Merge pull request #501 from MikaylaFischler/devel

2024.06.15 Release

.github/FUNDING.yml

@@ -0,0 +1 @@
+ko_fi: mikayla_f

.github/ISSUE_TEMPLATE/feature_request.md

@@ -2,7 +2,7 @@
 name: Feature request
 about: Suggest an idea for this project
 title: ''
-labels: enhancement
+labels: "enhancement,feature request"
 assignees: ''
 
 ---

.github/workflows/check.yml

@@ -5,12 +5,10 @@ on:
   push:
     branches:
       - main
-      - latest
       - devel
   pull_request:
     branches:
       - main
-      - latest
       - devel
 jobs:
   check:
@@ -28,4 +26,4 @@ jobs:
           # --no-max-line-length = Disable warnings for long line lengths
           # --exclude-files ...  = Exclude lockbox library (external) and config files
           # --globals ...        = Override all globals overridden in .vscode/settings.json AND 'os' since CraftOS 'os' differs from Lua's 'os'
-          args: . --no-max-line-length -i 121 512 542 --exclude-files ./lockbox/* ./*/config.lua --globals os _HOST bit colors fs http parallel periphemu peripheral read rs settings shell term textutils window
+          args: . --no-max-line-length -i 121 512 542 --exclude-files ./lockbox/* ./*/config.lua --globals os _HOST bit colors fs http keys parallel periphemu peripheral read rs settings shell term textutils window

.github/workflows/manifest.yml

@@ -6,7 +6,6 @@ on:
   push:
     branches:
       - main
-      - latest
       - devel
 
 # Sets permissions of the GITHUB_TOKEN to allow deployment to GitHub Pages
@@ -43,7 +42,7 @@ jobs:
       - name: Create outputs folders
         if: success() || failure()
         shell: bash
-        run: mkdir deploy; mkdir deploy/manifests; mkdir deploy/manifests/main deploy/manifests/latest deploy/manifests/devel
+        run: mkdir deploy; mkdir deploy/manifests; mkdir deploy/manifests/main deploy/manifests/devel
       - name: Generate manifest and shields for main branch
         id: manifest-main
         if: ${{ (success() || failure()) && steps.checkout-main.outcome == 'success' }}
@@ -51,21 +50,6 @@ jobs:
       - name: Save main's manifest
         if: ${{ (success() || failure()) && steps.manifest-main.outcome == 'success' }}
         run: mv install_manifest.json deploy/manifests/main
-      # Generate manifest for latest branch
-      - name: Checkout latest
-        id: checkout-latest
-        if: success() || failure()
-        uses: actions/checkout@v3
-        with:
-          ref: 'latest'
-          clean: false
-      - name: Generate manifest for latest
-        id: manifest-latest
-        if: ${{ (success() || failure()) && steps.checkout-latest.outcome == 'success' }}
-        run: python imgen.py
-      - name: Save latest's manifest
-        if: ${{ (success() || failure()) && steps.manifest-latest.outcome == 'success' }}
-        run: mv install_manifest.json deploy/manifests/latest
       # Generate manifest for devel branch
       - name: Checkout devel
         id: checkout-devel

.vscode/settings.json

@@ -5,6 +5,7 @@
         "colors",
         "fs",
         "http",
+        "keys",
         "parallel",
         "periphemu",
         "peripheral",
@@ -24,6 +25,7 @@
     },
     "Lua.hint.setType": true,
     "Lua.diagnostics.disable": [
-        "duplicate-set-field"
+        "duplicate-set-field",
+        "inject-field"
     ]
 }

LICENSE

@@ -1,6 +1,6 @@
 MIT License
 
-Copyright © 2022 - 2023 Mikayla Fischler
+Copyright © 2022 - 2024 Mikayla Fischler
 
 Permission is hereby granted, free of charge, to any person obtaining a copy
 of this software and associated documentation files (the "Software"), to deal

README.md

@@ -4,12 +4,11 @@ Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fi
 ![GitHub](https://img.shields.io/github/license/MikaylaFischler/cc-mek-scada)
 ![GitHub release (latest by date including pre-releases)](https://img.shields.io/github/v/release/MikaylaFischler/cc-mek-scada?include_prereleases)
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=main&label=main)
-![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=latest&label=latest)
 ![GitHub Workflow Status (with branch)](https://img.shields.io/github/actions/workflow/status/MikaylaFischler/cc-mek-scada/check.yml?branch=devel&label=devel)
 
-### [Join](https://discord.gg/R9NSCkhcwt) the Discord!
+### Join [the Discord](https://discord.gg/R9NSCkhcwt)!
 
-![Discord](https://img.shields.io/discord/1129075839288496259)
+![Discord](https://img.shields.io/discord/1129075839288496259?logo=Discord&logoColor=white&label=discord)
 
 ## Released Component Versions
 
@@ -17,7 +16,10 @@ Configurable ComputerCraft SCADA system for multi-reactor control of Mekanism fi
 
 
 ![Bootloader](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fbootloader.json)
+![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcommon.json)
 ![Comms](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fcomms.json)
+![Graphics](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Fgraphics.json)
+![Lockbox](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Flockbox.json)
 
 
 ![Reactor PLC](https://img.shields.io/endpoint?url=https%3A%2F%2Fmikaylafischler.github.io%2Fcc-mek-scada%2Freactor-plc.json)
@@ -34,14 +36,21 @@ Mod Requirements:
 
 Mod Recommendations:
 - Advanced Peripherals (adds the capability to detect environmental radiation levels)
+- Immersive Engineering (provides bundled redstone, though any mod containing bundled redstone will do)
 
-v10.1+ is required due the complete support of CC:Tweaked added in Mekanism v10.1
+v10.1+ is required due to the complete support of CC:Tweaked added in Mekanism v10.1
 
 ## Installation
 
 You can install this on a ComputerCraft computer using either:
 * `wget https://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada/main/ccmsi.lua`
-* `pastebin get RGasyTM4 ccmsi.lua`
+* `pastebin get sqUN6VUb ccmsi.lua`
+
+## Contributing
+
+Please reach out to me via Discord or email (or GitHub in some way) if you are thinking of making any contributions at this time. I started this project as a challenge for myself and have been enjoying having something I can work on in my own way. 
+
+Once this is out of beta I will be more open to contributions, but for now I am hoping to keep them to a minimum as the remaining challenges are ones I am looking forward to solving.
 
 ## [SCADA](https://en.wikipedia.org/wiki/SCADA)
 > Supervisory control and data acquisition (SCADA) is a control system architecture comprising computers, networked data communications and graphical user interfaces for high-level supervision of machines and processes. It also covers sensors and other devices, such as programmable logic controllers, which interface with process plant or machinery.

ccmsi.lua

@@ -1,9 +1,7 @@
---
--- ComputerCraft Mekanism SCADA System Installer Utility
---
-
 --[[
-Copyright (c) 2023 Mikayla Fischler
+CC-MEK-SCADA Installer Utility
+
+Copyright (c) 2023 - 2024 Mikayla Fischler
 
 Permission is hereby granted, free of charge, to any person obtaining a copy of this software and
 associated documentation files (the "Software"), to deal in the Software without restriction,
@@ -20,7 +18,7 @@ SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
 local function println(message) print(tostring(message)) end
 local function print(message) term.write(tostring(message)) end
 
-local CCMSI_VERSION = "v1.7d"
+local CCMSI_VERSION = "v1.14"
 
 local install_dir = "/.install-cache"
 local manifest_path = "https://mikaylafischler.github.io/cc-mek-scada/manifests/"
@@ -28,12 +26,13 @@ local repo_path = "http://raw.githubusercontent.com/MikaylaFischler/cc-mek-scada
 
 local opts = { ... }
 local mode, app, target
-local install_manifest = manifest_path .. "main/install_manifest.json"
+local install_manifest = manifest_path.."main/install_manifest.json"
 
 local function red() term.setTextColor(colors.red) end
 local function orange() term.setTextColor(colors.orange) end
 local function yellow() term.setTextColor(colors.yellow) end
 local function green() term.setTextColor(colors.green) end
+local function cyan() term.setTextColor(colors.cyan) end
 local function blue() term.setTextColor(colors.blue) end
 local function white() term.setTextColor(colors.white) end
 local function lgray() term.setTextColor(colors.lightGray) end
@@ -60,19 +59,18 @@ local function ask_y_n(question, default)
 end
 
 -- print out a white + blue text message
-local function pkg_message(message, package) white();print(message .. " ");blue();println(package);white() end
+local function pkg_message(message, package) white();print(message.." ");blue();println(package);white() end
 
 -- indicate actions to be taken based on package differences for installs/updates
-local function show_pkg_change(name, v_local, v_remote)
-    if v_local ~= nil then
-        if v_local ~= v_remote then
-            print("[" .. name .. "] updating ");blue();print(v_local);white();print(" \xbb ");blue();println(v_remote);white()
+local function show_pkg_change(name, v)
+    if v.v_local ~= nil then
+        if v.v_local ~= v.v_remote then
+            print("["..name.."] updating ");blue();print(v.v_local);white();print(" \xbb ");blue();println(v.v_remote);white()
         elseif mode == "install" then
-            pkg_message("[" .. name .. "] reinstalling", v_local)
+            pkg_message("["..name.."] reinstalling", v.v_local)
         end
-    else
-        pkg_message("[" .. name .. "] new install of", v_remote)
-    end
+    else pkg_message("["..name.."] new install of", v.v_remote) end
+    return v.v_local ~= v.v_remote
 end
 
 -- read the local manifest file
@@ -91,8 +89,8 @@ end
 local function get_remote_manifest()
     local response, error = http.get(install_manifest)
     if response == nil then
-        orange();println("failed to get installation manifest from GitHub, cannot update or install")
-        red();println("HTTP error: " .. error);white()
+        orange();println("Failed to get installation manifest from GitHub, cannot update or install.")
+        red();println("HTTP error: "..error);white()
         return false, {}
     end
 
@@ -157,92 +155,92 @@ local function _clean_dir(dir, tree)
     if tree == nil then tree = {} end
     local ls = fs.list(dir)
     for _, val in pairs(ls) do
-        local path = dir .. "/" .. val
+        local path = dir.."/"..val
         if fs.isDir(path) then
             _clean_dir(path, tree[val])
-            if #fs.list(path) == 0 then fs.delete(path);println("deleted " .. path) end
-        elseif not _in_array(val, tree) then
+            if #fs.list(path) == 0 then fs.delete(path);println("deleted "..path) end
+        elseif (not _in_array(val, tree)) and (val ~= "config.lua" ) then
             fs.delete(path)
-            println("deleted " .. path)
+            println("deleted "..path)
         end
     end
 end
 
 -- go through app/common directories to delete unused files
 local function clean(manifest)
-    local root_ext = false
     local tree = gen_tree(manifest)
 
     table.insert(tree, "install_manifest.json")
     table.insert(tree, "ccmsi.lua")
-    table.insert(tree, "log.txt")
-
-    lgray()
+    table.insert(tree, "log.txt") ---@fixme fix after migration to settings files?
 
     local ls = fs.list("/")
     for _, val in pairs(ls) do
-        if fs.isDir(val) then
-            if tree[val] ~= nil then _clean_dir("/" .. val, tree[val]) end
-            if #fs.list(val) == 0 then fs.delete(val);println("deleted " .. val) end
-        elseif not _in_array(val, tree) then
-            root_ext = true
-            yellow();println(val .. " not used")
+        if fs.isDriveRoot(val) then
+            yellow();println("skipped mount '"..val.."'")
+        elseif fs.isDir(val) then
+            if tree[val] ~= nil then lgray();_clean_dir("/"..val, tree[val])
+            else white(); if ask_y_n("delete the unused directory '"..val.."'") then lgray();_clean_dir("/"..val) end end
+            if #fs.list(val) == 0 then fs.delete(val);lgray();println("deleted empty directory '"..val.."'") end
+        elseif not _in_array(val, tree) and (string.find(val, ".settings") == nil) then
+            white();if ask_y_n("delete the unused file '"..val.."'") then fs.delete(val);lgray();println("deleted "..val) end
         end
     end
 
     white()
-    if root_ext then println("Files in root directory won't be automatically deleted.") end
 end
 
 -- get and validate command line options
 
-println("-- CC Mekanism SCADA Installer " .. CCMSI_VERSION .. " --")
+println("-- CC Mekanism SCADA Installer "..CCMSI_VERSION.." --")
 
 if #opts == 0 or opts[1] == "help" then
     println("usage: ccmsi <mode> <app> <branch>")
     println("<mode>")
     lgray()
-    println(" check       - check latest versions avilable")
+    println(" check       - check latest versions available")
     yellow()
     println("               ccmsi check <branch> for target")
     lgray()
-    println(" install     - fresh install, overwrites config")
-    println(" update      - update files EXCEPT for config/logs")
-    println(" remove      - delete files EXCEPT for config/logs")
-    println(" purge       - delete files INCLUDING config/logs")
+    println(" install     - fresh install")
+    println(" update      - update files")
+    println(" uninstall   - delete files INCLUDING config/logs")
     white();println("<app>");lgray()
     println(" reactor-plc - reactor PLC firmware")
     println(" rtu         - RTU firmware")
     println(" supervisor  - supervisor server application")
     println(" coordinator - coordinator application")
     println(" pocket      - pocket application")
-    white();println("<branch>");yellow()
-    println(" second parameter when used with check")
-    lgray();println(" main (default) | latest | devel");white()
+    println(" installer   - ccmsi installer (update only)")
+    white();println("<branch>")
+    lgray();println(" main (default) | devel");white()
     return
 else
-    mode = get_opt(opts[1], { "check", "install", "update", "remove", "purge" })
+    mode = get_opt(opts[1], { "check", "install", "update", "uninstall" })
     if mode == nil then
         red();println("Unrecognized mode.");white()
         return
     end
 
-    app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket" })
+    app = get_opt(opts[2], { "reactor-plc", "rtu", "supervisor", "coordinator", "pocket", "installer" })
     if app == nil and mode ~= "check" then
         red();println("Unrecognized application.");white()
         return
+    elseif app == "installer" and mode ~= "update" then
+        red();println("Installer app only supports 'update' option.");white()
+        return
     end
 
     -- determine target
     if mode == "check" then target = opts[2] else target = opts[3] end
-    if (target ~= "main") and (target ~= "latest") and (target ~= "devel") then
+    if (target ~= "main") and (target ~= "devel") then
         if (target and target ~= "") then yellow();println("Unknown target, defaulting to 'main'");white() end
         target = "main"
     end
 
     -- set paths
-    install_manifest = manifest_path .. target .. "/install_manifest.json"
-    repo_path = repo_path .. target .. "/"
+    install_manifest = manifest_path..target.."/install_manifest.json"
+    repo_path = repo_path..target.."/"
 end
 
 -- run selected mode
@@ -262,21 +260,24 @@ if mode == "check" then
     -- list all versions
     for key, value in pairs(manifest.versions) do
         term.setTextColor(colors.purple)
-        print(string.format("%-14s", "[" .. key .. "]"))
+        print(string.format("%-14s", "["..key.."]"))
         if key == "installer" or (local_ok and (local_manifest.versions[key] ~= nil)) then
             blue();print(local_manifest.versions[key])
             if value ~= local_manifest.versions[key] then
                 white();print(" (")
-                term.setTextColor(colors.cyan)
-                print(value);white();println(" available)")
+                cyan();print(value);white();println(" available)")
             else green();println(" (up to date)") end
         else
             lgray();print("not installed");white();print(" (latest ")
-            term.setTextColor(colors.cyan)
-            print(value);white();println(")")
+            cyan();print(value);white();println(")")
         end
     end
+
+    if manifest.versions.installer ~= local_manifest.versions.installer then
+        yellow();println("\nA different version of the installer is available, it is recommended to update (use 'ccmsi update installer').");white()
+    end
 elseif mode == "install" or mode == "update" then
+    local update_installer = app == "installer"
     local ok, manifest = get_remote_manifest()
     if not ok then return end
 
@@ -284,71 +285,75 @@ elseif mode == "install" or mode == "update" then
         app = { v_local = nil, v_remote = nil, changed = false },
         boot = { v_local = nil, v_remote = nil, changed = false },
         comms = { v_local = nil, v_remote = nil, changed = false },
+        common = { v_local = nil, v_remote = nil, changed = false },
         graphics = { v_local = nil, v_remote = nil, changed = false },
         lockbox = { v_local = nil, v_remote = nil, changed = false }
     }
 
     -- try to find local versions
-    local local_ok, local_manifest = read_local_manifest()
+    local local_ok, lmnf = read_local_manifest()
     if not local_ok then
         if mode == "update" then
-            red();println("failed to load local installation information, cannot update");white()
+            red();println("Failed to load local installation information, cannot update.");white()
             return
         end
-    else
-        ver.boot.v_local = local_manifest.versions.bootloader
-        ver.app.v_local = local_manifest.versions[app]
-        ver.comms.v_local = local_manifest.versions.comms
-        ver.graphics.v_local = local_manifest.versions.graphics
-        ver.lockbox.v_local = local_manifest.versions.lockbox
+    elseif not update_installer then
+        ver.boot.v_local = lmnf.versions.bootloader
+        ver.app.v_local = lmnf.versions[app]
+        ver.comms.v_local = lmnf.versions.comms
+        ver.common.v_local = lmnf.versions.common
+        ver.graphics.v_local = lmnf.versions.graphics
+        ver.lockbox.v_local = lmnf.versions.lockbox
 
-        if local_manifest.versions[app] == nil then
-            red();println("another application is already installed, please purge it before installing a new application");white()
+        if lmnf.versions[app] == nil then
+            red();println("Another application is already installed, please uninstall it before installing a new application.");white()
             return
         end
+    end
 
-        local_manifest.versions.installer = CCMSI_VERSION
-        if manifest.versions.installer ~= CCMSI_VERSION then
-            yellow();println("a newer version of the installer is available, it is recommended to download it");white()
+    if manifest.versions.installer ~= CCMSI_VERSION then
+        if not update_installer then yellow();println("A different version of the installer is available, it is recommended to update to it.");white() end
+        if update_installer or ask_y_n("Would you like to update now") then
+            lgray();println("GET ccmsi.lua")
+            local dl, err = http.get(repo_path.."ccmsi.lua")
+
+            if dl == nil then
+                red();println("HTTP Error "..err)
+                println("Installer download failed.");white()
+            else
+                local handle = fs.open(debug.getinfo(1, "S").source:sub(2), "w") -- this file, regardless of name or location
+                handle.write(dl.readAll())
+                handle.close()
+                green();println("Installer updated successfully.");white()
+            end
+
+            return
         end
+    elseif update_installer then
+        green();println("Installer already up-to-date.");white()
+        return
     end
 
     ver.boot.v_remote = manifest.versions.bootloader
     ver.app.v_remote = manifest.versions[app]
     ver.comms.v_remote = manifest.versions.comms
+    ver.common.v_remote = manifest.versions.common
     ver.graphics.v_remote = manifest.versions.graphics
     ver.lockbox.v_remote = manifest.versions.lockbox
 
     green()
-    if mode == "install" then
-        println("Installing " .. app .. " files...")
-    elseif mode == "update" then
-        println("Updating " .. app .. " files... (keeping old config.lua)")
-    end
-    white()
+    if mode == "install" then print("Installing ") else print("Updating ") end
+    println(app.." files...");white()
 
-    -- display bootloader version change information
-    show_pkg_change("bootldr", ver.boot.v_local, ver.boot.v_remote)
-    ver.boot.changed = ver.boot.v_local ~= ver.boot.v_remote
-
-    -- display app version change information
-    show_pkg_change(app, ver.app.v_local, ver.app.v_remote)
-    ver.app.changed = ver.app.v_local ~= ver.app.v_remote
-
-    -- display comms version change information
-    show_pkg_change("comms", ver.comms.v_local, ver.comms.v_remote)
-    ver.comms.changed = ver.comms.v_local ~= ver.comms.v_remote
+    ver.boot.changed = show_pkg_change("bootldr", ver.boot)
+    ver.common.changed = show_pkg_change("common", ver.common)
+    ver.comms.changed = show_pkg_change("comms", ver.comms)
     if ver.comms.changed and ver.comms.v_local ~= nil then
         print("[comms] ");yellow();println("other devices on the network will require an update");white()
     end
-
-    -- display graphics version change information
-    show_pkg_change("graphics", ver.graphics.v_local, ver.graphics.v_remote)
-    ver.graphics.changed = ver.graphics.v_local ~= ver.graphics.v_remote
-
-    -- display lockbox version change information
-    show_pkg_change("lockbox", ver.lockbox.v_local, ver.lockbox.v_remote)
-    ver.lockbox.changed = ver.lockbox.v_local ~= ver.lockbox.v_remote
+    ver.app.changed = show_pkg_change(app, ver.app)
+    ver.graphics.changed = show_pkg_change("graphics", ver.graphics)
+    ver.lockbox.changed = show_pkg_change("lockbox", ver.lockbox)
 
     -- ask for confirmation
     if not ask_y_n("Continue", false) then return end
@@ -364,7 +369,6 @@ elseif mode == "install" or mode == "update" then
     local file_list = manifest.files
     local size_list = manifest.sizes
     local dependencies = manifest.depends[app]
-    local config_file = app .. "/config.lua"
 
     table.insert(dependencies, app)
 
@@ -376,10 +380,11 @@ elseif mode == "install" or mode == "update" then
     -- check space constraints
     if space_available < space_required then
         single_file_mode = true
-        yellow();println("WARNING: Insufficient space available for a full download!");white()
-        println("Files can be downloaded one by one, so if you are replacing a current install this will not be a problem unless installation fails.")
-        if mode == "update" then println("If installation still fails, delete this device's log file or uninstall the app (not purge) and try again.") end
-        if not ask_y_n("Do you wish to continue?", false) then
+        yellow();println("NOTICE: Insufficient space available for a full cached download!");white()
+        lgray();println("Files can instead be downloaded one by one. If you are replacing a current install this may corrupt your install ONLY if it fails (such as a sudden network issue). If that occurs, you can still try again.")
+        if mode == "update" then println("If installation still fails, delete this device's log file and/or any unrelated files you have on this computer then try again.") end
+        white();
+        if not ask_y_n("Do you wish to continue", false) then
             println("Operation cancelled.")
             return
         end
@@ -392,16 +397,13 @@ elseif mode == "install" or mode == "update" then
         if dependency == "system" then return not ver.boot.changed
         elseif dependency == "graphics" then return not ver.graphics.changed
         elseif dependency == "lockbox" then return not ver.lockbox.changed
-        elseif dependency == "common" then return not (ver.app.changed or ver.comms.changed)
+        elseif dependency == "common" then return not (ver.common.changed or ver.comms.changed)
         elseif dependency == app then return not ver.app.changed
         else return true end
     end
 
     if not single_file_mode then
-        if fs.exists(install_dir) then
-            fs.delete(install_dir)
-            fs.makeDir(install_dir)
-        end
+        if fs.exists(install_dir) then fs.delete(install_dir);fs.makeDir(install_dir) end
 
         -- download all dependencies
         for _, dependency in pairs(dependencies) do
@@ -413,15 +415,15 @@ elseif mode == "install" or mode == "update" then
 
                 local files = file_list[dependency]
                 for _, file in pairs(files) do
-                    println("GET " .. file)
-                    local dl, err = http.get(repo_path .. file)
+                    println("GET "..file)
+                    local dl, err = http.get(repo_path..file)
 
                     if dl == nil then
-                        red();println("GET HTTP Error " .. err)
+                        red();println("HTTP Error "..err)
                         success = false
                         break
                     else
-                        local handle = fs.open(install_dir .. "/" .. file, "w")
+                        local handle = fs.open(install_dir.."/"..file, "w")
                         handle.write(dl.readAll())
                         handle.close()
                     end
@@ -440,11 +442,9 @@ elseif mode == "install" or mode == "update" then
 
                     local files = file_list[dependency]
                     for _, file in pairs(files) do
-                        if mode == "install" or file ~= config_file then
-                            local temp_file = install_dir .. "/" .. file
-                            if fs.exists(file) then fs.delete(file) end
-                            fs.move(temp_file, file)
-                        end
+                        local temp_file = install_dir.."/"..file
+                        if fs.exists(file) then fs.delete(file) end
+                        fs.move(temp_file, file)
                     end
                 end
             end
@@ -477,19 +477,17 @@ elseif mode == "install" or mode == "update" then
 
                 local files = file_list[dependency]
                 for _, file in pairs(files) do
-                    if mode == "install" or file ~= config_file then
-                        println("GET " .. file)
-                        local dl, err = http.get(repo_path .. file)
+                    println("GET "..file)
+                    local dl, err = http.get(repo_path..file)
 
-                        if dl == nil then
-                            red();println("GET HTTP Error " .. err)
-                            success = false
-                            break
-                        else
-                            local handle = fs.open("/" .. file, "w")
-                            handle.write(dl.readAll())
-                            handle.close()
-                        end
+                    if dl == nil then
+                        red();println("HTTP Error "..err)
+                        success = false
+                        break
+                    else
+                        local handle = fs.open("/"..file, "w")
+                        handle.write(dl.readAll())
+                        handle.close()
                     end
                 end
             end
@@ -511,22 +509,19 @@ elseif mode == "install" or mode == "update" then
             else println("Update failed, files may have been skipped.") end
         end
     end
-elseif mode == "remove" or mode == "purge" then
+elseif mode == "uninstall" then
     local ok, manifest = read_local_manifest()
     if not ok then
         red();println("Error parsing local installation manifest.");white()
         return
-    elseif mode == "remove" and manifest.versions[app] == nil then
-        red();println(app .. " is not installed, cannot remove.");white()
+    end
+
+    if manifest.versions[app] == nil then
+        red();println("Error: '"..app.."' is not installed.")
         return
     end
 
-    orange()
-    if mode == "remove" then
-        println("Removing all " .. app .. " files except for config and log...")
-    elseif mode == "purge" then
-        println("Purging all " .. app .. " files including config and log...")
-    end
+    orange();println("Uninstalling all "..app.." files...")
 
     -- ask for confirmation
     if not ask_y_n("Continue", false) then return end
@@ -536,76 +531,68 @@ elseif mode == "remove" or mode == "purge" then
 
     local file_list = manifest.files
     local dependencies = manifest.depends[app]
-    local config_file = app .. "/config.lua"
 
     table.insert(dependencies, app)
 
-    -- delete log file if purging
+    -- delete log file
+    local log_deleted = false
+    local settings_file = app..".settings"
+    local legacy_config_file = app.."/config.lua"
+
     lgray()
-    if mode == "purge" and fs.exists(config_file) then
-        local log_deleted = pcall(function ()
-            local config = require(app .. ".config")
+    if fs.exists(legacy_config_file) then
+        log_deleted = pcall(function ()
+            local config = require(app..".config")
             if fs.exists(config.LOG_PATH) then
                 fs.delete(config.LOG_PATH)
-                println("deleted log file " .. config.LOG_PATH)
+                println("deleted log file "..config.LOG_PATH)
             end
         end)
-
-        if not log_deleted then
-            red();println("failed to delete log file")
-            white();println("press any key to continue...")
-            any_key();lgray()
+    elseif fs.exists(settings_file) and settings.load(settings_file) then
+        local log = settings.get("LogPath")
+        if log ~= nil and fs.exists(log) then
+            log_deleted = true
+            fs.delete(log)
+            println("deleted log file "..log)
         end
     end
 
-    -- delete all files except config unless purging
+    if not log_deleted then
+        red();println("Failed to delete log file.")
+        white();println("press any key to continue...")
+        any_key();lgray()
+    end
+
+    -- delete all installed files
     for _, dependency in pairs(dependencies) do
         local files = file_list[dependency]
         for _, file in pairs(files) do
-            if mode == "purge" or file ~= config_file then
-                if fs.exists(file) then fs.delete(file);println("deleted " .. file) end
-            end
+            if fs.exists(file) then fs.delete(file);println("deleted "..file) end
         end
 
-        -- delete folders that we should be deleteing
-        if mode == "purge" or dependency ~= app then
-            local folder = files[1]
-            while true do
-                local dir = fs.getDir(folder)
-                if dir == "" or dir == ".." then break else folder = dir end
-            end
+        local folder = files[1]
+        while true do
+            local dir = fs.getDir(folder)
+            if dir == "" or dir == ".." then break else folder = dir end
+        end
 
-            if fs.isDir(folder) then
-                fs.delete(folder)
-                println("deleted directory " .. folder)
-            end
-        elseif dependency == app then
-            -- delete individual subdirectories so we can leave the config
-            for _, folder in pairs(files) do
-                while true do
-                    local dir = fs.getDir(folder)
-                    if dir == "" or dir == ".." or dir == app then break else folder = dir end
-                end
-
-                if folder ~= app and fs.isDir(folder) then
-                    fs.delete(folder);println("deleted app subdirectory " .. folder)
-                end
-            end
+        if fs.isDir(folder) then
+            fs.delete(folder)
+            println("deleted directory "..folder)
         end
     end
 
-    -- only delete manifest if purging
-    if mode == "purge" then
-        fs.delete("install_manifest.json")
-        println("deleted install_manifest.json")
-    else
-        -- remove all data from versions list to show nothing is installed
-        manifest.versions = {}
-        local imfile = fs.open("install_manifest.json", "w")
-        imfile.write(textutils.serializeJSON(manifest))
-        imfile.close()
+    if fs.exists(legacy_config_file) then
+        fs.delete(legacy_config_file);println("deleted "..legacy_config_file)
     end
 
+    if fs.exists(settings_file) then
+        fs.delete(settings_file);println("deleted "..settings_file)
+    end
+
+    fs.delete("install_manifest.json")
+    println("deleted install_manifest.json")
+
     green();println("Done!")
 end
 

configure.lua

@@ -0,0 +1,11 @@
+print("CONFIGURE> SCANNING FOR CONFIGURATOR...")
+
+if fs.exists("reactor-plc/configure.lua") then require("reactor-plc.configure").configure()
+elseif fs.exists("rtu/configure.lua") then require("rtu.configure").configure()
+elseif fs.exists("supervisor/configure.lua") then require("supervisor.configure").configure()
+elseif fs.exists("coordinator/configure.lua") then require("coordinator.configure").configure()
+elseif fs.exists("pocket/configure.lua") then require("pocket.configure").configure()
+else
+    print("CONFIGURE> NO CONFIGURATOR FOUND")
+    print("CONFIGURE> EXIT")
+end

coordinator/config.lua

@@ -1,38 +0,0 @@
-local config = {}
-
--- supervisor comms channel
-config.SVR_CHANNEL = 16240
--- coordinator comms channel
-config.CRD_CHANNEL = 16243
--- pocket comms channel
-config.PKT_CHANNEL = 16244
--- max trusted modem message distance (0 to disable check)
-config.TRUSTED_RANGE = 0
--- time in seconds (>= 2) before assuming a remote device is no longer active
-config.SV_TIMEOUT = 5
-config.API_TIMEOUT = 5
--- facility authentication key (do NOT use one of your passwords)
--- this enables verifying that messages are authentic
--- all devices on the same network must use the same key
--- config.AUTH_KEY = "SCADAfacility123"
-
--- expected number of reactor units, used only to require that number of unit monitors
-config.NUM_UNITS = 4
-
--- alarm sounder volume (0.0 to 3.0, 1.0 being standard max volume, this is the option given to to speaker.play())
--- note: alarm sine waves are at half saturation, so that multiple will be required to reach full scale
-config.SOUNDER_VOLUME = 1.0
-
--- true for 24 hour time on main view screen
-config.TIME_24_HOUR = true
-
--- log path
-config.LOG_PATH = "/log.txt"
--- log mode
---  0 = APPEND (adds to existing file on start)
---  1 = NEW (replaces existing file on start)
-config.LOG_MODE = 0
--- true to log verbose debug messages
-config.LOG_DEBUG = false
-
-return config

coordinator/coordinator.lua

@@ -4,21 +4,18 @@ local ppm         = require("scada-common.ppm")
 local util        = require("scada-common.util")
 local types       = require("scada-common.types")
 
+local themes      = require("graphics.themes")
+
 local iocontrol   = require("coordinator.iocontrol")
 local process     = require("coordinator.process")
 
 local apisessions = require("coordinator.session.apisessions")
 
-local dialog      = require("coordinator.ui.dialog")
-
-local print = util.print
-local println = util.println
-
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
 local ESTABLISH_ACK = comms.ESTABLISH_ACK
-local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
-local SCADA_CRDN_TYPE = comms.SCADA_CRDN_TYPE
+local MGMT_TYPE = comms.MGMT_TYPE
+local CRDN_TYPE = comms.CRDN_TYPE
 local UNIT_COMMAND = comms.UNIT_COMMAND
 local FAC_COMMAND = comms.FAC_COMMAND
 
@@ -26,153 +23,166 @@ local LINK_TIMEOUT = 60.0
 
 local coordinator = {}
 
--- request the user to select a monitor
----@nodiscard
----@param names table available monitors
----@return boolean|string|nil
-local function ask_monitor(names)
-    println("available monitors:")
-    for i = 1, #names do
-        print(" " .. names[i])
-    end
-    println("")
-    println("select a monitor or type c to cancel")
+---@type crd_config
+local config = {}
 
-    local iface = dialog.ask_options(names, "c")
+coordinator.config = config
 
-    if iface ~= false and iface ~= nil then
-        util.filter_table(names, function (x) return x ~= iface end)
+-- load the coordinator configuration<br>
+-- status of 0 is OK, 1 is bad config, 2 is bad monitor config
+---@return 0|1|2 status, nil|monitors_struct|string monitors (or error message)
+function coordinator.load_config()
+    if not settings.load("/coordinator.settings") then return 1 end
+
+    config.UnitCount = settings.get("UnitCount")
+    config.SpeakerVolume = settings.get("SpeakerVolume")
+    config.Time24Hour = settings.get("Time24Hour")
+    config.TempScale = settings.get("TempScale")
+
+    config.DisableFlowView = settings.get("DisableFlowView")
+    config.MainDisplay = settings.get("MainDisplay")
+    config.FlowDisplay = settings.get("FlowDisplay")
+    config.UnitDisplays = settings.get("UnitDisplays")
+
+    config.SVR_Channel = settings.get("SVR_Channel")
+    config.CRD_Channel = settings.get("CRD_Channel")
+    config.PKT_Channel = settings.get("PKT_Channel")
+    config.SVR_Timeout = settings.get("SVR_Timeout")
+    config.API_Timeout = settings.get("API_Timeout")
+    config.TrustedRange = settings.get("TrustedRange")
+    config.AuthKey = settings.get("AuthKey")
+
+    config.LogMode = settings.get("LogMode")
+    config.LogPath = settings.get("LogPath")
+    config.LogDebug = settings.get("LogDebug")
+
+    config.MainTheme = settings.get("MainTheme")
+    config.FrontPanelTheme = settings.get("FrontPanelTheme")
+    config.ColorMode = settings.get("ColorMode")
+
+    local cfv = util.new_validator()
+
+    cfv.assert_type_int(config.UnitCount)
+    cfv.assert_range(config.UnitCount, 1, 4)
+    cfv.assert_type_bool(config.Time24Hour)
+    cfv.assert_type_int(config.TempScale)
+    cfv.assert_range(config.TempScale, 1, 4)
+
+    cfv.assert_type_bool(config.DisableFlowView)
+    cfv.assert_type_table(config.UnitDisplays)
+
+    cfv.assert_type_num(config.SpeakerVolume)
+    cfv.assert_range(config.SpeakerVolume, 0, 3)
+
+    cfv.assert_channel(config.SVR_Channel)
+    cfv.assert_channel(config.CRD_Channel)
+    cfv.assert_channel(config.PKT_Channel)
+
+    cfv.assert_type_num(config.SVR_Timeout)
+    cfv.assert_min(config.SVR_Timeout, 2)
+    cfv.assert_type_num(config.API_Timeout)
+    cfv.assert_min(config.API_Timeout, 2)
+
+    cfv.assert_type_num(config.TrustedRange)
+    cfv.assert_min(config.TrustedRange, 0)
+    cfv.assert_type_str(config.AuthKey)
+
+    if type(config.AuthKey) == "string" then
+        local len = string.len(config.AuthKey)
+        cfv.assert(len == 0 or len >= 8)
     end
 
-    return iface
-end
+    cfv.assert_type_int(config.LogMode)
+    cfv.assert_range(config.LogMode, 0, 1)
+    cfv.assert_type_str(config.LogPath)
+    cfv.assert_type_bool(config.LogDebug)
+
+    cfv.assert_type_int(config.MainTheme)
+    cfv.assert_range(config.MainTheme, 1, 2)
+    cfv.assert_type_int(config.FrontPanelTheme)
+    cfv.assert_range(config.FrontPanelTheme, 1, 2)
+    cfv.assert_type_int(config.ColorMode)
+    cfv.assert_range(config.ColorMode, 1, themes.COLOR_MODE.NUM_MODES)
+
+    -- Monitor Setup
 
--- configure monitor layout
----@param num_units integer number of units expected
----@return boolean success, monitors_struct? monitors
-function coordinator.configure_monitors(num_units)
     ---@class monitors_struct
     local monitors = {
-        primary = nil,
-        primary_name = "",
+        main = nil,     ---@type table|nil
+        main_name = "",
+        flow = nil,     ---@type table|nil
+        flow_name = "",
         unit_displays = {},
         unit_name_map = {}
     }
 
-    local monitors_avail = ppm.get_monitor_list()
-    local names = {}
-    local available = {}
+    local mon_cfv = util.new_validator()
 
     -- get all interface names
-    for iface, _ in pairs(monitors_avail) do
-        table.insert(names, iface)
-        table.insert(available, iface)
-    end
+    local names = {}
+    for iface, _ in pairs(ppm.get_monitor_list()) do table.insert(names, iface) end
 
-    -- we need a certain number of monitors (1 per unit + 1 primary display)
-    local num_displays_needed = num_units + 1
-    if #names < num_displays_needed then
-        local message = "not enough monitors connected (need " .. num_displays_needed .. ")"
-        println(message)
-        log.warning(message)
-        return false
-    end
+    local function setup_monitors()
+        mon_cfv.assert_type_str(config.MainDisplay)
+        if not config.DisableFlowView then mon_cfv.assert_type_str(config.FlowDisplay) end
+        mon_cfv.assert_eq(#config.UnitDisplays, config.UnitCount)
 
-    -- attempt to load settings
-    if not settings.load("/coord.settings") then
-        log.warning("configure_monitors(): failed to load coordinator settings file (may not exist yet)")
-    else
-        local _primary = settings.get("PRIMARY_DISPLAY")
-        local _unitd = settings.get("UNIT_DISPLAYS")
+        if mon_cfv.valid() then
+            local w, h, _
 
-        -- filter out already assigned monitors
-        util.filter_table(available, function (x) return x ~= _primary end)
-        if type(_unitd) == "table" then
-            util.filter_table(available, function (x) return not util.table_contains(_unitd, x) end)
-        end
-    end
-
-    ---------------------
-    -- PRIMARY DISPLAY --
-    ---------------------
-
-    local iface_primary_display = settings.get("PRIMARY_DISPLAY")   ---@type boolean|string|nil
-
-    if not util.table_contains(names, iface_primary_display) then
-        println("primary display is not connected")
-        local response = dialog.ask_y_n("would you like to change it", true)
-        if response == false then return false end
-        iface_primary_display = nil
-    end
-
-    while iface_primary_display == nil and #available > 0 do
-        -- lets get a monitor
-        iface_primary_display = ask_monitor(available)
-    end
-
-    if type(iface_primary_display) ~= "string" then return false end
-
-    settings.set("PRIMARY_DISPLAY", iface_primary_display)
-    util.filter_table(available, function (x) return x ~= iface_primary_display end)
-
-    monitors.primary = ppm.get_periph(iface_primary_display)
-    monitors.primary_name = iface_primary_display
-
-    -------------------
-    -- UNIT DISPLAYS --
-    -------------------
-
-    local unit_displays = settings.get("UNIT_DISPLAYS")
-
-    if unit_displays == nil then
-        unit_displays = {}
-        for i = 1, num_units do
-            local display = nil
-
-            while display == nil and #available > 0 do
-                -- lets get a monitor
-                println("please select monitor for unit #" .. i)
-                display = ask_monitor(available)
+            if not util.table_contains(names, config.MainDisplay) then
+                return 2, "Main monitor is not connected."
             end
 
-            if display == false then return false end
+            monitors.main = ppm.get_periph(config.MainDisplay)
+            monitors.main_name = config.MainDisplay
 
-            unit_displays[i] = display
-        end
-    else
-        -- make sure all displays are connected
-        for i = 1, num_units do
-            local display = unit_displays[i]
-
-            if not util.table_contains(names, display) then
-                println("unit #" .. i .. " display is not connected")
-                local response = dialog.ask_y_n("would you like to change it", true)
-                if response == false then return false end
-                display = nil
+            monitors.main.setTextScale(0.5)
+            w, _ = ppm.monitor_block_size(monitors.main.getSize())
+            if w ~= 8 then
+                return 2, util.c("Main monitor width is incorrect (was ", w, ", must be 8).")
             end
 
-            while display == nil and #available > 0 do
-                -- lets get a monitor
-                display = ask_monitor(available)
+            if not config.DisableFlowView then
+                if not util.table_contains(names, config.FlowDisplay) then
+                    return 2, "Flow monitor is not connected."
+                end
+
+                monitors.flow = ppm.get_periph(config.FlowDisplay)
+                monitors.flow_name = config.FlowDisplay
+
+                monitors.flow.setTextScale(0.5)
+                w, _ = ppm.monitor_block_size(monitors.flow.getSize())
+                if w ~= 8 then
+                    return 2, util.c("Flow monitor width is incorrect (was ", w, ", must be 8).")
+                end
             end
 
-            if display == false then return false end
+            for i = 1, config.UnitCount do
+                local display = config.UnitDisplays[i]
+                if type(display) ~= "string" or not util.table_contains(names, display) then
+                    return 2, "Unit " .. i .. " monitor is not connected."
+                end
 
-            unit_displays[i] = display
-        end
+                monitors.unit_displays[i] = ppm.get_periph(display)
+                monitors.unit_name_map[i] = display
+
+                monitors.unit_displays[i].setTextScale(0.5)
+                w, h = ppm.monitor_block_size(monitors.unit_displays[i].getSize())
+                if w ~= 4 or h ~= 4 then
+                    return 2, util.c("Unit ", i, " monitor size is incorrect (was ", w, " by ", h,", must be 4 by 4).")
+                end
+            end
+        else return 2, "Monitor configuration invalid." end
     end
 
-    settings.set("UNIT_DISPLAYS", unit_displays)
-    if not settings.save("/coord.settings") then
-        log.warning("configure_monitors(): failed to save coordinator settings file")
-    end
+    if cfv.valid() then
+        local ok, result, message = pcall(setup_monitors)
+        assert(ok, util.c("fatal error while trying to verify monitors: ", result))
+        if result == 2 then return 2, message end
+    else return 1 end
 
-    for i = 1, #unit_displays do
-        monitors.unit_displays[i] = ppm.get_periph(unit_displays[i])
-        monitors.unit_name_map[i] = unit_displays[i]
-    end
-
-    return true, monitors
+    return 0, monitors
 end
 
 -- dmesg print wrapper
@@ -182,7 +192,7 @@ end
 ---@return function? update, function? done
 local function log_dmesg(message, dmesg_tag, working)
     local colors = {
-        GRAPHICS = colors.green,
+        RENDER = colors.green,
         SYSTEM = colors.cyan,
         BOOT = colors.blue,
         COMMS = colors.purple,
@@ -196,7 +206,7 @@ local function log_dmesg(message, dmesg_tag, working)
     end
 end
 
-function coordinator.log_graphics(message) log_dmesg(message, "GRAPHICS") end
+function coordinator.log_render(message) log_dmesg(message, "RENDER") end
 function coordinator.log_sys(message) log_dmesg(message, "SYSTEM") end
 function coordinator.log_boot(message) log_dmesg(message, "BOOT") end
 function coordinator.log_comms(message) log_dmesg(message, "COMMS") end
@@ -217,12 +227,8 @@ end
 ---@nodiscard
 ---@param version string coordinator version
 ---@param nic nic network interface device
----@param crd_channel integer port of configured supervisor
----@param svr_channel integer listening port for supervisor replys
----@param pkt_channel integer listening port for pocket API
----@param range integer trusted device connection range
 ---@param sv_watchdog watchdog
-function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel, range, sv_watchdog)
+function coordinator.comms(version, nic, sv_watchdog)
     local self = {
         sv_linked = false,
         sv_addr = comms.BROADCAST,
@@ -237,19 +243,19 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
         est_task_done = nil
     }
 
-    comms.set_trusted_range(range)
-
-    -- PRIVATE FUNCTIONS --
+    comms.set_trusted_range(config.TrustedRange)
 
     -- configure network channels
     nic.closeAll()
-    nic.open(crd_channel)
+    nic.open(config.CRD_Channel)
 
-    -- link nic to apisessions
-    apisessions.init(nic)
+    -- pass config to apisessions
+    apisessions.init(nic, config)
+
+    -- PRIVATE FUNCTIONS --
 
     -- send a packet to the supervisor
-    ---@param msg_type SCADA_MGMT_TYPE|SCADA_CRDN_TYPE
+    ---@param msg_type MGMT_TYPE|CRDN_TYPE
     ---@param msg table
     local function _send_sv(protocol, msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -266,33 +272,34 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
         pkt.make(msg_type, msg)
         s_pkt.make(self.sv_addr, self.sv_seq_num, protocol, pkt.raw_sendable())
 
-        nic.transmit(svr_channel, crd_channel, s_pkt)
+        nic.transmit(config.SVR_Channel, config.CRD_Channel, s_pkt)
         self.sv_seq_num = self.sv_seq_num + 1
     end
 
     -- send an API establish request response
     ---@param packet scada_packet
     ---@param ack ESTABLISH_ACK
-    local function _send_api_establish_ack(packet, ack)
+    ---@param data any?
+    local function _send_api_establish_ack(packet, ack, data)
         local s_pkt = comms.scada_packet()
         local m_pkt = comms.mgmt_packet()
 
-        m_pkt.make(SCADA_MGMT_TYPE.ESTABLISH, { ack })
+        m_pkt.make(MGMT_TYPE.ESTABLISH, { ack, data })
         s_pkt.make(packet.src_addr(), packet.seq_num() + 1, PROTOCOL.SCADA_MGMT, m_pkt.raw_sendable())
 
-        nic.transmit(pkt_channel, crd_channel, s_pkt)
+        nic.transmit(config.PKT_Channel, config.CRD_Channel, s_pkt)
         self.last_api_est_acks[packet.src_addr()] = ack
     end
 
     -- attempt connection establishment
     local function _send_establish()
-        _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.CRDN })
+        _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.CRD })
     end
 
     -- keep alive ack
     ---@param srv_time integer
     local function _send_keep_alive_ack(srv_time)
-        _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
+        _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
     end
 
     -- PUBLIC FUNCTIONS --
@@ -309,24 +316,24 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
 
         if not self.sv_linked then
             if self.est_tick_waiting == nil then
-                self.est_start = util.time_s()
+                self.est_start = os.clock()
                 self.est_last = self.est_start
 
                 self.est_tick_waiting, self.est_task_done =
-                    coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. svr_channel)
+                    coordinator.log_comms_connecting("attempting to connect to configured supervisor on channel " .. config.SVR_Channel)
 
                 _send_establish()
             else
-                self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (util.time_s() - self.est_start)))
+                self.est_tick_waiting(math.max(0, LINK_TIMEOUT - (os.clock() - self.est_start)))
             end
 
-            if abort or (util.time_s() - self.est_start) >= LINK_TIMEOUT then
+            if abort or (os.clock() - self.est_start) >= LINK_TIMEOUT then
                 self.est_task_done(false)
 
                 if abort then
                     coordinator.log_comms("supervisor connection attempt cancelled by user")
                 elseif self.sv_config_err then
-                    coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                    coordinator.log_comms("supervisor unit count does not match coordinator unit count, check configs")
                 elseif not self.sv_linked then
                     if self.last_est_ack == ESTABLISH_ACK.DENY then
                         coordinator.log_comms("supervisor connection attempt denied")
@@ -341,11 +348,12 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
 
                 ok = false
             elseif self.sv_config_err then
-                coordinator.log_comms("supervisor cooling configuration invalid, check supervisor config file")
+                self.est_task_done(false)
+                coordinator.log_comms("supervisor unit count does not match coordinator unit count, check configs")
                 ok = false
-            elseif (util.time_s() - self.est_last) > 1.0 then
+            elseif (os.clock() - self.est_last) > 1.0 then
                 _send_establish()
-                self.est_last = util.time_s()
+                self.est_last = os.clock()
             end
         elseif self.est_tick_waiting ~= nil then
             self.est_task_done(true)
@@ -364,21 +372,21 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
         self.sv_linked = false
         self.sv_r_seq_num = nil
         iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
-        _send_sv(PROTOCOL.SCADA_MGMT, SCADA_MGMT_TYPE.CLOSE, {})
+        _send_sv(PROTOCOL.SCADA_MGMT, MGMT_TYPE.CLOSE, {})
     end
 
     -- send a facility command
     ---@param cmd FAC_COMMAND command
     ---@param option any? optional option options for the optional options (like waste mode)
     function public.send_fac_command(cmd, option)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, { cmd, option })
+        _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_CMD, { cmd, option })
     end
 
     -- send the auto process control configuration with a start command
-    ---@param config coord_auto_config configuration
-    function public.send_auto_start(config)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_CMD, {
-            FAC_COMMAND.START, config.mode, config.burn_target, config.charge_target, config.gen_target, config.limits
+    ---@param auto_cfg coord_auto_config configuration
+    function public.send_auto_start(auto_cfg)
+        _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_CMD, {
+            FAC_COMMAND.START, auto_cfg.mode, auto_cfg.burn_target, auto_cfg.charge_target, auto_cfg.gen_target, auto_cfg.limits
         })
     end
 
@@ -387,7 +395,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     ---@param unit integer unit ID
     ---@param option any? optional option options for the optional options (like burn rate)
     function public.send_unit_command(cmd, unit, option)
-        _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
+        _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.UNIT_CMD, { cmd, unit, option })
     end
 
     -- parse a packet
@@ -396,7 +404,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     ---@param reply_to integer
     ---@param message any
     ---@param distance integer
-    ---@return mgmt_frame|crdn_frame|capi_frame|nil packet
+    ---@return mgmt_frame|crdn_frame|nil packet
     function public.parse_packet(side, sender, reply_to, message, distance)
         local s_pkt = nic.receive(side, sender, reply_to, message, distance)
         local pkt = nil
@@ -414,12 +422,6 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 if crdn_pkt.decode(s_pkt) then
                     pkt = crdn_pkt.get()
                 end
-            -- get as coordinator API packet
-            elseif s_pkt.protocol() == PROTOCOL.COORD_API then
-                local capi_pkt = comms.capi_packet()
-                if capi_pkt.decode(s_pkt) then
-                    pkt = capi_pkt.get()
-                end
             else
                 log.debug("attempted parse of illegal packet type " .. s_pkt.protocol(), true)
             end
@@ -429,7 +431,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
     end
 
     -- handle a packet
-    ---@param packet mgmt_frame|crdn_frame|capi_frame|nil
+    ---@param packet mgmt_frame|crdn_frame|nil
     ---@return boolean close_ui
     function public.handle_packet(packet)
         local was_linked = self.sv_linked
@@ -440,23 +442,23 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
             local src_addr = packet.scada_frame.src_addr()
             local protocol = packet.scada_frame.protocol()
 
-            if l_chan ~= crd_channel then
+            if l_chan ~= config.CRD_Channel then
                 log.debug("received packet on unconfigured channel " .. l_chan, true)
-            elseif r_chan == pkt_channel then
+            elseif r_chan == config.PKT_Channel then
                 if not self.sv_linked then
                     log.debug("discarding pocket API packet before linked to supervisor")
-                elseif protocol == PROTOCOL.COORD_API then
-                    ---@cast packet capi_frame
+                elseif protocol == PROTOCOL.SCADA_CRDN then
+                    ---@cast packet crdn_frame
                     -- look for an associated session
                     local session = apisessions.find_session(src_addr)
 
-                    -- API packet
+                    -- coordinator packet
                     if session ~= nil then
                         -- pass the packet onto the session handler
                         session.in_queue.push_packet(packet)
                     else
                         -- any other packet should be session related, discard it
-                        log.debug("discarding COORD_API packet without a known session")
+                        log.debug("discarding SCADA_CRDN packet without a known session")
                     end
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
@@ -467,13 +469,14 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                     if session ~= nil then
                         -- pass the packet onto the session handler
                         session.in_queue.push_packet(packet)
-                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- establish a new session
                         -- validate packet and continue
-                        if packet.length == 3 and type(packet.data[1]) == "string" and type(packet.data[2]) == "string" then
-                            local comms_v = packet.data[1]
-                            local firmware_v = packet.data[2]
+                        if packet.length == 4 then
+                            local comms_v = util.strval(packet.data[1])
+                            local firmware_v = util.strval(packet.data[2])
                             local dev_type = packet.data[3]
+                            local api_v = util.strval(packet.data[4])
 
                             if comms_v ~= comms.version then
                                 if self.last_api_est_acks[src_addr] ~= ESTABLISH_ACK.BAD_VERSION then
@@ -481,12 +484,19 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                                 end
 
                                 _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.BAD_VERSION)
+                            elseif api_v ~= comms.api_version then
+                                if self.last_api_est_acks[src_addr] ~= ESTABLISH_ACK.BAD_API_VERSION then
+                                    log.info(util.c("dropping API establish packet with incorrect api version v", api_v, " (expected v", comms.api_version, ")"))
+                                end
+
+                                _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.BAD_API_VERSION)
                             elseif dev_type == DEVICE_TYPE.PKT then
                                 -- pocket linking request
                                 local id = apisessions.establish_session(src_addr, firmware_v)
                                 coordinator.log_comms(util.c("API_ESTABLISH: pocket (", firmware_v, ") [@", src_addr, "] connected with session ID ", id))
 
-                                _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW)
+                                local conf = iocontrol.get_db().facility.conf
+                                _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.ALLOW, { conf.num_units, conf.cooling })
                             else
                                 log.debug(util.c("API_ESTABLISH: illegal establish packet for device ", dev_type, " on pocket channel"))
                                 _send_api_establish_ack(packet.scada_frame, ESTABLISH_ACK.DENY)
@@ -502,7 +512,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 else
                     log.debug("illegal packet type " .. protocol .. " on pocket channel", true)
                 end
-            elseif r_chan == svr_channel then
+            elseif r_chan == config.SVR_Channel then
                 -- check sequence number
                 if self.sv_r_seq_num == nil then
                     self.sv_r_seq_num = packet.scada_frame.seq_num()
@@ -523,7 +533,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 if protocol == PROTOCOL.SCADA_CRDN then
                     ---@cast packet crdn_frame
                     if self.sv_linked then
-                        if packet.type == SCADA_CRDN_TYPE.INITIAL_BUILDS then
+                        if packet.type == CRDN_TYPE.INITIAL_BUILDS then
                             if packet.length == 2 then
                                 -- record builds
                                 local fac_builds = iocontrol.record_facility_builds(packet.data[1])
@@ -531,31 +541,31 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
 
                                 if fac_builds and unit_builds then
                                     -- acknowledge receipt of builds
-                                    _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.INITIAL_BUILDS, {})
+                                    _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.INITIAL_BUILDS, {})
                                 else
                                     log.debug("received invalid INITIAL_BUILDS packet")
                                 end
                             else
                                 log.debug("INITIAL_BUILDS packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.FAC_BUILDS then
+                        elseif packet.type == CRDN_TYPE.FAC_BUILDS then
                             if packet.length == 1 then
                                 -- record facility builds
                                 if iocontrol.record_facility_builds(packet.data[1]) then
                                     -- acknowledge receipt of builds
-                                    _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.FAC_BUILDS, {})
+                                    _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.FAC_BUILDS, {})
                                 else
                                     log.debug("received invalid FAC_BUILDS packet")
                                 end
                             else
                                 log.debug("FAC_BUILDS packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.FAC_STATUS then
+                        elseif packet.type == CRDN_TYPE.FAC_STATUS then
                             -- update facility status
                             if not iocontrol.update_facility_status(packet.data) then
                                 log.debug("received invalid FAC_STATUS packet")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.FAC_CMD then
+                        elseif packet.type == CRDN_TYPE.FAC_CMD then
                             -- facility command acknowledgement
                             if packet.length >= 2 then
                                 local cmd = packet.data[1]
@@ -583,24 +593,24 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                             else
                                 log.debug("SCADA_CRDN facility command ack packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.UNIT_BUILDS then
+                        elseif packet.type == CRDN_TYPE.UNIT_BUILDS then
                             -- record builds
                             if packet.length == 1 then
                                 if iocontrol.record_unit_builds(packet.data[1]) then
                                     -- acknowledge receipt of builds
-                                    _send_sv(PROTOCOL.SCADA_CRDN, SCADA_CRDN_TYPE.UNIT_BUILDS, {})
+                                    _send_sv(PROTOCOL.SCADA_CRDN, CRDN_TYPE.UNIT_BUILDS, {})
                                 else
                                     log.debug("received invalid UNIT_BUILDS packet")
                                 end
                             else
                                 log.debug("UNIT_BUILDS packet length mismatch")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.UNIT_STATUSES then
+                        elseif packet.type == CRDN_TYPE.UNIT_STATUSES then
                             -- update statuses
                             if not iocontrol.update_unit_statuses(packet.data) then
                                 log.debug("received invalid UNIT_STATUSES packet")
                             end
-                        elseif packet.type == SCADA_CRDN_TYPE.UNIT_CMD then
+                        elseif packet.type == CRDN_TYPE.UNIT_CMD then
                             -- unit command acknowledgement
                             if packet.length == 3 then
                                 local cmd = packet.data[1]
@@ -642,7 +652,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
                     if self.sv_linked then
-                        if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
+                        if packet.type == MGMT_TYPE.KEEP_ALIVE then
                             -- keep alive request received, echo back
                             if packet.length == 1 then
                                 local timestamp = packet.data[1]
@@ -660,7 +670,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                             else
                                 log.debug("SCADA keep alive packet length mismatch")
                             end
-                        elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
+                        elseif packet.type == MGMT_TYPE.CLOSE then
                             -- handle session close
                             sv_watchdog.cancel()
                             self.sv_addr = comms.BROADCAST
@@ -671,33 +681,28 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                         else
                             log.debug("received unknown SCADA_MGMT packet type " .. packet.type)
                         end
-                    elseif packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- connection with supervisor established
                         if packet.length == 2 then
                             local est_ack = packet.data[1]
-                            local config = packet.data[2]
+                            local sv_config = packet.data[2]
 
                             if est_ack == ESTABLISH_ACK.ALLOW then
                                 -- reset to disconnected before validating
                                 iocontrol.fp_link_state(types.PANEL_LINK_STATE.DISCONNECTED)
 
-                                if type(config) == "table" and #config > 1 then
+                                if type(sv_config) == "table" and #sv_config == 2 then
                                     -- get configuration
 
                                     ---@class facility_conf
                                     local conf = {
-                                        num_units = config[1],  ---@type integer
-                                        defs = {}               -- boilers and turbines
+                                        num_units = sv_config[1], ---@type integer
+                                        cooling = sv_config[2]    ---@type sv_cooling_conf
                                     }
 
-                                    if (#config - 1) == (conf.num_units * 2) then
-                                        -- record sequence of pairs of [#boilers, #turbines] per unit
-                                        for i = 2, #config do
-                                            table.insert(conf.defs, config[i])
-                                        end
-
+                                    if conf.num_units == config.UnitCount then
                                         -- init io controller
-                                        iocontrol.init(conf, public)
+                                        iocontrol.init(conf, public, config.TempScale)
 
                                         self.sv_addr = src_addr
                                         self.sv_linked = true
@@ -707,7 +712,7 @@ function coordinator.comms(version, nic, crd_channel, svr_channel, pkt_channel,
                                         iocontrol.fp_link_state(types.PANEL_LINK_STATE.LINKED)
                                     else
                                         self.sv_config_err = true
-                                        log.warning("invalid supervisor configuration definitions received, establish failed")
+                                        log.warning("supervisor config's number of units don't match coordinator's config, establish failed")
                                     end
                                 else
                                     log.debug("invalid supervisor configuration table received, establish failed")

coordinator/iocontrol.lua

@@ -14,6 +14,8 @@ local pgi     = require("coordinator.ui.pgi")
 
 local ALARM_STATE = types.ALARM_STATE
 local PROCESS = types.PROCESS
+local TEMP_SCALE = types.TEMP_SCALE
+local TEMP_UNITS = types.TEMP_SCALE_UNITS
 
 -- nominal RTT is ping (0ms to 10ms usually) + 500ms for CRD main loop tick
 local WARN_RTT = 1000   -- 2x as long as expected w/ 0 ping
@@ -38,9 +40,7 @@ local function __generic_ack(success) end
 ---@param comms_v string comms version
 function iocontrol.init_fp(firmware_v, comms_v)
     ---@class ioctl_front_panel
-    io.fp = {
-        ps = psil.create()
-    }
+    io.fp = { ps = psil.create() }
 
     io.fp.ps.publish("version", firmware_v)
     io.fp.ps.publish("comms_version", comms_v)
@@ -49,10 +49,29 @@ end
 -- initialize the coordinator IO controller
 ---@param conf facility_conf configuration
 ---@param comms coord_comms comms reference
-function iocontrol.init(conf, comms)
+---@param temp_scale TEMP_SCALE temperature unit
+function iocontrol.init(conf, comms, temp_scale)
+    io.temp_label = TEMP_UNITS[temp_scale]
+
+    -- temperature unit label and conversion function (from Kelvin)
+    if temp_scale == TEMP_SCALE.CELSIUS then
+        io.temp_convert = function (t) return t - 273.15 end
+    elseif temp_scale == TEMP_SCALE.FAHRENHEIT then
+        io.temp_convert = function (t) return (1.8 * (t - 273.15)) + 32 end
+    elseif temp_scale == TEMP_SCALE.RANKINE then
+        io.temp_convert = function (t) return 1.8 * t end
+    else
+        io.temp_label = "K"
+        io.temp_convert = function (t) return t end
+    end
+
+    -- facility data structure
     ---@class ioctl_facility
     io.facility = {
-        num_units = conf.num_units, ---@type integer
+        conf = conf,
+        num_units = conf.num_units,
+        tank_mode = conf.cooling.fac_tank_mode,
+        tank_defs = conf.cooling.fac_tank_defs,
         all_sys_ok = false,
         rtu_count = 0,
 
@@ -74,6 +93,7 @@ function iocontrol.init(conf, comms)
         ---@type WASTE_PRODUCT
         auto_current_waste_product = types.WASTE_PRODUCT.PLUTONIUM,
         auto_pu_fallback_active = false,
+        auto_sps_disabled = false,
 
         radiation = types.new_zero_radiation_reading(),
 
@@ -83,6 +103,8 @@ function iocontrol.init(conf, comms)
         scram_ack = __generic_ack,
         ack_alarms_ack = __generic_ack,
 
+        alarm_tones = { false, false, false, false, false, false, false, false },
+
         ps = psil.create(),
 
         induction_ps_tbl = {},
@@ -104,6 +126,101 @@ function iocontrol.init(conf, comms)
     table.insert(io.facility.sps_ps_tbl, psil.create())
     table.insert(io.facility.sps_data_tbl, {})
 
+    -- determine tank information
+    if io.facility.tank_mode == 0 then
+        io.facility.tank_defs = {}
+        -- on facility tank mode 0, setup tank defs to match unit tank option
+        for i = 1, conf.num_units do
+            io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TankConnection, 1, 0)
+        end
+
+        io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
+    else
+        -- decode the layout of tanks from the connections definitions
+        local tank_mode = io.facility.tank_mode
+        local tank_defs = io.facility.tank_defs
+        local tank_list = { table.unpack(tank_defs) }
+
+        local function calc_fdef(start_idx, end_idx)
+            local first = 4
+            for i = start_idx, end_idx do
+                if io.facility.tank_defs[i] == 2 then
+                    if i < first then first = i end
+                end
+            end
+            return first
+        end
+
+        if tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef = calc_fdef(1, #tank_defs)
+            for i = 1, #tank_defs do
+                if i > first_fdef and tank_defs[i] == 2 then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
+                    tank_list[b] = 0
+                end
+            end
+        elseif tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef = calc_fdef(2, #tank_defs)
+            for i = 1, #tank_defs do
+                if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef = calc_fdef(3, #tank_defs)
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        end
+
+        io.facility.tank_list = tank_list
+    end
+
+    -- create facility tank tables
+    for i = 1, #io.facility.tank_list do
+        if io.facility.tank_list[i] == 2 then
+            table.insert(io.facility.tank_ps_tbl, psil.create())
+            table.insert(io.facility.tank_data_tbl, {})
+        end
+    end
+
+    -- create unit data structures
     io.units = {}
     for i = 1, conf.num_units do
         local function ack(alarm) process.ack_alarm(i, alarm) end
@@ -112,19 +229,28 @@ function iocontrol.init(conf, comms)
         ---@class ioctl_unit
         local entry = {
             unit_id = i,
+            connected = false,
+            rtu_hw = { boilers = {}, turbines = {} },
 
             num_boilers = 0,
             num_turbines = 0,
             num_snas = 0,
+            has_tank = conf.cooling.r_cool[i].TankConnection,
 
             control_state = false,
             burn_rate_cmd = 0.0,
             radiation = types.new_zero_radiation_reading(),
-            sna_prod_rate = 0.0,
+
+            sna_peak_rate = 0.0,
+            sna_max_rate = 0.0,
+            sna_out_rate = 0.0,
 
             waste_mode = types.WASTE_MODE.MANUAL_PLUTONIUM,
             waste_product = types.WASTE_PRODUCT.PLUTONIUM,
 
+            last_rate_change_ms = 0,
+            turbine_flow_stable = false,
+
             -- auto control group
             a_group = 0,
 
@@ -161,18 +287,18 @@ function iocontrol.init(conf, comms)
 
             ---@type alarms
             alarms = {
-                ALARM_STATE.INACTIVE,   -- containment breach
-                ALARM_STATE.INACTIVE,   -- containment radiation
-                ALARM_STATE.INACTIVE,   -- reactor lost
-                ALARM_STATE.INACTIVE,   -- damage critical
-                ALARM_STATE.INACTIVE,   -- reactor taking damage
-                ALARM_STATE.INACTIVE,   -- reactor over temperature
-                ALARM_STATE.INACTIVE,   -- reactor high temperature
-                ALARM_STATE.INACTIVE,   -- waste leak
-                ALARM_STATE.INACTIVE,   -- waste level high
-                ALARM_STATE.INACTIVE,   -- RPS transient
-                ALARM_STATE.INACTIVE,   -- RCS transient
-                ALARM_STATE.INACTIVE    -- turbine trip
+                ALARM_STATE.INACTIVE, -- containment breach
+                ALARM_STATE.INACTIVE, -- containment radiation
+                ALARM_STATE.INACTIVE, -- reactor lost
+                ALARM_STATE.INACTIVE, -- damage critical
+                ALARM_STATE.INACTIVE, -- reactor taking damage
+                ALARM_STATE.INACTIVE, -- reactor over temperature
+                ALARM_STATE.INACTIVE, -- reactor high temperature
+                ALARM_STATE.INACTIVE, -- waste leak
+                ALARM_STATE.INACTIVE, -- waste level high
+                ALARM_STATE.INACTIVE, -- RPS transient
+                ALARM_STATE.INACTIVE, -- RCS transient
+                ALARM_STATE.INACTIVE  -- turbine trip
             },
 
             annunciator = {},   ---@type annunciator
@@ -190,18 +316,29 @@ function iocontrol.init(conf, comms)
             tank_data_tbl = {}
         }
 
+        -- on other facility modes, overwrite unit TANK option with facility tank defs
+        if io.facility.tank_mode ~= 0 then
+            entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
+        end
+
         -- create boiler tables
-        for _ = 1, conf.defs[(i * 2) - 1] do
-            local data = {} ---@type boilerv_session_db
+        for _ = 1, conf.cooling.r_cool[i].BoilerCount do
             table.insert(entry.boiler_ps_tbl, psil.create())
-            table.insert(entry.boiler_data_tbl, data)
+            table.insert(entry.boiler_data_tbl, {})
+            table.insert(entry.rtu_hw.boilers, { connected = false, faulted = false })
         end
 
         -- create turbine tables
-        for _ = 1, conf.defs[i * 2] do
-            local data = {} ---@type turbinev_session_db
+        for _ = 1, conf.cooling.r_cool[i].TurbineCount do
             table.insert(entry.turbine_ps_tbl, psil.create())
-            table.insert(entry.turbine_data_tbl, data)
+            table.insert(entry.turbine_data_tbl, {})
+            table.insert(entry.rtu_hw.turbines, { connected = false, faulted = false })
+        end
+
+        -- create tank tables
+        if io.facility.tank_defs[i] == 1 then
+            table.insert(entry.tank_ps_tbl, psil.create())
+            table.insert(entry.tank_data_tbl, {})
         end
 
         entry.num_boilers = #entry.boiler_data_tbl
@@ -232,11 +369,28 @@ function iocontrol.fp_has_speaker(has_speaker) io.fp.ps.publish("has_speaker", h
 function iocontrol.fp_link_state(state) io.fp.ps.publish("link_state", state) end
 
 -- report monitor connection state
----@param id integer unit ID or 0 for main
+---@param id string|integer unit ID for unit monitor, "main" for main monitor, or "flow" for flow monitor
 function iocontrol.fp_monitor_state(id, connected)
-    local name = "main_monitor"
-    if id > 0 then name = "unit_monitor_" .. id end
-    io.fp.ps.publish(name, connected)
+    local name = nil
+
+    if id == "main" then
+        name = "main_monitor"
+    elseif id == "flow" then
+        name = "flow_monitor"
+    elseif type(id) == "number" then
+        name = "unit_monitor_" .. id
+    end
+
+    if name ~= nil then
+        io.fp.ps.publish(name, connected)
+    end
+end
+
+-- report thread (routine) statuses
+---@param thread string thread name
+---@param ok boolean thread state
+function iocontrol.fp_rt_status(thread, ok)
+    io.fp.ps.publish(util.c("routine__", thread), ok)
 end
 
 -- report PKT firmware version and PKT session connection state
@@ -266,7 +420,7 @@ function iocontrol.fp_pkt_rtt(session_id, rtt)
     elseif rtt > WARN_RTT then
         io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.yellow_hc)
     else
-        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.green)
+        io.fp.ps.publish("pkt_" .. session_id .. "_rtt_color", colors.green_hc)
     end
 end
 
@@ -351,7 +505,7 @@ function iocontrol.record_unit_builds(builds)
 
     -- note: if not all units and RTUs are connected, some will be nil
     for id, build in pairs(builds) do
-        local unit = io.units[id]    ---@type ioctl_unit
+        local unit = io.units[id] ---@type ioctl_unit
 
         local log_header = util.c("iocontrol.record_unit_builds[UNIT ", id, "]: ")
 
@@ -448,7 +602,7 @@ function iocontrol.update_facility_status(status)
 
         local ctl_status = status[1]
 
-        if type(ctl_status) == "table" and #ctl_status == 16 then
+        if type(ctl_status) == "table" and #ctl_status == 17 then
             fac.all_sys_ok = ctl_status[1]
             fac.auto_ready = ctl_status[2]
 
@@ -499,9 +653,11 @@ function iocontrol.update_facility_status(status)
 
             fac.auto_current_waste_product = ctl_status[15]
             fac.auto_pu_fallback_active = ctl_status[16]
+            fac.auto_sps_disabled = ctl_status[17]
 
             fac.ps.publish("current_waste_product", fac.auto_current_waste_product)
             fac.ps.publish("pu_fallback_active", fac.auto_pu_fallback_active)
+            fac.ps.publish("sps_disabled_low_power", fac.auto_sps_disabled)
         else
             log.debug(log_header .. "control status not a table or length mismatch")
             valid = false
@@ -518,10 +674,27 @@ function iocontrol.update_facility_status(status)
             fac.rtu_count = rtu_statuses.count
 
             -- power statistics
-            if type(rtu_statuses.power) == "table" then
-                fac.induction_ps_tbl[1].publish("avg_charge", rtu_statuses.power[1])
-                fac.induction_ps_tbl[1].publish("avg_inflow", rtu_statuses.power[2])
-                fac.induction_ps_tbl[1].publish("avg_outflow", rtu_statuses.power[3])
+            if type(rtu_statuses.power) == "table" and #rtu_statuses.power == 4 then
+                local data = fac.induction_data_tbl[1] ---@type imatrix_session_db
+                local ps   = fac.induction_ps_tbl[1]   ---@type psil
+
+                local chg   = tonumber(rtu_statuses.power[1])
+                local in_f  = tonumber(rtu_statuses.power[2])
+                local out_f = tonumber(rtu_statuses.power[3])
+                local eta   = tonumber(rtu_statuses.power[4])
+
+                ps.publish("avg_charge", chg)
+                ps.publish("avg_inflow", in_f)
+                ps.publish("avg_outflow", out_f)
+                ps.publish("eta_ms", eta)
+
+                ps.publish("is_charging", in_f > out_f)
+                ps.publish("is_discharging", out_f > in_f)
+
+                if data and data.build then
+                    local cap = util.joules_to_fe(data.build.transfer_cap)
+                    ps.publish("at_max_io", in_f >= cap or out_f >= cap)
+                end
             else
                 log.debug(log_header .. "power statistics list not a table")
                 valid = false
@@ -576,8 +749,8 @@ function iocontrol.update_facility_status(status)
 
                 for id, sps in pairs(rtu_statuses.sps) do
                     if type(fac.sps_data_tbl[id]) == "table" then
-                        local data = fac.sps_data_tbl[id]   ---@type sps_session_db
-                        local ps   = fac.sps_ps_tbl[id]     ---@type psil
+                        local data = fac.sps_data_tbl[id] ---@type sps_session_db
+                        local ps   = fac.sps_ps_tbl[id]   ---@type psil
 
                         local rtu_faulted = _record_multiblock_status(sps, data, ps)
 
@@ -614,8 +787,8 @@ function iocontrol.update_facility_status(status)
 
                 for id, tank in pairs(rtu_statuses.tanks) do
                     if type(fac.tank_data_tbl[id]) == "table" then
-                        local data = fac.tank_data_tbl[id]  ---@type dynamicv_session_db
-                        local ps   = fac.tank_ps_tbl[id]    ---@type psil
+                        local data = fac.tank_data_tbl[id] ---@type dynamicv_session_db
+                        local ps   = fac.tank_ps_tbl[id]   ---@type psil
 
                         local rtu_faulted = _record_multiblock_status(tank, data, ps)
 
@@ -642,20 +815,34 @@ function iocontrol.update_facility_status(status)
             end
 
             -- environment detector status
-            if type(rtu_statuses.rad_mon) == "table" then
-                if #rtu_statuses.rad_mon > 0 then
-                    local rad_mon = rtu_statuses.rad_mon[1]
-                    local rtu_faulted = rad_mon[1]  ---@type boolean
-                    fac.radiation     = rad_mon[2]  ---@type number
+            if type(rtu_statuses.envds) == "table" then
+                local max_rad, max_reading, any_conn, any_faulted = 0, types.new_zero_radiation_reading(), false, false
 
-                    fac.ps.publish("rad_computed_status", util.trinary(rtu_faulted, 2, 3))
-                    fac.ps.publish("radiation", fac.radiation)
+                for _, envd in pairs(rtu_statuses.envds) do
+                    local rtu_faulted = envd[1] ---@type boolean
+                    local radiation   = envd[2] ---@type radiation_reading
+                    local rad_raw     = envd[3] ---@type number
+
+                    any_conn = true
+                    any_faulted = any_faulted or rtu_faulted
+
+                    if rad_raw > max_rad then
+                        max_rad = rad_raw
+                        max_reading = radiation
+                    end
+                end
+
+                if any_conn then
+                    fac.radiation = max_reading
+                    fac.ps.publish("rad_computed_status", util.trinary(any_faulted, 2, 3))
                 else
                     fac.radiation = types.new_zero_radiation_reading()
                     fac.ps.publish("rad_computed_status", 1)
                 end
+
+                fac.ps.publish("radiation", fac.radiation)
             else
-                log.debug(log_header .. "radiation monitor list not a table")
+                log.debug(log_header .. "environment detector list not a table")
                 valid = false
             end
         else
@@ -664,6 +851,16 @@ function iocontrol.update_facility_status(status)
         end
 
         fac.ps.publish("rtu_count", fac.rtu_count)
+
+        -- alarm tone commands
+
+        if (type(status[3]) == "table") and (#status[3] == 8) then
+            fac.alarm_tones = status[3]
+            sounder.set(fac.alarm_tones)
+        else
+            log.debug(log_header .. "alarm tones not a table or length mismatch")
+            valid = false
+        end
     end
 
     return valid
@@ -684,8 +881,7 @@ function iocontrol.update_unit_statuses(statuses)
     else
         local burn_rate_sum = 0.0
         local sna_count_sum = 0
-        local pu_rate = 0.0
-        local po_rate = 0.0
+        local pu_rate, po_rate, po_pl_rate, po_am_rate, spent_rate = 0.0, 0.0, 0.0, 0.0, 0.0
 
         -- get all unit statuses
         for i = 1, #statuses do
@@ -696,7 +892,7 @@ function iocontrol.update_unit_statuses(statuses)
 
             local burn_rate = 0.0
 
-            if type(status) ~= "table" or #status ~= 5 then
+            if type(status) ~= "table" or #status ~= 6 then
                 log.debug(log_header .. "invalid status entry in unit statuses (not a table or invalid length)")
                 valid = false
             else
@@ -709,6 +905,7 @@ function iocontrol.update_unit_statuses(statuses)
                 end
 
                 if #reactor_status == 0 then
+                    unit.connected = false
                     unit.unit_ps.publish("computed_status", 1)   -- disconnected
                 elseif #reactor_status == 3 then
                     local mek_status = reactor_status[1]
@@ -768,6 +965,8 @@ function iocontrol.update_unit_statuses(statuses)
                             unit.unit_ps.publish(key, val)
                         end
                     end
+
+                    unit.connected = true
                 else
                     log.debug(log_header .. "reactor status length mismatch")
                     valid = false
@@ -779,8 +978,13 @@ function iocontrol.update_unit_statuses(statuses)
                 if type(rtu_statuses) == "table" then
                     -- boiler statuses
                     if type(rtu_statuses.boilers) == "table" then
+                        local boil_sum = 0
+
                         for id = 1, #unit.boiler_ps_tbl do
-                            if rtu_statuses.boilers[i] == nil then
+                            local connected = rtu_statuses.boilers[id] ~= nil
+                            unit.rtu_hw.boilers[id].connected = connected
+
+                            if not connected then
                                 -- disconnected
                                 unit.boiler_ps_tbl[id].publish("computed_status", 1)
                             end
@@ -788,14 +992,17 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, boiler in pairs(rtu_statuses.boilers) do
                             if type(unit.boiler_data_tbl[id]) == "table" then
-                                local data = unit.boiler_data_tbl[id]   ---@type boilerv_session_db
-                                local ps   = unit.boiler_ps_tbl[id]     ---@type psil
+                                local data = unit.boiler_data_tbl[id] ---@type boilerv_session_db
+                                local ps   = unit.boiler_ps_tbl[id]   ---@type psil
 
                                 local rtu_faulted = _record_multiblock_status(boiler, data, ps)
+                                unit.rtu_hw.boilers[id].faulted = rtu_faulted
 
                                 if rtu_faulted then
                                     ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    boil_sum = boil_sum + data.state.boil_rate
+
                                     if data.state.boil_rate > 0 then
                                         ps.publish("computed_status", 5)    -- active
                                     else
@@ -809,6 +1016,8 @@ function iocontrol.update_unit_statuses(statuses)
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("boiler_boil_sum", boil_sum)
                     else
                         log.debug(log_header .. "boiler list not a table")
                         valid = false
@@ -816,8 +1025,13 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- turbine statuses
                     if type(rtu_statuses.turbines) == "table" then
+                        local flow_sum = 0
+
                         for id = 1, #unit.turbine_ps_tbl do
-                            if rtu_statuses.turbines[i] == nil then
+                            local connected = rtu_statuses.turbines[id] ~= nil
+                            unit.rtu_hw.turbines[id].connected = connected
+
+                            if not connected then
                                 -- disconnected
                                 unit.turbine_ps_tbl[id].publish("computed_status", 1)
                             end
@@ -825,14 +1039,17 @@ function iocontrol.update_unit_statuses(statuses)
 
                         for id, turbine in pairs(rtu_statuses.turbines) do
                             if type(unit.turbine_data_tbl[id]) == "table" then
-                                local data = unit.turbine_data_tbl[id]  ---@type turbinev_session_db
-                                local ps   = unit.turbine_ps_tbl[id]    ---@type psil
+                                local data = unit.turbine_data_tbl[id] ---@type turbinev_session_db
+                                local ps   = unit.turbine_ps_tbl[id]   ---@type psil
 
                                 local rtu_faulted = _record_multiblock_status(turbine, data, ps)
+                                unit.rtu_hw.turbines[id].faulted = rtu_faulted
 
                                 if rtu_faulted then
                                     ps.publish("computed_status", 3)        -- faulted
                                 elseif data.formed then
+                                    flow_sum = flow_sum + data.state.flow_rate
+
                                     if data.tanks.energy_fill >= 0.99 then
                                         ps.publish("computed_status", 6)    -- trip
                                     elseif data.state.flow_rate < 100 then
@@ -848,6 +1065,8 @@ function iocontrol.update_unit_statuses(statuses)
                                 valid = false
                             end
                         end
+
+                        unit.unit_ps.publish("turbine_flow_sum", flow_sum)
                     else
                         log.debug(log_header .. "turbine list not a table")
                         valid = false
@@ -856,7 +1075,7 @@ function iocontrol.update_unit_statuses(statuses)
                     -- dynamic tank statuses
                     if type(rtu_statuses.tanks) == "table" then
                         for id = 1, #unit.tank_ps_tbl do
-                            if rtu_statuses.tanks[i] == nil then
+                            if rtu_statuses.tanks[id] == nil then
                                 -- disconnected
                                 unit.tank_ps_tbl[id].publish("computed_status", 1)
                             end
@@ -877,7 +1096,7 @@ function iocontrol.update_unit_statuses(statuses)
                                     elseif data.tanks.fill < 0.20 then
                                         ps.publish("computed_status", 5)    -- low
                                     else
-                                        ps.publish("computed_status", 5)    -- active
+                                        ps.publish("computed_status", 4)    -- on-line
                                     end
                                 else
                                     ps.publish("computed_status", 2)        -- not formed
@@ -894,10 +1113,15 @@ function iocontrol.update_unit_statuses(statuses)
 
                     -- solar neutron activator status info
                     if type(rtu_statuses.sna) == "table" then
-                        unit.num_snas      = rtu_statuses.sna[1]    ---@type integer
-                        unit.sna_prod_rate = rtu_statuses.sna[2]    ---@type number
+                        unit.num_snas      = rtu_statuses.sna[1] ---@type integer
+                        unit.sna_peak_rate = rtu_statuses.sna[2] ---@type number
+                        unit.sna_max_rate  = rtu_statuses.sna[3] ---@type number
+                        unit.sna_out_rate  = rtu_statuses.sna[4] ---@type number
 
-                        unit.unit_ps.publish("sna_prod_rate", unit.sna_prod_rate)
+                        unit.unit_ps.publish("sna_count", unit.num_snas)
+                        unit.unit_ps.publish("sna_peak_rate", unit.sna_peak_rate)
+                        unit.unit_ps.publish("sna_max_rate", unit.sna_max_rate)
+                        unit.unit_ps.publish("sna_out_rate", unit.sna_out_rate)
 
                         sna_count_sum = sna_count_sum + unit.num_snas
                     else
@@ -906,16 +1130,28 @@ function iocontrol.update_unit_statuses(statuses)
                     end
 
