[9]
+    end
+end
+
+-- get the IO controller database
+function iocontrol.get_db() return io end
+
+return iocontrol

pocket/pocket.lua

@@ -1,30 +1,70 @@
-local comms  = require("scada-common.comms")
-local log    = require("scada-common.log")
-local util   = require("scada-common.util")
+local comms     = require("scada-common.comms")
+local log       = require("scada-common.log")
+local util      = require("scada-common.util")
 
-local coreio = require("pocket.coreio")
+local iocontrol = require("pocket.iocontrol")
 
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
 local ESTABLISH_ACK = comms.ESTABLISH_ACK
-local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
--- local CAPI_TYPE = comms.CAPI_TYPE
+local MGMT_TYPE = comms.MGMT_TYPE
+local CRDN_TYPE = comms.CRDN_TYPE
 
-local LINK_STATE = coreio.LINK_STATE
+local LINK_STATE = iocontrol.LINK_STATE
 
 local pocket = {}
 
+---@type pkt_config
+local config = {}
+
+pocket.config = config
+
+-- load the pocket configuration
+function pocket.load_config()
+    if not settings.load("/pocket.settings") then return false end
+
+    config.SVR_Channel = settings.get("SVR_Channel")
+    config.CRD_Channel = settings.get("CRD_Channel")
+    config.PKT_Channel = settings.get("PKT_Channel")
+    config.ConnTimeout = settings.get("ConnTimeout")
+    config.TrustedRange = settings.get("TrustedRange")
+    config.AuthKey = settings.get("AuthKey")
+
+    config.LogMode = settings.get("LogMode")
+    config.LogPath = settings.get("LogPath")
+    config.LogDebug = settings.get("LogDebug")
+
+    local cfv = util.new_validator()
+
+    cfv.assert_channel(config.SVR_Channel)
+    cfv.assert_channel(config.CRD_Channel)
+    cfv.assert_channel(config.PKT_Channel)
+    cfv.assert_type_num(config.ConnTimeout)
+    cfv.assert_min(config.ConnTimeout, 2)
+    cfv.assert_type_num(config.TrustedRange)
+    cfv.assert_min(config.TrustedRange, 0)
+    cfv.assert_type_str(config.AuthKey)
+
+    if type(config.AuthKey) == "string" then
+        local len = string.len(config.AuthKey)
+        cfv.assert(len == 0 or len >= 8)
+    end
+
+    cfv.assert_type_int(config.LogMode)
+    cfv.assert_range(config.LogMode, 0, 1)
+    cfv.assert_type_str(config.LogPath)
+    cfv.assert_type_bool(config.LogDebug)
+
+    return cfv.valid()
+end
+
 -- pocket coordinator + supervisor communications
 ---@nodiscard
 ---@param version string pocket version
 ---@param nic nic network interface device
----@param pkt_channel integer pocket comms channel
----@param svr_channel integer supervisor access channel
----@param crd_channel integer coordinator access channel
----@param range integer trusted device connection range
 ---@param sv_watchdog watchdog
 ---@param api_watchdog watchdog
-function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range, sv_watchdog, api_watchdog)
+function pocket.comms(version, nic, sv_watchdog, api_watchdog)
     local self = {
         sv = {
             linked = false,
@@ -43,16 +83,16 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         establish_delay_counter = 0
     }
 
-    comms.set_trusted_range(range)
+    comms.set_trusted_range(config.TrustedRange)
 
     -- PRIVATE FUNCTIONS --
 
     -- configure network channels
     nic.closeAll()
-    nic.open(pkt_channel)
+    nic.open(config.PKT_Channel)
 
     -- send a management packet to the supervisor
-    ---@param msg_type SCADA_MGMT_TYPE
+    ---@param msg_type MGMT_TYPE
     ---@param msg table
     local function _send_sv(msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -61,12 +101,12 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         pkt.make(msg_type, msg)
         s_pkt.make(self.sv.addr, self.sv.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
 
-        nic.transmit(svr_channel, pkt_channel, s_pkt)
+        nic.transmit(config.SVR_Channel, config.PKT_Channel, s_pkt)
         self.sv.seq_num = self.sv.seq_num + 1
     end
 
     -- send a management packet to the coordinator
-    ---@param msg_type SCADA_MGMT_TYPE
+    ---@param msg_type MGMT_TYPE
     ---@param msg table
     local function _send_crd(msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -75,44 +115,44 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         pkt.make(msg_type, msg)
         s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
 
-        nic.transmit(crd_channel, pkt_channel, s_pkt)
+        nic.transmit(config.CRD_Channel, config.PKT_Channel, s_pkt)
         self.api.seq_num = self.api.seq_num + 1
     end
 
-    -- send a packet to the coordinator API
-    -----@param msg_type CAPI_TYPE
-    -----@param msg table
-    -- local function _send_api(msg_type, msg)
-    --     local s_pkt = comms.scada_packet()
-    --     local pkt = comms.capi_packet()
+    -- send an API packet to the coordinator
+    ---@param msg_type CRDN_TYPE
+    ---@param msg table
+    local function _send_api(msg_type, msg)
+        local s_pkt = comms.scada_packet()
+        local pkt = comms.crdn_packet()
 
-    --     pkt.make(msg_type, msg)
-    --     s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.COORD_API, pkt.raw_sendable())
+        pkt.make(msg_type, msg)
+        s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.SCADA_CRDN, pkt.raw_sendable())
 
-    --     nic.transmit(crd_channel, pkt_channel, s_pkt)
-    --     self.api.seq_num = self.api.seq_num + 1
-    -- end
+        nic.transmit(config.CRD_Channel, config.PKT_Channel, s_pkt)
+        self.api.seq_num = self.api.seq_num + 1
+    end
 
     -- attempt supervisor connection establishment
     local function _send_sv_establish()
-        _send_sv(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
+        _send_sv(MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
     end
 
     -- attempt coordinator API connection establishment
     local function _send_api_establish()
-        _send_crd(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
+        _send_crd(MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT, comms.api_version })
     end
 
     -- keep alive ack to supervisor
     ---@param srv_time integer
     local function _send_sv_keep_alive_ack(srv_time)
-        _send_sv(SCADA_MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
+        _send_sv(MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
     end
 
     -- keep alive ack to coordinator
     ---@param srv_time integer
     local function _send_api_keep_alive_ack(srv_time)
-        _send_crd(SCADA_MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
+        _send_crd(MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
     end
 
     -- PUBLIC FUNCTIONS --
@@ -126,7 +166,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         self.sv.linked = false
         self.sv.r_seq_num = nil
         self.sv.addr = comms.BROADCAST
-        _send_sv(SCADA_MGMT_TYPE.CLOSE, {})
+        _send_sv(MGMT_TYPE.CLOSE, {})
     end
 
     -- close connection to coordinator API server
@@ -135,7 +175,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         self.api.linked = false
         self.api.r_seq_num = nil
         self.api.addr = comms.BROADCAST
-        _send_crd(SCADA_MGMT_TYPE.CLOSE, {})
+        _send_crd(MGMT_TYPE.CLOSE, {})
     end
 
     -- close the connections to the servers
@@ -147,7 +187,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
     -- attempt to re-link if any of the dependent links aren't active
     function public.link_update()
         if not self.sv.linked then
-            coreio.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
+            iocontrol.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
 
             if self.establish_delay_counter <= 0 then
                 _send_sv_establish()
@@ -156,7 +196,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 self.establish_delay_counter = self.establish_delay_counter - 1
             end
         elseif not self.api.linked then
-            coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
+            iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
 
             if self.establish_delay_counter <= 0 then
                 _send_api_establish()
@@ -166,17 +206,41 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
             end
         else
             -- linked, all good!
-            coreio.report_link_state(LINK_STATE.LINKED)
+            iocontrol.report_link_state(LINK_STATE.LINKED, self.sv.addr, self.api.addr)
         end
     end
 