                     -- environment detector status
-                    if type(rtu_statuses.rad_mon) == "table" then
-                        if #rtu_statuses.rad_mon > 0 then
-                            local rad_mon = rtu_statuses.rad_mon[1]
-                            -- local rtu_faulted = rad_mon[1]  ---@type boolean
-                            unit.radiation = rad_mon[2]  ---@type number
+                    if type(rtu_statuses.envds) == "table" then
+                        local max_rad, max_reading, any_conn = 0, types.new_zero_radiation_reading(), false
 
-                            unit.unit_ps.publish("radiation", unit.radiation)
+                        for _, envd in pairs(rtu_statuses.envds) do
+                            local radiation = envd[2] ---@type radiation_reading
+                            local rad_raw   = envd[3] ---@type number
+
+                            any_conn = true
+
+                            if rad_raw > max_rad then
+                                max_rad = rad_raw
+                                max_reading = radiation
+                            end
+                        end
+
+                        if any_conn then
+                            unit.radiation = max_reading
                         else
                             unit.radiation = types.new_zero_radiation_reading()
                         end
+
+                        unit.unit_ps.publish("radiation", unit.radiation)
                     else
                         log.debug(log_header .. "radiation monitor list not a table")
                         valid = false
@@ -982,9 +1218,11 @@ function iocontrol.update_unit_statuses(statuses)
                 local unit_state = status[5]
 
                 if type(unit_state) == "table" then
-                    if #unit_state == 6 then
+                    if #unit_state == 8 then
                         unit.waste_mode = unit_state[5]
                         unit.waste_product = unit_state[6]
+                        unit.last_rate_change_ms = unit_state[7]
+                        unit.turbine_flow_stable = unit_state[8]
 
                         unit.unit_ps.publish("U_StatusLine1", unit_state[1])
                         unit.unit_ps.publish("U_StatusLine2", unit_state[2])
@@ -1002,10 +1240,64 @@ function iocontrol.update_unit_statuses(statuses)
                     valid = false
                 end
 
+                -- valve states
+                local valve_states = status[6]
+
+                if type(valve_states) == "table" then
+                    if #valve_states == 5 then
+                        unit.unit_ps.publish("V_pu_conn", valve_states[1] > 0)
+                        unit.unit_ps.publish("V_pu_state", valve_states[1] == 2)
+                        unit.unit_ps.publish("V_po_conn", valve_states[2] > 0)
+                        unit.unit_ps.publish("V_po_state", valve_states[2] == 2)
+                        unit.unit_ps.publish("V_pl_conn", valve_states[3] > 0)
+                        unit.unit_ps.publish("V_pl_state", valve_states[3] == 2)
+                        unit.unit_ps.publish("V_am_conn", valve_states[4] > 0)
+                        unit.unit_ps.publish("V_am_state", valve_states[4] == 2)
+                        unit.unit_ps.publish("V_emc_conn", valve_states[5] > 0)
+                        unit.unit_ps.publish("V_emc_state", valve_states[5] == 2)
+                    else
+                        log.debug(log_header .. "valve states length mismatch")
+                        valid = false
+                    end
+                else
+                    log.debug(log_header .. "valve states not a table")
+                    valid = false
+                end
+
                 -- determine waste production for this unit, add to statistics
+
                 local is_pu = unit.waste_product == types.WASTE_PRODUCT.PLUTONIUM
-                pu_rate = pu_rate + util.trinary(is_pu, burn_rate / 10.0, 0.0)
-                po_rate = po_rate + util.trinary(not is_pu, math.min(burn_rate / 10.0, unit.sna_prod_rate), 0.0)
+                local waste_rate = burn_rate / 10.0
+
+                local u_spent_rate = waste_rate
+                local u_pu_rate = util.trinary(is_pu, waste_rate, 0.0)
+                local u_po_rate = unit.sna_out_rate
+
+                unit.unit_ps.publish("pu_rate", u_pu_rate)
+                unit.unit_ps.publish("po_rate", u_po_rate)
+
+                unit.unit_ps.publish("sna_in", util.trinary(is_pu, 0, burn_rate))
+
+                if unit.waste_product == types.WASTE_PRODUCT.POLONIUM then
+                    u_spent_rate = u_po_rate
+                    unit.unit_ps.publish("po_pl_rate", u_po_rate)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                    po_pl_rate = po_pl_rate + u_po_rate
+                elseif unit.waste_product == types.WASTE_PRODUCT.ANTI_MATTER then
+                    u_spent_rate = 0
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", u_po_rate)
+                    po_am_rate = po_am_rate + u_po_rate
+                else
+                    unit.unit_ps.publish("po_pl_rate", 0)
+                    unit.unit_ps.publish("po_am_rate", 0)
+                end
+
+                unit.unit_ps.publish("ws_rate", u_spent_rate)
+
+                pu_rate = pu_rate + u_pu_rate
+                po_rate = po_rate + u_po_rate
+                spent_rate = spent_rate + u_spent_rate
             end
         end
 
@@ -1013,9 +1305,9 @@ function iocontrol.update_unit_statuses(statuses)
         io.facility.ps.publish("sna_count", sna_count_sum)
         io.facility.ps.publish("pu_rate", pu_rate)
         io.facility.ps.publish("po_rate", po_rate)
-
-        -- update alarm sounder
-        sounder.eval(io.units)
+        io.facility.ps.publish("po_pl_rate", po_pl_rate)
+        io.facility.ps.publish("po_am_rate", po_am_rate)
+        io.facility.ps.publish("spent_waste_rate", spent_rate)
     end
 
     return valid

coordinator/process.lua

@@ -19,15 +19,21 @@ local process = {}
 local self = {
     io = nil,       ---@type ioctl
     comms = nil,    ---@type coord_comms
-    ---@class coord_auto_config
-    config = {
-        mode = PROCESS.INACTIVE,
-        burn_target = 0.0,
-        charge_target = 0.0,
-        gen_target = 0.0,
-        limits = {},
-        waste_product = PRODUCT.PLUTONIUM,
-        pu_fallback = false
+    ---@class coord_control_states
+    control_states = {
+        ---@class coord_auto_config
+        process = {
+            mode = PROCESS.INACTIVE,
+            burn_target = 0.0,
+            charge_target = 0.0,
+            gen_target = 0.0,
+            limits = {},
+            waste_product = PRODUCT.PLUTONIUM,
+            pu_fallback = false,
+            sps_low_power = false
+        },
+        waste_modes = {},
+        priority_groups = {}
     }
 }
 
@@ -42,63 +48,67 @@ function process.init(iocontrol, coord_comms)
     self.io = iocontrol
     self.comms = coord_comms
 
+    local ctl_proc = self.control_states.process
+
     for i = 1, self.io.facility.num_units do
-        self.config.limits[i] = 0.1
+        ctl_proc.limits[i] = 0.1
     end
 
-    -- load settings
-    if not settings.load("/coord.settings") then
-        log.error("process.init(): failed to load coordinator settings file")
-    end
+    local ctrl_states = settings.get("ControlStates", {})
+    local config = ctrl_states.process  ---@type coord_auto_config
 
     -- facility auto control configuration
-    local config = settings.get("PROCESS")  ---@type coord_auto_config|nil
     if type(config) == "table" then
-        self.config.mode = config.mode
-        self.config.burn_target = config.burn_target
-        self.config.charge_target = config.charge_target
-        self.config.gen_target = config.gen_target
-        self.config.limits = config.limits
-        self.config.waste_product = config.waste_product
-        self.config.pu_fallback = config.pu_fallback
+        ctl_proc.mode = config.mode
+        ctl_proc.burn_target = config.burn_target
+        ctl_proc.charge_target = config.charge_target
+        ctl_proc.gen_target = config.gen_target
+        ctl_proc.limits = config.limits
+        ctl_proc.waste_product = config.waste_product
+        ctl_proc.pu_fallback = config.pu_fallback
+        ctl_proc.sps_low_power = config.sps_low_power
 
-        self.io.facility.ps.publish("process_mode", self.config.mode)
-        self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
-        self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
-        self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
-        self.io.facility.ps.publish("process_waste_product", self.config.waste_product)
-        self.io.facility.ps.publish("process_pu_fallback", self.config.pu_fallback)
+        self.io.facility.ps.publish("process_mode", ctl_proc.mode)
+        self.io.facility.ps.publish("process_burn_target", ctl_proc.burn_target)
+        self.io.facility.ps.publish("process_charge_target", ctl_proc.charge_target)
+        self.io.facility.ps.publish("process_gen_target", ctl_proc.gen_target)
+        self.io.facility.ps.publish("process_waste_product", ctl_proc.waste_product)
+        self.io.facility.ps.publish("process_pu_fallback", ctl_proc.pu_fallback)
+        self.io.facility.ps.publish("process_sps_low_power", ctl_proc.sps_low_power)
 
-        for id = 1, math.min(#self.config.limits, self.io.facility.num_units) do
+        for id = 1, math.min(#ctl_proc.limits, self.io.facility.num_units) do
             local unit = self.io.units[id]   ---@type ioctl_unit
-            unit.unit_ps.publish("burn_limit", self.config.limits[id])
+            unit.unit_ps.publish("burn_limit", ctl_proc.limits[id])
         end
 
-        log.info("PROCESS: loaded auto control settings from coord.settings")
+        log.info("PROCESS: loaded auto control settings")
 
         -- notify supervisor of auto waste config
-        self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, self.config.waste_product)
-        self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, self.config.pu_fallback)
+        self.comms.send_fac_command(FAC_COMMAND.SET_WASTE_MODE, ctl_proc.waste_product)
+        self.comms.send_fac_command(FAC_COMMAND.SET_PU_FB, ctl_proc.pu_fallback)
+        self.comms.send_fac_command(FAC_COMMAND.SET_SPS_LP, ctl_proc.sps_low_power)
     end
 
     -- unit waste states
-    local waste_modes = settings.get("WASTE_MODES")  ---@type table|nil
+    local waste_modes = ctrl_states.waste_modes  ---@type table|nil
     if type(waste_modes) == "table" then
         for id, mode in pairs(waste_modes) do
+            self.control_states.waste_modes[id] = mode
             self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
         end
 
-        log.info("PROCESS: loaded unit waste mode settings from coord.settings")
+        log.info("PROCESS: loaded unit waste mode settings")
     end
 
     -- unit priority groups
-    local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil
+    local prio_groups = ctrl_states.priority_groups ---@type table|nil
     if type(prio_groups) == "table" then
         for id, group in pairs(prio_groups) do
+            self.control_states.priority_groups[id] = group
             self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, id, group)
         end
 
-        log.info("PROCESS: loaded priority groups settings from coord.settings")
+        log.info("PROCESS: loaded priority groups settings")
     end
 end
 
@@ -155,15 +165,10 @@ function process.set_unit_waste(id, mode)
     self.comms.send_unit_command(UNIT_COMMAND.SET_WASTE, id, mode)
     log.debug(util.c("PROCESS: UNIT[", id, "] SET WASTE ", mode))
 
-    local waste_mode = settings.get("WASTE_MODES")  ---@type table|nil
+    self.control_states.waste_modes[id] = mode
+    settings.set("ControlStates", self.control_states)
 
-    if type(waste_mode) ~= "table" then waste_mode = {} end
-
-    waste_mode[id] = mode
-
-    settings.set("WASTE_MODES", waste_mode)
-
-    if not settings.save("/coord.settings") then
+    if not settings.save("/coordinator.settings") then
         log.error("process.set_unit_waste(): failed to save coordinator settings file")
     end
 end
@@ -198,15 +203,10 @@ function process.set_group(unit_id, group_id)
     self.comms.send_unit_command(UNIT_COMMAND.SET_GROUP, unit_id, group_id)
     log.debug(util.c("PROCESS: UNIT[", unit_id, "] SET GROUP ", group_id))
 
-    local prio_groups = settings.get("PRIORITY_GROUPS") ---@type table|nil
+    self.control_states.priority_groups[unit_id] = group_id
+    settings.set("ControlStates", self.control_states)
 
-    if type(prio_groups) ~= "table" then prio_groups = {} end
-
-    prio_groups[unit_id] = group_id
-
-    settings.set("PRIORITY_GROUPS", prio_groups)
-
-    if not settings.save("/coord.settings") then
+    if not settings.save("/coordinator.settings") then
         log.error("process.set_group(): failed to save coordinator settings file")
     end
 end
@@ -217,20 +217,14 @@ end
 
 -- write auto process control to config file
 local function _write_auto_config()
-    -- attempt to load settings
-    if not settings.load("/coord.settings") then
-        log.warning("process._write_auto_config(): failed to load coordinator settings file")
-    end
-
     -- save config
-    settings.set("PROCESS", self.config)
-    local saved = settings.save("/coord.settings")
-
+    settings.set("ControlStates", self.control_states)
+    local saved = settings.save("/coordinator.settings")
     if not saved then
         log.warning("process._write_auto_config(): failed to save coordinator settings file")
     end
 
-    return not not saved
+    return saved
 end
 
 -- stop automatic process control
@@ -241,7 +235,7 @@ end
 
 -- start automatic process control
 function process.start_auto()
-    self.comms.send_auto_start(self.config)
+    self.comms.send_auto_start(self.control_states.process)
     log.debug("PROCESS: START AUTO CTL")
 end
 
@@ -253,7 +247,7 @@ function process.set_process_waste(product)
     log.debug(util.c("PROCESS: SET WASTE ", product))
 
     -- update config table and save
-    self.config.waste_product = product
+    self.control_states.process.waste_product = product
     _write_auto_config()
 end
 
@@ -265,7 +259,19 @@ function process.set_pu_fallback(enabled)
     log.debug(util.c("PROCESS: SET PU FALLBACK ", enabled))
 
     -- update config table and save
-    self.config.pu_fallback = enabled
+    self.control_states.process.pu_fallback = enabled
+    _write_auto_config()
+end
+
+-- set automatic process control SPS usage at low power
+---@param enabled boolean whether to enable SPS usage at low power
+function process.set_sps_low_power(enabled)
+    self.comms.send_fac_command(FAC_COMMAND.SET_SPS_LP, enabled)
+
+    log.debug(util.c("PROCESS: SET SPS LOW POWER ", enabled))
+
+    -- update config table and save
+    self.control_states.process.sps_low_power = enabled
     _write_auto_config()
 end
 
@@ -279,11 +285,12 @@ function process.save(mode, burn_target, charge_target, gen_target, limits)
     log.debug("PROCESS: SAVE")
 
     -- update config table
-    self.config.mode = mode
-    self.config.burn_target = burn_target
-    self.config.charge_target = charge_target
-    self.config.gen_target = gen_target
-    self.config.limits = limits
+    local ctl_proc = self.control_states.process
+    ctl_proc.mode = mode
+    ctl_proc.burn_target = burn_target
+    ctl_proc.charge_target = charge_target
+    ctl_proc.gen_target = gen_target
+    ctl_proc.limits = limits
 
     -- save config
     self.io.facility.save_cfg_ack(_write_auto_config())
@@ -294,22 +301,23 @@ end
 function process.start_ack_handle(response)
     local ack = response[1]
 
-    self.config.mode = response[2]
-    self.config.burn_target = response[3]
-    self.config.charge_target = response[4]
-    self.config.gen_target = response[5]
+    local ctl_proc = self.control_states.process
+    ctl_proc.mode = response[2]
+    ctl_proc.burn_target = response[3]
+    ctl_proc.charge_target = response[4]
+    ctl_proc.gen_target = response[5]
 
     for i = 1, math.min(#response[6], self.io.facility.num_units) do
-        self.config.limits[i] = response[6][i]
+        ctl_proc.limits[i] = response[6][i]
 
         local unit = self.io.units[i]   ---@type ioctl_unit
-        unit.unit_ps.publish("burn_limit", self.config.limits[i])
+        unit.unit_ps.publish("burn_limit", ctl_proc.limits[i])
     end
 
-    self.io.facility.ps.publish("process_mode", self.config.mode)
-    self.io.facility.ps.publish("process_burn_target", self.config.burn_target)
-    self.io.facility.ps.publish("process_charge_target", self.config.charge_target)
-    self.io.facility.ps.publish("process_gen_target", self.config.gen_target)
+    self.io.facility.ps.publish("process_mode", ctl_proc.mode)
+    self.io.facility.ps.publish("process_burn_target", ctl_proc.burn_target)
+    self.io.facility.ps.publish("process_charge_target", ctl_proc.charge_target)
+    self.io.facility.ps.publish("process_gen_target", ctl_proc.gen_target)
 
     self.io.facility.start_ack(ack)
 end
@@ -317,14 +325,14 @@ end
 -- record waste product state after attempting to change it
 ---@param response WASTE_PRODUCT supervisor waste product state
 function process.waste_ack_handle(response)
-    self.config.waste_product = response
+    self.control_states.process.waste_product = response
     self.io.facility.ps.publish("process_waste_product", response)
 end
 
 -- record plutonium fallback state after attempting to change it
 ---@param response boolean supervisor plutonium fallback state
 function process.pu_fb_ack_handle(response)
-    self.config.pu_fallback = response
+    self.control_states.process.pu_fallback = response
     self.io.facility.ps.publish("process_pu_fallback", response)
 end
 

coordinator/renderer.lua

@@ -2,26 +2,33 @@
 -- Graphics Rendering Control
 --
 
-local log        = require("scada-common.log")
-local util       = require("scada-common.util")
+local log         = require("scada-common.log")
+local util        = require("scada-common.util")
 
-local iocontrol  = require("coordinator.iocontrol")
+local coordinator = require("coordinator.coordinator")
+local iocontrol   = require("coordinator.iocontrol")
 
-local style      = require("coordinator.ui.style")
-local pgi        = require("coordinator.ui.pgi")
+local style       = require("coordinator.ui.style")
+local pgi         = require("coordinator.ui.pgi")
 
-local panel_view = require("coordinator.ui.layout.front_panel")
-local main_view  = require("coordinator.ui.layout.main_view")
-local unit_view  = require("coordinator.ui.layout.unit_view")
+local flow_view   = require("coordinator.ui.layout.flow_view")
+local panel_view  = require("coordinator.ui.layout.front_panel")
+local main_view   = require("coordinator.ui.layout.main_view")
+local unit_view   = require("coordinator.ui.layout.unit_view")
 
-local flasher    = require("graphics.flasher")
+local core        = require("graphics.core")
+local flasher     = require("graphics.flasher")
 
-local DisplayBox = require("graphics.elements.displaybox")
+local DisplayBox  = require("graphics.elements.displaybox")
 
+local log_render = coordinator.log_render
+
+---@class coord_renderer
 local renderer = {}
 
 -- render engine
 local engine = {
+    color_mode = 1,         ---@type COLOR_MODE
     monitors = nil,         ---@type monitors_struct|nil
     dmesg_window = nil,     ---@type table|nil
     ui_ready = false,
@@ -29,8 +36,10 @@ local engine = {
     ui = {
         front_panel = nil,  ---@type graphics_element|nil
         main_display = nil, ---@type graphics_element|nil
+        flow_display = nil, ---@type graphics_element|nil
         unit_displays = {}
-    }
+    },
+    disable_flow_view = false
 }
 
 -- init a display to the "default", but set text scale to 0.5
@@ -43,9 +52,34 @@ local function _init_display(monitor)
     monitor.setCursorPos(1, 1)
 
     -- set overridden colors
-    for i = 1, #style.colors do
-        monitor.setPaletteColor(style.colors[i].c, style.colors[i].hex)
+    for i = 1, #style.theme.colors do
+        monitor.setPaletteColor(style.theme.colors[i].c, style.theme.colors[i].hex)
     end
+
+    -- apply color mode
+    local c_mode_overrides = style.theme.color_modes[engine.color_mode]
+    for i = 1, #c_mode_overrides do
+        monitor.setPaletteColor(c_mode_overrides[i].c, c_mode_overrides[i].hex)
+    end
+end
+
+-- print out that the monitor is too small
+---@param monitor table monitor
+local function _print_too_small(monitor)
+    monitor.setCursorPos(1, 1)
+    monitor.setBackgroundColor(colors.black)
+    monitor.setTextColor(colors.red)
+    monitor.clear()
+    monitor.write("monitor too small")
+end
+
+-- apply renderer configurations
+---@param config crd_config
+function renderer.configure(config)
+    style.set_themes(config.MainTheme, config.FrontPanelTheme, config.ColorMode)
+
+    engine.color_mode = config.ColorMode
+    engine.disable_flow_view = config.DisableFlowView
 end
 
 -- link to the monitor peripherals
@@ -54,14 +88,16 @@ function renderer.set_displays(monitors)
     engine.monitors = monitors
 
     -- report to front panel as connected
-    iocontrol.fp_monitor_state(0, true)
+    iocontrol.fp_monitor_state("main", engine.monitors.main ~= nil)
+    iocontrol.fp_monitor_state("flow", engine.monitors.flow ~= nil)
     for i = 1, #engine.monitors.unit_displays do iocontrol.fp_monitor_state(i, true) end
 end
 
 -- init all displays in use by the renderer
 function renderer.init_displays()
-    -- init primary monitor
-    _init_display(engine.monitors.primary)
+    -- init main and flow monitors
+    _init_display(engine.monitors.main)
+    if not engine.disable_flow_view then _init_display(engine.monitors.flow) end
 
     -- init unit displays
     for _, monitor in ipairs(engine.monitors.unit_displays) do
@@ -75,56 +111,48 @@ function renderer.init_displays()
     term.setCursorPos(1, 1)
 
     -- set overridden colors
-    for i = 1, #style.fp.colors do
-        term.setPaletteColor(style.fp.colors[i].c, style.fp.colors[i].hex)
-    end
-end
-
--- check main display width
----@nodiscard
----@return boolean width_okay
-function renderer.validate_main_display_width()
-    local w, _ = engine.monitors.primary.getSize()
-    return w == 164
-end
-
--- check display sizes
----@nodiscard
----@return boolean valid all unit display dimensions OK
-function renderer.validate_unit_display_sizes()
-    local valid = true
-
-    for id, monitor in ipairs(engine.monitors.unit_displays) do
-        local w, h = monitor.getSize()
-        if w ~= 79 or h ~= 52 then
-            log.warning(util.c("RENDERER: unit ", id, " display resolution not 79 wide by 52 tall: ", w, ", ", h))
-            valid = false
-        end
+    for i = 1, #style.fp_theme.colors do
+        term.setPaletteColor(style.fp_theme.colors[i].c, style.fp_theme.colors[i].hex)
     end
 
-    return valid
+    -- apply color mode
+    local c_mode_overrides = style.fp_theme.color_modes[engine.color_mode]
+    for i = 1, #c_mode_overrides do
+        term.setPaletteColor(c_mode_overrides[i].c, c_mode_overrides[i].hex)
+    end
 end
 
 -- initialize the dmesg output window
 function renderer.init_dmesg()
-    local disp_x, disp_y = engine.monitors.primary.getSize()
-    engine.dmesg_window = window.create(engine.monitors.primary, 1, 1, disp_x, disp_y)
+    local disp_w, disp_h = engine.monitors.main.getSize()
+    engine.dmesg_window = window.create(engine.monitors.main, 1, 1, disp_w, disp_h)
     log.direct_dmesg(engine.dmesg_window)
 end
 
--- start the coordinator front panel
-function renderer.start_fp()
+-- try to start the front panel
+---@return boolean success, any error_msg
+function renderer.try_start_fp()
+    local status, msg = true, nil
+
     if not engine.fp_ready then
         -- show front panel view on terminal
-        engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
-        panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
+        status, msg = pcall(function ()
+            engine.ui.front_panel = DisplayBox{window=term.native(),fg_bg=style.fp.root}
+            panel_view(engine.ui.front_panel, #engine.monitors.unit_displays)
+        end)
 
-        -- start flasher callback task
-        flasher.run()
-
-        -- report front panel as ready
-        engine.fp_ready = true
+        if status then
+            -- start flasher callback task and report ready
+            flasher.run()
+            engine.fp_ready = true
+        else
+            -- report fail and close front panel
+            msg = core.extract_assert_msg(msg)
+            renderer.close_fp()
+        end
     end
+
+    return status, msg
 end
 
 -- close out the front panel
@@ -144,9 +172,9 @@ function renderer.close_fp()
         engine.fp_ready = false
 
         -- restore colors
-        for i = 1, #style.colors do
-            local r, g, b = term.nativePaletteColor(style.colors[i].c)
-            term.setPaletteColor(style.colors[i].c, r, g, b)
+        for i = 1, #style.fp_theme.colors do
+            local r, g, b = term.nativePaletteColor(style.fp_theme.colors[i].c)
+            term.setPaletteColor(style.fp_theme.colors[i].c, r, g, b)
         end
 
         -- reset terminal
@@ -157,30 +185,50 @@ function renderer.close_fp()
     end
 end
 
--- start the coordinator GUI
-function renderer.start_ui()
+-- try to start the main GUI
+---@return boolean success, any error_msg
+function renderer.try_start_ui()
+    local status, msg = true, nil
+
     if not engine.ui_ready then
         -- hide dmesg
         engine.dmesg_window.setVisible(false)
 
-        -- show main view on main monitor
-        if engine.monitors.primary ~= nil then
-            engine.ui.main_display = DisplayBox{window=engine.monitors.primary,fg_bg=style.root}
-            main_view(engine.ui.main_display)
+        status, msg = pcall(function ()
+            -- show main view on main monitor
+            if engine.monitors.main ~= nil then
+                engine.ui.main_display = DisplayBox{window=engine.monitors.main,fg_bg=style.root}
+                main_view(engine.ui.main_display)
+                util.nop()
+            end
+
+            -- show flow view on flow monitor
+            if engine.monitors.flow ~= nil then
+                engine.ui.flow_display = DisplayBox{window=engine.monitors.flow,fg_bg=style.root}
+                flow_view(engine.ui.flow_display)
+                util.nop()
+            end
+
+            -- show unit views on unit displays
+            for idx, display in pairs(engine.monitors.unit_displays) do
+                engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
+                unit_view(engine.ui.unit_displays[idx], idx)
+                util.nop()
+            end
+        end)
+
+        if status then
+            -- start flasher callback task and report ready
+            flasher.run()
+            engine.ui_ready = true
+        else
+            -- report fail and close ui
+            msg = core.extract_assert_msg(msg)
+            renderer.close_ui()
         end
-
-        -- show unit views on unit displays
-        for idx, display in pairs(engine.monitors.unit_displays) do
-            engine.ui.unit_displays[idx] = DisplayBox{window=display,fg_bg=style.root}
-            unit_view(engine.ui.unit_displays[idx], idx)
-        end
-
-        -- start flasher callback task
-        flasher.run()
-
-        -- report ui as ready
-        engine.ui_ready = true
     end
+
+    return status, msg
 end
 
 -- close out the UI
@@ -192,6 +240,7 @@ function renderer.close_ui()
 
     -- delete element trees
     if engine.ui.main_display ~= nil then engine.ui.main_display.delete() end
+    if engine.ui.flow_display ~= nil then engine.ui.flow_display.delete() end
     for _, display in pairs(engine.ui.unit_displays) do display.delete() end
 
     -- report ui as not ready
@@ -199,11 +248,17 @@ function renderer.close_ui()
 
     -- clear root UI elements
     engine.ui.main_display = nil
+    engine.ui.flow_display = nil
     engine.ui.unit_displays = {}
 
     -- clear unit monitors
     for _, monitor in ipairs(engine.monitors.unit_displays) do monitor.clear() end
 
+    if not engine.disable_flow_view then
+        -- clear flow monitor
+        engine.monitors.flow.clear()
+    end
+
     -- re-draw dmesg
     engine.dmesg_window.setVisible(true)
     engine.dmesg_window.redraw()
@@ -225,32 +280,43 @@ function renderer.ui_ready() return engine.ui_ready end
 function renderer.handle_disconnect(device)
     local is_used = false
 
-    if engine.monitors ~= nil then
-        if engine.monitors.primary == device then
-            if engine.ui.main_display ~= nil then
-                -- delete element tree and clear root UI elements
-                engine.ui.main_display.delete()
-            end
+    if not engine.monitors then return false end
 
-            is_used = true
-            engine.monitors.primary = nil
-            engine.ui.main_display = nil
+    if engine.monitors.main == device then
+        if engine.ui.main_display ~= nil then
+            -- delete element tree and clear root UI elements
+            engine.ui.main_display.delete()
+        end
 
-            iocontrol.fp_monitor_state(0, false)
-        else
-            for idx, monitor in pairs(engine.monitors.unit_displays) do
-                if monitor == device then
-                    if engine.ui.unit_displays[idx] ~= nil then
-                        engine.ui.unit_displays[idx].delete()
-                    end
+        is_used = true
+        engine.monitors.main = nil
+        engine.ui.main_display = nil
 
-                    is_used = true
-                    engine.monitors.unit_displays[idx] = nil
-                    engine.ui.unit_displays[idx] = nil
+        iocontrol.fp_monitor_state("main", false)
+    elseif engine.monitors.flow == device then
+        if engine.ui.flow_display ~= nil then
+            -- delete element tree and clear root UI elements
+            engine.ui.flow_display.delete()
+        end
 
-                    iocontrol.fp_monitor_state(idx, false)
-                    break
+        is_used = true
+        engine.monitors.flow = nil
+        engine.ui.flow_display = nil
+
+        iocontrol.fp_monitor_state("flow", false)
+    else
+        for idx, monitor in pairs(engine.monitors.unit_displays) do
+            if monitor == device then
+                if engine.ui.unit_displays[idx] ~= nil then
+                    engine.ui.unit_displays[idx].delete()
                 end
+
+                is_used = true
+                engine.monitors.unit_displays[idx] = nil
+                engine.ui.unit_displays[idx] = nil
+
+                iocontrol.fp_monitor_state(idx, false)
+                break
             end
         end
     end
@@ -265,41 +331,29 @@ end
 function renderer.handle_reconnect(name, device)
     local is_used = false
 
-    if engine.monitors ~= nil then
-        if engine.monitors.primary_name == name then
-            is_used = true
-            _init_display(device)
-            engine.monitors.primary = device
+    if not engine.monitors then return false end
 
-            local disp_x, disp_y = engine.monitors.primary.getSize()
-            engine.dmesg_window.reposition(1, 1, disp_x, disp_y, engine.monitors.primary)
+    -- note: handle_resize is a more adaptive way of re-initializing a connected monitor
+    --       since it can handle a monitor being reconnected that isn't the right size
 
-            if engine.ui_ready and (engine.ui.main_display == nil) then
-                engine.dmesg_window.setVisible(false)
+    if engine.monitors.main_name == name then
+        is_used = true
+        engine.monitors.main = device
 
-                engine.ui.main_display = DisplayBox{window=device,fg_bg=style.root}
-                main_view(engine.ui.main_display)
-            else
-                engine.dmesg_window.setVisible(true)
-                engine.dmesg_window.redraw()
-            end
+        renderer.handle_resize(name)
+    elseif engine.monitors.flow_name == name then
+        is_used = true
+        engine.monitors.flow = device
 
-            iocontrol.fp_monitor_state(0, true)
-        else
-            for idx, monitor in ipairs(engine.monitors.unit_name_map) do
-                if monitor == name then
-                    is_used = true
-                    _init_display(device)
-                    engine.monitors.unit_displays[idx] = device
+        renderer.handle_resize(name)
+    else
+        for idx, monitor in ipairs(engine.monitors.unit_name_map) do
+            if monitor == name then
+                is_used = true
+                engine.monitors.unit_displays[idx] = device
 
-                    if engine.ui_ready and (engine.ui.unit_displays[idx] == nil) then
-                        engine.ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
-                        unit_view(engine.ui.unit_displays[idx], idx)
-                    end
-
-                    iocontrol.fp_monitor_state(idx, true)
-                    break
-                end
+                renderer.handle_resize(name)
+                break
             end
         end
     end
@@ -307,6 +361,142 @@ function renderer.handle_reconnect(name, device)
     return is_used
 end
 
+-- handle a monitor being resized<br>
+-- returns if this monitor is assigned + if the assigned screen still fits
+---@param name string monitor name
+---@return boolean is_used, boolean is_ok
+function renderer.handle_resize(name)
+    local is_used = false
+    local is_ok = true
+    local ui = engine.ui
+
+    if not engine.monitors then return false, false end
+
+    if engine.monitors.main_name == name and engine.monitors.main then
+        local device = engine.monitors.main  ---@type table
+
+        -- this is necessary if the bottom left block was broken and on reconnect
+        _init_display(device)
+
+        is_used = true
+
+        -- resize dmesg window if needed, but don't make it thinner
+        local disp_w, disp_h = engine.monitors.main.getSize()
+        local dmsg_w, _ = engine.dmesg_window.getSize()
+        engine.dmesg_window.reposition(1, 1, math.max(disp_w, dmsg_w), disp_h, engine.monitors.main)
+
+        if ui.main_display then
+            ui.main_display.delete()
+            ui.main_display = nil
+        end
+
+        iocontrol.fp_monitor_state("main", true)
+
+        engine.dmesg_window.setVisible(not engine.ui_ready)
+
+        if engine.ui_ready then
+            local draw_start = util.time_ms()
+            local ok = pcall(function ()
+                ui.main_display = DisplayBox{window=device,fg_bg=style.root}
+                main_view(ui.main_display)
+            end)
+
+            if ok then
+                log_render("main view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
+            else
+                if ui.main_display then
+                    ui.main_display.delete()
+                    ui.main_display = nil
+                end
+
+                _print_too_small(device)
+
+                iocontrol.fp_monitor_state("main", false)
+                is_ok = false
+            end
+        else engine.dmesg_window.redraw() end
+    elseif engine.monitors.flow_name == name and engine.monitors.flow then
+        local device = engine.monitors.flow ---@type table
+
+        -- this is necessary if the bottom left block was broken and on reconnect
+        _init_display(device)
+
+        is_used = true
+
+        if ui.flow_display then
+            ui.flow_display.delete()
+            ui.flow_display = nil
+        end
+
+        iocontrol.fp_monitor_state("flow", true)
+
+        if engine.ui_ready then
+            local draw_start = util.time_ms()
+            local ok = pcall(function ()
+                ui.flow_display = DisplayBox{window=device,fg_bg=style.root}
+                flow_view(ui.flow_display)
+            end)
+
+            if ok then
+                log_render("flow view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
+            else
+                if ui.flow_display then
+                    ui.flow_display.delete()
+                    ui.flow_display = nil
+                end
+
+                _print_too_small(device)
+
+                iocontrol.fp_monitor_state("flow", false)
+                is_ok = false
+            end
+        end
+    else
+        for idx, monitor in ipairs(engine.monitors.unit_name_map) do
+            local device = engine.monitors.unit_displays[idx]
+
+            if monitor == name and device then
+                -- this is necessary if the bottom left block was broken and on reconnect
+                _init_display(device)
+
+                is_used = true
+
+                if ui.unit_displays[idx] then
+                    ui.unit_displays[idx].delete()
+                    ui.unit_displays[idx] = nil
+                end
+
+                iocontrol.fp_monitor_state(idx, true)
+
+                if engine.ui_ready then
+                    local draw_start = util.time_ms()
+                    local ok = pcall(function ()
+                        ui.unit_displays[idx] = DisplayBox{window=device,fg_bg=style.root}
+                        unit_view(ui.unit_displays[idx], idx)
+                    end)
+
+                    if ok then
+                        log_render("unit " .. idx .. " view re-draw completed in " .. (util.time_ms() - draw_start) .. "ms")
+                    else
+                        if ui.unit_displays[idx] then
+                            ui.unit_displays[idx].delete()
+                            ui.unit_displays[idx] = nil
+                        end
+
+                        _print_too_small(device)
+
+                        iocontrol.fp_monitor_state(idx, false)
+                        is_ok = false
+                    end
+                end
+
+                break
+            end
+        end
+    end
+
+    return is_used, is_ok
+end
 
 -- handle a touch event
 ---@param event mouse_interaction|nil
@@ -315,14 +505,15 @@ function renderer.handle_mouse(event)
         if engine.fp_ready and event.monitor == "terminal" then
             engine.ui.front_panel.handle_mouse(event)
         elseif engine.ui_ready then
-            if event.monitor == engine.monitors.primary_name then
-                engine.ui.main_display.handle_mouse(event)
+            if event.monitor == engine.monitors.main_name then
+                if engine.ui.main_display then engine.ui.main_display.handle_mouse(event) end
+            elseif event.monitor == engine.monitors.flow_name then
+                if engine.ui.flow_display then engine.ui.flow_display.handle_mouse(event) end
             else
                 for id, monitor in ipairs(engine.monitors.unit_name_map) do
-                    if event.monitor == monitor then
-                        local layout = engine.ui.unit_displays[id]  ---@type graphics_element
-                        layout.handle_mouse(event)
-                        break
+                    local display = engine.ui.unit_displays[id]
+                    if event.monitor == monitor and display then
+                        if display then display.handle_mouse(event) end
                     end
                 end
             end

coordinator/session/apisessions.lua

@@ -3,7 +3,6 @@ local log       = require("scada-common.log")
 local mqueue    = require("scada-common.mqueue")
 local util      = require("scada-common.util")
 
-local config    = require("coordinator.config")
 local iocontrol = require("coordinator.iocontrol")
 
 local pocket    = require("coordinator.session.pocket")
@@ -11,7 +10,8 @@ local pocket    = require("coordinator.session.pocket")
 local apisessions = {}
 
 local self = {
-    nic = nil,
+    nic = nil,    ---@type nic
+    config = nil, ---@type crd_config
     next_id = 0,
     sessions = {}
 }
@@ -32,7 +32,7 @@ local function _api_handle_outq(session)
         if msg ~= nil then
             if msg.qtype == mqueue.TYPE.PACKET then
                 -- handle a packet to be sent
-                self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
+                self.nic.transmit(self.config.PKT_Channel, self.config.CRD_Channel, msg.message)
             elseif msg.qtype == mqueue.TYPE.COMMAND then
                 -- handle instruction/notification
             elseif msg.qtype == mqueue.TYPE.DATA then
@@ -42,8 +42,8 @@ local function _api_handle_outq(session)
 
         -- max 100ms spent processing queue
         if util.time() - handle_start > 100 then
-            log.warning("[API] out queue handler exceeded 100ms queue process limit")
-            log.warning(util.c("[API] offending session: ", session))
+            log.warning("API: out queue handler exceeded 100ms queue process limit")
+            log.warning(util.c("API: offending session: ", session))
             break
         end
     end
@@ -59,19 +59,21 @@ local function _shutdown(session)
     while session.out_queue.ready() do
         local msg = session.out_queue.pop()
         if msg ~= nil and msg.qtype == mqueue.TYPE.PACKET then
-            self.nic.transmit(config.PKT_CHANNEL, config.CRD_CHANNEL, msg.message)
+            self.nic.transmit(self.config.PKT_Channel, self.config.CRD_Channel, msg.message)
         end
     end
 
-    log.debug(util.c("[API] closed session ", session))
+    log.debug(util.c("API: closed session ", session))
 end
 
 -- PUBLIC FUNCTIONS --
 
 -- initialize apisessions
----@param nic nic
-function apisessions.init(nic)
+---@param nic nic network interface
+---@param config crd_config coordinator config
+function apisessions.init(nic, config)
     self.nic = nic
+    self.config = config
 end
 
 -- find a session by remote port
@@ -103,7 +105,7 @@ function apisessions.establish_session(source_addr, version)
 
     local id = self.next_id
 
-    pkt_s.instance = pocket.new_session(id, source_addr, pkt_s.in_queue, pkt_s.out_queue, config.API_TIMEOUT)
+    pkt_s.instance = pocket.new_session(id, source_addr, pkt_s.in_queue, pkt_s.out_queue, self.config.API_Timeout)
     table.insert(self.sessions, pkt_s)
 
     local mt = {
@@ -114,7 +116,7 @@ function apisessions.establish_session(source_addr, version)
     setmetatable(pkt_s, mt)
 
     iocontrol.fp_pkt_connected(id, version, source_addr)
-    log.debug(util.c("[API] established new session: ", pkt_s))
+    log.debug(util.c("API: established new session: ", pkt_s))
 
     self.next_id = id + 1
 
@@ -130,7 +132,7 @@ function apisessions.check_all_watchdogs(timer_event)
         if session.open then
             local triggered = session.instance.check_wd(timer_event)
             if triggered then
-                log.debug(util.c("[API] watchdog closing session ", session, "..."))
+                log.debug(util.c("API: watchdog closing session ", session, "..."))
                 _shutdown(session)
             end
         end
@@ -156,7 +158,7 @@ function apisessions.free_all_closed()
 
     ---@param session pkt_session_struct
     local on_delete = function (session)
-        log.debug(util.c("[API] free'ing closed session ", session))
+        log.debug(util.c("API: free'ing closed session ", session))
     end
 
     util.filter_table(self.sessions, f, on_delete)

coordinator/session/pocket.lua

@@ -8,8 +8,8 @@ local iocontrol = require("coordinator.iocontrol")
 local pocket = {}
 
 local PROTOCOL = comms.PROTOCOL
--- local CAPI_TYPE = comms.CAPI_TYPE
-local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
+local CRDN_TYPE = comms.CRDN_TYPE
+local MGMT_TYPE = comms.MGMT_TYPE
 
 -- retry time constants in ms
 -- local INITIAL_WAIT = 1500
@@ -72,22 +72,22 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
         iocontrol.fp_pkt_disconnected(id)
     end
 
-    -- send a CAPI packet
-    -----@param msg_type CAPI_TYPE
-    -----@param msg table
-    -- local function _send(msg_type, msg)
-    --     local s_pkt = comms.scada_packet()
-    --     local c_pkt = comms.capi_packet()
+    -- send a CRDN packet
+    ---@param msg_type CRDN_TYPE
+    ---@param msg table
+    local function _send(msg_type, msg)
+        local s_pkt = comms.scada_packet()
+        local c_pkt = comms.crdn_packet()
 
-    --     c_pkt.make(msg_type, msg)
-    --     s_pkt.make(self.seq_num, PROTOCOL.COORD_API, c_pkt.raw_sendable())
+        c_pkt.make(msg_type, msg)
+        s_pkt.make(s_addr, self.seq_num, PROTOCOL.SCADA_CRDN, c_pkt.raw_sendable())
 
-    --     out_queue.push_packet(s_pkt)
-    --     self.seq_num = self.seq_num + 1
-    -- end
+        out_queue.push_packet(s_pkt)
+        self.seq_num = self.seq_num + 1
+    end
 
     -- send a SCADA management packet
-    ---@param msg_type SCADA_MGMT_TYPE
+    ---@param msg_type MGMT_TYPE
     ---@param msg table
     local function _send_mgmt(msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -101,7 +101,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     end
 
     -- handle a packet
-    ---@param pkt mgmt_frame|capi_frame
+    ---@param pkt mgmt_frame|crdn_frame
     local function _handle_packet(pkt)
         -- check sequence number
         if self.r_seq_num == nil then
@@ -117,17 +117,55 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
         self.conn_watchdog.feed()
 
         -- process packet
-        if pkt.scada_frame.protocol() == PROTOCOL.COORD_API then
-            ---@cast pkt capi_frame
+        if pkt.scada_frame.protocol() == PROTOCOL.SCADA_CRDN then
+            ---@cast pkt crdn_frame
+
+            local db = iocontrol.get_db()
 
             -- handle packet by type
-            if pkt.type == nil then
+            if pkt.type == CRDN_TYPE.API_GET_FAC then
+                local fac = db.facility
+
+                local data = {
+                    fac.all_sys_ok,
+                    fac.rtu_count,
+                    fac.radiation,
+                    { fac.auto_ready, fac.auto_active, fac.auto_ramping, fac.auto_saturated },
+                    { fac.auto_current_waste_product, fac.auto_pu_fallback_active },
+                    util.table_len(fac.tank_data_tbl),
+                    fac.induction_data_tbl[1] ~= nil,
+                    fac.sps_data_tbl[1] ~= nil,
+                }
+
+                _send(CRDN_TYPE.API_GET_FAC, data)
+            elseif pkt.type == CRDN_TYPE.API_GET_UNIT then
+                if pkt.length == 1 and type(pkt.data[1]) == "number" then
+                    local u = db.units[pkt.data[1]]   ---@type ioctl_unit
+
+                    if u then
+                        local data = {
+                            u.unit_id,
+                            u.connected,
+                            u.rtu_hw,
+                            u.alarms,
+                            u.annunciator,
+                            u.reactor_data,
+                            u.boiler_data_tbl,
+                            u.turbine_data_tbl,
+                            u.tank_data_tbl,
+                            u.last_rate_change_ms,
+                            u.turbine_flow_stable
+                        }
+
+                        _send(CRDN_TYPE.API_GET_UNIT, data)
+                    end
+                end
             else
-                log.debug(log_header .. "handler received unsupported CAPI packet type " .. pkt.type)
+                log.debug(log_header .. "handler received unsupported CRDN packet type " .. pkt.type)
             end
         elseif pkt.scada_frame.protocol() == PROTOCOL.SCADA_MGMT then
             ---@cast pkt mgmt_frame
-            if pkt.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
+            if pkt.type == MGMT_TYPE.KEEP_ALIVE then
                 -- keep alive reply
                 if pkt.length == 2 then
                     local srv_start = pkt.data[1]
@@ -146,7 +184,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
                 else
                     log.debug(log_header .. "SCADA keep alive packet length mismatch")
                 end
-            elseif pkt.type == SCADA_MGMT_TYPE.CLOSE then
+            elseif pkt.type == MGMT_TYPE.CLOSE then
                 -- close the session
                 _close()
             else
@@ -174,7 +212,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
     -- close the connection
     function public.close()
         _close()
-        _send_mgmt(SCADA_MGMT_TYPE.CLOSE, {})
+        _send_mgmt(MGMT_TYPE.CLOSE, {})
         log.info(log_header .. "session closed by server")
     end
 
@@ -229,7 +267,7 @@ function pocket.new_session(id, s_addr, in_queue, out_queue, timeout)
 
             periodics.keep_alive = periodics.keep_alive + elapsed
             if periodics.keep_alive >= PERIODICS.KEEP_ALIVE then
-                _send_mgmt(SCADA_MGMT_TYPE.KEEP_ALIVE, { util.time() })
+                _send_mgmt(MGMT_TYPE.KEEP_ALIVE, { util.time() })
                 periodics.keep_alive = 0
             end
 

coordinator/sounder.lua

@@ -2,269 +2,25 @@
 -- Alarm Sounder
 --
 
+local audio = require("scada-common.audio")
 local log   = require("scada-common.log")
-local types = require("scada-common.types")
-local util  = require("scada-common.util")
-
-local ALARM = types.ALARM
-local ALARM_STATE = types.ALARM_STATE
 
 ---@class sounder
 local sounder = {}
 
--- note: max samples = 0x20000 (128 * 1024 samples)
-
-local _2_PI        = 2 * math.pi    -- 2 whole pies, hope you're hungry
-local _DRATE       = 48000          -- 48kHz audio
-local _MAX_VAL     = 127 / 2        -- max signed integer in this 8-bit audio
-local _05s_SAMPLES = 24000          -- half a second worth of samples
-
-local test_alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
-
 local alarm_ctl = {
     speaker = nil,
     volume = 0.5,
-    playing = false,
-    num_active = 0,
-    next_block = 1,
-    -- split audio up into 0.5s samples so specific components can be ended quicker
-    quad_buffer = { {}, {}, {}, {} }
+    stream = audio.new_stream()
 }
 
--- sounds modeled after https://www.e2s.com/references-and-guidelines/listen-and-download-alarm-tones
-
-local T_340Hz_Int_2Hz = 1
-local T_544Hz_440Hz_Alt = 2
-local T_660Hz_Int_125ms = 3
-local T_745Hz_Int_1Hz = 4
-local T_800Hz_Int = 5
-local T_800Hz_1000Hz_Alt = 6
-local T_1000Hz_Int = 7
-local T_1800Hz_Int_4Hz = 8
-
-local TONES = {
-    { active = false, component = { {}, {}, {}, {} } }, -- 340Hz @ 2Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 544Hz 100mS / 440Hz 400mS Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 660Hz @ 125ms On 125ms Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 745Hz @ 1Hz Intermittent
-    { active = false, component = { {}, {}, {}, {} } }, -- 800Hz @ 0.25s On 1.75s Off
-    { active = false, component = { {}, {}, {}, {} } }, -- 800/1000Hz @ 0.25s Alternating
-    { active = false, component = { {}, {}, {}, {} } }, -- 1KHz 1s on, 1s off Intermittent
-    { active = false, component = { {}, {}, {}, {} } }  -- 1.8KHz @ 4Hz Intermittent
-}
-
--- calculate how many samples are in the given number of milliseconds
----@nodiscard
----@param ms integer milliseconds
----@return integer samples
-local function ms_to_samples(ms) return math.floor(ms * 48) end
-
---#region Tone Generation (the Maths)
-
--- 340Hz @ 2Hz Intermittent
-local function gen_tone_1()
-    local t, dt = 0, _2_PI * 340 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[1].component[1][i] = val
-        TONES[1].component[3][i] = val
-        TONES[1].component[2][i] = 0
-        TONES[1].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 544Hz 100mS / 440Hz 400mS Alternating
-local function gen_tone_2()
-    local t1, dt1 = 0, _2_PI * 544 / _DRATE
-    local t2, dt2 = 0, _2_PI * 440 / _DRATE
-    local alternate_at = ms_to_samples(100)
-
-    for i = 1, _05s_SAMPLES do
-        local value
-
-        if i <= alternate_at then
-            value = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            value = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[2].component[1][i] = value
-        TONES[2].component[2][i] = value
-        TONES[2].component[3][i] = value
-        TONES[2].component[4][i] = value
-    end
-end
-
--- 660Hz @ 125ms On 125ms Off
-local function gen_tone_3()
-    local elapsed_samples = 0
-    local alternate_after = ms_to_samples(125)
-    local alternate_at = alternate_after
-    local mode = true
-
-    local t, dt = 0, _2_PI * 660 / _DRATE
-
-    for set = 1, 4 do
-        for i = 1, _05s_SAMPLES do
-            if mode then
-                local val = math.floor(math.sin(t) * _MAX_VAL)
-                TONES[3].component[set][i] = val
-                t = (t + dt) % _2_PI
-            else
-                t = 0
-                TONES[3].component[set][i] = 0
-            end
-
-            if elapsed_samples == alternate_at then
-                mode = not mode
-                alternate_at = elapsed_samples + alternate_after
-            end
-
-            elapsed_samples = elapsed_samples + 1
-        end
-    end
-end
-
--- 745Hz @ 1Hz Intermittent
-local function gen_tone_4()
-    local t, dt = 0, _2_PI * 745 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[4].component[1][i] = val
-        TONES[4].component[3][i] = val
-        TONES[4].component[2][i] = 0
-        TONES[4].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 800Hz @ 0.25s On 1.75s Off
-local function gen_tone_5()
-    local t, dt = 0, _2_PI * 800 / _DRATE
-    local stop_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-
-        if i > stop_at then
-            TONES[5].component[1][i] = val
-        else
-            TONES[5].component[1][i] = 0
-        end
-
-        TONES[5].component[2][i] = 0
-        TONES[5].component[3][i] = 0
-        TONES[5].component[4][i] = 0
-
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1000/800Hz @ 0.25s Alternating
-local function gen_tone_6()
-    local t1, dt1 = 0, _2_PI * 1000 / _DRATE
-    local t2, dt2 = 0, _2_PI * 800 / _DRATE
-
-    local alternate_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val
-        if i <= alternate_at then
-            val = math.floor(math.sin(t1) * _MAX_VAL)
-            t1 = (t1 + dt1) % _2_PI
-        else
-            val = math.floor(math.sin(t2) * _MAX_VAL)
-            t2 = (t2 + dt2) % _2_PI
-        end
-
-        TONES[6].component[1][i] = val
-        TONES[6].component[2][i] = val
-        TONES[6].component[3][i] = val
-        TONES[6].component[4][i] = val
-    end
-end
-
--- 1KHz 1s on, 1s off Intermittent
-local function gen_tone_7()
-    local t, dt = 0, _2_PI * 1000 / _DRATE
-
-    for i = 1, _05s_SAMPLES do
-        local val = math.floor(math.sin(t) * _MAX_VAL)
-        TONES[7].component[1][i] = val
-        TONES[7].component[2][i] = val
-        TONES[7].component[3][i] = 0
-        TONES[7].component[4][i] = 0
-        t = (t + dt) % _2_PI
-    end
-end
-
--- 1800Hz @ 4Hz Intermittent
-local function gen_tone_8()
-    local t, dt = 0, _2_PI * 1800 / _DRATE
-
-    local off_at = ms_to_samples(250)
-
-    for i = 1, _05s_SAMPLES do
-        local val = 0
-
-        if i <= off_at then
-            val = math.floor(math.sin(t) * _MAX_VAL)
-            t = (t + dt) % _2_PI
-        end
-
-        TONES[8].component[1][i] = val
-        TONES[8].component[2][i] = val
-        TONES[8].component[3][i] = val
-        TONES[8].component[4][i] = val
-    end
-end
-
---#endregion
-
--- hard audio limiter
----@nodiscard
----@param output number output level
----@return number limited -128.0 to 127.0
-local function limit(output)
-    return math.max(-128, math.min(127, output))
-end
-
--- zero the alarm audio buffer
-local function zero()
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do alarm_ctl.quad_buffer[i][s] = 0 end
-    end
-end
-
--- add an alarm to the output buffer
----@param alarm_idx integer tone ID
-local function add(alarm_idx)
-    alarm_ctl.num_active = alarm_ctl.num_active + 1
-    TONES[alarm_idx].active = true
-
-    for i = 1, 4 do
-        for s = 1, _05s_SAMPLES do
-            alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] + TONES[alarm_idx].component[i][s])
-        end
-    end
-end
-
 -- start audio or continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 local function play()
     if not alarm_ctl.playing then
         alarm_ctl.playing = true
-        alarm_ctl.next_block = 1
-
         return sounder.continue()
-    else
-        return true
-    end
+    else return true end
 end
 
 -- initialize the annunciator alarm system
@@ -273,23 +29,10 @@ end
 function sounder.init(speaker, volume)
     alarm_ctl.speaker = speaker
     alarm_ctl.speaker.stop()
-
     alarm_ctl.volume = volume
-    alarm_ctl.playing = false
-    alarm_ctl.num_active = 0
-    alarm_ctl.next_block = 1
+    alarm_ctl.stream.stop()
 
-    zero()
-
-    -- generate tones
-    gen_tone_1()
-    gen_tone_2()
-    gen_tone_3()
-    gen_tone_4()
-    gen_tone_5()
-    gen_tone_6()
-    gen_tone_7()
-    gen_tone_8()
+    audio.generate_tones()
 end
 
 -- reconnect the speaker peripheral
@@ -297,173 +40,40 @@ end
 function sounder.reconnect(speaker)
     alarm_ctl.speaker = speaker
     alarm_ctl.playing = false
-    alarm_ctl.next_block = 1
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
+    alarm_ctl.stream.stop()
 end
 
--- check alarm state to enable/disable alarms
----@param units table|nil unit list or nil to use test mode
-function sounder.eval(units)
-    local changed = false
-    local any_active = false
-    local new_states = { false, false, false, false, false, false, false, false }
-    local alarms = { false, false, false, false, false, false, false, false, false, false, false, false }
+-- set alarm tones
+---@param states table alarm tone commands from supervisor
+function sounder.set(states)
+    -- set tone states
+    for id = 1, #states do alarm_ctl.stream.set_active(id, states[id]) end
 
-    if units ~= nil then
-        -- check all alarms for all units
-        for i = 1, #units do
-            local unit = units[i]   ---@type ioctl_unit
-            for id = 1, #unit.alarms do
-                alarms[id] = alarms[id] or (unit.alarms[id] == ALARM_STATE.TRIPPED)
-            end
-        end
-    else
-        alarms = test_alarms
-    end
-
-    -- containment breach is worst case CRITICAL alarm, this takes priority
-    if alarms[ALARM.ContainmentBreach] then
-        new_states[T_1800Hz_Int_4Hz] = true
-    else
-        -- critical damage is highest priority CRITICAL level alarm
-        if alarms[ALARM.CriticalDamage] then
-            new_states[T_660Hz_Int_125ms] = true
-        else
-            -- EMERGENCY level alarms + URGENT over temp
-            if alarms[ALARM.ReactorDamage] or alarms[ALARM.ReactorOverTemp] or alarms[ALARM.ReactorWasteLeak] then
-                new_states[T_544Hz_440Hz_Alt] = true
-            -- URGENT level turbine trip
-            elseif alarms[ALARM.TurbineTrip] then
-                new_states[T_745Hz_Int_1Hz] = true
-            -- URGENT level reactor lost
-            elseif alarms[ALARM.ReactorLost] then
-                new_states[T_340Hz_Int_2Hz] = true
-            -- TIMELY level alarms
-            elseif alarms[ALARM.ReactorHighTemp] or alarms[ALARM.ReactorHighWaste] or alarms[ALARM.RCSTransient] then
-                new_states[T_800Hz_Int] = true
-            end
-        end
-
-        -- check RPS transient URGENT level alarm
-        if alarms[ALARM.RPSTransient] then
-            new_states[T_1000Hz_Int] = true
-            -- disable really painful audio combination
-            new_states[T_340Hz_Int_2Hz] = false
-        end
-    end
-
-    -- radiation is a big concern, always play this CRITICAL level alarm if active
-    if alarms[ALARM.ContainmentRadiation] then
-        new_states[T_800Hz_1000Hz_Alt] = true
-        -- we are going to disable the RPS trip alarm audio due to conflict, and if it was enabled
-        -- then we can re-enable the reactor lost alarm audio since it doesn't painfully combine with this one
-        if new_states[T_1000Hz_Int] and alarms[ALARM.ReactorLost] then new_states[T_340Hz_Int_2Hz] = true end
-        -- it sounds *really* bad if this is in conjunction with these other tones, so disable them
-        new_states[T_745Hz_Int_1Hz] = false
-        new_states[T_800Hz_Int] = false
-        new_states[T_1000Hz_Int] = false
-    end
-
-    -- check if any changed, check if any active, update active flags
-    for id = 1, #TONES do
-        if new_states[id] ~= TONES[id].active then
-            TONES[id].active = new_states[id]
-            changed = true
-        end
-
-        if TONES[id].active then any_active = true end
-    end
-
-    -- zero and re-add tones if changed
-    if changed then
-        zero()
-
-        for id = 1, #TONES do
-            if TONES[id].active then add(id) end
-        end
-    end
-
-    if any_active then play() else sounder.stop() end
+    -- re-compute output if needed, then play audio if available
+    if alarm_ctl.stream.is_recompute_needed() then alarm_ctl.stream.compute_buffer() end
+    if alarm_ctl.stream.any_active() then play() else sounder.stop() end
 end
 
 -- stop all audio and clear output buffer
 function sounder.stop()
     alarm_ctl.playing = false
     alarm_ctl.speaker.stop()
-    alarm_ctl.next_block = 1
-    alarm_ctl.num_active = 0
-    for id = 1, #TONES do TONES[id].active = false end
-    zero()
+    alarm_ctl.stream.stop()
 end
 
 -- continue audio on buffer empty
 ---@return boolean success successfully added buffer to audio output
 function sounder.continue()
+    local success = false
+
     if alarm_ctl.playing then
-        if alarm_ctl.speaker ~= nil and #alarm_ctl.quad_buffer[alarm_ctl.next_block] > 0 then
-            local success = alarm_ctl.speaker.playAudio(alarm_ctl.quad_buffer[alarm_ctl.next_block], alarm_ctl.volume)
-
-            alarm_ctl.next_block = alarm_ctl.next_block + 1
-            if alarm_ctl.next_block > 4 then alarm_ctl.next_block = 1 end
-
-            if not success then
-                log.debug("SOUNDER: error playing audio")
-            end
-
-            return success
-        else
-            return false
-        end
-    else
-        return false
-    end
-end
-
---#region Test Functions
-
-function sounder.test_1() add(1) play() end -- play tone T_340Hz_Int_2Hz
-function sounder.test_2() add(2) play() end -- play tone T_544Hz_440Hz_Alt
-function sounder.test_3() add(3) play() end -- play tone T_660Hz_Int_125ms
-function sounder.test_4() add(4) play() end -- play tone T_745Hz_Int_1Hz
-function sounder.test_5() add(5) play() end -- play tone T_800Hz_Int
-function sounder.test_6() add(6) play() end -- play tone T_800Hz_1000Hz_Alt
-function sounder.test_7() add(7) play() end -- play tone T_1000Hz_Int
-function sounder.test_8() add(8) play() end -- play tone T_1800Hz_Int_4Hz
-
-function sounder.test_breach(active)    test_alarms[ALARM.ContainmentBreach]    = active end    ---@param active boolean
-function sounder.test_rad(active)       test_alarms[ALARM.ContainmentRadiation] = active end    ---@param active boolean
-function sounder.test_lost(active)      test_alarms[ALARM.ReactorLost]          = active end    ---@param active boolean
-function sounder.test_crit(active)      test_alarms[ALARM.CriticalDamage]       = active end    ---@param active boolean
-function sounder.test_dmg(active)       test_alarms[ALARM.ReactorDamage]        = active end    ---@param active boolean
-function sounder.test_overtemp(active)  test_alarms[ALARM.ReactorOverTemp]      = active end    ---@param active boolean
-function sounder.test_hightemp(active)  test_alarms[ALARM.ReactorHighTemp]      = active end    ---@param active boolean
-function sounder.test_wasteleak(active) test_alarms[ALARM.ReactorWasteLeak]     = active end    ---@param active boolean
-function sounder.test_highwaste(active) test_alarms[ALARM.ReactorHighWaste]     = active end    ---@param active boolean
-function sounder.test_rps(active)       test_alarms[ALARM.RPSTransient]         = active end    ---@param active boolean
-function sounder.test_rcs(active)       test_alarms[ALARM.RCSTransient]         = active end    ---@param active boolean
-function sounder.test_turbinet(active)  test_alarms[ALARM.TurbineTrip]          = active end    ---@param active boolean
-
--- power rescaling limiter test
-function sounder.test_power_scale()
-    local start = util.time_ms()
-
-    zero()
-
-    for id = 1, #TONES do
-        if TONES[id].active then
-            for i = 1, 4 do
-                for s = 1, _05s_SAMPLES do
-                    alarm_ctl.quad_buffer[i][s] = limit(alarm_ctl.quad_buffer[i][s] +
-                        (TONES[id].component[i][s] / math.sqrt(alarm_ctl.num_active)))
-                end
-            end
+        if alarm_ctl.speaker ~= nil and alarm_ctl.stream.has_next_block() then
+            success = alarm_ctl.speaker.playAudio(alarm_ctl.stream.get_next_block(), alarm_ctl.volume)
+            if not success then log.error("SOUNDER: error playing audio") end
         end
     end
 
-    log.debug("SOUNDER: power rescale test took " .. (util.time_ms() - start) .. "ms")
+    return success
 end
 
---#endregion
-
 return sounder

coordinator/startup.lua

@@ -7,59 +7,92 @@ require("/initenv").init_env()
 local comms       = require("scada-common.comms")
 local crash       = require("scada-common.crash")
 local log         = require("scada-common.log")
+local mqueue      = require("scada-common.mqueue")
 local network     = require("scada-common.network")
 local ppm         = require("scada-common.ppm")
-local tcd         = require("scada-common.tcd")
 local util        = require("scada-common.util")
 
-local core        = require("graphics.core")
-
-local config      = require("coordinator.config")
+local configure   = require("coordinator.configure")
 local coordinator = require("coordinator.coordinator")
 local iocontrol   = require("coordinator.iocontrol")
 local renderer    = require("coordinator.renderer")
 local sounder     = require("coordinator.sounder")
+local threads     = require("coordinator.threads")
 
-local apisessions = require("coordinator.session.apisessions")
+local COORDINATOR_VERSION = "v1.4.7"
 
-local COORDINATOR_VERSION = "v0.21.2"
+local CHUNK_LOAD_DELAY_S = 30.0
 
-local println = util.println
+local println    = util.println
 local println_ts = util.println_ts
 
-local log_graphics = coordinator.log_graphics
-local log_sys = coordinator.log_sys
-local log_boot = coordinator.log_boot
-local log_comms = coordinator.log_comms
+local log_render = coordinator.log_render
+local log_sys    = coordinator.log_sys
+local log_boot   = coordinator.log_boot
+local log_comms  = coordinator.log_comms
 local log_crypto = coordinator.log_crypto
 
 ----------------------------------------
--- config validation
+-- get configuration
 ----------------------------------------
 
-local cfv = util.new_validator()
+-- mount connected devices (required for monitor setup)
+ppm.mount_all()
 
-cfv.assert_channel(config.SVR_CHANNEL)
-cfv.assert_channel(config.CRD_CHANNEL)
-cfv.assert_channel(config.PKT_CHANNEL)
-cfv.assert_type_int(config.TRUSTED_RANGE)
-cfv.assert_type_num(config.SV_TIMEOUT)
-cfv.assert_min(config.SV_TIMEOUT, 2)
-cfv.assert_type_num(config.API_TIMEOUT)
-cfv.assert_min(config.API_TIMEOUT, 2)
-cfv.assert_type_int(config.NUM_UNITS)
-cfv.assert_type_num(config.SOUNDER_VOLUME)
-cfv.assert_type_bool(config.TIME_24_HOUR)
-cfv.assert_type_str(config.LOG_PATH)
-cfv.assert_type_int(config.LOG_MODE)
+local wait_on_load = true
+local loaded, monitors = coordinator.load_config()
 
-assert(cfv.valid(), "bad config file: missing/invalid fields")
+-- if the computer just started, its chunk may have just loaded (...or the user rebooted)
+-- if monitor config failed, maybe an adjacent chunk containing all or part of a monitor has not loaded yet, so keep trying
+while wait_on_load and loaded == 2 and os.clock() < CHUNK_LOAD_DELAY_S do
+    term.clear()
+    term.setCursorPos(1, 1)
+    println("There was a monitor configuration problem at boot.\n")
+    println("Startup will keep trying every 2s in case of chunk load delays.\n")
+    println(util.sprintf("The configurator will be started in %ds if all attempts fail.\n", math.max(0, CHUNK_LOAD_DELAY_S - os.clock())))
+    println("(click to skip to the configurator)")
+
+    local timer_id = util.start_timer(2)
+
+    while true do
+        local event, param1 = util.pull_event()
+        if event == "timer" and param1 == timer_id then
+            -- remount and re-attempt
+            ppm.mount_all()
+            loaded, monitors = coordinator.load_config()
+            break
+        elseif event == "mouse_click" or event == "terminate" then
+            wait_on_load = false
+            break
+        end
+    end
+end
+
+if loaded ~= 0 then
+    -- try to reconfigure (user action)
+    local success, error = configure.configure(loaded, monitors)
+    if success then
+        loaded, monitors = coordinator.load_config()
+        if loaded ~= 0 then
+            println(util.trinary(loaded == 2, "monitor configuration invalid", "failed to load a valid configuration") .. ", please reconfigure")
+            return
+        end
+    else
+        println("configuration error: " .. error)
+        return
+    end
+end
+
+-- passed checks, good now
+---@cast monitors monitors_struct
+
+local config = coordinator.config
 
 ----------------------------------------
 -- log init
 ----------------------------------------
 
-log.init(config.LOG_PATH, config.LOG_MODE, config.LOG_DEBUG == true)
+log.init(config.LogPath, config.LogMode, config.LogDebug)
 
 log.info("========================================")
 log.info("BOOTING coordinator.startup " .. COORDINATOR_VERSION)
@@ -67,6 +100,7 @@ log.info("========================================")
 println(">> SCADA Coordinator " .. COORDINATOR_VERSION .. " <<")
 
 crash.set_env("coordinator", COORDINATOR_VERSION)
+crash.dbg_log_env()
 
 ----------------------------------------
 -- main application
@@ -77,49 +111,73 @@ local function main()
     -- system startup
     ----------------------------------------
 
-    -- mount connected devices
-    ppm.mount_all()
+    -- log mounts now since mounting was done before logging was ready
+    ppm.log_mounts()
 
     -- report versions/init fp PSIL
     iocontrol.init_fp(COORDINATOR_VERSION, comms.version)
 
-    -- setup monitors
-    local configured, monitors = coordinator.configure_monitors(config.NUM_UNITS)
-    if not configured or monitors == nil then
-        println("startup> monitor setup failed")
-        log.fatal("monitor configuration failed")
-        return
-    end
-
     -- init renderer
+    renderer.configure(config)
     renderer.set_displays(monitors)
     renderer.init_displays()
-
-    if not renderer.validate_main_display_width() then
-        println("startup> main display must be 8 blocks wide")
-        log.fatal("main display not wide enough")
-        return
-    elseif not renderer.validate_unit_display_sizes() then
-        println("startup> one or more unit display dimensions incorrect; they must be 4x4 blocks")
-        log.fatal("unit display dimensions incorrect")
-        return
-    end
-
     renderer.init_dmesg()
 
     -- lets get started!
     log.info("monitors ready, dmesg output incoming...")
 
-    log_graphics("displays connected and reset")
+    log_render("displays connected and reset")
     log_sys("system start on " .. os.date("%c"))
     log_boot("starting " .. COORDINATOR_VERSION)
 
+    ----------------------------------------
+    -- memory allocation
+    ----------------------------------------
+
+    -- shared memory across threads
+    ---@class crd_shared_memory
+    local __shared_memory = {
+        -- time and date format for display
+        date_format = util.trinary(config.Time24Hour, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y"),
+
+        -- coordinator system state flags
+        ---@class crd_state
+        crd_state = {
+            fp_ok = false,
+            ui_ok = true,       -- default true, used to abort on fail
+            link_fail = false,
+            shutdown = false
+        },
+
+        -- core coordinator devices
+        crd_dev = {
+            speaker = ppm.get_device("speaker"),
+            modem = ppm.get_wireless_modem()
+        },
+
+        -- system objects
+        crd_sys = {
+            nic = nil,          ---@type nic
+            coord_comms = nil,  ---@type coord_comms
+            conn_watchdog = nil ---@type watchdog
+        },
+
+        -- message queues
+        q = {
+            mq_render = mqueue.new()
+        }
+    }
+
+    local smem_dev = __shared_memory.crd_dev
+    local smem_sys = __shared_memory.crd_sys
+
+    local crd_state = __shared_memory.crd_state
+
     ----------------------------------------
     -- setup alarm sounder subsystem
     ----------------------------------------
 
-    local speaker = ppm.get_device("speaker")
-    if speaker == nil then
+    if smem_dev.speaker == nil then
         log_boot("annunciator alarm speaker not found")
         println("startup> speaker not found")
         log.fatal("no annunciator alarm speaker found")
@@ -127,7 +185,7 @@ local function main()
     else
         local sounder_start = util.time_ms()
         log_boot("annunciator alarm speaker connected")
-        sounder.init(speaker, config.SOUNDER_VOLUME)
+        sounder.init(smem_dev.speaker, config.SpeakerVolume)
         log_boot("tone generation took " .. (util.time_ms() - sounder_start) .. "ms")
         log_sys("annunciator alarm configured")
         iocontrol.fp_has_speaker(true)
@@ -138,14 +196,13 @@ local function main()
     ----------------------------------------
 
     -- message authentication init
-    if type(config.AUTH_KEY) == "string" then
-        local init_time = network.init_mac(config.AUTH_KEY)
+    if type(config.AuthKey) == "string" and string.len(config.AuthKey) > 0 then
+        local init_time = network.init_mac(config.AuthKey)
         log_crypto("HMAC init took " .. init_time .. "ms")
     end
 
     -- get the communications modem
-    local modem = ppm.get_wireless_modem()
-    if modem == nil then
+    if smem_dev.modem == nil then
         log_comms("wireless modem not found")
         println("startup> wireless modem not found")
         log.fatal("no wireless modem on startup")
@@ -156,238 +213,54 @@ local function main()
     end
 
     -- create connection watchdog
-    local conn_watchdog = util.new_watchdog(config.SV_TIMEOUT)
-    conn_watchdog.cancel()
+    smem_sys.conn_watchdog = util.new_watchdog(config.SVR_Timeout)
+    smem_sys.conn_watchdog.cancel()
     log.debug("startup> conn watchdog created")
 
     -- create network interface then setup comms
-    local nic = network.nic(modem)
-    local coord_comms = coordinator.comms(COORDINATOR_VERSION, nic, config.CRD_CHANNEL, config.SVR_CHANNEL,
-                                            config.PKT_CHANNEL, config.TRUSTED_RANGE, conn_watchdog)
+    smem_sys.nic = network.nic(smem_dev.modem)
+    smem_sys.coord_comms = coordinator.comms(COORDINATOR_VERSION, smem_sys.nic, smem_sys.conn_watchdog)
     log.debug("startup> comms init")
     log_comms("comms initialized")
 
-    -- base loop clock (2Hz, 10 ticks)
-    local MAIN_CLOCK = 0.5
-    local loop_clock = util.new_clock(MAIN_CLOCK)
-
     ----------------------------------------
-    -- start front panel & UI start function
+    -- start front panel
     ----------------------------------------
 
-    log_graphics("starting front panel UI...")
+    log_render("starting front panel UI...")
 
-    local fp_ok, fp_message = pcall(renderer.start_fp)
-    if not fp_ok then
-        renderer.close_fp()
-        log_graphics(util.c("front panel UI error: ", fp_message))
+    local fp_message
+    crd_state.fp_ok, fp_message = renderer.try_start_fp()
+    if not crd_state.fp_ok then
+        log_render(util.c("front panel UI error: ", fp_message))
         println_ts("front panel UI creation failed")
         log.fatal(util.c("front panel GUI render failed with error ", fp_message))
         return
-    else log_graphics("front panel ready") end
-
-    -- start up the main UI
-    ---@return boolean ui_ok started ok
-    local function start_main_ui()
-        log_graphics("starting main UI...")
-
-        local draw_start = util.time_ms()
-
-        local ui_ok, ui_message = pcall(renderer.start_ui)
-        if not ui_ok then
-            renderer.close_ui()
-            log_graphics(util.c("main UI error: ", ui_message))
-            log.fatal(util.c("main GUI render failed with error ", ui_message))
-        else
-            log_graphics("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
-        end
-
-        return ui_ok
-    end
+    else log_render("front panel ready") end
 
     ----------------------------------------
-    -- main event loop
+    -- start system
     ----------------------------------------
 
-    local link_failed = false
-    local ui_ok = true
-    local date_format = util.trinary(config.TIME_24_HOUR, "%X \x04 %A, %B %d %Y", "%r \x04 %A, %B %d %Y")
+    -- init threads
+    local main_thread   = threads.thread__main(__shared_memory)
+    local render_thread = threads.thread__render(__shared_memory)
 
-    -- start clock
-    loop_clock.start()
+    log.info("startup> completed")
 
-    log_sys("system started successfully")
-
-    -- main event loop
-    while true do
-        local event, param1, param2, param3, param4, param5 = util.pull_event()
-
-        -- handle event
-        if event == "peripheral_detach" then
-            local type, device = ppm.handle_unmount(param1)
-
-            if type ~= nil and device ~= nil then
-                if type == "modem" then
-                    -- we only really care if this is our wireless modem
-                    -- if it is another modem, handle other peripheral losses separately
-                    if nic.is_modem(device) then
-                        nic.disconnect()
-                        log_sys("comms modem disconnected")
-
-                        local other_modem = ppm.get_wireless_modem()
-                        if other_modem then
-                            log_sys("found another wireless modem, using it for comms")
-                            nic.connect(other_modem)
-                        else
-                            -- close out main UI
-                            renderer.close_ui()
-
-                            -- alert user to status
-                            log_sys("awaiting comms modem reconnect...")
-
-                            iocontrol.fp_has_modem(false)
-                        end
-                    else
-                        log_sys("non-comms modem disconnected")
-                    end
-                elseif type == "monitor" then
-                    if renderer.handle_disconnect(device) then
-                        log_sys("lost a configured monitor")
-                    else
-                        log_sys("lost an unused monitor")
-                    end
-                elseif type == "speaker" then
-                    log_sys("lost alarm sounder speaker")
-                    iocontrol.fp_has_speaker(false)
-                end
-            end
-        elseif event == "peripheral" then
-            local type, device = ppm.mount(param1)
-
-            if type ~= nil and device ~= nil then
-                if type == "modem" then
-                    if device.isWireless() and not nic.is_connected() then
-                        -- reconnected modem
-                        log_sys("comms modem reconnected")
-                        nic.connect(device)
-                        iocontrol.fp_has_modem(true)
-                    elseif device.isWireless() then
-                        log.info("unused wireless modem reconnected")
-                    else
-                        log_sys("wired modem reconnected")
-                    end
-                elseif type == "monitor" then
-                    if renderer.handle_reconnect(param1, device) then
-                        log_sys(util.c("configured monitor ", param1, " reconnected"))
-                    else
-                        log_sys(util.c("unused monitor ", param1, " connected"))
-                    end
-                elseif type == "speaker" then
-                    log_sys("alarm sounder speaker reconnected")
-                    sounder.reconnect(device)
-                    iocontrol.fp_has_speaker(true)
-                end
-            end
-        elseif event == "timer" then
-            if loop_clock.is_clock(param1) then
-                -- main loop tick
-
-                -- toggle heartbeat
-                iocontrol.heartbeat()
-
-                -- maintain connection
-                if nic.is_connected() then
-                    local ok, start_ui = coord_comms.try_connect()
-                    if not ok then
-                        link_failed = true
-                        log_sys("supervisor connection failed, shutting down...")
-                        log.fatal("failed to connect to supervisor")
-                        break
-                    elseif start_ui then
-                        log_sys("supervisor connected, proceeding to main UI start")
-                        ui_ok = start_main_ui()
-                        if not ui_ok then break end
-                    end
-                end
-
-                -- iterate sessions
-                apisessions.iterate_all()
-
-                -- free any closed sessions
-                apisessions.free_all_closed()
-
-                -- update date and time string for main display
-                if coord_comms.is_linked() then
-                    iocontrol.get_db().facility.ps.publish("date_time", os.date(date_format))
-                end
-
-                loop_clock.start()
-            elseif conn_watchdog.is_timer(param1) then
-                -- supervisor watchdog timeout
-                log_comms("supervisor server timeout")
-
-                -- close connection, main UI, and stop sounder
-                coord_comms.close()
-                renderer.close_ui()
-                sounder.stop()
-            else
-                -- a non-clock/main watchdog timer event
-
-                -- check API watchdogs
-                apisessions.check_all_watchdogs(param1)
-
-                -- notify timer callback dispatcher
-                tcd.handle(param1)
-            end
-        elseif event == "modem_message" then
-            -- got a packet
-            local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
-
-            -- handle then check if it was a disconnect
-            if coord_comms.handle_packet(packet) then
-                log_comms("supervisor closed connection")
-
-                -- close connection, main UI, and stop sounder
-                coord_comms.close()
-                renderer.close_ui()
-                sounder.stop()
-            end
-        elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
-               event == "mouse_drag" or event == "mouse_scroll" then
-            -- handle a mouse event
-            renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
-        elseif event == "speaker_audio_empty" then
-            -- handle speaker buffer emptied
-            sounder.continue()
-        end
-
-        -- check for termination request
-        if event == "terminate" or ppm.should_terminate() then
-            -- handle supervisor connection
-            coord_comms.try_connect(true)
-
-            if coord_comms.is_linked() then
-                log_comms("terminate requested, closing supervisor connection...")
-            else link_failed = true end
-
-            coord_comms.close()
-            log_comms("supervisor connection closed")
-
-            -- handle API sessions
-            log_comms("closing api sessions...")
-            apisessions.close_all()
-            log_comms("api sessions closed")
-            break
-        end
-    end
+    -- run threads
+    parallel.waitForAll(main_thread.p_exec, render_thread.p_exec)
 
     renderer.close_ui()
     renderer.close_fp()
     sounder.stop()
     log_sys("system shutdown")
 
-    if link_failed then println_ts("failed to connect to supervisor") end
-    if not ui_ok then println_ts("main UI creation failed") end
+    if crd_state.link_fail then println_ts("failed to connect to supervisor") end
+    if not crd_state.ui_ok then println_ts("main UI creation failed") end
+
+    -- close on error exit (such as UI error)
+    if smem_sys.coord_comms.is_linked() then smem_sys.coord_comms.close() end
 
     println_ts("exited")
     log.info("exited")

coordinator/threads.lua

@@ -0,0 +1,363 @@
+local log         = require("scada-common.log")
+local mqueue      = require("scada-common.mqueue")
+local ppm         = require("scada-common.ppm")
+local tcd         = require("scada-common.tcd")
+local util        = require("scada-common.util")
+
+local coordinator = require("coordinator.coordinator")
+local iocontrol   = require("coordinator.iocontrol")
+local renderer    = require("coordinator.renderer")
+local sounder     = require("coordinator.sounder")
+
+local apisessions = require("coordinator.session.apisessions")
+
+local core        = require("graphics.core")
+
+local log_render = coordinator.log_render
+local log_sys    = coordinator.log_sys
+local log_comms  = coordinator.log_comms
+
+local threads = {}
+
+local MAIN_CLOCK   = 0.5 -- (2Hz,   10 ticks)
+local RENDER_SLEEP = 100 -- (100ms, 2 ticks)
+
+local MQ__RENDER_CMD = {
+    START_MAIN_UI = 1
+}
+
+local MQ__RENDER_DATA = {
+    MON_CONNECT = 1,
+    MON_DISCONNECT = 2,
+    MON_RESIZE = 3
+}
+
+-- main thread
+---@nodiscard
+---@param smem crd_shared_memory
+function threads.thread__main(smem)
+    ---@class parallel_thread
+    local public = {}
+
+    -- execute thread
+    function public.exec()
+        iocontrol.fp_rt_status("main", true)
+        log.debug("main thread start")
+
+        local loop_clock = util.new_clock(MAIN_CLOCK)
+
+        -- start clock
+        loop_clock.start()
+
+        log_sys("system started successfully")
+
+        -- load in from shared memory
+        local crd_state     = smem.crd_state
+        local nic           = smem.crd_sys.nic
+        local coord_comms   = smem.crd_sys.coord_comms
+        local conn_watchdog = smem.crd_sys.conn_watchdog
+
+        -- event loop
+        while true do
+            local event, param1, param2, param3, param4, param5 = util.pull_event()
+
+            -- handle event
+            if event == "peripheral_detach" then
+                local type, device = ppm.handle_unmount(param1)
+
+                if type ~= nil and device ~= nil then
+                    if type == "modem" then
+                        -- we only really care if this is our wireless modem
+                        -- if it is another modem, handle other peripheral losses separately
+                        if nic.is_modem(device) then
+                            nic.disconnect()
+                            log_sys("comms modem disconnected")
+
+                            local other_modem = ppm.get_wireless_modem()
+                            if other_modem then
+                                log_sys("found another wireless modem, using it for comms")
+                                nic.connect(other_modem)
+                            else
+                                -- close out main UI
+                                renderer.close_ui()
+
+                                -- alert user to status
+                                log_sys("awaiting comms modem reconnect...")
+
+                                iocontrol.fp_has_modem(false)
+                            end
+                        else
+                            log_sys("non-comms modem disconnected")
+                        end
+                    elseif type == "monitor" then
+                        smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_DISCONNECT, device)
+                    elseif type == "speaker" then
+                        log_sys("lost alarm sounder speaker")
+                        iocontrol.fp_has_speaker(false)
+                    end
+                end
+            elseif event == "peripheral" then
+                local type, device = ppm.mount(param1)
+
+                if type ~= nil and device ~= nil then
+                    if type == "modem" then
+                        if device.isWireless() and not nic.is_connected() then
+                            -- reconnected modem
+                            log_sys("comms modem reconnected")
+                            nic.connect(device)
+                            iocontrol.fp_has_modem(true)
+                        elseif device.isWireless() then
+                            log.info("unused wireless modem reconnected")
+                        else
+                            log_sys("wired modem reconnected")
+                        end
+                    elseif type == "monitor" then
+                        smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_CONNECT, { name = param1, device = device })
+                    elseif type == "speaker" then
+                        log_sys("alarm sounder speaker reconnected")
+                        sounder.reconnect(device)
+                        iocontrol.fp_has_speaker(true)
+                    end
+                end
+            elseif event == "monitor_resize" then
+                smem.q.mq_render.push_data(MQ__RENDER_DATA.MON_RESIZE, param1)
+            elseif event == "timer" then
+                if loop_clock.is_clock(param1) then
+                    -- main loop tick
+
+                    -- toggle heartbeat
+                    iocontrol.heartbeat()
+
+                    -- maintain connection
+                    if nic.is_connected() then
+                        local ok, start_ui = coord_comms.try_connect()
+                        if not ok then
+                            crd_state.link_fail = true
+                            crd_state.shutdown = true
+                            log_sys("supervisor connection failed, shutting down...")
+                            log.fatal("failed to connect to supervisor")
+                            break
+                        elseif start_ui then
+                            log_sys("supervisor connected, dispatching main UI start")
+                            smem.q.mq_render.push_command(MQ__RENDER_CMD.START_MAIN_UI)
+                        end
+                    end
+
+                    -- iterate sessions and free any closed ones
+                    apisessions.iterate_all()
+                    apisessions.free_all_closed()
+
+                    if renderer.ui_ready() then
+                        -- update clock used on main and flow monitors
+                        iocontrol.get_db().facility.ps.publish("date_time", os.date(smem.date_format))
+                    end
+
+                    loop_clock.start()
+                elseif conn_watchdog.is_timer(param1) then
+                    -- supervisor watchdog timeout
+                    log_comms("supervisor server timeout")
+
+                    -- close connection, main UI, and stop sounder
+                    coord_comms.close()
+                    renderer.close_ui()
+                    sounder.stop()
+                else
+                    -- a non-clock/main watchdog timer event
+
+                    -- check API watchdogs
+                    apisessions.check_all_watchdogs(param1)
+
+                    -- notify timer callback dispatcher
+                    tcd.handle(param1)
+                end
+            elseif event == "modem_message" then
+                -- got a packet
+                local packet = coord_comms.parse_packet(param1, param2, param3, param4, param5)
+
+                -- handle then check if it was a disconnect
+                if coord_comms.handle_packet(packet) then
+                    log_comms("supervisor closed connection")
+
+                    -- close connection, main UI, and stop sounder
+                    coord_comms.close()
+                    renderer.close_ui()
+                    sounder.stop()
+                end
+            elseif event == "monitor_touch" or event == "mouse_click" or event == "mouse_up" or
+                   event == "mouse_drag" or event == "mouse_scroll" or event == "double_click" then
+                -- handle a mouse event
+                renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
+            elseif event == "speaker_audio_empty" then
+                -- handle speaker buffer emptied
+                sounder.continue()
+            end
+
+            -- check for termination request or UI crash
+            if event == "terminate" or ppm.should_terminate() then
+                crd_state.shutdown = true
+                log.info("terminate requested, main thread exiting")
+            elseif not crd_state.ui_ok then
+                crd_state.shutdown = true
+                log.info("terminating due to fatal UI error")
+            end
+
+            if crd_state.shutdown then
+                -- handle closing supervisor connection
+                coord_comms.try_connect(true)
+
+                if coord_comms.is_linked() then
+                    log_comms("closing supervisor connection...")
+                else crd_state.link_fail = true end
+
+                coord_comms.close()
+                log_comms("supervisor connection closed")
+
+                -- handle API sessions
+                log_comms("closing api sessions...")
+                apisessions.close_all()
+                log_comms("api sessions closed")
+                break
+            end
+        end
+    end
+
+    -- execute the thread in a protected mode, retrying it on return if not shutting down
+    function public.p_exec()
+        local crd_state = smem.crd_state
+
+        while not crd_state.shutdown do
+            local status, result = pcall(public.exec)
+            if status == false then
+                log.fatal(util.strval(result))
+            end
+
+            iocontrol.fp_rt_status("main", false)
+
+            -- if status is true, then we are probably exiting, so this won't matter
+            -- this thread cannot be slept because it will miss events (namely "terminate")
+            if not crd_state.shutdown then
+                log.info("main thread restarting now...")
+            end
+        end
+    end
+
+    return public
+end
+
+-- coordinator renderer thread, tasked with long duration draws
+---@nodiscard
+---@param smem crd_shared_memory
+function threads.thread__render(smem)
+    ---@class parallel_thread
+    local public = {}
+
+    -- execute thread
+    function public.exec()
+        iocontrol.fp_rt_status("render", true)
+        log.debug("render thread start")
+
+        -- load in from shared memory
+        local crd_state    = smem.crd_state
+        local render_queue = smem.q.mq_render
+
+        local last_update = util.time()
+
+        -- thread loop
+        while true do
+            -- check for messages in the message queue
+            while render_queue.ready() and not crd_state.shutdown do
+                local msg = render_queue.pop()
+
+                if msg ~= nil then
+                    if msg.qtype == mqueue.TYPE.COMMAND then
+                        -- received a command
+                        if msg.message == MQ__RENDER_CMD.START_MAIN_UI then
+                            -- stop the UI if it was already started
+                            -- this may occur on a quick supervisor disconnect -> connect
+                            if renderer.ui_ready() then
+                                log_render("closing main UI before executing new request to start")
+                                renderer.close_ui()
+                            end
+
+                            -- start up the main UI
+                            log_render("starting main UI...")
+
+                            local draw_start = util.time_ms()
+
+                            local ui_message
+                            crd_state.ui_ok, ui_message = renderer.try_start_ui()
+                            if not crd_state.ui_ok then
+                                log_render(util.c("main UI error: ", ui_message))
+                                log.fatal(util.c("main GUI render failed with error ", ui_message))
+                            else
+                                log_render("main UI draw took " .. (util.time_ms() - draw_start) .. "ms")
+                            end
+                        end
+                    elseif msg.qtype == mqueue.TYPE.DATA then
+                        -- received data
+                        local cmd = msg.message ---@type queue_data
+
+                        if cmd.key == MQ__RENDER_DATA.MON_CONNECT then
+                            -- monitor connected
+                            if renderer.handle_reconnect(cmd.val.name, cmd.val.device) then
+                                log_sys(util.c("configured monitor ", cmd.val.name, " reconnected"))
+                            else
+                                log_sys(util.c("unused monitor ", cmd.val.name, " connected"))
+                            end
+                        elseif cmd.key == MQ__RENDER_DATA.MON_DISCONNECT then
+                            -- monitor disconnected
+                            if renderer.handle_disconnect(cmd.val) then
+                                log_sys("lost a configured monitor")
+                            else
+                                log_sys("lost an unused monitor")
+                            end
+                        elseif cmd.key == MQ__RENDER_DATA.MON_RESIZE then
+                            -- monitor resized
+                            local is_used, is_ok = renderer.handle_resize(cmd.val)
+                            if is_used then
+                                log_sys(util.c("configured monitor ", cmd.val, " resized, ", util.trinary(is_ok, "display fits", "display does not fit")))
+                            end
+                        end
+                    elseif msg.qtype == mqueue.TYPE.PACKET then
+                        -- received a packet
+                    end
+                end
+
+                -- quick yield
+                util.nop()
+            end
+
+            -- check for termination request
+            if crd_state.shutdown then
+                log.info("render thread exiting")
+                break
+            end
+
+            -- delay before next check
+            last_update = util.adaptive_delay(RENDER_SLEEP, last_update)
+        end
+    end
+
+    -- execute the thread in a protected mode, retrying it on return if not shutting down
+    function public.p_exec()
+        local crd_state = smem.crd_state
+
+        while not crd_state.shutdown do
+            local status, result = pcall(public.exec)
+            if status == false then
+                log.fatal(util.strval(result))
+            end
+
+            iocontrol.fp_rt_status("render", false)
+
+            if not crd_state.shutdown then
+                log.info("render thread restarting in 5 seconds...")
+                util.psleep(5)
+            end
+        end
+    end
+
+    return public
+end
+
+return threads

coordinator/ui/components/boiler.lua

@@ -1,5 +1,7 @@
 local style          = require("coordinator.ui.style")
 
+local iocontrol      = require("coordinator.iocontrol")
+
 local core           = require("graphics.core")
 
 local Rectangle      = require("graphics.elements.rectangle")
@@ -18,23 +20,25 @@ local border = core.border
 ---@param y integer top left y
 ---@param ps psil ps interface
 local function new_view(root, x, y, ps)
-    local boiler = Rectangle{parent=root,border=border(1, colors.gray, true),width=31,height=7,x=x,y=y}
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
+    local db = iocontrol.get_db()
+
+    local boiler = Rectangle{parent=root,border=border(1,colors.gray,true),width=31,height=7,x=x,y=y}
 
     local status = StateIndicator{parent=boiler,x=9,y=1,states=style.boiler.states,value=1,min_width=12}
-    local temp   = DataIndicator{parent=boiler,x=5,y=3,lu_colors=lu_col,label="Temp:",unit="K",format="%10.2f",value=0,width=22,fg_bg=text_fg_bg}
-    local boil_r = DataIndicator{parent=boiler,x=5,y=4,lu_colors=lu_col,label="Boil:",unit="mB/t",format="%10.0f",value=0,commas=true,width=22,fg_bg=text_fg_bg}
+    local temp   = DataIndicator{parent=boiler,x=5,y=3,lu_colors=lu_col,label="Temp:",unit=db.temp_label,format="%10.2f",value=0,commas=true,width=22,fg_bg=text_fg}
+    local boil_r = DataIndicator{parent=boiler,x=5,y=4,lu_colors=lu_col,label="Boil:",unit="mB/t",format="%10.0f",value=0,commas=true,width=22,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
-    temp.register(ps, "temperature", temp.update)
+    temp.register(ps, "temperature", function (t) temp.update(db.temp_convert(t)) end)
     boil_r.register(ps, "boil_rate", boil_r.update)
 
-    TextBox{parent=boiler,text="H",x=2,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=boiler,text="W",x=3,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=boiler,text="S",x=27,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=boiler,text="C",x=28,y=5,height=1,width=1,fg_bg=text_fg_bg}
+    TextBox{parent=boiler,text="H",x=2,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=boiler,text="W",x=3,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=boiler,text="S",x=27,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=boiler,text="C",x=28,y=5,height=1,width=1,fg_bg=text_fg}
 
     local hcool = VerticalBar{parent=boiler,x=2,y=1,fg_bg=cpair(colors.orange,colors.gray),height=4,width=1}
     local water = VerticalBar{parent=boiler,x=3,y=1,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1}

coordinator/ui/components/imatrix.lua

@@ -9,6 +9,7 @@ local Rectangle      = require("graphics.elements.rectangle")
 local TextBox        = require("graphics.elements.textbox")
 
 local DataIndicator  = require("graphics.elements.indicators.data")
+local IndicatorLight = require("graphics.elements.indicators.light")
 local PowerIndicator = require("graphics.elements.indicators.power")
 local StateIndicator = require("graphics.elements.indicators.state")
 local VerticalBar    = require("graphics.elements.indicators.vbar")
@@ -16,7 +17,7 @@ local VerticalBar    = require("graphics.elements.indicators.vbar")
 local cpair = core.cpair
 local border = core.border
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 -- new induction matrix view
 ---@param root graphics_element parent
@@ -26,71 +27,120 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 ---@param ps psil ps interface
 ---@param id number? matrix ID
 local function new_view(root, x, y, data, ps, id)
+    local label_fg = style.theme.label_fg
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
+
+    local ind_yel = style.ind_yel
+    local ind_wht = style.ind_wht
+
     local title = "INDUCTION MATRIX"
     if type(id) == "number" then title = title .. id end
 
     local matrix = Div{parent=root,fg_bg=style.root,width=33,height=24,x=x,y=y}
 
-    TextBox{parent=matrix,text=" ",width=33,height=1,x=1,y=1,fg_bg=cpair(colors.lightGray,colors.gray)}
-    TextBox{parent=matrix,text=title,alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.gray)}
+    -- black has low contrast with dark gray, so if background is black use white instead
+    local cutout_fg_bg = cpair(util.trinary(style.theme.bg == colors.black, colors.white, style.theme.bg), colors.gray)
+
+    TextBox{parent=matrix,text=" ",width=33,height=1,x=1,y=1,fg_bg=cutout_fg_bg}
+    TextBox{parent=matrix,text=title,alignment=ALIGN.CENTER,width=33,height=1,x=1,y=2,fg_bg=cutout_fg_bg}
 
     local rect = Rectangle{parent=matrix,border=border(1,colors.gray,true),width=33,height=22,x=1,y=3}
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local label_fg_bg = cpair(colors.gray, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
-
-    local status   = StateIndicator{parent=rect,x=10,y=1,states=style.imatrix.states,value=1,min_width=14}
-    local energy   = PowerIndicator{parent=rect,x=7,y=3,lu_colors=lu_col,label="Energy:  ",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local capacity = PowerIndicator{parent=rect,x=7,y=4,lu_colors=lu_col,label="Capacity:",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local input    = PowerIndicator{parent=rect,x=7,y=5,lu_colors=lu_col,label="Input:   ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
-    local output   = PowerIndicator{parent=rect,x=7,y=6,lu_colors=lu_col,label="Output:  ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
-
-    local avg_chg  = PowerIndicator{parent=rect,x=7,y=8,lu_colors=lu_col,label="Avg. Chg:",format="%8.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local avg_in   = PowerIndicator{parent=rect,x=7,y=9,lu_colors=lu_col,label="Avg. In: ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
-    local avg_out  = PowerIndicator{parent=rect,x=7,y=10,lu_colors=lu_col,label="Avg. Out:",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg_bg}
+    local status    = StateIndicator{parent=rect,x=10,y=1,states=style.imatrix.states,value=1,min_width=14}
+    local capacity  = PowerIndicator{parent=rect,x=7,y=3,lu_colors=lu_col,label="Capacity:",format="%8.2f",value=0,width=26,fg_bg=text_fg}
+    local energy    = PowerIndicator{parent=rect,x=7,y=4,lu_colors=lu_col,label="Energy:  ",format="%8.2f",value=0,width=26,fg_bg=text_fg}
+    local avg_chg   = PowerIndicator{parent=rect,x=7,y=5,lu_colors=lu_col,label="\xb7Average:",format="%8.2f",value=0,width=26,fg_bg=text_fg}
+    local input     = PowerIndicator{parent=rect,x=7,y=6,lu_colors=lu_col,label="Input:   ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local avg_in    = PowerIndicator{parent=rect,x=7,y=7,lu_colors=lu_col,label="\xb7Average:",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local output    = PowerIndicator{parent=rect,x=7,y=8,lu_colors=lu_col,label="Output:  ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local avg_out   = PowerIndicator{parent=rect,x=7,y=9,lu_colors=lu_col,label="\xb7Average:",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
+    local trans_cap = PowerIndicator{parent=rect,x=7,y=10,lu_colors=lu_col,label="Max I/O: ",format="%8.2f",rate=true,value=0,width=26,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
-    energy.register(ps, "energy", function (val) energy.update(util.joules_to_fe(val)) end)
     capacity.register(ps, "max_energy", function (val) capacity.update(util.joules_to_fe(val)) end)
-    input.register(ps, "last_input", function (val) input.update(util.joules_to_fe(val)) end)
-    output.register(ps, "last_output", function (val) output.update(util.joules_to_fe(val)) end)
-
+    energy.register(ps, "energy", function (val) energy.update(util.joules_to_fe(val)) end)
     avg_chg.register(ps, "avg_charge", avg_chg.update)
+    input.register(ps, "last_input", function (val) input.update(util.joules_to_fe(val)) end)
     avg_in.register(ps, "avg_inflow", avg_in.update)
+    output.register(ps, "last_output", function (val) output.update(util.joules_to_fe(val)) end)
     avg_out.register(ps, "avg_outflow", avg_out.update)
+    trans_cap.register(ps, "transfer_cap", function (val) trans_cap.update(util.joules_to_fe(val)) end)
 
-    local fill      = DataIndicator{parent=rect,x=11,y=12,lu_colors=lu_col,label="Fill:",unit="%",format="%8.2f",value=0,width=18,fg_bg=text_fg_bg}
-
-    local cells     = DataIndicator{parent=rect,x=11,y=14,lu_colors=lu_col,label="Cells:    ",format="%7d",value=0,width=18,fg_bg=text_fg_bg}
-    local providers = DataIndicator{parent=rect,x=11,y=15,lu_colors=lu_col,label="Providers:",format="%7d",value=0,width=18,fg_bg=text_fg_bg}
-
-    TextBox{parent=rect,text="Transfer Capacity",x=11,y=17,height=1,width=17,fg_bg=label_fg_bg}
-    local trans_cap = PowerIndicator{parent=rect,x=19,y=18,lu_colors=lu_col,label="",format="%5.2f",rate=true,value=0,width=12,fg_bg=text_fg_bg}
+    local fill      = DataIndicator{parent=rect,x=11,y=12,lu_colors=lu_col,label="Fill:     ",format="%7.2f",unit="%",value=0,width=20,fg_bg=text_fg}
+    local cells     = DataIndicator{parent=rect,x=11,y=13,lu_colors=lu_col,label="Cells:    ",format="%7d",value=0,width=18,fg_bg=text_fg}
+    local providers = DataIndicator{parent=rect,x=11,y=14,lu_colors=lu_col,label="Providers:",format="%7d",value=0,width=18,fg_bg=text_fg}
 
+    fill.register(ps, "energy_fill", function (val) fill.update(val * 100) end)
     cells.register(ps, "cells", cells.update)
     providers.register(ps, "providers", providers.update)
-    fill.register(ps, "energy_fill", function (val) fill.update(val * 100) end)
-    trans_cap.register(ps, "transfer_cap", function (val) trans_cap.update(util.joules_to_fe(val)) end)
+
+    local chging = IndicatorLight{parent=rect,x=11,y=16,label="Charging",colors=ind_wht}
+    local dischg = IndicatorLight{parent=rect,x=11,y=17,label="Discharging",colors=ind_wht}
+    local max_io = IndicatorLight{parent=rect,x=11,y=18,label="Max I/O Rate",colors=ind_yel}
+
+    chging.register(ps, "is_charging", chging.update)
+    dischg.register(ps, "is_discharging", dischg.update)
+    max_io.register(ps, "at_max_io", max_io.update)
 
     local charge  = VerticalBar{parent=rect,x=2,y=2,fg_bg=cpair(colors.green,colors.gray),height=17,width=4}
     local in_cap  = VerticalBar{parent=rect,x=7,y=12,fg_bg=cpair(colors.red,colors.gray),height=7,width=1}
     local out_cap = VerticalBar{parent=rect,x=9,y=12,fg_bg=cpair(colors.blue,colors.gray),height=7,width=1}
 
-    TextBox{parent=rect,text="FILL",x=2,y=20,height=1,width=4,fg_bg=text_fg_bg}
-    TextBox{parent=rect,text="I/O",x=7,y=20,height=1,width=3,fg_bg=text_fg_bg}
+    TextBox{parent=rect,text="FILL I/O",x=2,y=20,height=1,width=8,fg_bg=label_fg}
 
     local function calc_saturation(val)
         if (type(data.build) == "table") and (type(data.build.transfer_cap) == "number") and (data.build.transfer_cap > 0) then
             return val / data.build.transfer_cap
-        else
-            return 0
-        end
+        else return 0 end
     end
 
     charge.register(ps, "energy_fill", charge.update)
     in_cap.register(ps, "last_input", function (val) in_cap.update(calc_saturation(val)) end)
     out_cap.register(ps, "last_output", function (val) out_cap.update(calc_saturation(val)) end)
+
+    local eta = TextBox{parent=rect,x=11,y=20,width=20,height=1,text="ETA Unknown",alignment=ALIGN.CENTER,fg_bg=style.theme.field_box}
+
+    eta.register(ps, "eta_ms", function (eta_ms)
+        local str, pre = "", util.trinary(eta_ms >= 0, "Full in ", "Empty in ")
+
+        local seconds = math.abs(eta_ms) / 1000
+        local minutes = seconds / 60
+        local hours   = minutes / 60
+        local days    = hours / 24
+
+        if math.abs(eta_ms) < 1000 or (eta_ms ~= eta_ms) then
+            -- really small or NaN
+            str = "No ETA"
+        elseif days < 1000 then
+            days    = math.floor(days)
+            hours   = math.floor(hours % 24)
+            minutes = math.floor(minutes % 60)
+            seconds = math.floor(seconds % 60)
+
+            if days > 0 then
+                str = days .. "d"
+            elseif hours > 0 then
+                str = hours .. "h " .. minutes .. "m"
+            elseif minutes > 0 then
+                str = minutes .. "m " .. seconds .. "s"
+            elseif seconds > 0 then
+                str = seconds .. "s"
+            end
+
+            str = pre .. str
+        else
+            local years = math.floor(days / 365.25)
+
+            if years <= 99999999 then
+                str = pre .. years .. "y"
+            else
+                str = pre .. "eras"
+            end
+        end
+
+        eta.set_value(str)
+    end)
 end
 
 return new_view

coordinator/ui/components/pkt_entry.lua

@@ -4,6 +4,8 @@
 
 local iocontrol     = require("coordinator.iocontrol")
 
+local style         = require("coordinator.ui.style")
+
 local core          = require("graphics.core")
 
 local Div           = require("graphics.elements.div")
@@ -11,7 +13,7 @@ local TextBox       = require("graphics.elements.textbox")
 
 local DataIndicator = require("graphics.elements.indicators.data")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 
@@ -19,26 +21,31 @@ local cpair = core.cpair
 ---@param parent graphics_element parent
 ---@param id integer PKT session ID
 local function init(parent, id)
+    local s_hi_box = style.fp_theme.highlight_box
+    local s_hi_bright = style.fp_theme.highlight_box_bright
+
+    local label_fg = style.fp.label_fg
+
     local ps = iocontrol.get_db().fp.ps
 
     -- root div
     local root = Div{parent=parent,x=2,y=2,height=4,width=parent.get_width()-2,hidden=true}
-    local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=cpair(colors.black,colors.white)}
+    local entry = Div{parent=root,x=2,y=1,height=3,fg_bg=s_hi_bright}
 
     local ps_prefix = "pkt_" .. id .. "_"
 
-    TextBox{parent=entry,x=1,y=1,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
-    local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=TEXT_ALIGN.CENTER,width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray),nav_active=cpair(colors.gray,colors.black)}
-    TextBox{parent=entry,x=1,y=3,text="",width=8,height=1,fg_bg=cpair(colors.black,colors.lightGray)}
+    TextBox{parent=entry,x=1,y=1,text="",width=8,height=1,fg_bg=s_hi_box}
+    local pkt_addr = TextBox{parent=entry,x=1,y=2,text="@ C ??",alignment=ALIGN.CENTER,width=8,height=1,fg_bg=s_hi_box,nav_active=cpair(colors.gray,colors.black)}
+    TextBox{parent=entry,x=1,y=3,text="",width=8,height=1,fg_bg=s_hi_box}
     pkt_addr.register(ps, ps_prefix .. "addr", pkt_addr.set_value)
 
     TextBox{parent=entry,x=10,y=2,text="FW:",width=3,height=1}
-    local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    local pkt_fw_v = TextBox{parent=entry,x=14,y=2,text=" ------- ",width=20,height=1,fg_bg=label_fg}
     pkt_fw_v.register(ps, ps_prefix .. "fw", pkt_fw_v.set_value)
 
     TextBox{parent=entry,x=35,y=2,text="RTT:",width=4,height=1}
-    local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=cpair(colors.lightGray,colors.white)}
-    TextBox{parent=entry,x=46,y=2,text="ms",width=4,height=1,fg_bg=cpair(colors.lightGray,colors.white)}
+    local pkt_rtt = DataIndicator{parent=entry,x=40,y=2,label="",unit="",format="%5d",value=0,width=5,fg_bg=label_fg}
+    TextBox{parent=entry,x=46,y=2,text="ms",width=4,height=1,fg_bg=label_fg}
     pkt_rtt.register(ps, ps_prefix .. "rtt", pkt_rtt.update)
     pkt_rtt.register(ps, ps_prefix .. "rtt_color", pkt_rtt.recolor)
 

coordinator/ui/components/process_ctl.lua

@@ -23,11 +23,13 @@ local HazardButton      = require("graphics.elements.controls.hazard_button")
 local RadioButton       = require("graphics.elements.controls.radio_button")
 local SpinboxNumeric    = require("graphics.elements.controls.spinbox_numeric")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 local border = core.border
 
+local bw_fg_bg = style.bw_fg_bg
+
 local period = core.flasher.PERIOD
 
 -- new process control view
@@ -35,16 +37,28 @@ local period = core.flasher.PERIOD
 ---@param x integer top left x
 ---@param y integer top left y
 local function new_view(root, x, y)
+    local s_hi_box = style.theme.highlight_box
+    local s_field = style.theme.field_box
+
+    local lu_cpair = style.lu_colors
+    local hzd_fg_bg  = style.hzd_fg_bg
+    local dis_colors = style.dis_colors
+    local arrow_fg_bg = cpair(style.theme.label, s_hi_box.bkg)
+
+    local ind_grn = style.ind_grn
+    local ind_yel = style.ind_yel
+    local ind_red = style.ind_red
+    local ind_wht = style.ind_wht
+
     assert(root.get_height() >= (y + 24), "main display not of sufficient vertical resolution (add an additional row of monitors)")
 
+    local black = cpair(colors.black, colors.black)
+    local blk_brn = cpair(colors.black, colors.brown)
+    local blk_pur = cpair(colors.black, colors.purple)
+
     local facility = iocontrol.get_db().facility
     local units = iocontrol.get_db().units
 
-    local bw_fg_bg   = cpair(colors.black, colors.white)
-    local hzd_fg_bg  = cpair(colors.white, colors.gray)
-    local lu_cpair   = cpair(colors.gray, colors.gray)
-    local dis_colors = cpair(colors.white, colors.lightGray)
-
     local main = Div{parent=root,width=128,height=24,x=x,y=y}
 
     local scram = HazardButton{parent=main,x=1,y=1,text="FAC SCRAM",accent=colors.yellow,dis_colors=dis_colors,callback=process.fac_scram,fg_bg=hzd_fg_bg}
@@ -53,10 +67,10 @@ local function new_view(root, x, y)
     facility.scram_ack = scram.on_response
     facility.ack_alarms_ack = ack_a.on_response
 
-    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=cpair(colors.green,colors.red)}
-    local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
-    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=cpair(colors.green,colors.gray)}
-    local sps     = IndicatorLight{parent=main,label="SPS Connected",colors=cpair(colors.green,colors.gray)}
+    local all_ok  = IndicatorLight{parent=main,y=5,label="Unit Systems Online",colors=ind_grn}
+    local rad_mon = TriIndicatorLight{parent=main,label="Radiation Monitor",c1=style.ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd}
+    local ind_mat = IndicatorLight{parent=main,label="Induction Matrix",colors=ind_grn}
+    local sps     = IndicatorLight{parent=main,label="SPS Connected",colors=ind_grn}
 
     all_ok.register(facility.ps, "all_sys_ok", all_ok.update)
     rad_mon.register(facility.ps, "rad_computed_status", rad_mon.update)
@@ -65,10 +79,10 @@ local function new_view(root, x, y)
 
     main.line_break()
 
-    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=cpair(colors.green,colors.red)}
-    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=cpair(colors.green,colors.gray)}
-    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=cpair(colors.yellow,colors.gray)}
+    local auto_ready = IndicatorLight{parent=main,label="Configured Units Ready",colors=ind_grn}
+    local auto_act   = IndicatorLight{parent=main,label="Process Active",colors=ind_grn}
+    local auto_ramp  = IndicatorLight{parent=main,label="Process Ramping",colors=ind_wht,flash=true,period=period.BLINK_250_MS}
+    local auto_sat   = IndicatorLight{parent=main,label="Min/Max Burn Rate",colors=ind_yel}
 
     auto_ready.register(facility.ps, "auto_ready", auto_ready.update)
     auto_act.register(facility.ps, "auto_active", auto_act.update)
@@ -77,12 +91,12 @@ local function new_view(root, x, y)
 
     main.line_break()
 
-    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local auto_scram  = IndicatorLight{parent=main,label="Automatic SCRAM",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local matrix_dc   = IndicatorLight{parent=main,label="Matrix Disconnected",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local matrix_fill = IndicatorLight{parent=main,label="Matrix Charge High",colors=ind_red,flash=true,period=period.BLINK_500_MS}
+    local unit_crit   = IndicatorLight{parent=main,label="Unit Critical Alarm",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local fac_rad_h   = IndicatorLight{parent=main,label="Facility Radiation High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local gen_fault   = IndicatorLight{parent=main,label="Gen. Control Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
 
     auto_scram.register(facility.ps, "auto_scram", auto_scram.update)
     matrix_dc.register(facility.ps, "as_matrix_dc", matrix_dc.update)
@@ -92,11 +106,11 @@ local function new_view(root, x, y)
     gen_fault.register(facility.ps, "as_gen_fault", gen_fault.update)
 
     TextBox{parent=main,y=23,text="Radiation",height=1,width=13,fg_bg=style.label}
-    local radiation = RadIndicator{parent=main,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local radiation = RadIndicator{parent=main,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     radiation.register(facility.ps, "radiation", radiation.update)
 
     TextBox{parent=main,x=15,y=23,text="Linked RTUs",height=1,width=11,fg_bg=style.label}
-    local rtu_count = DataIndicator{parent=main,x=15,y=24,label="",format="%11d",value=0,lu_colors=lu_cpair,width=11,fg_bg=bw_fg_bg}
+    local rtu_count = DataIndicator{parent=main,x=15,y=24,label="",format="%11d",value=0,lu_colors=lu_cpair,width=11,fg_bg=s_field}
     rtu_count.register(facility.ps, "rtu_count", rtu_count.update)
 
     ---------------------
@@ -111,35 +125,35 @@ local function new_view(root, x, y)
 
     local targets = Div{parent=proc,width=31,height=24,x=1,y=1}
 
-    local burn_tag = Div{parent=targets,x=1,y=1,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
+    local burn_tag = Div{parent=targets,x=1,y=1,width=8,height=4,fg_bg=blk_pur}
     TextBox{parent=burn_tag,x=2,y=2,text="Burn Target",width=7,height=2}
 
-    local burn_target = Div{parent=targets,x=9,y=1,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local b_target = SpinboxNumeric{parent=burn_target,x=11,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=burn_target,x=18,y=2,text="mB/t"}
-    local burn_sum = DataIndicator{parent=targets,x=9,y=4,label="",format="%18.1f",value=0,unit="mB/t",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
+    local burn_target = Div{parent=targets,x=9,y=1,width=23,height=3,fg_bg=s_hi_box}
+    local b_target = SpinboxNumeric{parent=burn_target,x=11,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=burn_target,x=18,y=2,text="mB/t",fg_bg=style.theme.label_fg}
+    local burn_sum = DataIndicator{parent=targets,x=9,y=4,label="",format="%18.1f",value=0,unit="mB/t",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
 
     b_target.register(facility.ps, "process_burn_target", b_target.set_value)
     burn_sum.register(facility.ps, "burn_sum", burn_sum.update)
 
-    local chg_tag = Div{parent=targets,x=1,y=6,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
+    local chg_tag = Div{parent=targets,x=1,y=6,width=8,height=4,fg_bg=blk_pur}
     TextBox{parent=chg_tag,x=2,y=2,text="Charge Target",width=7,height=2}
 
-    local chg_target = Div{parent=targets,x=9,y=6,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local c_target = SpinboxNumeric{parent=chg_target,x=2,y=1,whole_num_precision=15,fractional_precision=0,min=0,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=chg_target,x=18,y=2,text="MFE"}
-    local cur_charge = DataIndicator{parent=targets,x=9,y=9,label="",format="%19d",value=0,unit="MFE",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
+    local chg_target = Div{parent=targets,x=9,y=6,width=23,height=3,fg_bg=s_hi_box}
+    local c_target = SpinboxNumeric{parent=chg_target,x=2,y=1,whole_num_precision=15,fractional_precision=0,min=0,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=chg_target,x=18,y=2,text="MFE",fg_bg=style.theme.label_fg}
+    local cur_charge = DataIndicator{parent=targets,x=9,y=9,label="",format="%19d",value=0,unit="MFE",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
 
     c_target.register(facility.ps, "process_charge_target", c_target.set_value)
-    cur_charge.register(facility.induction_ps_tbl[1], "energy", function (j) cur_charge.update(util.joules_to_fe(j) / 1000000) end)
+    cur_charge.register(facility.induction_ps_tbl[1], "avg_charge", function (fe) cur_charge.update(fe / 1000000) end)
 
-    local gen_tag = Div{parent=targets,x=1,y=11,width=8,height=4,fg_bg=cpair(colors.black,colors.purple)}
+    local gen_tag = Div{parent=targets,x=1,y=11,width=8,height=4,fg_bg=blk_pur}
     TextBox{parent=gen_tag,x=2,y=2,text="Gen. Target",width=7,height=2}
 
-    local gen_target = Div{parent=targets,x=9,y=11,width=23,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local g_target = SpinboxNumeric{parent=gen_target,x=8,y=1,whole_num_precision=9,fractional_precision=0,min=0,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=gen_target,x=18,y=2,text="kFE/t"}
-    local cur_gen = DataIndicator{parent=targets,x=9,y=14,label="",format="%17d",value=0,unit="kFE/t",commas=true,lu_colors=cpair(colors.black,colors.black),width=23,fg_bg=cpair(colors.black,colors.brown)}
+    local gen_target = Div{parent=targets,x=9,y=11,width=23,height=3,fg_bg=s_hi_box}
+    local g_target = SpinboxNumeric{parent=gen_target,x=8,y=1,whole_num_precision=9,fractional_precision=0,min=0,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=gen_target,x=18,y=2,text="kFE/t",fg_bg=style.theme.label_fg}
+    local cur_gen = DataIndicator{parent=targets,x=9,y=14,label="",format="%17d",value=0,unit="kFE/t",commas=true,lu_colors=black,width=23,fg_bg=blk_brn}
 
     g_target.register(facility.ps, "process_gen_target", g_target.set_value)
     cur_gen.register(facility.induction_ps_tbl[1], "last_input", function (j) cur_gen.update(util.round(util.joules_to_fe(j) / 1000)) end)
@@ -154,18 +168,18 @@ local function new_view(root, x, y)
 
     for i = 1, 4 do
         local unit
-        local tag_fg_bg = cpair(colors.gray,colors.white)
-        local lim_fg_bg = cpair(colors.lightGray,colors.white)
-        local ctl_fg    = colors.lightGray
-        local cur_fg_bg = cpair(colors.lightGray,colors.white)
-        local cur_lu    = colors.lightGray
+        local tag_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local lim_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local label_fg  = style.theme.disabled_fg
+        local cur_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local cur_lu    = style.theme.disabled
 
         if i <= facility.num_units then
             unit = units[i]   ---@type ioctl_unit
-            tag_fg_bg = cpair(colors.black,colors.lightBlue)
-            lim_fg_bg = bw_fg_bg
-            ctl_fg    = colors.gray
-            cur_fg_bg = cpair(colors.black,colors.brown)
+            tag_fg_bg = cpair(colors.black, colors.lightBlue)
+            lim_fg_bg = s_hi_box
+            label_fg  = style.theme.label_fg
+            cur_fg_bg = blk_brn
             cur_lu    = colors.black
         end
 
@@ -174,9 +188,9 @@ local function new_view(root, x, y)
         local unit_tag = Div{parent=limit_div,x=1,y=_y,width=8,height=4,fg_bg=tag_fg_bg}
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Limit",width=7,height=2}
 
-        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=cpair(ctl_fg,colors.white)}
-        local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=lim_fg_bg}
-        TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1}
+        local lim_ctl = Div{parent=limit_div,x=9,y=_y,width=14,height=3,fg_bg=s_hi_box}
+        local lim = SpinboxNumeric{parent=lim_ctl,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled,fg_bg=lim_fg_bg}
+        TextBox{parent=lim_ctl,x=9,y=2,text="mB/t",width=4,height=1,fg_bg=label_fg}
 
         local cur_burn = DataIndicator{parent=limit_div,x=9,y=_y+3,label="",format="%7.1f",value=0,unit="mB/t",commas=false,lu_colors=cpair(cur_lu,cur_lu),width=14,fg_bg=cur_fg_bg}
 
@@ -198,14 +212,14 @@ local function new_view(root, x, y)
     local stat_div = Div{parent=proc,width=22,height=24,x=57,y=6}
 
     for i = 1, 4 do
-        local tag_fg_bg = cpair(colors.gray,colors.white)
-        local ind_fg_bg = cpair(colors.lightGray,colors.white)
-        local ind_off = colors.lightGray
+        local tag_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local ind_fg_bg = cpair(style.theme.disabled, s_hi_box.bkg)
+        local ind_off = style.theme.disabled
 
         if i <= facility.num_units then
-            tag_fg_bg = cpair(colors.black,colors.cyan)
-            ind_fg_bg = bw_fg_bg
-            ind_off = colors.gray
+            tag_fg_bg = cpair(colors.black, colors.cyan)
+            ind_fg_bg = cpair(style.theme.text, s_hi_box.bkg)
+            ind_off = style.ind_hi_box_bg
         end
 
         local _y = ((i - 1) * 5) + 1
@@ -214,8 +228,8 @@ local function new_view(root, x, y)
         TextBox{parent=unit_tag,x=2,y=2,text="Unit "..i.." Status",width=7,height=2}
 
         local lights   = Div{parent=stat_div,x=9,y=_y,width=14,height=4,fg_bg=ind_fg_bg}
-        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(colors.green,ind_off)}
-        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(colors.red,ind_off),flash=true,period=period.BLINK_250_MS}
+        local ready    = IndicatorLight{parent=lights,x=2,y=2,label="Ready",colors=cpair(ind_grn.fgd,ind_off)}
+        local degraded = IndicatorLight{parent=lights,x=2,y=3,label="Degraded",colors=cpair(ind_red.fgd,ind_off),flash=true,period=period.BLINK_250_MS}
 
         if i <= facility.num_units then
             local unit = units[i]   ---@type ioctl_unit
@@ -230,18 +244,18 @@ local function new_view(root, x, y)
     -------------------------
 
     local ctl_opts = { "Monitored Max Burn", "Combined Burn Rate", "Charge Level", "Generation Rate" }
-    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.purple}
+    local mode = RadioButton{parent=proc,x=34,y=1,options=ctl_opts,callback=function()end,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.purple}
 
     mode.register(facility.ps, "process_mode", mode.set_value)
 
     local u_stat = Rectangle{parent=proc,border=border(1,colors.gray,true),thin=true,width=31,height=4,x=1,y=16,fg_bg=bw_fg_bg}
-    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=31,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=bw_fg_bg}
-    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=31,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.gray, colors.white)}
+    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=31,height=1,alignment=ALIGN.CENTER,fg_bg=bw_fg_bg}
+    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=31,height=1,alignment=ALIGN.CENTER,fg_bg=cpair(colors.gray,colors.white)}
 
     stat_line_1.register(facility.ps, "status_line_1", stat_line_1.set_value)
     stat_line_2.register(facility.ps, "status_line_2", stat_line_2.set_value)
 
-    local auto_controls = Div{parent=proc,x=1,y=20,width=31,height=5,fg_bg=cpair(colors.gray,colors.white)}
+    local auto_controls = Div{parent=proc,x=1,y=20,width=31,height=5,fg_bg=s_hi_box}
 
     -- save the automatic process control configuration without starting
     local function _save_cfg()
@@ -307,7 +321,7 @@ local function new_view(root, x, y)
         local unit = units[i]   ---@type ioctl_unit
 
         TextBox{parent=waste_status,y=i,text="U"..i.." Waste",width=8,height=1}
-        local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=cpair(colors.white,colors.gray)}
+        local a_waste = IndicatorLight{parent=waste_status,x=10,y=i,label="Auto",colors=ind_wht}
         local waste_m = StateIndicator{parent=waste_status,x=17,y=i,states=style.waste.states_abbrv,value=1,min_width=6}
 
         a_waste.register(unit.unit_ps, "U_AutoWaste", a_waste.update)
@@ -316,40 +330,36 @@ local function new_view(root, x, y)
 
     local waste_sel = Div{parent=proc,width=21,height=24,x=81,y=1}
 
-    TextBox{parent=waste_sel,text=" ",width=21,height=1,x=1,y=1,fg_bg=cpair(colors.black,colors.brown)}
-    TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=TEXT_ALIGN.CENTER,width=21,height=1,x=1,y=2,fg_bg=cpair(colors.lightGray,colors.brown)}
+    local cutout_fg_bg = cpair(style.theme.bg, colors.brown)
+
+    TextBox{parent=waste_sel,text=" ",width=21,height=1,x=1,y=1,fg_bg=cutout_fg_bg}
+    TextBox{parent=waste_sel,text="WASTE PRODUCTION",alignment=ALIGN.CENTER,width=21,height=1,x=1,y=2,fg_bg=cutout_fg_bg}
 
     local rect   = Rectangle{parent=waste_sel,border=border(1,colors.brown,true),width=21,height=22,x=1,y=3}
     local status = StateIndicator{parent=rect,x=2,y=1,states=style.waste.states,value=1,min_width=17}
 
     status.register(facility.ps, "current_waste_product", status.update)
 
-    local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(colors.white,colors.black),radio_bg=colors.brown}
-    local pu_fallback = Checkbox{parent=rect,x=2,y=7,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.green,colors.black)}
+    local waste_prod = RadioButton{parent=rect,x=2,y=3,options=style.waste.options,callback=process.set_process_waste,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.brown}
 
     waste_prod.register(facility.ps, "process_waste_product", waste_prod.set_value)
-    pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
 
-    local fb_active  = IndicatorLight{parent=rect,x=2,y=9,label="Fallback Active",colors=cpair(colors.white,colors.gray)}
+    local fb_active = IndicatorLight{parent=rect,x=2,y=7,label="Fallback Active",colors=ind_wht}
+    local sps_disabled  = IndicatorLight{parent=rect,x=2,y=8,label="SPS Disabled LC",colors=ind_yel}
 
     fb_active.register(facility.ps, "pu_fallback_active", fb_active.update)
+    sps_disabled.register(facility.ps, "sps_disabled_low_power", sps_disabled.update)
 
-    TextBox{parent=rect,x=2,y=11,text="Plutonium Rate",height=1,width=17,fg_bg=style.label}
-    local pu_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+    local pu_fallback = Checkbox{parent=rect,x=2,y=10,label="Pu Fallback",callback=process.set_pu_fallback,box_fg_bg=cpair(colors.brown,style.theme.checkbox_bg)}
 
-    TextBox{parent=rect,x=2,y=14,text="Polonium Rate",height=1,width=17,fg_bg=style.label}
-    local po_rate = DataIndicator{parent=rect,x=2,label="",unit="mB/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+    TextBox{parent=rect,x=2,y=12,height=3,text="Switch to Pu when SNAs cannot keep up with waste.",fg_bg=style.label}
 
-    TextBox{parent=rect,x=2,y=17,text="Antimatter Rate",height=1,width=17,fg_bg=style.label}
-    local am_rate = DataIndicator{parent=rect,x=2,label="",unit="\xb5B/t",format="%12.2f",value=0,lu_colors=lu_cpair,fg_bg=bw_fg_bg,width=17}
+    local lc_sps = Checkbox{parent=rect,x=2,y=16,label="Low Charge SPS",callback=process.set_sps_low_power,box_fg_bg=cpair(colors.brown,style.theme.checkbox_bg)}
 
-    pu_rate.register(facility.ps, "pu_rate", pu_rate.update)
-    po_rate.register(facility.ps, "po_rate", po_rate.update)
-    am_rate.register(facility.ps, "am_rate", am_rate.update)
+    TextBox{parent=rect,x=2,y=18,height=3,text="Use SPS at low charge, otherwise switches to Po.",fg_bg=style.label}
 
-    local sna_count = DataIndicator{parent=rect,x=2,y=20,label="Linked SNAs:",format="%4d",value=0,lu_colors=lu_cpair,width=17}
-
-    sna_count.register(facility.ps, "sna_count", sna_count.update)
+    pu_fallback.register(facility.ps, "process_pu_fallback", pu_fallback.set_value)
+    lc_sps.register(facility.ps, "process_sps_low_power", lc_sps.set_value)
 end
 
 return new_view

coordinator/ui/components/reactor.lua

@@ -1,5 +1,7 @@
 local types          = require("scada-common.types")
 
+local iocontrol      = require("coordinator.iocontrol")
+
 local style          = require("coordinator.ui.style")
 
 local core           = require("graphics.core")
@@ -20,29 +22,31 @@ local border = core.border
 ---@param y integer top left y
 ---@param ps psil ps interface
 local function new_view(root, x, y, ps)
-    local reactor = Rectangle{parent=root,border=border(1, colors.gray, true),width=30,height=7,x=x,y=y}
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
+    local db = iocontrol.get_db()
+
+    local reactor = Rectangle{parent=root,border=border(1,colors.gray,true),width=30,height=7,x=x,y=y}
 
     local status    = StateIndicator{parent=reactor,x=6,y=1,states=style.reactor.states,value=1,min_width=16}
-    local core_temp = DataIndicator{parent=reactor,x=2,y=3,lu_colors=lu_col,label="Core Temp:",unit="K",format="%10.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local burn_r    = DataIndicator{parent=reactor,x=2,y=4,lu_colors=lu_col,label="Burn Rate:",unit="mB/t",format="%10.2f",value=0,width=26,fg_bg=text_fg_bg}
-    local heating_r = DataIndicator{parent=reactor,x=2,y=5,lu_colors=lu_col,label="Heating:",unit="mB/t",format="%12.0f",value=0,commas=true,width=26,fg_bg=text_fg_bg}
+    local core_temp = DataIndicator{parent=reactor,x=2,y=3,lu_colors=lu_col,label="Core Temp:",unit=db.temp_label,format="%10.2f",value=0,commas=true,width=26,fg_bg=text_fg}
+    local burn_r    = DataIndicator{parent=reactor,x=2,y=4,lu_colors=lu_col,label="Burn Rate:",unit="mB/t",format="%10.2f",value=0,width=26,fg_bg=text_fg}
+    local heating_r = DataIndicator{parent=reactor,x=2,y=5,lu_colors=lu_col,label="Heating:",unit="mB/t",format="%12.0f",value=0,commas=true,width=26,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
-    core_temp.register(ps, "temp", core_temp.update)
+    core_temp.register(ps, "temp", function (t) core_temp.update(db.temp_convert(t)) end)
     burn_r.register(ps, "act_burn_rate", burn_r.update)
     heating_r.register(ps, "heating_rate", heating_r.update)
 
     local reactor_fills = Rectangle{parent=root,border=border(1, colors.gray, true),width=24,height=7,x=(x + 29),y=y}
 
-    TextBox{parent=reactor_fills,text="FUEL",x=2,y=1,height=1,fg_bg=text_fg_bg}
-    TextBox{parent=reactor_fills,text="COOL",x=2,y=2,height=1,fg_bg=text_fg_bg}
-    TextBox{parent=reactor_fills,text="HCOOL",x=2,y=4,height=1,fg_bg=text_fg_bg}
-    TextBox{parent=reactor_fills,text="WASTE",x=2,y=5,height=1,fg_bg=text_fg_bg}
+    TextBox{parent=reactor_fills,text="FUEL",x=2,y=1,height=1,fg_bg=text_fg}
+    TextBox{parent=reactor_fills,text="COOL",x=2,y=2,height=1,fg_bg=text_fg}
+    TextBox{parent=reactor_fills,text="HCOOL",x=2,y=4,height=1,fg_bg=text_fg}
+    TextBox{parent=reactor_fills,text="WASTE",x=2,y=5,height=1,fg_bg=text_fg}
 
-    local fuel  = HorizontalBar{parent=reactor_fills,x=8,y=1,show_percent=true,bar_fg_bg=cpair(colors.black,colors.gray),height=1,width=14}
+    local fuel  = HorizontalBar{parent=reactor_fills,x=8,y=1,show_percent=true,bar_fg_bg=cpair(style.theme.fuel_color,colors.gray),height=1,width=14}
     local ccool = HorizontalBar{parent=reactor_fills,x=8,y=2,show_percent=true,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=14}
     local hcool = HorizontalBar{parent=reactor_fills,x=8,y=4,show_percent=true,bar_fg_bg=cpair(colors.white,colors.gray),height=1,width=14}
     local waste = HorizontalBar{parent=reactor_fills,x=8,y=5,show_percent=true,bar_fg_bg=cpair(colors.brown,colors.gray),height=1,width=14}

coordinator/ui/components/turbine.lua

@@ -21,24 +21,24 @@ local border = core.border
 ---@param y integer top left y
 ---@param ps psil ps interface
 local function new_view(root, x, y, ps)
-    local turbine = Rectangle{parent=root,border=border(1, colors.gray, true),width=23,height=7,x=x,y=y}
+    local text_fg = style.theme.text_fg
+    local lu_col = style.lu_colors
 
-    local text_fg_bg = cpair(colors.black, colors.lightGray)
-    local lu_col = cpair(colors.gray, colors.gray)
+    local turbine = Rectangle{parent=root,border=border(1,colors.gray,true),width=23,height=7,x=x,y=y}
 
     local status    = StateIndicator{parent=turbine,x=7,y=1,states=style.turbine.states,value=1,min_width=12}
-    local prod_rate = PowerIndicator{parent=turbine,x=5,y=3,lu_colors=lu_col,label="",format="%10.2f",value=0,rate=true,width=16,fg_bg=text_fg_bg}
-    local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg_bg}
+    local prod_rate = PowerIndicator{parent=turbine,x=5,y=3,lu_colors=lu_col,label="",format="%10.2f",value=0,rate=true,width=16,fg_bg=text_fg}
+    local flow_rate = DataIndicator{parent=turbine,x=5,y=4,lu_colors=lu_col,label="",unit="mB/t",format="%10.0f",value=0,commas=true,width=16,fg_bg=text_fg}
 
     status.register(ps, "computed_status", status.update)
     prod_rate.register(ps, "prod_rate", function (val) prod_rate.update(util.joules_to_fe(val)) end)
-    flow_rate.register(ps, "flow_rate", flow_rate.update)
+    flow_rate.register(ps, "steam_input_rate", flow_rate.update)
 
     local steam  = VerticalBar{parent=turbine,x=2,y=1,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
     local energy = VerticalBar{parent=turbine,x=3,y=1,fg_bg=cpair(colors.green,colors.gray),height=4,width=1}
 
-    TextBox{parent=turbine,text="S",x=2,y=5,height=1,width=1,fg_bg=text_fg_bg}
-    TextBox{parent=turbine,text="E",x=3,y=5,height=1,width=1,fg_bg=text_fg_bg}
+    TextBox{parent=turbine,text="S",x=2,y=5,height=1,width=1,fg_bg=text_fg}
+    TextBox{parent=turbine,text="E",x=3,y=5,height=1,width=1,fg_bg=text_fg}
 
     steam.register(ps, "steam_fill", steam.update)
     energy.register(ps, "energy_fill", energy.update)

coordinator/ui/components/unit_detail.lua

@@ -2,6 +2,9 @@
 -- Reactor Unit SCADA Coordinator GUI
 --
 
+local types             = require("scada-common.types")
+local util              = require("scada-common.util")
+
 local iocontrol         = require("coordinator.iocontrol")
 
 local style             = require("coordinator.ui.style")
@@ -26,19 +29,39 @@ local PushButton        = require("graphics.elements.controls.push_button")
 local RadioButton       = require("graphics.elements.controls.radio_button")
 local SpinboxNumeric    = require("graphics.elements.controls.spinbox_numeric")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 local border = core.border
 
+local bw_fg_bg = style.bw_fg_bg
+local gry_wht = style.gray_white
+
 local period = core.flasher.PERIOD
 
 -- create a unit view
 ---@param parent graphics_element parent
 ---@param id integer
 local function init(parent, id)
-    local unit = iocontrol.get_db().units[id]   ---@type ioctl_unit
-    local f_ps = iocontrol.get_db().facility.ps
+    local s_hi_box = style.theme.highlight_box
+    local s_hi_bright = style.theme.highlight_box_bright
+    local s_field = style.theme.field_box
+
+    local hc_text = style.hc_text
+    local lu_cpair = style.lu_colors
+    local hzd_fg_bg = style.hzd_fg_bg
+    local dis_colors = style.dis_colors
+    local arrow_fg_bg = cpair(style.theme.label, s_hi_box.bkg)
+
+    local ind_bkg = style.ind_bkg
+    local ind_grn = style.ind_grn
+    local ind_yel = style.ind_yel
+    local ind_red = style.ind_red
+    local ind_wht = style.ind_wht
+
+    local db = iocontrol.get_db()
+    local unit = db.units[id]   ---@type ioctl_unit
+    local f_ps = db.facility.ps
 
     local main = Div{parent=parent,x=1,y=1}
 
@@ -48,11 +71,7 @@ local function init(parent, id)
     local b_ps = unit.boiler_ps_tbl
     local t_ps = unit.turbine_ps_tbl
 
-    TextBox{parent=main,text="Reactor Unit #" .. id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
-
-    local bw_fg_bg  = cpair(colors.black, colors.white)
-    local hzd_fg_bg = cpair(colors.white, colors.gray)
-    local lu_cpair  = cpair(colors.gray, colors.gray)
+    TextBox{parent=main,text="Reactor Unit #" .. id,alignment=ALIGN.CENTER,height=1,fg_bg=style.theme.header}
 
     -----------------------------
     -- main stats and core map --
@@ -63,11 +82,11 @@ local function init(parent, id)
     core_map.register(u_ps, "size", function (s) core_map.resize(s[1], s[2]) end)
 
     TextBox{parent=main,x=12,y=22,text="Heating Rate",height=1,width=12,fg_bg=style.label}
-    local heating_r = DataIndicator{parent=main,x=12,label="",format="%14.0f",value=0,unit="mB/t",commas=true,lu_colors=lu_cpair,width=19,fg_bg=bw_fg_bg}
+    local heating_r = DataIndicator{parent=main,x=12,label="",format="%14.0f",value=0,unit="mB/t",commas=true,lu_colors=lu_cpair,width=19,fg_bg=s_field}
     heating_r.register(u_ps, "heating_rate", heating_r.update)
 
     TextBox{parent=main,x=12,y=25,text="Commanded Burn Rate",height=1,width=19,fg_bg=style.label}
-    local burn_r = DataIndicator{parent=main,x=12,label="",format="%14.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=19,fg_bg=bw_fg_bg}
+    local burn_r = DataIndicator{parent=main,x=12,label="",format="%14.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=19,fg_bg=s_field}
     burn_r.register(u_ps, "burn_rate", burn_r.update)
 
     TextBox{parent=main,text="F",x=2,y=22,width=1,height=1,fg_bg=style.label}
@@ -77,7 +96,7 @@ local function init(parent, id)
     TextBox{parent=main,text="H",x=8,y=22,width=1,height=1,fg_bg=style.label}
     TextBox{parent=main,text="W",x=10,y=22,width=1,height=1,fg_bg=style.label}
 
-    local fuel  = VerticalBar{parent=main,x=2,y=23,fg_bg=cpair(colors.black,colors.gray),height=4,width=1}
+    local fuel  = VerticalBar{parent=main,x=2,y=23,fg_bg=cpair(style.theme.fuel_color,colors.gray),height=4,width=1}
     local ccool = VerticalBar{parent=main,x=4,y=23,fg_bg=cpair(colors.blue,colors.gray),height=4,width=1}
     local hcool = VerticalBar{parent=main,x=8,y=23,fg_bg=cpair(colors.white,colors.gray),height=4,width=1}
     local waste = VerticalBar{parent=main,x=10,y=23,fg_bg=cpair(colors.brown,colors.gray),height=4,width=1}
@@ -88,7 +107,7 @@ local function init(parent, id)
     waste.register(u_ps, "waste_fill", waste.update)
 
     ccool.register(u_ps, "ccool_type", function (type)
-        if type == "mekanism:sodium" then
+        if type == types.FLUID.SODIUM then
             ccool.recolor(cpair(colors.lightBlue, colors.gray))
         else
             ccool.recolor(cpair(colors.blue, colors.gray))
@@ -96,7 +115,7 @@ local function init(parent, id)
     end)
 
     hcool.register(u_ps, "hcool_type", function (type)
-        if type == "mekanism:superheated_sodium" then
+        if type == types.FLUID.SUPERHEATED_SODIUM then
             hcool.recolor(cpair(colors.orange, colors.gray))
         else
             hcool.recolor(cpair(colors.white, colors.gray))
@@ -104,19 +123,20 @@ local function init(parent, id)
     end)
 
     TextBox{parent=main,x=32,y=22,text="Core Temp",height=1,width=9,fg_bg=style.label}
-    local core_temp = DataIndicator{parent=main,x=32,label="",format="%11.2f",value=0,unit="K",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
-    core_temp.register(u_ps, "temp", core_temp.update)
+    local fmt = util.trinary(string.len(db.temp_label) == 2, "%10.2f", "%11.2f")
+    local core_temp = DataIndicator{parent=main,x=32,label="",format=fmt,value=0,commas=true,unit=db.temp_label,lu_colors=lu_cpair,width=13,fg_bg=s_field}
+    core_temp.register(u_ps, "temp", function (t) core_temp.update(db.temp_convert(t)) end)
 
     TextBox{parent=main,x=32,y=25,text="Burn Rate",height=1,width=9,fg_bg=style.label}
-    local act_burn_r = DataIndicator{parent=main,x=32,label="",format="%8.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local act_burn_r = DataIndicator{parent=main,x=32,label="",format="%8.2f",value=0,unit="mB/t",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     act_burn_r.register(u_ps, "act_burn_rate", act_burn_r.update)
 
     TextBox{parent=main,x=32,y=28,text="Damage",height=1,width=6,fg_bg=style.label}
-    local damage_p = DataIndicator{parent=main,x=32,label="",format="%11.0f",value=0,unit="%",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local damage_p = DataIndicator{parent=main,x=32,label="",format="%11.0f",value=0,unit="%",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     damage_p.register(u_ps, "damage", damage_p.update)
 
     TextBox{parent=main,x=32,y=31,text="Radiation",height=1,width=21,fg_bg=style.label}
-    local radiation = RadIndicator{parent=main,x=32,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=bw_fg_bg}
+    local radiation = RadIndicator{parent=main,x=32,label="",format="%9.3f",lu_colors=lu_cpair,width=13,fg_bg=s_field}
     radiation.register(u_ps, "radiation", radiation.update)
 
     -------------------
@@ -124,8 +144,8 @@ local function init(parent, id)
     -------------------
 
     local u_stat = Rectangle{parent=main,border=border(1,colors.gray,true),thin=true,width=33,height=4,x=46,y=3,fg_bg=bw_fg_bg}
-    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=33,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=bw_fg_bg}
-    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=33,height=1,alignment=TEXT_ALIGN.CENTER,fg_bg=cpair(colors.gray, colors.white)}
+    local stat_line_1 = TextBox{parent=u_stat,x=1,y=1,text="UNKNOWN",width=33,height=1,alignment=ALIGN.CENTER,fg_bg=bw_fg_bg}
+    local stat_line_2 = TextBox{parent=u_stat,x=1,y=2,text="awaiting data...",width=33,height=1,alignment=ALIGN.CENTER,fg_bg=gry_wht}
 
     stat_line_1.register(u_ps, "U_StatusLine1", stat_line_1.set_value)
     stat_line_2.register(u_ps, "U_StatusLine2", stat_line_2.set_value)
@@ -139,9 +159,9 @@ local function init(parent, id)
     local annunciator = Div{parent=main,width=23,height=18,x=22,y=3}
 
     -- connectivity
-    local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(colors.green,colors.red)}
-    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=cpair(colors.white,colors.gray)}
-    local rad_mon    = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=colors.gray,c2=colors.yellow,c3=colors.green}
+    local plc_online = IndicatorLight{parent=annunciator,label="PLC Online",colors=cpair(ind_grn.fgd,ind_red.fgd)}
+    local plc_hbeat  = IndicatorLight{parent=annunciator,label="PLC Heartbeat",colors=ind_wht}
+    local rad_mon    = TriIndicatorLight{parent=annunciator,label="Radiation Monitor",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd}
 
     plc_online.register(u_ps, "PLCOnline", plc_online.update)
     plc_hbeat.register(u_ps, "PLCHeartbeat", plc_hbeat.update)
@@ -150,25 +170,25 @@ local function init(parent, id)
     annunciator.line_break()
 
     -- operating state
-    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=cpair(colors.green,colors.gray)}
-    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=cpair(colors.white,colors.gray)}
+    local r_active = IndicatorLight{parent=annunciator,label="Active",colors=ind_grn}
+    local r_auto   = IndicatorLight{parent=annunciator,label="Automatic Control",colors=ind_wht}
 
     r_active.register(u_ps, "status", r_active.update)
     r_auto.register(u_ps, "AutoControl", r_auto.update)
 
     -- main unit transient/warning annunciator panel
-    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=cpair(colors.red,colors.gray)}
-    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=cpair(colors.yellow,colors.gray)}
-    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=cpair(colors.red,colors.gray)}
-    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant  Level Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=cpair(colors.red,colors.gray)}
-    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=cpair(colors.yellow,colors.gray)}
-    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=cpair(colors.yellow,colors.gray)}
-    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=cpair(colors.yellow,colors.gray)}
-    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=cpair(colors.yellow,colors.gray)}
+    local r_scram = IndicatorLight{parent=annunciator,label="Reactor SCRAM",colors=ind_red}
+    local r_mscrm = IndicatorLight{parent=annunciator,label="Manual Reactor SCRAM",colors=ind_red}
+    local r_ascrm = IndicatorLight{parent=annunciator,label="Auto Reactor SCRAM",colors=ind_red}
+    local rad_wrn = IndicatorLight{parent=annunciator,label="Radiation Warning",colors=ind_yel}
+    local r_rtrip = IndicatorLight{parent=annunciator,label="RCP Trip",colors=ind_red}
+    local r_cflow = IndicatorLight{parent=annunciator,label="RCS Flow Low",colors=ind_yel}
+    local r_clow  = IndicatorLight{parent=annunciator,label="Coolant Level Low",colors=ind_yel}
+    local r_temp  = IndicatorLight{parent=annunciator,label="Reactor Temp. High",colors=ind_red}
+    local r_rhdt  = IndicatorLight{parent=annunciator,label="Reactor High Delta T",colors=ind_yel}
+    local r_firl  = IndicatorLight{parent=annunciator,label="Fuel Input Rate Low",colors=ind_yel}
+    local r_wloc  = IndicatorLight{parent=annunciator,label="Waste Line Occlusion",colors=ind_yel}
+    local r_hsrt  = IndicatorLight{parent=annunciator,label="Startup Rate High",colors=ind_yel}
 
     r_scram.register(u_ps, "ReactorSCRAM", r_scram.update)
     r_mscrm.register(u_ps, "ManualReactorSCRAM", r_mscrm.update)
@@ -185,20 +205,20 @@ local function init(parent, id)
 
     -- RPS annunciator panel
 
-    TextBox{parent=main,text="REACTOR PROTECTION SYSTEM",fg_bg=cpair(colors.black,colors.cyan),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=8}
+    TextBox{parent=main,text="REACTOR PROTECTION SYSTEM",fg_bg=cpair(colors.black,colors.cyan),alignment=ALIGN.CENTER,width=33,height=1,x=46,y=8}
     local rps = Rectangle{parent=main,border=border(1,colors.cyan,true),thin=true,width=33,height=12,x=46,y=9}
     local rps_annunc = Div{parent=rps,width=31,height=10,x=2,y=1}
 
-    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=cpair(colors.yellow,colors.gray)}
-    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=cpair(colors.yellow,colors.gray)}
-    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
-    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=cpair(colors.yellow,colors.gray)}
-    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=cpair(colors.yellow,colors.gray)}
-    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_500_MS}
-    local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=cpair(colors.orange,colors.gray),flash=true,period=period.BLINK_500_MS}
+    local rps_trp = IndicatorLight{parent=rps_annunc,label="RPS Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_dmg = IndicatorLight{parent=rps_annunc,label="Damage Level High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_exh = IndicatorLight{parent=rps_annunc,label="Excess Heated Coolant",colors=ind_yel}
+    local rps_exw = IndicatorLight{parent=rps_annunc,label="Excess Waste",colors=ind_yel}
+    local rps_tmp = IndicatorLight{parent=rps_annunc,label="Core Temperature High",colors=ind_red,flash=true,period=period.BLINK_250_MS}
+    local rps_nof = IndicatorLight{parent=rps_annunc,label="No Fuel",colors=ind_yel}
+    local rps_loc = IndicatorLight{parent=rps_annunc,label="Coolant Level Low Low",colors=ind_yel}
+    local rps_flt = IndicatorLight{parent=rps_annunc,label="PPM Fault",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local rps_tmo = IndicatorLight{parent=rps_annunc,label="Connection Timeout",colors=ind_yel,flash=true,period=period.BLINK_500_MS}
+    local rps_sfl = IndicatorLight{parent=rps_annunc,label="System Failure",colors=ind_red,flash=true,period=period.BLINK_500_MS}
 
     rps_trp.register(u_ps, "rps_tripped", rps_trp.update)
     rps_dmg.register(u_ps, "high_dmg", rps_dmg.update)
@@ -213,17 +233,17 @@ local function init(parent, id)
 
     -- cooling annunciator panel
 
-    TextBox{parent=main,text="REACTOR COOLANT SYSTEM",fg_bg=cpair(colors.black,colors.blue),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=22}
+    TextBox{parent=main,text="REACTOR COOLANT SYSTEM",fg_bg=cpair(colors.black,colors.blue),alignment=ALIGN.CENTER,width=33,height=1,x=46,y=22}
     local rcs = Rectangle{parent=main,border=border(1,colors.blue,true),thin=true,width=33,height=24,x=46,y=23}
     local rcs_annunc = Div{parent=rcs,width=27,height=22,x=3,y=1}
     local rcs_tags = Div{parent=rcs,width=2,height=16,x=1,y=7}
 
-    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=cpair(colors.yellow,colors.gray)}
-    local c_emg  = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=colors.gray,c2=colors.white,c3=colors.green}
-    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=cpair(colors.yellow,colors.gray)}
-    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=cpair(colors.yellow,colors.gray)}
+    local c_flt  = IndicatorLight{parent=rcs_annunc,label="RCS Hardware Fault",colors=ind_yel}
+    local c_emg  = TriIndicatorLight{parent=rcs_annunc,label="Emergency Coolant",c1=ind_bkg,c2=ind_wht.fgd,c3=ind_grn.fgd}
+    local c_cfm  = IndicatorLight{parent=rcs_annunc,label="Coolant Feed Mismatch",colors=ind_yel}
+    local c_brm  = IndicatorLight{parent=rcs_annunc,label="Boil Rate Mismatch",colors=ind_yel}
+    local c_sfm  = IndicatorLight{parent=rcs_annunc,label="Steam Feed Mismatch",colors=ind_yel}
+    local c_mwrf = IndicatorLight{parent=rcs_annunc,label="Max Water Return Feed",colors=ind_yel}
 
     c_flt.register(u_ps, "RCSFault", c_flt.update)
     c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
@@ -242,15 +262,15 @@ local function init(parent, id)
 
     -- boiler annunciator panel(s)
 
-    if available_space > 0 then _add_space() end
-
     if unit.num_boilers > 0 then
-        TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
-        b1_wll.register(b_ps[1], "WasterLevelLow", b1_wll.update)
+        if available_space > 0 then _add_space() end
 
-        TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=bw_fg_bg}
-        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        TextBox{parent=rcs_tags,x=1,text="B1",width=2,height=1,fg_bg=hc_text}
+        local b1_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
+        b1_wll.register(b_ps[1], "WaterLevelLow", b1_wll.update)
+
+        TextBox{parent=rcs_tags,text="B1",width=2,height=1,fg_bg=hc_text}
+        local b1_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b1_hr.register(b_ps[1], "HeatingRateLow", b1_hr.update)
     end
     if unit.num_boilers > 1 then
@@ -261,12 +281,12 @@ local function init(parent, id)
             _add_space()
         end
 
-        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=cpair(colors.red,colors.gray)}
-        b2_wll.register(b_ps[2], "WasterLevelLow", b2_wll.update)
+        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=hc_text}
+        local b2_wll = IndicatorLight{parent=rcs_annunc,label="Water Level Low",colors=ind_red}
+        b2_wll.register(b_ps[2], "WaterLevelLow", b2_wll.update)
 
-        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=bw_fg_bg}
-        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=cpair(colors.yellow,colors.gray)}
+        TextBox{parent=rcs_tags,text="B2",width=2,height=1,fg_bg=hc_text}
+        local b2_hr = IndicatorLight{parent=rcs_annunc,label="Heating Rate Low",colors=ind_yel}
         b2_hr.register(b_ps[2], "HeatingRateLow", b2_hr.update)
     end
 
@@ -274,20 +294,20 @@ local function init(parent, id)
 
     if available_space > 1 then _add_space() end
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
     t1_sdo.register(t_ps[1], "SteamDumpOpen", t1_sdo.update)
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
     t1_tos.register(t_ps[1], "TurbineOverSpeed", t1_tos.update)
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
     t1_gtrp.register(t_ps[1], "GeneratorTrip", t1_gtrp.update)
 
-    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=bw_fg_bg}
-    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+    TextBox{parent=rcs_tags,text="T1",width=2,height=1,fg_bg=hc_text}
+    local t1_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
     t1_trp.register(t_ps[1], "TurbineTrip", t1_trp.update)
 
     if unit.num_turbines > 1 then
@@ -295,55 +315,55 @@ local function init(parent, id)
             _add_space()
         end
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
         t2_sdo.register(t_ps[2], "SteamDumpOpen", t2_sdo.update)
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t2_tos.register(t_ps[2], "TurbineOverSpeed", t2_tos.update)
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t2_gtrp.register(t_ps[2], "GeneratorTrip", t2_gtrp.update)
 
-        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=bw_fg_bg}
-        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T2",width=2,height=1,fg_bg=hc_text}
+        local t2_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t2_trp.register(t_ps[2], "TurbineTrip", t2_trp.update)
     end
 
     if unit.num_turbines > 2 then
         if available_space > 3 then _add_space() end
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=colors.gray,c2=colors.yellow,c3=colors.red}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_sdo = TriIndicatorLight{parent=rcs_annunc,label="Steam Relief Valve Open",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_red.fgd}
         t3_sdo.register(t_ps[3], "SteamDumpOpen", t3_sdo.update)
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=cpair(colors.red,colors.gray)}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_tos = IndicatorLight{parent=rcs_annunc,label="Turbine Over Speed",colors=ind_red}
         t3_tos.register(t_ps[3], "TurbineOverSpeed", t3_tos.update)
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=cpair(colors.yellow,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_gtrp = IndicatorLight{parent=rcs_annunc,label="Generator Trip",colors=ind_yel,flash=true,period=period.BLINK_250_MS}
         t3_gtrp.register(t_ps[3], "GeneratorTrip", t3_gtrp.update)
 
-        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=bw_fg_bg}
-        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=cpair(colors.red,colors.gray),flash=true,period=period.BLINK_250_MS}
+        TextBox{parent=rcs_tags,text="T3",width=2,height=1,fg_bg=hc_text}
+        local t3_trp = IndicatorLight{parent=rcs_annunc,label="Turbine Trip",colors=ind_red,flash=true,period=period.BLINK_250_MS}
         t3_trp.register(t_ps[3], "TurbineTrip", t3_trp.update)
     end
 
+    util.nop()
+
     ----------------------
     -- reactor controls --
     ----------------------
 
-    local dis_colors = cpair(colors.white, colors.lightGray)
-
-    local burn_control = Div{parent=main,x=12,y=28,width=19,height=3,fg_bg=cpair(colors.gray,colors.white)}
-    local burn_rate = SpinboxNumeric{parent=burn_control,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=cpair(colors.gray,colors.white),fg_bg=bw_fg_bg}
-    TextBox{parent=burn_control,x=9,y=2,text="mB/t"}
+    local burn_control = Div{parent=main,x=12,y=28,width=19,height=3,fg_bg=s_hi_box}
+    local burn_rate = SpinboxNumeric{parent=burn_control,x=2,y=1,whole_num_precision=4,fractional_precision=1,min=0.1,arrow_fg_bg=arrow_fg_bg,arrow_disable=style.theme.disabled}
+    TextBox{parent=burn_control,x=9,y=2,text="mB/t",fg_bg=style.theme.label_fg}
 
     local set_burn = function () unit.set_burn(burn_rate.get_value()) end
-    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=dis_colors,callback=set_burn}
+    local set_burn_btn = PushButton{parent=burn_control,x=14,y=2,text="SET",min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=dis_colors,callback=set_burn}
 
     burn_rate.register(u_ps, "burn_rate", burn_rate.set_value)
     burn_rate.register(u_ps, "max_burn", burn_rate.set_max)
@@ -374,7 +394,7 @@ local function init(parent, id)
 
     reset.register(u_ps, "rps_tripped", function (active) if active then reset.enable() else reset.disable() end end)
 
-    TextBox{parent=main,text="WASTE PROCESSING",fg_bg=cpair(colors.black,colors.brown),alignment=TEXT_ALIGN.CENTER,width=33,height=1,x=46,y=48}
+    TextBox{parent=main,text="WASTE PROCESSING",fg_bg=cpair(colors.black,colors.brown),alignment=ALIGN.CENTER,width=33,height=1,x=46,y=48}
     local waste_proc = Rectangle{parent=main,border=border(1,colors.brown,true),thin=true,width=33,height=3,x=46,y=49}
     local waste_div = Div{parent=waste_proc,x=2,y=1,width=31,height=1}
 
@@ -386,22 +406,22 @@ local function init(parent, id)
     -- alarm management --
     ----------------------
 
-    local alarm_panel = Div{parent=main,x=2,y=36,width=29,height=16,fg_bg=bw_fg_bg}
+    local alarm_panel = Div{parent=main,x=2,y=36,width=29,height=16,fg_bg=s_hi_bright}
 
-    local a_brc = AlarmLight{parent=alarm_panel,x=6,y=2,label="Containment Breach",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rad = AlarmLight{parent=alarm_panel,x=6,label="Containment Radiation",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_dmg = AlarmLight{parent=alarm_panel,x=6,label="Critical Damage",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
+    local a_brc = AlarmLight{parent=alarm_panel,x=6,y=2,label="Containment Breach",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rad = AlarmLight{parent=alarm_panel,x=6,label="Containment Radiation",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_dmg = AlarmLight{parent=alarm_panel,x=6,label="Critical Damage",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
     alarm_panel.line_break()
-    local a_rcl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Lost",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rcd = AlarmLight{parent=alarm_panel,x=6,label="Reactor Damage",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rot = AlarmLight{parent=alarm_panel,x=6,label="Reactor Over Temp",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rht = AlarmLight{parent=alarm_panel,x=6,label="Reactor High Temp",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
-    local a_rwl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste Leak",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
-    local a_rwh = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste High",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
+    local a_rcl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Lost",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rcd = AlarmLight{parent=alarm_panel,x=6,label="Reactor Damage",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rot = AlarmLight{parent=alarm_panel,x=6,label="Reactor Over Temp",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rht = AlarmLight{parent=alarm_panel,x=6,label="Reactor High Temp",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
+    local a_rwl = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste Leak",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
+    local a_rwh = AlarmLight{parent=alarm_panel,x=6,label="Reactor Waste High",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
     alarm_panel.line_break()
-    local a_rps = AlarmLight{parent=alarm_panel,x=6,label="RPS Transient",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
-    local a_clt = AlarmLight{parent=alarm_panel,x=6,label="RCS Transient",c1=colors.gray,c2=colors.yellow,c3=colors.green,flash=true,period=period.BLINK_500_MS}
-    local a_tbt = AlarmLight{parent=alarm_panel,x=6,label="Turbine Trip",c1=colors.gray,c2=colors.red,c3=colors.green,flash=true,period=period.BLINK_250_MS}
+    local a_rps = AlarmLight{parent=alarm_panel,x=6,label="RPS Transient",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
+    local a_clt = AlarmLight{parent=alarm_panel,x=6,label="RCS Transient",c1=ind_bkg,c2=ind_yel.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_500_MS}
+    local a_tbt = AlarmLight{parent=alarm_panel,x=6,label="Turbine Trip",c1=ind_bkg,c2=ind_red.fgd,c3=ind_grn.fgd,flash=true,period=period.BLINK_250_MS}
 
     a_brc.register(u_ps, "Alarm_1", a_brc.update)
     a_rad.register(u_ps, "Alarm_2", a_rad.update)
@@ -454,40 +474,40 @@ local function init(parent, id)
 
     -- color tags
 
-    TextBox{parent=alarm_panel,x=5,y=13,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.cyan)}
-    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.blue)}
-    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(colors.white,colors.blue)}
+    TextBox{parent=alarm_panel,x=5,y=13,text="\x95",width=1,height=1,fg_bg=cpair(s_hi_bright.bkg,colors.cyan)}
+    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(s_hi_bright.bkg,colors.blue)}
+    TextBox{parent=alarm_panel,x=5,text="\x95",width=1,height=1,fg_bg=cpair(s_hi_bright.bkg,colors.blue)}
 
     --------------------------------
     -- automatic control settings --
     --------------------------------
 
-    TextBox{parent=main,text="AUTO CTRL",fg_bg=cpair(colors.black,colors.purple),alignment=TEXT_ALIGN.CENTER,width=13,height=1,x=32,y=36}
+    TextBox{parent=main,text="AUTO CTRL",fg_bg=cpair(colors.black,colors.purple),alignment=ALIGN.CENTER,width=13,height=1,x=32,y=36}
     local auto_ctl = Rectangle{parent=main,border=border(1,colors.purple,true),thin=true,width=13,height=15,x=32,y=37}
     local auto_div = Div{parent=auto_ctl,width=13,height=15,x=1,y=1}
 
     local ctl_opts = { "Manual", "Primary", "Secondary", "Tertiary", "Backup" }
 
-    local group = RadioButton{parent=auto_div,options=ctl_opts,callback=function()end,radio_colors=cpair(colors.blue,colors.white),radio_bg=colors.gray}
+    local group = RadioButton{parent=auto_div,options=ctl_opts,callback=function()end,radio_colors=cpair(style.theme.accent_dark,style.theme.accent_light),select_color=colors.purple}
 
     group.register(u_ps, "auto_group_id", function (gid) group.set_value(gid + 1) end)
 
     auto_div.line_break()
 
     local function set_group() unit.set_group(group.get_value() - 1) end
-    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=cpair(colors.white,colors.gray),dis_fg_bg=cpair(colors.gray,colors.white),callback=set_group}
+    local set_grp_btn = PushButton{parent=auto_div,text="SET",x=4,min_width=5,fg_bg=cpair(colors.black,colors.yellow),active_fg_bg=style.wh_gray,dis_fg_bg=gry_wht,callback=set_group}
 
     auto_div.line_break()
 
     TextBox{parent=auto_div,text="Prio. Group",height=1,width=11,fg_bg=style.label}
-    local auto_grp = TextBox{parent=auto_div,text="Manual",height=1,width=11,fg_bg=bw_fg_bg}
+    local auto_grp = TextBox{parent=auto_div,text="Manual",height=1,width=11,fg_bg=s_field}
 
     auto_grp.register(u_ps, "auto_group", auto_grp.set_value)
 
     auto_div.line_break()
 