+    -- supervisor get active alarm tones
+    function public.diag__get_alarm_tones()
+        if self.sv.linked then _send_sv(MGMT_TYPE.DIAG_TONE_GET, {}) end
+    end
+
+    -- supervisor test alarm tones by tone
+    ---@param id TONE|0 tone ID, or 0 to stop all
+    ---@param state boolean tone state
+    function public.diag__set_alarm_tone(id, state)
+        if self.sv.linked then _send_sv(MGMT_TYPE.DIAG_TONE_SET, { id, state }) end
+    end
+
+    -- supervisor test alarm tones by alarm
+    ---@param id ALARM|0 alarm ID, 0 to stop all
+    ---@param state boolean alarm state
+    function public.diag__set_alarm(id, state)
+        if self.sv.linked then _send_sv(MGMT_TYPE.DIAG_ALARM_SET, { id, state }) end
+    end
+
+    -- coordinator get unit data
+    function public.api__get_unit(unit)
+        if self.api.linked then _send_api(CRDN_TYPE.API_GET_UNIT, { unit }) end
+    end
+
     -- parse a packet
     ---@param side string
     ---@param sender integer
     ---@param reply_to integer
     ---@param message any
     ---@param distance integer
-    ---@return mgmt_frame|capi_frame|nil packet
+    ---@return mgmt_frame|crdn_frame|nil packet
     function public.parse_packet(side, sender, reply_to, message, distance)
         local s_pkt = nic.receive(side, sender, reply_to, message, distance)
         local pkt = nil
@@ -188,11 +252,11 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 if mgmt_pkt.decode(s_pkt) then
                     pkt = mgmt_pkt.get()
                 end
-            -- get as coordinator API packet
-            elseif s_pkt.protocol() == PROTOCOL.COORD_API then
-                local capi_pkt = comms.capi_packet()
-                if capi_pkt.decode(s_pkt) then
-                    pkt = capi_pkt.get()
+            -- get as coordinator packet
+            elseif s_pkt.protocol() == PROTOCOL.SCADA_CRDN then
+                local crdn_pkt = comms.crdn_packet()
+                if crdn_pkt.decode(s_pkt) then
+                    pkt = crdn_pkt.get()
                 end
             else
                 log.debug("attempted parse of illegal packet type " .. s_pkt.protocol(), true)
@@ -202,18 +266,39 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         return pkt
     end
 
+    ---@param packet mgmt_frame|crdn_frame
+    ---@param length integer
+    ---@param max integer?
+    ---@return boolean
+    local function _check_length(packet, length, max)
+        local ok = util.trinary(max == nil, packet.length == length, packet.length >= length and packet.length <= (max or 0))
+        if not ok then
+            local fmt = "[comms] RX_PACKET{r_chan=%d,proto=%d,type=%d}: packet length mismatch -> expect %d != actual %d"
+            log.debug(util.sprintf(fmt, packet.scada_frame.remote_channel(), packet.scada_frame.protocol(), packet.type))
+        end
+        return ok
+    end
+
+    ---@param packet mgmt_frame|crdn_frame
+    local function _fail_type(packet)
+        local fmt = "[comms] RX_PACKET{r_chan=%d,proto=%d,type=%d}: unrecognized packet type"
+        log.debug(util.sprintf(fmt, packet.scada_frame.remote_channel(), packet.scada_frame.protocol(), packet.type))
+    end
+
     -- handle a packet
-    ---@param packet mgmt_frame|capi_frame|nil
+    ---@param packet mgmt_frame|crdn_frame|nil
     function public.handle_packet(packet)
+        local diag = iocontrol.get_db().diag
+
         if packet ~= nil then
             local l_chan   = packet.scada_frame.local_channel()
             local r_chan   = packet.scada_frame.remote_channel()
             local protocol = packet.scada_frame.protocol()
             local src_addr = packet.scada_frame.src_addr()
 
-            if l_chan ~= pkt_channel then
+            if l_chan ~= config.PKT_Channel then
                 log.debug("received packet on unconfigured channel " .. l_chan, true)
-            elseif r_chan == crd_channel then
+            elseif r_chan == config.CRD_Channel then
                 -- check sequence number
                 if self.api.r_seq_num == nil then
                     self.api.r_seq_num = packet.scada_frame.seq_num()
@@ -222,7 +307,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                     return
                 elseif self.api.linked and (src_addr ~= self.api.addr) then
                     log.debug("received packet from unknown computer " .. src_addr .. " while linked (API expected " .. self.api.addr ..
-                                "); channel in use by another system?")
+                              "); channel in use by another system?")
                     return
                 else
                     self.api.r_seq_num = packet.scada_frame.seq_num()
@@ -231,25 +316,79 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 -- feed watchdog on valid sequence number
                 api_watchdog.feed()
 
-                if protocol == PROTOCOL.COORD_API then
-                    ---@cast packet capi_frame
+                if protocol == PROTOCOL.SCADA_CRDN then
+                    ---@cast packet crdn_frame
+                    if self.api.linked then
+                        if packet.type == CRDN_TYPE.API_GET_FAC then
+                            if _check_length(packet, 11) then
+                                iocontrol.record_facility_data(packet.data)
+                            end
+                        elseif packet.type == CRDN_TYPE.API_GET_UNIT then
+                            if _check_length(packet, 9) then
+                                iocontrol.record_unit_data(packet.data)
+                            end
+                        else _fail_type(packet) end
+                    else
+                        log.debug("discarding coordinator SCADA_CRDN packet before linked")
+                    end
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if self.api.linked then
+                        if packet.type == MGMT_TYPE.KEEP_ALIVE then
+                            -- keep alive request received, echo back
+                            if _check_length(packet, 1) then
+                                local timestamp = packet.data[1]
+                                local trip_time = util.time() - timestamp
+
+                                if trip_time > 750 then
+                                    log.warning("pocket coordinator KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
+                                end
+
+                                -- log.debug("pocket coordinator TT = " .. trip_time .. "ms")
+
+                                _send_api_keep_alive_ack(timestamp)
+
+                                iocontrol.report_crd_tt(trip_time)
+                            end
+                        elseif packet.type == MGMT_TYPE.CLOSE then
+                            -- handle session close
+                            api_watchdog.cancel()
+                            self.api.linked = false
+                            self.api.r_seq_num = nil
+                            self.api.addr = comms.BROADCAST
+                            log.info("coordinator server connection closed by remote host")
+                        else _fail_type(packet) end
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- connection with coordinator established
-                        if packet.length == 1 then
+                        if _check_length(packet, 1, 2) then
                             local est_ack = packet.data[1]
 
                             if est_ack == ESTABLISH_ACK.ALLOW then
-                                log.info("coordinator connection established")
-                                self.establish_delay_counter = 0
-                                self.api.linked = true
-                                self.api.addr = src_addr
+                                if packet.length == 2 then
+                                    local fac_config = packet.data[2]
 
-                                if self.sv.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
+                                    if type(fac_config) == "table" and #fac_config == 2 then
+                                        -- get configuration
+                                        local conf = { num_units = fac_config[1], cooling = fac_config[2] }
+
+                                        ---@todo unit options
+                                        iocontrol.init_fac(conf, 1)
+
+                                        log.info("coordinator connection established")
+                                        self.establish_delay_counter = 0
+                                        self.api.linked = true
+                                        self.api.addr = src_addr
+
+                                        if self.sv.linked then
+                                            iocontrol.report_link_state(LINK_STATE.LINKED, self.sv.addr, self.api.addr)
+                                        else
+                                            iocontrol.report_link_state(LINK_STATE.API_LINK_ONLY)
+                                        end
+                                    else
+                                        log.debug("invalid facility configuration table received from coordinator, establish failed")
+                                    end
                                 else
-                                    coreio.report_link_state(LINK_STATE.API_LINK_ONLY)
+                                    log.debug("received coordinator establish allow without facility configuration")
                                 end
                             elseif est_ack == ESTABLISH_ACK.DENY then
                                 if self.api.last_est_ack ~= est_ack then
@@ -263,40 +402,15 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                                 if self.api.last_est_ack ~= est_ack then
                                     log.info("coordinator comms version mismatch")
                                 end
+                            elseif est_ack == ESTABLISH_ACK.BAD_API_VERSION then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator api version mismatch")
+                                end
                             else
                                 log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
                             end
 