-    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=cpair(colors.green,colors.gray)}
-    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=cpair(colors.white,colors.gray),flash=true,period=period.BLINK_1000_MS}
+    local a_rdy = IndicatorLight{parent=auto_div,label="Ready",x=2,colors=ind_grn}
+    local a_stb = IndicatorLight{parent=auto_div,label="Standby",x=2,colors=ind_wht,flash=true,period=period.BLINK_1000_MS}
 
     a_rdy.register(u_ps, "U_AutoReady", a_rdy.update)
 

coordinator/ui/components/unit_flow.lua

@@ -0,0 +1,229 @@
+--
+-- Basic Unit Flow Overview
+--
+
+local util              = require("scada-common.util")
+
+local style             = require("coordinator.ui.style")
+
+local core              = require("graphics.core")
+
+local Div               = require("graphics.elements.div")
+local PipeNetwork       = require("graphics.elements.pipenet")
+local TextBox           = require("graphics.elements.textbox")
+
+local Rectangle         = require("graphics.elements.rectangle")
+
+local DataIndicator     = require("graphics.elements.indicators.data")
+
+local IndicatorLight    = require("graphics.elements.indicators.light")
+local TriIndicatorLight = require("graphics.elements.indicators.trilight")
+
+local ALIGN = core.ALIGN
+
+local sprintf = util.sprintf
+
+local border = core.border
+local cpair = core.cpair
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+local lg_gray = style.lg_gray
+
+-- make a new unit flow window
+---@param parent graphics_element parent
+---@param x integer top left x
+---@param y integer top left y
+---@param wide boolean whether to render wide version
+---@param unit ioctl_unit unit database entry
+local function make(parent, x, y, wide, unit)
+    local s_field = style.theme.field_box
+
+    local text_c = style.text_colors
+    local lu_c = style.lu_colors
+    local lu_c_d = style.lu_colors_dark
+
+    local ind_grn = style.ind_grn
+    local ind_wht = style.ind_wht
+
+    local height = 16
+
+    local v_start = 1 + ((unit.unit_id - 1) * 5)
+    local prv_start = 1 + ((unit.unit_id - 1) * 3)
+    local v_fields = { "pu", "po", "pl", "am" }
+    local v_names = {
+        sprintf("PV%02d-PU", v_start),
+        sprintf("PV%02d-PO", v_start + 1),
+        sprintf("PV%02d-PL", v_start + 2),
+        sprintf("PV%02d-AM", v_start + 3),
+        sprintf("PRV%02d", prv_start),
+        sprintf("PRV%02d", prv_start + 1),
+        sprintf("PRV%02d", prv_start + 2)
+    }
+
+    assert(parent.get_height() >= (y + height), "flow display not of sufficient vertical resolution (add an additional row of monitors) " .. y .. "," .. parent.get_height())
+
+    local function _wide(a, b) return util.trinary(wide, a, b) end
+
+    -- bounding box div
+    local root = Div{parent=parent,x=x,y=y,width=_wide(136, 114),height=height}
+
+    ------------------
+    -- COOLING LOOP --
+    ------------------
+
+    local reactor = Rectangle{parent=root,x=1,y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=reactor,y=1,text="FISSION REACTOR",alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=reactor,y=3,text="UNIT #"..unit.unit_id,alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=19,y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+    TextBox{parent=root,x=3,y=5,text="\x19",width=1,height=1,fg_bg=lg_gray}
+
+    local rc_pipes = {}
+
+    local emc_x = 42    -- emergency coolant connection x point
+
+    if unit.num_boilers > 0 then
+        table.insert(rc_pipes, pipe(0, 1, _wide(28, 19), 1, colors.lightBlue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(28, 19), 3, colors.orange, true))
+        table.insert(rc_pipes, pipe(_wide(46 ,39), 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(_wide(46,39), 3, _wide(72,58), 3, colors.white, true))
+    else
+        emc_x = 3
+        table.insert(rc_pipes, pipe(0, 1, _wide(72,58), 1, colors.blue, true))
+        table.insert(rc_pipes, pipe(0, 3, _wide(72,58), 3, colors.white, true))
+    end
+
+    if unit.has_tank then
+        table.insert(rc_pipes, pipe(emc_x, 1, emc_x, 0, colors.blue, true, true))
+    end
+
+    local prv_yo = math.max(3 - unit.num_turbines, 0)
+    for i = 1, unit.num_turbines do
+        local py = 2 * (i - 1) + prv_yo
+        table.insert(rc_pipes, pipe(_wide(92, 78), py, _wide(104, 83), py, colors.white, true))
+    end
+
+    PipeNetwork{parent=root,x=20,y=1,pipes=rc_pipes,bg=style.theme.bg}
+
+    if unit.num_boilers > 0 then
+        local cc_rate = DataIndicator{parent=root,x=_wide(25,22),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+        local hc_rate = DataIndicator{parent=root,x=_wide(25,22),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+
+        cc_rate.register(unit.unit_ps, "boiler_boil_sum", function (sum) cc_rate.update(sum * 10) end)
+        hc_rate.register(unit.unit_ps, "heating_rate", hc_rate.update)
+
+        local boiler = Rectangle{parent=root,x=_wide(47,40),y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+        TextBox{parent=boiler,y=1,text="THERMO-ELECTRIC",alignment=ALIGN.CENTER,height=1}
+        TextBox{parent=boiler,y=3,text=util.trinary(unit.num_boilers>1,"BOILERS","BOILER"),alignment=ALIGN.CENTER,height=1}
+        TextBox{parent=root,x=_wide(47,40),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+        TextBox{parent=root,x=_wide(65,58),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+        local wt_rate = DataIndicator{parent=root,x=_wide(71,61),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+        local st_rate = DataIndicator{parent=root,x=_wide(71,61),y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "boiler_boil_sum", st_rate.update)
+    else
+        local wt_rate = DataIndicator{parent=root,x=28,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+        local st_rate = DataIndicator{parent=root,x=28,y=5,lu_colors=lu_c,label="",unit="mB/t",format="%11.0f",value=0,commas=true,width=16,fg_bg=s_field}
+
+        wt_rate.register(unit.unit_ps, "turbine_flow_sum", wt_rate.update)
+        st_rate.register(unit.unit_ps, "heating_rate", st_rate.update)
+    end
+
+    local turbine = Rectangle{parent=root,x=_wide(93,79),y=1,border=border(1,colors.gray,true),width=19,height=5,fg_bg=wh_gray}
+    TextBox{parent=turbine,y=1,text="STEAM TURBINE",alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=turbine,y=3,text=util.trinary(unit.num_turbines>1,"GENERATORS","GENERATOR"),alignment=ALIGN.CENTER,height=1}
+    TextBox{parent=root,x=_wide(93,79),y=2,text="\x1b \x80 \x1a",width=1,height=3,fg_bg=lg_gray}
+
+    for i = 1, unit.num_turbines do
+        local ry = 1 + (2 * (i - 1)) + prv_yo
+        TextBox{parent=root,x=_wide(125,103),y=ry,text="\x10\x11\x7f",fg_bg=text_c,width=3,height=1}
+        local state = TriIndicatorLight{parent=root,x=_wide(129,107),y=ry,label=v_names[i+4],c1=style.ind_bkg,c2=style.ind_yel.fgd,c3=style.ind_red.fgd}
+        state.register(unit.turbine_ps_tbl[i], "SteamDumpOpen", state.update)
+    end
+
+    ----------------------
+    -- WASTE PROCESSING --
+    ----------------------
+
+    local waste = Div{parent=root,x=3,y=6}
+
+    local waste_c = style.theme.fuel_color
+
+    local waste_pipes = {
+        pipe(0, 0, _wide(19, 16), 1, colors.brown, true),
+        pipe(_wide(14, 13), 1, _wide(19, 17), 5, colors.brown, true),
+        pipe(_wide(22, 19), 1, _wide(49, 45), 1, colors.brown, true),
+        pipe(_wide(22, 19), 5, _wide(28, 24), 5, colors.brown, true),
+
+        pipe(_wide(64, 53), 1, _wide(95, 81), 1, colors.green, true),
+
+        pipe(_wide(48, 43), 4, _wide(71, 61), 4, colors.cyan, true),
+        pipe(_wide(66, 57), 4, _wide(71, 61), 8, colors.cyan, true),
+        pipe(_wide(74, 63), 4, _wide(95, 81), 4, colors.cyan, true),
+        pipe(_wide(74, 63), 8, _wide(133, 111), 8, colors.cyan, true),
+
+        pipe(_wide(108, 94), 1, _wide(132, 110), 6, waste_c, true, true),
+        pipe(_wide(108, 94), 4, _wide(111, 95), 1, waste_c, true, true),
+        pipe(_wide(132, 110), 6, _wide(130, 108), 6, waste_c, true, true)
+    }
+
+    PipeNetwork{parent=waste,x=1,y=1,pipes=waste_pipes,bg=style.theme.bg}
+
+    local function _valve(vx, vy, n)
+        TextBox{parent=waste,x=vx,y=vy,text="\x10\x11",fg_bg=text_c,width=2,height=1}
+        local conn = IndicatorLight{parent=waste,x=vx-3,y=vy+1,label=v_names[n],colors=ind_grn}
+        local open = IndicatorLight{parent=waste,x=vx-3,y=vy+2,label="OPEN",colors=ind_wht}
+        conn.register(unit.unit_ps, util.c("V_", v_fields[n], "_conn"), conn.update)
+        open.register(unit.unit_ps, util.c("V_", v_fields[n], "_state"), open.update)
+    end
+
+    local function _machine(mx, my, name)
+        local l = string.len(name) + 2
+        TextBox{parent=waste,x=mx,y=my,text=string.rep("\x8f",l),alignment=ALIGN.CENTER,fg_bg=cpair(style.theme.bg,style.theme.header.bkg),width=l,height=1}
+        TextBox{parent=waste,x=mx,y=my+1,text=name,alignment=ALIGN.CENTER,fg_bg=style.theme.header,width=l,height=1}
+    end
+
+    local waste_rate = DataIndicator{parent=waste,x=1,y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local pu_rate = DataIndicator{parent=waste,x=_wide(82,70),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%7.3f",value=0,width=12,fg_bg=s_field}
+    local po_rate = DataIndicator{parent=waste,x=_wide(52,45),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local popl_rate = DataIndicator{parent=waste,x=_wide(82,70),y=6,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local poam_rate = DataIndicator{parent=waste,x=_wide(82,70),y=10,lu_colors=lu_c,label="",unit="mB/t",format="%7.2f",value=0,width=12,fg_bg=s_field}
+    local spent_rate = DataIndicator{parent=waste,x=_wide(117,98),y=3,lu_colors=lu_c,label="",unit="mB/t",format="%8.3f",value=0,width=13,fg_bg=s_field}
+
+    waste_rate.register(unit.unit_ps, "act_burn_rate", waste_rate.update)
+    pu_rate.register(unit.unit_ps, "pu_rate", pu_rate.update)
+    po_rate.register(unit.unit_ps, "po_rate", po_rate.update)
+    popl_rate.register(unit.unit_ps, "po_pl_rate", popl_rate.update)
+    poam_rate.register(unit.unit_ps, "po_am_rate", poam_rate.update)
+    spent_rate.register(unit.unit_ps, "ws_rate", spent_rate.update)
+
+    _valve(_wide(21, 18), 2, 1)
+    _valve(_wide(21, 18), 6, 2)
+    _valve(_wide(73, 62), 5, 3)
+    _valve(_wide(73, 62), 9, 4)
+
+    _machine(_wide(51, 45), 1, "CENTRIFUGE \x1a");
+    _machine(_wide(97, 83), 1, "PRC [Pu] \x1a");
+    _machine(_wide(97, 83), 4, "PRC [Po] \x1a");
+    _machine(_wide(116, 94), 6, "SPENT WASTE \x1b")
+
+    TextBox{parent=waste,x=_wide(30,25),y=3,text="SNAs [Po]",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sna_po  = Rectangle{parent=waste,x=_wide(30,25),y=4,border=border(1,colors.gray,true),width=19,height=7,thin=true,fg_bg=style.theme.highlight_box_bright}
+    local sna_act = IndicatorLight{parent=sna_po,label="ACTIVE",colors=ind_grn}
+    local sna_cnt = DataIndicator{parent=sna_po,x=12,y=1,lu_colors=lu_c_d,label="CNT",unit="",format="%2d",value=0,width=7}
+    local sna_pk = DataIndicator{parent=sna_po,y=3,lu_colors=lu_c_d,label="PEAK",unit="mB/t",format="%7.2f",value=0,width=17}
+    local sna_max = DataIndicator{parent=sna_po,lu_colors=lu_c_d,label="MAX",unit="mB/t",format="%8.2f",value=0,width=17}
+    local sna_in = DataIndicator{parent=sna_po,lu_colors=lu_c_d,label="IN",unit="mB/t",format="%9.2f",value=0,width=17}
+
+    sna_act.register(unit.unit_ps, "po_rate", function (r) sna_act.update(r > 0) end)
+    sna_cnt.register(unit.unit_ps, "sna_count", sna_cnt.update)
+    sna_pk.register(unit.unit_ps, "sna_peak_rate", sna_pk.update)
+    sna_max.register(unit.unit_ps, "sna_max_rate", sna_max.update)
+    sna_in.register(unit.unit_ps, "sna_in", sna_in.update)
+
+    return root
+end
+
+return make

coordinator/ui/components/unit_overview.lua

@@ -14,7 +14,7 @@ local Div          = require("graphics.elements.div")
 local PipeNetwork  = require("graphics.elements.pipenet")
 local TextBox      = require("graphics.elements.textbox")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local pipe = core.pipe
 
@@ -34,7 +34,7 @@ local function make(parent, x, y, unit)
 
     if num_boilers == 0 and num_turbines == 1 then
         height = 9
-    elseif num_boilers == 1 and num_turbines <= 2 then
+    elseif num_boilers <= 1 and num_turbines <= 2 then
         height = 17
     end
 
@@ -44,7 +44,7 @@ local function make(parent, x, y, unit)
     local root = Div{parent=parent,x=x,y=y,width=80,height=height}
 
     -- unit header message
-    TextBox{parent=root,text="Unit #"..unit.unit_id,alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
+    TextBox{parent=root,text="Unit #"..unit.unit_id,alignment=ALIGN.CENTER,height=1,fg_bg=style.theme.header}
 
     -------------
     -- REACTOR --
@@ -66,7 +66,7 @@ local function make(parent, x, y, unit)
             table.insert(coolant_pipes, pipe(2, 0, 11, 11, colors.orange))
         end
 
-        PipeNetwork{parent=root,x=4,y=10,pipes=coolant_pipes,bg=colors.lightGray}
+        PipeNetwork{parent=root,x=4,y=10,pipes=coolant_pipes,bg=style.theme.bg}
     end
 
     -------------
@@ -164,10 +164,10 @@ local function make(parent, x, y, unit)
             table.insert(steam_pipes_b, pipe(0, 18, 2, 18, colors.blue, false, true))       -- water boiler 2 to turbine 2 junction
         end
 
-        PipeNetwork{parent=root,x=47,y=11,pipes=steam_pipes_a,bg=colors.lightGray}
+        PipeNetwork{parent=root,x=47,y=11,pipes=steam_pipes_a,bg=style.theme.bg}
     end
 
-    PipeNetwork{parent=root,x=54,y=3,pipes=steam_pipes_b,bg=colors.lightGray}
+    PipeNetwork{parent=root,x=54,y=3,pipes=steam_pipes_b,bg=style.theme.bg}
 
     return root
 end

coordinator/ui/dialog.lua

@@ -1,52 +0,0 @@
-local completion = require("cc.completion")
-
-local util       = require("scada-common.util")
-
-local print = util.print
-
-local dialog = {}
-
--- ask the user yes or no
----@nodiscard
----@param question string
----@param default boolean
----@return boolean|nil
-function dialog.ask_y_n(question, default)
-    print(question)
-
-    if default == true then
-        print(" (Y/n)? ")
-    else
-        print(" (y/N)? ")
-    end
-
-    local response = read(nil, nil)
-
-    if response == "" then
-        return default
-    elseif response == "Y" or response == "y" then
-        return true
-    elseif response == "N" or response == "n" then
-        return false
-    else
-        return nil
-    end
-end
-
--- ask the user for an input within a set of options
----@nodiscard
----@param options table
----@param cancel string
----@return boolean|string|nil
-function dialog.ask_options(options, cancel)
-    print("> ")
-    local response = read(nil, nil, function(text) return completion.choice(text, options) end)
-
-    if response == cancel then return false end
-
-    if util.table_contains(options, response) then
-        return response
-    else return nil end
-end
-
-return dialog

coordinator/ui/layout/flow_view.lua

@@ -0,0 +1,393 @@
+--
+-- Flow Monitor GUI
+--
+
+local types          = require("scada-common.types")
+local util           = require("scada-common.util")
+
+local iocontrol      = require("coordinator.iocontrol")
+
+local style          = require("coordinator.ui.style")
+
+local unit_flow      = require("coordinator.ui.components.unit_flow")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local PipeNetwork    = require("graphics.elements.pipenet")
+local Rectangle      = require("graphics.elements.rectangle")
+local TextBox        = require("graphics.elements.textbox")
+
+local DataIndicator  = require("graphics.elements.indicators.data")
+local HorizontalBar  = require("graphics.elements.indicators.hbar")
+local IndicatorLight = require("graphics.elements.indicators.light")
+local StateIndicator = require("graphics.elements.indicators.state")
+
+local CONTAINER_MODE = types.CONTAINER_MODE
+
+local ALIGN = core.ALIGN
+
+local cpair = core.cpair
+local border = core.border
+local pipe = core.pipe
+
+local wh_gray = style.wh_gray
+
+-- create new flow view
+---@param main graphics_element main displaybox
+local function init(main)
+    local s_hi_bright = style.theme.highlight_box_bright
+    local s_field = style.theme.field_box
+    local text_col = style.text_colors
+    local lu_col = style.lu_colors
+    local lu_c_d = style.lu_colors_dark
+
+    local facility = iocontrol.get_db().facility
+    local units = iocontrol.get_db().units
+
+    local tank_defs = facility.tank_defs
+    local tank_list = facility.tank_list
+
+    -- window header message
+    local header = TextBox{parent=main,y=1,text="Facility Coolant and Waste Flow Monitor",alignment=ALIGN.CENTER,height=1,fg_bg=style.theme.header}
+    -- max length example: "01:23:45 AM - Wednesday, September 28 2022"
+    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=ALIGN.RIGHT,width=42,height=1,fg_bg=style.theme.header}
+
+    datetime.register(facility.ps, "date_time", datetime.set_value)
+
+    local po_pipes = {}
+    local water_pipes = {}
+
+    -- get the y offset for this unit index
+    ---@param idx integer unit index
+    local function y_ofs(idx) return ((idx - 1) * 20) end
+
+    -- determinte facility tank start/end from the definitions list
+    ---@param start_idx integer start index of table iteration
+    ---@param end_idx integer end index of table iteration
+    local function find_fdef(start_idx, end_idx)
+        local first, last = 4, 0
+        for i = start_idx, end_idx do
+            if tank_defs[i] == 2 then
+                last = i
+                if i < first then first = i end
+            end
+        end
+        return first, last
+    end
+
+    if facility.tank_mode == 0 or facility.tank_mode == 8 then
+        -- (0) tanks belong to reactor units OR (8) 4 total facility tanks (A B C D)
+        for i = 1, facility.num_units do
+            if units[i].has_tank then
+                local y = y_ofs(i)
+                table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+    else
+        -- setup connections for units with emergency coolant, always the same
+        for i = 1, #tank_defs do
+            if tank_defs[i] > 0 then
+                local y = y_ofs(i)
+
+                if tank_defs[i] == 2 then
+                    table.insert(water_pipes, pipe(1, y, 21, y, colors.blue, true))
+                else
+                    table.insert(water_pipes, pipe(2, y, 2, y + 3, colors.blue, true))
+                    table.insert(water_pipes, pipe(2, y, 21, y, colors.blue, true))
+                end
+
+                local u = units[i]  ---@type ioctl_unit
+                local x = util.trinary(u.num_boilers == 0, 45, 84)
+                table.insert(water_pipes, pipe(21, y, x, y + 2, colors.blue, true, true))
+            end
+        end
+
+        if facility.tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef, last_fdef = find_fdef(1, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef, last_fdef = find_fdef(1, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if tank_defs[a] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(a), 1, y_ofs(a) + 6, colors.blue, true))
+                    if tank_defs[b] == 2 then
+                        table.insert(water_pipes, pipe(0, y_ofs(b) - 13, 1, y_ofs(b), colors.blue, true))
+                    end
+                elseif tank_defs[b] == 2 then
+                    table.insert(water_pipes, pipe(0, y_ofs(b), 1, y_ofs(b) + 6, colors.blue, true))
+                end
+            end
+        elseif facility.tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef, last_fdef = find_fdef(2, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef, last_fdef = find_fdef(1, math.min(2, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 3 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef, last_fdef = find_fdef(2, math.min(3, #tank_defs))
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 4 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        elseif facility.tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef, last_fdef = find_fdef(3, #tank_defs)
+
+            for i = 1, #tank_defs do
+                local y = y_ofs(i)
+                if i == 1 or i == 2 then
+                    if tank_defs[i] == 2 then
+                        table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                    end
+                elseif i == first_fdef then
+                    table.insert(water_pipes, pipe(0, y, 1, y + 5, colors.blue, true))
+                elseif i > first_fdef then
+                    if i == last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y, colors.blue, true))
+                    elseif i < last_fdef then
+                        table.insert(water_pipes, pipe(0, y - 14, 0, y + 5, colors.blue, true))
+                    end
+                end
+            end
+        end
+    end
+
+    local flow_x = 3
+    if #water_pipes > 0 then
+        flow_x = 25
+        PipeNetwork{parent=main,x=2,y=3,pipes=water_pipes,bg=style.theme.bg}
+    end
+
+    for i = 1, facility.num_units do
+        local y_offset = y_ofs(i)
+        unit_flow(main, flow_x, 5 + y_offset, #water_pipes == 0, units[i])
+        table.insert(po_pipes, pipe(0, 3 + y_offset, 4, 0, colors.cyan, true, true))
+        util.nop()
+    end
+
+    PipeNetwork{parent=main,x=139,y=15,pipes=po_pipes,bg=style.theme.bg}
+
+    -----------------
+    -- tank valves --
+    -----------------
+
+    local next_f_id = 1
+
+    for i = 1, #tank_defs do
+        if tank_defs[i] > 0 then
+            local vy = 3 + y_ofs(i)
+
+            TextBox{parent=main,x=12,y=vy,text="\x10\x11",fg_bg=text_col,width=2,height=1}
+
+            local conn = IndicatorLight{parent=main,x=9,y=vy+1,label=util.sprintf("PV%02d-EMC", i * 5),colors=style.ind_grn}
+            local open = IndicatorLight{parent=main,x=9,y=vy+2,label="OPEN",colors=style.ind_wht}
+
+            conn.register(units[i].unit_ps, "V_emc_conn", conn.update)
+            open.register(units[i].unit_ps, "V_emc_state", open.update)
+        end
+    end
+
+    -------------------
+    -- dynamic tanks --
+    -------------------
+
+    for i = 1, #tank_list do
+        if tank_list[i] > 0 then
+            local id = "U-" .. i
+            local f_id = next_f_id
+            if tank_list[i] == 2 then
+                id = "F-" .. next_f_id
+                next_f_id = next_f_id + 1
+            end
+
+            local y_offset = y_ofs(i)
+
+            local tank = Div{parent=main,x=3,y=7+y_offset,width=20,height=14}
+
+            TextBox{parent=tank,text=" ",height=1,x=1,y=1,fg_bg=style.lg_gray}
+            TextBox{parent=tank,text="DYNAMIC TANK "..id,alignment=ALIGN.CENTER,height=1,fg_bg=style.wh_gray}
+
+            local tank_box = Rectangle{parent=tank,border=border(1,colors.gray,true),width=20,height=12}
+
+            local status = StateIndicator{parent=tank_box,x=3,y=1,states=style.dtank.states,value=1,min_width=14}
+
+            TextBox{parent=tank_box,x=2,y=3,text="Fill",height=1,width=10,fg_bg=style.label}
+            local tank_pcnt = DataIndicator{parent=tank_box,x=10,y=3,label="",format="%5.2f",value=100,unit="%",lu_colors=lu_col,width=8,fg_bg=text_col}
+            local tank_amnt = DataIndicator{parent=tank_box,x=2,label="",format="%13d",value=0,commas=true,unit="mB",lu_colors=lu_col,width=16,fg_bg=s_field}
+
+            TextBox{parent=tank_box,x=2,y=6,text="Water Level",height=1,width=11,fg_bg=style.label}
+            local level = HorizontalBar{parent=tank_box,x=2,y=7,bar_fg_bg=cpair(colors.blue,colors.gray),height=1,width=16}
+
+            TextBox{parent=tank_box,x=2,y=9,text="In/Out Mode",height=1,width=11,fg_bg=style.label}
+            local can_fill = IndicatorLight{parent=tank_box,x=2,y=10,label="FILL",colors=style.ind_wht}
+            local can_empty = IndicatorLight{parent=tank_box,x=10,y=10,label="EMPTY",colors=style.ind_wht}
+
+            local function _can_fill(mode)
+                can_fill.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.FILL))
+            end
+
+            local function _can_empty(mode)
+                can_empty.update((mode == CONTAINER_MODE.BOTH) or (mode == CONTAINER_MODE.EMPTY))
+            end
+
+            if tank_list[i] == 1 then
+                status.register(units[i].tank_ps_tbl[1], "computed_status", status.update)
+                tank_pcnt.register(units[i].tank_ps_tbl[1], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(units[i].tank_ps_tbl[1], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(units[i].tank_ps_tbl[1], "fill", level.update)
+                can_fill.register(units[i].tank_ps_tbl[1], "container_mode", _can_fill)
+                can_empty.register(units[i].tank_ps_tbl[1], "container_mode", _can_empty)
+            else
+                status.register(facility.tank_ps_tbl[f_id], "computed_status", status.update)
+                tank_pcnt.register(facility.tank_ps_tbl[f_id], "fill", function (f) tank_pcnt.update(f * 100) end)
+                tank_amnt.register(facility.tank_ps_tbl[f_id], "stored", function (sto) tank_amnt.update(sto.amount) end)
+                level.register(facility.tank_ps_tbl[f_id], "fill", level.update)
+                can_fill.register(facility.tank_ps_tbl[f_id], "container_mode", _can_fill)
+                can_empty.register(facility.tank_ps_tbl[f_id], "container_mode", _can_empty)
+            end
+        end
+    end
+
+    util.nop()
+
+    ---------
+    -- SPS --
+    ---------
+
+    local sps = Div{parent=main,x=140,y=3,height=12}
+
+    TextBox{parent=sps,text=" ",width=24,height=1,x=1,y=1,fg_bg=style.lg_gray}
+    TextBox{parent=sps,text="SPS",alignment=ALIGN.CENTER,width=24,height=1,fg_bg=wh_gray}
+
+    local sps_box = Rectangle{parent=sps,border=border(1,colors.gray,true),width=24,height=10}
+
+    local status = StateIndicator{parent=sps_box,x=5,y=1,states=style.sps.states,value=1,min_width=14}
+
+    status.register(facility.sps_ps_tbl[1], "computed_status", status.update)
+
+    TextBox{parent=sps_box,x=2,y=3,text="Input Rate",height=1,width=10,fg_bg=style.label}
+    local sps_in = DataIndicator{parent=sps_box,x=2,label="",format="%15.2f",value=0,unit="mB/t",lu_colors=lu_col,width=20,fg_bg=s_field}
+
+    sps_in.register(facility.ps, "po_am_rate", sps_in.update)
+
+    TextBox{parent=sps_box,x=2,y=6,text="Production Rate",height=1,width=15,fg_bg=style.label}
+    local sps_rate = DataIndicator{parent=sps_box,x=2,label="",format="%15d",value=0,unit="\xb5B/t",lu_colors=lu_col,width=20,fg_bg=s_field}
+
+    sps_rate.register(facility.sps_ps_tbl[1], "process_rate", function (r) sps_rate.update(r * 1000) end)
+
+    ----------------
+    -- statistics --
+    ----------------
+
+    TextBox{parent=main,x=145,y=16,text="RAW WASTE",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local raw_waste  = Rectangle{parent=main,x=145,y=17,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=s_hi_bright}
+    local sum_raw_waste = DataIndicator{parent=raw_waste,lu_colors=lu_c_d,label="SUM",unit="mB/t",format="%8.2f",value=0,width=17}
+
+    sum_raw_waste.register(facility.ps, "burn_sum", sum_raw_waste.update)
+
+    TextBox{parent=main,x=145,y=21,text="PROC. WASTE",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local pr_waste  = Rectangle{parent=main,x=145,y=22,border=border(1,colors.gray,true),width=19,height=5,thin=true,fg_bg=s_hi_bright}
+    local pu = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="Pu",unit="mB/t",format="%9.3f",value=0,width=17}
+    local po = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="Po",unit="mB/t",format="%9.2f",value=0,width=17}
+    local popl = DataIndicator{parent=pr_waste,lu_colors=lu_c_d,label="PoPl",unit="mB/t",format="%7.2f",value=0,width=17}
+
+    pu.register(facility.ps, "pu_rate", pu.update)
+    po.register(facility.ps, "po_rate", po.update)
+    popl.register(facility.ps, "po_pl_rate", popl.update)
+
+    TextBox{parent=main,x=145,y=28,text="SPENT WASTE",alignment=ALIGN.CENTER,width=19,height=1,fg_bg=wh_gray}
+    local sp_waste  = Rectangle{parent=main,x=145,y=29,border=border(1,colors.gray,true),width=19,height=3,thin=true,fg_bg=s_hi_bright}
+    local sum_sp_waste = DataIndicator{parent=sp_waste,lu_colors=lu_c_d,label="SUM",unit="mB/t",format="%8.3f",value=0,width=17}
+
+    sum_sp_waste.register(facility.ps, "spent_waste_rate", sum_sp_waste.update)
+end
+
+return init

coordinator/ui/layout/front_panel.lua

@@ -2,39 +2,44 @@
 -- Coordinator Front Panel GUI
 --
 
-local types         = require("scada-common.types")
-local util          = require("scada-common.util")
+local types     = require("scada-common.types")
+local util      = require("scada-common.util")
 
-local iocontrol     = require("coordinator.iocontrol")
+local iocontrol = require("coordinator.iocontrol")
 
-local pgi           = require("coordinator.ui.pgi")
-local style         = require("coordinator.ui.style")
+local pgi       = require("coordinator.ui.pgi")
+local style     = require("coordinator.ui.style")
 
-local pkt_entry     = require("coordinator.ui.components.pkt_entry")
+local pkt_entry = require("coordinator.ui.components.pkt_entry")
 
-local core          = require("graphics.core")
+local core      = require("graphics.core")
 
-local Div           = require("graphics.elements.div")
-local ListBox       = require("graphics.elements.listbox")
-local MultiPane     = require("graphics.elements.multipane")
-local TextBox       = require("graphics.elements.textbox")
+local Div       = require("graphics.elements.div")
+local ListBox   = require("graphics.elements.listbox")
+local MultiPane = require("graphics.elements.multipane")
+local TextBox   = require("graphics.elements.textbox")
 
-local TabBar        = require("graphics.elements.controls.tabbar")
+local TabBar    = require("graphics.elements.controls.tabbar")
 
-local LED           = require("graphics.elements.indicators.led")
-local RGBLED        = require("graphics.elements.indicators.ledrgb")
+local LED       = require("graphics.elements.indicators.led")
+local LEDPair   = require("graphics.elements.indicators.ledpair")
+local RGBLED    = require("graphics.elements.indicators.ledrgb")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local LINK_STATE = types.PANEL_LINK_STATE
+
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 
+local led_grn = style.led_grn
+
 -- create new front panel view
 ---@param panel graphics_element main displaybox
 ---@param num_units integer number of units (number of unit monitors)
 local function init(panel, num_units)
     local ps = iocontrol.get_db().fp.ps
 
-    TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.fp.header}
+    TextBox{parent=panel,y=1,text="SCADA COORDINATOR",alignment=ALIGN.CENTER,height=1,fg_bg=style.fp_theme.header}
 
     local page_div = Div{parent=panel,x=1,y=3}
 
@@ -47,36 +52,78 @@ local function init(panel, num_units)
     local system = Div{parent=main_page,width=14,height=17,x=2,y=2}
 
     local status = LED{parent=system,label="STATUS",colors=cpair(colors.green,colors.red)}
-    local heartbeat = LED{parent=system,label="HEARTBEAT",colors=cpair(colors.green,colors.green_off)}
+    local heartbeat = LED{parent=system,label="HEARTBEAT",colors=led_grn}
     status.update(true)
     system.line_break()
 
     heartbeat.register(ps, "heartbeat", heartbeat.update)
 
-    local modem = LED{parent=system,label="MODEM",colors=cpair(colors.green,colors.green_off)}
-    local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,colors.gray}}
-    network.update(types.PANEL_LINK_STATE.DISCONNECTED)
+    local modem = LED{parent=system,label="MODEM",colors=led_grn}
+
+    if not style.colorblind then
+        local network = RGBLED{parent=system,label="NETWORK",colors={colors.green,colors.red,colors.orange,colors.yellow,style.fp_ind_bkg}}
+        network.update(types.PANEL_LINK_STATE.DISCONNECTED)
+        network.register(ps, "link_state", network.update)
+    else
+        local nt_lnk = LEDPair{parent=system,label="NT LINKED",off=style.fp_ind_bkg,c1=colors.red,c2=colors.green}
+        local nt_ver = LEDPair{parent=system,label="NT VERSION",off=style.fp_ind_bkg,c1=colors.red,c2=colors.green}
+
+        nt_lnk.register(ps, "link_state", function (state)
+            local value = 2
+
+            if state == LINK_STATE.DISCONNECTED then
+                value = 1
+            elseif state == LINK_STATE.LINKED then
+                value = 3
+            end
+
+            nt_lnk.update(value)
+        end)
+
+        nt_ver.register(ps, "link_state", function (state)
+            local value = 3
+
+            if state == LINK_STATE.BAD_VERSION then
+                value = 2
+            elseif state == LINK_STATE.DISCONNECTED then
+                value = 1
+            end
+
+            nt_ver.update(value)
+        end)
+    end
+
     system.line_break()
 
     modem.register(ps, "has_modem", modem.update)
-    network.register(ps, "link_state", network.update)
 
-    local speaker = LED{parent=system,label="SPEAKER",colors=cpair(colors.green,colors.green_off)}
+    local speaker = LED{parent=system,label="SPEAKER",colors=led_grn}
     speaker.register(ps, "has_speaker", speaker.update)
 
+    system.line_break()
+
+    local rt_main = LED{parent=system,label="RT MAIN",colors=led_grn}
+    local rt_render = LED{parent=system,label="RT RENDER",colors=led_grn}
+
+    rt_main.register(ps, "routine__main", rt_main.update)
+    rt_render.register(ps, "routine__render", rt_render.update)
+
 ---@diagnostic disable-next-line: undefined-field
     local comp_id = util.sprintf("(%d)", os.getComputerID())
-    TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=cpair(colors.lightGray,colors.ivory)}
+    TextBox{parent=system,x=9,y=4,width=6,height=1,text=comp_id,fg_bg=style.fp.disabled_fg}
 
     local monitors = Div{parent=main_page,width=16,height=17,x=18,y=2}
 
-    local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=cpair(colors.green,colors.green_off)}
+    local main_monitor = LED{parent=monitors,label="MAIN MONITOR",colors=led_grn}
     main_monitor.register(ps, "main_monitor", main_monitor.update)
 
+    local flow_monitor = LED{parent=monitors,label="FLOW MONITOR",colors=led_grn}
+    flow_monitor.register(ps, "flow_monitor", flow_monitor.update)
+
     monitors.line_break()
 
     for i = 1, num_units do
-        local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=cpair(colors.green,colors.green_off)}
+        local unit_monitor = LED{parent=monitors,label="UNIT "..i.." MONITOR",colors=led_grn}
         unit_monitor.register(ps, "unit_monitor_" .. i, unit_monitor.update)
     end
 
@@ -84,9 +131,9 @@ local function init(panel, num_units)
     -- about footer
     --
 
-    local about   = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=cpair(colors.lightGray,colors.ivory)}
-    local fw_v    = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
-    local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00",alignment=TEXT_ALIGN.LEFT,height=1}
+    local about   = Div{parent=main_page,width=15,height=3,x=1,y=16,fg_bg=style.fp.disabled_fg}
+    local fw_v    = TextBox{parent=about,x=1,y=1,text="FW: v00.00.00",alignment=ALIGN.LEFT,height=1}
+    local comms_v = TextBox{parent=about,x=1,y=2,text="NT: v00.00.00",alignment=ALIGN.LEFT,height=1}
 
     fw_v.register(ps, "version", function (version) fw_v.set_value(util.c("FW: ", version)) end)
     comms_v.register(ps, "comms_version", function (version) comms_v.set_value(util.c("NT: v", version)) end)
@@ -98,7 +145,7 @@ local function init(panel, num_units)
     -- API page
 
     local api_page = Div{parent=page_div,x=1,y=1,hidden=true}
-    local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=cpair(colors.black,colors.ivory),nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
+    local api_list = ListBox{parent=api_page,x=1,y=1,height=17,width=51,scroll_height=1000,fg_bg=style.fp.text_fg,nav_fg_bg=cpair(colors.gray,colors.lightGray),nav_active=cpair(colors.black,colors.gray)}
     local _ = Div{parent=api_list,height=1,hidden=true} -- padding
 
     -- assemble page panes
@@ -108,11 +155,11 @@ local function init(panel, num_units)
     local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
 
     local tabs = {
-        { name = "CRD", color = cpair(colors.black, colors.ivory) },
-        { name = "API", color = cpair(colors.black, colors.ivory) },
+        { name = "CRD", color = style.fp.text },
+        { name = "API", color = style.fp.text },
     }
 
-    TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=cpair(colors.black,colors.white)}
+    TabBar{parent=panel,y=2,tabs=tabs,min_width=9,callback=page_pane.set_value,fg_bg=style.fp_theme.highlight_box_bright}
 
     -- link pocket API list management to PGI
     pgi.link_elements(api_list, pkt_entry)

coordinator/ui/layout/main_view.lua

@@ -18,21 +18,21 @@ local TextBox       = require("graphics.elements.textbox")
 
 local DataIndicator = require("graphics.elements.indicators.data")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
-
-local cpair = core.cpair
+local ALIGN = core.ALIGN
 
 -- create new main view
 ---@param main graphics_element main displaybox
 local function init(main)
+    local s_header = style.theme.header
+
     local facility = iocontrol.get_db().facility
     local units = iocontrol.get_db().units
 
     -- window header message
-    local header = TextBox{parent=main,y=1,text="Nuclear Generation Facility SCADA Coordinator",alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=style.header}
-    local ping = DataIndicator{parent=main,x=1,y=1,label="SVTT",format="%d",value=0,unit="ms",lu_colors=cpair(colors.lightGray, colors.white),width=12,fg_bg=style.header}
+    local header = TextBox{parent=main,y=1,text="Nuclear Generation Facility SCADA Coordinator",alignment=ALIGN.CENTER,height=1,fg_bg=s_header}
+    local ping = DataIndicator{parent=main,x=1,y=1,label="SVTT",format="%d",value=0,unit="ms",lu_colors=style.lg_white,width=12,fg_bg=s_header}
     -- max length example: "01:23:45 AM - Wednesday, September 28 2022"
-    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=TEXT_ALIGN.RIGHT,width=42,height=1,fg_bg=style.header}
+    local datetime = TextBox{parent=main,x=(header.get_width()-42),y=1,text="",alignment=ALIGN.RIGHT,width=42,height=1,fg_bg=s_header}
 
     ping.register(facility.ps, "sv_ping", ping.update)
     datetime.register(facility.ps, "date_time", datetime.set_value)
@@ -55,6 +55,8 @@ local function init(main)
 
     cnc_y_start = cnc_y_start + row_1_height + 1
 
+    util.nop()
+
     if facility.num_units >= 3 then
         -- base offset 3, spacing 1, max height of units 1 and 2
         local row_2_offset = cnc_y_start
@@ -66,23 +68,25 @@ local function init(main)
             uo_4 = unit_overview(main, 84, row_2_offset, units[4])
             cnc_y_start = math.max(cnc_y_start, row_2_offset + uo_4.get_height() + 1)
         end
+
+        util.nop()
     end
 
     -- command & control
 
-    cnc_y_start = cnc_y_start
-
     -- induction matrix and process control interfaces are 24 tall + space needed for divider
     local cnc_bottom_align_start = main.get_height() - 26
 
     assert(cnc_bottom_align_start >= cnc_y_start, "main display not of sufficient vertical resolution (add an additional row of monitors)")
 
-    TextBox{parent=main,y=cnc_bottom_align_start,text=util.strrep("\x8c", header.get_width()),alignment=TEXT_ALIGN.CENTER,height=1,fg_bg=cpair(colors.lightGray,colors.gray)}
+    TextBox{parent=main,y=cnc_bottom_align_start,text=string.rep("\x8c", header.get_width()),alignment=ALIGN.CENTER,height=1,fg_bg=style.lg_gray}
 
     cnc_bottom_align_start = cnc_bottom_align_start + 2
 
     process_ctl(main, 2, cnc_bottom_align_start)
 
+    util.nop()
+
     imatrix(main, 131, cnc_bottom_align_start, facility.induction_data_tbl[1], facility.induction_ps_tbl[1])
 end
 

coordinator/ui/style.lua

@@ -2,73 +2,149 @@
 -- Graphics Style Options
 --
 
-local core = require("graphics.core")
+local util   = require("scada-common.util")
 
+local core   = require("graphics.core")
+local themes = require("graphics.themes")
+
+---@class crd_style
 local style = {}
 
 local cpair = core.cpair
 
--- GLOBAL --
-
--- add color mappings for front panel
-colors.ivory = colors.pink
-colors.yellow_hc = colors.purple
-colors.red_off = colors.brown
-colors.yellow_off = colors.magenta
-colors.green_off = colors.lime
-
 -- front panel styling
 
-style.fp = {}
+style.fp_theme = themes.sandstone
+style.fp = themes.get_fp_style(style.fp_theme)
 
-style.fp.root = cpair(colors.black, colors.ivory)
-style.fp.header = cpair(colors.black, colors.lightGray)
-
-style.fp.colors = {
-    { c = colors.red,       hex = 0xdf4949 },   -- RED ON
-    { c = colors.orange,    hex = 0xffb659 },
-    { c = colors.yellow,    hex = 0xf9fb53 },   -- YELLOW ON
-    { c = colors.lime,      hex = 0x16665a },   -- GREEN OFF
-    { c = colors.green,     hex = 0x6be551 },   -- GREEN ON
-    { c = colors.cyan,      hex = 0x34bac8 },
-    { c = colors.lightBlue, hex = 0x6cc0f2 },
-    { c = colors.blue,      hex = 0x0096ff },
-    { c = colors.purple,    hex = 0xb156ee },   -- YELLOW HIGH CONTRAST
-    { c = colors.pink,      hex = 0xdcd9ca },   -- IVORY
-    { c = colors.magenta,   hex = 0x85862c },   -- YELLOW OFF
-    -- { c = colors.white,     hex = 0xdcd9ca },
-    { c = colors.lightGray, hex = 0xb1b8b3 },
-    { c = colors.gray,      hex = 0x575757 },
-    -- { c = colors.black,     hex = 0x191919 },
-    { c = colors.brown,     hex = 0x672223 }    -- RED OFF
-}
+style.led_grn = cpair(colors.green, colors.green_off)
 
 -- main GUI styling
 
-style.root = cpair(colors.black, colors.lightGray)
-style.header = cpair(colors.white, colors.gray)
-style.label = cpair(colors.gray, colors.lightGray)
+---@class theme
+local smooth_stone = {
+    text = colors.black,
+    text_inv = colors.white,
+    label = colors.gray,
+    label_dark = colors.gray,
+    disabled = colors.lightGray,
+    bg = colors.lightGray,
+    checkbox_bg = colors.black,
+    accent_light = colors.white,
+    accent_dark = colors.gray,
 
-style.colors = {
-    { c = colors.red,       hex = 0xdf4949 },
-    { c = colors.orange,    hex = 0xffb659 },
-    { c = colors.yellow,    hex = 0xfffc79 },
-    { c = colors.lime,      hex = 0x80ff80 },
-    { c = colors.green,     hex = 0x4aee8a },
-    { c = colors.cyan,      hex = 0x34bac8 },
-    { c = colors.lightBlue, hex = 0x6cc0f2 },
-    { c = colors.blue,      hex = 0x0096ff },
-    { c = colors.purple,    hex = 0xb156ee },
-    { c = colors.pink,      hex = 0xf26ba2 },
-    { c = colors.magenta,   hex = 0xf9488a },
-    -- { c = colors.white,     hex = 0xf0f0f0 },
-    { c = colors.lightGray, hex = 0xcacaca },
-    { c = colors.gray,      hex = 0x575757 },
-    -- { c = colors.black,     hex = 0x191919 },
-    -- { c = colors.brown,     hex = 0x7f664c }
+    fuel_color = colors.black,
+
+    header = cpair(colors.white, colors.gray),
+
+    text_fg = cpair(colors.black, colors._INHERIT),
+    label_fg = cpair(colors.gray, colors._INHERIT),
+    disabled_fg = cpair(colors.lightGray, colors._INHERIT),
+
+    highlight_box = cpair(colors.black, colors.white),
+    highlight_box_bright = cpair(colors.black, colors.white),
+    field_box = cpair(colors.black, colors.white),
+
+    colors = themes.smooth_stone.colors,
+
+    -- color re-mappings for assistive modes
+    color_modes = themes.smooth_stone.color_modes
 }
 
--- MAIN LAYOUT --
+---@type theme
+local deepslate = {
+    text = colors.white,
+    text_inv = colors.black,
+    label = colors.lightGray,
+    label_dark = colors.gray,
+    disabled = colors.gray,
+    bg = colors.black,
+    checkbox_bg = colors.gray,
+    accent_light = colors.gray,
+    accent_dark = colors.lightGray,
+
+    fuel_color = colors.lightGray,
+
+    header = cpair(colors.white, colors.gray),
+
+    text_fg = cpair(colors.white, colors._INHERIT),
+    label_fg = cpair(colors.lightGray, colors._INHERIT),
+    disabled_fg = cpair(colors.gray, colors._INHERIT),
+
+    highlight_box = cpair(colors.white, colors.gray),
+    highlight_box_bright = cpair(colors.black, colors.lightGray),
+    field_box = cpair(colors.white, colors.gray),
+
+    colors = themes.deepslate.colors,
+
+    -- color re-mappings for assistive modes
+    color_modes = themes.deepslate.color_modes
+}
+
+style.theme = smooth_stone
+
+-- set themes per configurations
+---@param main UI_THEME main UI theme
+---@param fp FP_THEME front panel theme
+---@param color_mode COLOR_MODE the color mode to use
+function style.set_themes(main, fp, color_mode)
+    local colorblind = color_mode ~= themes.COLOR_MODE.STANDARD and color_mode ~= themes.COLOR_MODE.STD_ON_BLACK
+    local gray_ind_off = color_mode == themes.COLOR_MODE.STANDARD or color_mode == themes.COLOR_MODE.BLUE_IND
+
+    style.ind_bkg = colors.gray
+    style.fp_ind_bkg = util.trinary(gray_ind_off, colors.gray, colors.black)
+    style.ind_hi_box_bg = util.trinary(gray_ind_off, colors.gray, colors.black)
+
+    if main == themes.UI_THEME.SMOOTH_STONE then
+        style.theme = smooth_stone
+        style.ind_bkg = util.trinary(gray_ind_off, colors.gray, colors.black)
+    elseif main == themes.UI_THEME.DEEPSLATE then
+        style.theme = deepslate
+        style.ind_hi_box_bg = util.trinary(gray_ind_off, colors.lightGray, colors.black)
+    end
+
+    style.colorblind = colorblind
+
+    style.root = cpair(style.theme.text, style.theme.bg)
+    style.label = cpair(style.theme.label, style.theme.bg)
+
+    -- high contrast text (also tags)
+    style.hc_text = cpair(style.theme.text, style.theme.text_inv)
+    -- text on default background
+    style.text_colors = cpair(style.theme.text, style.theme.bg)
+    -- label & unit colors
+    style.lu_colors = cpair(style.theme.label, style.theme.label)
+    -- label & unit colors (darker if set)
+    style.lu_colors_dark = cpair(style.theme.label_dark, style.theme.label_dark)
+
+    style.ind_grn = cpair(util.trinary(colorblind, colors.blue, colors.green), style.ind_bkg)
+    style.ind_yel = cpair(colors.yellow, style.ind_bkg)
+    style.ind_red = cpair(colors.red, style.ind_bkg)
+    style.ind_wht = cpair(colors.white, style.ind_bkg)
+
+    if fp == themes.FP_THEME.SANDSTONE then
+        style.fp_theme = themes.sandstone
+    elseif fp == themes.FP_THEME.BASALT then
+        style.fp_theme = themes.basalt
+    end
+
+    style.fp = themes.get_fp_style(style.fp_theme)
+end
+
+-- COMMON COLOR PAIRS --
+
+style.wh_gray = cpair(colors.white, colors.gray)
+
+style.bw_fg_bg = cpair(colors.black, colors.white)
+
+style.hzd_fg_bg  = style.wh_gray
+style.dis_colors = cpair(colors.white, colors.lightGray)
+
+style.lg_gray = cpair(colors.lightGray, colors.gray)
+style.lg_white = cpair(colors.lightGray, colors.white)
+style.gray_white = cpair(colors.gray, colors.white)
+
+-- UI COMPONENTS --
 
 style.reactor = {
     -- reactor states
@@ -206,7 +282,7 @@ style.sps = {
             text = "RTU  FAULT"
         },
         {
-            color = cpair(colors.black, colors.gray),
+            color = cpair(colors.white, colors.gray),
             text = "IDLE"
         },
         {
@@ -216,6 +292,36 @@ style.sps = {
     }
 }
 
+style.dtank = {
+    -- dynamic tank states
+    states = {
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "OFF-LINE"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "NOT FORMED"
+        },
+        {
+            color = cpair(colors.black, colors.orange),
+            text = "RTU  FAULT"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "ONLINE"
+        },
+        {
+            color = cpair(colors.black, colors.yellow),
+            text = "LOW FILL"
+        },
+        {
+            color = cpair(colors.black, colors.green),
+            text = "FILLED"
+        },
+    }
+}
+
 style.waste = {
     -- auto waste processing states
     states = {

graphics/core.lua

@@ -7,19 +7,15 @@ local flasher = require("graphics.flasher")
 
 local core = {}
 
-core.version = "1.0.2"
+core.version = "2.3.0"
 
 core.flasher = flasher
 core.events = events
 
 -- Core Types
 
----@enum TEXT_ALIGN
-core.TEXT_ALIGN = {
-    LEFT = 1,
-    CENTER = 2,
-    RIGHT = 3
-}
+---@enum ALIGN
+core.ALIGN = { LEFT = 1, CENTER = 2, RIGHT = 3 }
 
 ---@class graphics_border
 ---@field width integer
@@ -35,11 +31,7 @@ core.TEXT_ALIGN = {
 ---@param even? boolean whether to pad width extra to account for rectangular pixels, defaults to false
 ---@return graphics_border
 function core.border(width, color, even)
-    return {
-        width = width,
-        color = color,
-        even = even or false    -- convert nil to false
-    }
+    return { width = width, color = color, even = even or false }
 end
 
 ---@class graphics_frame
@@ -56,12 +48,7 @@ end
 ---@param h integer
 ---@return graphics_frame
 function core.gframe(x, y, w, h)
-    return {
-        x = x,
-        y = y,
-        w = w,
-        h = h
-    }
+    return { x = x, y = y, w = w, h = h }
 end
 
 ---@class cpair
@@ -74,6 +61,9 @@ end
 ---@field blit_fgd string
 ---@field blit_bkg string
 
+-- add inherited flag, 3 isn't a pure color so it wouldn't be used
+colors._INHERIT = 3
+
 -- create a new color pair definition
 ---@nodiscard
 ---@param a color
@@ -82,15 +72,9 @@ end
 function core.cpair(a, b)
     return {
         -- color pairs
-        color_a = a,
-        color_b = b,
-        blit_a = colors.toBlit(a),
-        blit_b = colors.toBlit(b),
+        color_a = a, color_b = b, blit_a = colors.toBlit(a), blit_b = colors.toBlit(b),
         -- aliases
-        fgd = a,
-        bkg = b,
-        blit_fgd = colors.toBlit(a),
-        blit_bkg = colors.toBlit(b)
+        fgd = a, bkg = b, blit_fgd = colors.toBlit(a), blit_bkg = colors.toBlit(b)
     }
 end
 
@@ -130,4 +114,215 @@ function core.pipe(x1, y1, x2, y2, color, thin, align_tr)
     }
 end
 
+-- Assertion Handling
+
+-- extract the custom element assert message, dropping the path to the element file
+function core.extract_assert_msg(msg)
+    return string.sub(msg, (string.find(msg, "@") or 0) + 1)
+end
+
+-- Interactive Field Manager
+
+---@param e graphics_base
+---@param max_len any
+---@param fg_bg any
+---@param dis_fg_bg any
+function core.new_ifield(e, max_len, fg_bg, dis_fg_bg)
+    local self = {
+        frame_start = 1,
+        visible_text = e.value,
+        cursor_pos = string.len(e.value) + 1,
+        selected_all = false
+    }
+
+    -- update visible text
+    local function _update_visible()
+        self.visible_text = string.sub(e.value, self.frame_start, self.frame_start + math.min(string.len(e.value), e.frame.w) - 1)
+    end
+
+    -- try shifting frame left
+    local function _try_lshift()
+        if self.frame_start > 1 then
+            self.frame_start = self.frame_start - 1
+            return true
+        end
+    end
+
+    -- try shifting frame right
+    local function _try_rshift()
+        if (self.frame_start + e.frame.w - 1) <= string.len(e.value) then
+            self.frame_start = self.frame_start + 1
+            return true
+        end
+    end
+
+    ---@class ifield
+    local public = {}
+
+    -- censor the display (for private info, for example) with the provided character<br>
+    -- disable by passing no argument
+    ---@param censor string? character to hide data with
+    function public.censor(censor)
+        if type(censor) == "string" and string.len(censor) == 1 then
+            self.censor = censor
+        else self.censor = nil end
+        public.show()
+    end
+
+    -- show the field
+    function public.show()
+        _update_visible()
+
+        if e.enabled then
+            e.w_set_bkg(fg_bg.bkg)
+            e.w_set_fgd(fg_bg.fgd)
+        elseif dis_fg_bg ~= nil then
+            e.w_set_bkg(dis_fg_bg.bkg)
+            e.w_set_fgd(dis_fg_bg.fgd)
+        end
+
+        -- clear and print
+        e.w_set_cur(1, 1)
+        e.w_write(string.rep(" ", e.frame.w))
+        e.w_set_cur(1, 1)
+
+        local function _write()
+            if self.censor then
+                e.w_write(string.rep(self.censor, string.len(self.visible_text)))
+            else
+                e.w_write(self.visible_text)
+            end
+        end
+
+        if e.is_focused() and e.enabled then
+            -- write text with cursor
+            if self.selected_all then
+                e.w_set_bkg(fg_bg.fgd)
+                e.w_set_fgd(fg_bg.bkg)
+                _write()
+            elseif self.cursor_pos >= (string.len(self.visible_text) + 1) then
+                -- write text with cursor at the end, no need to blit
+                _write()
+                e.w_set_fgd(colors.lightGray)
+                e.w_write("_")
+            else
+                local a, b = "", ""
+
+                if self.cursor_pos <= string.len(self.visible_text) then
+                    a = fg_bg.blit_bkg
+                    b = fg_bg.blit_fgd
+                end
+
+                local b_fgd = string.rep(fg_bg.blit_fgd, self.cursor_pos - 1) .. a .. string.rep(fg_bg.blit_fgd, string.len(self.visible_text) - self.cursor_pos)
+                local b_bkg = string.rep(fg_bg.blit_bkg, self.cursor_pos - 1) .. b .. string.rep(fg_bg.blit_bkg, string.len(self.visible_text) - self.cursor_pos)
+
+                if self.censor then
+                    e.w_blit(string.rep(self.censor, string.len(self.visible_text)), b_fgd, b_bkg)
+                else
+                    e.w_blit(self.visible_text, b_fgd, b_bkg)
+                end
+            end
+        else
+            self.selected_all = false
+
+            -- write text without cursor
+            _write()
+        end
+    end
+
+    -- move cursor to x
+    ---@param x integer
+    function public.move_cursor(x)
+        self.selected_all = false
+        self.cursor_pos = math.min(x, string.len(self.visible_text) + 1)
+        public.show()
+    end
+
+    -- select all text
+    function public.select_all()
+        self.selected_all = true
+        public.show()
+    end
+
+    -- set field value
+    ---@param val string
+    function public.set_value(val)
+        e.value = string.sub(val, 1, math.min(max_len, string.len(val)))
+        public.nav_end()
+    end
+
+    -- try to insert a character if there is space
+    ---@param char string
+    function public.try_insert_char(char)
+        -- limit length
+        if string.len(e.value) >= max_len then return end
+
+        -- replace if selected all, insert otherwise
+        if self.selected_all then
+            self.selected_all = false
+            self.cursor_pos = 2
+            self.frame_start = 1
+
+            e.value = char
+            public.show()
+        else
+            e.value = string.sub(e.value, 1, self.frame_start + self.cursor_pos - 2) .. char .. string.sub(e.value, self.frame_start + self.cursor_pos - 1, string.len(e.value))
+            _update_visible()
+            public.nav_right()
+        end
+    end
+
+    -- remove charcter before cursor if there is anything to remove, or delete all if selected all
+    function public.backspace()
+        if self.selected_all then
+            self.selected_all = false
+            e.value = ""
+            self.cursor_pos = 1
+            self.frame_start = 1
+            public.show()
+        else
+            if self.frame_start + self.cursor_pos > 2 then
+                e.value = string.sub(e.value, 1, self.frame_start + self.cursor_pos - 3) .. string.sub(e.value, self.frame_start + self.cursor_pos - 1, string.len(e.value))
+                if self.cursor_pos > 1 then
+                    self.cursor_pos = self.cursor_pos - 1
+                    public.show()
+                elseif _try_lshift() then public.show() end
+            end
+        end
+    end
+
+    -- move cursor left by one
+    function public.nav_left()
+        if self.cursor_pos > 1 then
+            self.cursor_pos = self.cursor_pos - 1
+            public.show()
+        elseif _try_lshift() then public.show() end
+    end
+
+    -- move cursor right by one
+    function public.nav_right()
+        if self.cursor_pos < math.min(string.len(self.visible_text) + 1, e.frame.w) then
+            self.cursor_pos = self.cursor_pos + 1
+            public.show()
+        elseif _try_rshift() then public.show() end
+    end
+
+    -- move cursor to the start
+    function public.nav_start()
+        self.cursor_pos = 1
+        self.frame_start = 1
+        public.show()
+    end
+
+    -- move cursor to the end
+    function public.nav_end()
+        self.frame_start = math.max(1, string.len(e.value) - e.frame.w + 2)
+        _update_visible()
+        self.cursor_pos = string.len(self.visible_text) + 1
+        public.show()
+    end
+
+    return public
+end
+
 return core

graphics/element.lua

@@ -2,8 +2,12 @@
 -- Generic Graphics Element
 --
 
+local util = require("scada-common.util")
+
 local core = require("graphics.core")
 
+local events = core.events
+
 local element = {}
 
 ---@class graphics_args_generic
@@ -17,18 +21,23 @@ local element = {}
 ---@field gframe? graphics_frame frame instead of x/y/width/height
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
+---@field can_focus? boolean true if this element can be focused, false by default
 
 ---@alias graphics_args graphics_args_generic
 ---|waiting_args
+---|app_button_args
 ---|checkbox_args
 ---|hazard_button_args
 ---|multi_button_args
 ---|push_button_args
+---|radio_2d_args
 ---|radio_button_args
 ---|sidebar_args
 ---|spinbox_args
 ---|switch_button_args
 ---|tabbar_args
+---|number_field_args
+---|text_field_args
 ---|alarm_indicator_light
 ---|core_map_args
 ---|data_indicator_args
@@ -40,9 +49,11 @@ local element = {}
 ---|indicator_light_args
 ---|power_indicator_args
 ---|rad_indicator_args
+---|signal_bar_args
 ---|state_indicator_args
 ---|tristate_indicator_light_args
 ---|vbar_args
+---|app_multipane_args
 ---|colormap_args
 ---|displaybox_args
 ---|div_args
@@ -58,22 +69,38 @@ local element = {}
 ---@field key string data key
 ---@field func function callback
 
+-- more detailed assert message for element verification
+---@param condition any assert condition
+---@param msg string assert message
+---@param callstack_offset? integer shift value to change targets of debug.getinfo()
+function element.assert(condition, msg, callstack_offset)
+    callstack_offset = callstack_offset or 0
+    local caller = debug.getinfo(3 + callstack_offset)
+    assert(condition, util.c(caller.source, ":", caller.currentline, "{", debug.getinfo(2 + callstack_offset).name, "}: ", msg))
+end
+
 -- a base graphics element, should not be created on its own
 ---@nodiscard
 ---@param args graphics_args arguments
+---@param constraint? function apply a dimensional constraint based on proposed dimensions function(frame) -> width, height
 ---@param child_offset_x? integer mouse event offset x
 ---@param child_offset_y? integer mouse event offset y
-function element.new(args, child_offset_x, child_offset_y)
+function element.new(args, constraint, child_offset_x, child_offset_y)
     local self = {
         id = nil,                                       ---@type element_id|nil
+        is_root = args.parent == nil,
         elem_type = debug.getinfo(2).name,
         define_completed = false,
         p_window = nil,                                 ---@type table
-        position = { x = 1, y = 1 },                    ---@type coordinate_2d
+        position = events.new_coord_2d(1, 1),
         bounds = { x1 = 1, y1 = 1, x2 = 1, y2 = 1 },    ---@class element_bounds
+        offset_x = 0,
+        offset_y = 0,
         next_y = 1,                                     -- next child y coordinate
         next_id = 0,                                    -- next child ID
         subscriptions = {},
+        button_down = { events.new_coord_2d(-1, -1), events.new_coord_2d(-1, -1), events.new_coord_2d(-1, -1) },
+        focused = false,
         mt = {}
     }
 
@@ -83,16 +110,16 @@ function element.new(args, child_offset_x, child_offset_y)
         value = nil,            ---@type any
         window = nil,           ---@type table
         content_window = nil,   ---@type table|nil
+        mouse_window_shift = { x = 0, y = 0 },
         fg_bg = core.cpair(colors.white, colors.black),
         frame = core.gframe(1, 1, 1, 1),
-        children = {}
+        children = {},
+        child_id_map = {}
     }
 
-    local name_brief = "graphics.element{" .. self.elem_type .. "}: "
-
     -- element as string
     function self.mt.__tostring()
-        return "graphics.element{" .. self.elem_type .. "} @ " .. tostring(self)
+        return util.c("graphics.element{", self.elem_type, "} @ ", self)
     end
 
     ---@class graphics_element
@@ -100,6 +127,69 @@ function element.new(args, child_offset_x, child_offset_y)
 
     setmetatable(public, self.mt)
 
+    -----------------------
+    -- PRIVATE FUNCTIONS --
+    -----------------------
+
+    -- use tab to jump to the next focusable field
+    ---@param reverse boolean
+    local function _tab_focusable(reverse)
+        local first_f = nil ---@type graphics_element|nil
+        local prev_f = nil  ---@type graphics_element|nil
+        local cur_f = nil   ---@type graphics_element|nil
+        local done = false
+
+        ---@param elem graphics_element
+        local function handle_element(elem)
+            if elem.is_visible() and elem.is_focusable() and elem.is_enabled() then
+                if first_f == nil then first_f = elem end
+
+                if cur_f == nil then
+                    if elem.is_focused() then
+                        cur_f = elem
+                        if (not done) and (reverse and prev_f ~= nil) then
+                            cur_f.unfocus()
+                            prev_f.focus()
+                            done = true
+                        end
+                    end
+                else
+                    if elem.is_focused() then
+                        elem.unfocus()
+                    elseif not (reverse or done) then
+                        cur_f.unfocus()
+                        elem.focus()
+                        done = true
+                    end
+                end
+
+                prev_f = elem
+            end
+        end
+
+        ---@param children table
+        local function traverse(children)
+            for i = 1, #children do
+                local child = children[i]   ---@type graphics_base
+                handle_element(child.get())
+                if child.get().is_visible() then traverse(child.children) end
+            end
+        end
+
+        traverse(protected.children)
+
+        -- if no element was focused, wrap focus
+        if first_f ~= nil and not done then
+            if reverse then
+                if cur_f ~= nil then cur_f.unfocus() end
+                if prev_f ~= nil then prev_f.focus() end
+            else
+                if cur_f ~= nil then cur_f.unfocus() end
+                first_f.focus()
+            end
+        end
+    end
+
     -------------------------
     -- PROTECTED FUNCTIONS --
     -------------------------
@@ -109,6 +199,13 @@ function element.new(args, child_offset_x, child_offset_y)
     ---@param offset_y integer y offset for mouse events
     ---@param next_y integer next line if no y was provided
     function protected.prepare_template(offset_x, offset_y, next_y)
+        -- don't auto incrememnt y if inheriting height, that would cause an assertion
+        next_y = util.trinary(args.height == nil and constraint == nil, 1, next_y)
+
+        -- record offsets in case there is a reposition
+        self.offset_x = offset_x
+        self.offset_y = offset_y
+
         -- get frame coordinates/size
         if args.gframe ~= nil then
             protected.frame.x = args.gframe.x
@@ -130,24 +227,44 @@ function element.new(args, child_offset_x, child_offset_y)
             local w, h = self.p_window.getSize()
             f.w = math.min(f.w, w - (f.x - 1))
             f.h = math.min(f.h, h - (f.y - 1))
+
+            if type(constraint) == "function" then
+                -- constrain per provided constraint function (can only get smaller than available space)
+                w, h = constraint(f)
+                f.w = math.min(f.w, w)
+                f.h = math.min(f.h, h)
+            end
         end
 
         -- check frame
-        assert(f.x >= 1, name_brief .. "frame x not >= 1")
-        assert(f.y >= 1, name_brief .. "frame y not >= 1")
-        assert(f.w >= 1, name_brief .. "frame width not >= 1")
-        assert(f.h >= 1, name_brief .. "frame height not >= 1")
+        element.assert(f.x >= 1, "frame x not >= 1", 3)
+        element.assert(f.y >= 1, "frame y not >= 1", 3)
+        element.assert(f.w >= 1, "frame width not >= 1", 3)
+        element.assert(f.h >= 1, "frame height not >= 1", 3)
 
         -- create window
         protected.window = window.create(self.p_window, f.x, f.y, f.w, f.h, args.hidden ~= true)
 
         -- init colors
         if args.fg_bg ~= nil then
-            protected.fg_bg = args.fg_bg
-        elseif args.parent ~= nil then
-            protected.fg_bg = args.parent.get_fg_bg()
+            protected.fg_bg = core.cpair(args.fg_bg.fgd, args.fg_bg.bkg)
         end
 
+        if args.parent ~= nil then
+            local p_fg_bg = args.parent.get_fg_bg()
+
+            if args.fg_bg == nil then
+                protected.fg_bg = core.cpair(p_fg_bg.fgd, p_fg_bg.bkg)
+            else
+                if protected.fg_bg.fgd == colors._INHERIT then protected.fg_bg = core.cpair(p_fg_bg.fgd, protected.fg_bg.bkg) end
+                if protected.fg_bg.bkg == colors._INHERIT then protected.fg_bg = core.cpair(protected.fg_bg.fgd, p_fg_bg.bkg) end
+            end
+        end
+
+        -- check colors
+        element.assert(protected.fg_bg.fgd ~= colors._INHERIT, "could not determine foreground color to inherit")
+        element.assert(protected.fg_bg.bkg ~= colors._INHERIT, "could not determine background color to inherit")
+
         -- set colors
         protected.window.setBackgroundColor(protected.fg_bg.bkg)
         protected.window.setTextColor(protected.fg_bg.fgd)
@@ -165,6 +282,31 @@ function element.new(args, child_offset_x, child_offset_y)
         self.bounds.x2 = self.position.x + f.w - 1
         self.bounds.y1 = self.position.y
         self.bounds.y2 = self.position.y + f.h - 1
+
+        -- alias functions
+
+        -- window set cursor position
+        ---@param x integer
+        ---@param y integer
+        function protected.w_set_cur(x, y) protected.window.setCursorPos(x, y) end
+
+        -- set background color
+        ---@param c color
+        function protected.w_set_bkg(c) protected.window.setBackgroundColor(c) end
+
+        -- set foreground (text) color
+        ---@param c color
+        function protected.w_set_fgd(c) protected.window.setTextColor(c) end
+
+        -- write text
+        ---@param str string
+        function protected.w_write(str) protected.window.write(str) end
+
+        -- blit text
+        ---@param str string
+        ---@param fg string
+        ---@param bg string
+        function protected.w_blit(str, fg, bg) protected.window.blit(str, fg, bg) end
     end
 
     -- check if a coordinate relative to the parent is within the bounds of this element
@@ -185,85 +327,6 @@ function element.new(args, child_offset_x, child_offset_y)
         return in_x and in_y
     end
 
--- luacheck: push ignore
----@diagnostic disable: unused-local, unused-vararg
-
-    -- handle a child element having been added
-    ---@param id element_id element identifier
-    ---@param child graphics_element child element
-    function protected.on_added(id, child)
-    end
-
-    -- handle a child element having been removed
-    ---@param id element_id element identifier
-    function protected.on_removed(id)
-    end
-
-    -- handle a mouse event
-    ---@param event mouse_interaction mouse interaction event
-    function protected.handle_mouse(event)
-    end
-
-    -- handle data value changes
-    ---@vararg any value(s)
-    function protected.on_update(...)
-    end
-
-    -- callback on control press responses
-    ---@param result any
-    function protected.response_callback(result)
-    end
-
-    -- get value
-    ---@nodiscard
-    function protected.get_value()
-        return protected.value
-    end
-
-    -- set value
-    ---@param value any value to set
-    function protected.set_value(value)
-    end
-
-    -- set minimum input value
-    ---@param min integer minimum allowed value
-    function protected.set_min(min)
-    end
-
-    -- set maximum input value
-    ---@param max integer maximum allowed value
-    function protected.set_max(max)
-    end
-
-    -- enable the control
-    function protected.enable()
-    end
-
-    -- disable the control
-    function protected.disable()
-    end
-
-    -- custom recolor command, varies by element if implemented
-    ---@vararg cpair|color color(s)
-    function protected.recolor(...)
-    end
-
-    -- custom resize command, varies by element if implemented
-    ---@vararg integer sizing
-    function protected.resize(...)
-    end
-
--- luacheck: pop
----@diagnostic enable: unused-local, unused-vararg
-
-    -- start animations
-    function protected.start_anim()
-    end
-
-    -- stop animations
-    function protected.stop_anim()
-    end
-
     -- get public interface
     ---@nodiscard
     ---@return graphics_element element, element_id id
@@ -277,6 +340,111 @@ function element.new(args, child_offset_x, child_offset_y)
         return public, self.id
     end
 
+    -- protected version of public is_focused()
+    ---@nodiscard
+    ---@return boolean is_focused
+    function protected.is_focused() return self.focused end
+
+    -- defocus this element
+    function protected.defocus() public.unfocus_all() end
+
+    -- focus this element and take away focus from all other elements
+    function protected.take_focus() args.parent.__focus_child(public) end
+
+    -- action handlers --
+
+-- luacheck: push ignore
+---@diagnostic disable: unused-local, unused-vararg
+
+    -- handle a child element having been added
+    ---@param id element_id element identifier
+    ---@param child graphics_element child element
+    function protected.on_added(id, child) end
+
+    -- handle a child element having been removed
+    ---@param id element_id element identifier
+    function protected.on_removed(id) end
+
+    -- handle enabled
+    function protected.on_enabled() end
+
+    -- handle disabled
+    function protected.on_disabled() end
+
+    -- handle this element having been focused
+    function protected.on_focused() end
+
+    -- handle this element having been unfocused
+    function protected.on_unfocused() end
+
+    -- handle this element having had a child focused
+    ---@param child graphics_element
+    function protected.on_child_focused(child) end
+
+    -- handle this element having been shown
+    function protected.on_shown() end
+
+    -- handle this element having been hidden
+    function protected.on_hidden() end
+
+    -- handle a mouse event
+    ---@param event mouse_interaction mouse interaction event
+    function protected.handle_mouse(event) end
+
+    -- handle a keyboard event
+    ---@param event key_interaction key interaction event
+    function protected.handle_key(event) end
+
+    -- handle a paste event
+    ---@param text string pasted text
+    function protected.handle_paste(text) end
+
+    -- handle data value changes
+    ---@vararg any value(s)
+    function protected.on_update(...) end
+
+    -- callback on control press responses
+    ---@param result any
+    function protected.response_callback(result) end
+
+    -- accessors and control --
+
+    -- get value
+    ---@nodiscard
+    function protected.get_value() return protected.value end
+
+    -- set value
+    ---@param value any value to set
+    function protected.set_value(value) end
+
+    -- set minimum input value
+    ---@param min integer minimum allowed value
+    function protected.set_min(min) end
+
+    -- set maximum input value
+    ---@param max integer maximum allowed value
+    function protected.set_max(max) end
+
+    -- custom recolor command, varies by element if implemented
+    ---@vararg cpair|color color(s)
+    function protected.recolor(...) end
+
+    -- custom resize command, varies by element if implemented
+    ---@vararg integer sizing
+    function protected.resize(...) end
+
+-- luacheck: pop
+---@diagnostic enable: unused-local, unused-vararg
+
+    -- re-draw this element
+    function protected.redraw() end
+
+    -- start animations
+    function protected.start_anim() end
+
+    -- stop animations
+    function protected.stop_anim() end
+
     -----------
     -- SETUP --
     -----------
@@ -288,7 +456,7 @@ function element.new(args, child_offset_x, child_offset_y)
     end
 
     -- check window
-    assert(self.p_window, name_brief .. "no parent window provided")
+    element.assert(self.p_window, "no parent window provided", 1)
 
     -- prepare the template
     if args.parent == nil then
@@ -329,7 +497,7 @@ function element.new(args, child_offset_x, child_offset_y)
 
         -- delete all children
         for k, v in pairs(protected.children) do
-            v.delete()
+            v.get().delete()
             protected.children[k] = nil
         end
 
@@ -351,65 +519,94 @@ function element.new(args, child_offset_x, child_offset_y)
 
         self.next_y = child.frame.y + child.frame.h
 
-        local child_element = child.get()
-
         local id = key  ---@type string|integer|nil
         if id == nil then
             id = self.next_id
             self.next_id = self.next_id + 1
         end
 
-        protected.children[id] = child_element
+        table.insert(protected.children, child)
+
+        protected.child_id_map[id] = #protected.children
+
         return id
     end
 
     -- remove a child element
-    ---@param key element_id id
-    function public.__remove_child(key)
-        if protected.children[key] ~= nil then
-            protected.on_removed(key)
-            protected.children[key] = nil
+    ---@param id element_id id
+    function public.__remove_child(id)
+        local index = protected.child_id_map[id]
+        if protected.children[index] ~= nil then
+            protected.on_removed(id)
+            protected.children[index] = nil
+            protected.child_id_map[id] = nil
         end
     end
 
     -- actions to take upon a child element becoming ready (initial draw/construction completed)
     ---@param key element_id id
     ---@param child graphics_element
-    function public.__child_ready(key, child)
-        protected.on_added(key, child)
+    function public.__child_ready(key, child) protected.on_added(key, child) end
+
+    -- focus solely on this child
+    ---@param child graphics_element
+    function public.__focus_child(child)
+        if self.is_root then
+            public.unfocus_all()
+            child.focus()
+        else args.parent.__focus_child(child) end
+    end
+
+    -- a child was focused, used to make sure it is actually visible to the user in the content frame
+    ---@param child graphics_element
+    function public.__child_focused(child)
+        protected.on_child_focused(child)
+        if not self.is_root then args.parent.__child_focused(public) end
     end
 
     -- get a child element
     ---@nodiscard
     ---@param id element_id
     ---@return graphics_element
-    function public.get_child(id) return protected.children[id] end
+    function public.get_child(id) return protected.children[protected.child_id_map[id]].get() end
 
     -- remove a child element
     ---@param id element_id
     function public.remove(id)
-        if protected.children[id] ~= nil then
-            protected.children[id].delete()
+        local index = protected.child_id_map[id]
+        if protected.children[index] ~= nil then
+            protected.children[index].get().delete()
             protected.on_removed(id)
-            protected.children[id] = nil
+            protected.children[index] = nil
+            protected.child_id_map[id] = nil
         end
     end
 
+    -- remove all child elements and reset next y
+    function public.remove_all()
+        for i = 1, #protected.children do
+            local child = protected.children[i].get()   ---@type graphics_element
+            child.delete()
+            protected.on_removed(child.get_id())
+        end
+
+        self.next_y = 1
+        protected.children = {}
+        protected.child_id_map = {}
+    end
+
     -- attempt to get a child element by ID (does not include this element itself)
     ---@nodiscard
     ---@param id element_id
     ---@return graphics_element|nil element
     function public.get_element_by_id(id)
-        if protected.children[id] == nil then
+        local index = protected.child_id_map[id]
+        if protected.children[index] == nil then
             for _, child in pairs(protected.children) do
-                local elem = child.get_element_by_id(id)
+                local elem = child.get().get_element_by_id(id)
                 if elem ~= nil then return elem end
             end
-        else
-            return protected.children[id]
-        end
-
-        return nil
+        else return protected.children[index].get() end
     end
 
     -- AUTO-PLACEMENT --
@@ -421,89 +618,109 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- PROPERTIES --
 
-    -- get the foreground/background colors
+    -- get element id
     ---@nodiscard
-    ---@return cpair fg_bg
-    function public.get_fg_bg()
-        return protected.fg_bg
-    end
+    ---@return element_id
+    function public.get_id() return self.id end
 
     -- get element x
     ---@nodiscard
     ---@return integer x
-    function public.get_x()
-        return protected.frame.x
-    end
+    function public.get_x() return protected.frame.x end
 
     -- get element y
     ---@nodiscard
     ---@return integer y
-    function public.get_y()
-        return protected.frame.y
-    end
+    function public.get_y() return protected.frame.y end
 
     -- get element width
     ---@nodiscard
     ---@return integer width
-    function public.get_width()
-        return protected.frame.w
-    end
+    function public.get_width() return protected.frame.w end
 
     -- get element height
     ---@nodiscard
     ---@return integer height
-    function public.get_height()
-        return protected.frame.h
-    end
+    function public.get_height() return protected.frame.h end
+
+    -- get the foreground/background colors
+    ---@nodiscard
+    ---@return cpair fg_bg
+    function public.get_fg_bg() return protected.fg_bg end
 
     -- get the element value
     ---@nodiscard
     ---@return any value
-    function public.get_value()
-        return protected.get_value()
-    end
+    function public.get_value() return protected.get_value() end
 
     -- set the element value
     ---@param value any new value
-    function public.set_value(value)
-        protected.set_value(value)
-    end
+    function public.set_value(value) protected.set_value(value) end
 
     -- set minimum input value
     ---@param min integer minimum allowed value
-    function public.set_min(min)
-        protected.set_min(min)
-    end
+    function public.set_min(min) protected.set_min(min) end
 
     -- set maximum input value
     ---@param max integer maximum allowed value
-    function public.set_max(max)
-        protected.set_max(max)
-    end
+    function public.set_max(max) protected.set_max(max) end
+
+    -- check if this element is enabled
+    function public.is_enabled() return protected.enabled end
 
     -- enable the element
     function public.enable()
-        protected.enabled = true
-        protected.enable()
+        if not protected.enabled then
+            protected.enabled = true
+            protected.on_enabled()
+        end
     end
 
     -- disable the element
     function public.disable()
-        protected.enabled = false
-        protected.disable()
+        if protected.enabled then
+            protected.enabled = false
+            protected.on_disabled()
+            public.unfocus_all()
+        end
+    end
+
+    -- can this element be focused
+    function public.is_focusable() return args.can_focus end
+
+    -- is this element focused
+    function public.is_focused() return self.focused end
+
+    -- focus the element
+    function public.focus()
+        if args.can_focus and protected.enabled and not self.focused then
+            self.focused = true
+            protected.on_focused()
+            if not self.is_root then args.parent.__child_focused(public) end
+        end
+    end
+
+    -- unfocus this element
+    function public.unfocus()
+        if args.can_focus and self.focused then
+            self.focused = false
+            protected.on_unfocused()
+        end
+    end
+
+    -- unfocus this element and all its children
+    function public.unfocus_all()
+        public.unfocus()
+        for _, child in pairs(protected.children) do child.get().unfocus_all() end
     end
 
     -- custom recolor command, varies by element if implemented
     ---@vararg cpair|color color(s)
-    function public.recolor(...)
-        protected.recolor(...)
-    end
+    function public.recolor(...) protected.recolor(...) end
 
     -- resize attributes of the element value if supported
     ---@vararg number dimensions (element specific)
-    function public.resize(...)
-        protected.resize(...)
-    end
+    function public.resize(...) protected.resize(...) end
 
     -- reposition the element window<br>
     -- offsets relative to parent frame are where (1, 1) would be on top of the parent's top left corner
@@ -511,37 +728,89 @@ function element.new(args, child_offset_x, child_offset_y)
     ---@param y integer y position relative to parent frame
     function public.reposition(x, y)
         protected.window.reposition(x, y)
+
+        -- record position
+        self.position.x, self.position.y = protected.window.getPosition()
+
+        -- shift per parent child offset
+        self.position.x = self.position.x + self.offset_x
+        self.position.y = self.position.y + self.offset_y
+
+        -- calculate mouse event bounds
+        self.bounds.x1 = self.position.x
+        self.bounds.x2 = self.position.x + protected.frame.w - 1
+        self.bounds.y1 = self.position.y
+        self.bounds.y2 = self.position.y + protected.frame.h - 1
     end
 
     -- FUNCTION CALLBACKS --
 
-    -- handle a monitor touch or mouse click
+    -- handle a monitor touch or mouse click if this element is visible
     ---@param event mouse_interaction mouse interaction event
     function public.handle_mouse(event)
-        local x_ini, y_ini = event.initial.x, event.initial.y
+        if protected.window.isVisible() then
+            local x_ini, y_ini = event.initial.x, event.initial.y
 
-        local ini_in = protected.in_window_bounds(x_ini, y_ini)
+            local ini_in = protected.in_window_bounds(x_ini, y_ini)
 
-        if ini_in then
-            local event_T = core.events.mouse_transposed(event, self.position.x, self.position.y)
+            if ini_in then
+                if event.type == events.MOUSE_CLICK.UP or event.type == events.MOUSE_CLICK.DRAG then
+                    -- make sure we don't handle mouse events that started before this element was made visible
+                    if (event.initial.x ~= self.button_down[event.button].x) or (event.initial.y ~= self.button_down[event.button].y) then
+                        return
+                    end
+                elseif event.type == events.MOUSE_CLICK.DOWN then
+                    self.button_down[event.button] = event.initial
+                end
 
-            -- handle the mouse event then pass to children
-            protected.handle_mouse(event_T)
-            for _, child in pairs(protected.children) do child.handle_mouse(event_T) end
+                local event_T = events.mouse_transposed(event, self.position.x, self.position.y)
+                protected.handle_mouse(event_T)
+
+                -- shift child event if the content window has moved then pass to children
+                local c_event_T = events.mouse_transposed(event_T, protected.mouse_window_shift.x + 1, protected.mouse_window_shift.y + 1)
+                for _, child in pairs(protected.children) do child.get().handle_mouse(c_event_T) end
+            elseif event.type == events.MOUSE_CLICK.DOWN or event.type == events.MOUSE_CLICK.TAP then
+                -- clicked out, unfocus this element and children
+                public.unfocus_all()
+            end
+        else
+            -- don't track clicks while hidden
+            self.button_down[event.button] = events.new_coord_2d(-1, -1)
+        end
+    end
+
+    -- handle a keyboard click if this element is visible and focused
+    ---@param event key_interaction keyboard interaction event
+    function public.handle_key(event)
+        if protected.window.isVisible() then
+            if self.is_root and (event.type == events.KEY_CLICK.DOWN) and (event.key == keys.tab) then
+                -- try to jump to the next/previous focusable field
+                _tab_focusable(event.shift)
+            else
+                -- handle the key event then pass to children
+                if self.focused then protected.handle_key(event) end
+                for _, child in pairs(protected.children) do child.get().handle_key(event) end
+            end
+        end
+    end
+
+    -- handle text paste
+    ---@param text string pasted text
+    function public.handle_paste(text)
+        if protected.window.isVisible() then
+            -- handle the paste event then pass to children
+            if self.focused then protected.handle_paste(text) end
+            for _, child in pairs(protected.children) do child.get().handle_paste(text) end
         end
     end
 
     -- draw the element given new data
     ---@vararg any new data
-    function public.update(...)
-        protected.on_update(...)
-    end
+    function public.update(...) protected.on_update(...) end
 
     -- on a control request response
     ---@param result any
-    function public.on_response(result)
-        protected.response_callback(result)
-    end
+    function public.on_response(result) protected.response_callback(result) end
 
     -- register a callback with a PSIL, allowing for automatic unregister on delete<br>
     -- do not use graphics elements directly with PSIL subscribe()
@@ -555,6 +824,9 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- VISIBILITY & ANIMATIONS --
 
+    -- check if this element is visible
+    function public.is_visible() return protected.window.isVisible() end
+
     -- show the element and enables animations by default
     ---@param animate? boolean true (default) to automatically resume animations
     function public.show(animate)
@@ -564,47 +836,54 @@ function element.new(args, child_offset_x, child_offset_y)
 
     -- hide the element and disables animations<br>
     -- this alone does not cause an element to be fully hidden, it only prevents updates from being shown<br>
+    ---@see graphics_element.redraw
     ---@see graphics_element.content_redraw
-    function public.hide()
+    ---@param clear? boolean true to visibly hide this element (redraws the parent)
+    function public.hide(clear)
         public.freeze_all() -- stop animations for efficiency/performance
+        public.unfocus_all()
         protected.window.setVisible(false)
+        if clear and args.parent then args.parent.redraw() end
     end
 
     -- start/resume animation(s)
-    function public.animate()
-        protected.start_anim()
-    end
+    function public.animate() protected.start_anim() end
 
     -- start/resume animation(s) for this element and all its children<br>
     -- only animates if a window is visible
     function public.animate_all()
         if protected.window.isVisible() then
             public.animate()
-            for _, child in pairs(protected.children) do child.animate_all() end
+            for _, child in pairs(protected.children) do child.get().animate_all() end
         end
     end
 
     -- freeze animation(s)
-    function public.freeze()
-        protected.stop_anim()
-    end
+    function public.freeze() protected.stop_anim() end
 
     -- freeze animation(s) for this element and all its children
     function public.freeze_all()
         public.freeze()
-        for _, child in pairs(protected.children) do child.freeze_all() end
+        for _, child in pairs(protected.children) do child.get().freeze_all() end
     end
 
-    -- re-draw the element
+    -- re-draw this element and all its children
     function public.redraw()
-        protected.window.redraw()
+        local bg, fg = protected.window.getBackgroundColor(), protected.window.getTextColor()
+        protected.window.setBackgroundColor(protected.fg_bg.bkg)
+        protected.window.setTextColor(protected.fg_bg.fgd)
+        protected.window.clear()
+        protected.window.setBackgroundColor(bg)
+        protected.window.setTextColor(fg)
+        protected.redraw()
+        for _, child in pairs(protected.children) do child.get().redraw() end
     end
 
     -- if a content window is set, clears it then re-draws all children
     function public.content_redraw()
         if protected.content_window ~= nil then
             protected.content_window.clear()
-            for _, child in pairs(protected.children) do child.redraw() end
+            for _, child in pairs(protected.children) do child.get().redraw() end
         end
     end
 

graphics/elements/animations/waiting.lua

@@ -36,49 +36,49 @@ local function waiting(args)
 
         if state >= 0 and state < 7 then
             -- top
-            e.window.setCursorPos(1 + math.floor(state / 2), 1)
+            e.w_set_cur(1 + math.floor(state / 2), 1)
             if state % 2 == 0 then
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_blit("\x8f", blit_fg, blit_bg)
             else
-                e.window.blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
+                e.w_blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
             end
 
             -- bottom
-            e.window.setCursorPos(4 - math.ceil(state / 2), 3)
+            e.w_set_cur(4 - math.ceil(state / 2), 3)
             if state % 2 == 0 then
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_blit("\x8f", blit_fg, blit_bg)
             else
-                e.window.blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
+                e.w_blit("\x8a\x85", blit_fg_2x, blit_bg_2x)
             end
         else
             local st = state - 7
 