                             self.api.last_est_ack = est_ack
-                        else
-                            log.debug("coordinator SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.api.linked then
-                        if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-                            -- keep alive request received, echo back
-                            if packet.length == 1 then
-                                local timestamp = packet.data[1]
-                                local trip_time = util.time() - timestamp
-
-                                if trip_time > 750 then
-                                    log.warning("pocket coordinator KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
-                                end
-
-                                -- log.debug("pocket coordinator RTT = " .. trip_time .. "ms")
-
-                                _send_api_keep_alive_ack(timestamp)
-                            else
-                                log.debug("coordinator SCADA keep alive packet length mismatch")
-                            end
-                        elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
-                            -- handle session close
-                            api_watchdog.cancel()
-                            self.api.linked = false
-                            self.api.r_seq_num = nil
-                            self.api.addr = comms.BROADCAST
-                            log.info("coordinator server connection closed by remote host")
-                        else
-                            log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from coordinator")
                         end
                     else
                         log.debug("discarding coordinator non-link SCADA_MGMT packet before linked")
@@ -304,7 +418,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 else
                     log.debug("illegal packet type " .. protocol .. " from coordinator", true)
                 end
-            elseif r_chan == svr_channel then
+            elseif r_chan == config.SVR_Channel then
                 -- check sequence number
                 if self.sv.r_seq_num == nil then
                     self.sv.r_seq_num = packet.scada_frame.seq_num()
@@ -325,9 +439,77 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 -- handle packet
                 if protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if self.sv.linked then
+                        if packet.type == MGMT_TYPE.KEEP_ALIVE then
+                            -- keep alive request received, echo back
+                            if _check_length(packet, 1) then
+                                local timestamp = packet.data[1]
+                                local trip_time = util.time() - timestamp
+
+                                if trip_time > 750 then
+                                    log.warning("pocket supervisor KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
+                                end
+
+                                -- log.debug("pocket supervisor TT = " .. trip_time .. "ms")
+
+                                _send_sv_keep_alive_ack(timestamp)
+
+                                iocontrol.report_svr_tt(trip_time)
+                            end
+                        elseif packet.type == MGMT_TYPE.CLOSE then
+                            -- handle session close
+                            sv_watchdog.cancel()
+                            self.sv.linked = false
+                            self.sv.r_seq_num = nil
+                            self.sv.addr = comms.BROADCAST
+                            log.info("supervisor server connection closed by remote host")
+                        elseif packet.type == MGMT_TYPE.DIAG_TONE_GET then
+                            if _check_length(packet, 8) then
+                                for i = 1, #packet.data do
+                                    diag.tone_test.tone_indicators[i].update(packet.data[i] == true)
+                                end
+                            end
+                        elseif packet.type == MGMT_TYPE.DIAG_TONE_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag tone set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.tone_buttons[i] ~= nil then
+                                        diag.tone_test.tone_buttons[i].set_value(states[i] == true)
+                                        diag.tone_test.tone_indicators[i].update(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag tone set packet length/type mismatch")
+                            end
+                        elseif packet.type == MGMT_TYPE.DIAG_ALARM_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag alarm set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.alarm_buttons[i] ~= nil then
+                                        diag.tone_test.alarm_buttons[i].set_value(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag alarm set packet length/type mismatch")
+                            end
+                        else _fail_type(packet) end
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- connection with supervisor established
-                        if packet.length == 1 then
+                        if _check_length(packet, 1) then
                             local est_ack = packet.data[1]
 
                             if est_ack == ESTABLISH_ACK.ALLOW then
@@ -337,9 +519,9 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                                 self.sv.addr = src_addr
 
                                 if self.api.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
+                                    iocontrol.report_link_state(LINK_STATE.LINKED, self.sv.addr, self.api.addr)
                                 else
-                                    coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
+                                    iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
                                 end
                             elseif est_ack == ESTABLISH_ACK.DENY then
                                 if self.sv.last_est_ack ~= est_ack then
@@ -358,42 +540,11 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                             end
 
                             self.sv.last_est_ack = est_ack
-                        else
-                            log.debug("supervisor SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.sv.linked then
-                        if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-                            -- keep alive request received, echo back
-                            if packet.length == 1 then
-                                local timestamp = packet.data[1]
-                                local trip_time = util.time() - timestamp
-
-                                if trip_time > 750 then
-                                    log.warning("pocket supervisor KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
-                                end
-
-                                -- log.debug("pocket supervisor RTT = " .. trip_time .. "ms")
-
-                                _send_sv_keep_alive_ack(timestamp)
-                            else
-                                log.debug("supervisor SCADA keep alive packet length mismatch")
-                            end
-                        elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
-                            -- handle session close
-                            sv_watchdog.cancel()
-                            self.sv.linked = false
-                            self.sv.r_seq_num = nil
-                            self.sv.addr = comms.BROADCAST
-                            log.info("supervisor server connection closed by remote host")
-                        else
-                            log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from supervisor")
                         end
                     else
                         log.debug("discarding supervisor non-link SCADA_MGMT packet before linked")
                     end
-                else
-                    log.debug("illegal packet type " .. protocol .. " from supervisor", true)
-                end
+                else _fail_type(packet) end
             else
                 log.debug("received packet from unconfigured channel " .. r_chan, true)
             end
@@ -411,5 +562,4 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
     return public
 end
 
-
 return pocket

pocket/renderer.lua

@@ -5,18 +5,23 @@
 local main_view  = require("pocket.ui.main")
 local style      = require("pocket.ui.style")
 
+local core       = require("graphics.core")
 local flasher    = require("graphics.flasher")
 
 local DisplayBox = require("graphics.elements.displaybox")
 
+---@class pocket_renderer
 local renderer = {}
 
 local ui = {
     display = nil
 }
 
--- start the pocket GUI
-function renderer.start_ui()
+-- try to start the pocket GUI
+---@return boolean success, any error_msg
+function renderer.try_start_ui()
+    local status, msg = true, nil
+
     if ui.display == nil then
         -- reset screen
         term.setTextColor(colors.white)
@@ -30,12 +35,22 @@ function renderer.start_ui()
         end
 
         -- init front panel view
-        ui.display = DisplayBox{window=term.current(),fg_bg=style.root}
-        main_view(ui.display)
+        status, msg = pcall(function ()
+            ui.display = DisplayBox{window=term.current(),fg_bg=style.root}
+            main_view(ui.display)
+        end)
 
-        -- start flasher callback task
-        flasher.run()
+        if status then
+            -- start flasher callback task
+            flasher.run()
+        else
+            -- report fail and close ui
+            msg = core.extract_assert_msg(msg)
+            renderer.close_ui()
+        end
     end
+
+    return status, msg
 end
 
 -- close out the UI

pocket/startup.lua

@@ -4,53 +4,57 @@
 
 require("/initenv").init_env()
 
-local crash    = require("scada-common.crash")
-local log      = require("scada-common.log")
-local network  = require("scada-common.network")
-local ppm      = require("scada-common.ppm")
-local tcd      = require("scada-common.tcd")
-local util     = require("scada-common.util")
+local crash     = require("scada-common.crash")
+local log       = require("scada-common.log")
+local network   = require("scada-common.network")
+local ppm       = require("scada-common.ppm")
+local tcd       = require("scada-common.tcd")
+local util      = require("scada-common.util")
 
-local core     = require("graphics.core")
+local core      = require("graphics.core")
 
-local config   = require("pocket.config")
-local coreio   = require("pocket.coreio")
-local pocket   = require("pocket.pocket")
-local renderer = require("pocket.renderer")
+local configure = require("pocket.configure")
+local iocontrol = require("pocket.iocontrol")
+local pocket    = require("pocket.pocket")
+local renderer  = require("pocket.renderer")
 
-local POCKET_VERSION = "alpha-v0.5.2"
+local POCKET_VERSION = "v0.9.1-alpha"
 
 local println = util.println
 local println_ts = util.println_ts
 
 ----------------------------------------
--- config validation
+-- get configuration
 ----------------------------------------
 
-local cfv = util.new_validator()
+if not pocket.load_config() then
+    -- try to reconfigure (user action)
+    local success, error = configure.configure(true)
+    if success then
+        if not pocket.load_config() then
+            println("failed to load a valid configuration, please reconfigure")
+            return
+        end
+    else
+        println("configuration error: " .. error)
+        return
+    end
+end
 
-cfv.assert_channel(config.SVR_CHANNEL)
-cfv.assert_channel(config.CRD_CHANNEL)
-cfv.assert_channel(config.PKT_CHANNEL)
-cfv.assert_type_int(config.TRUSTED_RANGE)
-cfv.assert_type_num(config.COMMS_TIMEOUT)
-cfv.assert_min(config.COMMS_TIMEOUT, 2)
-cfv.assert_type_str(config.LOG_PATH)
-cfv.assert_type_int(config.LOG_MODE)
-
-assert(cfv.valid(), "bad config file: missing/invalid fields")
+local config = pocket.config
 
 ----------------------------------------
 -- log init
 ----------------------------------------
 
-log.init(config.LOG_PATH, config.LOG_MODE, config.LOG_DEBUG == true)
+log.init(config.LogPath, config.LogMode, config.LogDebug)
 
 log.info("========================================")
 log.info("BOOTING pocket.startup " .. POCKET_VERSION)
 log.info("========================================")
 
 crash.set_env("pocket", POCKET_VERSION)
+crash.dbg_log_env()
 
 ----------------------------------------
 -- main application
@@ -64,16 +68,19 @@ local function main()
     -- mount connected devices
     ppm.mount_all()
 
+    -- record version for GUI
+    iocontrol.get_db().version = POCKET_VERSION
+
     ----------------------------------------
     -- setup communications & clocks
     ----------------------------------------
 
     -- message authentication init
-    if type(config.AUTH_KEY) == "string" then
-        network.init_mac(config.AUTH_KEY)
+    if type(config.AuthKey) == "string" and string.len(config.AuthKey) > 0 then
+        network.init_mac(config.AuthKey)
     end
 
-    coreio.report_link_state(coreio.LINK_STATE.UNLINKED)
+    iocontrol.report_link_state(iocontrol.LINK_STATE.UNLINKED)
 