             -- right
             if st % 3 == 0 then
-                e.window.setCursorPos(4, 1 + math.floor(st / 3))
-                e.window.blit("\x83", blit_bg, blit_fg)
+                e.w_set_cur(4, 1 + math.floor(st / 3))
+                e.w_blit("\x83", blit_bg, blit_fg)
             elseif st % 3 == 1 then
-                e.window.setCursorPos(4, 1 + math.floor(st / 3))
-                e.window.blit("\x8f", blit_bg, blit_fg)
-                e.window.setCursorPos(4, 2 + math.floor(st / 3))
-                e.window.blit("\x83", blit_fg, blit_bg)
+                e.w_set_cur(4, 1 + math.floor(st / 3))
+                e.w_blit("\x8f", blit_bg, blit_fg)
+                e.w_set_cur(4, 2 + math.floor(st / 3))
+                e.w_blit("\x83", blit_fg, blit_bg)
             else
-                e.window.setCursorPos(4, 2 + math.floor(st / 3))
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_set_cur(4, 2 + math.floor(st / 3))
+                e.w_blit("\x8f", blit_fg, blit_bg)
             end
 
             -- left
             if st % 3 == 0 then
-                e.window.setCursorPos(1, 3 - math.floor(st / 3))
-                e.window.blit("\x83", blit_fg, blit_bg)
-                e.window.setCursorPos(1, 2 - math.floor(st / 3))
-                e.window.blit("\x8f", blit_bg, blit_fg)
+                e.w_set_cur(1, 3 - math.floor(st / 3))
+                e.w_blit("\x83", blit_fg, blit_bg)
+                e.w_set_cur(1, 2 - math.floor(st / 3))
+                e.w_blit("\x8f", blit_bg, blit_fg)
             elseif st % 3 == 1 then
-                e.window.setCursorPos(1, 2 - math.floor(st / 3))
-                e.window.blit("\x83", blit_bg, blit_fg)
+                e.w_set_cur(1, 2 - math.floor(st / 3))
+                e.w_blit("\x83", blit_bg, blit_fg)
             else
-                e.window.setCursorPos(1, 2 - math.floor(st / 3))
-                e.window.blit("\x8f", blit_fg, blit_bg)
+                e.w_set_cur(1, 2 - math.floor(st / 3))
+                e.w_blit("\x8f", blit_fg, blit_bg)
             end
         end
 

graphics/elements/appmultipane.lua

@@ -0,0 +1,109 @@
+-- App Page Multi-Pane Display Graphics Element
+
+local util    = require("scada-common.util")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+local events  = require("graphics.events")
+
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class app_multipane_args
+---@field panes table panes to swap between
+---@field nav_colors cpair on/off colors (a/b respectively) for page navigator
+---@field scroll_nav boolean? true to allow scrolling to change the active pane
+---@field drag_nav boolean? true to allow mouse dragging to change the active pane (on mouse up)
+---@field callback function? function to call when pane is changed by mouse interaction
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field width? integer parent width if omitted
+---@field height? integer parent height if omitted
+---@field gframe? graphics_frame frame instead of x/y/width/height
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new app multipane element
+---@nodiscard
+---@param args app_multipane_args
+---@return graphics_element element, element_id id
+local function multipane(args)
+    element.assert(type(args.panes) == "table", "panes is a required field")
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    e.value = 1
+
+    local nav_x_start = math.floor((e.frame.w / 2) - (#args.panes / 2)) + 1
+    local nav_x_end   = math.floor((e.frame.w / 2) - (#args.panes / 2)) + #args.panes
+
+    -- show the selected pane
+    function e.redraw()
+        for i = 1, #args.panes do args.panes[i].hide() end
+        args.panes[e.value].show()
+
+        -- draw page indicator dots
+        for i = 1, #args.panes do
+            e.w_set_cur(nav_x_start + (i - 1), e.frame.h)
+            e.w_set_fgd(util.trinary(i == e.value, args.nav_colors.color_a, args.nav_colors.color_b))
+            e.w_write("\x07")
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        local initial = e.value
+
+        if e.enabled then
+            if event.current.y == e.frame.h and event.current.x >= nav_x_start and event.current.x <= nav_x_end then
+                local id = event.current.x - nav_x_start + 1
+
+                if event.type == MOUSE_CLICK.TAP then
+                    e.set_value(id)
+                elseif event.type == MOUSE_CLICK.UP then
+                    e.set_value(id)
+                end
+            end
+        end
+
+        if args.scroll_nav then
+            if event.type == events.MOUSE_CLICK.SCROLL_DOWN then
+                e.set_value(e.value + 1)
+            elseif event.type == events.MOUSE_CLICK.SCROLL_UP then
+                e.set_value(e.value - 1)
+            end
+        end
+
+        if args.drag_nav then
+            local x1, x2 = event.initial.x, event.current.x
+            if event.type == events.MOUSE_CLICK.UP and e.in_frame_bounds(x1, event.initial.y) and e.in_frame_bounds(x1, event.current.y) then
+                if x2 > x1 then
+                    e.set_value(e.value - 1)
+                elseif x2 < x1 then
+                    e.set_value(e.value + 1)
+                end
+            end
+        end
+
+        if e.value ~= initial and type(args.callback) == "function" then args.callback(e.value) end
+    end
+
+    -- select which pane is shown
+    ---@param value integer pane to show
+    function e.set_value(value)
+        if (e.value ~= value) and (value > 0) and (value <= #args.panes) then
+            e.value = value
+            e.redraw()
+        end
+    end
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return multipane

graphics/elements/colormap.lua

@@ -1,7 +1,5 @@
 -- Color Map Graphics Element
 
-local util    = require("scada-common.util")
-
 local element = require("graphics.element")
 
 ---@class colormap_args
@@ -16,7 +14,7 @@ local element = require("graphics.element")
 ---@return graphics_element element, element_id id
 local function colormap(args)
     local bkg = "008877FFCCEE114455DD9933BBAA2266"
-    local spaces = util.spaces(32)
+    local spaces = string.rep(" ", 32)
 
     args.width = 32
     args.height = 1
@@ -25,8 +23,13 @@ local function colormap(args)
     local e = element.new(args)
 
     -- draw color map
-    e.window.setCursorPos(1, 1)
-    e.window.blit(spaces, bkg, bkg)
+    function e.redraw()
+        e.w_set_cur(1, 1)
+        e.w_blit(spaces, bkg, bkg)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/app.lua

@@ -0,0 +1,132 @@
+-- App Button Graphics Element
+
+local tcd     = require("scada-common.tcd")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class app_button_args
+---@field text string app icon text
+---@field title string app title text
+---@field callback function function to call on touch
+---@field app_fg_bg cpair app icon foreground/background colors
+---@field active_fg_bg? cpair foreground/background colors when pressed
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new app button
+---@param args app_button_args
+---@return graphics_element element, element_id id
+local function app_button(args)
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.title) == "string", "title is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.app_fg_bg) == "table", "app_fg_bg is a required field")
+
+    args.height = 4
+    args.width = 7
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- draw the app button
+    local function draw()
+        local fgd = args.app_fg_bg.fgd
+        local bkg = args.app_fg_bg.bkg
+
+        if e.value then
+            fgd = args.active_fg_bg.fgd
+            bkg = args.active_fg_bg.bkg
+        end
+
+        -- draw icon
+        e.w_set_cur(2, 1)
+        e.w_set_fgd(fgd)
+        e.w_set_bkg(bkg)
+        e.w_write("\x9f\x83\x83\x83")
+        e.w_set_fgd(bkg)
+        e.w_set_bkg(fgd)
+        e.w_write("\x90")
+        e.w_set_fgd(fgd)
+        e.w_set_bkg(bkg)
+        e.w_set_cur(2, 2)
+        e.w_write("\x95   ")
+        e.w_set_fgd(bkg)
+        e.w_set_bkg(fgd)
+        e.w_write("\x95")
+        e.w_set_cur(2, 3)
+        e.w_write("\x82\x8f\x8f\x8f\x81")
+
+        -- write the icon text
+        e.w_set_cur(4, 2)
+        e.w_set_fgd(fgd)
+        e.w_set_bkg(bkg)
+        e.w_write(args.text)
+    end
+
+    -- draw the app button as pressed (if active_fg_bg set)
+    local function show_pressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = true
+            e.w_set_fgd(args.active_fg_bg.fgd)
+            e.w_set_bkg(args.active_fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- draw the app button as unpressed (if active_fg_bg set)
+    local function show_unpressed()
+        if e.enabled and args.active_fg_bg ~= nil then
+            e.value = false
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            draw()
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled then
+            if event.type == MOUSE_CLICK.TAP then
+                show_pressed()
+                -- show as unpressed in 0.25 seconds
+                if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
+                args.callback()
+            elseif event.type == MOUSE_CLICK.DOWN then
+                show_pressed()
+            elseif event.type == MOUSE_CLICK.UP then
+                show_unpressed()
+                if e.in_frame_bounds(event.current.x, event.current.y) then
+                    args.callback()
+                end
+            end
+        end
+    end
+
+    -- set the value (true simulates pressing the app button)
+    ---@param val boolean new value
+    function e.set_value(val)
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
+    end
+
+    -- element redraw
+    function e.redraw()
+        e.w_set_cur(math.floor((e.frame.w - string.len(args.title)) / 2) + 1, 4)
+        e.w_write(args.title)
+        draw()
+    end
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return app_button

graphics/elements/controls/checkbox.lua

@@ -6,7 +6,8 @@ local element = require("graphics.element")
 ---@class checkbox_args
 ---@field label string checkbox text
 ---@field box_fg_bg cpair colors for checkbox
----@field callback function function to call on press
+---@field default? boolean default value
+---@field callback? function function to call on press
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -18,48 +19,75 @@ local element = require("graphics.element")
 ---@param args checkbox_args
 ---@return graphics_element element, element_id id
 local function checkbox(args)
-    assert(type(args.label) == "string", "graphics.elements.controls.checkbox: label is a required field")
-    assert(type(args.box_fg_bg) == "table", "graphics.elements.controls.checkbox: box_fg_bg is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.checkbox: callback is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.box_fg_bg) == "table", "box_fg_bg is a required field")
 
+    args.can_focus = true
     args.height = 1
-    args.width = 3 + string.len(args.label)
+    args.width = 2 + string.len(args.label)
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    e.value = false
+    e.value = args.default == true
 
     -- show the button state
     local function draw()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if e.value then
             -- show as selected
-            e.window.setTextColor(args.box_fg_bg.bkg)
-            e.window.setBackgroundColor(args.box_fg_bg.fgd)
-            e.window.write("\x88")
-            e.window.setTextColor(args.box_fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write("\x95")
+            e.w_set_fgd(args.box_fg_bg.bkg)
+            e.w_set_bkg(args.box_fg_bg.fgd)
+            e.w_write("\x88")
+            e.w_set_fgd(args.box_fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write("\x95")
         else
             -- show as unselected
-            e.window.setTextColor(e.fg_bg.bkg)
-            e.window.setBackgroundColor(args.box_fg_bg.bkg)
-            e.window.write("\x88")
-            e.window.setTextColor(args.box_fg_bg.bkg)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write("\x95")
+            e.w_set_fgd(e.fg_bg.bkg)
+            e.w_set_bkg(args.box_fg_bg.bkg)
+            e.w_write("\x88")
+            e.w_set_fgd(args.box_fg_bg.bkg)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write("\x95")
+        end
+    end
+
+    -- write label text
+    local function draw_label()
+        if e.enabled and e.is_focused() then
+            e.w_set_cur(3, 1)
+            e.w_set_fgd(e.fg_bg.bkg)
+            e.w_set_bkg(e.fg_bg.fgd)
+            e.w_write(args.label)
+        else
+            e.w_set_cur(3, 1)
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write(args.label)
         end
     end
 
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled and core.events.was_clicked(event.type) then
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
             e.value = not e.value
             draw()
-            args.callback(e.value)
+            if type(args.callback) == "function" then args.callback(e.value) end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == core.events.KEY_CLICK.DOWN then
+            if event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter then
+                e.value = not e.value
+                draw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            end
         end
     end
 
@@ -70,14 +98,22 @@ local function checkbox(args)
         draw()
     end
 
-    -- write label text
-    e.window.setCursorPos(3, 1)
-    e.window.setTextColor(e.fg_bg.fgd)
-    e.window.setBackgroundColor(e.fg_bg.bkg)
-    e.window.write(args.label)
+    -- handle focus
+    e.on_focused = draw_label
+    e.on_unfocused = draw_label
+
+    -- handle enable
+    e.on_enabled = draw_label
+    e.on_disabled = draw_label
+
+    -- element redraw
+    function e.redraw()
+        draw()
+        draw_label()
+    end
 
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/hazard_button.lua

@@ -1,7 +1,6 @@
 -- Hazard-bordered Button Graphics Element
 
 local tcd     = require("scada-common.tcd")
-local util    = require("scada-common.util")
 
 local core    = require("graphics.core")
 local element = require("graphics.element")
@@ -22,47 +21,42 @@ local element = require("graphics.element")
 ---@param args hazard_button_args
 ---@return graphics_element element, element_id id
 local function hazard_button(args)
-    assert(type(args.text) == "string", "graphics.elements.controls.hazard_button: text is a required field")
-    assert(type(args.accent) == "number", "graphics.elements.controls.hazard_button: accent is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.hazard_button: callback is a required field")
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.accent) == "number", "accent is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
 
-    -- static dimensions
     args.height = 3
     args.width = string.len(args.text) + 4
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- write the button text
-    e.window.setCursorPos(3, 2)
-    e.window.write(args.text)
-
     -- draw border
     ---@param accent color accent color
     local function draw_border(accent)
         -- top
-        e.window.setTextColor(accent)
-        e.window.setBackgroundColor(args.fg_bg.bkg)
-        e.window.setCursorPos(1, 1)
-        e.window.write("\x99" .. util.strrep("\x89", args.width - 2) .. "\x99")
+        e.w_set_fgd(accent)
+        e.w_set_bkg(args.fg_bg.bkg)
+        e.w_set_cur(1, 1)
+        e.w_write("\x99" .. string.rep("\x89", args.width - 2) .. "\x99")
 
         -- center left
-        e.window.setCursorPos(1, 2)
-        e.window.setTextColor(args.fg_bg.bkg)
-        e.window.setBackgroundColor(accent)
-        e.window.write("\x99")
+        e.w_set_cur(1, 2)
+        e.w_set_fgd(args.fg_bg.bkg)
+        e.w_set_bkg(accent)
+        e.w_write("\x99")
 
         -- center right
-        e.window.setTextColor(args.fg_bg.bkg)
-        e.window.setBackgroundColor(accent)
-        e.window.setCursorPos(args.width, 2)
-        e.window.write("\x99")
+        e.w_set_fgd(args.fg_bg.bkg)
+        e.w_set_bkg(accent)
+        e.w_set_cur(args.width, 2)
+        e.w_write("\x99")
 
         -- bottom
-        e.window.setTextColor(accent)
-        e.window.setBackgroundColor(args.fg_bg.bkg)
-        e.window.setCursorPos(1, 3)
-        e.window.write("\x99" .. util.strrep("\x98", args.width - 2) .. "\x99")
+        e.w_set_fgd(accent)
+        e.w_set_bkg(args.fg_bg.bkg)
+        e.w_set_cur(1, 3)
+        e.w_write("\x99" .. string.rep("\x98", args.width - 2) .. "\x99")
     end
 
     -- on request timeout: recursively calls itself to double flash button text
@@ -73,9 +67,9 @@ local function hazard_button(args)
 
         if n == 0 then
             -- go back off
-            e.window.setTextColor(args.fg_bg.fgd)
-            e.window.setCursorPos(3, 2)
-            e.window.write(args.text)
+            e.w_set_fgd(args.fg_bg.fgd)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
         end
 
         if n >= 4 then
@@ -83,18 +77,18 @@ local function hazard_button(args)
         elseif n % 2 == 0 then
             -- toggle text color on after 0.25 seconds
             tcd.dispatch(0.25, function ()
-                e.window.setTextColor(args.accent)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.accent)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_timeout(n + 1)
                 on_timeout(n + 1)
             end)
         elseif n % 1 then
             -- toggle text color off after 0.25 seconds
             tcd.dispatch(0.25, function ()
-                e.window.setTextColor(args.fg_bg.fgd)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.fg_bg.fgd)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_timeout(n + 1)
             end)
         end
@@ -102,9 +96,9 @@ local function hazard_button(args)
 
     -- blink routine for success indication
     local function on_success()
-        e.window.setTextColor(args.fg_bg.fgd)
-        e.window.setCursorPos(3, 2)
-        e.window.write(args.text)
+        e.w_set_fgd(args.fg_bg.fgd)
+        e.w_set_cur(3, 2)
+        e.w_write(args.text)
     end
 
     -- blink routine for failure indication
@@ -115,9 +109,9 @@ local function hazard_button(args)
 
         if n == 0 then
             -- go back off
-            e.window.setTextColor(args.fg_bg.fgd)
-            e.window.setCursorPos(3, 2)
-            e.window.write(args.text)
+            e.w_set_fgd(args.fg_bg.fgd)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
         end
 
         if n >= 2 then
@@ -125,17 +119,17 @@ local function hazard_button(args)
         elseif n % 2 == 0 then
             -- toggle text color on after 0.5 seconds
             tcd.dispatch(0.5, function ()
-                e.window.setTextColor(args.accent)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.accent)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_failure(n + 1)
             end)
         elseif n % 1 then
             -- toggle text color off after 0.25 seconds
             tcd.dispatch(0.25, function ()
-                e.window.setTextColor(args.fg_bg.fgd)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+                e.w_set_fgd(args.fg_bg.fgd)
+                e.w_set_cur(3, 2)
+                e.w_write(args.text)
                 on_failure(n + 1)
             end)
         end
@@ -144,24 +138,21 @@ local function hazard_button(args)
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled then
-            if core.events.was_clicked(event.type) then
-                -- change text color to indicate clicked
-                e.window.setTextColor(args.accent)
-                e.window.setCursorPos(3, 2)
-                e.window.write(args.text)
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
+            -- change text color to indicate clicked
+            e.w_set_fgd(args.accent)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
 
-                -- abort any other callbacks
-                tcd.abort(on_timeout)
-                tcd.abort(on_success)
-                tcd.abort(on_failure)
+            -- abort any other callbacks
+            tcd.abort(on_timeout)
+            tcd.abort(on_success)
+            tcd.abort(on_failure)
 
-                -- 1.5 second timeout
-                tcd.dispatch(1.5, on_timeout)
+            -- 1.5 second timeout
+            tcd.dispatch(1.5, on_timeout)
 
-                -- call the touch callback
-                args.callback()
-            end
+            args.callback()
         end
     end
 
@@ -175,29 +166,37 @@ local function hazard_button(args)
     -- set the value (true simulates pressing the button)
     ---@param val boolean new value
     function e.set_value(val)
-        if val then e.handle_mouse(core.events.mouse_generic(core.events.CLICK_TYPE.UP, 1, 1)) end
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
     end
 
     -- show the button as disabled
-    function e.disable()
+    function e.on_disabled()
         if args.dis_colors then
             draw_border(args.dis_colors.color_a)
-            e.window.setTextColor(args.dis_colors.color_b)
-            e.window.setCursorPos(3, 2)
-            e.window.write(args.text)
+            e.w_set_fgd(args.dis_colors.color_b)
+            e.w_set_cur(3, 2)
+            e.w_write(args.text)
         end
     end
 
     -- show the button as enabled
-    function e.enable()
+    function e.on_enabled()
         draw_border(args.accent)
-        e.window.setTextColor(args.fg_bg.fgd)
-        e.window.setCursorPos(3, 2)
-        e.window.write(args.text)
+        e.w_set_fgd(args.fg_bg.fgd)
+        e.w_set_cur(3, 2)
+        e.w_write(args.text)
     end
 
-    -- initial draw of border
-    draw_border(args.accent)
+    -- element redraw
+    function e.redraw()
+        -- write the button text and draw border
+        e.w_set_cur(3, 2)
+        e.w_write(args.text)
+        draw_border(args.accent)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/multi_button.lua

@@ -29,13 +29,11 @@ local element = require("graphics.element")
 ---@param args multi_button_args
 ---@return graphics_element element, element_id id
 local function multi_button(args)
-    assert(type(args.options) == "table", "graphics.elements.controls.multi_button: options is a required field")
-    assert(#args.options > 0, "graphics.elements.controls.multi_button: at least one option is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.multi_button: callback is a required field")
-    assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0),
-        "graphics.elements.controls.multi_button: default must be nil or a number > 0")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.multi_button: min_width must be nil or a number > 0")
+    element.assert(type(args.options) == "table", "options is a required field")
+    element.assert(#args.options > 0, "at least one option is required")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     -- single line
     args.height = 1
@@ -71,23 +69,23 @@ local function multi_button(args)
     end
 
     -- show the button state
-    local function draw()
+    function e.redraw()
         for i = 1, #args.options do
             local opt = args.options[i] ---@type button_option
 
-            e.window.setCursorPos(opt._start_x, 1)
+            e.w_set_cur(opt._start_x, 1)
 
             if e.value == i then
                 -- show as pressed
-                e.window.setTextColor(opt.active_fg_bg.fgd)
-                e.window.setBackgroundColor(opt.active_fg_bg.bkg)
+                e.w_set_fgd(opt.active_fg_bg.fgd)
+                e.w_set_bkg(opt.active_fg_bg.bkg)
             else
                 -- show as unpressed
-                e.window.setTextColor(opt.fg_bg.fgd)
-                e.window.setBackgroundColor(opt.fg_bg.bkg)
+                e.w_set_fgd(opt.fg_bg.fgd)
+                e.w_set_bkg(opt.fg_bg.bkg)
             end
 
-            e.window.write(util.pad(opt.text, button_width))
+            e.w_write(util.pad(opt.text, button_width))
         end
     end
 
@@ -115,7 +113,7 @@ local function multi_button(args)
             -- tap always has identical coordinates, so this always passes for taps
             if button_ini == button_cur and button_cur ~= nil then
                 e.value = button_cur
-                draw()
+                e.redraw()
                 args.callback(e.value)
             end
         end
@@ -125,11 +123,11 @@ local function multi_button(args)
     ---@param val integer new value
     function e.set_value(val)
         e.value = val
-        draw()
+        e.redraw()
     end
 
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/push_button.lua

@@ -1,23 +1,27 @@
 -- Button Graphics Element
 
 local tcd     = require("scada-common.tcd")
+local util    = require("scada-common.util")
 
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local CLICK_TYPE = core.events.CLICK_TYPE
+local ALIGN = core.ALIGN
+
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+local KEY_CLICK = core.events.KEY_CLICK
 
 ---@class push_button_args
 ---@field text string button text
 ---@field callback function function to call on touch
 ---@field min_width? integer text length if omitted
+---@field alignment? ALIGN text align if min width > length
 ---@field active_fg_bg? cpair foreground/background colors when pressed
 ---@field dis_fg_bg? cpair foreground/background colors when disabled
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
 ---@field y? integer auto incremented if omitted
----@field height? integer parent height if omitted
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
 
@@ -25,40 +29,58 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@param args push_button_args
 ---@return graphics_element element, element_id id
 local function push_button(args)
-    assert(type(args.text) == "string", "graphics.elements.controls.push_button: text is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.push_button: callback is a required field")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.push_button: min_width must be nil or a number > 0")
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     local text_width = string.len(args.text)
+    local alignment = args.alignment or ALIGN.CENTER
 
-    -- single line height, calculate width
-    args.height = 1
+    -- set automatic settings
+    args.can_focus = true
     args.min_width = args.min_width or 0
     args.width = math.max(text_width, args.min_width)
 
-    -- create new graphics element base object
-    local e = element.new(args)
+    -- provide a constraint condition to element creation to prefer a single line button
+    ---@param frame graphics_frame
+    local function constrain(frame)
+        return frame.w, math.max(1, #util.strwrap(args.text, frame.w))
+    end
 
-    local h_pad = math.floor((e.frame.w - text_width) / 2) + 1
-    local v_pad = math.floor(e.frame.h / 2) + 1
+    -- create new graphics element base object
+    local e = element.new(args, constrain)
+
+    local text_lines = util.strwrap(args.text, e.frame.w)
 
     -- draw the button
-    local function draw()
+    function e.redraw()
         e.window.clear()
 
-        -- write the button text
-        e.window.setCursorPos(h_pad, v_pad)
-        e.window.write(args.text)
+        for i = 1, #text_lines do
+            if i > e.frame.h then break end
+
+            local len = string.len(text_lines[i])
+
+            -- use cursor position to align this line
+            if alignment == ALIGN.CENTER then
+                e.w_set_cur(math.floor((e.frame.w - len) / 2) + 1, i)
+            elseif alignment == ALIGN.RIGHT then
+                e.w_set_cur((e.frame.w - len) + 1, i)
+            else
+                e.w_set_cur(1, i)
+            end
+
+            e.w_write(text_lines[i])
+        end
     end
 
     -- draw the button as pressed (if active_fg_bg set)
     local function show_pressed()
         if e.enabled and args.active_fg_bg ~= nil then
             e.value = true
-            e.window.setTextColor(args.active_fg_bg.fgd)
-            e.window.setBackgroundColor(args.active_fg_bg.bkg)
-            draw()
+            e.w_set_fgd(args.active_fg_bg.fgd)
+            e.w_set_bkg(args.active_fg_bg.bkg)
+            e.redraw()
         end
     end
 
@@ -66,9 +88,9 @@ local function push_button(args)
     local function show_unpressed()
         if e.enabled and args.active_fg_bg ~= nil then
             e.value = false
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            draw()
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.redraw()
         end
     end
 
@@ -76,14 +98,14 @@ local function push_button(args)
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         if e.enabled then
-            if event.type == CLICK_TYPE.TAP then
+            if event.type == MOUSE_CLICK.TAP then
                 show_pressed()
                 -- show as unpressed in 0.25 seconds
                 if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_unpressed) end
                 args.callback()
-            elseif event.type == CLICK_TYPE.DOWN then
+            elseif event.type == MOUSE_CLICK.DOWN then
                 show_pressed()
-            elseif event.type == CLICK_TYPE.UP then
+            elseif event.type == MOUSE_CLICK.UP then
                 show_unpressed()
                 if e.in_frame_bounds(event.current.x, event.current.y) then
                     args.callback()
@@ -92,34 +114,51 @@ local function push_button(args)
         end
     end
 
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.DOWN then
+            if event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter then
+                args.callback()
+                -- visualize click without unfocusing
+                show_unpressed()
+                if args.active_fg_bg ~= nil then tcd.dispatch(0.25, show_pressed) end
+            end
+        end
+    end
+
     -- set the value (true simulates pressing the button)
     ---@param val boolean new value
     function e.set_value(val)
-        if val then e.handle_mouse(core.events.mouse_generic(core.events.CLICK_TYPE.UP, 1, 1)) end
+        if val then e.handle_mouse(core.events.mouse_generic(core.events.MOUSE_CLICK.UP, 1, 1)) end
     end
 
     -- show butten as enabled
-    function e.enable()
+    function e.on_enabled()
         if args.dis_fg_bg ~= nil then
             e.value = false
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            draw()
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.redraw()
         end
     end
 
     -- show button as disabled
-    function e.disable()
+    function e.on_disabled()
         if args.dis_fg_bg ~= nil then
             e.value = false
-            e.window.setTextColor(args.dis_fg_bg.fgd)
-            e.window.setBackgroundColor(args.dis_fg_bg.bkg)
-            draw()
+            e.w_set_fgd(args.dis_fg_bg.fgd)
+            e.w_set_bkg(args.dis_fg_bg.bkg)
+            e.redraw()
         end
     end
 
+    -- handle focus
+    e.on_focused = show_pressed
+    e.on_unfocused = show_unpressed
+
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/radio_2d.lua

@@ -0,0 +1,203 @@
+-- 2D Radio Button Graphics Element
+
+local util    = require("scada-common.util")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+---@class radio_2d_args
+---@field rows integer
+---@field columns integer
+---@field options table
+---@field radio_colors cpair radio button colors (inner & outer)
+---@field select_color? color color for radio button when selected
+---@field color_map? table colors for each radio button when selected
+---@field disable_color? color color for radio button when disabled
+---@field disable_fg_bg? cpair text colors when disabled
+---@field default? integer default state, defaults to options[1]
+---@field callback? function function to call on touch
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new 2D radio button list (latch selection, exclusively one color at a time)
+---@param args radio_2d_args
+---@return graphics_element element, element_id id
+local function radio_2d_button(args)
+    element.assert(type(args.options) == "table" and #args.options > 0, "options should be a table with length >= 1")
+    element.assert(util.is_int(args.rows) and util.is_int(args.columns), "rows/columns must be integers")
+    element.assert((args.rows * args.columns) >= #args.options, "rows x columns size insufficient for provided number of options")
+    element.assert(type(args.radio_colors) == "table", "radio_colors is a required field")
+    element.assert(type(args.select_color) == "number" or type(args.color_map) == "table", "select_color or color_map is required")
+    element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
+
+    local array = {}
+    local col_widths = {}
+
+    local next_idx = 1
+    local total_width = 0
+    local max_rows = 1
+
+    local focused_opt = 1
+    local focus_x, focus_y = 1, 1
+
+    -- build table to display
+    for col = 1, args.columns do
+        local max_width = 0
+        array[col] = {}
+
+        for row = 1, args.rows do
+            local len = string.len(args.options[next_idx])
+            if len > max_width then max_width = len end
+            if row > max_rows then max_rows = row end
+
+            table.insert(array[col], { text = args.options[next_idx], id = next_idx, x_1 = 1 + total_width, x_2 = 2 + total_width + len })
+
+            next_idx = next_idx + 1
+            if next_idx > #args.options then break end
+        end
+
+        table.insert(col_widths, max_width + 3)
+        total_width = total_width + max_width + 3
+        if next_idx > #args.options then break end
+    end
+
+    args.can_focus = true
+    args.width = total_width
+    args.height = max_rows
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- selected option (convert nil to 1 if missing)
+    e.value = args.default or 1
+
+    -- draw the element
+    function e.redraw()
+        local col_x = 1
+
+        local radio_color_b = util.trinary(type(args.disable_color) == "number" and not e.enabled, args.disable_color, args.radio_colors.color_b)
+
+        for col = 1, #array do
+            for row = 1, #array[col] do
+                local opt = array[col][row]
+                local select_color = args.select_color
+
+                if type(args.color_map) == "table" and args.color_map[opt.id] then
+                    select_color = args.color_map[opt.id]
+                end
+
+                local inner_color = util.trinary((e.value == opt.id) and e.enabled, radio_color_b, args.radio_colors.color_a)
+                local outer_color = util.trinary((e.value == opt.id) and e.enabled, select_color, radio_color_b)
+
+                e.w_set_cur(col_x, row)
+
+                e.w_set_fgd(inner_color)
+                e.w_set_bkg(outer_color)
+                e.w_write("\x88")
+
+                e.w_set_fgd(outer_color)
+                e.w_set_bkg(e.fg_bg.bkg)
+                e.w_write("\x95")
+
+                if opt.id == focused_opt then
+                    focus_x, focus_y = row, col
+                end
+
+                -- write button text
+                if opt.id == focused_opt and e.is_focused() and e.enabled then
+                    e.w_set_fgd(e.fg_bg.bkg)
+                    e.w_set_bkg(e.fg_bg.fgd)
+                elseif type(args.disable_fg_bg) == "table" and not e.enabled then
+                    e.w_set_fgd(args.disable_fg_bg.fgd)
+                    e.w_set_bkg(args.disable_fg_bg.bkg)
+                else
+                    e.w_set_fgd(e.fg_bg.fgd)
+                    e.w_set_bkg(e.fg_bg.bkg)
+                end
+
+                e.w_write(opt.text)
+            end
+
+            col_x = col_x + col_widths[col]
+        end
+    end
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        if e.enabled and core.events.was_clicked(event.type) and (event.initial.y == event.current.y) then
+            -- determine what was pressed
+            for _, row in ipairs(array) do
+                local elem = row[event.current.y]
+                if elem ~= nil and event.initial.x >= elem.x_1 and event.initial.x <= elem.x_2 and event.current.x >= elem.x_1 and event.current.x <= elem.x_2 then
+                    e.value = elem.id
+                    focused_opt = elem.id
+                    e.redraw()
+                    if type(args.callback) == "function" then args.callback(e.value) end
+                    break
+                end
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == core.events.KEY_CLICK.DOWN or event.type == core.events.KEY_CLICK.HELD then
+            if event.type == core.events.KEY_CLICK.DOWN and (event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter) then
+                e.value = focused_opt
+                e.redraw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            elseif event.key == keys.down then
+                if focused_opt < #args.options then
+                    focused_opt = focused_opt + 1
+                    e.redraw()
+                end
+            elseif event.key == keys.up then
+                if focused_opt > 1 then
+                    focused_opt = focused_opt - 1
+                    e.redraw()
+                end
+            elseif event.key == keys.right then
+                if array[focus_y + 1] and array[focus_y + 1][focus_x] then
+                    focused_opt = array[focus_y + 1][focus_x].id
+                else focused_opt = array[1][focus_x].id end
+                e.redraw()
+            elseif event.key == keys.left then
+                if array[focus_y - 1] and array[focus_y - 1][focus_x] then
+                    focused_opt = array[focus_y - 1][focus_x].id
+                    e.redraw()
+                elseif array[#array][focus_x] then
+                    focused_opt = array[#array][focus_x].id
+                    e.redraw()
+                end
+            end
+        end
+    end
+
+    -- set the value
+    ---@param val integer new value
+    function e.set_value(val)
+        if type(val) == "number" and val > 0 and val <= #args.options then
+            e.value = val
+            e.redraw()
+        end
+    end
+
+    -- handle focus & enable
+    e.on_focused = e.redraw
+    e.on_unfocused = e.redraw
+    e.on_enabled = e.redraw
+    e.on_disabled = e.redraw
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return radio_2d_button

graphics/elements/controls/radio_button.lua

@@ -1,15 +1,19 @@
 -- Radio Button Graphics Element
 
+local util    = require("scada-common.util")
+
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
+local KEY_CLICK = core.events.KEY_CLICK
+
 ---@class radio_button_args
 ---@field options table button options
----@field callback function function to call on touch
----@field radio_colors cpair colors for radio button center dot when active (a) or inactive (b)
----@field radio_bg color background color of radio button
+---@field radio_colors cpair radio button colors (inner & outer)
+---@field select_color color color for radio button border when selected
 ---@field default? integer default state, defaults to options[1]
 ---@field min_width? integer text length + 2 if omitted
+---@field callback? function function to call on touch
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -21,16 +25,12 @@ local element = require("graphics.element")
 ---@param args radio_button_args
 ---@return graphics_element element, element_id id
 local function radio_button(args)
-    assert(type(args.options) == "table", "graphics.elements.controls.radio_button: options is a required field")
-    assert(#args.options > 0, "graphics.elements.controls.radio_button: at least one option is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.radio_button: callback is a required field")
-    assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0),
-        "graphics.elements.controls.radio_button: default must be nil or a number > 0")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.radio_button: min_width must be nil or a number > 0")
-
-    -- one line per option
-    args.height = #args.options
+    element.assert(type(args.options) == "table", "options is a required field")
+    element.assert(#args.options > 0, "at least one option is required")
+    element.assert(type(args.radio_colors) == "table", "radio_colors is a required field")
+    element.assert(type(args.select_color) == "number", "select_color is a required field")
+    element.assert(type(args.default) == "nil" or (type(args.default) == "number" and args.default > 0), "default must be nil or a number > 0")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     -- determine widths
     local max_width = 1
@@ -43,53 +43,83 @@ local function radio_button(args)
 
     local button_text_width = math.max(max_width, args.min_width or 0)
 
+    -- set automatic args
+    args.can_focus = true
     args.width = button_text_width + 2
+    args.height = #args.options -- one line per option
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    local focused_opt = 1
+
     -- button state (convert nil to 1 if missing)
     e.value = args.default or 1
 
     -- show the button state
-    local function draw()
+    function e.redraw()
         for i = 1, #args.options do
             local opt = args.options[i] ---@type string
 
-            e.window.setCursorPos(1, i)
+            local inner_color = util.trinary(e.value == i, args.radio_colors.color_b, args.radio_colors.color_a)
+            local outer_color = util.trinary(e.value == i, args.select_color, args.radio_colors.color_b)
 
-            if e.value == i then
-                -- show as selected
-                e.window.setTextColor(args.radio_colors.color_a)
-                e.window.setBackgroundColor(args.radio_bg)
-            else
-                -- show as unselected
-                e.window.setTextColor(args.radio_colors.color_b)
-                e.window.setBackgroundColor(args.radio_bg)
-            end
+            e.w_set_cur(1, i)
 
-            e.window.write("\x88")
+            e.w_set_fgd(inner_color)
+            e.w_set_bkg(outer_color)
+            e.w_write("\x88")
 
-            e.window.setTextColor(args.radio_bg)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write("\x95")
+            e.w_set_fgd(outer_color)
+            e.w_set_bkg(e.fg_bg.bkg)
+            e.w_write("\x95")
 
             -- write button text
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
-            e.window.write(opt)
+            if i == focused_opt and e.is_focused() and e.enabled then
+                e.w_set_fgd(e.fg_bg.bkg)
+                e.w_set_bkg(e.fg_bg.fgd)
+            else
+                e.w_set_fgd(e.fg_bg.fgd)
+                e.w_set_bkg(e.fg_bg.bkg)
+            end
+
+            e.w_write(opt)
         end
     end
 
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled and core.events.was_clicked(event.type) and (event.initial.y == event.current.y) then
+        if e.enabled and core.events.was_clicked(event.type) and
+           (event.initial.y == event.current.y) and e.in_frame_bounds(event.current.x, event.current.y) then
             -- determine what was pressed
             if args.options[event.current.y] ~= nil then
                 e.value = event.current.y
-                draw()
-                args.callback(e.value)
+                focused_opt = e.value
+                e.redraw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if event.type == KEY_CLICK.DOWN and (event.key == keys.space or event.key == keys.enter or event.key == keys.numPadEnter) then
+                e.value = focused_opt
+                e.redraw()
+                if type(args.callback) == "function" then args.callback(e.value) end
+            elseif event.key == keys.down then
+                if focused_opt < #args.options then
+                    focused_opt = focused_opt + 1
+                    e.redraw()
+                end
+            elseif event.key == keys.up then
+                if focused_opt > 1 then
+                    focused_opt = focused_opt - 1
+                    e.redraw()
+                end
             end
         end
     end
@@ -97,12 +127,20 @@ local function radio_button(args)
     -- set the value
     ---@param val integer new value
     function e.set_value(val)
-        e.value = val
-        draw()
+        if type(val) == "number" and val > 0 and val <= #args.options then
+            e.value = val
+            e.redraw()
+        end
     end
 
+    -- handle focus & enable
+    e.on_focused = e.redraw
+    e.on_unfocused = e.redraw
+    e.on_enabled = e.redraw
+    e.on_disabled = e.redraw
+
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/sidebar.lua

@@ -1,19 +1,14 @@
 -- Sidebar Graphics Element
 
 local tcd     = require("scada-common.tcd")
+local util    = require("scada-common.util")
 
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local CLICK_TYPE = core.events.CLICK_TYPE
-
----@class sidebar_tab
----@field char string character identifier
----@field color cpair tab colors (fg/bg)
+local MOUSE_CLICK = core.events.MOUSE_CLICK
 
 ---@class sidebar_args
----@field tabs table sidebar tab options
----@field callback function function to call on tab change
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -26,53 +21,71 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@param args sidebar_args
 ---@return graphics_element element, element_id id
 local function sidebar(args)
-    assert(type(args.tabs) == "table", "graphics.elements.controls.sidebar: tabs is a required field")
-    assert(#args.tabs > 0, "graphics.elements.controls.sidebar: at least one tab is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.sidebar: callback is a required field")
-
-    -- always 3 wide
     args.width = 3
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    assert(e.frame.h >= (#args.tabs * 3), "graphics.elements.controls.sidebar: height insufficent to display all tabs")
-
     -- default to 1st tab
     e.value = 1
 
+    local was_pressed = false
+    local tabs = {}
+
     -- show the button state
-    ---@param pressed boolean if the currently selected tab should appear as actively pressed
+    ---@param pressed? boolean if the currently selected tab should appear as actively pressed
     ---@param pressed_idx? integer optional index to show as held (that is not yet selected)
     local function draw(pressed, pressed_idx)
+        pressed = util.trinary(pressed == nil, was_pressed, pressed)
+        was_pressed = pressed
         pressed_idx = pressed_idx or e.value
 
-        for i = 1, #args.tabs do
-            local tab = args.tabs[i] ---@type sidebar_tab
+        -- clear
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_bkg(e.fg_bg.bkg)
+        for y = 1, e.frame.h do
+            e.w_set_cur(1, y)
+            e.w_write("   ")
+        end
 
-            local y = ((i - 1) * 3) + 1
+        -- draw tabs
+        for i = 1, #tabs do
+            local tab = tabs[i] ---@type sidebar_tab
+            local y = tab.y_start
 
-            e.window.setCursorPos(1, y)
+            e.w_set_cur(1, y)
 
             if pressed and i == pressed_idx then
-                e.window.setTextColor(e.fg_bg.fgd)
-                e.window.setBackgroundColor(e.fg_bg.bkg)
+                e.w_set_fgd(e.fg_bg.fgd)
+                e.w_set_bkg(e.fg_bg.bkg)
             else
-                e.window.setTextColor(tab.color.fgd)
-                e.window.setBackgroundColor(tab.color.bkg)
+                e.w_set_fgd(tab.color.fgd)
+                e.w_set_bkg(tab.color.bkg)
             end
 
-            e.window.write("   ")
-            e.window.setCursorPos(1, y + 1)
-            if e.value == i then
-                -- show as selected
-                e.window.write(" " .. tab.char .. "\x10")
-            else
-                -- show as unselected
-                e.window.write(" " .. tab.char .. " ")
+            if tab.tall then
+                e.w_write("   ")
+                e.w_set_cur(1, y + 1)
+            end
+
+            e.w_write(tab.label)
+
+            if tab.tall then
+                e.w_set_cur(1, y + 2)
+                e.w_write("   ")
+            end
+        end
+    end
+
+    -- determine which tab was pressed
+    ---@param y integer y coordinate
+    local function find_tab(y)
+        for i = 1, #tabs do
+            local tab = tabs[i] ---@type sidebar_tab
+
+            if y >= tab.y_start and y <= tab.y_end then
+                return i
             end
-            e.window.setCursorPos(1, y + 2)
-            e.window.write("   ")
         end
     end
 
@@ -81,26 +94,28 @@ local function sidebar(args)
     function e.handle_mouse(event)
         -- determine what was pressed
         if e.enabled then
-            local cur_idx = math.ceil(event.current.y / 3)
-            local ini_idx = math.ceil(event.initial.y / 3)
+            local cur_idx = find_tab(event.current.y)
+            local ini_idx = find_tab(event.initial.y)
+            local tab = tabs[cur_idx]
 
-            if args.tabs[cur_idx] ~= nil then
-                if event.type == CLICK_TYPE.TAP then
+            -- handle press if a callback was provided
+            if tab ~= nil and type(tab.callback) == "function" then
+                if event.type == MOUSE_CLICK.TAP then
                     e.value = cur_idx
                     draw(true)
                     -- show as unpressed in 0.25 seconds
                     tcd.dispatch(0.25, function () draw(false) end)
-                    args.callback(e.value)
-                elseif event.type == CLICK_TYPE.DOWN then
+                    tab.callback()
+                elseif event.type == MOUSE_CLICK.DOWN then
                     draw(true, cur_idx)
-                elseif event.type == CLICK_TYPE.UP then
+                elseif event.type == MOUSE_CLICK.UP then
                     if cur_idx == ini_idx and e.in_frame_bounds(event.current.x, event.current.y) then
                         e.value = cur_idx
                         draw(false)
-                        args.callback(e.value)
+                        tab.callback()
                     else draw(false) end
                 end
-            elseif event.type == CLICK_TYPE.UP then
+            elseif event.type == MOUSE_CLICK.UP then
                 draw(false)
             end
         end
@@ -113,8 +128,39 @@ local function sidebar(args)
         draw(false)
     end
 
-    -- initial draw
-    draw(false)
+    -- update the sidebar navigation options
+    ---@param items table sidebar entries
+    function e.on_update(items)
+        local next_y = 1
+
+        tabs = {}
+
+        for i = 1, #items do
+            local item = items[i]
+            local height = util.trinary(item.tall, 3, 1)
+
+            ---@class sidebar_tab
+            local entry = {
+                y_start = next_y,            ---@type integer
+                y_end = next_y + height - 1, ---@type integer
+                tall = item.tall,            ---@type boolean
+                label = item.label,          ---@type string
+                color = item.color,          ---@type cpair
+                callback = item.callback     ---@type function|nil
+            }
+
+            next_y = next_y + height
+
+            tabs[i] = entry
+        end
+
+        draw()
+    end
+
+    -- element redraw
+    e.redraw = draw
+
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/spinbox_numeric.lua

@@ -29,8 +29,8 @@ local function spinbox(args)
     local wn_prec = args.whole_num_precision
     local fr_prec = args.fractional_precision
 
-    assert(util.is_int(wn_prec), "graphics.element.controls.spinbox_numeric: whole number precision must be an integer")
-    assert(util.is_int(fr_prec), "graphics.element.controls.spinbox_numeric: fractional precision must be an integer")
+    element.assert(util.is_int(wn_prec), "whole number precision must be an integer")
+    element.assert(util.is_int(fr_prec), "fractional precision must be an integer")
 
     local fmt, fmt_init ---@type string, string
 
@@ -44,7 +44,7 @@ local function spinbox(args)
 
     local dec_point_x = args.whole_num_precision + 1
 
-    assert(type(args.arrow_fg_bg) == "table", "graphics.element.spinbox_numeric: arrow_fg_bg is a required field")
+    element.assert(type(args.arrow_fg_bg) == "table", "arrow_fg_bg is a required field")
 
     -- determine widths
     args.width = wn_prec + fr_prec + util.trinary(fr_prec > 0, 1, 0)
@@ -58,22 +58,20 @@ local function spinbox(args)
 
     -- draw the arrows
     local function draw_arrows(color)
-        e.window.setBackgroundColor(args.arrow_fg_bg.bkg)
-        e.window.setTextColor(color)
-        e.window.setCursorPos(1, 1)
-        e.window.write(util.strrep("\x1e", wn_prec))
-        e.window.setCursorPos(1, 3)
-        e.window.write(util.strrep("\x1f", wn_prec))
+        e.w_set_bkg(args.arrow_fg_bg.bkg)
+        e.w_set_fgd(color)
+        e.w_set_cur(1, 1)
+        e.w_write(string.rep("\x1e", wn_prec))
+        e.w_set_cur(1, 3)
+        e.w_write(string.rep("\x1f", wn_prec))
         if fr_prec > 0 then
-            e.window.setCursorPos(1 + wn_prec, 1)
-            e.window.write(" " .. util.strrep("\x1e", fr_prec))
-            e.window.setCursorPos(1 + wn_prec, 3)
-            e.window.write(" " .. util.strrep("\x1f", fr_prec))
+            e.w_set_cur(1 + wn_prec, 1)
+            e.w_write(" " .. string.rep("\x1e", fr_prec))
+            e.w_set_cur(1 + wn_prec, 3)
+            e.w_write(" " .. string.rep("\x1f", fr_prec))
         end
     end
 
-    draw_arrows(args.arrow_fg_bg.fgd)
-
     -- populate digits from current value
     local function set_digits()
         local initial_str = util.sprintf(fmt_init, e.value)
@@ -119,35 +117,29 @@ local function spinbox(args)
         end
 
         -- draw
-        e.window.setBackgroundColor(e.fg_bg.bkg)
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.setCursorPos(1, 2)
-        e.window.write(util.sprintf(fmt, e.value))
+        e.w_set_bkg(e.fg_bg.bkg)
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_cur(1, 2)
+        e.w_write(util.sprintf(fmt, e.value))
     end
 
-    -- init with the default value
-    show_num()
-
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         -- only handle if on an increment or decrement arrow
-        if e.enabled and core.events.was_clicked(event.type) and
-                (event.current.x ~= dec_point_x) and (event.current.y ~= 2) then
-            if event.current.x == event.initial.x and event.current.y == event.initial.y then
-                local idx = util.trinary(event.current.x > dec_point_x, event.current.x - 1, event.current.x)
-                if digits[idx] ~= nil then
-                    if event.current.y == 1 then
-                        -- increment
-                        digits[idx] = digits[idx] + 1
-                    elseif event.current.y == 3 then
-                        -- decrement
-                        digits[idx] = digits[idx] - 1
-                    end
-
-                    update_value()
-                    show_num()
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) and
+           (event.current.x ~= dec_point_x) and (event.current.y ~= 2) and
+           (event.current.x == event.initial.x) and (event.current.y == event.initial.y) then
+            local idx = util.trinary(event.current.x > dec_point_x, event.current.x - 1, event.current.x)
+            if digits[idx] ~= nil then
+                if event.current.y == 1 then
+                    digits[idx] = digits[idx] + 1
+                elseif event.current.y == 3 then
+                    digits[idx] = digits[idx] - 1
                 end
+
+                update_value()
+                show_num()
             end
         end
     end
@@ -176,18 +168,19 @@ local function spinbox(args)
     end
 
     -- enable this input
-    function e.enable()
-        draw_arrows(args.arrow_fg_bg.fgd)
-    end
+    function e.on_enabled() draw_arrows(args.arrow_fg_bg.fgd) end
 
     -- disable this input
-    function e.disable()
-        draw_arrows(args.arrow_disable or colors.lightGray)
+    function e.on_disabled() draw_arrows(args.arrow_disable or colors.lightGray) end
+
+    -- element redraw
+    function e.redraw()
+        show_num()
+        draw_arrows(util.trinary(e.enabled, args.arrow_fg_bg.fgd, args.arrow_disable or colors.lightGray))
     end
 
-    -- default to zero, init digits table
-    e.value = 0
-    set_digits()
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/controls/switch_button.lua

@@ -21,15 +21,13 @@ local element = require("graphics.element")
 ---@param args switch_button_args
 ---@return graphics_element element, element_id id
 local function switch_button(args)
-    assert(type(args.text) == "string", "graphics.elements.controls.switch_button: text is a required field")
-    assert(type(args.callback) == "function", "graphics.elements.controls.switch_button: callback is a required field")
-    assert(type(args.active_fg_bg) == "table", "graphics.elements.controls.switch_button: active_fg_bg is a required field")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.switch_button: min_width must be nil or a number > 0")
+    element.assert(type(args.text) == "string", "text is a required field")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.active_fg_bg) == "table", "active_fg_bg is a required field")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
     local text_width = string.len(args.text)
 
-    -- single line height, calculate width
     args.height = 1
     args.min_width = args.min_width or 0
     args.width = math.max(text_width, args.min_width)
@@ -37,56 +35,46 @@ local function switch_button(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- button state (convert nil to false if missing)
     e.value = args.default or false
 
     local h_pad = math.floor((e.frame.w - text_width) / 2) + 1
     local v_pad = math.floor(e.frame.h / 2) + 1
 
     -- show the button state
-    local function draw_state()
+    function e.redraw()
         if e.value then
-            -- show as pressed
-            e.window.setTextColor(args.active_fg_bg.fgd)
-            e.window.setBackgroundColor(args.active_fg_bg.bkg)
+            e.w_set_fgd(args.active_fg_bg.fgd)
+            e.w_set_bkg(args.active_fg_bg.bkg)
         else
-            -- show as unpressed
-            e.window.setTextColor(e.fg_bg.fgd)
-            e.window.setBackgroundColor(e.fg_bg.bkg)
+            e.w_set_fgd(e.fg_bg.fgd)
+            e.w_set_bkg(e.fg_bg.bkg)
         end
 
-        -- clear to redraw background
         e.window.clear()
-
-        -- write the button text
-        e.window.setCursorPos(h_pad, v_pad)
-        e.window.write(args.text)
+        e.w_set_cur(h_pad, v_pad)
+        e.w_write(args.text)
     end
 
-    -- initial draw
-    draw_state()
-
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
-        if e.enabled and core.events.was_clicked(event.type) then
-            -- toggle state
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
             e.value = not e.value
-            draw_state()
-
-            -- call the touch callback with state
+            e.redraw()
             args.callback(e.value)
         end
     end
 
-    -- set the value
+    -- set the value (does not call the callback)
     ---@param val boolean new value
     function e.set_value(val)
-        -- set state
         e.value = val
-        draw_state()
+        e.redraw()
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/controls/tabbar.lua

@@ -27,13 +27,11 @@ local element = require("graphics.element")
 ---@param args tabbar_args
 ---@return graphics_element element, element_id id
 local function tabbar(args)
-    assert(type(args.tabs) == "table", "graphics.elements.controls.tabbar: tabs is a required field")
-    assert(#args.tabs > 0, "graphics.elements.controls.tabbar: at least one tab is required")
-    assert(type(args.callback) == "function", "graphics.elements.controls.tabbar: callback is a required field")
-    assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0),
-        "graphics.elements.controls.tabbar: min_width must be nil or a number > 0")
+    element.assert(type(args.tabs) == "table", "tabs is a required field")
+    element.assert(#args.tabs > 0, "at least one tab is required")
+    element.assert(type(args.callback) == "function", "callback is a required field")
+    element.assert(type(args.min_width) == "nil" or (type(args.min_width) == "number" and args.min_width > 0), "min_width must be nil or a number > 0")
 
-    -- always 1 tall
     args.height = 1
 
     -- determine widths
@@ -50,7 +48,7 @@ local function tabbar(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    assert(e.frame.w >= (button_width * #args.tabs), "graphics.elements.controls.tabbar: width insufficent to display all tabs")
+    element.assert(e.frame.w >= (button_width * #args.tabs), "width insufficent to display all tabs")
 
     -- default to 1st tab
     e.value = 1
@@ -67,21 +65,21 @@ local function tabbar(args)
     end
 
     -- show the tab state
-    local function draw()
+    function e.redraw()
         for i = 1, #args.tabs do
             local tab = args.tabs[i]    ---@type tabbar_tab
 
-            e.window.setCursorPos(tab._start_x, 1)
+            e.w_set_cur(tab._start_x, 1)
 
             if e.value == i then
-                e.window.setTextColor(tab.color.fgd)
-                e.window.setBackgroundColor(tab.color.bkg)
+                e.w_set_fgd(tab.color.fgd)
+                e.w_set_bkg(tab.color.bkg)
             else
-                e.window.setTextColor(e.fg_bg.fgd)
-                e.window.setBackgroundColor(e.fg_bg.bkg)
+                e.w_set_fgd(e.fg_bg.fgd)
+                e.w_set_bkg(e.fg_bg.bkg)
             end
 
-            e.window.write(util.pad(tab.name, button_width))
+            e.w_write(util.pad(tab.name, button_width))
         end
     end
 
@@ -100,7 +98,7 @@ local function tabbar(args)
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         -- determine what was pressed
-        if e.enabled and core.events.was_clicked(event.type) then
+        if e.enabled and core.events.was_clicked(event.type) and e.in_frame_bounds(event.current.x, event.current.y) then
             -- a button may have been pressed, which one was it?
             local tab_ini = which_tab(event.initial.x)
             local tab_cur = which_tab(event.current.x)
@@ -109,7 +107,7 @@ local function tabbar(args)
             -- tap always has identical coordinates, so this always passes for taps
             if tab_ini == tab_cur and tab_cur ~= nil then
                 e.value = tab_cur
-                draw()
+                e.redraw()
                 args.callback(e.value)
             end
         end
@@ -119,11 +117,11 @@ local function tabbar(args)
     ---@param val integer new value
     function e.set_value(val)
         e.value = val
-        draw()
+        e.redraw()
     end
 
     -- initial draw
-    draw()
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/form/number_field.lua

@@ -0,0 +1,197 @@
+-- Numeric Value Entry Graphics Element
+
+local util    = require("scada-common.util")
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local KEY_CLICK = core.events.KEY_CLICK
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class number_field_args
+---@field default? number default value, defaults to 0
+---@field min? number minimum, enforced on unfocus
+---@field max? number maximum, enforced on unfocus
+---@field max_chars? integer maximum number of characters, defaults to width
+---@field max_int_digits? integer maximum number of integer digits, enforced on unfocus
+---@field max_frac_digits? integer maximum number of fractional digits, enforced on unfocus
+---@field allow_decimal? boolean true to allow decimals
+---@field allow_negative? boolean true to allow negative numbers
+---@field dis_fg_bg? cpair foreground/background colors when disabled
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field width? integer parent width if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new numeric entry field
+---@param args number_field_args
+---@return graphics_element element, element_id id
+local function number_field(args)
+    element.assert(args.max_int_digits == nil or (util.is_int(args.max_int_digits) and args.max_int_digits > 0), "max_int_digits must be an integer greater than zero if supplied")
+    element.assert(args.max_frac_digits == nil or (util.is_int(args.max_frac_digits) and args.max_frac_digits > 0), "max_frac_digits must be an integer greater than zero if supplied")
+
+    args.height = 1
+    args.can_focus = true
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    local has_decimal = false
+
+    args.max_chars = args.max_chars or e.frame.w
+
+    -- set initial value
+    e.value = "" .. (args.default or 0)
+
+    -- make an interactive field manager
+    local ifield = core.new_ifield(e, args.max_chars, args.fg_bg, args.dis_fg_bg)
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        -- only handle if on an increment or decrement arrow
+        if e.enabled and e.in_frame_bounds(event.current.x, event.current.y) then
+            if core.events.was_clicked(event.type) then
+                e.take_focus()
+
+                if event.type == MOUSE_CLICK.UP then
+                    ifield.move_cursor(event.current.x)
+                end
+            elseif event.type == MOUSE_CLICK.DOUBLE_CLICK then
+                ifield.select_all()
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.CHAR and string.len(e.value) < args.max_chars then
+            if tonumber(event.name) then
+                if e.value == 0 then e.value = "" end
+                ifield.try_insert_char(event.name)
+            end
+        elseif event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if (event.key == keys.backspace or event.key == keys.delete) and (string.len(e.value) > 0) then
+                ifield.backspace()
+                has_decimal = string.find(e.value, "%.") ~= nil
+            elseif (event.key == keys.period or event.key == keys.numPadDecimal) and (not has_decimal) and args.allow_decimal then
+                has_decimal = true
+                ifield.try_insert_char(".")
+            elseif (event.key == keys.minus or event.key == keys.numPadSubtract) and (string.len(e.value) == 0) and args.allow_negative then
+                ifield.set_value("-")
+            elseif event.key == keys.left then
+                ifield.nav_left()
+            elseif event.key == keys.right then
+                ifield.nav_right()
+            elseif event.key == keys.a and event.ctrl then
+                ifield.select_all()
+            elseif event.key == keys.home or event.key == keys.up then
+                ifield.nav_start()
+            elseif event.key == keys["end"] or event.key == keys.down then
+                ifield.nav_end()
+            end
+        end
+    end
+
+    -- set the value (must be a number)
+    ---@param val number number to show
+    function e.set_value(val)
+        if tonumber(val) then ifield.set_value("" .. tonumber(val)) end
+    end
+
+    -- set minimum input value
+    ---@param min integer minimum allowed value
+    function e.set_min(min)
+        args.min = min
+        e.on_unfocused()
+    end
+
+    -- set maximum input value
+    ---@param max integer maximum allowed value
+    function e.set_max(max)
+        args.max = max
+        e.on_unfocused()
+    end
+
+    -- replace text with pasted text if its a number
+    ---@param text string string pasted
+    function e.handle_paste(text)
+        if tonumber(text) then
+            ifield.set_value("" .. tonumber(text))
+        else
+            ifield.set_value("0")
+        end
+    end
+
+    -- handle unfocused
+    function e.on_unfocused()
+        local val = tonumber(e.value)
+        local max = tonumber(args.max)
+        local min = tonumber(args.min)
+
+        if type(val) == "number" then
+            if args.max_int_digits or args.max_frac_digits then
+                local str = e.value
+                local ceil = false
+
+                if string.find(str, "-") then str = string.sub(e.value, 2) end
+                local parts = util.strtok(str, ".")
+
+                if parts[1] and args.max_int_digits then
+                    if string.len(parts[1]) > args.max_int_digits then
+                        parts[1] = string.rep("9", args.max_int_digits)
+                        ceil = true
+                    end
+                end
+
+                if args.allow_decimal and args.max_frac_digits then
+                    if ceil then
+                        parts[2] = string.rep("9", args.max_frac_digits)
+                    elseif parts[2] and (string.len(parts[2]) > args.max_frac_digits) then
+                        -- add a half of the highest precision fractional value in order to round using floor
+                        local scaled = math.fmod(val, 1) * (10 ^ (args.max_frac_digits))
+                        local value = math.floor(scaled + 0.5)
+                        local unscaled = value * (10 ^ (-args.max_frac_digits))
+                        parts[2] = string.sub(tostring(unscaled), 3) -- remove starting "0."
+                    end
+                end
+
+                if parts[2] then parts[2] = "." .. parts[2] else parts[2] = "" end
+
+                val = tonumber((parts[1] or "") .. parts[2])
+            end
+
+            if type(args.max) == "number" and val > max then
+                e.value = "" .. max
+                ifield.nav_start()
+            elseif type(args.min) == "number" and val < min then
+                e.value = "" .. min
+                ifield.nav_start()
+            else
+                e.value = "" .. val
+                ifield.nav_end()
+            end
+        else
+            e.value = ""
+        end
+
+        ifield.show()
+    end
+
+    -- handle focus (not unfocus), enable, and redraw with show()
+    e.on_focused = ifield.show
+    e.on_enabled = ifield.show
+    e.on_disabled = ifield.show
+    e.redraw = ifield.show
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return number_field

graphics/elements/form/text_field.lua

@@ -0,0 +1,105 @@
+-- Text Value Entry Graphics Element
+
+local core    = require("graphics.core")
+local element = require("graphics.element")
+
+local KEY_CLICK = core.events.KEY_CLICK
+local MOUSE_CLICK = core.events.MOUSE_CLICK
+
+---@class text_field_args
+---@field value? string initial value
+---@field max_len? integer maximum string length
+---@field censor? string character to replace text with when printing to screen
+---@field dis_fg_bg? cpair foreground/background colors when disabled
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field width? integer parent width if omitted
+---@field fg_bg? cpair foreground/background colors
+---@field hidden? boolean true to hide on initial draw
+
+-- new text entry field
+---@param args text_field_args
+---@return graphics_element element, element_id id, function censor_ctl
+local function text_field(args)
+    args.height = 1
+    args.can_focus = true
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    -- set initial value
+    e.value = args.value or ""
+
+    -- make an interactive field manager
+    local ifield = core.new_ifield(e, args.max_len or e.frame.w, args.fg_bg, args.dis_fg_bg)
+
+    ifield.censor(args.censor)
+
+    -- handle mouse interaction
+    ---@param event mouse_interaction mouse event
+    function e.handle_mouse(event)
+        -- only handle if on an increment or decrement arrow
+        if e.enabled and e.in_frame_bounds(event.current.x, event.current.y) then
+            if core.events.was_clicked(event.type) then
+                e.take_focus()
+
+                if event.type == MOUSE_CLICK.UP then
+                    ifield.move_cursor(event.current.x)
+                end
+            elseif event.type == MOUSE_CLICK.DOUBLE_CLICK then
+                ifield.select_all()
+            end
+        end
+    end
+
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.CHAR then
+            ifield.try_insert_char(event.name)
+        elseif event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if (event.key == keys.backspace or event.key == keys.delete) then
+                ifield.backspace()
+            elseif event.key == keys.left then
+                ifield.nav_left()
+            elseif event.key == keys.right then
+                ifield.nav_right()
+            elseif event.key == keys.a and event.ctrl then
+                ifield.select_all()
+            elseif event.key == keys.home or event.key == keys.up then
+                ifield.nav_start()
+            elseif event.key == keys["end"] or event.key == keys.down then
+                ifield.nav_end()
+            end
+        end
+    end
+
+    -- set the value
+    ---@param val string string to set
+    function e.set_value(val)
+        ifield.set_value(val)
+    end
+
+    -- replace text with pasted text
+    ---@param text string string to set
+    function e.handle_paste(text)
+        ifield.set_value(text)
+    end
+
+    -- handle focus, enable, and redraw with show()
+    e.on_focused = ifield.show
+    e.on_unfocused = ifield.show
+    e.on_enabled = ifield.show
+    e.on_disabled = ifield.show
+    e.redraw = ifield.show
+
+    -- initial draw
+    e.redraw()
+
+    local elem, id = e.complete()
+    return elem, id, ifield.censor
+end
+
+return text_field

graphics/elements/indicators/alight.lua

@@ -25,13 +25,13 @@ local flasher = require("graphics.flasher")
 ---@param args alarm_indicator_light
 ---@return graphics_element element, element_id id
 local function alarm_indicator_light(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.alight: label is a required field")
-    assert(type(args.c1) == "number", "graphics.elements.indicators.alight: c1 is a required field")
-    assert(type(args.c2) == "number", "graphics.elements.indicators.alight: c2 is a required field")
-    assert(type(args.c3) == "number", "graphics.elements.indicators.alight: c3 is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.c1) == "number", "c1 is a required field")
+    element.assert(type(args.c2) == "number", "c2 is a required field")
+    element.assert(type(args.c3) == "number", "c3 is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.alight: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
     -- single line
@@ -51,19 +51,21 @@ local function alarm_indicator_light(args)
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 1
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
             if e.value == 2 then
-                e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
             end
         else
             if e.value == 3 then
-                e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
             else
-                e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
             end
         end
 
@@ -76,7 +78,7 @@ local function alarm_indicator_light(args)
         local was_off = e.value ~= 2
 
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if args.flash then
             if was_off and (new_state == 2) then
@@ -87,17 +89,17 @@ local function alarm_indicator_light(args)
                 flasher.stop(flash_callback)
 
                 if new_state == 3 then
-                    e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+                    e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
                 else
-                    e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+                    e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
                 end
             end
         elseif new_state == 2 then
-            e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
         elseif new_state == 3 then
-            e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
         else
-            e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
         end
     end
 
@@ -105,9 +107,14 @@ local function alarm_indicator_light(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        e.w_write(args.label)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/coremap.lua

@@ -18,8 +18,8 @@ local element = require("graphics.element")
 ---@param args core_map_args
 ---@return graphics_element element, element_id id
 local function core_map(args)
-    assert(util.is_int(args.reactor_l), "graphics.elements.indicators.coremap: reactor_l is a required field")
-    assert(util.is_int(args.reactor_w), "graphics.elements.indicators.coremap: reactor_w is a required field")
+    element.assert(util.is_int(args.reactor_l), "reactor_l is a required field")
+    element.assert(util.is_int(args.reactor_w), "reactor_w is a required field")
 
     -- require max dimensions
     args.width = 18
@@ -31,6 +31,8 @@ local function core_map(args)
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 0
+
     local alternator = true
 
     local core_l = args.reactor_l - 2
@@ -47,25 +49,25 @@ local function core_map(args)
 
     -- create coordinate grid and frame
     local function draw_frame()
-        e.window.setTextColor(colors.white)
+        e.w_set_fgd(colors.white)
 
         for x = 0, (inner_width - 1) do
-            e.window.setCursorPos(x + start_x, 1)
-            e.window.write(util.sprintf("%X", x))
+            e.w_set_cur(x + start_x, 1)
+            e.w_write(util.sprintf("%X", x))
         end
 
         for y = 0, (inner_height - 1) do
-            e.window.setCursorPos(1, y + start_y)
-            e.window.write(util.sprintf("%X", y))
+            e.w_set_cur(1, y + start_y)
+            e.w_write(util.sprintf("%X", y))
         end
 
         -- even out bottom edge
-        e.window.setTextColor(e.fg_bg.bkg)
-        e.window.setBackgroundColor(args.parent.get_fg_bg().bkg)
-        e.window.setCursorPos(1, e.frame.h)
-        e.window.write(util.strrep("\x8f", e.frame.w))
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.setBackgroundColor(e.fg_bg.bkg)
+        e.w_set_fgd(e.fg_bg.bkg)
+        e.w_set_bkg(args.parent.get_fg_bg().bkg)
+        e.w_set_cur(1, e.frame.h)
+        e.w_write(string.rep("\x8f", e.frame.w))
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_bkg(e.fg_bg.bkg)
     end
 
     -- draw the core
@@ -102,13 +104,13 @@ local function core_map(args)
 
         -- draw pattern
         for y = start_y, inner_height + (start_y - 1) do
-            e.window.setCursorPos(start_x, y)
+            e.w_set_cur(start_x, y)
             for _ = 1, inner_width do
                 if alternator then
                     i = i + 1
-                    e.window.blit("\x07", text_c, back_c)
+                    e.w_blit("\x07", text_c, back_c)
                 else
-                    e.window.blit("\x07", "7", "8")
+                    e.w_blit("\x07", "7", "8")
                 end
 
                 alternator = not alternator
@@ -157,11 +159,14 @@ local function core_map(args)
         e.on_update(e.value)
     end
 
-    -- initial (one-time except for resize()) frame draw
-    draw_frame()
+    -- redraw both frame and core
+    function e.redraw()
+        draw_frame()
+        draw_core(e.value)
+    end
 
     -- initial draw
-    e.on_update(0)
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/data.lua

@@ -24,25 +24,17 @@ local element = require("graphics.element")
 ---@param args data_indicator_args
 ---@return graphics_element element, element_id id
 local function data(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.data: label is a required field")
-    assert(type(args.format) == "string", "graphics.elements.indicators.data: format is a required field")
-    assert(args.value ~= nil, "graphics.elements.indicators.data: value is a required field")
-    assert(util.is_int(args.width), "graphics.elements.indicators.data: width is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.format) == "string", "format is a required field")
+    element.assert(args.value ~= nil, "value is a required field")
+    element.assert(util.is_int(args.width), "width is a required field")
 
-    -- single line
     args.height = 1
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- label color
-    if args.lu_colors ~= nil then
-        e.window.setTextColor(args.lu_colors.color_a)
-    end
-
-    -- write label
-    e.window.setCursorPos(1, 1)
-    e.window.write(args.label)
+    e.value = args.value
 
     local value_color = e.fg_bg.fgd
     local label_len   = string.len(args.label)
@@ -60,25 +52,25 @@ local function data(args)
         e.value = value
 
         -- clear old data and label
-        e.window.setCursorPos(data_start, 1)
-        e.window.write(util.spaces(clear_width))
+        e.w_set_cur(data_start, 1)
+        e.w_write(util.spaces(clear_width))
 
         -- write data
         local data_str = util.sprintf(args.format, value)
-        e.window.setCursorPos(data_start, 1)
-        e.window.setTextColor(value_color)
+        e.w_set_cur(data_start, 1)
+        e.w_set_fgd(value_color)
         if args.commas then
-            e.window.write(util.comma_format(data_str))
+            e.w_write(util.comma_format(data_str))
         else
-            e.window.write(data_str)
+            e.w_write(data_str)
         end
 
         -- write label
         if args.unit ~= nil then
             if args.lu_colors ~= nil then
-                e.window.setTextColor(args.lu_colors.color_b)
+                e.w_set_fgd(args.lu_colors.color_b)
             end
-            e.window.write(" " .. args.unit)
+            e.w_write(" " .. args.unit)
         end
     end
 
@@ -93,8 +85,17 @@ local function data(args)
         e.on_update(e.value)
     end
 
-    -- initial value draw
-    e.on_update(args.value)
+    -- element redraw
+    function e.redraw()
+        if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
+        e.w_set_cur(1, 1)
+        e.w_write(args.label)
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/hbar.lua

@@ -22,16 +22,17 @@ local element = require("graphics.element")
 ---@param args hbar_args
 ---@return graphics_element element, element_id id
 local function hbar(args)
-    -- properties/state
-    local last_num_bars = -1
-
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 0.0
+
     -- bar width is width - 5 characters for " 100%" if showing percent
     local bar_width = util.trinary(args.show_percent, e.frame.w - 5, e.frame.w)
 
-    assert(bar_width > 0, "graphics.elements.indicators.hbar: too small for bar")
+    element.assert(bar_width > 0, "too small for bar")
+
+    local last_num_bars = -1
 
     -- determine bar colors
     local bar_bkg = e.fg_bg.blit_bkg
@@ -87,16 +88,16 @@ local function hbar(args)
 
             -- draw bar
             for y = 1, e.frame.h do
-                e.window.setCursorPos(1, y)
+                e.w_set_cur(1, y)
                 -- intentionally swapped fgd/bkg since we use spaces as fill, but they are the opposite
-                e.window.blit(spaces, bkg, fgd)
+                e.w_blit(spaces, bkg, fgd)
             end
         end
 
         -- update percentage
         if args.show_percent then
-            e.window.setCursorPos(bar_width + 2, math.max(1, math.ceil(e.frame.h / 2)))
-            e.window.write(util.sprintf("%3.0f%%", fraction * 100))
+            e.w_set_cur(bar_width + 2, math.max(1, math.ceil(e.frame.h / 2)))
+            e.w_write(util.sprintf("%3.0f%%", fraction * 100))
         end
     end
 
@@ -105,20 +106,21 @@ local function hbar(args)
     function e.recolor(bar_fg_bg)
         bar_bkg = bar_fg_bg.blit_bkg
         bar_fgd = bar_fg_bg.blit_fgd
-
-        -- re-draw
-        last_num_bars = 0
-        if type(e.value) == "number" then
-            e.on_update(e.value)
-        end
+        e.redraw()
     end
 
     -- set the percentage value
     ---@param val number 0.0 to 1.0
     function e.set_value(val) e.on_update(val) end
 
-    -- initialize to 0
-    e.on_update(0)
+    -- element redraw
+    function e.redraw()
+        last_num_bars = -1
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/icon.lua

@@ -1,7 +1,5 @@
 -- Icon Indicator Graphics Element
 
-local util    = require("scada-common.util")
-
 local element = require("graphics.element")
 
 ---@class icon_sym_color
@@ -11,7 +9,7 @@ local element = require("graphics.element")
 ---@class icon_indicator_args
 ---@field label string indicator label
 ---@field states table state color and symbol table
----@field value? integer default state, defaults to 1
+---@field value? integer|boolean default state, defaults to 1 (true = 2, false = 1)
 ---@field min_label_width? integer label length if omitted
 ---@field parent graphics_element
 ---@field id? string element id
@@ -25,18 +23,18 @@ local element = require("graphics.element")
 ---@param args icon_indicator_args
 ---@return graphics_element element, element_id id
 local function icon(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.icon: label is a required field")
-    assert(type(args.states) == "table", "graphics.elements.indicators.icon: states is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.states) == "table", "states is a required field")
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 4
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = args.value or 1
+    if e.value == true then e.value = 2 end
+
     -- state blit strings
     local state_blit_cmds = {}
     for i = 1, #args.states do
@@ -44,30 +42,37 @@ local function icon(args)
 
         table.insert(state_blit_cmds, {
             text = " " .. sym_color.symbol .. " ",
-            fgd = util.strrep(sym_color.color.blit_fgd, 3),
-            bkg = util.strrep(sym_color.color.blit_bkg, 3)
+            fgd = string.rep(sym_color.color.blit_fgd, 3),
+            bkg = string.rep(sym_color.color.blit_bkg, 3)
         })
     end
 
-    -- write label and initial indicator light
-    e.window.setCursorPos(5, 1)
-    e.window.write(args.label)
-
     -- on state change
-    ---@param new_state integer indicator state
+    ---@param new_state integer|boolean indicator state
     function e.on_update(new_state)
+        new_state = new_state or 1
+        if new_state == true then new_state = 2 end
+
         local blit_cmd = state_blit_cmds[new_state]
         e.value = new_state
-        e.window.setCursorPos(1, 1)
-        e.window.blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
+        e.w_set_cur(1, 1)
+        e.w_blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
     end
 
     -- set indicator state
-    ---@param val integer indicator state
+    ---@param val integer|boolean indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- initial icon draw
-    e.on_update(args.value or 1)
+    -- element redraw
+    function e.redraw()
+        e.w_set_cur(5, 1)
+        e.w_write(args.label)
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/led.lua

@@ -23,33 +23,31 @@ local flasher = require("graphics.flasher")
 ---@param args indicator_led_args
 ---@return graphics_element element, element_id id
 local function indicator_led(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.led: label is a required field")
-    assert(type(args.colors) == "table", "graphics.elements.indicators.led: colors is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.colors) == "table", "colors is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.led: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
 
-    -- flasher state
     local flash_on = true
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = false
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
-            e.window.blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
         else
-            e.window.blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -61,8 +59,8 @@ local function indicator_led(args)
             flash_on = true
             flasher.start(flash_callback, args.period)
         else
-            e.window.setCursorPos(1, 1)
-            e.window.blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
+            e.w_set_cur(1, 1)
+            e.w_blit("\x8c", args.colors.blit_a, e.fg_bg.blit_bkg)
         end
     end
 
@@ -73,8 +71,8 @@ local function indicator_led(args)
             flasher.stop(flash_callback)
         end
 
-        e.window.setCursorPos(1, 1)
-        e.window.blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
+        e.w_set_cur(1, 1)
+        e.w_blit("\x8c", args.colors.blit_b, e.fg_bg.blit_bkg)
     end
 
     -- on state change
@@ -88,13 +86,18 @@ local function indicator_led(args)
     ---@param val boolean indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(false)
-    if string.len(args.label) > 0 then
-        e.window.setCursorPos(3, 1)
-        e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        if string.len(args.label) > 0 then
+            e.w_set_cur(3, 1)
+            e.w_write(args.label)
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/indicators/ledpair.lua

@@ -25,25 +25,20 @@ local flasher = require("graphics.flasher")
 ---@param args indicator_led_pair_args
 ---@return graphics_element element, element_id id
 local function indicator_led_pair(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.ledpair: label is a required field")
-    assert(type(args.off) == "number", "graphics.elements.indicators.ledpair: off is a required field")
-    assert(type(args.c1) == "number", "graphics.elements.indicators.ledpair: c1 is a required field")
-    assert(type(args.c2) == "number", "graphics.elements.indicators.ledpair: c2 is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.off) == "number", "off is a required field")
+    element.assert(type(args.c1) == "number", "c1 is a required field")
+    element.assert(type(args.c2) == "number", "c2 is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.ledpair: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
 
-    -- flasher state
     local flash_on = true
 
-    -- blit translations
     local co = colors.toBlit(args.off)
     local c1 = colors.toBlit(args.c1)
     local c2 = colors.toBlit(args.c2)
@@ -51,21 +46,20 @@ local function indicator_led_pair(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- init value for initial check in on_update
     e.value = 1
 
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
             if e.value == 2 then
-                e.window.blit("\x8c", c1, e.fg_bg.blit_bkg)
+                e.w_blit("\x8c", c1, e.fg_bg.blit_bkg)
             elseif e.value == 3 then
-                e.window.blit("\x8c", c2, e.fg_bg.blit_bkg)
+                e.w_blit("\x8c", c2, e.fg_bg.blit_bkg)
             end
         else
-            e.window.blit("\x8c", co, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -77,7 +71,7 @@ local function indicator_led_pair(args)
         local was_off = e.value <= 1
 
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if args.flash then
             if was_off and (new_state > 1) then
@@ -86,15 +80,14 @@ local function indicator_led_pair(args)
             elseif new_state <= 1 then
                 flash_on = false
                 flasher.stop(flash_callback)
-
-                e.window.blit("\x8c", co, e.fg_bg.blit_bkg)
+                e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
             end
         elseif new_state == 2 then
-            e.window.blit("\x8c", c1, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", c1, e.fg_bg.blit_bkg)
         elseif new_state == 3 then
-            e.window.blit("\x8c", c2, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", c2, e.fg_bg.blit_bkg)
         else
-            e.window.blit("\x8c", co, e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", co, e.fg_bg.blit_bkg)
         end
     end
 
@@ -102,13 +95,18 @@ local function indicator_led_pair(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    if string.len(args.label) > 0 then
-        e.window.setCursorPos(3, 1)
-        e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        if string.len(args.label) > 0 then
+            e.w_set_cur(3, 1)
+            e.w_write(args.label)
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/indicators/ledrgb.lua

@@ -18,28 +18,24 @@ local element = require("graphics.element")
 ---@param args indicator_led_rgb_args
 ---@return graphics_element element, element_id id
 local function indicator_led_rgb(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.ledrgb: label is a required field")
-    assert(type(args.colors) == "table", "graphics.elements.indicators.ledrgb: colors is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.colors) == "table", "colors is a required field")
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 0, string.len(args.label)) + 2
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- init value for initial check in on_update
     e.value = 1
 
     -- on state change
     ---@param new_state integer indicator state
     function e.on_update(new_state)
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
         if type(args.colors[new_state]) == "number" then
-            e.window.blit("\x8c", colors.toBlit(args.colors[new_state]), e.fg_bg.blit_bkg)
+            e.w_blit("\x8c", colors.toBlit(args.colors[new_state]), e.fg_bg.blit_bkg)
         end
     end
 
@@ -47,13 +43,18 @@ local function indicator_led_rgb(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    if string.len(args.label) > 0 then
-        e.window.setCursorPos(3, 1)
-        e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(e.value)
+        if string.len(args.label) > 0 then
+            e.w_set_cur(3, 1)
+            e.w_write(args.label)
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/indicators/light.lua

@@ -23,33 +23,31 @@ local flasher = require("graphics.flasher")
 ---@param args indicator_light_args
 ---@return graphics_element element, element_id id
 local function indicator_light(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.light: label is a required field")
-    assert(type(args.colors) == "table", "graphics.elements.indicators.light: colors is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.colors) == "table", "colors is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.light: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2
 
-    -- flasher state
     local flash_on = true
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = false
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
-            e.window.blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
         else
-            e.window.blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -61,8 +59,8 @@ local function indicator_light(args)
             flash_on = true
             flasher.start(flash_callback, args.period)
         else
-            e.window.setCursorPos(1, 1)
-            e.window.blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
+            e.w_set_cur(1, 1)
+            e.w_blit(" \x95", "0" .. args.colors.blit_a, args.colors.blit_a .. e.fg_bg.blit_bkg)
         end
     end
 
@@ -73,8 +71,8 @@ local function indicator_light(args)
             flasher.stop(flash_callback)
         end
 
-        e.window.setCursorPos(1, 1)
-        e.window.blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
+        e.w_set_cur(1, 1)
+        e.w_blit(" \x95", "0" .. args.colors.blit_b, args.colors.blit_b .. e.fg_bg.blit_bkg)
     end
 
     -- on state change
@@ -88,10 +86,15 @@ local function indicator_light(args)
     ---@param val boolean indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(false)
-    e.window.setCursorPos(3, 1)
-    e.window.write(args.label)
+    -- draw label and indicator light
+    function e.redraw()
+        e.on_update(false)
+        e.w_set_cur(3, 1)
+        e.w_write(args.label)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/power.lua

@@ -9,7 +9,7 @@ local element = require("graphics.element")
 ---@field format string power format override (lua string format)
 ---@field rate boolean? whether to append /t to the end (power per tick)
 ---@field lu_colors? cpair label foreground color (a), unit foreground color (b)
----@field value any default value
+---@field value number default value
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -23,26 +23,17 @@ local element = require("graphics.element")
 ---@param args power_indicator_args
 ---@return graphics_element element, element_id id
 local function power(args)
-    assert(args.value ~= nil, "graphics.elements.indicators.power: value is a required field")
-    assert(util.is_int(args.width), "graphics.elements.indicators.power: width is a required field")
+    element.assert(type(args.value) == "number", "value is a required field")
+    element.assert(util.is_int(args.width), "width is a required field")
 
-    -- single line
     args.height = 1
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- label color
-    if args.lu_colors ~= nil then
-        e.window.setTextColor(args.lu_colors.color_a)
-    end
+    e.value = args.value
 
-    -- write label
-    e.window.setCursorPos(1, 1)
-    e.window.write(args.label)
-
-    local data_start = string.len(args.label) + 2
-    if string.len(args.label) == 0 then data_start = 1 end
+    local data_start = 0
 
     -- on state change
     ---@param value any new value
@@ -52,13 +43,13 @@ local function power(args)
         local data_str, unit = util.power_format(value, false, args.format)
 
         -- write data
-        e.window.setCursorPos(data_start, 1)
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.write(util.comma_format(data_str))
+        e.w_set_cur(data_start, 1)
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_write(util.comma_format(data_str))
 
         -- write unit
         if args.lu_colors ~= nil then
-            e.window.setTextColor(args.lu_colors.color_b)
+            e.w_set_fgd(args.lu_colors.color_b)
         end
 