     -- get the communications modem
     local modem = ppm.get_wireless_modem()
@@ -85,8 +92,8 @@ local function main()
 
     -- create connection watchdogs
     local conn_wd = {
-        sv = util.new_watchdog(config.COMMS_TIMEOUT),
-        api = util.new_watchdog(config.COMMS_TIMEOUT)
+        sv = util.new_watchdog(config.ConnTimeout),
+        api = util.new_watchdog(config.ConnTimeout)
     }
 
     conn_wd.sv.cancel()
@@ -96,21 +103,22 @@ local function main()
 
     -- create network interface then setup comms
     local nic = network.nic(modem)
-    local pocket_comms = pocket.comms(POCKET_VERSION, nic, config.PKT_CHANNEL, config.SVR_CHANNEL,
-                                        config.CRD_CHANNEL, config.TRUSTED_RANGE, conn_wd.sv, conn_wd.api)
+    local pocket_comms = pocket.comms(POCKET_VERSION, nic, conn_wd.sv, conn_wd.api)
     log.debug("startup> comms init")
 
     -- base loop clock (2Hz, 10 ticks)
     local MAIN_CLOCK = 0.5
     local loop_clock = util.new_clock(MAIN_CLOCK)
 
+    -- init I/O control
+    iocontrol.init_core(pocket_comms)
+
     ----------------------------------------
     -- start the UI
     ----------------------------------------
 
-    local ui_ok, message = pcall(renderer.start_ui)
+    local ui_ok, message = renderer.try_start_ui()
     if not ui_ok then
-        renderer.close_ui()
         println(util.c("UI error: ", message))
         log.error(util.c("startup> GUI render failed with error ", message))
     else
@@ -126,7 +134,10 @@ local function main()
         -- start connection watchdogs
         conn_wd.sv.feed()
         conn_wd.api.feed()
-        log.debug("startup> conn watchdog started")
+        log.debug("startup> conn watchdogs started")
+
+        local io_db = iocontrol.get_db()
+        local nav   = io_db.nav
 
         -- main event loop
         while true do
@@ -140,6 +151,10 @@ local function main()
                     -- relink if necessary
                     pocket_comms.link_update()
 
+                    -- update any tasks for the active page
+                    local page_tasks = nav.get_current_page().tasks
+                    for i = 1, #page_tasks do page_tasks[i]() end
+
                     loop_clock.start()
                 elseif conn_wd.sv.is_timer(param1) then
                     -- supervisor watchdog timeout
@@ -158,7 +173,8 @@ local function main()
                 -- got a packet
                 local packet = pocket_comms.parse_packet(param1, param2, param3, param4, param5)
                 pocket_comms.handle_packet(packet)
-            elseif event == "mouse_click" or event == "mouse_up" or event == "mouse_drag" or event == "mouse_scroll" then
+            elseif event == "mouse_click" or event == "mouse_up" or event == "mouse_drag" or event == "mouse_scroll" or
+                   event == "double_click" then
                 -- handle a monitor touch event
                 renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
             end

pocket/ui/apps/diag_apps.lua

@@ -0,0 +1,116 @@
+--
+-- Diagnostic Apps
+--
+
+local iocontrol      = require("pocket.iocontrol")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local TextBox        = require("graphics.elements.textbox")
+
+local IndicatorLight = require("graphics.elements.indicators.light")
+
+local Checkbox       = require("graphics.elements.controls.checkbox")
+local PushButton     = require("graphics.elements.controls.push_button")
+local SwitchButton   = require("graphics.elements.controls.switch_button")
+
+local cpair = core.cpair
+
+local ALIGN = core.ALIGN
+
+-- create diagnostic app pages
+---@param root graphics_element parent
+local function create_pages(root)
+    local db = iocontrol.get_db()
+
+    ------------------------
+    -- Alarm Testing Page --
+    ------------------------
+
+    local alarm_test = Div{parent=root,x=1,y=1}
+
+    local alarm_app = db.nav.register_app(iocontrol.APP_ID.ALARMS, alarm_test)
+
+    local page = alarm_app.new_page(nil, function () end)
+    page.tasks = { db.diag.tone_test.get_tone_states }
+
+    local ttest = db.diag.tone_test
+
+    local c_wht_gray = cpair(colors.white, colors.gray)
+    local c_red_gray = cpair(colors.red, colors.gray)
+    local c_yel_gray = cpair(colors.yellow, colors.gray)
+    local c_blue_gray = cpair(colors.blue, colors.gray)
+
+    local audio = Div{parent=alarm_test,x=1,y=1}
+
+    TextBox{parent=audio,y=1,text="Alarm Sounder Tests",height=1,alignment=ALIGN.CENTER}
+
+    ttest.ready_warn = TextBox{parent=audio,y=2,text="",height=1,alignment=ALIGN.CENTER,fg_bg=cpair(colors.yellow,colors.black)}
+
+    local tones = Div{parent=audio,x=2,y=3,height=10,width=8,fg_bg=cpair(colors.black,colors.yellow)}
+
+    TextBox{parent=tones,text="Tones",height=1,alignment=ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local test_btns = {}
+    test_btns[1] = SwitchButton{parent=tones,text="TEST 1",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_1}
+    test_btns[2] = SwitchButton{parent=tones,text="TEST 2",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_2}
+    test_btns[3] = SwitchButton{parent=tones,text="TEST 3",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_3}
+    test_btns[4] = SwitchButton{parent=tones,text="TEST 4",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_4}
+    test_btns[5] = SwitchButton{parent=tones,text="TEST 5",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_5}
+    test_btns[6] = SwitchButton{parent=tones,text="TEST 6",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_6}
+    test_btns[7] = SwitchButton{parent=tones,text="TEST 7",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_7}
+    test_btns[8] = SwitchButton{parent=tones,text="TEST 8",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_8}
+
+    ttest.tone_buttons = test_btns
+
+    local function stop_all_tones()
+        for i = 1, #test_btns do test_btns[i].set_value(false) end
+        ttest.stop_tones()
+    end
+
+    PushButton{parent=tones,text="STOP",min_width=8,active_fg_bg=c_wht_gray,fg_bg=cpair(colors.black,colors.red),callback=stop_all_tones}
+
+    local alarms = Div{parent=audio,x=11,y=3,height=15,fg_bg=cpair(colors.lightGray,colors.black)}
+
+    TextBox{parent=alarms,text="Alarms (\x13)",height=1,alignment=ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local alarm_btns = {}
+    alarm_btns[1] = Checkbox{parent=alarms,label="BREACH",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_breach}
+    alarm_btns[2] = Checkbox{parent=alarms,label="RADIATION",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_rad}
+    alarm_btns[3] = Checkbox{parent=alarms,label="RCT LOST",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_lost}
+    alarm_btns[4] = Checkbox{parent=alarms,label="CRIT DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_crit}
+    alarm_btns[5] = Checkbox{parent=alarms,label="DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_dmg}
+    alarm_btns[6] = Checkbox{parent=alarms,label="OVER TEMP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_overtemp}
+    alarm_btns[7] = Checkbox{parent=alarms,label="HIGH TEMP",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_hightemp}
+    alarm_btns[8] = Checkbox{parent=alarms,label="WASTE LEAK",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_wasteleak}
+    alarm_btns[9] = Checkbox{parent=alarms,label="WASTE HIGH",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_highwaste}
+    alarm_btns[10] = Checkbox{parent=alarms,label="RPS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rps}
+    alarm_btns[11] = Checkbox{parent=alarms,label="RCS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rcs}
+    alarm_btns[12] = Checkbox{parent=alarms,label="TURBINE TRP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_turbinet}
+
+    ttest.alarm_buttons = alarm_btns
+
+    local function stop_all_alarms()
+        for i = 1, #alarm_btns do alarm_btns[i].set_value(false) end
+        ttest.stop_alarms()
+    end
+
+    PushButton{parent=alarms,x=3,y=15,text="STOP \x13",min_width=8,fg_bg=cpair(colors.black,colors.red),active_fg_bg=c_wht_gray,callback=stop_all_alarms}
+
+    local states = Div{parent=audio,x=2,y=14,height=5,width=8}
+
+    TextBox{parent=states,text="States",height=1,alignment=ALIGN.CENTER}
+    local t_1 = IndicatorLight{parent=states,label="1",colors=c_blue_gray}
+    local t_2 = IndicatorLight{parent=states,label="2",colors=c_blue_gray}
+    local t_3 = IndicatorLight{parent=states,label="3",colors=c_blue_gray}
+    local t_4 = IndicatorLight{parent=states,label="4",colors=c_blue_gray}
+    local t_5 = IndicatorLight{parent=states,x=6,y=2,label="5",colors=c_blue_gray}
+    local t_6 = IndicatorLight{parent=states,x=6,label="6",colors=c_blue_gray}
+    local t_7 = IndicatorLight{parent=states,x=6,label="7",colors=c_blue_gray}
+    local t_8 = IndicatorLight{parent=states,x=6,label="8",colors=c_blue_gray}
+
+    ttest.tone_indicators = { t_1, t_2, t_3, t_4, t_5, t_6, t_7, t_8 }
+end
+
+return create_pages

pocket/ui/apps/dummy_app.lua

@@ -0,0 +1,26 @@
+--
+-- Placeholder App
+--
+
+local iocontrol = require("pocket.iocontrol")
+
+local core      = require("graphics.core")
+
+local Div       = require("graphics.elements.div")
+local TextBox   = require("graphics.elements.textbox")
+
+-- create placeholder app page
+---@param root graphics_element parent
+local function create_pages(root)
+    local db = iocontrol.get_db()
+
+    local main = Div{parent=root,x=1,y=1}
+
+    db.nav.register_app(iocontrol.APP_ID.DUMMY, main).new_page(nil, function () end)
+
+    TextBox{parent=main,text="This app is not implemented yet.",x=1,y=2,alignment=core.ALIGN.CENTER}
+
+    TextBox{parent=main,text=" pretend something  cool is here \x03",x=1,y=10,alignment=core.ALIGN.CENTER,fg_bg=core.cpair(colors.gray,colors.black)}
+end
+
+return create_pages

pocket/ui/apps/sys_apps.lua

@@ -0,0 +1,145 @@
+--
+-- System Apps
+--
+
+local comms      = require("scada-common.comms")
+local util       = require("scada-common.util")
+
+local lockbox    = require("lockbox")
+
+local iocontrol  = require("pocket.iocontrol")
+local pocket     = require("pocket.pocket")
+
+local core       = require("graphics.core")
+
+local Div        = require("graphics.elements.div")
+local ListBox    = require("graphics.elements.listbox")
+local MultiPane  = require("graphics.elements.multipane")
+local TextBox    = require("graphics.elements.textbox")
+
+local PushButton = require("graphics.elements.controls.push_button")
+
+local cpair = core.cpair
+
+local ALIGN = core.ALIGN
+
+-- create system app pages
+---@param root graphics_element parent
+local function create_pages(root)
+    local db = iocontrol.get_db()
+
+    ----------------
+    -- About Page --
+    ----------------
+
+    local about_root = Div{parent=root,x=1,y=1}
+
+    local about_app = db.nav.register_app(iocontrol.APP_ID.ABOUT, about_root)
+
+    local about_page = about_app.new_page(nil, 1)
+    local nt_page = about_app.new_page(about_page, 2)
+    local fw_page = about_app.new_page(about_page, 3)
+    local hw_page = about_app.new_page(about_page, 4)
+
+    local about = Div{parent=about_root,x=1,y=2}
+
+    TextBox{parent=about,y=1,text="System Information",height=1,alignment=ALIGN.CENTER}
+
+    local btn_fg_bg = cpair(colors.lightBlue, colors.black)
+    local btn_active = cpair(colors.white, colors.black)
+    local label = cpair(colors.lightGray, colors.black)
+
+    PushButton{parent=about,x=2,y=3,text="Network             >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=nt_page.nav_to}
+    PushButton{parent=about,x=2,y=4,text="Firmware            >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=fw_page.nav_to}
+    PushButton{parent=about,x=2,y=5,text="Host Details        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=hw_page.nav_to}
+
+    --#region Network Details
+
+    local config = pocket.config
+
+    local nt_div = Div{parent=about_root,x=1,y=2}
+    TextBox{parent=nt_div,y=1,text="Network Details",height=1,alignment=ALIGN.CENTER}
+
+    PushButton{parent=nt_div,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=about_page.nav_to}
+
+    TextBox{parent=nt_div,x=2,y=3,text="Pocket Address",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+---@diagnostic disable-next-line: undefined-field
+    TextBox{parent=nt_div,x=2,text=util.c(os.getComputerID(),":",config.PKT_Channel),height=1,alignment=ALIGN.LEFT}
+
+    nt_div.line_break()
+    TextBox{parent=nt_div,x=2,text="Supervisor Address",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    local sv = TextBox{parent=nt_div,x=2,text="",height=1,alignment=ALIGN.LEFT}
+
+    nt_div.line_break()
+    TextBox{parent=nt_div,x=2,text="Coordinator Address",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    local coord = TextBox{parent=nt_div,x=2,text="",height=1,alignment=ALIGN.LEFT}
+
+    sv.register(db.ps, "sv_addr", function (addr) sv.set_value(util.c(addr, ":", config.SVR_Channel)) end)
+    coord.register(db.ps, "api_addr", function (addr) coord.set_value(util.c(addr, ":", config.CRD_Channel)) end)
+
+    nt_div.line_break()
+    TextBox{parent=nt_div,x=2,text="Message Authentication",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    local auth = util.trinary(type(config.AuthKey) == "string" and string.len(config.AuthKey) > 0, "HMAC-MD5", "None")
+    TextBox{parent=nt_div,x=2,text=auth,height=1,alignment=ALIGN.LEFT}
+
+    --#endregion
+
+    --#region Firmware Versions
+
+    local fw_div = Div{parent=about_root,x=1,y=2}
+    TextBox{parent=fw_div,y=1,text="Firmware Versions",height=1,alignment=ALIGN.CENTER}
+
+    PushButton{parent=fw_div,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=about_page.nav_to}
+
+    local fw_list_box = ListBox{parent=fw_div,x=1,y=3,scroll_height=100,nav_fg_bg=cpair(colors.lightGray,colors.gray),nav_active=cpair(colors.white,colors.gray)}
+
+    local fw_list = Div{parent=fw_list_box,x=1,y=2,height=18}
+
+    TextBox{parent=fw_list,x=2,text="Pocket Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=db.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Comms Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=comms.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="API Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=comms.api_version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Common Lib Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=util.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Graphics Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=core.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Lockbox Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=lockbox.version,height=1,alignment=ALIGN.LEFT}
+
+    --#endregion
+
+    --#region Host Versions
+
+    local hw_div = Div{parent=about_root,x=1,y=2}
+    TextBox{parent=hw_div,y=1,text="Host Versions",height=1,alignment=ALIGN.CENTER}
+
+    PushButton{parent=hw_div,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=about_page.nav_to}
+
+    hw_div.line_break()
+    TextBox{parent=hw_div,x=2,text="Lua Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=hw_div,x=2,text=_VERSION,height=1,alignment=ALIGN.LEFT}
+
+    hw_div.line_break()
+    TextBox{parent=hw_div,x=2,text="Environment",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=hw_div,x=2,text=_HOST,height=6,alignment=ALIGN.LEFT}
+
+    --#endregion
+
+    local root_pane = MultiPane{parent=about_root,x=1,y=1,panes={about,nt_div,fw_div,hw_div}}
+
+    about_app.set_root_pane(root_pane)
+end
+
+return create_pages

pocket/ui/components/conn_waiting.lua

@@ -11,7 +11,7 @@ local TextBox     = require("graphics.elements.textbox")
 
 local WaitingAnim = require("graphics.elements.animations.waiting")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 
@@ -29,10 +29,10 @@ local function init(parent, y, is_api)
 
     if is_api then
         WaitingAnim{parent=box,x=waiting_x,y=1,fg_bg=cpair(colors.blue,style.root.bkg)}
-        TextBox{parent=box,text="Connecting to API",alignment=TEXT_ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
+        TextBox{parent=box,text="Connecting to API",alignment=ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
     else
         WaitingAnim{parent=box,x=waiting_x,y=1,fg_bg=cpair(colors.green,style.root.bkg)}
-        TextBox{parent=box,text="Connecting to Supervisor",alignment=TEXT_ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
+        TextBox{parent=box,text="Connecting to Supervisor",alignment=ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
     end
 
     return root

pocket/ui/main.lua

@@ -2,17 +2,18 @@
 -- Pocket GUI Root
 --
 
-local coreio        = require("pocket.coreio")
+local iocontrol    = require("pocket.iocontrol")
 
-local style        = require("pocket.ui.style")
+local diag_apps    = require("pocket.ui.apps.diag_apps")
+local dummy_app    = require("pocket.ui.apps.dummy_app")
+local sys_apps     = require("pocket.ui.apps.sys_apps")
 
 local conn_waiting = require("pocket.ui.components.conn_waiting")
 
 local home_page    = require("pocket.ui.pages.home_page")
 local unit_page    = require("pocket.ui.pages.unit_page")
-local reactor_page = require("pocket.ui.pages.reactor_page")
-local boiler_page  = require("pocket.ui.pages.boiler_page")
-local turbine_page = require("pocket.ui.pages.turbine_page")
+
+local style        = require("pocket.ui.style")
 
 local core         = require("graphics.core")
 