         -- append per tick if rate is set
@@ -70,15 +61,27 @@ local function power(args)
             if unit == "FE" then unit = "FE " end
         end
 
-        e.window.write(" " .. unit)
+        e.w_write(" " .. unit)
     end
 
     -- set the value
     ---@param val any new value
     function e.set_value(val) e.on_update(val) end
 
-    -- initial value draw
-    e.on_update(args.value)
+    -- element redraw
+    function e.redraw()
+        if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
+        e.w_set_cur(1, 1)
+        e.w_write(args.label)
+
+        data_start = string.len(args.label) + 2
+        if string.len(args.label) == 0 then data_start = 1 end
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/rad.lua

@@ -10,7 +10,7 @@ local element = require("graphics.element")
 ---@field format string data format (lua string format)
 ---@field commas? boolean whether to use commas if a number is given (default to false)
 ---@field lu_colors? cpair label foreground color (a), unit foreground color (b)
----@field value any default value
+---@field value? radiation_reading default value
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
@@ -24,24 +24,16 @@ local element = require("graphics.element")
 ---@param args rad_indicator_args
 ---@return graphics_element element, element_id id
 local function rad(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.rad: label is a required field")
-    assert(type(args.format) == "string", "graphics.elements.indicators.rad: format is a required field")
-    assert(util.is_int(args.width), "graphics.elements.indicators.rad: width is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.format) == "string", "format is a required field")
+    element.assert(util.is_int(args.width), "width is a required field")
 
-    -- single line
     args.height = 1
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- label color
-    if args.lu_colors ~= nil then
-        e.window.setTextColor(args.lu_colors.color_a)
-    end
-
-    -- write label
-    e.window.setCursorPos(1, 1)
-    e.window.write(args.label)
+    e.value = args.value or types.new_zero_radiation_reading()
 
     local label_len = string.len(args.label)
     local data_start = 1
@@ -58,32 +50,41 @@ local function rad(args)
         e.value = value.radiation
 
         -- clear old data and label
-        e.window.setCursorPos(data_start, 1)
-        e.window.write(util.spaces(clear_width))
+        e.w_set_cur(data_start, 1)
+        e.w_write(util.spaces(clear_width))
 
         -- write data
         local data_str = util.sprintf(args.format, e.value)
-        e.window.setCursorPos(data_start, 1)
-        e.window.setTextColor(e.fg_bg.fgd)
+        e.w_set_cur(data_start, 1)
+        e.w_set_fgd(e.fg_bg.fgd)
         if args.commas then
-            e.window.write(util.comma_format(data_str))
+            e.w_write(util.comma_format(data_str))
         else
-            e.window.write(data_str)
+            e.w_write(data_str)
         end
 
         -- write unit
         if args.lu_colors ~= nil then
-            e.window.setTextColor(args.lu_colors.color_b)
+            e.w_set_fgd(args.lu_colors.color_b)
         end
-        e.window.write(" " .. value.unit)
+        e.w_write(" " .. value.unit)
     end
 
     -- set the value
     ---@param val any new value
     function e.set_value(val) e.on_update(val) end
 
-    -- initial value draw
-    e.on_update(types.new_zero_radiation_reading())
+    -- element redraw
+    function e.redraw()
+        if args.lu_colors ~= nil then e.w_set_fgd(args.lu_colors.color_a) end
+        e.w_set_cur(1, 1)
+        e.w_write(args.label)
+
+        e.on_update(e.value)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/signal.lua

@@ -0,0 +1,85 @@
+-- Signal Bars Graphics Element
+
+local util    = require("scada-common.util")
+
+local element = require("graphics.element")
+
+---@class signal_bar_args
+---@field compact? boolean true to use a single character (works better against edges that extend out colors)
+---@field colors_low_med? cpair color a for low signal quality, color b for medium signal quality
+---@field disconnect_color? color color for the 'x' on disconnect
+---@field parent graphics_element
+---@field id? string element id
+---@field x? integer 1 if omitted
+---@field y? integer auto incremented if omitted
+---@field fg_bg? cpair foreground/background colors (foreground is used for high signal quality)
+---@field hidden? boolean true to hide on initial draw
+
+-- new signal bar
+---@nodiscard
+---@param args signal_bar_args
+---@return graphics_element element, element_id id
+local function signal_bar(args)
+    args.height = 1
+    args.width = util.trinary(args.compact, 1, 2)
+
+    -- create new graphics element base object
+    local e = element.new(args)
+
+    e.value = 0
+
+    local blit_bkg = args.fg_bg.blit_bkg
+    local blit_0, blit_1, blit_2, blit_3 = args.fg_bg.blit_fgd, args.fg_bg.blit_fgd, args.fg_bg.blit_fgd, args.fg_bg.blit_fgd
+
+    if type(args.colors_low_med) == "table" then
+        blit_1 = args.colors_low_med.blit_a or blit_1
+        blit_2 = args.colors_low_med.blit_b or blit_2
+    end
+
+    if util.is_int(args.disconnect_color) then blit_0 = colors.toBlit(args.disconnect_color) end
+
+    -- on state change (0 = offline, 1 through 3 = low to high signal)
+    ---@param new_state integer signal state
+    function e.on_update(new_state)
+        e.value = new_state
+        e.redraw()
+    end
+
+    -- set signal state (0 = offline, 1 through 3 = low to high signal)
+    ---@param val integer signal state
+    function e.set_value(val) e.on_update(val) end
+
+    -- draw label and signal bar
+    function e.redraw()
+        e.w_set_cur(1, 1)
+
+        if args.compact then
+            if e.value == 1 then
+                e.w_blit("\x90", blit_1, blit_bkg)
+            elseif e.value == 2 then
+                e.w_blit("\x94", blit_2, blit_bkg)
+            elseif e.value == 3 then
+                e.w_blit("\x95", blit_3, blit_bkg)
+            else
+                e.w_blit("x", blit_0, blit_bkg)
+            end
+        else
+            if e.value == 1 then
+                e.w_blit("\x9f ", blit_bkg .. blit_bkg, blit_1 .. blit_bkg)
+            elseif e.value == 2 then
+                e.w_blit("\x9f\x94", blit_bkg .. blit_2, blit_2 .. blit_bkg)
+            elseif e.value == 3 then
+                e.w_blit("\x9f\x81", blit_bkg .. blit_bkg, blit_3 .. blit_3)
+            else
+                e.w_blit(" x", blit_0 .. blit_0, blit_bkg .. blit_bkg)
+            end
+        end
+    end
+
+    -- initial draw
+    e.redraw()
+
+    return e.complete()
+end
+
+return signal_bar

graphics/elements/indicators/state.lua

@@ -25,16 +25,12 @@ local element = require("graphics.element")
 ---@param args state_indicator_args
 ---@return graphics_element element, element_id id
 local function state_indicator(args)
-    assert(type(args.states) == "table", "graphics.elements.indicators.state: states is a required field")
+    element.assert(type(args.states) == "table", "states is a required field")
 
-    -- determine height
     if util.is_int(args.height) then
-        assert(args.height % 2 == 1, "graphics.elements.indicators.state: height should be an odd number")
-    else
-        args.height = 1
-    end
+        element.assert(args.height % 2 == 1, "height should be an odd number")
+    else args.height = 1 end
 
-    -- initial guess at width
     args.width = args.min_width or 1
 
     -- state blit strings
@@ -42,7 +38,6 @@ local function state_indicator(args)
     for i = 1, #args.states do
         local state_def = args.states[i]    ---@type state_text_color
 
-        -- re-determine width
         if string.len(state_def.text) > args.width then
             args.width = string.len(state_def.text)
         end
@@ -51,21 +46,28 @@ local function state_indicator(args)
 
         table.insert(state_blit_cmds, {
             text = text,
-            fgd = util.strrep(state_def.color.blit_fgd, string.len(text)),
-            bkg = util.strrep(state_def.color.blit_bkg, string.len(text))
+            fgd = string.rep(state_def.color.blit_fgd, string.len(text)),
+            bkg = string.rep(state_def.color.blit_bkg, string.len(text))
         })
     end
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = args.value or 1
+
+    -- element redraw
+    function e.redraw()
+        local blit_cmd = state_blit_cmds[e.value]
+        e.w_set_cur(1, 1)
+        e.w_blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
+    end
+
     -- on state change
     ---@param new_state integer indicator state
     function e.on_update(new_state)
-        local blit_cmd = state_blit_cmds[new_state]
         e.value = new_state
-        e.window.setCursorPos(1, 1)
-        e.window.blit(blit_cmd.text, blit_cmd.fgd, blit_cmd.bkg)
+        e.redraw()
     end
 
     -- set indicator state
@@ -73,7 +75,7 @@ local function state_indicator(args)
     function e.set_value(val) e.on_update(val) end
 
     -- initial draw
-    e.on_update(args.value or 1)
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/trilight.lua

@@ -25,47 +25,41 @@ local flasher = require("graphics.flasher")
 ---@param args tristate_indicator_light_args
 ---@return graphics_element element, element_id id
 local function tristate_indicator_light(args)
-    assert(type(args.label) == "string", "graphics.elements.indicators.trilight: label is a required field")
-    assert(type(args.c1) == "number", "graphics.elements.indicators.trilight: c1 is a required field")
-    assert(type(args.c2) == "number", "graphics.elements.indicators.trilight: c2 is a required field")
-    assert(type(args.c3) == "number", "graphics.elements.indicators.trilight: c3 is a required field")
+    element.assert(type(args.label) == "string", "label is a required field")
+    element.assert(type(args.c1) == "number", "c1 is a required field")
+    element.assert(type(args.c2) == "number", "c2 is a required field")
+    element.assert(type(args.c3) == "number", "c3 is a required field")
 
     if args.flash then
-        assert(util.is_int(args.period), "graphics.elements.indicators.trilight: period is a required field if flash is enabled")
+        element.assert(util.is_int(args.period), "period is a required field if flash is enabled")
     end
 
-    -- single line
     args.height = 1
-
-    -- determine width
     args.width = math.max(args.min_label_width or 1, string.len(args.label)) + 2
 
-    -- flasher state
-    local flash_on = true
-
-    -- blit translations
-    local c1 = colors.toBlit(args.c1)
-    local c2 = colors.toBlit(args.c2)
-    local c3 = colors.toBlit(args.c3)
-
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- init value for initial check in on_update
     e.value = 1
 
+    local flash_on = true
+
+    local c1 = colors.toBlit(args.c1)
+    local c2 = colors.toBlit(args.c2)
+    local c3 = colors.toBlit(args.c3)
+
     -- called by flasher when enabled
     local function flash_callback()
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if flash_on then
             if e.value == 2 then
-                e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
             elseif e.value == 3 then
-                e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
             end
         else
-            e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
         end
 
         flash_on = not flash_on
@@ -77,7 +71,7 @@ local function tristate_indicator_light(args)
         local was_off = e.value <= 1
 
         e.value = new_state
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         if args.flash then
             if was_off and (new_state > 1) then
@@ -87,14 +81,14 @@ local function tristate_indicator_light(args)
                 flash_on = false
                 flasher.stop(flash_callback)
 
-                e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+                e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
             end
         elseif new_state == 2 then
-            e.window.blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c2, c2 .. e.fg_bg.blit_bkg)
         elseif new_state == 3 then
-            e.window.blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c3, c3 .. e.fg_bg.blit_bkg)
         else
-            e.window.blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
+            e.w_blit(" \x95", "0" .. c1, c1 .. e.fg_bg.blit_bkg)
         end
     end
 
@@ -102,9 +96,14 @@ local function tristate_indicator_light(args)
     ---@param val integer indicator state
     function e.set_value(val) e.on_update(val) end
 
-    -- write label and initial indicator light
-    e.on_update(1)
-    e.window.write(args.label)
+    -- draw light and label
+    function e.redraw()
+        e.on_update(1)
+        e.w_write(args.label)
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/indicators/vbar.lua

@@ -20,18 +20,18 @@ local element = require("graphics.element")
 ---@param args vbar_args
 ---@return graphics_element element, element_id id
 local function vbar(args)
-    -- properties/state
-    local last_num_bars = -1
-
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- blit strings
-    local fgd = util.strrep(e.fg_bg.blit_fgd, e.frame.w)
-    local bkg = util.strrep(e.fg_bg.blit_bkg, e.frame.w)
+    e.value = 0.0
+
+    local last_num_bars = -1
+
+    local fgd = string.rep(e.fg_bg.blit_fgd, e.frame.w)
+    local bkg = string.rep(e.fg_bg.blit_bkg, e.frame.w)
     local spaces = util.spaces(e.frame.w)
-    local one_third = util.strrep("\x8f", e.frame.w)
-    local two_thirds = util.strrep("\x83", e.frame.w)
+    local one_third = string.rep("\x8f", e.frame.w)
+    local two_thirds = string.rep("\x83", e.frame.w)
 
     -- handle data changes
     ---@param fraction number 0.0 to 1.0
@@ -52,54 +52,55 @@ local function vbar(args)
         if num_bars ~= last_num_bars then
             last_num_bars = num_bars
 
-            -- start bottom up
             local y = e.frame.h
-
-            -- start at base of vertical bar
-            e.window.setCursorPos(1, y)
+            e.w_set_cur(1, y)
 
             -- fill percentage
             for _ = 1, num_bars / 3 do
-                e.window.blit(spaces, bkg, fgd)
+                e.w_blit(spaces, bkg, fgd)
                 y = y - 1
-                e.window.setCursorPos(1, y)
+                e.w_set_cur(1, y)
             end
 
             -- add fractional bar if needed
             if num_bars % 3 == 1 then
-                e.window.blit(one_third, bkg, fgd)
+                e.w_blit(one_third, bkg, fgd)
                 y = y - 1
             elseif num_bars % 3 == 2 then
-                e.window.blit(two_thirds, bkg, fgd)
+                e.w_blit(two_thirds, bkg, fgd)
                 y = y - 1
             end
 
             -- fill the rest blank
             while y > 0 do
-                e.window.setCursorPos(1, y)
-                e.window.blit(spaces, fgd, bkg)
+                e.w_set_cur(1, y)
+                e.w_blit(spaces, fgd, bkg)
                 y = y - 1
             end
         end
     end
 
-    -- change bar color
-    ---@param fg_bg cpair new bar colors
-    function e.recolor(fg_bg)
-        fgd = util.strrep(fg_bg.blit_fgd, e.frame.w)
-        bkg = util.strrep(fg_bg.blit_bkg, e.frame.w)
-
-        -- re-draw
-        last_num_bars = 0
-        if type(e.value) == "number" then
-            e.on_update(e.value)
-        end
-    end
-
     -- set the percentage value
     ---@param val number 0.0 to 1.0
     function e.set_value(val) e.on_update(val) end
 
+    -- element redraw
+    function e.redraw()
+        last_num_bars = -1
+        e.on_update(e.value)
+    end
+
+    -- change bar color
+    ---@param fg_bg cpair new bar colors
+    function e.recolor(fg_bg)
+        fgd = string.rep(fg_bg.blit_fgd, e.frame.w)
+        bkg = string.rep(fg_bg.blit_bkg, e.frame.w)
+        e.redraw()
+    end
+
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/listbox.lua

@@ -5,7 +5,8 @@ local tcd     = require("scada-common.tcd")
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local CLICK_TYPE = core.events.CLICK_TYPE
+local KEY_CLICK = core.events.KEY_CLICK
+local MOUSE_CLICK = core.events.MOUSE_CLICK
 
 ---@class listbox_args
 ---@field scroll_height integer height of internal scrolling container (must fit all elements vertically tiled)
@@ -33,6 +34,8 @@ local CLICK_TYPE = core.events.CLICK_TYPE
 ---@param args listbox_args
 ---@return graphics_element element, element_id id
 local function listbox(args)
+    args.can_focus = true
+
     -- create new graphics element base object
     local e = element.new(args)
 
@@ -63,34 +66,34 @@ local function listbox(args)
 
         -- draw up/down arrows
         if pressed_arrow == 1 then
-            e.window.setTextColor(active_fg_bg.fgd)
-            e.window.setBackgroundColor(active_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, 1)
-            e.window.write("\x1e")
-            e.window.setTextColor(nav_fg_bg.fgd)
-            e.window.setBackgroundColor(nav_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, e.frame.h)
-            e.window.write("\x1f")
+            e.w_set_fgd(active_fg_bg.fgd)
+            e.w_set_bkg(active_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, 1)
+            e.w_write("\x1e")
+            e.w_set_fgd(nav_fg_bg.fgd)
+            e.w_set_bkg(nav_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, e.frame.h)
+            e.w_write("\x1f")
         elseif pressed_arrow == -1 then
-            e.window.setTextColor(nav_fg_bg.fgd)
-            e.window.setBackgroundColor(nav_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, 1)
-            e.window.write("\x1e")
-            e.window.setTextColor(active_fg_bg.fgd)
-            e.window.setBackgroundColor(active_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, e.frame.h)
-            e.window.write("\x1f")
+            e.w_set_fgd(nav_fg_bg.fgd)
+            e.w_set_bkg(nav_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, 1)
+            e.w_write("\x1e")
+            e.w_set_fgd(active_fg_bg.fgd)
+            e.w_set_bkg(active_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, e.frame.h)
+            e.w_write("\x1f")
         else
-            e.window.setTextColor(nav_fg_bg.fgd)
-            e.window.setBackgroundColor(nav_fg_bg.bkg)
-            e.window.setCursorPos(e.frame.w, 1)
-            e.window.write("\x1e")
-            e.window.setCursorPos(e.frame.w, e.frame.h)
-            e.window.write("\x1f")
+            e.w_set_fgd(nav_fg_bg.fgd)
+            e.w_set_bkg(nav_fg_bg.bkg)
+            e.w_set_cur(e.frame.w, 1)
+            e.w_write("\x1e")
+            e.w_set_cur(e.frame.w, e.frame.h)
+            e.w_write("\x1f")
         end
 
-        e.window.setTextColor(e.fg_bg.fgd)
-        e.window.setBackgroundColor(e.fg_bg.bkg)
+        e.w_set_fgd(e.fg_bg.fgd)
+        e.w_set_bkg(e.fg_bg.bkg)
     end
 
     -- render the scroll bar and re-cacluate height & bounds
@@ -115,23 +118,23 @@ local function listbox(args)
         for i = 2, e.frame.h - 1 do
             if (i >= offset and i < (bar_height + offset)) and (bar_height ~= max_bar_height) then
                 if args.nav_fg_bg ~= nil then
-                    e.window.setBackgroundColor(args.nav_fg_bg.fgd)
+                    e.w_set_bkg(args.nav_fg_bg.fgd)
                 else
-                    e.window.setBackgroundColor(e.fg_bg.fgd)
+                    e.w_set_bkg(e.fg_bg.fgd)
                 end
             else
                 if args.nav_fg_bg ~= nil then
-                    e.window.setBackgroundColor(args.nav_fg_bg.bkg)
+                    e.w_set_bkg(args.nav_fg_bg.bkg)
                 else
-                    e.window.setBackgroundColor(e.fg_bg.bkg)
+                    e.w_set_bkg(e.fg_bg.bkg)
                 end
             end
 
-            e.window.setCursorPos(e.frame.w, i)
-            e.window.write(" ")
+            e.w_set_cur(e.frame.w, i)
+            if e.is_focused() then e.w_write("\x7f") else e.w_write(" ") end
         end
 
-        e.window.setBackgroundColor(e.fg_bg.bkg)
+        e.w_set_bkg(e.fg_bg.bkg)
     end
 
     -- update item y positions and move elements
@@ -158,6 +161,9 @@ local function listbox(args)
         scroll_frame.reposition(1, 1 + scroll_offset)
         scroll_frame.setVisible(true)
 
+        -- shift mouse events
+        e.mouse_window_shift.y = scroll_offset
+
         draw_bar()
     end
 
@@ -219,30 +225,60 @@ local function listbox(args)
         end
     end
 
+    -- handle focus
+    e.on_focused = draw_bar
+    e.on_unfocused = draw_bar
+
+    -- handle a child in the list being focused, make sure it is visible
+    function e.on_child_focused(child)
+        for i = 1, #list do
+            local item = list[i]    ---@type listbox_item
+            if item.e == child then
+                if (item.y + scroll_offset) <= 0 then
+                    scroll_offset = 1 - item.y
+                    update_positions()
+                    draw_bar()
+                elseif (item.y + scroll_offset) == 1 then
+                    -- do nothing, it's right at the top (if the bottom doesn't fit we can't easily fix that)
+                elseif ((item.h + item.y - 1) + scroll_offset) > e.frame.h then
+                    scroll_offset = 1 - ((item.h + item.y) - e.frame.h)
+                    update_positions()
+                    draw_bar()
+                end
+
+                return
+            end
+        end
+    end
+
     -- handle mouse interaction
     ---@param event mouse_interaction mouse event
     function e.handle_mouse(event)
         if e.enabled then
-            if event.type == CLICK_TYPE.TAP then
+            if event.type == MOUSE_CLICK.TAP then
                 if event.current.x == e.frame.w then
                     if event.current.y == 1 or event.current.y < bar_bounds[1] then
-                        draw_arrows(1)
                         scroll_up()
-                        if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        if event.current.y == 1 then
+                            draw_arrows(1)
+                            if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        end
                     elseif event.current.y == e.frame.h or event.current.y > bar_bounds[2] then
-                        draw_arrows(-1)
                         scroll_down()
-                        if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        if event.current.y == e.frame.h then
+                            draw_arrows(-1)
+                            if args.nav_active ~= nil then tcd.dispatch(0.25, function () draw_arrows(0) end) end
+                        end
                     end
                 end
-            elseif event.type == CLICK_TYPE.DOWN then
+            elseif event.type == MOUSE_CLICK.DOWN then
                 if event.current.x == e.frame.w then
                     if event.current.y == 1 or event.current.y < bar_bounds[1] then
-                        draw_arrows(1)
                         scroll_up()
+                        if event.current.y == 1 then draw_arrows(1) end
                     elseif event.current.y == e.frame.h or event.current.y > bar_bounds[2] then
-                        draw_arrows(-1)
                         scroll_down()
+                        if event.current.y == e.frame.h then draw_arrows(-1) end
                     else
                         -- clicked on bar
                         holding_bar = true
@@ -250,10 +286,10 @@ local function listbox(args)
                         mouse_last_y = event.current.y
                     end
                 end
-            elseif event.type == CLICK_TYPE.UP then
+            elseif event.type == MOUSE_CLICK.UP then
                 holding_bar = false
                 draw_arrows(0)
-            elseif event.type == CLICK_TYPE.DRAG then
+            elseif event.type == MOUSE_CLICK.DRAG then
                 if holding_bar then
                     -- if mouse is within vertical frame, including the grip point
                     if event.current.y > (1 + bar_grip_pos) and event.current.y <= ((e.frame.h - bar_height) + bar_grip_pos) then
@@ -266,16 +302,40 @@ local function listbox(args)
                         mouse_last_y = event.current.y
                     end
                 end
-            elseif event.type == CLICK_TYPE.SCROLL_DOWN then
+            elseif event.type == MOUSE_CLICK.SCROLL_DOWN then
                 scroll_down()
-            elseif event.type == CLICK_TYPE.SCROLL_UP then
+            elseif event.type == MOUSE_CLICK.SCROLL_UP then
                 scroll_up()
             end
         end
     end
 
-    draw_arrows(0)
-    draw_bar()
+    -- handle keyboard interaction
+    ---@param event key_interaction key event
+    function e.handle_key(event)
+        if event.type == KEY_CLICK.DOWN or event.type == KEY_CLICK.HELD then
+            if event.key == keys.up then
+                scroll_up()
+            elseif event.key == keys.down then
+                scroll_down()
+            elseif event.key == keys.home then
+                scroll_offset = 0
+                update_positions()
+            elseif event.key == keys["end"] then
+                scroll_offset = max_down_scroll
+                update_positions()
+            end
+        end
+    end
+
+    -- element redraw
+    function e.redraw()
+        draw_arrows(0)
+        draw_bar()
+    end
+
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/multipane.lua

@@ -19,23 +19,30 @@ local element = require("graphics.element")
 ---@param args multipane_args
 ---@return graphics_element element, element_id id
 local function multipane(args)
-    assert(type(args.panes) == "table", "graphics.elements.multipane: panes is a required field")
+    element.assert(type(args.panes) == "table", "panes is a required field")
 
     -- create new graphics element base object
     local e = element.new(args)
 
+    e.value = 1
+
+    -- show the selected pane
+    function e.redraw()
+        for i = 1, #args.panes do args.panes[i].hide() end
+        args.panes[e.value].show()
+    end
+
     -- select which pane is shown
     ---@param value integer pane to show
     function e.set_value(value)
         if (e.value ~= value) and (value > 0) and (value <= #args.panes) then
             e.value = value
-
-            for i = 1, #args.panes do args.panes[i].hide() end
-            args.panes[value].show()
+            e.redraw()
         end
     end
 
-    e.set_value(1)
+    -- initial draw
+    e.redraw()
 
     return e.complete()
 end

graphics/elements/pipenet.lua

@@ -14,16 +14,21 @@ local element = require("graphics.element")
 ---@field y? integer auto incremented if omitted
 ---@field hidden? boolean true to hide on initial draw
 
+---@class _pipe_map_entry
+---@field atr boolean align top right (or bottom left for false)
+---@field thin boolean thin pipe or not
+---@field fg string foreground blit
+---@field bg string background blit
+
 -- new pipe network
 ---@param args pipenet_args
 ---@return graphics_element element, element_id id
 local function pipenet(args)
-    assert(type(args.pipes) == "table", "graphics.elements.indicators.pipenet: pipes is a required field")
+    element.assert(type(args.pipes) == "table", "pipes is a required field")
 
     args.width = 0
     args.height = 0
 
-    -- determine width/height
     for i = 1, #args.pipes do
         local pipe = args.pipes[i]  ---@type pipe
 
@@ -44,104 +49,282 @@ local function pipenet(args)
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- draw all pipes
+    -- determine if there are any thin pipes involved
+    local any_thin = false
     for p = 1, #args.pipes do
-        local pipe = args.pipes[p]  ---@type pipe
+        any_thin = args.pipes[p].thin
+        if any_thin then break end
+    end
 
-        local x = 1 + pipe.x1
-        local y = 1 + pipe.y1
+    -- draw all pipes by drawing out lines
+    local function vector_draw()
+        for p = 1, #args.pipes do
+            local pipe = args.pipes[p]  ---@type pipe
 
-        local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
-        local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+            local x = 1 + pipe.x1
+            local y = 1 + pipe.y1
 
-        e.window.setCursorPos(x, y)
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
 
-        local c = core.cpair(pipe.color, e.fg_bg.bkg)
-
-        if pipe.align_tr then
-            -- cross width then height
-            for i = 1, pipe.w do
-                if pipe.thin then
-                    if i == pipe.w then
-                        -- corner
-                        if y_step > 0 then
-                            e.window.blit("\x93", c.blit_bkg, c.blit_fgd)
-                        else
-                            e.window.blit("\x8e", c.blit_fgd, c.blit_bkg)
-                        end
-                    else
-                        e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.w and y_step > 0 then
-                        -- corner
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
-                    else
-                        e.window.blit("\x8f", c.blit_fgd, c.blit_bkg)
-                    end
-                end
-
-                x = x + x_step
-                e.window.setCursorPos(x, y)
+            if pipe.thin then
+                x_step = util.trinary(pipe.x1 == pipe.x2, 0, x_step)
+                y_step = util.trinary(pipe.y1 == pipe.y2, 0, y_step)
             end
 
-            -- back up one
-            x = x - x_step
+            e.w_set_cur(x, y)
 
-            for _ = 1, pipe.h - 1 do
-                y = y + y_step
-                e.window.setCursorPos(x, y)
+            local c = core.cpair(pipe.color, e.fg_bg.bkg)
 
-                if pipe.thin then
-                    e.window.blit("\x95", c.blit_bkg, c.blit_fgd)
-                else
-                    e.window.blit(" ", c.blit_bkg, c.blit_fgd)
+            if pipe.align_tr then
+                -- cross width then height
+                for i = 1, pipe.w do
+                    if pipe.thin then
+                        if i == pipe.w then
+                            -- corner
+                            if y_step > 0 then
+                                e.w_blit("\x93", c.blit_bkg, c.blit_fgd)
+                            else
+                                e.w_blit("\x8e", c.blit_fgd, c.blit_bkg)
+                            end
+                        else
+                            e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
+                        end
+                    else
+                        if i == pipe.w and y_step > 0 then
+                            -- corner
+                            e.w_blit(" ", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.w_blit("\x8f", c.blit_fgd, c.blit_bkg)
+                        end
+                    end
+
+                    x = x + x_step
+                    e.w_set_cur(x, y)
                 end
+
+                -- back up one
+                x = x - x_step
+
+                for _ = 1, pipe.h - 1 do
+                    y = y + y_step
+                    e.w_set_cur(x, y)
+
+                    if pipe.thin then
+                        e.w_blit("\x95", c.blit_bkg, c.blit_fgd)
+                    else
+                        e.w_blit(" ", c.blit_bkg, c.blit_fgd)
+                    end
+                end
+            else
+                -- cross height then width
+                for i = 1, pipe.h do
+                    if pipe.thin then
+                        if i == pipe.h then
+                            -- corner
+                            if y_step < 0 then
+                                e.w_blit("\x97", c.blit_bkg, c.blit_fgd)
+                            elseif y_step > 0 then
+                                e.w_blit("\x8d", c.blit_fgd, c.blit_bkg)
+                            else
+                                e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
+                            end
+                        else
+                            e.w_blit("\x95", c.blit_fgd, c.blit_bkg)
+                        end
+                    else
+                        if i == pipe.h and y_step < 0 then
+                            -- corner
+                            e.w_blit("\x83", c.blit_bkg, c.blit_fgd)
+                        else
+                            e.w_blit(" ", c.blit_bkg, c.blit_fgd)
+                        end
+                    end
+
+                    y = y + y_step
+                    e.w_set_cur(x, y)
+                end
+
+                -- back up one
+                y = y - y_step
+
+                for _ = 1, pipe.w - 1 do
+                    x = x + x_step
+                    e.w_set_cur(x, y)
+
+                    if pipe.thin then
+                        e.w_blit("\x8c", c.blit_fgd, c.blit_bkg)
+                    else
+                        e.w_blit("\x83", c.blit_bkg, c.blit_fgd)
+                    end
+                end
+            end
+        end
+    end
+
+    -- draw a particular map cell
+    ---@param map table 2D cell map
+    ---@param x integer x coord
+    ---@param y integer y coord
+    local function draw_map_cell(map, x, y)
+        local entry = map[x][y] ---@type _pipe_map_entry already confirmed not false
+        local char
+        local invert = false
+
+        local function check(cx, cy)
+            return (map[cx] ~= nil) and (map[cx][cy] ~= nil) and (map[cx][cy] ~= false) and (map[cx][cy].fg == entry.fg)
+        end
+
+        if entry.thin then
+            if check(x - 1, y) then -- if left
+                if check(x, y - 1) then -- if above
+                    if check(x + 1, y) then -- if right
+                        if check(x, y + 1) then -- if below
+                            char = util.trinary(entry.atr, "\x91", "\x9d")
+                            invert = entry.atr
+                        else -- not below
+                            char = util.trinary(entry.atr, "\x8e", "\x8d")
+                        end
+                    else -- not right
+                        if check(x, y + 1) then -- if below
+                            char = util.trinary(entry.atr, "\x91", "\x95")
+                            invert = entry.atr
+                        else -- not below
+                            char = util.trinary(entry.atr, "\x8e", "\x85")
+                        end
+                    end
+                elseif check(x, y + 1) then-- not above, if below
+                    if check(x + 1, y) then -- if right
+                        char = util.trinary(entry.atr, "\x93", "\x9c")
+                        invert = entry.atr
+                    else -- not right
+                        char = util.trinary(entry.atr, "\x93", "\x94")
+                        invert = entry.atr
+                    end
+                else -- not above, not below
+                    char = "\x8c"
+                end
+            elseif check(x + 1, y) then -- not left, if right
+                if check(x, y - 1) then -- if above
+                    if check(x, y + 1) then -- if below
+                        char = util.trinary(entry.atr, "\x95", "\x9d")
+                        invert = entry.atr
+                    else -- not below
+                        char = util.trinary(entry.atr, "\x8a", "\x8d")
+                    end
+                else -- not above
+                    if check(x, y + 1) then -- if below
+                        char = util.trinary(entry.atr, "\x97", "\x9c")
+                        invert = entry.atr
+                    else -- not below
+                        char = "\x8c"
+                    end
+                end
+            else -- not left, not right
+                char = "\x95"
+                invert = entry.atr
             end
         else
-            -- cross height then width
-            for i = 1, pipe.h do
-                if pipe.thin then
-                    if i == pipe.h then
-                        -- corner
-                        if y_step < 0 then
-                            e.window.blit("\x97", c.blit_bkg, c.blit_fgd)
-                        else
-                            e.window.blit("\x8d", c.blit_fgd, c.blit_bkg)
-                        end
-                    else
-                        e.window.blit("\x95", c.blit_fgd, c.blit_bkg)
-                    end
-                else
-                    if i == pipe.h and y_step < 0 then
-                        -- corner
-                        e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
-                    else
-                        e.window.blit(" ", c.blit_bkg, c.blit_fgd)
-                    end
+            if check(x, y - 1) then -- above
+                -- not below and (if left or right)
+                if (not check(x, y + 1)) and (check(x - 1, y) or check(x + 1, y)) then
+                    char = util.trinary(entry.atr, "\x8f", " ")
+                    invert = not entry.atr
+                else -- not below w/ sides only
+                    char = " "
+                    invert = true
+                end
+            elseif check(x, y + 1) then -- not above, if below
+                -- if left or right
+                if (check(x - 1, y) or check(x + 1, y)) then
+                    char = "\x83"
+                    invert = true
+                else -- not left or right
+                    char = " "
+                    invert = true
+                end
+            else -- not above, not below
+                char = util.trinary(entry.atr, "\x8f", "\x83")
+                invert = not entry.atr
+            end
+        end
+
+        e.w_set_cur(x, y)
+
+        if invert then
+            e.w_blit(char, entry.bg, entry.fg)
+        else
+            e.w_blit(char, entry.fg, entry.bg)
+        end
+    end
+
+    -- draw all pipes by assembling and marking up a 2D map<br>
+    -- this is an easy way to check adjacent blocks, which is required to properly draw thin pipes
+    local function map_draw()
+        local map = {}
+
+        for x = 1, args.width do
+            table.insert(map, {})
+            for _ = 1, args.height do table.insert(map[x], false) end
+        end
+
+        -- build map
+        for p = 1, #args.pipes do
+            local pipe = args.pipes[p]  ---@type pipe
+
+            local x = 1 + pipe.x1
+            local y = 1 + pipe.y1
+
+            local x_step = util.trinary(pipe.x1 >= pipe.x2, -1, 1)
+            local y_step = util.trinary(pipe.y1 >= pipe.y2, -1, 1)
+
+            local entry = { atr = pipe.align_tr, thin = pipe.thin, fg = colors.toBlit(pipe.color), bg = e.fg_bg.blit_bkg }
+
+            if pipe.align_tr then
+                -- cross width then height
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
                 end
 
-                y = y + y_step
-                e.window.setCursorPos(x, y)
-            end
+                x = x - x_step  -- back up one
 
-            -- back up one
-            y = y - y_step
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
+            else
+                -- cross height then width
+                for _ = 1, pipe.h do
+                    map[x][y] = entry
+                    y = y + y_step
+                end
 
-            for _ = 1, pipe.w - 1 do
-                x = x + x_step
-                e.window.setCursorPos(x, y)
+                y = y - y_step  -- back up one
 
-                if pipe.thin then
-                    e.window.blit("\x8c", c.blit_fgd, c.blit_bkg)
-                else
-                    e.window.blit("\x83", c.blit_bkg, c.blit_fgd)
+                for _ = 1, pipe.w do
+                    map[x][y] = entry
+                    x = x + x_step
                 end
             end
         end
 
+        -- render
+        for x = 1, args.width do
+            for y = 1, args.height do
+                if map[x][y] ~= false then draw_map_cell(map, x, y) end
+            end
+        end
     end
 
+    -- element redraw
+    function e.redraw()
+        if any_thin then map_draw() else vector_draw() end
+    end
+
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/rectangle.lua

@@ -22,7 +22,7 @@ local element = require("graphics.element")
 ---@param args rectangle_args
 ---@return graphics_element element, element_id id
 local function rectangle(args)
-    assert(args.border ~= nil or args.thin ~= true, "graphics.elements.rectangle: thin requires border to be provided")
+    element.assert(args.border ~= nil or args.thin ~= true, "thin requires border to be provided")
 
     -- if thin, then width will always need to be 1
     if args.thin == true then
@@ -45,7 +45,7 @@ local function rectangle(args)
     end
 
     -- create new graphics element base object
-    local e = element.new(args, offset_x, offset_y)
+    local e = element.new(args, nil, offset_x, offset_y)
 
     -- create content window for child elements
     e.content_window = window.create(e.window, 1 + offset_x, 1 + offset_y, e.frame.w - (2 * offset_x), e.frame.h - (2 * offset_y))
@@ -56,7 +56,7 @@ local function rectangle(args)
     -- draw bordered box if requested
     -- element constructor will have drawn basic colored rectangle regardless
     if args.border ~= nil then
-        e.window.setCursorPos(1, 1)
+        e.w_set_cur(1, 1)
 
         local border_width = offset_x
         local border_height = offset_y
@@ -65,50 +65,50 @@ local function rectangle(args)
         local inner_width = e.frame.w - width_x2
 
         -- check dimensions
-        assert(width_x2 <= e.frame.w, "graphics.elements.rectangle: border too thick for width")
-        assert(width_x2 <= e.frame.h, "graphics.elements.rectangle: border too thick for height")
+        element.assert(width_x2 <= e.frame.w, "border too thick for width")
+        element.assert(width_x2 <= e.frame.h, "border too thick for height")
 
         -- form the basic line strings and top/bottom blit strings
         local spaces = util.spaces(e.frame.w)
-        local blit_fg = util.strrep(e.fg_bg.blit_fgd, e.frame.w)
+        local blit_fg = string.rep(e.fg_bg.blit_fgd, e.frame.w)
         local blit_fg_sides = blit_fg
         local blit_bg_sides = ""
-        local blit_bg_top_bot = util.strrep(border_blit, e.frame.w)
+        local blit_bg_top_bot = string.rep(border_blit, e.frame.w)
 
         -- partial bars
         local p_a, p_b, p_s
         if args.thin == true then
             if args.even_inner == true then
-                p_a = "\x9c" .. util.strrep("\x8c", inner_width) .. "\x93"
-                p_b = "\x8d" .. util.strrep("\x8c", inner_width) .. "\x8e"
+                p_a = "\x9c" .. string.rep("\x8c", inner_width) .. "\x93"
+                p_b = "\x8d" .. string.rep("\x8c", inner_width) .. "\x8e"
             else
-                p_a = "\x97" .. util.strrep("\x83", inner_width) .. "\x94"
-                p_b = "\x8a" .. util.strrep("\x8f", inner_width) .. "\x85"
+                p_a = "\x97" .. string.rep("\x83", inner_width) .. "\x94"
+                p_b = "\x8a" .. string.rep("\x8f", inner_width) .. "\x85"
             end
 
             p_s = "\x95" .. util.spaces(inner_width) .. "\x95"
         else
             if args.even_inner == true then
-                p_a = util.strrep("\x83", inner_width + width_x2)
-                p_b = util.strrep("\x8f", inner_width + width_x2)
+                p_a = string.rep("\x83", inner_width + width_x2)
+                p_b = string.rep("\x8f", inner_width + width_x2)
             else
-                p_a = util.spaces(border_width) .. util.strrep("\x8f", inner_width) .. util.spaces(border_width)
-                p_b = util.spaces(border_width) .. util.strrep("\x83", inner_width) .. util.spaces(border_width)
+                p_a = util.spaces(border_width) .. string.rep("\x8f", inner_width) .. util.spaces(border_width)
+                p_b = util.spaces(border_width) .. string.rep("\x83", inner_width) .. util.spaces(border_width)
             end
 
             p_s = spaces
         end
 
-        local p_inv_fg = util.strrep(border_blit, border_width) .. util.strrep(e.fg_bg.blit_bkg, inner_width) ..
-                            util.strrep(border_blit, border_width)
-        local p_inv_bg = util.strrep(e.fg_bg.blit_bkg, border_width) .. util.strrep(border_blit, inner_width) ..
-                            util.strrep(e.fg_bg.blit_bkg, border_width)
+        local p_inv_fg = string.rep(border_blit, border_width) .. string.rep(e.fg_bg.blit_bkg, inner_width) ..
+                            string.rep(border_blit, border_width)
+        local p_inv_bg = string.rep(e.fg_bg.blit_bkg, border_width) .. string.rep(border_blit, inner_width) ..
+                            string.rep(e.fg_bg.blit_bkg, border_width)
 
         if args.thin == true then
-            p_inv_fg = e.fg_bg.blit_bkg .. util.strrep(e.fg_bg.blit_bkg, inner_width) .. util.strrep(border_blit, border_width)
-            p_inv_bg = border_blit .. util.strrep(border_blit, inner_width) .. util.strrep(e.fg_bg.blit_bkg, border_width)
+            p_inv_fg = e.fg_bg.blit_bkg .. string.rep(e.fg_bg.blit_bkg, inner_width) .. string.rep(border_blit, border_width)
+            p_inv_bg = border_blit .. string.rep(border_blit, inner_width) .. string.rep(e.fg_bg.blit_bkg, border_width)
 
-            blit_fg_sides = border_blit .. util.strrep(e.fg_bg.blit_bkg, inner_width) .. e.fg_bg.blit_bkg
+            blit_fg_sides = border_blit .. string.rep(e.fg_bg.blit_bkg, inner_width) .. e.fg_bg.blit_bkg
         end
 
         -- form the body blit strings (sides are border, inside is normal)
@@ -126,64 +126,69 @@ local function rectangle(args)
         end
 
         -- draw rectangle with borders
-        for y = 1, e.frame.h do
-            e.window.setCursorPos(1, y)
-            -- top border
-            if y <= border_height then
-                -- partial pixel fill
-                if args.border.even and y == border_height then
-                    if args.thin == true then
-                        e.window.blit(p_a, p_inv_bg, p_inv_fg)
-                    else
-                        local _fg = util.trinary(args.even_inner == true, util.strrep(e.fg_bg.blit_bkg, e.frame.w), p_inv_bg)
-                        local _bg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
+        function e.redraw()
+            for y = 1, e.frame.h do
+                e.w_set_cur(1, y)
+                -- top border
+                if y <= border_height then
+                    -- partial pixel fill
+                    if args.border.even and y == border_height then
+                        if args.thin == true then
+                            e.w_blit(p_a, p_inv_bg, p_inv_fg)
+                        else
+                            local _fg = util.trinary(args.even_inner == true, string.rep(e.fg_bg.blit_bkg, e.frame.w), p_inv_bg)
+                            local _bg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
 
-                        if width_x2 % 3 == 1 then
-                            e.window.blit(p_b, _fg, _bg)
-                        elseif width_x2 % 3 == 2 then
-                            e.window.blit(p_a, _fg, _bg)
-                        else
-                            -- skip line
-                            e.window.blit(spaces, blit_fg, blit_bg_sides)
-                        end
-                    end
-                else
-                    e.window.blit(spaces, blit_fg, blit_bg_top_bot)
-                end
-            -- bottom border
-            elseif y > (e.frame.h - border_width) then
-                -- partial pixel fill
-                if args.border.even and y == ((e.frame.h - border_width) + 1) then
-                    if args.thin == true then
-                        if args.even_inner == true then
-                            e.window.blit(p_b, blit_bg_top_bot, util.strrep(e.fg_bg.blit_bkg, e.frame.w))
-                        else
-                            e.window.blit(p_b, util.strrep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
+                            if width_x2 % 3 == 1 then
+                                e.w_blit(p_b, _fg, _bg)
+                            elseif width_x2 % 3 == 2 then
+                                e.w_blit(p_a, _fg, _bg)
+                            else
+                                -- skip line
+                                e.w_blit(spaces, blit_fg, blit_bg_sides)
+                            end
                         end
                     else
-                        local _fg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
-                        local _bg = util.trinary(args.even_inner == true, util.strrep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
-
-                        if width_x2 % 3 == 1 then
-                            e.window.blit(p_a, _fg, _bg)
-                        elseif width_x2 % 3 == 2 then
-                            e.window.blit(p_b, _fg, _bg)
+                        e.w_blit(spaces, blit_fg, blit_bg_top_bot)
+                    end
+                -- bottom border
+                elseif y > (e.frame.h - border_width) then
+                    -- partial pixel fill
+                    if args.border.even and y == ((e.frame.h - border_width) + 1) then
+                        if args.thin == true then
+                            if args.even_inner == true then
+                                e.w_blit(p_b, blit_bg_top_bot, string.rep(e.fg_bg.blit_bkg, e.frame.w))
+                            else
+                                e.w_blit(p_b, string.rep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
+                            end
                         else
-                            -- skip line
-                            e.window.blit(spaces, blit_fg, blit_bg_sides)
+                            local _fg = util.trinary(args.even_inner == true, blit_bg_top_bot, p_inv_fg)
+                            local _bg = util.trinary(args.even_inner == true, string.rep(e.fg_bg.blit_bkg, e.frame.w), blit_bg_top_bot)
+
+                            if width_x2 % 3 == 1 then
+                                e.w_blit(p_a, _fg, _bg)
+                            elseif width_x2 % 3 == 2 then
+                                e.w_blit(p_b, _fg, _bg)
+                            else
+                                -- skip line
+                                e.w_blit(spaces, blit_fg, blit_bg_sides)
+                            end
                         end
+                    else
+                        e.w_blit(spaces, blit_fg, blit_bg_top_bot)
                     end
                 else
-                    e.window.blit(spaces, blit_fg, blit_bg_top_bot)
-                end
-            else
-                if args.thin == true then
-                    e.window.blit(p_s, blit_fg_sides, blit_bg_sides)
-                else
-                    e.window.blit(p_s, blit_fg, blit_bg_sides)
+                    if args.thin == true then
+                        e.w_blit(p_s, blit_fg_sides, blit_bg_sides)
+                    else
+                        e.w_blit(p_s, blit_fg, blit_bg_sides)
+                    end
                 end
             end
         end
+
+        -- initial draw of border
+        e.redraw()
     end
 
     return e.complete()

graphics/elements/textbox.lua

@@ -5,17 +5,18 @@ local util    = require("scada-common.util")
 local core    = require("graphics.core")
 local element = require("graphics.element")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 ---@class textbox_args
 ---@field text string text to show
----@field alignment? TEXT_ALIGN text alignment, left by default
+---@field alignment? ALIGN text alignment, left by default
+---@field anchor? boolean true to use this as an anchor, making it focusable
 ---@field parent graphics_element
 ---@field id? string element id
 ---@field x? integer 1 if omitted
 ---@field y? integer auto incremented if omitted
 ---@field width? integer parent width if omitted
----@field height? integer parent height if omitted
+---@field height? integer minimum necessary height for wrapped text if omitted
 ---@field gframe? graphics_frame frame instead of x/y/width/height
 ---@field fg_bg? cpair foreground/background colors
 ---@field hidden? boolean true to hide on initial draw
@@ -24,19 +25,34 @@ local TEXT_ALIGN = core.TEXT_ALIGN
 ---@param args textbox_args
 ---@return graphics_element element, element_id id
 local function textbox(args)
-    assert(type(args.text) == "string", "graphics.elements.textbox: text is a required field")
+    element.assert(type(args.text) == "string", "text is a required field")
+
+    if args.anchor == true then args.can_focus = true end
+
+    -- provide a constraint condition to element creation to prevent an pointlessly tall text box
+    ---@param frame graphics_frame
+    local function constrain(frame)
+        local new_height = math.max(1, #util.strwrap(args.text, frame.w))
+
+        if args.height then
+            new_height = math.max(frame.h, new_height)
+        end
+
+        return frame.w, new_height
+    end
 
     -- create new graphics element base object
-    local e = element.new(args)
+    local e = element.new(args, constrain)
 
-    local alignment = args.alignment or TEXT_ALIGN.LEFT
+    e.value = args.text
+
+    local alignment = args.alignment or ALIGN.LEFT
 
     -- draw textbox
+    function e.redraw()
+        e.window.clear()
 
-    local function display_text(text)
-        e.value = text
-
-        local lines = util.strwrap(text, e.frame.w)
+        local lines = util.strwrap(e.value, e.frame.w)
 
         for i = 1, #lines do
             if i > e.frame.h then break end
@@ -44,27 +60,28 @@ local function textbox(args)
             local len = string.len(lines[i])
 
             -- use cursor position to align this line
-            if alignment == TEXT_ALIGN.CENTER then
-                e.window.setCursorPos(math.floor((e.frame.w - len) / 2) + 1, i)
-            elseif alignment == TEXT_ALIGN.RIGHT then
-                e.window.setCursorPos((e.frame.w - len) + 1, i)
+            if alignment == ALIGN.CENTER then
+                e.w_set_cur(math.floor((e.frame.w - len) / 2) + 1, i)
+            elseif alignment == ALIGN.RIGHT then
+                e.w_set_cur((e.frame.w - len) + 1, i)
             else
-                e.window.setCursorPos(1, i)
+                e.w_set_cur(1, i)
             end
 
-            e.window.write(lines[i])
+            e.w_write(lines[i])
         end
     end
 
-    display_text(args.text)
-
     -- set the string value and re-draw the text
     ---@param val string value
     function e.set_value(val)
-        e.window.clear()
-        display_text(val)
+        e.value = val
+        e.redraw()
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/elements/tiling.lua

@@ -22,13 +22,11 @@ local element = require("graphics.element")
 ---@param args tiling_args
 ---@return graphics_element element, element_id id
 local function tiling(args)
-    assert(type(args.fill_c) == "table", "graphics.elements.tiling: fill_c is a required field")
+    element.assert(type(args.fill_c) == "table", "fill_c is a required field")
 
     -- create new graphics element base object
     local e = element.new(args)
 
-    -- draw tiling box
-
     local fill_a = args.fill_c.blit_a
     local fill_b = args.fill_c.blit_b
 
@@ -38,13 +36,9 @@ local function tiling(args)
     local start_y = 1
     local inner_width = math.floor(e.frame.w / util.trinary(even, 2, 1))
     local inner_height = e.frame.h
-    local alternator = true
 
     -- border
     if args.border_c ~= nil then
-        e.window.setBackgroundColor(args.border_c)
-        e.window.clear()
-
         start_x = 1 + util.trinary(even, 2, 1)
         start_y = 2
 
@@ -53,35 +47,48 @@ local function tiling(args)
     end
 
     -- check dimensions
-    assert(inner_width > 0, "graphics.elements.tiling: inner_width <= 0")
-    assert(inner_height > 0, "graphics.elements.tiling: inner_height <= 0")
-    assert(start_x <= inner_width, "graphics.elements.tiling: start_x > inner_width")
-    assert(start_y <= inner_height, "graphics.elements.tiling: start_y > inner_height")
+    element.assert(inner_width > 0, "inner_width <= 0")
+    element.assert(inner_height > 0, "inner_height <= 0")
+    element.assert(start_x <= inner_width, "start_x > inner_width")
+    element.assert(start_y <= inner_height, "start_y > inner_height")
 
-    -- create pattern
-    for y = start_y, inner_height + (start_y - 1) do
-        e.window.setCursorPos(start_x, y)
-        for _ = 1, inner_width do
-            if alternator then
-                if even then
-                    e.window.blit("  ", "00", fill_a .. fill_a)
-                else
-                    e.window.blit(" ", "0", fill_a)
-                end
-            else
-                if even then
-                    e.window.blit("  ", "00", fill_b .. fill_b)
-                else
-                    e.window.blit(" ", "0", fill_b)
-                end
-            end
+    -- draw tiling box
+    function e.redraw()
+        local alternator = true
 
-            alternator = not alternator
+        if args.border_c ~= nil then
+            e.w_set_bkg(args.border_c)
+            e.window.clear()
         end
 
-        if inner_width % 2 == 0 then alternator = not alternator end
+        -- draw pattern
+        for y = start_y, inner_height + (start_y - 1) do
+            e.w_set_cur(start_x, y)
+            for _ = 1, inner_width do
+                if alternator then
+                    if even then
+                        e.w_blit("  ", "00", fill_a .. fill_a)
+                    else
+                        e.w_blit(" ", "0", fill_a)
+                    end
+                else
+                    if even then
+                        e.w_blit("  ", "00", fill_b .. fill_b)
+                    else
+                        e.w_blit(" ", "0", fill_b)
+                    end
+                end
+
+                alternator = not alternator
+            end
+
+            if inner_width % 2 == 0 then alternator = not alternator end
+        end
     end
 
+    -- initial draw
+    e.redraw()
+
     return e.complete()
 end
 

graphics/events.lua

@@ -4,46 +4,77 @@
 
 local util = require("scada-common.util")
 
+local DOUBLE_CLICK_MS = 500
+
 local events = {}
 
 ---@enum CLICK_BUTTON
-events.CLICK_BUTTON = {
+local CLICK_BUTTON = {
     GENERIC = 0,
     LEFT_BUTTON = 1,
     RIGHT_BUTTON = 2,
     MID_BUTTON = 3
 }
 
----@enum CLICK_TYPE
-events.CLICK_TYPE = {
+events.CLICK_BUTTON = CLICK_BUTTON
+
+---@enum MOUSE_CLICK
+local MOUSE_CLICK = {
     TAP = 1,            -- screen tap (complete click)
     DOWN = 2,           -- button down
     UP = 3,             -- button up (completed a click)
     DRAG = 4,           -- mouse dragged
     SCROLL_DOWN = 5,    -- scroll down
-    SCROLL_UP = 6       -- scroll up
+    SCROLL_UP = 6,      -- scroll up
+    DOUBLE_CLICK = 7    -- double left click
 }
 
+events.MOUSE_CLICK = MOUSE_CLICK
+
+---@enum KEY_CLICK
+local KEY_CLICK = {
+    DOWN = 1,
+    HELD = 2,
+    UP = 3,
+    CHAR = 4
+}
+
+events.KEY_CLICK = KEY_CLICK
+
 -- create a new 2D coordinate
 ---@param x integer
 ---@param y integer
 ---@return coordinate_2d
 local function _coord2d(x, y) return { x = x, y = y } end
 
+events.new_coord_2d = _coord2d
+
 ---@class mouse_interaction
 ---@field monitor string
 ---@field button CLICK_BUTTON
----@field type CLICK_TYPE
+---@field type MOUSE_CLICK
 ---@field initial coordinate_2d
 ---@field current coordinate_2d
 
+---@class key_interaction
+---@field type KEY_CLICK
+---@field key number key code
+---@field name string key character name
+---@field shift boolean shift held
+---@field ctrl boolean ctrl held
+---@field alt boolean alt held
+
 local handler = {
     -- left, right, middle button down tracking
-    button_down = {
-        _coord2d(0, 0),
-        _coord2d(0, 0),
-        _coord2d(0, 0)
-    }
+    button_down = { _coord2d(0, 0), _coord2d(0, 0), _coord2d(0, 0) },
+    -- keyboard modifiers
+    shift = false,
+    alt = false,
+    ctrl = false,
+    -- double click tracking
+    dc_start = 0,
+    dc_step = 1,
+    dc_coord = _coord2d(0, 0)
 }
 
 -- create a new monitor touch mouse interaction event
@@ -55,8 +86,8 @@ local handler = {
 local function _monitor_touch(monitor, x, y)
     return {
         monitor = monitor,
-        button = events.CLICK_BUTTON.GENERIC,
-        type = events.CLICK_TYPE.TAP,
+        button = CLICK_BUTTON.GENERIC,
+        type = MOUSE_CLICK.TAP,
         initial = _coord2d(x, y),
         current = _coord2d(x, y)
     }
@@ -65,7 +96,7 @@ end
 -- create a new mouse button mouse interaction event
 ---@nodiscard
 ---@param button CLICK_BUTTON mouse button
----@param type CLICK_TYPE click type
+---@param type MOUSE_CLICK click type
 ---@param x1 integer initial x
 ---@param y1 integer initial y
 ---@param x2 integer current x
@@ -83,14 +114,14 @@ end
 
 -- create a new generic mouse interaction event
 ---@nodiscard
----@param type CLICK_TYPE
+---@param type MOUSE_CLICK
 ---@param x integer
 ---@param y integer
 ---@return mouse_interaction
 function events.mouse_generic(type, x, y)
     return {
         monitor = "",
-        button = events.CLICK_BUTTON.GENERIC,
+        button = CLICK_BUTTON.GENERIC,
         type = type,
         initial = _coord2d(x, y),
         current = _coord2d(x, y)
@@ -115,8 +146,8 @@ end
 
 -- check if an event qualifies as a click (tap or up)
 ---@nodiscard
----@param t CLICK_TYPE
-function events.was_clicked(t) return t == events.CLICK_TYPE.TAP or t == events.CLICK_TYPE.UP end
+---@param t MOUSE_CLICK
+function events.was_clicked(t) return t == MOUSE_CLICK.TAP or t == MOUSE_CLICK.UP end
 
 -- create a new mouse event to pass onto graphics renderer<br>
 -- supports: mouse_click, mouse_up, mouse_drag, mouse_scroll, and monitor_touch
@@ -126,35 +157,97 @@ function events.was_clicked(t) return t == events.CLICK_TYPE.TAP or t == events.
 ---@param y integer y coordinate
 ---@return mouse_interaction|nil
 function events.new_mouse_event(event_type, opt, x, y)
+    local h = handler
+
     if event_type == "mouse_click" then
         ---@cast opt 1|2|3
-        handler.button_down[opt] = _coord2d(x, y)
-        return _mouse_event(opt, events.CLICK_TYPE.DOWN, x, y, x, y)
+
+        local init = true
+
+        if opt == 1 and (h.dc_step % 2) == 1 then
+            if h.dc_step ~= 1 and h.dc_coord.x == x and h.dc_coord.y == y and (util.time_ms() - h.dc_start) < DOUBLE_CLICK_MS then
+                init = false
+                h.dc_step = h.dc_step + 1
+            end
+        end
+
+        if init then
+            h.dc_start = util.time_ms()
+            h.dc_coord = _coord2d(x, y)
+            h.dc_step = 2
+        end
+
+        h.button_down[opt] = _coord2d(x, y)
+        return _mouse_event(opt, MOUSE_CLICK.DOWN, x, y, x, y)
     elseif event_type == "mouse_up" then
         ---@cast opt 1|2|3
-        local initial = handler.button_down[opt]    ---@type coordinate_2d
-        return _mouse_event(opt, events.CLICK_TYPE.UP, initial.x, initial.y, x, y)
+
+        if opt == 1 and (h.dc_step % 2) == 0 and h.dc_coord.x == x and h.dc_coord.y == y and
+                (util.time_ms() - h.dc_start) < DOUBLE_CLICK_MS then
+            if h.dc_step == 4 then
+                util.push_event("double_click", 1, x, y)
+                h.dc_step = 1
+            else h.dc_step = h.dc_step + 1 end
+        else h.dc_step = 1 end
+
+        local initial = h.button_down[opt]    ---@type coordinate_2d
+        return _mouse_event(opt, MOUSE_CLICK.UP, initial.x, initial.y, x, y)
     elseif event_type == "monitor_touch" then
         ---@cast opt string
         return _monitor_touch(opt, x, y)
     elseif event_type == "mouse_drag" then
         ---@cast opt 1|2|3
-        local initial = handler.button_down[opt]    ---@type coordinate_2d
-        return _mouse_event(opt, events.CLICK_TYPE.DRAG, initial.x, initial.y, x, y)
+        local initial = h.button_down[opt]    ---@type coordinate_2d
+        return _mouse_event(opt, MOUSE_CLICK.DRAG, initial.x, initial.y, x, y)
     elseif event_type == "mouse_scroll" then
         ---@cast opt 1|-1
-        local scroll_direction = util.trinary(opt == 1, events.CLICK_TYPE.SCROLL_DOWN, events.CLICK_TYPE.SCROLL_UP)
-        return _mouse_event(events.CLICK_BUTTON.GENERIC, scroll_direction, x, y, x, y)
+        local scroll_direction = util.trinary(opt == 1, MOUSE_CLICK.SCROLL_DOWN, MOUSE_CLICK.SCROLL_UP)
+        return _mouse_event(CLICK_BUTTON.GENERIC, scroll_direction, x, y, x, y)
+    elseif event_type == "double_click" then
+        return _mouse_event(CLICK_BUTTON.LEFT_BUTTON, MOUSE_CLICK.DOUBLE_CLICK, x, y, x, y)
     end
 end
 
--- create a new key event to pass onto graphics renderer<br>
+-- create a new keyboard interaction event
+---@nodiscard
+---@param click_type KEY_CLICK key click type
+---@param key integer|string keyboard key code or character for 'char' event
+---@return key_interaction
+local function _key_event(click_type, key)
+    local name = key
+    if type(key) == "number" then name = keys.getName(key) end
+    return { type = click_type, key = key, name = name, shift = handler.shift, ctrl = handler.ctrl, alt = handler.alt }
+end
+
+-- create a new keyboard event to pass onto graphics renderer<br>
 -- supports: char, key, and key_up
----@param event_type os_event
-function events.new_key_event(event_type)
+---@param event_type os_event OS event to handle
+---@param key integer keyboard key code
+---@param held boolean? if the key is being held (for 'key' event)
+---@return key_interaction|nil
+function events.new_key_event(event_type, key, held)
     if event_type == "char" then
+        return _key_event(KEY_CLICK.CHAR, key)
     elseif event_type == "key" then
+        if key == keys.leftShift or key == keys.rightShift then
+            handler.shift = true
+        elseif key == keys.leftCtrl or key == keys.rightCtrl then
+            handler.ctrl = true
+        elseif key == keys.leftAlt or key == keys.rightAlt then
+            handler.alt = true
+        else
+            return _key_event(util.trinary(held, KEY_CLICK.HELD, KEY_CLICK.DOWN), key)
+        end
     elseif event_type == "key_up" then
+        if key == keys.leftShift or key == keys.rightShift then
+            handler.shift = false
+        elseif key == keys.leftCtrl or key == keys.rightCtrl then
+            handler.ctrl = false
+        elseif key == keys.leftAlt or key == keys.rightAlt then
+            handler.alt = false
+        else
+            return _key_event(KEY_CLICK.UP, key)
+        end
     end
 end
 

graphics/themes.lua

@@ -0,0 +1,418 @@
+--
+-- Graphics Themes
+--
+
+local core = require("graphics.core")
+
+local cpair = core.cpair
+
+---@class graphics_themes
+local themes = {}
+
+-- add color mappings for front panels
+colors.ivory      = colors.pink
+colors.green_hc   = colors.cyan
+colors.yellow_hc  = colors.purple
+colors.red_off    = colors.brown
+colors.yellow_off = colors.magenta
+colors.green_off  = colors.lime
+
+--#region Types
+
+---@enum UI_THEME
+themes.UI_THEME = { SMOOTH_STONE = 1, DEEPSLATE = 2 }
+themes.UI_THEME_NAMES = { "Smooth Stone", "Deepslate" }
+
+-- attempts to get the string name of a main ui theme
+---@nodiscard
+---@param id any
+---@return string|nil
+function themes.ui_theme_name(id)
+    if id == themes.UI_THEME.SMOOTH_STONE or
+       id == themes.UI_THEME.DEEPSLATE then
+        return themes.UI_THEME_NAMES[id]
+    else return nil end
+end
+
+---@enum FP_THEME
+themes.FP_THEME = { SANDSTONE = 1, BASALT = 2 }
+themes.FP_THEME_NAMES = { "Sandstone", "Basalt" }
+
+-- attempts to get the string name of a front panel theme
+---@nodiscard
+---@param id any
+---@return string|nil
+function themes.fp_theme_name(id)
+    if id == themes.FP_THEME.SANDSTONE or
+       id == themes.FP_THEME.BASALT then
+        return themes.FP_THEME_NAMES[id]
+    else return nil end
+end
+
+---@enum COLOR_MODE
+themes.COLOR_MODE = {
+    STANDARD = 1,
+    DEUTERANOPIA = 2,
+    PROTANOPIA = 3,
+    TRITANOPIA = 4,
+    BLUE_IND = 5,
+    STD_ON_BLACK = 6,
+    BLUE_ON_BLACK = 7,
+    NUM_MODES = 8
+}
+
+themes.COLOR_MODE_NAMES = {
+    "Standard",
+    "Deuteranopia",
+    "Protanopia",
+    "Tritanopia",
+    "Blue for 'Good'",
+    "Standard + Black",
+    "Blue + Black"
+}
+
+-- attempts to get the string name of a color mode
+---@nodiscard
+---@param id any
+---@return string|nil
+function themes.color_mode_name(id)
+    if id == themes.COLOR_MODE.STANDARD or
+       id == themes.COLOR_MODE.DEUTERANOPIA or
+       id == themes.COLOR_MODE.PROTANOPIA or
+       id == themes.COLOR_MODE.TRITANOPIA or
+       id == themes.COLOR_MODE.BLUE_IND or
+       id == themes.COLOR_MODE.STD_ON_BLACK or
+       id == themes.COLOR_MODE.BLUE_ON_BLACK then
+        return themes.COLOR_MODE_NAMES[id]
+    else return nil end
+end
+
+--#endregion
+
+--#region Front Panel Themes
+
+---@class fp_theme
+themes.sandstone = {
+    text = colors.black,
+    label = colors.lightGray,
+    label_dark = colors.gray,
+    disabled = colors.lightGray,
+    bg = colors.ivory,
+
+    header = cpair(colors.black, colors.lightGray),
+
+    highlight_box = cpair(colors.black, colors.lightGray),
+    highlight_box_bright = cpair(colors.black, colors.white),
+    field_box = cpair(colors.gray, colors.white),
+
+    colors = {
+        { c = colors.red,        hex = 0xdf4949 },
+        { c = colors.orange,     hex = 0xffb659 },
+        { c = colors.yellow,     hex = 0xf9fb53 },
+        { c = colors.green_off,  hex = 0x16665a },
+        { c = colors.green,      hex = 0x6be551 },
+        { c = colors.green_hc,   hex = 0x6be551 },
+        { c = colors.lightBlue,  hex = 0x6cc0f2 },
+        { c = colors.blue,       hex = 0x0096ff },
+        { c = colors.yellow_hc,  hex = 0xe3bc2a },
+        { c = colors.ivory,      hex = 0xdcd9ca },
+        { c = colors.yellow_off, hex = 0x85862c },
+        { c = colors.white,      hex = 0xf0f0f0 },
+        { c = colors.lightGray,  hex = 0xb1b8b3 },
+        { c = colors.gray,       hex = 0x575757 },
+        { c = colors.black,      hex = 0x191919 },
+        { c = colors.red_off,    hex = 0x672223 }
+    },
+
+    -- color re-mappings for assistive modes
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow,     hex = 0xf7c311 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red,        hex = 0xfb5615 },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- protanopia
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow,     hex = 0xf5e633 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red,        hex = 0xff521a },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- tritanopia
+        {
+            { c = colors.green,      hex = 0x40cbd7 },
+            { c = colors.green_hc,   hex = 0x40cbd7 },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow,     hex = 0xffbc00 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red,        hex = 0xff0000 },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- blue indicators
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x053466 },
+        },
+        -- standard, black backgrounds
+        {
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red_off,    hex = 0x141414 }
+        },
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.green,      hex = 0x1081ff },
+            { c = colors.green_hc,   hex = 0x1081ff },
+            { c = colors.green_off,  hex = 0x141414 },
+            { c = colors.yellow_off, hex = 0x141414 },
+            { c = colors.red_off,    hex = 0x141414 }
+        }
+    }
+}
+
+---@type fp_theme
+themes.basalt = {
+    text = colors.white,
+    label = colors.gray,
+    label_dark = colors.ivory,
+    disabled = colors.lightGray,
+    bg = colors.ivory,
+
+    header = cpair(colors.white, colors.gray),
+
+    highlight_box = cpair(colors.white, colors.gray),
+    highlight_box_bright = cpair(colors.black, colors.lightGray),
+    field_box = cpair(colors.white, colors.gray),
+
+    colors = {
+        { c = colors.red,        hex = 0xf18486 },
+        { c = colors.orange,     hex = 0xffb659 },
+        { c = colors.yellow,     hex = 0xefe37c },
+        { c = colors.green_off,  hex = 0x436b41 },
+        { c = colors.green,      hex = 0x7ae175 },
+        { c = colors.green_hc,   hex = 0x7ae175 },
+        { c = colors.lightBlue,  hex = 0x7dc6f2 },
+        { c = colors.blue,       hex = 0x56aae6 },
+        { c = colors.yellow_hc,  hex = 0xe9cd68 },
+        { c = colors.ivory,      hex = 0x4d4e52 },
+        { c = colors.yellow_off, hex = 0x757040 },
+        { c = colors.white,      hex = 0xbfbfbf },
+        { c = colors.lightGray,  hex = 0x848794 },
+        { c = colors.gray,       hex = 0x5c5f68 },
+        { c = colors.black,      hex = 0x333333 },
+        { c = colors.red_off,    hex = 0x512d2d }
+    },
+
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow,     hex = 0xf7c311 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red,        hex = 0xf18486 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- protanopia
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow,     hex = 0xf5e633 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red,        hex = 0xff8058 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- tritanopia
+        {
+            { c = colors.green,      hex = 0x00ecff },
+            { c = colors.green_hc,   hex = 0x00ecff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow,     hex = 0xffbc00 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red,        hex = 0xdf4949 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- blue indicators
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x365e8a },
+        },
+        -- standard, black backgrounds
+        {
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red_off,    hex = 0x333333 }
+        },
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.green,      hex = 0x65aeff },
+            { c = colors.green_hc,   hex = 0x99c9ff },
+            { c = colors.green_off,  hex = 0x333333 },
+            { c = colors.yellow_off, hex = 0x333333 },
+            { c = colors.red_off,    hex = 0x333333 }
+        }
+    }
+}
+
+-- get style fields for a front panel based on the provided theme
+---@param theme fp_theme
+function themes.get_fp_style(theme)
+    ---@class fp_style
+    local style =  {
+        root = cpair(theme.text, theme.bg),
+
+        text = cpair(theme.text, theme.bg),
+        text_fg = cpair(theme.text, colors._INHERIT),
+
+        label_fg = cpair(theme.label, colors._INHERIT),
+        label_d_fg = cpair(theme.label_dark, colors._INHERIT),
+
+        disabled_fg = cpair(theme.disabled, colors._INHERIT)
+    }
+
+    return style
+end
+
+--#endregion
+
+--#region Main UI Color Palettes
+
+---@class ui_palette
+themes.smooth_stone = {
+    colors = {
+        { c = colors.red,       hex = 0xdf4949 },
+        { c = colors.orange,    hex = 0xffb659 },
+        { c = colors.yellow,    hex = 0xfffc79 },
+        { c = colors.lime,      hex = 0x80ff80 },
+        { c = colors.green,     hex = 0x4aee8a },
+        { c = colors.cyan,      hex = 0x34bac8 },
+        { c = colors.lightBlue, hex = 0x6cc0f2 },
+        { c = colors.blue,      hex = 0x0096ff },
+        { c = colors.purple,    hex = 0xb156ee },
+        { c = colors.pink,      hex = 0xf26ba2 },
+        { c = colors.magenta,   hex = 0xf9488a },
+        { c = colors.white,     hex = 0xf0f0f0 },
+        { c = colors.lightGray, hex = 0xcacaca },
+        { c = colors.gray,      hex = 0x575757 },
+        { c = colors.black,     hex = 0x191919 },
+        { c = colors.brown,     hex = 0x7f664c }
+    },
+
+    -- color re-mappings for assistive modes
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xf7c311 },
+            { c = colors.red,    hex = 0xfb5615 }
+        },
+        -- protanopia
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xf5e633 },
+            { c = colors.red,    hex = 0xff521a }
+        },
+        -- tritanopia
+        {
+            { c = colors.blue,   hex = 0x40cbd7 },
+            { c = colors.yellow, hex = 0xffbc00 },
+            { c = colors.red,    hex = 0xff0000 }
+        },
+        -- blue indicators
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xfffc79 },
+            { c = colors.red,    hex = 0xdf4949 }
+        },
+        -- standard, black backgrounds
+        {},
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.blue,   hex = 0x1081ff },
+            { c = colors.yellow, hex = 0xfffc79 },
+            { c = colors.red,    hex = 0xdf4949 }
+        }
+    }
+}
+
+---@type ui_palette
+themes.deepslate = {
+    colors = {
+        { c = colors.red,       hex = 0xeb6a6c },
+        { c = colors.orange,    hex = 0xf2b86c },
+        { c = colors.yellow,    hex = 0xd9cf81 },
+        { c = colors.lime,      hex = 0x80ff80 },
+        { c = colors.green,     hex = 0x70e19b },
+        { c = colors.cyan,      hex = 0x7ccdd0 },
+        { c = colors.lightBlue, hex = 0x99ceef },
+        { c = colors.blue,      hex = 0x60bcff },
+        { c = colors.purple,    hex = 0xc38aea },
+        { c = colors.pink,      hex = 0xff7fb8 },
+        { c = colors.magenta,   hex = 0xf980dd },
+        { c = colors.white,     hex = 0xd9d9d9 },
+        { c = colors.lightGray, hex = 0x949494 },
+        { c = colors.gray,      hex = 0x575757 },
+        { c = colors.black,     hex = 0x262626 },
+        { c = colors.brown,     hex = 0xb18f6a }
+    },
+
+    -- color re-mappings for assistive modes
+    color_modes = {
+        -- standard
+        {},
+        -- deuteranopia
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xf7c311 },
+            { c = colors.red,    hex = 0xfb5615 }
+        },
+        -- protanopia
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xf5e633 },
+            { c = colors.red,    hex = 0xff8058 }
+        },
+        -- tritanopia
+        {
+            { c = colors.blue,   hex = 0x00ecff },
+            { c = colors.yellow, hex = 0xffbc00 },
+            { c = colors.red,    hex = 0xdf4949 }
+        },
+        -- blue indicators
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xd9cf81 },
+            { c = colors.red,    hex = 0xeb6a6c }
+        },
+        -- standard, black backgrounds
+        {},
+        -- blue indicators, black backgrounds
+        {
+            { c = colors.blue,   hex = 0x65aeff },
+            { c = colors.yellow, hex = 0xd9cf81 },
+            { c = colors.red,    hex = 0xeb6a6c }
+        }
+    }
+}
+
+--#endregion
+
+return themes

imgen.py

@@ -48,6 +48,7 @@ def make_manifest(size):
         "versions" : {
             "installer" : get_version("./ccmsi.lua"),
             "bootloader" : get_version("./startup.lua"),
+            "common" : get_version("./scada-common/util.lua", True),
             "comms" : get_version("./scada-common/comms.lua", True),
             "graphics" : get_version("./graphics/core.lua", True),
             "lockbox" : get_version("./lockbox/init.lua", True),
@@ -59,7 +60,7 @@ def make_manifest(size):
         },
         "files" : {
             # common files
-            "system" : [ "initenv.lua", "startup.lua" ],
+            "system" : [ "initenv.lua", "startup.lua", "configure.lua", "LICENSE" ],
             "common" : list_files("./scada-common"),
             "graphics" : list_files("./graphics"),
             "lockbox" : list_files("./lockbox"),
@@ -81,7 +82,7 @@ def make_manifest(size):
             # manifest file estimate
             "manifest" : size,
             # common files
-            "system" : os.path.getsize("initenv.lua") + os.path.getsize("startup.lua"),
+            "system" : os.path.getsize("initenv.lua") + os.path.getsize("startup.lua") + os.path.getsize("configure.lua"),
             "common" : dir_size("./scada-common"),
             "graphics" : dir_size("./graphics"),
             "lockbox" : dir_size("./lockbox"),

initenv.lua

@@ -1,18 +1,8 @@
---
--- Initialize the Post-Boot Module Environment
---
-
 return {
-    -- initialize booted environment
-    init_env = function ()
-        local _require = require("cc.require")
-        local _env = setmetatable({}, { __index = _ENV })
-
-        -- overwrite require/package globals
-        require, package = _require.make(_env, "/")
-
-        -- reset terminal
-        term.clear()
-        term.setCursorPos(1, 1)
-    end
+-- initialize booted environment
+init_env = function ()
+    local _require, _env = require("cc.require"), setmetatable({}, { __index = _ENV })
+    require, package = _require.make(_env, "/")
+    term.clear(); term.setCursorPos(1, 1)
+end
 }

lockbox/digest/md5.lua

@@ -1,5 +1,3 @@
-require("lockbox").insecure();
-
 local Bit = require("lockbox.util.bit");
 local String = require("string");
 local Math = require("math");

lockbox/digest/sha1.lua

@@ -1,5 +1,3 @@
-require("lockbox").insecure();
-
 local Bit = require("lockbox.util.bit");
 local String = require("string");
 local Math = require("math");

lockbox/init.lua

@@ -1,25 +1,6 @@
-local Lockbox = {};
+local Lockbox = {}
 
 -- cc-mek-scada lockbox version
-Lockbox.version = "1.0"
+Lockbox.version = "1.1"
 