@@ -20,80 +21,73 @@ local Div          = require("graphics.elements.div")
 local MultiPane    = require("graphics.elements.multipane")
 local TextBox      = require("graphics.elements.textbox")
 
+local PushButton   = require("graphics.elements.controls.push_button")
 local Sidebar      = require("graphics.elements.controls.sidebar")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local SignalBar    = require("graphics.elements.indicators.signal")
+
+local LINK_STATE = iocontrol.LINK_STATE
+
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 
 -- create new main view
 ---@param main graphics_element main displaybox
 local function init(main)
-    -- window header message
-    TextBox{parent=main,y=1,text="",alignment=TEXT_ALIGN.LEFT,height=1,fg_bg=style.header}
+    local db = iocontrol.get_db()
 
-    --
-    -- root panel panes (connection screens + main screen)
-    --
+    -- window header message
+    TextBox{parent=main,y=1,text="WIP ALPHA APP      S   C   ",alignment=ALIGN.LEFT,height=1,fg_bg=style.header}
+    local svr_conn = SignalBar{parent=main,y=1,x=22,compact=true,colors_low_med=cpair(colors.red,colors.yellow),disconnect_color=colors.lightGray,fg_bg=cpair(colors.green,colors.gray)}
+    local crd_conn = SignalBar{parent=main,y=1,x=26,compact=true,colors_low_med=cpair(colors.red,colors.yellow),disconnect_color=colors.lightGray,fg_bg=cpair(colors.green,colors.gray)}
+
+    db.ps.subscribe("svr_conn_quality", svr_conn.set_value)
+    db.ps.subscribe("crd_conn_quality", crd_conn.set_value)
+
+    --#region root panel panes (connection screens + main screen)
 
     local root_pane_div = Div{parent=main,x=1,y=2}
 
     local conn_sv_wait = conn_waiting(root_pane_div, 6, false)
     local conn_api_wait = conn_waiting(root_pane_div, 6, true)
     local main_pane = Div{parent=main,x=1,y=2}
-    local root_panes = { conn_sv_wait, conn_api_wait, main_pane }
 
-    local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes=root_panes}
+    local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes={conn_sv_wait,conn_api_wait,main_pane}}
 
-    root_pane.register(coreio.core_ps(), "link_state", function (state)
-        if state == coreio.LINK_STATE.UNLINKED or state == coreio.LINK_STATE.API_LINK_ONLY then
+    root_pane.register(db.ps, "link_state", function (state)
+        if state == LINK_STATE.UNLINKED or state == LINK_STATE.API_LINK_ONLY then
             root_pane.set_value(1)
-        elseif state == coreio.LINK_STATE.SV_LINK_ONLY then
+        elseif state == LINK_STATE.SV_LINK_ONLY then
             root_pane.set_value(2)
         else
             root_pane.set_value(3)
         end
     end)
 
-    --
-    -- main page panel panes & sidebar
-    --
+    --#endregion
+
+    --#region main page panel panes & sidebar
 
     local page_div = Div{parent=main_pane,x=4,y=1}
 
-    local sidebar_tabs = {
-        {
-            char = "#",
-            color = cpair(colors.black,colors.green)
-        },
-        {
-            char = "U",
-            color = cpair(colors.black,colors.yellow)
-        },
-        {
-            char = "R",
-            color = cpair(colors.black,colors.cyan)
-        },
-        {
-            char = "B",
-            color = cpair(colors.black,colors.lightGray)
-        },
-        {
-            char = "T",
-            color = cpair(colors.black,colors.white)
-        }
-    }
+    home_page(page_div)
+    unit_page(page_div)
 
-    local pane_1 = home_page(page_div)
-    local pane_2 = unit_page(page_div)
-    local pane_3 = reactor_page(page_div)
-    local pane_4 = boiler_page(page_div)
-    local pane_5 = turbine_page(page_div)
-    local panes = { pane_1, pane_2, pane_3, pane_4, pane_5 }
+    diag_apps(page_div)
+    sys_apps(page_div)
+    dummy_app(page_div)
 
-    local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
+    assert(#db.nav.get_containers() == iocontrol.APP_ID.NUM_APPS, "app IDs were not sequential or some apps weren't registered")
 
-    Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=page_pane.set_value}
+    db.nav.set_pane(MultiPane{parent=page_div,x=1,y=1,panes=db.nav.get_containers()})
+    db.nav.set_sidebar(Sidebar{parent=main_pane,x=1,y=1,height=18,fg_bg=cpair(colors.white,colors.gray)})
+
+    PushButton{parent=main_pane,x=1,y=19,text="\x1b",min_width=3,fg_bg=cpair(colors.white,colors.gray),active_fg_bg=cpair(colors.gray,colors.black),callback=db.nav.nav_up}
+
+    db.nav.open_app(iocontrol.APP_ID.ROOT)
+
+    --#endregion
 end
 
 return init

pocket/ui/pages/boiler_page.lua

@@ -1,22 +0,0 @@
--- local style   = require("pocket.ui.style")
-
-local core    = require("graphics.core")
-
-local Div     = require("graphics.elements.div")
-local TextBox = require("graphics.elements.textbox")
-
--- local cpair = core.cpair
-
-local TEXT_ALIGN = core.TEXT_ALIGN
-
--- new boiler page view
----@param root graphics_element parent
-local function new_view(root)
-    local main = Div{parent=root,x=1,y=1}
-
-    TextBox{parent=main,text="BOILERS",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
-
-    return main
-end
-
-return new_view

pocket/ui/pages/home_page.lua

@@ -1,20 +1,64 @@
--- local style   = require("pocket.ui.style")
+--
+-- Main Home Page
+--
 
-local core    = require("graphics.core")
+local iocontrol    = require("pocket.iocontrol")
 
-local Div     = require("graphics.elements.div")
-local TextBox = require("graphics.elements.textbox")
+local core         = require("graphics.core")
 
--- local cpair = core.cpair
+local AppMultiPane = require("graphics.elements.appmultipane")
+local Div          = require("graphics.elements.div")
+local TextBox      = require("graphics.elements.textbox")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local App          = require("graphics.elements.controls.app")
+
+local cpair = core.cpair
+
+local APP_ID = iocontrol.APP_ID
+
+local ALIGN = core.ALIGN
 
 -- new home page view
 ---@param root graphics_element parent
 local function new_view(root)
-    local main = Div{parent=root,x=1,y=1}
+    local db = iocontrol.get_db()
 
-    TextBox{parent=main,text="HOME",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
+    local main = Div{parent=root,x=1,y=1,height=19}
+
+    local app = db.nav.register_app(iocontrol.APP_ID.ROOT, main)
+
+    local apps_1 = Div{parent=main,x=1,y=1,height=15}
+    local apps_2 = Div{parent=main,x=1,y=1,height=15}
+
+    local panes = { apps_1, apps_2 }
+
+    local app_pane = AppMultiPane{parent=main,x=1,y=1,height=18,panes=panes,active_color=colors.lightGray,nav_colors=cpair(colors.lightGray,colors.gray),scroll_nav=true,drag_nav=true,callback=app.switcher}
+
+    app.set_root_pane(app_pane)
+    app.new_page(app.new_page(nil, 1), 2)
+
+    local function open(id) db.nav.open_app(id) end
+
+    app.set_sidebar({
+        { label = " #\x10", tall = true, color = core.cpair(colors.black, colors.green), callback = function () open(APP_ID.ROOT) end }
+    })
+
+    local active_fg_bg = cpair(colors.white,colors.gray)
+
+    App{parent=apps_1,x=2,y=2,text="U",title="Units",callback=function()open(APP_ID.UNITS)end,app_fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=active_fg_bg}
+    App{parent=apps_1,x=9,y=2,text="F",title="Facil",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.orange),active_fg_bg=active_fg_bg}
+    App{parent=apps_1,x=16,y=2,text="\x15",title="Control",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.green),active_fg_bg=active_fg_bg}
+    App{parent=apps_1,x=2,y=7,text="\x17",title="Process",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.purple),active_fg_bg=active_fg_bg}
+    App{parent=apps_1,x=9,y=7,text="\x7f",title="Waste",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.brown),active_fg_bg=active_fg_bg}
+    App{parent=apps_1,x=16,y=7,text="\x08",title="Devices",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.lightGray),active_fg_bg=active_fg_bg}
+    App{parent=apps_1,x=2,y=12,text="\xb6",title="Guide",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.cyan),active_fg_bg=active_fg_bg}
+    App{parent=apps_1,x=9,y=12,text="?",title="About",callback=function()open(APP_ID.ABOUT)end,app_fg_bg=cpair(colors.black,colors.white),active_fg_bg=active_fg_bg}
+
+    TextBox{parent=apps_2,text="Diagnostic Apps",x=1,y=2,height=1,alignment=ALIGN.CENTER}
+
+    App{parent=apps_2,x=2,y=4,text="\x0f",title="Alarm",callback=function()open(APP_ID.ALARMS)end,app_fg_bg=cpair(colors.black,colors.red),active_fg_bg=active_fg_bg}
+    App{parent=apps_2,x=9,y=4,text="\x1e",title="LoopT",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.cyan),active_fg_bg=active_fg_bg}
+    App{parent=apps_2,x=16,y=4,text="@",title="Comps",callback=function()open(APP_ID.DUMMY)end,app_fg_bg=cpair(colors.black,colors.orange),active_fg_bg=active_fg_bg}
 