---[[
-package.path =  "./?.lua;"
-                .. "./cipher/?.lua;"
-                .. "./digest/?.lua;"
-                .. "./kdf/?.lua;"
-                .. "./mac/?.lua;"
-                .. "./padding/?.lua;"
-                .. "./test/?.lua;"
-                .. "./util/?.lua;"
-                .. package.path;
---]]
-Lockbox.ALLOW_INSECURE = true;
-
-Lockbox.insecure = function()
-    assert(Lockbox.ALLOW_INSECURE,
-            "This module is insecure!  It should not be used in production." ..
-            "If you really want to use it, set Lockbox.ALLOW_INSECURE to true before importing it");
-end
-
-return Lockbox;
+return Lockbox

lockbox/mac/hmac.lua

@@ -8,7 +8,7 @@ local HMAC = function()
 
     local public = {};
     local blockSize = 64;
-    local Digest = nil;
+    local Digest;
     local outerPadding = {};
     local innerPadding = {}
     local digest;

lockbox/util/array.lua

@@ -1,4 +1,3 @@
-
 local String = require("string");
 local Bit = require("lockbox.util.bit");
 local Queue = require("lockbox.util.queue");

pocket/config.lua

@@ -1,27 +0,0 @@
-local config = {}
-
--- supervisor comms channel
-config.SVR_CHANNEL = 16240
--- coordinator comms channel
-config.CRD_CHANNEL = 16243
--- pocket comms channel
-config.PKT_CHANNEL = 16244
--- max trusted modem message distance (0 to disable check)
-config.TRUSTED_RANGE = 0
--- time in seconds (>= 2) before assuming a remote device is no longer active
-config.COMMS_TIMEOUT = 5
--- facility authentication key (do NOT use one of your passwords)
--- this enables verifying that messages are authentic
--- all devices on the same network must use the same key
--- config.AUTH_KEY = "SCADAfacility123"
-
--- log path
-config.LOG_PATH = "/log.txt"
--- log mode
---  0 = APPEND (adds to existing file on start)
---  1 = NEW (replaces existing file on start)
-config.LOG_MODE = 0
--- true to log verbose debug messages
-config.LOG_DEBUG = false
-
-return config

pocket/configure.lua

@@ -0,0 +1,594 @@
+--
+-- Configuration GUI
+--
+
+local log         = require("scada-common.log")
+local types       = require("scada-common.types")
+local util        = require("scada-common.util")
+
+local core        = require("graphics.core")
+local themes      = require("graphics.themes")
+
+local DisplayBox  = require("graphics.elements.displaybox")
+local Div         = require("graphics.elements.div")
+local ListBox     = require("graphics.elements.listbox")
+local MultiPane   = require("graphics.elements.multipane")
+local TextBox     = require("graphics.elements.textbox")
+
+local CheckBox    = require("graphics.elements.controls.checkbox")
+local PushButton  = require("graphics.elements.controls.push_button")
+local RadioButton = require("graphics.elements.controls.radio_button")
+
+local NumberField = require("graphics.elements.form.number_field")
+local TextField   = require("graphics.elements.form.text_field")
+
+local println = util.println
+local tri = util.trinary
+
+local cpair = core.cpair
+
+local LEFT = core.ALIGN.LEFT
+local CENTER = core.ALIGN.CENTER
+local RIGHT = core.ALIGN.RIGHT
+
+-- changes to the config data/format to let the user know
+local changes = {
+    { "v0.9.2", { "Added temperature scale options" } }
+}
+
+---@class pkt_configurator
+local configurator = {}
+
+local style = {}
+
+style.root = cpair(colors.black, colors.lightGray)
+style.header = cpair(colors.white, colors.gray)
+
+style.colors = themes.smooth_stone.colors
+
+local bw_fg_bg = cpair(colors.black, colors.white)
+local g_lg_fg_bg = cpair(colors.gray, colors.lightGray)
+local nav_fg_bg = bw_fg_bg
+local btn_act_fg_bg = cpair(colors.white, colors.gray)
+local dis_fg_bg = cpair(colors.lightGray,colors.white)
+
+local tool_ctl = {
+    ask_config = false,
+    has_config = false,
+    viewing_config = false,
+    importing_legacy = false,
+
+    view_cfg = nil,         ---@type graphics_element
+    settings_apply = nil,   ---@type graphics_element
+
+    set_networked = nil,    ---@type function
+    bundled_emcool = nil,   ---@type function
+    gen_summary = nil,      ---@type function
+    show_current_cfg = nil, ---@type function
+    load_legacy = nil,      ---@type function
+
+    show_auth_key = nil,    ---@type function
+    show_key_btn = nil,     ---@type graphics_element
+    auth_key_textbox = nil, ---@type graphics_element
+    auth_key_value = ""
+}
+
+---@class pkt_config
+local tmp_cfg = {
+    TempScale = 1,
+    SVR_Channel = nil,  ---@type integer
+    CRD_Channel = nil,  ---@type integer
+    PKT_Channel = nil,  ---@type integer
+    ConnTimeout = nil,  ---@type number
+    TrustedRange = nil, ---@type number
+    AuthKey = nil,      ---@type string|nil
+    LogMode = 0,
+    LogPath = "",
+    LogDebug = false,
+}
+
+---@class pkt_config
+local ini_cfg = {}
+---@class pkt_config
+local settings_cfg = {}
+
+-- all settings fields, their nice names, and their default values
+local fields = {
+    { "TempScale", "Temperature Scale", 1 },
+    { "SVR_Channel", "SVR Channel", 16240 },
+    { "CRD_Channel", "CRD Channel", 16243 },
+    { "PKT_Channel", "PKT Channel", 16244 },
+    { "ConnTimeout", "Connection Timeout", 5 },
+    { "TrustedRange", "Trusted Range", 0 },
+    { "AuthKey", "Facility Auth Key" , ""},
+    { "LogMode", "Log Mode", log.MODE.APPEND },
+    { "LogPath", "Log Path", "/log.txt" },
+    { "LogDebug", "Log Debug Messages", false }
+}
+
+-- load data from the settings file
+---@param target pkt_config
+---@param raw boolean? true to not use default values
+local function load_settings(target, raw)
+    for _, v in pairs(fields) do settings.unset(v[1]) end
+
+    local loaded = settings.load("/pocket.settings")
+
+    for _, v in pairs(fields) do target[v[1]] = settings.get(v[1], tri(raw, nil, v[3])) end
+
+    return loaded
+end
+
+-- create the config view
+---@param display graphics_element
+local function config_view(display)
+---@diagnostic disable-next-line: undefined-field
+    local function exit() os.queueEvent("terminate") end
+
+    TextBox{parent=display,y=1,text="Pocket Configurator",alignment=CENTER,height=1,fg_bg=style.header}
+
+    local root_pane_div = Div{parent=display,x=1,y=2}
+
+    local main_page = Div{parent=root_pane_div,x=1,y=1}
+    local ui_cfg = Div{parent=root_pane_div,x=1,y=1}
+    local net_cfg = Div{parent=root_pane_div,x=1,y=1}
+    local log_cfg = Div{parent=root_pane_div,x=1,y=1}
+    local summary = Div{parent=root_pane_div,x=1,y=1}
+    local changelog = Div{parent=root_pane_div,x=1,y=1}
+
+    local main_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes={main_page,ui_cfg,net_cfg,log_cfg,summary,changelog}}
+
+    -- Main Page
+
+    local y_start = 7
+
+    TextBox{parent=main_page,x=2,y=2,height=4,text="Welcome to the Pocket configurator! Please select one of the following options."}
+
+    if tool_ctl.ask_config then
+        TextBox{parent=main_page,x=2,y=y_start,height=4,width=49,text="Please configure before starting up.",fg_bg=cpair(colors.red,colors.lightGray)}
+        y_start = y_start + 3
+    end
+
+    local function view_config()
+        tool_ctl.viewing_config = true
+        tool_ctl.gen_summary(settings_cfg)
+        tool_ctl.settings_apply.hide(true)
+        main_pane.set_value(5)
+    end
+
+    if fs.exists("/pocket/config.lua") then
+        PushButton{parent=main_page,x=2,y=y_start,min_width=22,text="Import Legacy Config",callback=function()tool_ctl.load_legacy()end,fg_bg=cpair(colors.black,colors.cyan),active_fg_bg=btn_act_fg_bg}
+        y_start = y_start + 2
+    end
+
+    PushButton{parent=main_page,x=2,y=y_start,min_width=18,text="Configure Device",callback=function()main_pane.set_value(2)end,fg_bg=cpair(colors.black,colors.blue),active_fg_bg=btn_act_fg_bg}
+    tool_ctl.view_cfg = PushButton{parent=main_page,x=2,y=y_start+2,min_width=20,text="View Configuration",callback=view_config,fg_bg=cpair(colors.black,colors.blue),active_fg_bg=btn_act_fg_bg,dis_fg_bg=dis_fg_bg}
+
+    if not tool_ctl.has_config then tool_ctl.view_cfg.disable() end
+
+    PushButton{parent=main_page,x=2,y=18,min_width=6,text="Exit",callback=exit,fg_bg=cpair(colors.black,colors.red),active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=main_page,x=14,y=18,min_width=12,text="Change Log",callback=function()main_pane.set_value(6)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    --#region Pocket UI
+
+    local ui_c_1 = Div{parent=ui_cfg,x=2,y=4,width=24}
+
+    TextBox{parent=ui_cfg,x=1,y=2,height=1,text=" Pocket UI",fg_bg=cpair(colors.black,colors.lime)}
+
+    TextBox{parent=ui_c_1,x=1,y=1,height=3,text="You may use the options below to customize formats."}
+
+    TextBox{parent=ui_c_1,x=1,y=5,height=1,text="Temperature Scale"}
+    local temp_scale = RadioButton{parent=ui_c_1,x=1,y=6,default=ini_cfg.TempScale,options=types.TEMP_SCALE_NAMES,callback=function()end,radio_colors=cpair(colors.lightGray,colors.black),select_color=colors.lime}
+
+    local function submit_ui_opts()
+        tmp_cfg.TempScale = temp_scale.get_value()
+        main_pane.set_value(3)
+    end
+
+    PushButton{parent=ui_c_1,x=1,y=15,text="\x1b Back",callback=function()main_pane.set_value(1)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=ui_c_1,x=19,y=15,text="Next \x1a",callback=submit_ui_opts,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    --#endregion
+
+    --#region Network
+
+    local net_c_1 = Div{parent=net_cfg,x=2,y=4,width=24}
+    local net_c_2 = Div{parent=net_cfg,x=2,y=4,width=24}
+    local net_c_3 = Div{parent=net_cfg,x=2,y=4,width=24}
+    local net_c_4 = Div{parent=net_cfg,x=2,y=4,width=24}
+
+    local net_pane = MultiPane{parent=net_cfg,x=1,y=4,panes={net_c_1,net_c_2,net_c_3,net_c_4}}
+
+    TextBox{parent=net_cfg,x=1,y=2,height=1,text=" Network Configuration",fg_bg=cpair(colors.black,colors.lightBlue)}
+
+    TextBox{parent=net_c_1,x=1,y=1,height=1,text="Set network channels."}
+    TextBox{parent=net_c_1,x=1,y=3,height=4,text="Each of the named channels must be the same within a particular SCADA network.",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_1,x=1,y=8,height=1,width=18,text="Supervisor Channel"}
+    local svr_chan = NumberField{parent=net_c_1,x=1,y=9,width=7,default=ini_cfg.SVR_Channel,min=1,max=65535,fg_bg=bw_fg_bg}
+    TextBox{parent=net_c_1,x=9,y=9,height=4,text="[SVR_CHANNEL]",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_1,x=1,y=10,height=1,width=19,text="Coordinator Channel"}
+    local crd_chan = NumberField{parent=net_c_1,x=1,y=11,width=7,default=ini_cfg.CRD_Channel,min=1,max=65535,fg_bg=bw_fg_bg}
+    TextBox{parent=net_c_1,x=9,y=11,height=4,text="[CRD_CHANNEL]",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_1,x=1,y=12,height=1,width=14,text="Pocket Channel"}
+    local pkt_chan = NumberField{parent=net_c_1,x=1,y=13,width=7,default=ini_cfg.PKT_Channel,min=1,max=65535,fg_bg=bw_fg_bg}
+    TextBox{parent=net_c_1,x=9,y=13,height=4,text="[PKT_CHANNEL]",fg_bg=g_lg_fg_bg}
+
+    local chan_err = TextBox{parent=net_c_1,x=1,y=14,height=1,width=24,text="Please set all channels.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_channels()
+        local svr_c, crd_c, pkt_c = tonumber(svr_chan.get_value()), tonumber(crd_chan.get_value()), tonumber(pkt_chan.get_value())
+        if svr_c ~= nil and crd_c ~= nil and pkt_c ~= nil then
+            tmp_cfg.SVR_Channel, tmp_cfg.CRD_Channel, tmp_cfg.PKT_Channel = svr_c, crd_c, pkt_c
+            net_pane.set_value(2)
+            chan_err.hide(true)
+        else chan_err.show() end
+    end
+
+    PushButton{parent=net_c_1,x=1,y=15,text="\x1b Back",callback=function()main_pane.set_value(2)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=net_c_1,x=19,y=15,text="Next \x1a",callback=submit_channels,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=net_c_2,x=1,y=1,height=1,text="Set connection timeout."}
+    TextBox{parent=net_c_2,x=1,y=3,height=7,text="You generally should not need to modify this. On slow servers, you can try to increase this to make the system wait longer before assuming a disconnection.",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_2,x=1,y=11,height=1,width=19,text="Connection Timeout"}
+    local timeout = NumberField{parent=net_c_2,x=1,y=12,width=7,default=ini_cfg.ConnTimeout,min=2,max=25,max_chars=6,max_frac_digits=2,allow_decimal=true,fg_bg=bw_fg_bg}
+
+    TextBox{parent=net_c_2,x=9,y=12,height=2,text="seconds\n(default 5)",fg_bg=g_lg_fg_bg}
+
+    local ct_err = TextBox{parent=net_c_2,x=1,y=14,height=1,width=24,text="Please set timeout.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_timeouts()
+        local timeout_val = tonumber(timeout.get_value())
+        if timeout_val ~= nil then
+            tmp_cfg.ConnTimeout = timeout_val
+            net_pane.set_value(3)
+            ct_err.hide(true)
+        else ct_err.show() end
+    end
+
+    PushButton{parent=net_c_2,x=1,y=15,text="\x1b Back",callback=function()net_pane.set_value(1)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=net_c_2,x=19,y=15,text="Next \x1a",callback=submit_timeouts,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=net_c_3,x=1,y=1,height=1,text="Set the trusted range."}
+    TextBox{parent=net_c_3,x=1,y=3,height=4,text="Setting this to a value larger than 0 prevents connections with devices that many blocks away.",fg_bg=g_lg_fg_bg}
+    TextBox{parent=net_c_3,x=1,y=8,height=4,text="This is optional. You can disable this functionality by setting the value to 0.",fg_bg=g_lg_fg_bg}
+
+    local range = NumberField{parent=net_c_3,x=1,y=13,width=10,default=ini_cfg.TrustedRange,min=0,max_chars=20,allow_decimal=true,fg_bg=bw_fg_bg}
+
+    local tr_err = TextBox{parent=net_c_3,x=1,y=14,height=1,width=24,text="Set the trusted range.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_tr()
+        local range_val = tonumber(range.get_value())
+        if range_val ~= nil then
+            tmp_cfg.TrustedRange = range_val
+            net_pane.set_value(4)
+            tr_err.hide(true)
+        else tr_err.show() end
+    end
+
+    PushButton{parent=net_c_3,x=1,y=15,text="\x1b Back",callback=function()net_pane.set_value(2)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=net_c_3,x=19,y=15,text="Next \x1a",callback=submit_tr,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=net_c_4,x=1,y=1,height=4,text="Optionally, set the facility authentication key. Do NOT use one of your passwords."}
+    TextBox{parent=net_c_4,x=1,y=6,height=6,text="This enables verifying that messages are authentic, so it is intended for security on multiplayer servers.",fg_bg=g_lg_fg_bg}
+
+    TextBox{parent=net_c_4,x=1,y=12,height=1,text="Facility Auth Key"}
+    local key, _, censor = TextField{parent=net_c_4,x=1,y=13,max_len=64,value=ini_cfg.AuthKey,width=24,height=1,fg_bg=bw_fg_bg}
+
+    local function censor_key(enable) censor(util.trinary(enable, "*", nil)) end
+
+    -- declare back first so tabbing makes sense visually
+    PushButton{parent=net_c_4,x=1,y=15,text="\x1b Back",callback=function()net_pane.set_value(3)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    local hide_key = CheckBox{parent=net_c_4,x=8,y=15,label="Hide Key",box_fg_bg=cpair(colors.lightBlue,colors.black),callback=censor_key}
+
+    hide_key.set_value(true)
+    censor_key(true)
+
+    local key_err = TextBox{parent=net_c_4,x=1,y=14,height=1,width=24,text="Length must be > 7.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_auth()
+        local v = key.get_value()
+        if string.len(v) == 0 or string.len(v) >= 8 then
+            tmp_cfg.AuthKey = key.get_value()
+            main_pane.set_value(4)
+            key_err.hide(true)
+        else key_err.show() end
+    end
+
+    PushButton{parent=net_c_4,x=19,y=15,text="Next \x1a",callback=submit_auth,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    --#endregion
+
+    --#region Logging
+
+    local log_c_1 = Div{parent=log_cfg,x=2,y=4,width=24}
+
+    TextBox{parent=log_cfg,x=1,y=2,height=1,text=" Logging Configuration",fg_bg=cpair(colors.black,colors.pink)}
+
+    TextBox{parent=log_c_1,x=1,y=1,height=1,text="Configure logging below."}
+
+    TextBox{parent=log_c_1,x=1,y=3,height=1,text="Log File Mode"}
+    local mode = RadioButton{parent=log_c_1,x=1,y=4,default=ini_cfg.LogMode+1,options={"Append on Startup","Replace on Startup"},callback=function()end,radio_colors=cpair(colors.lightGray,colors.black),select_color=colors.pink}
+
+    TextBox{parent=log_c_1,x=1,y=7,height=1,text="Log File Path"}
+    local path = TextField{parent=log_c_1,x=1,y=8,width=24,height=1,value=ini_cfg.LogPath,max_len=128,fg_bg=bw_fg_bg}
+
+    local en_dbg = CheckBox{parent=log_c_1,x=1,y=10,default=ini_cfg.LogDebug,label="Enable Debug Messages",box_fg_bg=cpair(colors.pink,colors.black)}
+    TextBox{parent=log_c_1,x=3,y=11,height=4,text="This results in much larger log files. Use only as needed.",fg_bg=g_lg_fg_bg}
+
+    local path_err = TextBox{parent=log_c_1,x=1,y=14,height=1,width=24,text="Provide a log file path.",fg_bg=cpair(colors.red,colors.lightGray),hidden=true}
+
+    local function submit_log()
+        if path.get_value() ~= "" then
+            path_err.hide(true)
+            tmp_cfg.LogMode = mode.get_value() - 1
+            tmp_cfg.LogPath = path.get_value()
+            tmp_cfg.LogDebug = en_dbg.get_value()
+            tool_ctl.gen_summary(tmp_cfg)
+            tool_ctl.viewing_config = false
+            tool_ctl.importing_legacy = false
+            tool_ctl.settings_apply.show()
+            main_pane.set_value(5)
+        else path_err.show() end
+    end
+
+    PushButton{parent=log_c_1,x=1,y=15,text="\x1b Back",callback=function()main_pane.set_value(3)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=log_c_1,x=19,y=15,text="Next \x1a",callback=submit_log,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    --#endregion
+
+    --#region Summary and Saving
+
+    local sum_c_1 = Div{parent=summary,x=2,y=4,width=24}
+    local sum_c_2 = Div{parent=summary,x=2,y=4,width=24}
+    local sum_c_3 = Div{parent=summary,x=2,y=4,width=24}
+    local sum_c_4 = Div{parent=summary,x=2,y=4,width=24}
+
+    local sum_pane = MultiPane{parent=summary,x=1,y=4,panes={sum_c_1,sum_c_2,sum_c_3,sum_c_4}}
+
+    TextBox{parent=summary,x=1,y=2,height=1,text=" Summary",fg_bg=cpair(colors.black,colors.green)}
+
+    local setting_list = ListBox{parent=sum_c_1,x=1,y=1,height=11,width=24,scroll_height=100,fg_bg=bw_fg_bg,nav_fg_bg=g_lg_fg_bg,nav_active=cpair(colors.black,colors.gray)}
+
+    local function back_from_summary()
+        if tool_ctl.viewing_config or tool_ctl.importing_legacy then
+            main_pane.set_value(1)
+            tool_ctl.viewing_config = false
+            tool_ctl.importing_legacy = false
+            tool_ctl.settings_apply.show()
+        else
+            main_pane.set_value(4)
+        end
+    end
+
+    ---@param element graphics_element
+    ---@param data any
+    local function try_set(element, data)
+        if data ~= nil then element.set_value(data) end
+    end
+
+    local function save_and_continue()
+        for k, v in pairs(tmp_cfg) do settings.set(k, v) end
+
+        if settings.save("/pocket.settings") then
+            load_settings(settings_cfg, true)
+            load_settings(ini_cfg)
+
+            try_set(svr_chan, ini_cfg.SVR_Channel)
+            try_set(crd_chan, ini_cfg.CRD_Channel)
+            try_set(pkt_chan, ini_cfg.PKT_Channel)
+            try_set(timeout, ini_cfg.ConnTimeout)
+            try_set(range, ini_cfg.TrustedRange)
+            try_set(key, ini_cfg.AuthKey)
+            try_set(mode, ini_cfg.LogMode)
+            try_set(path, ini_cfg.LogPath)
+            try_set(en_dbg, ini_cfg.LogDebug)
+
+            tool_ctl.view_cfg.enable()
+
+            if tool_ctl.importing_legacy then
+                tool_ctl.importing_legacy = false
+                sum_pane.set_value(3)
+            else
+                sum_pane.set_value(2)
+            end
+        else
+            sum_pane.set_value(4)
+        end
+    end
+
+    PushButton{parent=sum_c_1,x=1,y=15,text="\x1b Back",callback=back_from_summary,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    tool_ctl.show_key_btn = PushButton{parent=sum_c_1,x=1,y=13,min_width=17,text="Unhide Auth Key",callback=function()tool_ctl.show_auth_key()end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg,dis_fg_bg=dis_fg_bg}
+    tool_ctl.settings_apply = PushButton{parent=sum_c_1,x=18,y=15,min_width=7,text="Apply",callback=save_and_continue,fg_bg=cpair(colors.black,colors.green),active_fg_bg=btn_act_fg_bg}
+
+    TextBox{parent=sum_c_2,x=1,y=1,height=1,text="Settings saved!"}
+
+    local function go_home()
+        main_pane.set_value(1)
+        net_pane.set_value(1)
+        sum_pane.set_value(1)
+    end
+
+    PushButton{parent=sum_c_2,x=1,y=15,min_width=6,text="Home",callback=go_home,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=sum_c_2,x=19,y=15,min_width=6,text="Exit",callback=exit,fg_bg=cpair(colors.black,colors.red),active_fg_bg=cpair(colors.white,colors.gray)}
+
+    TextBox{parent=sum_c_3,x=1,y=1,height=4,text="The old config.lua file will now be deleted, then the configurator will exit."}
+
+    local function delete_legacy()
+        fs.delete("/pocket/config.lua")
+        exit()
+    end
+
+    PushButton{parent=sum_c_3,x=1,y=15,min_width=8,text="Cancel",callback=go_home,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=sum_c_3,x=19,y=15,min_width=6,text="OK",callback=delete_legacy,fg_bg=cpair(colors.black,colors.green),active_fg_bg=cpair(colors.white,colors.gray)}
+
+    TextBox{parent=sum_c_4,x=1,y=1,height=8,text="Failed to save the settings file.\n\nThere may not be enough space for the modification or server file permissions may be denying writes."}
+    PushButton{parent=sum_c_4,x=1,y=15,min_width=6,text="Home",callback=go_home,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+    PushButton{parent=sum_c_4,x=19,y=15,min_width=6,text="Exit",callback=exit,fg_bg=cpair(colors.black,colors.red),active_fg_bg=cpair(colors.white,colors.gray)}
+
+    --#endregion
+
+    -- Config Change Log
+
+    local cl = Div{parent=changelog,x=2,y=4,width=24}
+
+    TextBox{parent=changelog,x=1,y=2,height=1,text=" Config Change Log",fg_bg=bw_fg_bg}
+
+    local c_log = ListBox{parent=cl,x=1,y=1,height=13,width=24,scroll_height=100,fg_bg=bw_fg_bg,nav_fg_bg=g_lg_fg_bg,nav_active=cpair(colors.black,colors.gray)}
+
+    for _, change in ipairs(changes) do
+        TextBox{parent=c_log,text=change[1],height=1,fg_bg=bw_fg_bg}
+        for _, v in ipairs(change[2]) do
+            local e = Div{parent=c_log,height=#util.strwrap(v,21)}
+            TextBox{parent=e,y=1,x=1,text="- ",height=1,fg_bg=cpair(colors.gray,colors.white)}
+            TextBox{parent=e,y=1,x=3,text=v,height=e.get_height(),fg_bg=cpair(colors.gray,colors.white)}
+        end
+    end
+
+    PushButton{parent=cl,x=1,y=15,text="\x1b Back",callback=function()main_pane.set_value(1)end,fg_bg=nav_fg_bg,active_fg_bg=btn_act_fg_bg}
+
+    -- set tool functions now that we have the elements
+
+    -- load a legacy config file
+    function tool_ctl.load_legacy()
+        local config = require("pocket.config")
+
+        tmp_cfg.SVR_Channel = config.SVR_CHANNEL
+        tmp_cfg.CRD_Channel = config.CRD_CHANNEL
+        tmp_cfg.PKT_Channel = config.PKT_CHANNEL
+        tmp_cfg.ConnTimeout = config.COMMS_TIMEOUT
+        tmp_cfg.TrustedRange = config.TRUSTED_RANGE
+        tmp_cfg.AuthKey = config.AUTH_KEY or ""
+
+        tmp_cfg.LogMode = config.LOG_MODE
+        tmp_cfg.LogPath = config.LOG_PATH
+        tmp_cfg.LogDebug = config.LOG_DEBUG or false
+
+        tool_ctl.gen_summary(tmp_cfg)
+        sum_pane.set_value(1)
+        main_pane.set_value(5)
+        tool_ctl.importing_legacy = true
+    end
+
+    -- expose the auth key on the summary page
+    function tool_ctl.show_auth_key()
+        tool_ctl.show_key_btn.disable()
+        tool_ctl.auth_key_textbox.set_value(tool_ctl.auth_key_value)
+    end
+
+    -- generate the summary list
+    ---@param cfg pkt_config
+    function tool_ctl.gen_summary(cfg)
+        setting_list.remove_all()
+
+        local alternate = false
+        local inner_width = setting_list.get_width() - 1
+
+        tool_ctl.show_key_btn.enable()
+        tool_ctl.auth_key_value = cfg.AuthKey or "" -- to show auth key
+
+        for i = 1, #fields do
+            local f = fields[i]
+            local height = 1
+            local label_w = string.len(f[2])
+            local val_max_w = (inner_width - label_w) - 1
+            local raw = cfg[f[1]]
+            local val = util.strval(raw)
+
+            if f[1] == "AuthKey" then
+                val = string.rep("*", string.len(val))
+            elseif f[1] == "LogMode" then
+                val = util.trinary(raw == log.MODE.APPEND, "append", "replace")
+            elseif f[1] == "TempScale" then
+                val = types.TEMP_SCALE_NAMES[raw]
+            end
+
+            if val == "nil" then val = "<not set>" end
+
+            local c = util.trinary(alternate, g_lg_fg_bg, cpair(colors.gray,colors.white))
+            alternate = not alternate
+
+            if string.len(val) > val_max_w then
+                local lines = util.strwrap(val, inner_width)
+                height = #lines + 1
+            end
+
+            local line = Div{parent=setting_list,height=height,fg_bg=c}
+            TextBox{parent=line,text=f[2],width=string.len(f[2]),fg_bg=cpair(colors.black,line.get_fg_bg().bkg)}
+
+            local textbox
+            if height > 1 then
+                textbox = TextBox{parent=line,x=1,y=2,text=val,height=height-1,alignment=LEFT}
+            else
+                textbox = TextBox{parent=line,x=label_w+1,y=1,text=val,alignment=RIGHT}
+            end
+
+            if f[1] == "AuthKey" then tool_ctl.auth_key_textbox = textbox end
+        end
+    end
+end
+
+-- reset terminal screen
+local function reset_term()
+    term.setTextColor(colors.white)
+    term.setBackgroundColor(colors.black)
+    term.clear()
+    term.setCursorPos(1, 1)
+end
+
+-- run the pcoket configurator
+---@param ask_config? boolean indicate if this is being called by the startup app due to an invalid configuration
+function configurator.configure(ask_config)
+    tool_ctl.ask_config = ask_config == true
+
+    load_settings(settings_cfg, true)
+    tool_ctl.has_config = load_settings(ini_cfg)
+
+    reset_term()
+
+    -- set overridden colors
+    for i = 1, #style.colors do
+        term.setPaletteColor(style.colors[i].c, style.colors[i].hex)
+    end
+
+    local status, error = pcall(function ()
+        local display = DisplayBox{window=term.current(),fg_bg=style.root}
+        config_view(display)
+
+        while true do
+            local event, param1, param2, param3 = util.pull_event()
+
+            -- handle event
+            if event == "mouse_click" or event == "mouse_up" or event == "mouse_drag" or event == "mouse_scroll" or event == "double_click" then
+                local m_e = core.events.new_mouse_event(event, param1, param2, param3)
+                if m_e then display.handle_mouse(m_e) end
+            elseif event == "char" or event == "key" or event == "key_up" then
+                local k_e = core.events.new_key_event(event, param1, param2)
+                if k_e then display.handle_key(k_e) end
+            elseif event == "paste" then
+                display.handle_paste(param1)
+            end
+
+            if event == "terminate" then return end
+        end
+    end)
+
+    -- restore colors
+    for i = 1, #style.colors do
+        local r, g, b = term.nativePaletteColor(style.colors[i].c)
+        term.setPaletteColor(style.colors[i].c, r, g, b)
+    end
+
+    reset_term()
+    if not status then
+        println("configurator error: " .. error)
+    end
+
+    return status, error
+end
+
+return configurator

pocket/coreio.lua

@@ -1,35 +0,0 @@
---
--- Core I/O - Pocket Central I/O Management
---
-
-local psil = require("scada-common.psil")
-
-local coreio = {}
-
----@class pocket_core_io
-local io = {
-    ps = psil.create()
-}
-
----@enum POCKET_LINK_STATE
-local LINK_STATE = {
-    UNLINKED = 0,
-    SV_LINK_ONLY = 1,
-    API_LINK_ONLY = 2,
-    LINKED = 3
-}
-
-coreio.LINK_STATE = LINK_STATE
-
--- get the core PSIL
-function coreio.core_ps()
-    return io.ps
-end
-
--- set network link state
----@param state POCKET_LINK_STATE
-function coreio.report_link_state(state)
-    io.ps.publish("link_state", state)
-end
-
-return coreio

pocket/iocontrol.lua

@@ -0,0 +1,862 @@
+--
+-- I/O Control for Pocket Integration with Supervisor & Coordinator
+--
+
+local const = require("scada-common.constants")
+-- local log   = require("scada-common.log")
+local psil  = require("scada-common.psil")
+local types = require("scada-common.types")
+local util  = require("scada-common.util")
+
+local ALARM = types.ALARM
+local ALARM_STATE = types.ALARM_STATE
+local TEMP_SCALE = types.TEMP_SCALE
+local TEMP_UNITS = types.TEMP_SCALE_UNITS
+
+---@todo nominal trip time is ping (0ms to 10ms usually)
+local WARN_TT = 40
+local HIGH_TT = 80
+
+local iocontrol = {}
+
+---@enum POCKET_LINK_STATE
+local LINK_STATE = {
+    UNLINKED = 0,
+    SV_LINK_ONLY = 1,
+    API_LINK_ONLY = 2,
+    LINKED = 3
+}
+
+iocontrol.LINK_STATE = LINK_STATE
+
+---@class pocket_ioctl
+local io = {
+    version = "unknown",
+    ps = psil.create()
+}
+
+-- initialize facility-independent components of pocket iocontrol
+---@param comms pocket_comms
+---@param nav pocket_nav
+function iocontrol.init_core(comms, nav)
+    io.nav = nav
+
+    ---@class pocket_ioctl_diag
+    io.diag = {}
+
+    -- alarm testing
+    io.diag.tone_test = {
+        test_1 = function (state) comms.diag__set_alarm_tone(1, state) end,
+        test_2 = function (state) comms.diag__set_alarm_tone(2, state) end,
+        test_3 = function (state) comms.diag__set_alarm_tone(3, state) end,
+        test_4 = function (state) comms.diag__set_alarm_tone(4, state) end,
+        test_5 = function (state) comms.diag__set_alarm_tone(5, state) end,
+        test_6 = function (state) comms.diag__set_alarm_tone(6, state) end,
+        test_7 = function (state) comms.diag__set_alarm_tone(7, state) end,
+        test_8 = function (state) comms.diag__set_alarm_tone(8, state) end,
+        stop_tones = function () comms.diag__set_alarm_tone(0, false) end,
+
+        test_breach = function (state) comms.diag__set_alarm(ALARM.ContainmentBreach, state) end,
+        test_rad = function (state) comms.diag__set_alarm(ALARM.ContainmentRadiation, state) end,
+        test_lost = function (state) comms.diag__set_alarm(ALARM.ReactorLost, state) end,
+        test_crit = function (state) comms.diag__set_alarm(ALARM.CriticalDamage, state) end,
+        test_dmg = function (state) comms.diag__set_alarm(ALARM.ReactorDamage, state) end,
+        test_overtemp = function (state) comms.diag__set_alarm(ALARM.ReactorOverTemp, state) end,
+        test_hightemp = function (state) comms.diag__set_alarm(ALARM.ReactorHighTemp, state) end,
+        test_wasteleak = function (state) comms.diag__set_alarm(ALARM.ReactorWasteLeak, state) end,
+        test_highwaste = function (state) comms.diag__set_alarm(ALARM.ReactorHighWaste, state) end,
+        test_rps = function (state) comms.diag__set_alarm(ALARM.RPSTransient, state) end,
+        test_rcs = function (state) comms.diag__set_alarm(ALARM.RCSTransient, state) end,
+        test_turbinet = function (state) comms.diag__set_alarm(ALARM.TurbineTrip, state) end,
+        stop_alarms = function () comms.diag__set_alarm(0, false) end,
+
+        get_tone_states = function () comms.diag__get_alarm_tones() end,
+
+        ready_warn = nil,       ---@type graphics_element
+        tone_buttons = {},
+        alarm_buttons = {},
+        tone_indicators = {}    -- indicators to update from supervisor tone states
+    }
+
+    -- API access
+    ---@class pocket_ioctl_api
+    io.api = {
+        get_unit = function (unit) comms.api__get_unit(unit) end
+    }
+end
+
+-- initialize facility-dependent components of pocket iocontrol
+---@param conf facility_conf configuration
+---@param temp_scale TEMP_SCALE temperature unit
+function iocontrol.init_fac(conf, temp_scale)
+    io.temp_label = TEMP_UNITS[temp_scale]
+
+    -- temperature unit label and conversion function (from Kelvin)
+    if temp_scale == TEMP_SCALE.CELSIUS then
+        io.temp_convert = function (t) return t - 273.15 end
+    elseif temp_scale == TEMP_SCALE.FAHRENHEIT then
+        io.temp_convert = function (t) return (1.8 * (t - 273.15)) + 32 end
+    elseif temp_scale == TEMP_SCALE.RANKINE then
+        io.temp_convert = function (t) return 1.8 * t end
+    else
+        io.temp_label = "K"
+        io.temp_convert = function (t) return t end
+    end
+
+    -- facility data structure
+    ---@class pioctl_facility
+    io.facility = {
+        num_units = conf.num_units,
+        tank_mode = conf.cooling.fac_tank_mode,
+        tank_defs = conf.cooling.fac_tank_defs,
+        all_sys_ok = false,
+        rtu_count = 0,
+
+        auto_ready = false,
+        auto_active = false,
+        auto_ramping = false,
+        auto_saturated = false,
+
+        auto_scram = false,
+        ---@type ascram_status
+        ascram_status = {
+            matrix_dc = false,
+            matrix_fill = false,
+            crit_alarm = false,
+            radiation = false,
+            gen_fault = false
+        },
+
+        ---@type WASTE_PRODUCT
+        auto_current_waste_product = types.WASTE_PRODUCT.PLUTONIUM,
+        auto_pu_fallback_active = false,
+
+        radiation = types.new_zero_radiation_reading(),
+
+        ps = psil.create(),
+
+        induction_ps_tbl = {},
+        induction_data_tbl = {},
+
+        sps_ps_tbl = {},
+        sps_data_tbl = {},
+
+        tank_ps_tbl = {},
+        tank_data_tbl = {},
+
+        env_d_ps = psil.create(),
+        env_d_data = {}
+    }
+
+    -- create induction and SPS tables (currently only 1 of each is supported)
+    table.insert(io.facility.induction_ps_tbl, psil.create())
+    table.insert(io.facility.induction_data_tbl, {})
+    table.insert(io.facility.sps_ps_tbl, psil.create())
+    table.insert(io.facility.sps_data_tbl, {})
+
+    -- determine tank information
+    if io.facility.tank_mode == 0 then
+        io.facility.tank_defs = {}
+        -- on facility tank mode 0, setup tank defs to match unit tank option
+        for i = 1, conf.num_units do
+            io.facility.tank_defs[i] = util.trinary(conf.cooling.r_cool[i].TankConnection, 1, 0)
+        end
+
+        io.facility.tank_list = { table.unpack(io.facility.tank_defs) }
+    else
+        -- decode the layout of tanks from the connections definitions
+        local tank_mode = io.facility.tank_mode
+        local tank_defs = io.facility.tank_defs
+        local tank_list = { table.unpack(tank_defs) }
+
+        local function calc_fdef(start_idx, end_idx)
+            local first = 4
+            for i = start_idx, end_idx do
+                if io.facility.tank_defs[i] == 2 then
+                    if i < first then first = i end
+                end
+            end
+            return first
+        end
+
+        if tank_mode == 1 then
+            -- (1) 1 total facility tank (A A A A)
+            local first_fdef = calc_fdef(1, #tank_defs)
+            for i = 1, #tank_defs do
+                if i > first_fdef and tank_defs[i] == 2 then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 2 then
+            -- (2) 2 total facility tanks (A A A B)
+            local first_fdef = calc_fdef(1, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (i ~= 4) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 3 then
+            -- (3) 2 total facility tanks (A A B B)
+            for _, a in pairs({ 1, 3 }) do
+                local b = a + 1
+                if (tank_defs[a] == 2) and (tank_defs[b] == 2) then
+                    tank_list[b] = 0
+                end
+            end
+        elseif tank_mode == 4 then
+            -- (4) 2 total facility tanks (A B B B)
+            local first_fdef = calc_fdef(2, #tank_defs)
+            for i = 1, #tank_defs do
+                if (i ~= 1) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 5 then
+            -- (5) 3 total facility tanks (A A B C)
+            local first_fdef = calc_fdef(1, math.min(2, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 3 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 6 then
+            -- (6) 3 total facility tanks (A B B C)
+            local first_fdef = calc_fdef(2, math.min(3, #tank_defs))
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 4)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        elseif tank_mode == 7 then
+            -- (7) 3 total facility tanks (A B C C)
+            local first_fdef = calc_fdef(3, #tank_defs)
+            for i = 1, #tank_defs do
+                if (not (i == 1 or i == 2)) and (i > first_fdef) and (tank_defs[i] == 2) then
+                    tank_list[i] = 0
+                end
+            end
+        end
+
+        io.facility.tank_list = tank_list
+    end
+
+    -- create facility tank tables
+    for i = 1, #io.facility.tank_list do
+        if io.facility.tank_list[i] == 2 then
+            table.insert(io.facility.tank_ps_tbl, psil.create())
+            table.insert(io.facility.tank_data_tbl, {})
+        end
+    end
+
+    -- create unit data structures
+    io.units = {}
+    for i = 1, conf.num_units do
+        ---@class pioctl_unit
+        local entry = {
+            unit_id = i,
+            connected = false,
+            rtu_hw = {},
+
+            num_boilers = 0,
+            num_turbines = 0,
+            num_snas = 0,
+            has_tank = conf.cooling.r_cool[i].TankConnection,
+
+            control_state = false,
+            burn_rate_cmd = 0.0,
+            radiation = types.new_zero_radiation_reading(),
+
+            sna_peak_rate = 0.0,
+            sna_max_rate = 0.0,
+            sna_out_rate = 0.0,
+
+            waste_mode = types.WASTE_MODE.MANUAL_PLUTONIUM,
+            waste_product = types.WASTE_PRODUCT.PLUTONIUM,
+
+            last_rate_change_ms = 0,
+            turbine_flow_stable = false,
+
+            -- auto control group
+            a_group = 0,
+
+            ---@type alarms
+            alarms = { ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE, ALARM_STATE.INACTIVE },
+
+            annunciator = {},   ---@type annunciator
+
+            unit_ps = psil.create(),
+            reactor_data = {},  ---@type reactor_db
+
+            boiler_ps_tbl = {},
+            boiler_data_tbl = {},
+
+            turbine_ps_tbl = {},
+            turbine_data_tbl = {},
+
+            tank_ps_tbl = {},
+            tank_data_tbl = {}
+        }
+
+        -- on other facility modes, overwrite unit TANK option with facility tank defs
+        if io.facility.tank_mode ~= 0 then
+            entry.has_tank = conf.cooling.fac_tank_defs[i] > 0
+        end
+
+        -- create boiler tables
+        for _ = 1, conf.cooling.r_cool[i].BoilerCount do
+            table.insert(entry.boiler_ps_tbl, psil.create())
+            table.insert(entry.boiler_data_tbl, {})
+        end
+
+        -- create turbine tables
+        for _ = 1, conf.cooling.r_cool[i].TurbineCount do
+            table.insert(entry.turbine_ps_tbl, psil.create())
+            table.insert(entry.turbine_data_tbl, {})
+        end
+
+        -- create tank tables
+        if io.facility.tank_defs[i] == 1 then
+            table.insert(entry.tank_ps_tbl, psil.create())
+            table.insert(entry.tank_data_tbl, {})
+        end
+
+        entry.num_boilers = #entry.boiler_data_tbl
+        entry.num_turbines = #entry.turbine_data_tbl
+
+        table.insert(io.units, entry)
+    end
+end
+
+-- set network link state
+---@param state POCKET_LINK_STATE
+---@param sv_addr integer? supervisor address if linked
+---@param api_addr integer? coordinator address if linked
+function iocontrol.report_link_state(state, sv_addr, api_addr)
+    io.ps.publish("link_state", state)
+
+    if state == LINK_STATE.API_LINK_ONLY or state == LINK_STATE.UNLINKED then
+        io.ps.publish("svr_conn_quality", 0)
+    end
+
+    if state == LINK_STATE.SV_LINK_ONLY or state == LINK_STATE.UNLINKED then
+        io.ps.publish("crd_conn_quality", 0)
+    end
+
+    if state == LINK_STATE.LINKED then
+        io.ps.publish("sv_addr", sv_addr)
+        io.ps.publish("api_addr", api_addr)
+    end
+end
+
+-- determine supervisor connection quality (trip time)
+---@param trip_time integer
+function iocontrol.report_svr_tt(trip_time)
+    local state = 3
+    if trip_time > HIGH_TT then
+        state = 1
+    elseif trip_time > WARN_TT then
+        state = 2
+    end
+
+    io.ps.publish("svr_conn_quality", state)
+end
+
+-- determine coordinator connection quality (trip time)
+---@param trip_time integer
+function iocontrol.report_crd_tt(trip_time)
+    local state = 3
+    if trip_time > HIGH_TT then
+        state = 1
+    elseif trip_time > WARN_TT then
+        state = 2
+    end
+
+    io.ps.publish("crd_conn_quality", state)
+end
+
+-- populate facility data from API_GET_FAC
+---@param data table
+---@return boolean valid
+function iocontrol.record_facility_data(data)
+    local valid = true
+
+    local fac = io.facility
+
+    fac.all_sys_ok = data[1]
+    fac.rtu_count = data[2]
+    fac.radiation = data[3]
+
+    -- auto control
+    if type(data[4]) == "table" and #data[4] == 4 then
+        fac.auto_ready = data[4][1]
+        fac.auto_active = data[4][2]
+        fac.auto_ramping = data[4][3]
+        fac.auto_saturated = data[4][4]
+    end
+
+    -- waste
+    if type(data[5]) == "table" and #data[5] == 2 then
+        fac.auto_current_waste_product = data[5][1]
+        fac.auto_pu_fallback_active = data[5][2]
+    end
+
+    fac.num_tanks = data[6]
+    fac.has_imatrix = data[7]
+    fac.has_sps = data[8]
+
+    return valid
+end
+
+local function tripped(state) return state == ALARM_STATE.TRIPPED or state == ALARM_STATE.ACKED end
+
+local function _record_multiblock_status(faulted, data, ps)
+    ps.publish("formed", data.formed)
+    ps.publish("faulted", faulted)
+
+    for key, val in pairs(data.state) do ps.publish(key, val) end
+    for key, val in pairs(data.tanks) do ps.publish(key, val) end
+end
+
+-- update unit status data from API_GET_UNIT
+---@param data table
+function iocontrol.record_unit_data(data)
+    local unit = io.units[data[1]]  ---@type pioctl_unit
+
+    unit.connected = data[2]
+    unit.rtu_hw = data[3]
+    unit.alarms = data[4]
+
+    --#region Annunciator
+
+    unit.annunciator = data[5]
+
+    local rcs_disconn, rcs_warn, rcs_hazard = false, false, false
+
+    for key, val in pairs(unit.annunciator) do
+        if key == "BoilerOnline" or key == "TurbineOnline" then
+            local every = true
+
+            -- split up online arrays
+            for id = 1, #val do
+                every = every and val[id]
+
+                if key == "BoilerOnline" then
+                    unit.boiler_ps_tbl[id].publish(key, val[id])
+                else
+                    unit.turbine_ps_tbl[id].publish(key, val[id])
+                end
+            end
+
+            if not every then rcs_disconn = true end
+
+            unit.unit_ps.publish("U_" .. key, every)
+        elseif key == "HeatingRateLow" or key == "WaterLevelLow" then
+            -- split up array for all boilers
+            local any = false
+            for id = 1, #val do
+                any = any or val[id]
+                unit.boiler_ps_tbl[id].publish(key, val[id])
+            end
+
+            if key == "HeatingRateLow" and any then
+                rcs_warn = true
+            elseif key == "WaterLevelLow" and any then
+                rcs_hazard = true
+            end
+
+            unit.unit_ps.publish("U_" .. key, any)
+        elseif key == "SteamDumpOpen" or key == "TurbineOverSpeed" or key == "GeneratorTrip" or key == "TurbineTrip" then
+            -- split up array for all turbines
+            local any = false
+            for id = 1, #val do
+                any = any or val[id]
+                unit.turbine_ps_tbl[id].publish(key, val[id])
+            end
+
+            if key == "GeneratorTrip" and any then
+                rcs_warn = true
+            elseif (key == "TurbineOverSpeed" or key == "TurbineTrip") and any then
+                rcs_hazard = true
+            end
+
+            unit.unit_ps.publish("U_" .. key, any)
+        else
+            -- non-table fields
+            unit.unit_ps.publish(key, val)
+        end
+    end
+
+    local anc = unit.annunciator
+    rcs_hazard = rcs_hazard or anc.RCPTrip
+    rcs_warn = rcs_warn or anc.RCSFlowLow or anc.CoolantLevelLow or anc.RCSFault or anc.MaxWaterReturnFeed or
+                anc.CoolantFeedMismatch or anc.BoilRateMismatch or anc.SteamFeedMismatch
+
+    local rcs_status = 4
+    if rcs_hazard then
+        rcs_status = 2
+    elseif rcs_warn then
+        rcs_status = 3
+    elseif rcs_disconn then
+        rcs_status = 1
+    end
+
+    unit.unit_ps.publish("U_RCS", rcs_status)
+
+    --#endregion
+
+    --#region Reactor Data
+
+    unit.reactor_data = data[6]
+
+    local control_status = 1
+    local reactor_status = 1
+    local reactor_state = 1
+    local rps_status = 1
+
+    if unit.connected then
+        -- update RPS status
+        if unit.reactor_data.rps_tripped then
+            control_status = 2
+
+            if unit.reactor_data.rps_trip_cause == "manual" then
+                reactor_state = 4   -- disabled
+                rps_status = 3
+            else
+                reactor_state = 6   -- SCRAM
+                rps_status = 2
+            end
+        else rps_status = 4 end
+
+        -- update reactor/control status
+        if unit.reactor_data.mek_status.status then
+            reactor_status = 4
+            reactor_state = 5  -- running
+            control_status = util.trinary(unit.annunciator.AutoControl, 4, 3)
+        else
+            if unit.reactor_data.no_reactor then
+                reactor_status = 2
+                reactor_state = 3   -- faulted
+            elseif not unit.reactor_data.formed then
+                reactor_status = 3
+                reactor_state = 2   -- not formed
+            elseif unit.reactor_data.rps_status.force_dis then
+                reactor_status = 3
+                reactor_state = 7   -- force disabled
+            else
+                reactor_status = 4
+            end
+        end
+
+        for key, val in pairs(unit.reactor_data) do
+            if key ~= "rps_status" and key ~= "mek_struct" and key ~= "mek_status" then
+                unit.unit_ps.publish(key, val)
+            end
+        end
+
+        if type(unit.reactor_data.rps_status) == "table" then
+            for key, val in pairs(unit.reactor_data.rps_status) do
+                unit.unit_ps.publish(key, val)
+            end
+        end
+
+        if type(unit.reactor_data.mek_status) == "table" then
+            for key, val in pairs(unit.reactor_data.mek_status) do
+                unit.unit_ps.publish(key, val)
+            end
+        end
+    end
+
+    unit.unit_ps.publish("U_ControlStatus", control_status)
+    unit.unit_ps.publish("U_ReactorStatus", reactor_status)
+    unit.unit_ps.publish("U_ReactorStateStatus", reactor_state)
+    unit.unit_ps.publish("U_RPS", rps_status)
+
+    --#endregion
+
+    --#region RTU Devices
+
+    unit.boiler_data_tbl = data[7]
+
+    for id = 1, #unit.boiler_data_tbl do
+        local boiler = unit.boiler_data_tbl[id] ---@type boilerv_session_db
+        local ps     = unit.boiler_ps_tbl[id]   ---@type psil
+
+        local boiler_status = 1
+        local computed_status = 1
+
+        if unit.rtu_hw.boilers[id].connected then
+            if unit.rtu_hw.boilers[id].faulted then
+                boiler_status = 3
+                computed_status = 3
+            elseif boiler.formed then
+                boiler_status = 4
+
+                if boiler.state.boil_rate > 0 then
+                    computed_status = 5
+                else
+                    computed_status = 4
+                end
+            else
+                boiler_status = 2
+                computed_status = 2
+            end
+
+            _record_multiblock_status(unit.rtu_hw.boilers[id].faulted, boiler, ps)
+        end
+
+        ps.publish("BoilerStatus", boiler_status)
+        ps.publish("BoilerStateStatus", computed_status)
+    end
+
+    unit.turbine_data_tbl = data[8]
+
+    for id = 1, #unit.turbine_data_tbl do
+        local turbine = unit.turbine_data_tbl[id] ---@type turbinev_session_db
+        local ps      = unit.turbine_ps_tbl[id]   ---@type psil
+
+        local turbine_status = 1
+        local computed_status = 1
+
+        if unit.rtu_hw.turbines[id].connected then
+            if unit.rtu_hw.turbines[id].faulted then
+                turbine_status = 3
+                computed_status = 3
+            elseif turbine.formed then
+                turbine_status = 4
+
+                if turbine.tanks.energy_fill >= 0.99 then
+                    computed_status = 6
+                elseif turbine.state.flow_rate < 100 then
+                    computed_status = 4
+                else
+                    computed_status = 5
+                end
+            else
+                turbine_status = 2
+                computed_status = 2
+            end
+
+            _record_multiblock_status(unit.rtu_hw.turbines[id].faulted, turbine, ps)
+        end
+
+        ps.publish("TurbineStatus", turbine_status)
+        ps.publish("TurbineStateStatus", computed_status)
+    end
+
+    unit.tank_data_tbl = data[9]
+
+    unit.last_rate_change_ms = data[10]
+    unit.turbine_flow_stable = data[11]
+
+    --#endregion
+
+    --#region Status Information Display
+
+    local ecam = {} -- aviation reference :) back to VATSIM I go...
+
+    -- local function red(text) return { text = text, color = colors.red } end
+    local function white(text) return { text = text, color = colors.white } end
+    local function blue(text) return { text = text, color = colors.blue } end
+
+    -- unit.reactor_data.rps_status = {
+    --     high_dmg = false,
+    --     high_temp = false,
+    --     low_cool = false,
+    --     ex_waste = false,
+    --     ex_hcool = false,
+    --     no_fuel = false,
+    --     fault = false,
+    --     timeout = false,
+    --     manual = false,
+    --     automatic = false,
+    --     sys_fail = false,
+    --     force_dis = false
+    -- }
+
+    -- if unit.reactor_data.rps_status then
+    --     for k, v in pairs(unit.alarms) do
+    --         unit.alarms[k] = ALARM_STATE.TRIPPED
+    --     end
+    -- end
+
+    if tripped(unit.alarms[ALARM.ContainmentBreach]) then
+        local items = { white("REACTOR MELTDOWN"), blue("DON HAZMAT SUIT") }
+        table.insert(ecam, { color = colors.red, text = "CONTAINMENT BREACH", help = "ContainmentBreach", items = items })
+    end
+
+    if tripped(unit.alarms[ALARM.ContainmentRadiation]) then
+        local items = {
+            white("RADIATION DETECTED"),
+            blue("DON HAZMAT SUIT"),
+            blue("RESOLVE LEAK"),
+            blue("AWAIT SAFE LEVELS")
+        }
+
+        table.insert(ecam, { color = colors.red, text = "RADIATION LEAK", help = "ContainmentRadiation", items = items })
+    end
+
+    if tripped(unit.alarms[ALARM.CriticalDamage]) then
+        local items = { white("MELTDOWN IMMINENT"), blue("EVACUATE") }
+        table.insert(ecam, { color = colors.red, text = "RCT DAMAGE CRITICAL", help = "CriticalDamage", items = items })
+    end
+
+    if tripped(unit.alarms[ALARM.ReactorLost]) then
+        local items = { white("REACTOR OFF-LINE"), blue("CHECK PLC") }
+        table.insert(ecam, { color = colors.red, text = "REACTOR CONN LOST", help = "ReactorLost", items = items })
+    end
+
+    if tripped(unit.alarms[ALARM.ReactorDamage]) then
+        local items = { white("REACTOR DAMAGED"), blue("CHECK RCS"), blue("AWAIT DMG REDUCED") }
+        table.insert(ecam, { color = colors.red, text = "REACTOR DAMAGE", help = "ReactorDamage", items = items })
+    end
+
+    if tripped(unit.alarms[ALARM.ReactorOverTemp]) then
+        local items = { white("DAMAGING TEMP"), blue("CHECK RCS"), blue("AWAIT COOLDOWN") }
+        table.insert(ecam, { color = colors.red, text = "REACTOR OVER TEMP", help = "ReactorOverTemp", items = items })
+    end
+
+    if tripped(unit.alarms[ALARM.ReactorHighTemp]) then
+        local items = { white("OVER EXPECTED TEMP"), blue("CHECK RCS") }
+        table.insert(ecam, { color = colors.yellow, text = "REACTOR HIGH TEMP", help = "ReactorHighTemp", items = items})
+    end
+
+    if tripped(unit.alarms[ALARM.ReactorWasteLeak]) then
+        local items = { white("AT WASTE CAPACITY"), blue("CHECK WASTE OUTPUT"), blue("KEEP RCT DISABLED") }
+        table.insert(ecam, { color = colors.red, text = "REACTOR WASTE LEAK", help = "ReactorWasteLeak", items = items})
+    end
+
+    if tripped(unit.alarms[ALARM.ReactorHighWaste]) then
+        local items = { blue("CHECK WASTE OUTPUT") }
+        table.insert(ecam, { color = colors.yellow, text = "REACTOR WASTE HIGH", help = "ReactorHighWaste", items = items})
+    end
+
+    if tripped(unit.alarms[ALARM.RPSTransient]) then
+        local items = {}
+        local stat = unit.reactor_data.rps_status
+
+        -- for k, _ in pairs(stat) do stat[k] = true end
+
+        local function insert(cond, key, text, color) if cond[key] then table.insert(items, { text = text, help = key, color = color }) end end
+
+        table.insert(items, white("REACTOR SCRAMMED"))
+        insert(stat, "high_dmg", "HIGH DAMAGE", colors.red)
+        insert(stat, "high_temp", "HIGH TEMPERATURE", colors.red)
+        insert(stat, "low_cool", "CRIT LOW COOLANT")
+        insert(stat, "ex_waste", "EXCESS WASTE")
+        insert(stat, "ex_hcool", "EXCESS HEATED COOL")
+        insert(stat, "no_fuel", "NO FUEL")
+        insert(stat, "fault", "HARDWARE FAULT")
+        insert(stat, "timeout", "SUPERVISOR DISCONN")
+        insert(stat, "manual", "MANUAL SCRAM", colors.white)
+        insert(stat, "automatic", "AUTOMATIC SCRAM")
+        insert(stat, "sys_fail", "NOT FORMED", colors.red)
+        insert(stat, "force_dis", "FORCE DISABLED", colors.red)
+        table.insert(items, blue("RESOLVE PROBLEM"))
+        table.insert(items, blue("RESET RPS"))
+
+        table.insert(ecam, { color = colors.yellow, text = "RPS TRANSIENT", help = "RPSTransient", items = items})
+    end
+
+    if tripped(unit.alarms[ALARM.RCSTransient]) then
+        local items = {}
+        local annunc = unit.annunciator
+
+        -- for k, v in pairs(annunc) do
+        --     if type(v) == "boolean" then annunc[k] = true end
+        --     if type(v) == "table" then
+        --         for a, _ in pairs(v) do
+        --             v[a] = true
+        --         end
+        --     end
+        -- end
+
+        local function insert(cond, key, text, color)
+            if cond == true or (type(cond) == "table" and cond[key]) then table.insert(items, { text = text, help = key, color = color }) end
+        end
+
+        table.insert(items, white("COOLANT PROBLEM"))
+
+        insert(annunc, "RCPTrip", "RCP TRIP", colors.red)
+        insert(annunc, "CoolantLevelLow", "LOW COOLANT")
+
+        if unit.num_boilers == 0 then
+            if (util.time_ms() - unit.last_rate_change_ms) > const.FLOW_STABILITY_DELAY_MS then
+                insert(annunc, "BoilRateMismatch", "BOIL RATE MISMATCH")
+            end
+
+            if unit.turbine_flow_stable then
+                insert(annunc, "RCSFlowLow", "RCS FLOW LOW")
+                insert(annunc, "CoolantFeedMismatch", "COOL FEED MISMATCH")
+                insert(annunc, "SteamFeedMismatch", "STM FEED MISMATCH")
+            end
+        else
+            if (util.time_ms() - unit.last_rate_change_ms) > const.FLOW_STABILITY_DELAY_MS then
+                insert(annunc, "RCSFlowLow", "RCS FLOW LOW")
+                insert(annunc, "BoilRateMismatch", "BOIL RATE MISMATCH")
+                insert(annunc, "CoolantFeedMismatch", "COOL FEED MISMATCH")
+            end
+
+            if unit.turbine_flow_stable then
+                insert(annunc, "SteamFeedMismatch", "STM FEED MISMATCH")
+            end
+        end
+
+        insert(annunc, "MaxWaterReturnFeed", "MAX WTR RTRN FEED")
+
+        for k, v in ipairs(annunc.WaterLevelLow) do insert(v, "WaterLevelLow", "BOILER " .. k .. " WTR LOW", colors.red) end
+        for k, v in ipairs(annunc.HeatingRateLow) do insert(v, "HeatingRateLow", "BOILER " .. k .. " HEAT RATE") end
+        for k, v in ipairs(annunc.TurbineOverSpeed) do insert(v, "TurbineOverSpeed", "TURBINE " .. k .. " OVERSPD", colors.red) end
+        for k, v in ipairs(annunc.GeneratorTrip) do insert(v, "GeneratorTrip", "TURBINE " .. k .. " GEN TRIP") end
+
+        table.insert(items, blue("CHECK COOLING SYS"))
+
+        table.insert(ecam, { color = colors.yellow, text = "RCS TRANSIENT", help = "RCSTransient", items = items})
+    end
+
+    if tripped(unit.alarms[ALARM.TurbineTrip]) then
+        local items = {}
+
+        for k, v in ipairs(unit.annunciator.TurbineTrip) do
+            if v then table.insert(items, { text = "TURBINE " .. k .. " TRIP", help = "TurbineTrip" }) end
+        end
+
+        table.insert(items, blue("CHECK ENERGY OUT"))
+        table.insert(ecam, { color = colors.red, text = "TURBINE TRIP", help = "TurbineTripAlarm", items = items})
+    end
+
+    if not (tripped(unit.alarms[ALARM.ReactorLost]) or unit.connected) then
+        local items = { blue("CHECK PLC") }
+        table.insert(ecam, { color = colors.yellow, text = "REACTOR OFF-LINE", items = items })
+    end
+
+    for k, v in ipairs(unit.annunciator.BoilerOnline) do
+        if not v then
+            local items = { blue("CHECK RTU") }
+            table.insert(ecam, { color = colors.yellow, text = "BOILER " .. k .. " OFF-LINE", items = items})
+        end
+    end
+
+    for k, v in ipairs(unit.annunciator.TurbineOnline) do
+        if not v then
+            local items = { blue("CHECK RTU") }
+            table.insert(ecam, { color = colors.yellow, text = "TURBINE " .. k .. " OFF-LINE", items = items})
+        end
+    end
+
+    -- if no alarms, put some basic status messages in
+    if #ecam == 0 then
+        table.insert(ecam, { color = colors.green, text = "REACTOR " .. util.trinary(unit.reactor_data.mek_status.status, "NOMINAL", "IDLE"), items = {}})
+
+        local plural = util.trinary(unit.num_turbines > 1, "S", "")
+        table.insert(ecam, { color = colors.green, text = "TURBINE" .. plural .. util.trinary(unit.turbine_flow_stable, " STABLE", " STABILIZING"), items = {}})
+    end
+
+    unit.unit_ps.publish("U_ECAM", textutils.serialize(ecam))
+
+    --#endregion
+end
+
+-- get the IO controller database
+function iocontrol.get_db() return io end
+
+return iocontrol

pocket/pocket.lua

@@ -1,30 +1,352 @@
-local comms  = require("scada-common.comms")
-local log    = require("scada-common.log")
-local util   = require("scada-common.util")
+local comms     = require("scada-common.comms")
+local log       = require("scada-common.log")
+local util      = require("scada-common.util")
 
-local coreio = require("pocket.coreio")
+local iocontrol = require("pocket.iocontrol")
 
 local PROTOCOL = comms.PROTOCOL
 local DEVICE_TYPE = comms.DEVICE_TYPE
 local ESTABLISH_ACK = comms.ESTABLISH_ACK
-local SCADA_MGMT_TYPE = comms.SCADA_MGMT_TYPE
--- local CAPI_TYPE = comms.CAPI_TYPE
+local MGMT_TYPE = comms.MGMT_TYPE
+local CRDN_TYPE = comms.CRDN_TYPE
 
-local LINK_STATE = coreio.LINK_STATE
+local LINK_STATE = iocontrol.LINK_STATE
 
 local pocket = {}
 
+local MQ__RENDER_CMD = {
+    UNLOAD_SV_APPS = 1,
+    UNLOAD_API_APPS = 2
+}
+
+local MQ__RENDER_DATA = {
+    LOAD_APP = 1
+}
+
+pocket.MQ__RENDER_CMD = MQ__RENDER_CMD
+pocket.MQ__RENDER_DATA = MQ__RENDER_DATA
+
+---@type pkt_config
+local config = {}
+
+pocket.config = config
+
+-- load the pocket configuration
+function pocket.load_config()
+    if not settings.load("/pocket.settings") then return false end
+
+    config.TempScale = settings.get("TempScale")
+
+    config.SVR_Channel = settings.get("SVR_Channel")
+    config.CRD_Channel = settings.get("CRD_Channel")
+    config.PKT_Channel = settings.get("PKT_Channel")
+    config.ConnTimeout = settings.get("ConnTimeout")
+    config.TrustedRange = settings.get("TrustedRange")
+    config.AuthKey = settings.get("AuthKey")
+
+    config.LogMode = settings.get("LogMode")
+    config.LogPath = settings.get("LogPath")
+    config.LogDebug = settings.get("LogDebug")
+
+    local cfv = util.new_validator()
+
+    cfv.assert_type_int(config.TempScale)
+    cfv.assert_range(config.TempScale, 1, 4)
+
+    cfv.assert_channel(config.SVR_Channel)
+    cfv.assert_channel(config.CRD_Channel)
+    cfv.assert_channel(config.PKT_Channel)
+    cfv.assert_type_num(config.ConnTimeout)
+    cfv.assert_min(config.ConnTimeout, 2)
+    cfv.assert_type_num(config.TrustedRange)
+    cfv.assert_min(config.TrustedRange, 0)
+    cfv.assert_type_str(config.AuthKey)
+
+    if type(config.AuthKey) == "string" then
+        local len = string.len(config.AuthKey)
+        cfv.assert(len == 0 or len >= 8)
+    end
+
+    cfv.assert_type_int(config.LogMode)
+    cfv.assert_range(config.LogMode, 0, 1)
+    cfv.assert_type_str(config.LogPath)
+    cfv.assert_type_bool(config.LogDebug)
+
+    return cfv.valid()
+end
+
+---@enum POCKET_APP_ID
+local APP_ID = {
+    ROOT = 1,
+    -- main app pages
+    UNITS = 2,
+    GUIDE = 3,
+    ABOUT = 4,
+    -- diag app page
+    ALARMS = 5,
+    -- other
+    DUMMY = 6,
+    NUM_APPS = 6
+}
+
+pocket.APP_ID = APP_ID
+
+---@class nav_tree_page
+---@field _p nav_tree_page|nil page's parent
+---@field _c table page's children
+---@field nav_to function function to navigate to this page
+---@field switcher function|nil function to switch between children
+---@field tasks table tasks to run while viewing this page
+
+-- allocate the page navigation system
+---@param render_queue mqueue
+function pocket.init_nav(render_queue)
+    local self = {
+        pane = nil,    ---@type graphics_element
+        sidebar = nil, ---@type graphics_element
+        apps = {},
+        containers = {},
+        help_map = {},
+        help_return = nil,
+        cur_app = APP_ID.ROOT
+    }
+
+    self.cur_page = self.root
+
+    ---@class pocket_nav
+    local nav = {}
+
+    -- set the root pane element to switch between apps with
+    ---@param root_pane graphics_element
+    function nav.set_pane(root_pane) self.pane = root_pane end
+
+    -- link sidebar element
+    ---@param sidebar graphics_element
+    function nav.set_sidebar(sidebar) self.sidebar = sidebar end
+
+    -- register an app
+    ---@param app_id POCKET_APP_ID app ID
+    ---@param container graphics_element element that contains this app (usually a Div)
+    ---@param pane? graphics_element multipane if this is a simple paned app, then nav_to must be a number
+    ---@param require_sv? boolean true to specifiy if this app should be unloaded when the supervisor connection is lost
+    ---@param require_api? boolean true to specifiy if this app should be unloaded when the api connection is lost
+    function nav.register_app(app_id, container, pane, require_sv, require_api)
+        ---@class pocket_app
+        local app = {
+            loaded = false,
+            cur_page = nil, ---@type nav_tree_page
+            pane = pane,
+            paned_pages = {},
+            sidebar_items = {}
+        }
+
+        app.load = function () app.loaded = true end
+        app.unload = function () app.loaded = false end
+
+        -- check which connections this requires
+        ---@return boolean requires_sv, boolean requires_api
+        function app.check_requires() return require_sv or false, require_api or false end
+
+        -- delayed set of the pane if it wasn't ready at the start
+        ---@param root_pane graphics_element multipane
+        function app.set_root_pane(root_pane)
+            app.pane = root_pane
+        end
+
+        -- configure the sidebar
+        ---@param items table
+        function app.set_sidebar(items)
+            app.sidebar_items = items
+            if self.sidebar then self.sidebar.update(items) end
+        end
+
+        -- function to run on initial load into memory
+        ---@param on_load function callback
+        function app.set_load(on_load)
+            app.load = function ()
+                on_load()
+                app.loaded = true
+            end
+        end
+
+        -- function to run to close out the app
+        ---@param on_unload function callback
+        function app.set_unload(on_unload)
+            app.unload = function ()
+                on_unload()
+                app.loaded = false
+            end
+        end
+
+        -- if a pane was provided, this will switch between numbered pages
+        ---@param idx integer page index
+        function app.switcher(idx)
+            if app.paned_pages[idx] then
+                app.paned_pages[idx].nav_to()
+            end
+        end
+
+        -- create a new page entry in the app's page navigation tree
+        ---@param parent nav_tree_page|nil a parent page or nil to set this as the root
+        ---@param nav_to function|integer function to navigate to this page or pane index
+        ---@return nav_tree_page new_page this new page
+        function app.new_page(parent, nav_to)
+            ---@type nav_tree_page
+            local page = { _p = parent, _c = {}, nav_to = function () end, switcher = function () end, tasks = {} }
+
+            if parent == nil and app.cur_page == nil then
+                app.cur_page = page
+            end
+
+            if type(nav_to) == "number" then
+                app.paned_pages[nav_to] = page
+
+                function page.nav_to()
+                    app.cur_page = page
+                    if app.pane then app.pane.set_value(nav_to) end
+                end
+            else
+                function page.nav_to()
+                    app.cur_page = page
+                    nav_to()
+                end
+            end
+
+            -- switch between children
+            ---@param id integer child ID
+            function page.switcher(id) if page._c[id] then page._c[id].nav_to() end end
+
+            if parent ~= nil then
+                table.insert(page._p._c, page)
+            end
+
+            return page
+        end
+
+        -- delete paned pages and clear the current page
+        function app.delete_pages()
+            app.paned_pages = {}
+            app.cur_page = nil
+        end
+
+        -- get the currently active page
+        function app.get_current_page() return app.cur_page end
+
+        -- attempt to navigate up the tree
+        ---@return boolean success true if successfully navigated up
+        function app.nav_up()
+            local parent = app.cur_page._p
+            if parent then parent.nav_to() end
+            return parent ~= nil
+        end
+
+        self.apps[app_id] = app
+        self.containers[app_id] = container
+
+        return app
+    end
+
+    -- open an app
+    ---@param app_id POCKET_APP_ID
+    function nav.open_app(app_id)
+        -- reset help return on navigating out of an app
+        if app_id == APP_ID.ROOT then self.help_return = nil end
+
+        local app = self.apps[app_id] ---@type pocket_app
+        if app then
+            if not app.loaded then render_queue.push_data(MQ__RENDER_DATA.LOAD_APP, app_id) end
+
+            self.cur_app = app_id
+            self.pane.set_value(app_id)
+
+            if #app.sidebar_items > 0 then
+                self.sidebar.update(app.sidebar_items)
+            end
+        else
+            log.debug("tried to open unknown app")
+        end
+    end
+
+    -- load a given app
+    ---@param app_id POCKET_APP_ID
+    function nav.load_app(app_id)
+        self.apps[app_id].load()
+    end
+
+    -- unload api-dependent apps
+    function nav.unload_api()
+        for id, app in pairs(self.apps) do
+            local _, api = app.check_requires()
+            if app.loaded and api then
+                if id == self.cur_app then nav.open_app(APP_ID.ROOT) end
+                app.unload()
+            end
+        end
+    end
+
+    -- unload supervisor-dependent apps
+    function nav.unload_sv()
+        for id, app in pairs(self.apps) do
+            local sv, _ = app.check_requires()
+            if app.loaded and sv then
+                if id == self.cur_app then nav.open_app(APP_ID.ROOT) end
+                app.unload()
+            end
+        end
+    end
+
+    -- get a list of the app containers (usually Div elements)
+    function nav.get_containers() return self.containers end
+
+    -- get the currently active page
+    ---@return nav_tree_page
+    function nav.get_current_page()
+        return self.apps[self.cur_app].get_current_page()
+    end
+
+    -- attempt to navigate up within the active app, otherwise open home page<br>
+    -- except, this will go back to a prior app if leaving the help app after open_help was used
+    function nav.nav_up()
+        -- return out of help if opened with open_help
+        if self.help_return then
+            nav.open_app(self.help_return)
+            self.help_return = nil
+            return
+        end
+
+        local app = self.apps[self.cur_app] ---@type pocket_app
+        log.debug("attempting app nav up for app " .. self.cur_app)
+
+        if not app.nav_up() then
+            log.debug("internal app nav up failed, going to home screen")
+            nav.open_app(APP_ID.ROOT)
+        end
+    end
+
+    -- open the help app, to show the reference for a key
+    function nav.open_help(key)
+        self.help_return = self.cur_app
+
+        nav.open_app(APP_ID.GUIDE)
+
+        local load = self.help_map[key]
+        if load then load() end
+    end
+
+    -- link the help map from the guide app
+    function nav.link_help(map) self.help_map = map end
+
+    return nav
+end
+
 -- pocket coordinator + supervisor communications
 ---@nodiscard
 ---@param version string pocket version
 ---@param nic nic network interface device
----@param pkt_channel integer pocket comms channel
----@param svr_channel integer supervisor access channel
----@param crd_channel integer coordinator access channel
----@param range integer trusted device connection range
 ---@param sv_watchdog watchdog
 ---@param api_watchdog watchdog
-function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range, sv_watchdog, api_watchdog)
+---@param nav pocket_nav
+function pocket.comms(version, nic, sv_watchdog, api_watchdog, nav)
     local self = {
         sv = {
             linked = false,
@@ -43,16 +365,16 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         establish_delay_counter = 0
     }
 
-    comms.set_trusted_range(range)
+    comms.set_trusted_range(config.TrustedRange)
 
     -- PRIVATE FUNCTIONS --
 
     -- configure network channels
     nic.closeAll()
-    nic.open(pkt_channel)
+    nic.open(config.PKT_Channel)
 
     -- send a management packet to the supervisor
-    ---@param msg_type SCADA_MGMT_TYPE
+    ---@param msg_type MGMT_TYPE
     ---@param msg table
     local function _send_sv(msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -61,12 +383,12 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         pkt.make(msg_type, msg)
         s_pkt.make(self.sv.addr, self.sv.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
 
-        nic.transmit(svr_channel, pkt_channel, s_pkt)
+        nic.transmit(config.SVR_Channel, config.PKT_Channel, s_pkt)
         self.sv.seq_num = self.sv.seq_num + 1
     end
 
     -- send a management packet to the coordinator
-    ---@param msg_type SCADA_MGMT_TYPE
+    ---@param msg_type MGMT_TYPE
     ---@param msg table
     local function _send_crd(msg_type, msg)
         local s_pkt = comms.scada_packet()
@@ -75,44 +397,44 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         pkt.make(msg_type, msg)
         s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.SCADA_MGMT, pkt.raw_sendable())
 
-        nic.transmit(crd_channel, pkt_channel, s_pkt)
+        nic.transmit(config.CRD_Channel, config.PKT_Channel, s_pkt)
         self.api.seq_num = self.api.seq_num + 1
     end
 
-    -- send a packet to the coordinator API
-    -----@param msg_type CAPI_TYPE
-    -----@param msg table
-    -- local function _send_api(msg_type, msg)
-    --     local s_pkt = comms.scada_packet()
-    --     local pkt = comms.capi_packet()
+    -- send an API packet to the coordinator
+    ---@param msg_type CRDN_TYPE
+    ---@param msg table
+    local function _send_api(msg_type, msg)
+        local s_pkt = comms.scada_packet()
+        local pkt = comms.crdn_packet()
 
-    --     pkt.make(msg_type, msg)
-    --     s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.COORD_API, pkt.raw_sendable())
+        pkt.make(msg_type, msg)
+        s_pkt.make(self.api.addr, self.api.seq_num, PROTOCOL.SCADA_CRDN, pkt.raw_sendable())
 
-    --     nic.transmit(crd_channel, pkt_channel, s_pkt)
-    --     self.api.seq_num = self.api.seq_num + 1
-    -- end
+        nic.transmit(config.CRD_Channel, config.PKT_Channel, s_pkt)
+        self.api.seq_num = self.api.seq_num + 1
+    end
 
     -- attempt supervisor connection establishment
     local function _send_sv_establish()
-        _send_sv(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
+        _send_sv(MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
     end
 
     -- attempt coordinator API connection establishment
     local function _send_api_establish()
-        _send_crd(SCADA_MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT })
+        _send_crd(MGMT_TYPE.ESTABLISH, { comms.version, version, DEVICE_TYPE.PKT, comms.api_version })
     end
 
     -- keep alive ack to supervisor
     ---@param srv_time integer
     local function _send_sv_keep_alive_ack(srv_time)
-        _send_sv(SCADA_MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
+        _send_sv(MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
     end
 
     -- keep alive ack to coordinator
     ---@param srv_time integer
     local function _send_api_keep_alive_ack(srv_time)
-        _send_crd(SCADA_MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
+        _send_crd(MGMT_TYPE.KEEP_ALIVE, { srv_time, util.time() })
     end
 
     -- PUBLIC FUNCTIONS --
@@ -123,19 +445,21 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
     -- close connection to the supervisor
     function public.close_sv()
         sv_watchdog.cancel()
+        nav.unload_sv()
         self.sv.linked = false
         self.sv.r_seq_num = nil
         self.sv.addr = comms.BROADCAST
-        _send_sv(SCADA_MGMT_TYPE.CLOSE, {})
+        _send_sv(MGMT_TYPE.CLOSE, {})
     end
 
     -- close connection to coordinator API server
     function public.close_api()
         api_watchdog.cancel()
+        nav.unload_api()
         self.api.linked = false
         self.api.r_seq_num = nil
         self.api.addr = comms.BROADCAST
-        _send_crd(SCADA_MGMT_TYPE.CLOSE, {})
+        _send_crd(MGMT_TYPE.CLOSE, {})
     end
 
     -- close the connections to the servers
@@ -147,7 +471,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
     -- attempt to re-link if any of the dependent links aren't active
     function public.link_update()
         if not self.sv.linked then
-            coreio.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
+            iocontrol.report_link_state(util.trinary(self.api.linked, LINK_STATE.API_LINK_ONLY, LINK_STATE.UNLINKED))
 
             if self.establish_delay_counter <= 0 then
                 _send_sv_establish()
@@ -156,7 +480,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 self.establish_delay_counter = self.establish_delay_counter - 1
             end
         elseif not self.api.linked then
-            coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
+            iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
 
             if self.establish_delay_counter <= 0 then
                 _send_api_establish()
@@ -166,17 +490,41 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
             end
         else
             -- linked, all good!
-            coreio.report_link_state(LINK_STATE.LINKED)
+            iocontrol.report_link_state(LINK_STATE.LINKED, self.sv.addr, self.api.addr)
         end
     end
 
+    -- supervisor get active alarm tones
+    function public.diag__get_alarm_tones()
+        if self.sv.linked then _send_sv(MGMT_TYPE.DIAG_TONE_GET, {}) end
+    end
+
+    -- supervisor test alarm tones by tone
+    ---@param id TONE|0 tone ID, or 0 to stop all
+    ---@param state boolean tone state
+    function public.diag__set_alarm_tone(id, state)
+        if self.sv.linked then _send_sv(MGMT_TYPE.DIAG_TONE_SET, { id, state }) end
+    end
+
+    -- supervisor test alarm tones by alarm
+    ---@param id ALARM|0 alarm ID, 0 to stop all
+    ---@param state boolean alarm state
+    function public.diag__set_alarm(id, state)
+        if self.sv.linked then _send_sv(MGMT_TYPE.DIAG_ALARM_SET, { id, state }) end
+    end
+
+    -- coordinator get unit data
+    function public.api__get_unit(unit)
+        if self.api.linked then _send_api(CRDN_TYPE.API_GET_UNIT, { unit }) end
+    end
+
     -- parse a packet
     ---@param side string
     ---@param sender integer
     ---@param reply_to integer
     ---@param message any
     ---@param distance integer
-    ---@return mgmt_frame|capi_frame|nil packet
+    ---@return mgmt_frame|crdn_frame|nil packet
     function public.parse_packet(side, sender, reply_to, message, distance)
         local s_pkt = nic.receive(side, sender, reply_to, message, distance)
         local pkt = nil
@@ -188,11 +536,11 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 if mgmt_pkt.decode(s_pkt) then
                     pkt = mgmt_pkt.get()
                 end
-            -- get as coordinator API packet
-            elseif s_pkt.protocol() == PROTOCOL.COORD_API then
-                local capi_pkt = comms.capi_packet()
-                if capi_pkt.decode(s_pkt) then
-                    pkt = capi_pkt.get()
+            -- get as coordinator packet
+            elseif s_pkt.protocol() == PROTOCOL.SCADA_CRDN then
+                local crdn_pkt = comms.crdn_packet()
+                if crdn_pkt.decode(s_pkt) then
+                    pkt = crdn_pkt.get()
                 end
             else
                 log.debug("attempted parse of illegal packet type " .. s_pkt.protocol(), true)
@@ -202,18 +550,39 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
         return pkt
     end
 
+    ---@param packet mgmt_frame|crdn_frame
+    ---@param length integer
+    ---@param max integer?
+    ---@return boolean
+    local function _check_length(packet, length, max)
+        local ok = util.trinary(max == nil, packet.length == length, packet.length >= length and packet.length <= (max or 0))
+        if not ok then
+            local fmt = "[comms] RX_PACKET{r_chan=%d,proto=%d,type=%d}: packet length mismatch -> expect %d != actual %d"
+            log.debug(util.sprintf(fmt, packet.scada_frame.remote_channel(), packet.scada_frame.protocol(), packet.type, length, packet.scada_frame.length()))
+        end
+        return ok
+    end
+
+    ---@param packet mgmt_frame|crdn_frame
+    local function _fail_type(packet)
+        local fmt = "[comms] RX_PACKET{r_chan=%d,proto=%d,type=%d}: unrecognized packet type"
+        log.debug(util.sprintf(fmt, packet.scada_frame.remote_channel(), packet.scada_frame.protocol(), packet.type))
+    end
+
     -- handle a packet
-    ---@param packet mgmt_frame|capi_frame|nil
+    ---@param packet mgmt_frame|crdn_frame|nil
     function public.handle_packet(packet)
+        local diag = iocontrol.get_db().diag
+
         if packet ~= nil then
             local l_chan   = packet.scada_frame.local_channel()
             local r_chan   = packet.scada_frame.remote_channel()
             local protocol = packet.scada_frame.protocol()
             local src_addr = packet.scada_frame.src_addr()
 
-            if l_chan ~= pkt_channel then
+            if l_chan ~= config.PKT_Channel then
                 log.debug("received packet on unconfigured channel " .. l_chan, true)
-            elseif r_chan == crd_channel then
+            elseif r_chan == config.CRD_Channel then
                 -- check sequence number
                 if self.api.r_seq_num == nil then
                     self.api.r_seq_num = packet.scada_frame.seq_num()
@@ -222,7 +591,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                     return
                 elseif self.api.linked and (src_addr ~= self.api.addr) then
                     log.debug("received packet from unknown computer " .. src_addr .. " while linked (API expected " .. self.api.addr ..
-                                "); channel in use by another system?")
+                              "); channel in use by another system?")
                     return
                 else
                     self.api.r_seq_num = packet.scada_frame.seq_num()
@@ -231,25 +600,79 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 -- feed watchdog on valid sequence number
                 api_watchdog.feed()
 
-                if protocol == PROTOCOL.COORD_API then
-                    ---@cast packet capi_frame
+                if protocol == PROTOCOL.SCADA_CRDN then
+                    ---@cast packet crdn_frame
+                    if self.api.linked then
+                        if packet.type == CRDN_TYPE.API_GET_FAC then
+                            if _check_length(packet, 11) then
+                                iocontrol.record_facility_data(packet.data)
+                            end
+                        elseif packet.type == CRDN_TYPE.API_GET_UNIT then
+                            if _check_length(packet, 11) and type(packet.data[1]) == "number" and iocontrol.get_db().units[packet.data[1]] then
+                                iocontrol.record_unit_data(packet.data)
+                            end
+                        else _fail_type(packet) end
+                    else
+                        log.debug("discarding coordinator SCADA_CRDN packet before linked")
+                    end
                 elseif protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if self.api.linked then
+                        if packet.type == MGMT_TYPE.KEEP_ALIVE then
+                            -- keep alive request received, echo back
+                            if _check_length(packet, 1) then
+                                local timestamp = packet.data[1]
+                                local trip_time = util.time() - timestamp
+
+                                if trip_time > 750 then
+                                    log.warning("pocket coordinator KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
+                                end
+
+                                -- log.debug("pocket coordinator TT = " .. trip_time .. "ms")
+
+                                _send_api_keep_alive_ack(timestamp)
+
+                                iocontrol.report_crd_tt(trip_time)
+                            end
+                        elseif packet.type == MGMT_TYPE.CLOSE then
+                            -- handle session close
+                            api_watchdog.cancel()
+                            nav.unload_api()
+                            self.api.linked = false
+                            self.api.r_seq_num = nil
+                            self.api.addr = comms.BROADCAST
+                            log.info("coordinator server connection closed by remote host")
+                        else _fail_type(packet) end
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- connection with coordinator established
-                        if packet.length == 1 then
+                        if _check_length(packet, 1, 2) then
                             local est_ack = packet.data[1]
 
                             if est_ack == ESTABLISH_ACK.ALLOW then
-                                log.info("coordinator connection established")
-                                self.establish_delay_counter = 0
-                                self.api.linked = true
-                                self.api.addr = src_addr
+                                if packet.length == 2 then
+                                    local fac_config = packet.data[2]
 
-                                if self.sv.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
+                                    if type(fac_config) == "table" and #fac_config == 2 then
+                                        -- get configuration
+                                        local conf = { num_units = fac_config[1], cooling = fac_config[2] }
+
+                                        iocontrol.init_fac(conf, config.TempScale)
+
+                                        log.info("coordinator connection established")
+                                        self.establish_delay_counter = 0
+                                        self.api.linked = true
+                                        self.api.addr = src_addr
+
+                                        if self.sv.linked then
+                                            iocontrol.report_link_state(LINK_STATE.LINKED, self.sv.addr, self.api.addr)
+                                        else
+                                            iocontrol.report_link_state(LINK_STATE.API_LINK_ONLY)
+                                        end
+                                    else
+                                        log.debug("invalid facility configuration table received from coordinator, establish failed")
+                                    end
                                 else
-                                    coreio.report_link_state(LINK_STATE.API_LINK_ONLY)
+                                    log.debug("received coordinator establish allow without facility configuration")
                                 end
                             elseif est_ack == ESTABLISH_ACK.DENY then
                                 if self.api.last_est_ack ~= est_ack then
@@ -263,40 +686,15 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                                 if self.api.last_est_ack ~= est_ack then
                                     log.info("coordinator comms version mismatch")
                                 end
+                            elseif est_ack == ESTABLISH_ACK.BAD_API_VERSION then
+                                if self.api.last_est_ack ~= est_ack then
+                                    log.info("coordinator api version mismatch")
+                                end
                             else
                                 log.debug("coordinator SCADA_MGMT establish packet reply unsupported")
                             end
 
                             self.api.last_est_ack = est_ack
-                        else
-                            log.debug("coordinator SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.api.linked then
-                        if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-                            -- keep alive request received, echo back
-                            if packet.length == 1 then
-                                local timestamp = packet.data[1]
-                                local trip_time = util.time() - timestamp
-
-                                if trip_time > 750 then
-                                    log.warning("pocket coordinator KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
-                                end
-
-                                -- log.debug("pocket coordinator RTT = " .. trip_time .. "ms")
-
-                                _send_api_keep_alive_ack(timestamp)
-                            else
-                                log.debug("coordinator SCADA keep alive packet length mismatch")
-                            end
-                        elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
-                            -- handle session close
-                            api_watchdog.cancel()
-                            self.api.linked = false
-                            self.api.r_seq_num = nil
-                            self.api.addr = comms.BROADCAST
-                            log.info("coordinator server connection closed by remote host")
-                        else
-                            log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from coordinator")
                         end
                     else
                         log.debug("discarding coordinator non-link SCADA_MGMT packet before linked")
@@ -304,7 +702,7 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 else
                     log.debug("illegal packet type " .. protocol .. " from coordinator", true)
                 end
-            elseif r_chan == svr_channel then
+            elseif r_chan == config.SVR_Channel then
                 -- check sequence number
                 if self.sv.r_seq_num == nil then
                     self.sv.r_seq_num = packet.scada_frame.seq_num()
@@ -325,9 +723,78 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                 -- handle packet
                 if protocol == PROTOCOL.SCADA_MGMT then
                     ---@cast packet mgmt_frame
-                    if packet.type == SCADA_MGMT_TYPE.ESTABLISH then
+                    if self.sv.linked then
+                        if packet.type == MGMT_TYPE.KEEP_ALIVE then
+                            -- keep alive request received, echo back
+                            if _check_length(packet, 1) then
+                                local timestamp = packet.data[1]
+                                local trip_time = util.time() - timestamp
+
+                                if trip_time > 750 then
+                                    log.warning("pocket supervisor KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
+                                end
+
+                                -- log.debug("pocket supervisor TT = " .. trip_time .. "ms")
+
+                                _send_sv_keep_alive_ack(timestamp)
+
+                                iocontrol.report_svr_tt(trip_time)
+                            end
+                        elseif packet.type == MGMT_TYPE.CLOSE then
+                            -- handle session close
+                            sv_watchdog.cancel()
+                            nav.unload_sv()
+                            self.sv.linked = false
+                            self.sv.r_seq_num = nil
+                            self.sv.addr = comms.BROADCAST
+                            log.info("supervisor server connection closed by remote host")
+                        elseif packet.type == MGMT_TYPE.DIAG_TONE_GET then
+                            if _check_length(packet, 8) then
+                                for i = 1, #packet.data do
+                                    diag.tone_test.tone_indicators[i].update(packet.data[i] == true)
+                                end
+                            end
+                        elseif packet.type == MGMT_TYPE.DIAG_TONE_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag tone set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.tone_buttons[i] ~= nil then
+                                        diag.tone_test.tone_buttons[i].set_value(states[i] == true)
+                                        diag.tone_test.tone_indicators[i].update(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag tone set packet length/type mismatch")
+                            end
+                        elseif packet.type == MGMT_TYPE.DIAG_ALARM_SET then
+                            if packet.length == 1 and packet.data[1] == false then
+                                diag.tone_test.ready_warn.set_value("testing denied")
+                                log.debug("supervisor SCADA diag alarm set failed")
+                            elseif packet.length == 2 and type(packet.data[2]) == "table" then
+                                local ready = packet.data[1]
+                                local states = packet.data[2]
+
+                                diag.tone_test.ready_warn.set_value(util.trinary(ready, "", "system not ready"))
+
+                                for i = 1, #states do
+                                    if diag.tone_test.alarm_buttons[i] ~= nil then
+                                        diag.tone_test.alarm_buttons[i].set_value(states[i] == true)
+                                    end
+                                end
+                            else
+                                log.debug("supervisor SCADA diag alarm set packet length/type mismatch")
+                            end
+                        else _fail_type(packet) end
+                    elseif packet.type == MGMT_TYPE.ESTABLISH then
                         -- connection with supervisor established
-                        if packet.length == 1 then
+                        if _check_length(packet, 1) then
                             local est_ack = packet.data[1]
 
                             if est_ack == ESTABLISH_ACK.ALLOW then
@@ -337,9 +804,9 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                                 self.sv.addr = src_addr
 
                                 if self.api.linked then
-                                    coreio.report_link_state(LINK_STATE.LINKED)
+                                    iocontrol.report_link_state(LINK_STATE.LINKED, self.sv.addr, self.api.addr)
                                 else
-                                    coreio.report_link_state(LINK_STATE.SV_LINK_ONLY)
+                                    iocontrol.report_link_state(LINK_STATE.SV_LINK_ONLY)
                                 end
                             elseif est_ack == ESTABLISH_ACK.DENY then
                                 if self.sv.last_est_ack ~= est_ack then
@@ -358,42 +825,11 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
                             end
 
                             self.sv.last_est_ack = est_ack
-                        else
-                            log.debug("supervisor SCADA_MGMT establish packet length mismatch")
-                        end
-                    elseif self.sv.linked then
-                        if packet.type == SCADA_MGMT_TYPE.KEEP_ALIVE then
-                            -- keep alive request received, echo back
-                            if packet.length == 1 then
-                                local timestamp = packet.data[1]
-                                local trip_time = util.time() - timestamp
-
-                                if trip_time > 750 then
-                                    log.warning("pocket supervisor KEEP_ALIVE trip time > 750ms (" .. trip_time .. "ms)")
-                                end
-
-                                -- log.debug("pocket supervisor RTT = " .. trip_time .. "ms")
-
-                                _send_sv_keep_alive_ack(timestamp)
-                            else
-                                log.debug("supervisor SCADA keep alive packet length mismatch")
-                            end
-                        elseif packet.type == SCADA_MGMT_TYPE.CLOSE then
-                            -- handle session close
-                            sv_watchdog.cancel()
-                            self.sv.linked = false
-                            self.sv.r_seq_num = nil
-                            self.sv.addr = comms.BROADCAST
-                            log.info("supervisor server connection closed by remote host")
-                        else
-                            log.debug("received unknown SCADA_MGMT packet type " .. packet.type .. " from supervisor")
                         end
                     else
                         log.debug("discarding supervisor non-link SCADA_MGMT packet before linked")
                     end
-                else
-                    log.debug("illegal packet type " .. protocol .. " from supervisor", true)
-                end
+                else _fail_type(packet) end
             else
                 log.debug("received packet from unconfigured channel " .. r_chan, true)
             end
@@ -411,5 +847,4 @@ function pocket.comms(version, nic, pkt_channel, svr_channel, crd_channel, range
     return public
 end
 
-
 return pocket

pocket/renderer.lua

@@ -5,18 +5,23 @@
 local main_view  = require("pocket.ui.main")
 local style      = require("pocket.ui.style")
 
+local core       = require("graphics.core")
 local flasher    = require("graphics.flasher")
 
 local DisplayBox = require("graphics.elements.displaybox")
 
+---@class pocket_renderer
 local renderer = {}
 
 local ui = {
     display = nil
 }
 
--- start the pocket GUI
-function renderer.start_ui()
+-- try to start the pocket GUI
+---@return boolean success, any error_msg
+function renderer.try_start_ui()
+    local status, msg = true, nil
+
     if ui.display == nil then
         -- reset screen
         term.setTextColor(colors.white)
@@ -30,12 +35,22 @@ function renderer.start_ui()
         end
 
         -- init front panel view
-        ui.display = DisplayBox{window=term.current(),fg_bg=style.root}
-        main_view(ui.display)
+        status, msg = pcall(function ()
+            ui.display = DisplayBox{window=term.current(),fg_bg=style.root}
+            main_view(ui.display)
+        end)
 
-        -- start flasher callback task
-        flasher.run()
+        if status then
+            -- start flasher callback task
+            flasher.run()
+        else
+            -- report fail and close ui
+            msg = core.extract_assert_msg(msg)
+            renderer.close_ui()
+        end
     end
+
+    return status, msg
 end
 
 -- close out the UI
@@ -77,4 +92,20 @@ function renderer.handle_mouse(event)
     end
 end
 
+-- handle a keyboard event
+---@param event key_interaction|nil
+function renderer.handle_key(event)
+    if ui.display ~= nil and event ~= nil then
+        ui.display.handle_key(event)
+    end
+end
+
+-- handle a paste event
+---@param text string
+function renderer.handle_paste(text)
+    if ui.display ~= nil then
+        ui.display.handle_paste(text)
+    end
+end
+
 return renderer

pocket/startup.lua

@@ -2,55 +2,67 @@
 -- SCADA System Access on a Pocket Computer
 --
 
+---@diagnostic disable-next-line: undefined-global
+local _is_pocket_env = pocket or periphemu  -- luacheck: ignore pocket
+
 require("/initenv").init_env()
 
-local crash    = require("scada-common.crash")
-local log      = require("scada-common.log")
-local network  = require("scada-common.network")
-local ppm      = require("scada-common.ppm")
-local tcd      = require("scada-common.tcd")
-local util     = require("scada-common.util")
+local crash     = require("scada-common.crash")
+local log       = require("scada-common.log")
+local mqueue    = require("scada-common.mqueue")
+local network   = require("scada-common.network")
+local ppm       = require("scada-common.ppm")
+local util      = require("scada-common.util")
 
-local core     = require("graphics.core")
+local configure = require("pocket.configure")
+local iocontrol = require("pocket.iocontrol")
+local pocket    = require("pocket.pocket")
+local renderer  = require("pocket.renderer")
+local threads   = require("pocket.threads")
 
-local config   = require("pocket.config")
-local coreio   = require("pocket.coreio")
-local pocket   = require("pocket.pocket")
-local renderer = require("pocket.renderer")
-
-local POCKET_VERSION = "alpha-v0.5.2"
+local POCKET_VERSION = "v0.10.0-alpha"
 
 local println = util.println
 local println_ts = util.println_ts
 
+-- check environment (allows Pocket or CraftOS-PC)
+if not _is_pocket_env then
+    println("You can only use this application on a pocket computer.")
+    return
+end
+
 ----------------------------------------
--- config validation
+-- get configuration
 ----------------------------------------
 
-local cfv = util.new_validator()
+if not pocket.load_config() then
+    -- try to reconfigure (user action)
+    local success, error = configure.configure(true)
+    if success then
+        if not pocket.load_config() then
+            println("failed to load a valid configuration, please reconfigure")
+            return
+        end
+    else
+        println("configuration error: " .. error)
+        return
+    end
+end
 
-cfv.assert_channel(config.SVR_CHANNEL)
-cfv.assert_channel(config.CRD_CHANNEL)
-cfv.assert_channel(config.PKT_CHANNEL)
-cfv.assert_type_int(config.TRUSTED_RANGE)
-cfv.assert_type_num(config.COMMS_TIMEOUT)
-cfv.assert_min(config.COMMS_TIMEOUT, 2)
-cfv.assert_type_str(config.LOG_PATH)
-cfv.assert_type_int(config.LOG_MODE)
-
-assert(cfv.valid(), "bad config file: missing/invalid fields")
+local config = pocket.config
 
 ----------------------------------------
 -- log init
 ----------------------------------------
 
-log.init(config.LOG_PATH, config.LOG_MODE, config.LOG_DEBUG == true)
+log.init(config.LogPath, config.LogMode, config.LogDebug)
 
 log.info("========================================")
 log.info("BOOTING pocket.startup " .. POCKET_VERSION)
 log.info("========================================")
 
 crash.set_env("pocket", POCKET_VERSION)
+crash.dbg_log_env()
 
 ----------------------------------------
 -- main application
@@ -64,115 +76,116 @@ local function main()
     -- mount connected devices
     ppm.mount_all()
 
+    -- record version for GUI
+    iocontrol.get_db().version = POCKET_VERSION
+
     ----------------------------------------
-    -- setup communications & clocks
+    -- memory allocation
     ----------------------------------------
 
+    -- shared memory across threads
+    ---@class pkt_shared_memory
+    local __shared_memory = {
+        -- pocket system state flags
+        ---@class pkt_state
+        pkt_state = {
+            ui_ok = false,
+            ui_error = nil,
+            shutdown = false
+        },
+
+        -- core pocket devices
+        pkt_dev = {
+            modem = ppm.get_wireless_modem()
+        },
+
+        -- system objects
+        pkt_sys = {
+            nic = nil,          ---@type nic
+            pocket_comms = nil, ---@type pocket_comms
+            sv_wd = nil,        ---@type watchdog
+            api_wd = nil,       ---@type watchdog
+            nav = nil           ---@type pocket_nav
+        },
+
+        -- message queues
+        q = {
+            mq_render = mqueue.new()
+        }
+    }
+
+    local smem_dev = __shared_memory.pkt_dev
+    local smem_sys = __shared_memory.pkt_sys
+
+    local pkt_state = __shared_memory.pkt_state
+
+    ----------------------------------------
+    -- setup system
+    ----------------------------------------
+
+    smem_sys.nav = pocket.init_nav(__shared_memory.q.mq_render)
+
     -- message authentication init
-    if type(config.AUTH_KEY) == "string" then
-        network.init_mac(config.AUTH_KEY)
+    if type(config.AuthKey) == "string" and string.len(config.AuthKey) > 0 then
+        network.init_mac(config.AuthKey)
     end
 
-    coreio.report_link_state(coreio.LINK_STATE.UNLINKED)
+    iocontrol.report_link_state(iocontrol.LINK_STATE.UNLINKED)
 
     -- get the communications modem
-    local modem = ppm.get_wireless_modem()
-    if modem == nil then
+    if smem_dev.modem == nil then
         println("startup> wireless modem not found: please craft the pocket computer with a wireless modem")
         log.fatal("startup> no wireless modem on startup")
         return
     end
 
     -- create connection watchdogs
-    local conn_wd = {
-        sv = util.new_watchdog(config.COMMS_TIMEOUT),
-        api = util.new_watchdog(config.COMMS_TIMEOUT)
-    }
-
-    conn_wd.sv.cancel()
-    conn_wd.api.cancel()
-
+    smem_sys.sv_wd = util.new_watchdog(config.ConnTimeout)
+    smem_sys.sv_wd.cancel()
+    smem_sys.api_wd = util.new_watchdog(config.ConnTimeout)
+    smem_sys.api_wd.cancel()
     log.debug("startup> conn watchdogs created")
 
     -- create network interface then setup comms
-    local nic = network.nic(modem)
-    local pocket_comms = pocket.comms(POCKET_VERSION, nic, config.PKT_CHANNEL, config.SVR_CHANNEL,
-                                        config.CRD_CHANNEL, config.TRUSTED_RANGE, conn_wd.sv, conn_wd.api)
+    smem_sys.nic = network.nic(smem_dev.modem)
+    smem_sys.pocket_comms = pocket.comms(POCKET_VERSION, smem_sys.nic, smem_sys.sv_wd, smem_sys.api_wd, smem_sys.nav)
     log.debug("startup> comms init")
 
-    -- base loop clock (2Hz, 10 ticks)
-    local MAIN_CLOCK = 0.5
-    local loop_clock = util.new_clock(MAIN_CLOCK)
+    -- init I/O control
+    iocontrol.init_core(smem_sys.pocket_comms, smem_sys.nav)
 
     ----------------------------------------
     -- start the UI
     ----------------------------------------
 
-    local ui_ok, message = pcall(renderer.start_ui)
-    if not ui_ok then
-        renderer.close_ui()
-        println(util.c("UI error: ", message))
-        log.error(util.c("startup> GUI render failed with error ", message))
-    else
-        -- start clock
-        loop_clock.start()
+    local ui_message
+    pkt_state.ui_ok, ui_message = renderer.try_start_ui()
+    if not pkt_state.ui_ok then
+        println(util.c("UI error: ", ui_message))
+        log.error(util.c("startup> GUI render failed with error ", ui_message))
     end
 
     ----------------------------------------
-    -- main event loop
+    -- start system
     ----------------------------------------
 
-    if ui_ok then
-        -- start connection watchdogs
-        conn_wd.sv.feed()
-        conn_wd.api.feed()
-        log.debug("startup> conn watchdog started")
+    if pkt_state.ui_ok then
+        -- init threads
+        local main_thread   = threads.thread__main(__shared_memory)
+        local render_thread = threads.thread__render(__shared_memory)
 
-        -- main event loop
-        while true do
-            local event, param1, param2, param3, param4, param5 = util.pull_event()
+        log.info("startup> completed")
 
-            -- handle event
-            if event == "timer" then
-                if loop_clock.is_clock(param1) then
-                    -- main loop tick
-
-                    -- relink if necessary
-                    pocket_comms.link_update()
-
-                    loop_clock.start()
-                elseif conn_wd.sv.is_timer(param1) then
-                    -- supervisor watchdog timeout
-                    log.info("supervisor server timeout")
-                    pocket_comms.close_sv()
-                elseif conn_wd.api.is_timer(param1) then
-                    -- coordinator watchdog timeout
-                    log.info("coordinator api server timeout")
-                    pocket_comms.close_api()
-                else
-                    -- a non-clock/main watchdog timer event
-                    -- notify timer callback dispatcher
-                    tcd.handle(param1)
-                end
-            elseif event == "modem_message" then
-                -- got a packet
-                local packet = pocket_comms.parse_packet(param1, param2, param3, param4, param5)
-                pocket_comms.handle_packet(packet)
-            elseif event == "mouse_click" or event == "mouse_up" or event == "mouse_drag" or event == "mouse_scroll" then
-                -- handle a monitor touch event
-                renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
-            end
-
-            -- check for termination request
-            if event == "terminate" or ppm.should_terminate() then
-                log.info("terminate requested, closing server connections...")
-                pocket_comms.close()
-                log.info("connections closed")
-                break
-            end
-        end
+        -- run threads
+        parallel.waitForAll(main_thread.p_exec, render_thread.p_exec)
 
         renderer.close_ui()
+
+        if not pkt_state.ui_ok then
+            println(util.c("UI crashed with error: ", pkt_state.ui_error))
+        end
+    else
+        println_ts("UI creation failed")
     end
 
     println_ts("exited")

pocket/threads.lua

@@ -0,0 +1,219 @@
+local log      = require("scada-common.log")
+local mqueue   = require("scada-common.mqueue")
+local ppm      = require("scada-common.ppm")
+local tcd      = require("scada-common.tcd")
+local util     = require("scada-common.util")
+
+local pocket   = require("pocket.pocket")
+local renderer = require("pocket.renderer")
+
+local core     = require("graphics.core")
+
+local threads = {}
+
+local MAIN_CLOCK   = 0.5 -- (2Hz,   10 ticks)
+local RENDER_SLEEP = 100 -- (100ms, 2 ticks)
+
+local MQ__RENDER_CMD = pocket.MQ__RENDER_CMD
+local MQ__RENDER_DATA = pocket.MQ__RENDER_DATA
+
+-- main thread
+---@nodiscard
+---@param smem pkt_shared_memory
+function threads.thread__main(smem)
+    ---@class parallel_thread
+    local public = {}
+
+    -- execute thread
+    function public.exec()
+        log.debug("main thread start")
+
+        local loop_clock = util.new_clock(MAIN_CLOCK)
+
+        -- start clock
+        loop_clock.start()
+
+        -- load in from shared memory
+        local pkt_state    = smem.pkt_state
+        local pocket_comms = smem.pkt_sys.pocket_comms
+        local sv_wd        = smem.pkt_sys.sv_wd
+        local api_wd       = smem.pkt_sys.api_wd
+        local nav          = smem.pkt_sys.nav
+
+        -- start connection watchdogs
+        sv_wd.feed()
+        api_wd.feed()
+        log.debug("startup> conn watchdogs started")
+
+        -- event loop
+        while true do
+            local event, param1, param2, param3, param4, param5 = util.pull_event()
+
+            -- handle event
+            if event == "timer" then
+                if loop_clock.is_clock(param1) then
+                    -- main loop tick
+
+                    -- relink if necessary
+                    pocket_comms.link_update()
+
+                    -- update any tasks for the active page
+                    local page_tasks = nav.get_current_page().tasks
+                    for i = 1, #page_tasks do page_tasks[i]() end
+
+                    loop_clock.start()
+                elseif sv_wd.is_timer(param1) then
+                    -- supervisor watchdog timeout
+                    log.info("supervisor server timeout")
+                    pocket_comms.close_sv()
+                elseif api_wd.is_timer(param1) then
+                    -- coordinator watchdog timeout
+                    log.info("coordinator api server timeout")
+                    pocket_comms.close_api()
+                else
+                    -- a non-clock/main watchdog timer event
+                    -- notify timer callback dispatcher
+                    tcd.handle(param1)
+                end
+            elseif event == "modem_message" then
+                -- got a packet
+                local packet = pocket_comms.parse_packet(param1, param2, param3, param4, param5)
+                pocket_comms.handle_packet(packet)
+            elseif event == "mouse_click" or event == "mouse_up" or event == "mouse_drag" or event == "mouse_scroll" or
+                   event == "double_click" then
+                -- handle a mouse event
+                renderer.handle_mouse(core.events.new_mouse_event(event, param1, param2, param3))
+            elseif event == "char" or event == "key" or event == "key_up" then
+                -- handle a keyboard event
+                renderer.handle_key(core.events.new_key_event(event, param1, param2))
+            elseif event == "paste" then
+                -- handle a paste event
+                renderer.handle_paste(param1)
+            end
+
+            -- check for termination request or UI crash
+            if event == "terminate" or ppm.should_terminate() then
+                log.info("terminate requested, main thread exiting")
+                pkt_state.shutdown = true
+            elseif not pkt_state.ui_ok then
+                pkt_state.shutdown = true
+                log.info("terminating due to fatal UI error")
+            end
+
+            if pkt_state.shutdown then
+                log.info("closing server connections...")
+                pocket_comms.close()
+                log.info("connections closed")
+                break
+            end
+        end
+    end
+
+    -- execute the thread in a protected mode, retrying it on return if not shutting down
+    function public.p_exec()
+        local pkt_state = smem.pkt_state
+
+        while not pkt_state.shutdown do
+            local status, result = pcall(public.exec)
+            if status == false then
+                log.fatal(util.strval(result))
+            end
+
+            -- if status is true, then we are probably exiting, so this won't matter
+            -- this thread cannot be slept because it will miss events (namely "terminate")
+            if not pkt_state.shutdown then
+                log.info("main thread restarting now...")
+            end
+        end
+    end
+
+    return public
+end
+
+-- pocket renderer thread, tasked with long duration draws
+---@nodiscard
+---@param smem pkt_shared_memory
+function threads.thread__render(smem)
+    ---@class parallel_thread
+    local public = {}
+
+    -- execute thread
+    function public.exec()
+        log.debug("render thread start")
+
+        -- load in from shared memory
+        local pkt_state    = smem.pkt_state
+        local nav          = smem.pkt_sys.nav
+        local render_queue = smem.q.mq_render
+
+        local last_update = util.time()
+
+        -- thread loop
+        while true do
+            -- check for messages in the message queue
+            while render_queue.ready() and not pkt_state.shutdown do
+                local msg = render_queue.pop()
+
+                if msg ~= nil then
+                    if msg.qtype == mqueue.TYPE.COMMAND then
+                        -- received a command
+                        if msg.message == MQ__RENDER_CMD.UNLOAD_SV_APPS then
+                        elseif msg.message == MQ__RENDER_CMD.UNLOAD_API_APPS then
+                        end
+                    elseif msg.qtype == mqueue.TYPE.DATA then
+                        -- received data
+                        local cmd = msg.message ---@type queue_data
+
+                        if cmd.key == MQ__RENDER_DATA.LOAD_APP then
+                            log.debug("RENDER: load app " .. cmd.val)
+
+                            local draw_start = util.time_ms()
+
+                            pkt_state.ui_ok, pkt_state.ui_error = pcall(function () nav.load_app(cmd.val) end)
+                            if not pkt_state.ui_ok then
+                                log.fatal(util.c("RENDER: app load failed with error ", pkt_state.ui_error))
+                            else
+                                log.debug("RENDER: app loaded in " .. (util.time_ms() - draw_start) .. "ms")
+                            end
+                        end
+                    elseif msg.qtype == mqueue.TYPE.PACKET then
+                        -- received a packet
+                    end
+                end
+
+                -- quick yield
+                util.nop()
+            end
+
+            -- check for termination request
+            if pkt_state.shutdown then
+                log.info("render thread exiting")
+                break
+            end
+
+            -- delay before next check
+            last_update = util.adaptive_delay(RENDER_SLEEP, last_update)
+        end
+    end
+
+    -- execute the thread in a protected mode, retrying it on return if not shutting down
+    function public.p_exec()
+        local pkt_state = smem.pkt_state
+
+        while not pkt_state.shutdown do
+            local status, result = pcall(public.exec)
+            if status == false then
+                log.fatal(util.strval(result))
+            end
+
+            if not pkt_state.shutdown then
+                log.info("render thread restarting in 5 seconds...")
+                util.psleep(5)
+            end
+        end
+    end
+
+    return public
+end
+
+return threads

pocket/ui/apps/diag_apps.lua

@@ -0,0 +1,118 @@
+--
+-- Diagnostic Apps
+--
+
+local iocontrol      = require("pocket.iocontrol")
+local pocket         = require("pocket.pocket")
+
+local core           = require("graphics.core")
+
+local Div            = require("graphics.elements.div")
+local TextBox        = require("graphics.elements.textbox")
+
+local IndicatorLight = require("graphics.elements.indicators.light")
+
+local Checkbox       = require("graphics.elements.controls.checkbox")
+local PushButton     = require("graphics.elements.controls.push_button")
+local SwitchButton   = require("graphics.elements.controls.switch_button")
+
+local ALIGN = core.ALIGN
+local cpair = core.cpair
+
+local APP_ID = pocket.APP_ID
+
+-- create diagnostic app pages
+---@param root graphics_element parent
+local function create_pages(root)
+    local db = iocontrol.get_db()
+
+    ------------------------
+    -- Alarm Testing Page --
+    ------------------------
+
+    local alarm_test = Div{parent=root,x=1,y=1}
+
+    local alarm_app = db.nav.register_app(APP_ID.ALARMS, alarm_test)
+
+    local page = alarm_app.new_page(nil, function () end)
+    page.tasks = { db.diag.tone_test.get_tone_states }
+
+    local ttest = db.diag.tone_test
+
+    local c_wht_gray = cpair(colors.white, colors.gray)
+    local c_red_gray = cpair(colors.red, colors.gray)
+    local c_yel_gray = cpair(colors.yellow, colors.gray)
+    local c_blue_gray = cpair(colors.blue, colors.gray)
+
+    local audio = Div{parent=alarm_test,x=1,y=1}
+
+    TextBox{parent=audio,y=1,text="Alarm Sounder Tests",height=1,alignment=ALIGN.CENTER}
+
+    ttest.ready_warn = TextBox{parent=audio,y=2,text="",height=1,alignment=ALIGN.CENTER,fg_bg=cpair(colors.yellow,colors.black)}
+
+    local tones = Div{parent=audio,x=2,y=3,height=10,width=8,fg_bg=cpair(colors.black,colors.yellow)}
+
+    TextBox{parent=tones,text="Tones",height=1,alignment=ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local test_btns = {}
+    test_btns[1] = SwitchButton{parent=tones,text="TEST 1",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_1}
+    test_btns[2] = SwitchButton{parent=tones,text="TEST 2",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_2}
+    test_btns[3] = SwitchButton{parent=tones,text="TEST 3",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_3}
+    test_btns[4] = SwitchButton{parent=tones,text="TEST 4",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_4}
+    test_btns[5] = SwitchButton{parent=tones,text="TEST 5",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_5}
+    test_btns[6] = SwitchButton{parent=tones,text="TEST 6",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_6}
+    test_btns[7] = SwitchButton{parent=tones,text="TEST 7",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_7}
+    test_btns[8] = SwitchButton{parent=tones,text="TEST 8",min_width=8,active_fg_bg=c_wht_gray,callback=ttest.test_8}
+
+    ttest.tone_buttons = test_btns
+
+    local function stop_all_tones()
+        for i = 1, #test_btns do test_btns[i].set_value(false) end
+        ttest.stop_tones()
+    end
+
+    PushButton{parent=tones,text="STOP",min_width=8,active_fg_bg=c_wht_gray,fg_bg=cpair(colors.black,colors.red),callback=stop_all_tones}
+
+    local alarms = Div{parent=audio,x=11,y=3,height=15,fg_bg=cpair(colors.lightGray,colors.black)}
+
+    TextBox{parent=alarms,text="Alarms (\x13)",height=1,alignment=ALIGN.CENTER,fg_bg=audio.get_fg_bg()}
+
+    local alarm_btns = {}
+    alarm_btns[1] = Checkbox{parent=alarms,label="BREACH",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_breach}
+    alarm_btns[2] = Checkbox{parent=alarms,label="RADIATION",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_rad}
+    alarm_btns[3] = Checkbox{parent=alarms,label="RCT LOST",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_lost}
+    alarm_btns[4] = Checkbox{parent=alarms,label="CRIT DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_crit}
+    alarm_btns[5] = Checkbox{parent=alarms,label="DAMAGE",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_dmg}
+    alarm_btns[6] = Checkbox{parent=alarms,label="OVER TEMP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_overtemp}
+    alarm_btns[7] = Checkbox{parent=alarms,label="HIGH TEMP",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_hightemp}
+    alarm_btns[8] = Checkbox{parent=alarms,label="WASTE LEAK",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_wasteleak}
+    alarm_btns[9] = Checkbox{parent=alarms,label="WASTE HIGH",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_highwaste}
+    alarm_btns[10] = Checkbox{parent=alarms,label="RPS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rps}
+    alarm_btns[11] = Checkbox{parent=alarms,label="RCS TRANS",min_width=15,box_fg_bg=c_yel_gray,callback=ttest.test_rcs}
+    alarm_btns[12] = Checkbox{parent=alarms,label="TURBINE TRP",min_width=15,box_fg_bg=c_red_gray,callback=ttest.test_turbinet}
+
+    ttest.alarm_buttons = alarm_btns
+
+    local function stop_all_alarms()
+        for i = 1, #alarm_btns do alarm_btns[i].set_value(false) end
+        ttest.stop_alarms()
+    end
+
+    PushButton{parent=alarms,x=3,y=15,text="STOP \x13",min_width=8,fg_bg=cpair(colors.black,colors.red),active_fg_bg=c_wht_gray,callback=stop_all_alarms}
+
+    local states = Div{parent=audio,x=2,y=14,height=5,width=8}
+
+    TextBox{parent=states,text="States",height=1,alignment=ALIGN.CENTER}
+    local t_1 = IndicatorLight{parent=states,label="1",colors=c_blue_gray}
+    local t_2 = IndicatorLight{parent=states,label="2",colors=c_blue_gray}
+    local t_3 = IndicatorLight{parent=states,label="3",colors=c_blue_gray}
+    local t_4 = IndicatorLight{parent=states,label="4",colors=c_blue_gray}
+    local t_5 = IndicatorLight{parent=states,x=6,y=2,label="5",colors=c_blue_gray}
+    local t_6 = IndicatorLight{parent=states,x=6,label="6",colors=c_blue_gray}
+    local t_7 = IndicatorLight{parent=states,x=6,label="7",colors=c_blue_gray}
+    local t_8 = IndicatorLight{parent=states,x=6,label="8",colors=c_blue_gray}
+
+    ttest.tone_indicators = { t_1, t_2, t_3, t_4, t_5, t_6, t_7, t_8 }
+end
+
+return create_pages

pocket/ui/apps/dummy_app.lua

@@ -0,0 +1,29 @@
+--
+-- Placeholder App
+--
+
+local iocontrol = require("pocket.iocontrol")
+local pocket    = require("pocket.pocket")
+
+local core      = require("graphics.core")
+
+local Div       = require("graphics.elements.div")
+local TextBox   = require("graphics.elements.textbox")
+
+local APP_ID = pocket.APP_ID
+
+-- create placeholder app page
+---@param root graphics_element parent
+local function create_pages(root)
+    local db = iocontrol.get_db()
+
+    local main = Div{parent=root,x=1,y=1}
+
+    db.nav.register_app(APP_ID.DUMMY, main).new_page(nil, function () end)
+
+    TextBox{parent=main,text="This app is not implemented yet.",x=1,y=2,alignment=core.ALIGN.CENTER}
+
+    TextBox{parent=main,text=" pretend something  cool is here \x03",x=1,y=10,alignment=core.ALIGN.CENTER,fg_bg=core.cpair(colors.gray,colors.black)}
+end
+
+return create_pages

pocket/ui/apps/guide.lua

@@ -0,0 +1,247 @@
+--
+-- System Guide
+--
+
+local util          = require("scada-common.util")
+
+local iocontrol     = require("pocket.iocontrol")
+local pocket        = require("pocket.pocket")
+
+local docs          = require("pocket.ui.docs")
+-- local style         = require("pocket.ui.style")
+
+local guide_section = require("pocket.ui.pages.guide_section")
+
+local core          = require("graphics.core")
+
+local Div           = require("graphics.elements.div")
+local ListBox       = require("graphics.elements.listbox")
+local MultiPane     = require("graphics.elements.multipane")
+local TextBox       = require("graphics.elements.textbox")
+
+local WaitingAnim   = require("graphics.elements.animations.waiting")
+
+local PushButton    = require("graphics.elements.controls.push_button")
+
+local TextField     = require("graphics.elements.form.text_field")
+
+local ALIGN = core.ALIGN
+local cpair = core.cpair
+
+local APP_ID = pocket.APP_ID
+
+-- local label   = style.label
+-- local lu_col  = style.label_unit_pair
+-- local text_fg = style.text_fg
+
+-- new system guide view
+---@param root graphics_element parent
+local function new_view(root)
+    local db = iocontrol.get_db()
+
+    local frame = Div{parent=root,x=1,y=1}
+
+    local app = db.nav.register_app(APP_ID.GUIDE, frame)
+
+    local load_div = Div{parent=frame,x=1,y=1}
+    local main = Div{parent=frame,x=1,y=1}
+
+    TextBox{parent=load_div,y=12,text="Loading...",height=1,alignment=ALIGN.CENTER}
+    WaitingAnim{parent=load_div,x=math.floor(main.get_width()/2)-1,y=8,fg_bg=cpair(colors.cyan,colors._INHERIT)}
+
+    local load_pane = MultiPane{parent=main,x=1,y=1,panes={load_div,main}}
+
+    local btn_fg_bg = cpair(colors.cyan, colors.black)
+    local btn_active = cpair(colors.white, colors.black)
+    local btn_disable = cpair(colors.gray, colors.black)
+
+    app.set_sidebar({{ label = " # ", tall = true, color = core.cpair(colors.black, colors.green), callback = function () db.nav.open_app(APP_ID.ROOT) end }})
+
+    local page_div = nil ---@type nil|graphics_element
+
+    -- load the app (create the elements)
+    local function load()
+        local list = {
+            { label = " # ", tall = true, color = core.cpair(colors.black, colors.green), callback = function () db.nav.open_app(APP_ID.ROOT) end },
+            { label = " \x14 ", color = core.cpair(colors.black, colors.cyan), callback = function () app.switcher(1) end },
+            { label = "__?", color = core.cpair(colors.black, colors.lightGray), callback = function () app.switcher(2) end }
+        }
+
+        app.set_sidebar(list)
+
+        page_div = Div{parent=main,y=2}
+        local p_width = page_div.get_width() - 2
+
+        local main_page = app.new_page(nil, 1)
+        local search_page = app.new_page(main_page, 2)
+        local use_page = app.new_page(main_page, 3)
+        local uis_page = app.new_page(main_page, 4)
+        local fps_page = app.new_page(main_page, 5)
+        local gls_page = app.new_page(main_page, 6)
+
+        local home = Div{parent=page_div,x=2}
+        local search = Div{parent=page_div,x=2}
+        local use = Div{parent=page_div,x=2,width=p_width}
+        local uis = Div{parent=page_div,x=2,width=p_width}
+        local fps = Div{parent=page_div,x=2,width=p_width}
+        local gls = Div{parent=page_div,x=2,width=p_width}
+        local panes = { home, search, use, uis, fps, gls }
+
+        local doc_map = {}
+        local search_db = {}
+
+        ---@class _guide_section_constructor_data
+        local sect_construct_data = { app, page_div, panes, doc_map, search_db, btn_fg_bg, btn_active }
+
+        TextBox{parent=home,y=1,text="cc-mek-scada Guide",height=1,alignment=ALIGN.CENTER}
+
+        PushButton{parent=home,y=3,text="Search              >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=search_page.nav_to}
+        PushButton{parent=home,y=5,text="System Usage        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=use_page.nav_to}
+        PushButton{parent=home,text="Operator UIs        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=uis_page.nav_to}
+        PushButton{parent=home,text="Front Panels        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=fps_page.nav_to}
+        PushButton{parent=home,text="Glossary            >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=gls_page.nav_to}
+
+        TextBox{parent=search,y=1,text="Search",height=1,alignment=ALIGN.CENTER}
+
+        local query_field = TextField{parent=search,x=1,y=3,width=18,fg_bg=cpair(colors.white,colors.gray)}
+
+        local func_ref = {}
+
+        PushButton{parent=search,x=20,y=3,text="GO",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=function()func_ref.run_search()end}
+
+        local search_results = ListBox{parent=search,x=1,y=5,scroll_height=200,nav_fg_bg=cpair(colors.lightGray,colors.gray),nav_active=cpair(colors.white,colors.gray)}
+
+        function func_ref.run_search()
+            local query = string.lower(query_field.get_value())
+            local s_results = { {}, {}, {} }
+
+            search_results.remove_all()
+
+            if string.len(query) < 3 then
+                TextBox{parent=search_results,text="Search requires at least 3 characters."}
+                return
+            end
+
+            for _, entry in ipairs(search_db) do
+                local s_start, _ = string.find(entry[1], query, 1, true)
+
+                if s_start == nil then
+                elseif s_start == 1 then
+                    -- best match, start of key
+                    table.insert(s_results[1], entry)
+                elseif string.sub(query, s_start - 1, s_start) == " " then
+                    -- start of word, good match
+                    table.insert(s_results[2], entry)
+                else
+                    -- basic match in content
+                    table.insert(s_results[3], entry)
+                end
+            end
+
+            local empty = true
+
+            for tier = 1, 3 do
+                for idx = 1, #s_results[tier] do
+                    local entry = s_results[tier][idx]
+                    TextBox{parent=search_results,text=entry[3].." >",fg_bg=cpair(colors.gray,colors.black)}
+                    PushButton{parent=search_results,text=entry[2],alignment=ALIGN.LEFT,fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=entry[4]}
+
+                    empty = false
+                end
+            end
+
+            if empty then
+                TextBox{parent=search_results,text="No results found."}
+            end
+        end
+
+        TextBox{parent=search_results,text="Click 'GO' to search..."}
+
+        util.nop()
+
+        TextBox{parent=use,y=1,text="System Usage",height=1,alignment=ALIGN.CENTER}
+        PushButton{parent=use,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=main_page.nav_to}
+
+        PushButton{parent=use,y=3,text="Configuring Devices >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=use,text="Connecting Devices  >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=use,text="Manual Control      >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=use,text="Automatic Control   >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=use,text="Waste Control       >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+
+        TextBox{parent=uis,y=1,text="Operator UIs",height=1,alignment=ALIGN.CENTER}
+        PushButton{parent=uis,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=main_page.nav_to}
+
+        local annunc_page = app.new_page(uis_page, #panes + 1)
+        local annunc_div = Div{parent=page_div,x=2}
+        table.insert(panes, annunc_div)
+
+        local alarms_page = guide_section(sect_construct_data, uis_page, "Alarms", docs.alarms, 100)
+
+        PushButton{parent=uis,y=3,text="Alarms              >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=alarms_page.nav_to}
+        PushButton{parent=uis,text="Annunciators        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=annunc_page.nav_to}
+        PushButton{parent=uis,text="Pocket UI           >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=uis,text="Coordinator UI      >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+
+        TextBox{parent=annunc_div,y=1,text="Annunciators",height=1,alignment=ALIGN.CENTER}
+        PushButton{parent=annunc_div,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=uis_page.nav_to}
+
+        local unit_gen_page = guide_section(sect_construct_data, annunc_page, "Unit General", docs.annunc.unit.main_section, 170)
+        local unit_rps_page = guide_section(sect_construct_data, annunc_page, "Unit RPS", docs.annunc.unit.rps_section, 100)
+        local unit_rcs_page = guide_section(sect_construct_data, annunc_page, "Unit RCS", docs.annunc.unit.rcs_section, 170)
+
+        PushButton{parent=annunc_div,y=3,text="Unit General        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=unit_gen_page.nav_to}
+        PushButton{parent=annunc_div,text="Unit RPS            >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=unit_rps_page.nav_to}
+        PushButton{parent=annunc_div,text="Unit RCS            >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=unit_rcs_page.nav_to}
+        PushButton{parent=annunc_div,text="Facility General    >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=annunc_div,text="Waste & Valves      >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+
+        TextBox{parent=fps,y=1,text="Front Panels",height=1,alignment=ALIGN.CENTER}
+        PushButton{parent=fps,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=main_page.nav_to}
+
+        PushButton{parent=fps,y=3,text="Common Items        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=fps,text="Reactor PLC         >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=fps,text="RTU Gateway         >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=fps,text="Supervisor          >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+        PushButton{parent=fps,text="Coordinator         >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,dis_fg_bg=btn_disable,callback=function()end}.disable()
+
+        TextBox{parent=gls,y=1,text="Glossary",height=1,alignment=ALIGN.CENTER}
+        PushButton{parent=gls,x=3,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=main_page.nav_to}
+
+        local gls_abbv_page = guide_section(sect_construct_data, gls_page, "Abbreviations", docs.glossary.abbvs, 120)
+        local gls_term_page = guide_section(sect_construct_data, gls_page, "Terminology", docs.glossary.terms, 100)
+
+        PushButton{parent=gls,y=3,text="Abbreviations       >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=gls_abbv_page.nav_to}
+        PushButton{parent=gls,text="Terminology         >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=gls_term_page.nav_to}
+
+        -- setup multipane
+        local u_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
+        app.set_root_pane(u_pane)
+
+        -- link help resources
+        db.nav.link_help(doc_map)
+
+        -- done, show the app
+        load_pane.set_value(2)
+    end
+
+    -- delete the elements and switch back to the loading screen
+    local function unload()
+        if page_div then
+            page_div.delete()
+            page_div = nil
+        end
+
+        app.set_sidebar({ { label = " # ", tall = true, color = core.cpair(colors.black, colors.green), callback = function () db.nav.open_app(APP_ID.ROOT) end } })
+        app.delete_pages()
+
+        -- show loading screen
+        load_pane.set_value(1)
+    end
+
+    app.set_load(load)
+    app.set_unload(unload)
+
+    return main
+end
+
+return new_view

pocket/ui/apps/sys_apps.lua

@@ -0,0 +1,146 @@
+--
+-- System Apps
+--
+
+local comms      = require("scada-common.comms")
+local util       = require("scada-common.util")
+
+local lockbox    = require("lockbox")
+
+local iocontrol  = require("pocket.iocontrol")
+local pocket     = require("pocket.pocket")
+
+local core       = require("graphics.core")
+
+local Div        = require("graphics.elements.div")
+local ListBox    = require("graphics.elements.listbox")
+local MultiPane  = require("graphics.elements.multipane")
+local TextBox    = require("graphics.elements.textbox")
+
+local PushButton = require("graphics.elements.controls.push_button")
+
+local ALIGN = core.ALIGN
+local cpair = core.cpair
+
+local APP_ID = pocket.APP_ID
+
+-- create system app pages
+---@param root graphics_element parent
+local function create_pages(root)
+    local db = iocontrol.get_db()
+
+    ----------------
+    -- About Page --
+    ----------------
+
+    local about_root = Div{parent=root,x=1,y=1}
+
+    local about_app = db.nav.register_app(APP_ID.ABOUT, about_root)
+
+    local about_page = about_app.new_page(nil, 1)
+    local nt_page = about_app.new_page(about_page, 2)
+    local fw_page = about_app.new_page(about_page, 3)
+    local hw_page = about_app.new_page(about_page, 4)
+
+    local about = Div{parent=about_root,x=1,y=2}
+
+    TextBox{parent=about,y=1,text="System Information",height=1,alignment=ALIGN.CENTER}
+
+    local btn_fg_bg = cpair(colors.lightBlue, colors.black)
+    local btn_active = cpair(colors.white, colors.black)
+    local label = cpair(colors.lightGray, colors.black)
+
+    PushButton{parent=about,x=2,y=3,text="Network             >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=nt_page.nav_to}
+    PushButton{parent=about,x=2,y=4,text="Firmware            >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=fw_page.nav_to}
+    PushButton{parent=about,x=2,y=5,text="Host Details        >",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=hw_page.nav_to}
+
+    --#region Network Details
+
+    local config = pocket.config
+
+    local nt_div = Div{parent=about_root,x=1,y=2}
+    TextBox{parent=nt_div,y=1,text="Network Details",height=1,alignment=ALIGN.CENTER}
+
+    PushButton{parent=nt_div,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=about_page.nav_to}
+
+    TextBox{parent=nt_div,x=2,y=3,text="Pocket Address",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+---@diagnostic disable-next-line: undefined-field
+    TextBox{parent=nt_div,x=2,text=util.c(os.getComputerID(),":",config.PKT_Channel),height=1,alignment=ALIGN.LEFT}
+
+    nt_div.line_break()
+    TextBox{parent=nt_div,x=2,text="Supervisor Address",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    local sv = TextBox{parent=nt_div,x=2,text="",height=1,alignment=ALIGN.LEFT}
+
+    nt_div.line_break()
+    TextBox{parent=nt_div,x=2,text="Coordinator Address",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    local coord = TextBox{parent=nt_div,x=2,text="",height=1,alignment=ALIGN.LEFT}
+
+    sv.register(db.ps, "sv_addr", function (addr) sv.set_value(util.c(addr, ":", config.SVR_Channel)) end)
+    coord.register(db.ps, "api_addr", function (addr) coord.set_value(util.c(addr, ":", config.CRD_Channel)) end)
+
+    nt_div.line_break()
+    TextBox{parent=nt_div,x=2,text="Message Authentication",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    local auth = util.trinary(type(config.AuthKey) == "string" and string.len(config.AuthKey) > 0, "HMAC-MD5", "None")
+    TextBox{parent=nt_div,x=2,text=auth,height=1,alignment=ALIGN.LEFT}
+
+    --#endregion
+
+    --#region Firmware Versions
+
+    local fw_div = Div{parent=about_root,x=1,y=2}
+    TextBox{parent=fw_div,y=1,text="Firmware Versions",height=1,alignment=ALIGN.CENTER}
+
+    PushButton{parent=fw_div,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=about_page.nav_to}
+
+    local fw_list_box = ListBox{parent=fw_div,x=1,y=3,scroll_height=100,nav_fg_bg=cpair(colors.lightGray,colors.gray),nav_active=cpair(colors.white,colors.gray)}
+
+    local fw_list = Div{parent=fw_list_box,x=1,y=2,height=18}
+
+    TextBox{parent=fw_list,x=2,text="Pocket Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=db.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Comms Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=comms.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="API Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=comms.api_version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Common Lib Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=util.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Graphics Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=core.version,height=1,alignment=ALIGN.LEFT}
+
+    fw_list.line_break()
+    TextBox{parent=fw_list,x=2,text="Lockbox Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=fw_list,x=2,text=lockbox.version,height=1,alignment=ALIGN.LEFT}
+
+    --#endregion
+
+    --#region Host Versions
+
+    local hw_div = Div{parent=about_root,x=1,y=2}
+    TextBox{parent=hw_div,y=1,text="Host Versions",height=1,alignment=ALIGN.CENTER}
+
+    PushButton{parent=hw_div,x=2,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=about_page.nav_to}
+
+    hw_div.line_break()
+    TextBox{parent=hw_div,x=2,text="Lua Version",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=hw_div,x=2,text=_VERSION,height=1,alignment=ALIGN.LEFT}
+
+    hw_div.line_break()
+    TextBox{parent=hw_div,x=2,text="Environment",height=1,alignment=ALIGN.LEFT,fg_bg=label}
+    TextBox{parent=hw_div,x=2,text=_HOST,height=6,alignment=ALIGN.LEFT}
+
+    --#endregion
+
+    local root_pane = MultiPane{parent=about_root,x=1,y=1,panes={about,nt_div,fw_div,hw_div}}
+
+    about_app.set_root_pane(root_pane)
+end
+
+return create_pages

pocket/ui/apps/unit.lua

@@ -0,0 +1,399 @@
+--
+-- Unit Overview Page
+--
+
+local util          = require("scada-common.util")
+
+local iocontrol     = require("pocket.iocontrol")
+local pocket        = require("pocket.pocket")
+
+local style         = require("pocket.ui.style")
+
+local boiler        = require("pocket.ui.pages.unit_boiler")
+local reactor       = require("pocket.ui.pages.unit_reactor")
+local turbine       = require("pocket.ui.pages.unit_turbine")
+
+local core          = require("graphics.core")
+
+local Div           = require("graphics.elements.div")
+local ListBox       = require("graphics.elements.listbox")
+local MultiPane     = require("graphics.elements.multipane")
+local TextBox       = require("graphics.elements.textbox")
+
+local WaitingAnim   = require("graphics.elements.animations.waiting")
+
+local PushButton    = require("graphics.elements.controls.push_button")
+
+local DataIndicator = require("graphics.elements.indicators.data")
+local IconIndicator = require("graphics.elements.indicators.icon")
+
+local ALIGN = core.ALIGN
+local cpair = core.cpair
+
+local APP_ID = pocket.APP_ID
+
+-- local label        = style.label
+local lu_col       = style.label_unit_pair
+local text_fg      = style.text_fg
+local basic_states = style.icon_states.basic_states
+local mode_states  = style.icon_states.mode_states
+local red_ind_s    = style.icon_states.red_ind_s
+local yel_ind_s    = style.icon_states.yel_ind_s
+
+local emc_ind_s = {
+    { color = cpair(colors.black, colors.gray), symbol = "-" },
+    { color = cpair(colors.black, colors.white), symbol = "\x07" },
+    { color = cpair(colors.black, colors.green), symbol = "+" }
+}
+
+-- new unit page view
+---@param root graphics_element parent
+local function new_view(root)
+    local db = iocontrol.get_db()
+
+    local frame = Div{parent=root,x=1,y=1}
+
+    local app = db.nav.register_app(APP_ID.UNITS, frame, nil, false, true)
+
+    local load_div = Div{parent=frame,x=1,y=1}
+    local main = Div{parent=frame,x=1,y=1}
+
+    TextBox{parent=load_div,y=12,text="Loading...",height=1,alignment=ALIGN.CENTER}
+    WaitingAnim{parent=load_div,x=math.floor(main.get_width()/2)-1,y=8,fg_bg=cpair(colors.yellow,colors._INHERIT)}
+
+    local load_pane = MultiPane{parent=main,x=1,y=1,panes={load_div,main}}
+
+    app.set_sidebar({ { label = " # ", tall = true, color = core.cpair(colors.black, colors.green), callback = function () db.nav.open_app(APP_ID.ROOT) end } })
+
+    local btn_fg_bg = cpair(colors.yellow, colors.black)
+    local btn_active = cpair(colors.white, colors.black)
+
+    local nav_links = {}
+    local page_div = nil ---@type nil|graphics_element
+
+    -- set sidebar to display unit-specific fields based on a specified unit
+    local function set_sidebar(id)
+        local unit = db.units[id] ---@type pioctl_unit
+
+        local list = {
+            { label = " # ", tall = true, color = core.cpair(colors.black, colors.green), callback = function () db.nav.open_app(APP_ID.ROOT) end },
+            { label = "U-" .. id, color = core.cpair(colors.black, colors.yellow), callback = function () app.switcher(id) end },
+            { label = " \x13 ", color = core.cpair(colors.black, colors.red), callback = nav_links[id].alarm },
+            { label = "RPS", tall = true, color = core.cpair(colors.black, colors.cyan), callback = nav_links[id].rps },
+            { label = " R ", color = core.cpair(colors.black, colors.lightGray), callback = nav_links[id].reactor  },
+            { label = "RCS", tall = true, color = core.cpair(colors.black, colors.blue), callback = nav_links[id].rcs },
+        }
+
+        for i = 1, unit.num_boilers do
+            table.insert(list, { label = "B-" .. i, color = core.cpair(colors.black, colors.lightGray), callback = nav_links[id].boiler[i] })
+        end
+
+        for i = 1, unit.num_turbines do
+            table.insert(list, { label = "T-" .. i, color = core.cpair(colors.black, colors.lightGray), callback = nav_links[id].turbine[i] })
+        end
+
+        app.set_sidebar(list)
+    end
+
+    -- load the app (create the elements)
+    local function load()
+        page_div = Div{parent=main,y=2,width=main.get_width()}
+
+        local panes = {}
+
+        local active_unit = 1
+
+        -- create all page divs
+        for _ = 1, db.facility.num_units do
+            local div = Div{parent=page_div}
+            table.insert(panes, div)
+            table.insert(nav_links, {})
+        end
+
+        -- previous unit
+        local function prev(x)
+            active_unit = util.trinary(x == 1, db.facility.num_units, x - 1)
+            app.switcher(active_unit)
+            set_sidebar(active_unit)
+        end
+
+        -- next unit
+        local function next(x)
+            active_unit = util.trinary(x == db.facility.num_units, 1, x + 1)
+            app.switcher(active_unit)
+            set_sidebar(active_unit)
+        end
+
+        for i = 1, db.facility.num_units do
+            local u_pane = panes[i]
+            local u_div = Div{parent=u_pane,x=2,width=main.get_width()-2}
+            local unit = db.units[i] ---@type pioctl_unit
+            local u_ps = unit.unit_ps
+
+            -- refresh data callback, every 500ms it will re-send the query
+            local last_update = 0
+            local function update()
+                if util.time_ms() - last_update >= 500 then
+                    db.api.get_unit(i)
+                    last_update = util.time_ms()
+                end
+            end
+
+            --#region Main Unit Overview
+
+            local u_page = app.new_page(nil, i)
+            u_page.tasks = { update }
+
+            TextBox{parent=u_div,y=1,text="Reactor Unit #"..i,height=1,alignment=ALIGN.CENTER}
+            PushButton{parent=u_div,x=1,y=1,text="<",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=function()prev(i)end}
+            PushButton{parent=u_div,x=21,y=1,text=">",fg_bg=btn_fg_bg,active_fg_bg=btn_active,callback=function()next(i)end}
+
+            local type = util.trinary(unit.num_boilers > 0, "Sodium Cooled Reactor", "Boiling Water Reactor")
+            TextBox{parent=u_div,y=3,text=type,height=1,alignment=ALIGN.CENTER,fg_bg=cpair(colors.gray,colors.black)}
+
+            local rate = DataIndicator{parent=u_div,y=5,lu_colors=lu_col,label="Burn",unit="mB/t",format="%10.2f",value=0,commas=true,width=26,fg_bg=text_fg}
+            local temp = DataIndicator{parent=u_div,lu_colors=lu_col,label="Temp",unit=db.temp_label,format="%10.2f",value=0,commas=true,width=26,fg_bg=text_fg}
+
+            local ctrl = IconIndicator{parent=u_div,x=1,y=8,label="Control State",states=mode_states}
+
+            rate.register(u_ps, "act_burn_rate", rate.update)
+            temp.register(u_ps, "temp", function (t) temp.update(db.temp_convert(t)) end)
+            ctrl.register(u_ps, "U_ControlStatus", ctrl.update)
+
+            u_div.line_break()
+
+            local rct = IconIndicator{parent=u_div,x=1,label="Fission Reactor",states=basic_states}
+            local rps = IconIndicator{parent=u_div,x=1,label="Protection System",states=basic_states}
+
+            rct.register(u_ps, "U_ReactorStatus", rct.update)
+            rps.register(u_ps, "U_RPS", rps.update)
+
+            u_div.line_break()
+
+            local rcs = IconIndicator{parent=u_div,x=1,label="Coolant System",states=basic_states}
+            rcs.register(u_ps, "U_RCS", rcs.update)
+
+            for b = 1, unit.num_boilers do
+                local blr = IconIndicator{parent=u_div,x=1,label="Boiler "..b,states=basic_states}
+                blr.register(unit.boiler_ps_tbl[b], "BoilerStatus", blr.update)
+            end
+
+            for t = 1, unit.num_turbines do
+                local tbn = IconIndicator{parent=u_div,x=1,label="Turbine "..t,states=basic_states}
+                tbn.register(unit.turbine_ps_tbl[t], "TurbineStatus", tbn.update)
+            end
+
+            --#endregion
+
+            util.nop()
+
+            --#region Alarms Tab
+
+            local alm_div = Div{parent=page_div}
+            table.insert(panes, alm_div)
+
+            local alm_page = app.new_page(u_page, #panes)
+            alm_page.tasks = { update }
+            nav_links[i].alarm = alm_page.nav_to
+
+            TextBox{parent=alm_div,y=1,text="Status Info Display",height=1,alignment=ALIGN.CENTER}
+
+            local ecam_disp = ListBox{parent=alm_div,x=2,y=3,scroll_height=100,nav_fg_bg=cpair(colors.lightGray,colors.gray),nav_active=cpair(colors.white,colors.gray)}
+
+            ecam_disp.register(u_ps, "U_ECAM", function (data)
+                local ecam = textutils.unserialize(data)
+
+                ecam_disp.remove_all()
+                for _, entry in ipairs(ecam) do
+                    local div = Div{parent=ecam_disp,height=1+#entry.items,fg_bg=cpair(entry.color,colors.black)}
+                    local text = TextBox{parent=div,height=1,text=entry.text}
+
+                    if entry.help then
+                        PushButton{parent=div,x=21,y=text.get_y(),text="?",callback=function()db.nav.open_help(entry.help)end,fg_bg=cpair(colors.gray,colors.black)}
+                    end
+
+                    for _, item in ipairs(entry.items) do
+                        local fg_bg = nil
+                        if item.color then fg_bg = cpair(item.color, colors.black) end
+
+                        text = TextBox{parent=div,x=3,height=1,text=item.text,fg_bg=fg_bg}
+
+                        if item.help then
+                            PushButton{parent=div,x=21,y=text.get_y(),text="?",callback=function()db.nav.open_help(item.help)end,fg_bg=cpair(colors.gray,colors.black)}
+                        end
+                    end
+
+                    ecam_disp.line_break()
+                end
+            end)
+
+            --#endregion
+
+            --#region RPS Tab
+
+            local rps_pane = Div{parent=page_div}
+            local rps_div = Div{parent=rps_pane,x=2,width=main.get_width()-2}
+            table.insert(panes, rps_div)
+
+            local rps_page = app.new_page(u_page, #panes)
+            rps_page.tasks = { update }
+            nav_links[i].rps = rps_page.nav_to
+
+            TextBox{parent=rps_div,y=1,text="Protection System",height=1,alignment=ALIGN.CENTER}
+
+            local r_trip = IconIndicator{parent=rps_div,y=3,label="RPS Trip",states=basic_states}
+            r_trip.register(u_ps, "U_RPS", r_trip.update)
+
+            local r_mscrm = IconIndicator{parent=rps_div,y=5,label="Manual SCRAM",states=red_ind_s}
+            local r_ascrm = IconIndicator{parent=rps_div,label="Automatic SCRAM",states=red_ind_s}
+            local rps_tmo = IconIndicator{parent=rps_div,label="Timeout",states=yel_ind_s}
+            local rps_flt = IconIndicator{parent=rps_div,label="PPM Fault",states=yel_ind_s}
+            local rps_sfl = IconIndicator{parent=rps_div,label="Not Formed",states=red_ind_s}
+
+            r_mscrm.register(u_ps, "manual", r_mscrm.update)
+            r_ascrm.register(u_ps, "automatic", r_ascrm.update)
+            rps_tmo.register(u_ps, "timeout", rps_tmo.update)
+            rps_flt.register(u_ps, "fault", rps_flt.update)
+            rps_sfl.register(u_ps, "sys_fail", rps_sfl.update)
+
+            rps_div.line_break()
+            local rps_dmg = IconIndicator{parent=rps_div,label="Reactor Damage Hi",states=red_ind_s}
+            local rps_tmp = IconIndicator{parent=rps_div,label="Temp. Critical",states=red_ind_s}
+            local rps_nof = IconIndicator{parent=rps_div,label="Fuel Level Lo",states=yel_ind_s}
+            local rps_exw = IconIndicator{parent=rps_div,label="Waste Level Hi",states=yel_ind_s}
+            local rps_loc = IconIndicator{parent=rps_div,label="Coolant Lo Lo",states=yel_ind_s}
+            local rps_exh = IconIndicator{parent=rps_div,label="Heated Coolant Hi",states=yel_ind_s}
+
+            rps_dmg.register(u_ps, "high_dmg", rps_dmg.update)
+            rps_tmp.register(u_ps, "high_temp", rps_tmp.update)
+            rps_nof.register(u_ps, "no_fuel", rps_nof.update)
+            rps_exw.register(u_ps, "ex_waste", rps_exw.update)
+            rps_loc.register(u_ps, "low_cool", rps_loc.update)
+            rps_exh.register(u_ps, "ex_hcool", rps_exh.update)
+
+            --#endregion
+
+            --#region Reactor Tab
+
+            nav_links[i].reactor = reactor(app, u_page, panes, page_div, u_ps, update)
+
+            --#endregion
+
+            --#region RCS Tab
+
+            local rcs_pane = Div{parent=page_div}
+            local rcs_div = Div{parent=rcs_pane,x=2,width=main.get_width()-2}
+            table.insert(panes, rcs_pane)
+
+            local rcs_page = app.new_page(u_page, #panes)
+            rcs_page.tasks = { update }
+
+            nav_links[i].rcs = rcs_page.nav_to
+
+            TextBox{parent=rcs_div,y=1,text="Coolant System",height=1,alignment=ALIGN.CENTER}
+
+            local r_rtrip = IconIndicator{parent=rcs_div,y=3,label="RCP Trip",states=red_ind_s}
+            local r_cflow = IconIndicator{parent=rcs_div,label="RCS Flow Lo",states=yel_ind_s}
+            local r_clow  = IconIndicator{parent=rcs_div,label="Coolant Level Lo",states=yel_ind_s}
+
+            r_rtrip.register(u_ps, "RCPTrip", r_rtrip.update)
+            r_cflow.register(u_ps, "RCSFlowLow", r_cflow.update)
+            r_clow.register(u_ps, "CoolantLevelLow", r_clow.update)
+
+            local c_flt  = IconIndicator{parent=rcs_div,label="RCS HW Fault",states=yel_ind_s}
+            local c_emg  = IconIndicator{parent=rcs_div,label="Emergency Coolant",states=emc_ind_s}
+            local c_mwrf = IconIndicator{parent=rcs_div,label="Max Water Return",states=yel_ind_s}
+
+            c_flt.register(u_ps, "RCSFault", c_flt.update)
+            c_emg.register(u_ps, "EmergencyCoolant", c_emg.update)
+            c_mwrf.register(u_ps, "MaxWaterReturnFeed", c_mwrf.update)
+
+            -- rcs_div.line_break()
+            -- TextBox{parent=rcs_div,text="Mismatches",height=1,alignment=ALIGN.CENTER,fg_bg=label}
+            local c_cfm = IconIndicator{parent=rcs_div,label="Coolant Feed",states=yel_ind_s}
+            local c_brm = IconIndicator{parent=rcs_div,label="Boil Rate",states=yel_ind_s}
+            local c_sfm = IconIndicator{parent=rcs_div,label="Steam Feed",states=yel_ind_s}
+
+            c_cfm.register(u_ps, "CoolantFeedMismatch", c_cfm.update)
+            c_brm.register(u_ps, "BoilRateMismatch", c_brm.update)
+            c_sfm.register(u_ps, "SteamFeedMismatch", c_sfm.update)
+
+            rcs_div.line_break()
+            -- TextBox{parent=rcs_div,text="Aggregate Checks",height=1,alignment=ALIGN.CENTER,fg_bg=label}
+
+            if unit.num_boilers > 0 then
+                local wll = IconIndicator{parent=rcs_div,label="Boiler Water Lo",states=red_ind_s}
+                local hrl = IconIndicator{parent=rcs_div,label="Heating Rate Lo",states=yel_ind_s}
+
+                wll.register(u_ps, "U_WaterLevelLow", wll.update)
+                hrl.register(u_ps, "U_HeatingRateLow", hrl.update)
+            end
+
+            local tospd = IconIndicator{parent=rcs_div,label="TRB Over Speed",states=red_ind_s}
+            local gtrip = IconIndicator{parent=rcs_div,label="Generator Trip",states=yel_ind_s}
+            local ttrip = IconIndicator{parent=rcs_div,label="Turbine Trip",states=red_ind_s}
+
+            tospd.register(u_ps, "U_TurbineOverSpeed", tospd.update)
+            gtrip.register(u_ps, "U_GeneratorTrip", gtrip.update)
+            ttrip.register(u_ps, "U_TurbineTrip", ttrip.update)
+
+            --#endregion
+
+            --#region Boiler Tabs
+
+            local blr_pane = Div{parent=page_div}
+            nav_links[i].boiler = {}
+
+            for b_id = 1, unit.num_boilers do
+                local ps = unit.boiler_ps_tbl[b_id]
+                nav_links[i].boiler[b_id] = boiler(app, u_page, panes, blr_pane, b_id, ps, update)
+            end
+
+            --#endregion
+
+            --#region Turbine Tabs
+
+            local tbn_pane = Div{parent=page_div}
+            nav_links[i].turbine = {}
+
+            for t_id = 1, unit.num_turbines do
+                local ps = unit.turbine_ps_tbl[t_id]
+                nav_links[i].turbine[t_id] = turbine(app, u_page, panes, tbn_pane, i, t_id, ps, update)
+            end
+
+            --#endregion
+
+            util.nop()
+        end
+
+        -- setup multipane
+        local u_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
+        app.set_root_pane(u_pane)
+
+        set_sidebar(active_unit)
+
+        -- done, show the app
+        load_pane.set_value(2)
+    end
+
+    -- delete the elements and switch back to the loading screen
+    local function unload()
+        if page_div then
+            page_div.delete()
+            page_div = nil
+        end
+
+        app.set_sidebar({ { label = " # ", tall = true, color = core.cpair(colors.black, colors.green), callback = function () db.nav.open_app(APP_ID.ROOT) end } })
+        app.delete_pages()
+
+        -- show loading screen
+        load_pane.set_value(1)
+    end
+
+    app.set_load(load)
+    app.set_unload(unload)
+
+    return main
+end
+
+return new_view

pocket/ui/components/conn_waiting.lua

@@ -11,7 +11,7 @@ local TextBox     = require("graphics.elements.textbox")
 
 local WaitingAnim = require("graphics.elements.animations.waiting")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local ALIGN = core.ALIGN
 
 local cpair = core.cpair
 
@@ -29,10 +29,10 @@ local function init(parent, y, is_api)
 
     if is_api then
         WaitingAnim{parent=box,x=waiting_x,y=1,fg_bg=cpair(colors.blue,style.root.bkg)}
-        TextBox{parent=box,text="Connecting to API",alignment=TEXT_ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
+        TextBox{parent=box,text="Connecting to API",alignment=ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
     else
         WaitingAnim{parent=box,x=waiting_x,y=1,fg_bg=cpair(colors.green,style.root.bkg)}
-        TextBox{parent=box,text="Connecting to Supervisor",alignment=TEXT_ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
+        TextBox{parent=box,text="Connecting to Supervisor",alignment=ALIGN.CENTER,y=5,height=1,fg_bg=cpair(colors.white,style.root.bkg)}
     end
 
     return root

pocket/ui/docs.lua

@@ -0,0 +1,113 @@
+local docs = {}
+
+local target
+
+local function doc(key, name, desc)
+    ---@class pocket_doc_item
+    local item = { key = key, name = name, desc = desc }
+    table.insert(target, item)
+end
+
+-- important to note in the future: The PLC should always be in a chunk with the reactor to ensure it can protect it on chunk load if you do not keep it all chunk loaded
+
+docs.alarms = {}
+
+target = docs.alarms
+doc("ContainmentBreach", "Containment Breach", "Reactor disconnected or indicated unformed while being at or above 100% damage; explosion assumed.")
+doc("ContainmentRadiation", "Containment Radiation", "Environment detector(s) assigned to the unit have observed high levels of radiation.")
+doc("ReactorLost", "Reactor Lost", "Reactor PLC has stopped communicating with the supervisor.")
+doc("CriticalDamage", "Damage Critical", "Reactor damage has reached or exceeded 100%, so it will explode at any moment.")
+doc("ReactorDamage", "Reactor Damage", "Reactor temperature causing increasing damage to the reactor casing.")
+doc("ReactorOverTemp", "Reactor Over Temp", "Reactor temperature is at or above maximum safe temperature, so it is now taking damage.")
+doc("ReactorHighTemp", "Reactor High Temp", "Reactor temperature is above expected operating levels and may exceed maximum safe temperature soon.")
+doc("ReactorWasteLeak", "Reactor Waste Leak", "The reactor is full of spent waste so it will now emit radiation if additional waste is generated.")
+doc("ReactorHighWaste", "Reactor High Waste", "Reactor waste levels are high and may leak soon.")
+doc("RPSTransient", "RPS Transient", "Reactor protection system was activated.")
+doc("RCSTransient", "RCS Transient", "Something is wrong with the reactor coolant system, check RCS indicators for details.")
+doc("TurbineTripAlarm", "Turbine Trip", "A turbine stopped rotating, likely due to having full energy storage. This will prevent cooling, so it needs to be resolved before using that unit.")
+
+docs.annunc = {
+    unit = {
+        main_section = {}, rps_section = {}, rcs_section = {}
+    }
+}
+
+target = docs.annunc.unit.main_section
+doc("PLCOnline", "PLC Online", "Indicates if the fission reactor PLC is connected. If it isn't, check that your PLC is on and configured properly.")
+doc("PLCHeartbeat", "PLC Heartbeat", "An indicator of status data being live. As status messages are received from the PLC, this light will turn on and off. If it gets stuck, the supervisor has stopped receiving data or a screen has frozen.")
+doc("RadiationMonitor", "Radiation Monitor", "On if at least one environment detector is connected and assigned to this unit.")
+doc("AutoControl", "Automatic Control", "On if the reactor is under the control of one of the automatic control modes.")
+doc("ReactorSCRAM", "Reactor SCRAM", "On if the reactor protection system is holding the reactor SCRAM'd.")
+doc("ManualReactorSCRAM", "Manual Reactor SCRAM", "On if the operator (you) initiated a SCRAM.")
+doc("AutoReactorSCRAM", "Auto Reactor SCRAM", "On if the automatic control system initiated a SCRAM. The main view screen annunciator will have an indication as to why.")
+doc("RadiationWarning", "Radiation Warning", "On if radiation levels are above normal. There is likely a leak somewhere, so that should be identified and fixed. Hazmat suit recommended.")
+doc("RCPTrip", "RCP Trip", "Reactor coolant pump tripped. This is a technical concept not directly mapping to Mekansim. Here, it indicates if there is either high heated coolant or low cooled coolant that caused an RPS trip. Check the coolant system if this occurs.")
+doc("RCSFlowLow", "RCS Flow Low", "Indicates if the reactor coolant system flow is low. This is observed when the cooled coolant level in the reactor is dropping. This can occur while a turbine spins up, but if it persists, check that the cooling system is operating properly. This can occur with smaller boilers or when using pipes and not having enough.")
+doc("CoolantLevelLow", "Coolant Level Low", "On if the reactor coolant level is lower than it should be. Check the coolant system.")
+doc("ReactorTempHigh", "Reactor Temp. High", "On if the reactor temperature is above expected maximum operating temperature. This is not yet damaging, but should be attended to. Check coolant system.")
+doc("ReactorHighDeltaT", "Reactor High Delta T", "On if the reactor temperature is climbing rapidly. This can occur when a reactor is starting up, but it is a concern if it happens while the burn rate is not increasing.")
+doc("FuelInputRateLow", "Fuel Input Rate Low", "On if the fissile fuel levels in the reactor are dropping or very low. Ensure a steady supply of fuel is entering the reactor.")
+doc("WasteLineOcclusion", "Waste Line Occlusion", "Waste levels in the reactor are increasing. Ensure your waste processing system is operating at a sufficient rate for your burn rate.")
+doc("HighStartupRate", "Startup Rate High", "This is a rough calculation of if your burn rate is high enough to cause a loss of coolant on startup. A burn rate above this is likely to cause that, but it could occur at even higher or even lower rates depending on your setup (such as pipes, water supplies, and boiler tanks).")
+
+target = docs.annunc.unit.rps_section
+doc("rps_tripped", "RPS Trip", "Indicates if the reactor protection system has caused a SCRAM.")
+doc("manual", "Manual Reactor SCRAM", "Indicates if the operator (you) tripped the RPS by pressing SCRAM.")
+doc("automatic", "Auto Reactor SCRAM", "Indicates if the automatic control system tripped the RPS.")
+doc("high_dmg", "Damage Level High", "Indicates if the RPS tripped due to significant reactor damage. Await damage levels to lower.")
+doc("ex_waste", "Excess Waste", "Indicates if the RPS tripped due to very high waste levels. Ensure waste processing system is keeping up.")
+doc("ex_hcool", "Excess Heated Coolant", "Indicates if the RPS tripped due to very high heated coolant levels. Check that the cooling system is able to keep up with heated coolant flow.")
+doc("high_temp", "Temperature High", "Indicates if the RPS tripped due to reaching damaging temperatures. Await damage levels to lower.")
+doc("low_cool", "Coolant Level Low Low", "Indicates if the RPS tripped due to very low coolant levels that result in the temperature uncontrollably rising. Ensure that the cooling system can provide sufficient cooled coolant flow.")
+doc("no_fuel", "No Fuel", "Indicates if the RPS tripped due to no fuel being available. Check fuel input.")
+doc("fault", "PPM Fault", "Indicates if the RPS tripped due to a peripheral access fault. Something went wrong interfacing with the reactor, try restarting the PLC.")
+doc("timeout", "Connection Timeout", "Indicates if the RPS tripped due to losing connection with the supervisory computer. Check that your PLC and supervisor remain chunk loaded.")
+doc("sys_fail", "System Failure", "Indicates if the RPS tripped due to the reactor not being formed. Ensure that the multi-block is formed.")
+
+target = docs.annunc.unit.rcs_section
+doc("RCSFault", "RCS Hardware Fault", "Indicates if one or more of the RCS devices have a peripheral fault. Check that your machines are formed. If this persists, try rebooting affected RTUs.")
+doc("EmergencyCoolant", "Emergency Coolant", "Off if no emergency coolant redstone is configured, white when it is configured but not in use, and green/blue when it is activated. This is based on an RTU having a redstone emergency coolant output configured for this unit.")
+doc("CoolantFeedMismatch", "Coolant Feed Mismatch", "The coolant system is accumulating heated coolant or losing cooled coolant, likely due to one of the machines not keeping up with the needs of the reactor. The flow monitor can help figure out where the problem is.")
+doc("BoilRateMismatch", "Boil Rate Mismatch", "The total heating rate of the reactor exceed the tolerance from the steam input rate of the turbines OR for sodium setups, the boiler boil rates exceed the tolerance from the steam input rate of the turbines. The flow monitor can help figure out where the problem is.")
+doc("SteamFeedMismatch", "Steam Feed Mismatch", "There is an above tolerance difference between turbine flow and steam input rates or the reactor/boilers are gaining steam or losing water. The flow monitor can help figure out where the problem is.")
+doc("MaxWaterReturnFeed", "Max Water Return Feed", "The turbines are condensing the max rate of water that they can per the structure build. If water return is insufficient, add more saturating condensers to your turbine(s).")
+doc("WaterLevelLow", "Water Level Low", "The water level in the boiler is low. A larger boiler water tank may help, or you can feed additional water into the boiler from elsewhere.")
+doc("HeatingRateLow", "Heating Rate Low", "The boiler is not hot enough to boil water, but it is receiving heated coolant. This is almost never a safety concern.")
+doc("SteamDumpOpen", "Steam Relief Valve Open", "This turns yellow if the turbine is set to dumping excess and red if it is set to dumping [all]. 'Relief Valve' in this case is that setting allowing the venting of steam. You should never have this set to dumping [all]. Emergency coolant activation from the supervisor will automatically set it to dumping excess to ensure there is no backup of steam as water is added.")
+doc("TurbineOverSpeed", "Turbine Over Speed", "The turbine is at steam capacity, but not tripped. You may need more turbines if they can't keep up.")
+doc("GeneratorTrip", "Generator Trip", "The turbine is no longer outputting power due to it having nowhere to go. Likely due to full power storage. This will lead to a Turbine Trip if not addressed.")
+doc("TurbineTrip", "Turbine Trip", "The turbine has reached its maximum power charge and has stopped rotating, and as a result stopped cooling steam to water. Ensure the turbine has somewhere to output power, as this is the most common cause of reactor meltdowns. However, the likelihood of a meltdown with this system in place is much lower, especially with emergency coolant helping during turbine trips.")
+
+docs.glossary = {
+    abbvs = {}, terms = {}
+}
+
+target = docs.glossary.abbvs
+doc("G_ACK", "ACK", "Alarm ACKnowledge. Pressing this acknowledges that you understand an alarm occurred and would like to stop the audio tone(s).")
+doc("G_CRD", "CRD", "Coordinator. Abbreviation for the coordinator computer.")
+doc("G_DBG", "DBG", "Debug. Abbreviation for the debugging sessions from pocket computers found on the supervisor's front panel.")
+doc("G_FP", "FP", "Front Panel. See Terminology.")
+doc("G_PKT", "PKT", "Pocket. Abbreviation for the pocket computer.")
+doc("G_PLC", "PLC", "Programmable Logic Controller. A device that not only reports data and controls outputs, but can also make decisions on its own.")
+doc("G_PPM", "PPM", "Protected Peripheral Manager. This is an abstraction layer created for this project that prevents peripheral calls from crashing applications.")
+doc("G_RCP", "RCP", "Reactor Coolant Pump. This is from real-world terminology with water-cooled (boiling water and pressurized water) reactors, but in this system it just reflects to the functioning of reactor coolant flow. See the annunciator page on it for more information.")
+doc("G_RCS", "RCS", "Reactor Cooling System. The combination of all machines used to cool the reactor (turbines, boilers, dynamic tanks).")
+doc("G_RPS", "RPS", "Reactor Protection System. A component of the reactor PLC responsible for keeping the reactor safe.")
+doc("G_RTU", "RTU", "Remote Terminal Unit. Provides monitoring to and basic output from a SCADA system, interfacing with various types of devices/interfaces.")
+doc("G_SCADA", "SCADA", "Supervisory Control and Data Acquisition. A control systems architecture used in a wide variety process control applications.")
+doc("G_SVR", "SVR", "Supervisor. Abbreviation for the supervisory computer.")
+doc("G_UI", "UI", "User Interface.")
+
+target = docs.glossary.terms
+doc("G_Fault", "Fault", "Something has gone wrong and/or failed to function.")
+doc("G_FrontPanel", "Front Panel", "A basic interface on the front of a device for viewing and sometimes modifying its state. This is what you see when looking at a computer running one of the SCADA applications.")
+doc("G_Nominal", "Nominal", "Normal operation. Everything operating as intended.")
+doc("G_Ringback", "Ringback", "An indication that an alarm had gone off but is no longer having its trip condition(s) met. This is to make you are aware that it occurred.")
+doc("G_SCRAM", "SCRAM", "[Emergency] shut-down of a reactor by stopping the fission. In Mekanism and here, it isn't always for an emergency.")
+doc("G_Transient", "Transient", "A temporary change in state from normal operation. Coolant levels dropping or core temperature rising above nominal values are examples of transients.")
+doc("G_Trip", "Trip", "A checked condition had occurred, see 'Tripped'.")
+doc("G_Tripped", "Tripped", "An alarm condition has been met, and is still met.")
+doc("G_Tripping", "Tripping", "Alarm condition(s) is/are met, but has/have not reached the minimum time before the condition(s) is/are deemed a problem.")
+doc("G_TurbineTrip", "Turbine Trip", "The turbine stopped, which prevents heated coolant from being cooled. In Mekanism, this would occur when a turbine cannot generate any more energy due to filling its buffer and having no output with any remaining energy capacity.")
+
+return docs

pocket/ui/main.lua

@@ -2,17 +2,22 @@
 -- Pocket GUI Root
 --
 
-local coreio        = require("pocket.coreio")
+local util         = require("scada-common.util")
 
-local style        = require("pocket.ui.style")
+local iocontrol    = require("pocket.iocontrol")
+local pocket       = require("pocket.pocket")
+
+local diag_apps    = require("pocket.ui.apps.diag_apps")
+local dummy_app    = require("pocket.ui.apps.dummy_app")
+local guide_app    = require("pocket.ui.apps.guide")
+local sys_apps     = require("pocket.ui.apps.sys_apps")
+local unit_app     = require("pocket.ui.apps.unit")
 
 local conn_waiting = require("pocket.ui.components.conn_waiting")
 
 local home_page    = require("pocket.ui.pages.home_page")
-local unit_page    = require("pocket.ui.pages.unit_page")
-local reactor_page = require("pocket.ui.pages.reactor_page")
-local boiler_page  = require("pocket.ui.pages.boiler_page")
-local turbine_page = require("pocket.ui.pages.turbine_page")
+
+local style        = require("pocket.ui.style")
 
 local core         = require("graphics.core")
 
@@ -20,80 +25,75 @@ local Div          = require("graphics.elements.div")
 local MultiPane    = require("graphics.elements.multipane")
 local TextBox      = require("graphics.elements.textbox")
 
+local PushButton   = require("graphics.elements.controls.push_button")
 local Sidebar      = require("graphics.elements.controls.sidebar")
 
-local TEXT_ALIGN = core.TEXT_ALIGN
+local SignalBar    = require("graphics.elements.indicators.signal")
 
+local ALIGN = core.ALIGN
 local cpair = core.cpair
 
+local LINK_STATE = iocontrol.LINK_STATE
+
+local APP_ID = pocket.APP_ID
+
 -- create new main view
 ---@param main graphics_element main displaybox
 local function init(main)
-    -- window header message
-    TextBox{parent=main,y=1,text="",alignment=TEXT_ALIGN.LEFT,height=1,fg_bg=style.header}
+    local db = iocontrol.get_db()
 
-    --
-    -- root panel panes (connection screens + main screen)
-    --
+    -- window header message
+    TextBox{parent=main,y=1,text="EARLY ACCESS ALPHA S   C  ",alignment=ALIGN.LEFT,height=1,fg_bg=style.header}
+    local svr_conn = SignalBar{parent=main,y=1,x=22,compact=true,colors_low_med=cpair(colors.red,colors.yellow),disconnect_color=colors.lightGray,fg_bg=cpair(colors.green,colors.gray)}
+    local crd_conn = SignalBar{parent=main,y=1,x=26,compact=true,colors_low_med=cpair(colors.red,colors.yellow),disconnect_color=colors.lightGray,fg_bg=cpair(colors.green,colors.gray)}
+
+    db.ps.subscribe("svr_conn_quality", svr_conn.set_value)
+    db.ps.subscribe("crd_conn_quality", crd_conn.set_value)
+
+    --#region root panel panes (connection screens + main screen)
 
     local root_pane_div = Div{parent=main,x=1,y=2}
 
     local conn_sv_wait = conn_waiting(root_pane_div, 6, false)
     local conn_api_wait = conn_waiting(root_pane_div, 6, true)
     local main_pane = Div{parent=main,x=1,y=2}
-    local root_panes = { conn_sv_wait, conn_api_wait, main_pane }
 
-    local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes=root_panes}
+    local root_pane = MultiPane{parent=root_pane_div,x=1,y=1,panes={conn_sv_wait,conn_api_wait,main_pane}}
 
-    root_pane.register(coreio.core_ps(), "link_state", function (state)
-        if state == coreio.LINK_STATE.UNLINKED or state == coreio.LINK_STATE.API_LINK_ONLY then
+    root_pane.register(db.ps, "link_state", function (state)
+        if state == LINK_STATE.UNLINKED or state == LINK_STATE.API_LINK_ONLY then
             root_pane.set_value(1)
-        elseif state == coreio.LINK_STATE.SV_LINK_ONLY then
+        elseif state == LINK_STATE.SV_LINK_ONLY then
             root_pane.set_value(2)
         else
             root_pane.set_value(3)
         end
     end)
 
-    --
-    -- main page panel panes & sidebar
-    --
+    --#endregion
+
+    --#region main page panel panes & sidebar
 
     local page_div = Div{parent=main_pane,x=4,y=1}
 
-    local sidebar_tabs = {
-        {
-            char = "#",
-            color = cpair(colors.black,colors.green)
-        },
-        {
-            char = "U",
-            color = cpair(colors.black,colors.yellow)
-        },
-        {
-            char = "R",
-            color = cpair(colors.black,colors.cyan)
-        },
-        {
-            char = "B",
-            color = cpair(colors.black,colors.lightGray)
-        },
-        {
-            char = "T",
-            color = cpair(colors.black,colors.white)
-        }
-    }
+    home_page(page_div)
 
-    local pane_1 = home_page(page_div)
-    local pane_2 = unit_page(page_div)
-    local pane_3 = reactor_page(page_div)
-    local pane_4 = boiler_page(page_div)
-    local pane_5 = turbine_page(page_div)
-    local panes = { pane_1, pane_2, pane_3, pane_4, pane_5 }
+    unit_app(page_div)
+    guide_app(page_div)
+    sys_apps(page_div)
+    diag_apps(page_div)
+    dummy_app(page_div)
 
-    local page_pane = MultiPane{parent=page_div,x=1,y=1,panes=panes}
+    assert(util.table_len(db.nav.get_containers()) == APP_ID.NUM_APPS, "app IDs were not sequential or some apps weren't registered")
 
-    Sidebar{parent=main_pane,x=1,y=1,tabs=sidebar_tabs,fg_bg=cpair(colors.white,colors.gray),callback=page_pane.set_value}
+    db.nav.set_pane(MultiPane{parent=page_div,x=1,y=1,panes=db.nav.get_containers()})
+    db.nav.set_sidebar(Sidebar{parent=main_pane,x=1,y=1,height=18,fg_bg=cpair(colors.white,colors.gray)})
+
+    PushButton{parent=main_pane,x=1,y=19,text="\x1b",min_width=3,fg_bg=cpair(colors.white,colors.gray),active_fg_bg=cpair(colors.gray,colors.black),callback=db.nav.nav_up}
+
+    db.nav.open_app(APP_ID.ROOT)
+
+    --#endregion
 end
 
 return init

pocket/ui/pages/boiler_page.lua

@@ -1,22 +0,0 @@
--- local style   = require("pocket.ui.style")
-
-local core    = require("graphics.core")
-
-local Div     = require("graphics.elements.div")
-local TextBox = require("graphics.elements.textbox")
-
--- local cpair = core.cpair
-
-local TEXT_ALIGN = core.TEXT_ALIGN
-
--- new boiler page view
----@param root graphics_element parent
-local function new_view(root)
-    local main = Div{parent=root,x=1,y=1}
-
-    TextBox{parent=main,text="BOILERS",x=1,y=1,height=1,alignment=TEXT_ALIGN.CENTER}
-
-    return main
-end
-
-return new_view