     return main
 end

pocket/ui/pages/reactor_page.lua

@@ -1,22 +0,0 @@
--- local style   = require("pocket.ui.style")
-
-local core    = require("graphics.core")
-
-local Div     = require("graphics.elements.div")
-local TextBox = require("graphics.elements.textbox")
-
--- local cpair = core.cpair
-
-local TEXT_ALIGN = core.TEXT_ALIGN
-
--- new reactor page view
----@param root graphics_element parent
-local function new_view(root)
-    local main = Div{parent=root,x=1,y=1}
-
-    TextBox{parent=main,text="REACTOR",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
-
-    return main
-end
-
-return new_view

pocket/ui/pages/turbine_page.lua

@@ -1,22 +0,0 @@
--- local style   = require("pocket.ui.style")
-
-local core    = require("graphics.core")
-
-local Div     = require("graphics.elements.div")
-local TextBox = require("graphics.elements.textbox")
-
--- local cpair = core.cpair
-
-local TEXT_ALIGN = core.TEXT_ALIGN
-
--- new turbine page view
----@param root graphics_element parent
-local function new_view(root)
-    local main = Div{parent=root,x=1,y=1}
-
-    TextBox{parent=main,text="TURBINES",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
-
-    return main
-end
-
-return new_view

pocket/ui/pages/unit_page.lua

@@ -1,20 +1,319 @@
--- local style   = require("pocket.ui.style")
+--
+-- Unit Overview Page
+--
 
-local core    = require("graphics.core")
+local util      = require("scada-common.util")
+-- local log       = require("scada-common.log")
 
-local Div     = require("graphics.elements.div")
-local TextBox = require("graphics.elements.textbox")
+local iocontrol = require("pocket.iocontrol")
 
--- local cpair = core.cpair
+local core      = require("graphics.core")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local Div       = require("graphics.elements.div")
+local MultiPane = require("graphics.elements.multipane")
+local TextBox   = require("graphics.elements.textbox")
+
+local DataIndicator     = require("graphics.elements.indicators.data")
+local IconIndicator     = require("graphics.elements.indicators.icon")
+-- local RadIndicator      = require("graphics.elements.indicators.rad")
+-- local VerticalBar       = require("graphics.elements.indicators.vbar")
+
+local PushButton        = require("graphics.elements.controls.push_button")
+
+local ALIGN = core.ALIGN
+local cpair = core.cpair
+
+local basic_states = {
+    { color = cpair(colors.black, colors.lightGray), symbol = "\x07" },
+    { color = cpair(colors.black, colors.red), symbol = "-" },
+    { color = cpair(colors.black, colors.yellow), symbol = "\x1e" },
+    { color = cpair(colors.black, colors.green), symbol = "+" }
+}
+
+local mode_states = {
+    { color = cpair(colors.black, colors.lightGray), symbol = "\x07" },
+    { color = cpair(colors.black, colors.red), symbol = "-" },
+    { color = cpair(colors.black, colors.green), symbol = "+" },
+    { color = cpair(colors.black, colors.purple), symbol = "A" }
+}
+
+local emc_ind_s = {
+    { color = cpair(colors.black, colors.gray), symbol = "-" },
+    { color = cpair(colors.black, colors.white), symbol = "\x07" },
+    { color = cpair(colors.black, colors.green), symbol = "+" }
+}
+
+local red_ind_s = {
+    { color = cpair(colors.black, colors.lightGray), symbol = "+" },
+    { color = cpair(colors.black, colors.red), symbol = "-" }
+}
+
+local yel_ind_s = {
+    { color = cpair(colors.black, colors.lightGray), symbol = "+" },
+    { color = cpair(colors.black, colors.yellow), symbol = "-" }
+}
 
 -- new unit page view
 ---@param root graphics_element parent
 local function new_view(root)
+    local db = iocontrol.get_db()
+
     local main = Div{parent=root,x=1,y=1}
 
-    TextBox{parent=main,text="UNITS",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
+    local app = db.nav.register_app(iocontrol.APP_ID.UNITS, main)
+
+    TextBox{parent=main,y=2,text="Units App",height=1,alignment=ALIGN.CENTER}
+
+    TextBox{parent=main,y=4,text="Loading...",height=1,alignment=ALIGN.CENTER}
+
+    local btn_fg_bg = cpair(colors.yellow, colors.black)
+    local btn_active = cpair(colors.white, colors.black)
+    -- local label = cpair(colors.lightGray, colors.black)
+
+    local nav_links = {}
+
+    local function set_sidebar(id)
+        -- local unit = db.units[id] ---@type pioctl_unit
+
+        local list = {
+            { label = " # ", tall = true, color = core.cpair(colors.black, colors.green), callback = function () db.nav.open_app(iocontrol.APP_ID.ROOT) end },
+            { label = "U-" .. id, color = core.cpair(colors.black, colors.yellow), callback = function () app.switcher(id) end },
+            { label = " \x13 ", color = core.cpair(colors.black, colors.red), callback = nav_links[id].alarm },
+            { label = "RPS", tall = true, color = core.cpair(colors.black, colors.cyan), callback = nav_links[id].rps },
+            -- { label = " R ", color = core.cpair(colors.black, colors.lightGray), callback = function () end },
+            { label = "RCS", tall = true, color = core.cpair(colors.black, colors.blue), callback = nav_links[id].rcs },
+        }
+
+        -- for i = 1, unit.num_boilers do
+        --     table.insert(list, { label = "B-" .. i, color = core.cpair(colors.black, colors.lightBlue), callback = function () end })
+        -- end
+
+        -- for i = 1, unit.num_turbines do
+        --     table.insert(list, { label = "T-" .. i, color = core.cpair(colors.black, colors.white), callback = function () end })
+        -- end
+
+        app.set_sidebar(list)
+    end
+
+    local function load()
+        local page_div = Div{parent=main,x=2,y=2,width=main.get_width()-2}
+
+        local panes = {}
+
+        local active_unit = 1
+
+        -- create all page divs
+        for _ = 1, db.facility.num_units do
+            local div = Div{parent=page_div}
+            table.insert(panes, div)
+            table.insert(nav_links, {})
+        end
+
+        -- previous unit
+        local function prev(x)
+            active_unit = util.trinary(x == 1, db.facility.num_units, x - 1)
+            app.switcher(active_unit)
+            set_sidebar(active_unit)
+        end
+
+        -- next unit
+        local function next(x)
+            active_unit = util.trinary(x == db.facility.num_units, 1, x + 1)
+            app.switcher(active_unit)
+            set_sidebar(active_unit)
+        end
+
+        for i = 1, db.facility.num_units do
+            local u_div = panes[i] ---@type graphics_element
+            local unit = db.units[i] ---@type pioctl_unit
+            local u_ps = unit.unit_ps
+
+            -- refresh data callback, every 500ms it will re-send the query
+            local last_update = 0
+            local function update()
+                if util.time_ms() - last_update >= 500 then
+                    db.api.get_unit(i)
+                    last_update = util.time_ms()
+                end
+            end
+
+            --#region Main Unit Overview
+
+            local u_page = app.new_page(nil, i)
+            u_page.tasks = { update }
+
+            TextBox{parent=u_div,y=1,text="Reactor Unit #"..i,height=1,alignment=ALIGN.CENTER}
+            PushButton{parent=u_div,x=1,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=function()prev(i)end}
+            PushButton{parent=u_div,x=21,y=1,text=">",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=function()next(i)end}
+
+            local type = util.trinary(unit.num_boilers > 0, "Sodium Cooled Reactor", "Boiling Water Reactor")
+            TextBox{parent=u_div,y=3,text=type,height=1,alignment=ALIGN.CENTER,fg_bg=cpair(colors.gray,colors.black)}
+
+            local lu_col = cpair(colors.lightGray, colors.lightGray)
+            local text_fg = cpair(colors.white, colors._INHERIT)
+
+            local rate = DataIndicator{parent=u_div,y=5,lu_colors=lu_col,label="Rate",unit="mB/t",format="%10.2f",value=0,commas=true,width=26,fg_bg=text_fg}
+            local temp = DataIndicator{parent=u_div,lu_colors=lu_col,label="Temp",unit="K",format="%10.2f",value=0,commas=true,width=26,fg_bg=text_fg}
+
+            local ctrl = IconIndicator{parent=u_div,x=1,y=8,label="Control State",states=mode_states}
+
+            rate.register(u_ps, "act_burn_rate", rate.update)
+            temp.register(u_ps, "temp", temp.update)
+            ctrl.register(u_ps, "U_ControlStatus", ctrl.update)
+
+            u_div.line_break()
+
+            local rct = IconIndicator{parent=u_div,x=1,label="Fission Reactor",states=basic_states}
+            local rps = IconIndicator{parent=u_div,x=1,label="Protection System",states=basic_states}
+
+            rct.register(u_ps, "U_ReactorStatus", rct.update)
+            rps.register(u_ps, "U_RPS", rps.update)
+
+            u_div.line_break()
+
+            local rcs = IconIndicator{parent=u_div,x=1,label="Coolant System",states=basic_states}
+            rcs.register(u_ps, "U_RCS", rcs.update)
+
+            for b = 1, unit.num_boilers do
+                local blr = IconIndicator{parent=u_div,x=1,label="Boiler "..b,states=basic_states}
+                blr.register(unit.boiler_ps_tbl[b], "BoilerStatus", blr.update)
+            end
+
+            for t = 1, unit.num_turbines do
+                local tbn = IconIndicator{parent=u_div,x=1,label="Turbine "..t,states=basic_states}
+                tbn.register(unit.turbine_ps_tbl[t], "TurbineStatus", tbn.update)
+            end
+
+            --#endregion
+
+            --#region Alarms Tab
+
+            local alm_div = Div{parent=page_div}
+            table.insert(panes, alm_div)
+
+            local alm_page = app.new_page(u_page, #panes)
+            alm_page.tasks = { update }
+
+            nav_links[i].alarm = alm_page.nav_to
+
+            TextBox{parent=alm_div,y=1,text="Unit Alarms",height=1,alignment=ALIGN.CENTER}
+
+            TextBox{parent=alm_div,y=3,text="work in progress",height=1,alignment=ALIGN.CENTER,fg_bg=cpair(colors.gray,colors.black)}
+
+            --#endregion
+
+            --#region RPS Tab
+
+            local rps_div = Div{parent=page_div}
+            table.insert(panes, rps_div)
+
+            local rps_page = app.new_page(u_page, #panes)
+            rps_page.tasks = { update }
+
+            nav_links[i].rps = rps_page.nav_to
+
+            TextBox{parent=rps_div,y=1,text="Protection System",height=1,alignment=ALIGN.CENTER}
+
+            local r_trip = IconIndicator{parent=rps_div,y=3,label="RPS Trip",states=basic_states}
+            r_trip.register(u_ps, "U_RPS", r_trip.update)
+
+            local r_mscrm = IconIndicator{parent=rps_div,y=5,label="Manual SCRAM",states=red_ind_s}
+            local r_ascrm = IconIndicator{parent=rps_div,label="Automatic SCRAM",states=red_ind_s}
+            local rps_tmo = IconIndicator{parent=rps_div,label="Timeout",states=yel_ind_s}
+            local rps_flt = IconIndicator{parent=rps_div,label="PPM Fault",states=yel_ind_s}
+            local rps_sfl = IconIndicator{parent=rps_div,label="Not Formed",states=red_ind_s}
+
+            r_mscrm.register(u_ps, "manual", r_mscrm.update)
+            r_ascrm.register(u_ps, "automatic", r_ascrm.update)
+            rps_tmo.register(u_ps, "timeout", rps_tmo.update)
+            rps_flt.register(u_ps, "fault", rps_flt.update)
+            rps_sfl.register(u_ps, "sys_fail", rps_sfl.update)
+
+            rps_div.line_break()
+            local rps_dmg = IconIndicator{parent=rps_div,label="Reactor Damage Hi",states=red_ind_s}
+            local rps_tmp = IconIndicator{parent=rps_div,label="Temp. Critical",states=red_ind_s}
+            local rps_nof = IconIndicator{parent=rps_div,label="Fuel Level Lo",states=yel_ind_s}
+            local rps_exw = IconIndicator{parent=rps_div,label="Waste Level Hi",states=yel_ind_s}
+            local rps_loc = IconIndicator{parent=rps_div,label="Coolant Lo Lo",states=yel_ind_s}
+            local rps_exh = IconIndicator{parent=rps_div,label="Heated Coolant Hi",states=yel_ind_s}
+
+            rps_dmg.register(u_ps, "high_dmg", rps_dmg.update)
+            rps_tmp.register(u_ps, "high_temp", rps_tmp.update)
+            rps_nof.register(u_ps, "no_fuel", rps_nof.update)
+            rps_exw.register(u_ps, "ex_waste", rps_exw.update)
+            rps_loc.register(u_ps, "low_cool", rps_loc.update)
+            rps_exh.register(u_ps, "ex_hcool", rps_exh.update)
+
+            --#endregion
+
+            --#region RCS Tab
+
+            local rcs_div = Div{parent=page_div}
+            table.insert(panes, rcs_div)
+
+            local rcs_page = app.new_page(u_page, #panes)
+            rcs_page.tasks = { update }
+
+            nav_links[i].rcs = rcs_page.nav_to
+
+            TextBox{parent=rcs_div,y=1,text="Coolant System",height=1,alignment=ALIGN.CENTER}
+
+            local r_rtrip = IconIndicator{parent=rcs_div,y=3,label="RCP Trip",states=red_ind_s}
+            local r_cflow = IconIndicator{parent=rcs_div,label="RCS Flow Lo",states=yel_ind_s}
+            local r_clow  = IconIndicator{parent=rcs_div,label="Coolant Level Lo",states=yel_ind_s}
+
+            r_rtrip.register(u_ps, "RCPTrip", r_rtrip.update)
+            r_cflow.register(u_ps, "RCSFlowLow", r_cflow.update)
+            r_clow.register(u_ps, "CoolantLevelLow", r_clow.update)
+
+            local c_flt  = IconIndicator{parent=rcs_div,label="RCS HW Fault",states=yel_ind_s}
+            local c_emg  = IconIndicator{parent=rcs_div,label="Emergency Coolant",states=emc_ind_s}
+            local c_mwrf = IconIndicator{parent=rcs_div,label="Max Water Return",states=yel_ind_s}
+
+            c_flt.register(u_ps, "RCSFault", c_flt.update)
+            c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
+            c_mwrf.register(u_ps, "MaxWaterReturnFeed", c_mwrf.update)
+
+            -- rcs_div.line_break()
+            -- TextBox{parent=rcs_div,text="Mismatches",height=1,alignment=ALIGN.CENTER,fg_bg=label}
+            local c_cfm = IconIndicator{parent=rcs_div,label="Coolant Feed",states=yel_ind_s}
+            local c_brm = IconIndicator{parent=rcs_div,label="Boil Rate",states=yel_ind_s}
+            local c_sfm = IconIndicator{parent=rcs_div,label="Steam Feed",states=yel_ind_s}
+
+            c_cfm.register(u_ps, "CoolantFeedMismatch", c_cfm.update)
+            c_brm.register(u_ps, "BoilRateMismatch", c_brm.update)
+            c_sfm.register(u_ps, "SteamFeedMismatch", c_sfm.update)
+
+            rcs_div.line_break()
+            -- TextBox{parent=rcs_div,text="Aggregate Checks",height=1,alignment=ALIGN.CENTER,fg_bg=label}
+
+            if unit.num_boilers > 0 then
+                local wll = IconIndicator{parent=rcs_div,label="Boiler Water Lo",states=red_ind_s}
+                local hrl = IconIndicator{parent=rcs_div,label="Heating Rate Lo",states=yel_ind_s}
+
+                wll.register(u_ps, "U_WaterLevelLow", wll.update)
+                hrl.register(u_ps, "U_HeatingRateLow", hrl.update)
+            end
+
+            local tospd = IconIndicator{parent=rcs_div,label="TRB Over Speed",states=red_ind_s}
+            local gtrip = IconIndicator{parent=rcs_div,label="Generator Trip",states=yel_ind_s}
+            local ttrip = IconIndicator{parent=rcs_div,label="Turbine Trip",states=red_ind_s}
+
+            tospd.register(u_ps, "U_TurbineOverSpeed", tospd.update)
+            gtrip.register(u_ps, "U_GeneratorTrip", gtrip.update)
+            ttrip.register(u_ps, "U_TurbineTrip", ttrip.update)
+
+            --#endregion
+        end
+
+        -- setup multipane
+        local u_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
+        app.set_root_pane(u_pane)
+
+        set_sidebar(active_unit)
+    end
+
+    app.set_on_load(load)
 
     return main
 end